qalter -ac tag1=test 18458303
qalter -ac tag2=test 18458303
qalter -ac -ac tag1=test tag2=test 18458303
| from scipy.sparse import csr_matrix | |
| from rdkit import Chem | |
| from rdkit.Chem.rdFingerprintGenerator import GetRDKitFPGenerator | |
| smiles = 'CC1=C(C=C(C=C1)NC(=O)C2=CC=C(C=C2)CN3CCN(CC3)C)NC4=NC=CC(=N4)C5=CN=CC=C5' | |
| molobj = Chem.MolFromSmiles(smiles) | |
| for max_path in [2,3,4,5,6,7]: | |
| rdk_gen = GetRDKitFPGenerator(maxPath=max_path) | |
| fp = rdk_gen.GetSparseCountFingerprint(molobj) |
| from typing import List | |
| import pandas as pd | |
| def explode_multi_column( | |
| df: pd.DataFrame, index_cols: List[str], sep: str | |
| ): | |
| """ | |
| In [13]: |
| # -*- coding: utf-8 -*- | |
| """ | |
| Created on Fri Oct 25 23:16:39 2019 | |
| rdkit.Chem.rdFingerprintGenerator.GetRDKitFPGenerator([(int)minPath=1[, (int)maxPath=7[, (bool)useHs=True[, (bool)branchedPaths=True[, (bool)useBondOrder=True[, (bool)countSimulation=False[, (AtomPairsParameters)countBounds=None[, (int)fpSize=2048[, (int)numBitsPerFeature=2[, (AtomPairsParameters)atomInvariantsGenerator=None]]]]]]]]]]) → FingerprintGenerator64 : | |
| Get an RDKit fingerprint generator | |
| ARGUMENTS: | |
| minPath: the minimum path length (in bonds) to be included |
| from rdkit import Chem | |
| from rdkit.Chem.MolStandardize import rdMolStandardize | |
| # works | |
| smiles_charged = '[CH2-][Fe++][CH2-]' | |
| # does not work | |
| smiles_charged = 'CCCC(=O)c1ccc[c-]1[Fe++][c-]1cccc1C(=O)CCC' | |
| smiles_charged = 'Cc1ccc(C(=O)C=Cc2ccc[c-]2[Fe++][c-]2cccc2)c(O)c1' |
| import numpy as np | |
| import pandas as pd | |
| from bokeh.models import HoverTool | |
| import holoviews as hv | |
| hv.notebook_extension("bokeh") |
| import numpy as np | |
| import pandas as pd | |
| from rdkit import Chem | |
| from rdkit.Chem import Draw | |
| from bokeh.models import HoverTool | |
| import holoviews as hv |
| Ki_identifier = [ | |
| "Adjusted Ki", | |
| "Ki", | |
| "ki", | |
| "Ki app (inact)", | |
| "Ki app", | |
| "Ki(app)", | |
| "Ki_app", | |
| u"Ki’", | |
| u"Ki”", |
| def get_matching_buildingblocks( | |
| db: Session, | |
| smarts: str, | |
| limit: int, | |
| ) -> List[BuildingBlock]: | |
| r = db.query(BBSelect) \ | |
| .filter(func.arthor.matches(column('atdb'), smarts)) \ | |
| .limit(limit) \ | |
| .all() | |
| return [ |
| <?xml version="1.0" encoding="UTF-8"?><cml xmlns="http://www.chemaxon.com" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:schemaLocation="http://www.chemaxon.com/marvin/help/formats/schema/mrvSchema_6_2_0.xsd" version="ChemAxon file format v6.2, generated by v6.3.0"> | |
| <MDocument><MChemicalStruct><reaction><arrow type="DEFAULT" x1="-7.259480881745031" y1="1.3737404197296181" x2="-1.0587105901089497" y2="1.3539927419708107"></arrow><propertyList><property dictRef="NAME" title="NAME"><scalar><![CDATA[Suzuki coupling]]></scalar></property><property dictRef="EXPLAIN_REACTIVITY" title="EXPLAIN_REACTIVITY"><scalar><![CDATA[First reactant is boronic acid, boronic ester, borane, trifluoroborate salt or boronic acid anhydride. Second reactant may be halogenide or organosulfonate or methyl sulfide as these compounds behave as pseudohalogen compounds.]]></scalar></property><property dictRef="EXPLAIN_EXCLUDE" title="EXPLAIN_EXCLUDE"><scalar><![CDATA[Second reactant may not contain such functional groups which co |