Last active
June 27, 2022 18:32
-
-
Save hadim/2f4e405ceb191f256aa858d72cd02755 to your computer and use it in GitHub Desktop.
This file contains bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
{ | |
"cells": [ | |
{ | |
"cell_type": "code", | |
"execution_count": 1, | |
"id": "1ab1ed6a-868d-483c-8d5b-345cb84c72a8", | |
"metadata": {}, | |
"outputs": [], | |
"source": [ | |
"import tempfile\n", | |
"import numpy as np\n", | |
"\n", | |
"# Only a single import is needed (similar to Pandas and Numpy)\n", | |
"import datamol as dm" | |
] | |
}, | |
{ | |
"cell_type": "markdown", | |
"id": "7bd2ff4a-9da1-4ae2-b95a-1ec3ee1868d4", | |
"metadata": {}, | |
"source": [ | |
"## `dm.mol`" | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"execution_count": 2, | |
"id": "e687c648-9345-4cf9-bbe6-598443e53b53", | |
"metadata": {}, | |
"outputs": [ | |
{ | |
"data": { | |
"image/png": "iVBORw0KGgoAAAANSUhEUgAAAcIAAACWCAIAAADCEh9HAAAABmJLR0QA/wD/AP+gvaeTAAAeVklEQVR4nO3deVxU5f4H8M8Aw6oiq4AIgmmCGKYiJLibgoC4MKmVmHRL6xqmVni73R9Sva5otwLLK5gbLVYgaowpydVUEBFRUnDBBZBYVHaJfWbO749DNALKPmfO4ft++Q/PnDnnS+nn9Zznec5zRAzDgBBCSHdpcF0AIYTwG8UoIYT0CMUoIYT0CMUoIYT0CMUo6Rfq6+u5LoEIFsUoEbjExMRVq1ZZWVl5eHhEREQUFxdzXRERGhEteCICtn///pUrVzY2NmpqasrlcgCampoeHh6LFi1atGiRtbU11wUSIaDeKBGsbdu2LV++vLGxMSgo6P79+9HR0RKJRFdX9/Tp02vXrh02bNiYMWM2bdqUnZ3NdaWE36g3SgSIYZjQ0NDQ0FCRSLR58+bg4OCWj2pra0+cOBEbG3v48OHq6mq20dHRUSKR+Pr6TpgwgaOSCY9RjBKhkclkq1ev3r17t5aWVlRUVGBgYLuH1dXV/e9//4uNjY2Pj6+qqmIb7e3tfXx8JBKJu7u7SCRSYdWExyhGiaDU1NS88MILR48eNTAwiI2N9fLy6vArcrn83LlzsbGxP/744/3799lGW1tbPz8/iUQyefJkDQ0a+yJPQjFKhKO8vNzX1zclJcXExEQqlT733HNd+npLnh44cKCoqIhtNDMz8/T0lEgknp6eYrG4D6omvEcxSgQiLy/P09MzOzvbzs4uISFh1KhR3T6VQqHIyMiQSqXffffd7du32UYTE5N58+ZJJJK5c+dqa2v3UtVECChGiRBkZWV5eXkVFBQ4OTklJCQMHTr0cUfu3bt39uzZw4YN6+SZr169yt7v37hxg20ZPHjw888/7+Pjs2jRogEDBvRC9YTnKEYJ7506dWrBggVVVVUzZsw4dOiQoaHh447Mzs4ePXo0/pyaX7p0KftjZ1y9evXIkSNSqfTs2bNsi56e3qxZsyQSyYIFCwYNGtTzX4TwFUMInx06dEhXVxfAwoUL6+rqnnxwVlaWv7+/gYFBy99/Z2fn0NDQrKyszl8xJycnPDxceSpfV1fXx8cnKirqwYMHPfttCC9RjBIe+/LLL9lp9DVr1sjl8k5+q66uLj4+fvny5cr9Vjs7u6CgoKSkJIVC0cnz5OXlffrpp+7u7i1T+f7+/iUlJd39bQhfUYwSvgoLCwMgEolCQkK6dwaZTJaUlBQUFGRhYdGSpzY2Nmyedj6Xi4qKtm/fPnbsWLFYHBAQ0L1iCH/R2CjhH7lc/uabb+7cuVNTU3PHjh2vvfZaz0/ILnWKi4srLCxkG01NTb28vDq/1OnixYsTJ04cPXr09evXe1gP4ReKUcIzDQ0NL730UlxcnL6+fkxMjLe3dy+evGWp0/79+2/dusU2Ghsbe3t7d7jUqampydDQsL6+vqyszMjIqBerImqOYpTwSUVFxfz585OTk42MjKRSqbu7e99di13qFBMT09K77HCpk7u7e0pKyvHjx59//vm+K4yoHY4HFQjptMLCwmeeeQaAlZXVlStXVHbdzMzMTZs2sZdmGRgYpKamtj1y3bp1AD766COV1UbUAT0sTPjh2rVrbm5uV65ccXR0TE1NHTt2rMou7eTkFBIScvny5dzcXHapE9vY9shJkyYBSEtLU1ltRB3QTT3hgfPnz/v4+JSWlrq5uR05csTExITbesrLy42Njdu25+bm2tvbm5ubt2xxQvoD6o0SdRcfHz9jxozS0lI/P7+TJ09ynqEA2s1QAHZ2dkOGDHnw4EFeXp5qKyJcohglam3fvn2LFy+uq6tbuXLlgQMH9PT0uK6oAy4uLgDOnz/PdSFEdShGifrasmXLypUrZTJZcHDwnj17tLS0uK6oYzQ82g/x4O8l6Yfkcvlbb721Y8cOTU3NL7/8cvXq1VxX1Fmurq6g3mg/Q1NMRO00NDQEBATExMTo6Oh88803EomE64q6oLKy0tjYWEdH5+HDh7TNcz9BN/VE7WzdujUmJsbIyCgxMZFfGQpg8ODBI0eOrK+vz8rK4roWoiIUo0S9MAyTnJysra19/PjxKVOmcF1Od9B9fX9DMUrUi0gkKi0tbWxsrKur47qWbqIY7W8oRonaYSe7+RtDNFnf31CMErXD9ubajaEHDx7U1taqvKKuGTdunJ6e3vXr1ysrK7muhagCxShRO4+7KQ4ICBgyZMjx48e5KKoLxGKxs7MzwzAXL17kuhaiChSjRO2MHj168ODB+fn5xcXFyu22trbgyc0+DY/2KxSjRO2IRKIJEyYAuHDhgnI7j7KJhkf7FYpRoo7aTUy2MT09XS6Xc1NWp/Eo8UnPUYwKUUEB1q2DiwtGjsT06fjsM/Bt8VC7MWRmZjZ8+PDq6uobN25wVFdn2dvbm5qa3rt3Lz8/n+taSJ+jGBWca9fw7LM4cwYvvoiPP8bUqdi8GbNmob6e68q6wM3NDUBaWppCoVBu50svTyQS8X3ZFuk8ilHBef112Nri7FmsW4clS/Dhhzh9Gr/9hk8+4bqyLjA3N7exsamurs7OzlZu51E20fBo/0ExKiw5OTh7FuvXQ1f3r0ZHRyxejG++4a6s7njC8CgvsokvHWfScxSjwsJuh+Hg0Lp9zBjcvs2v+/p2e3Pjx48Xi8WZmZk1NTUc1dVZkyZNEolEFy9elMlkXNdC+hbFqLCwT/i0fcWFiQkYBmr//I+ydntzenp6Y8eOlcvlly5d4qiuzjI2Nh4xYkRtbS1t9SR4FKPCwgZoUVHr9sJCiMUYNEj1FXXbhAkTtLS0MjMzWz39yaObZR4NQZCeoBgVlvHjoaWFts8gXriACRPAh5dwtNDX13dycmpqasrIyFBu59HUDY8Sn/QExaiwmJpCIsGWLSgs/Kvx6FEcO4Y1a7grq5ueMMvEi2ziUeKTnqAYFZxt22BmhmeewSuv4IMP4OeH+fOxahVeeonryrqs3RhqeeK+qO3YhZoZN26cjo7OtWvXHj58yHUtpA9RjAqOqSlSU/H559DUxM2bsLPDiRPYsaP5U7V/jFJZux1PkUg0ceJEtHniXg3p6Og4OzsrFAra6knYKEaFSFsbAQHYvRsxMQgPx7RpALBtG6ysEBnJdXFd4ODgMGjQoLy8vPv37yu38+hmmUdDEKTbKEaF6Pp1REYiJ+eRRrEYxcXgQ/S00NDQ4MVWT/n5+f7+/hUVFW0/4lHik26jGBWisDC88QZ++eWRRldXAFCb6OmkdhPzcU/ccyIrK2vy5MlxcXHvvfde20/Z+lNTU1VeF1EdilEhajcxx46Fvj5u3kR7nSa11W6Mmpub29raqsNWT6mpqdOnTy8sLJw2bdp//vOftgdcvnxZX19/2bJl6r+5H+k2ilEhmjQJaBOjYjGefRYMA7WfmVHWsoK9VcdTHW6Wf/rpp5kzZ5aVlS1YsODYsWOGhoatDvj888+XLFlSW1s7ZMgQTU1NTookKkAxKkTOztDTQ3Y2Wr1SjYf39ZaWltbW1lVVVbdu3VJu53x4dO/evf7+/nV1dYGBgbGxsXp6esqfMgyzadOm9evXMwwTFhbW7v0+EQyKUSESizFuHBgG6emPtLO9VL5Nd6jhIvwtW7YEBgbKZLLg4ODdu3drPfp4mEwme/3110NDQ7W0tHbt2hUcHMxJkURlKEYFqt2OJw97o3j8Vk/sE/cq3upJLpe/8cYbGzdu1NTUjIyMDAsLa3VATU2Nn5/frl27DAwM4uPjAwMDVVke4QTFqEC12/EcPhxDhqCkBLm5nBTVPe12PNkn7mUy2W+//aayShoaGpYtWxYZGamjo/PDDz+sWrWq1QHl5eVz5sw5evSosbFxYmKil5eXymojHKIYFSi249l2nY2LC8CzDunEiRO1tLQuX75c9+gbpVxdXe3t7Stbjf/2mcrKyjlz5sTGxhoZGSUmJvr7+7c6IC8vb/LkySkpKcOHD09JSXnuuedUUxjhHkOEytycAZi8vEcaP/qIAZh16ziqqZueeeYZACkpKcqNTU1NKiugqKjI2dkZgKWl5eXLl9sekJmZaW1tDcDJyamgoEBlhRF1QL1R4Wq348nP4dF27+u1VLXv3/Xr193c3C5fvuzg4JCamspmurLTp097eHgUFBRMnz49OTl56NChqimMqAmKUeFqd3h00iRoaODSJTQ1cVJU93C4SjQtLW3atGn5+fmurq5nzpyxsbFpdcDhw4e9vLyqqqoWLlzY7upRIngUo8LVbsfT0BAjR6K+HpmZnBTVPVwtb0pMTJw1a1ZJSYmvr+/JkydNTU1bHbB9+/bFixfX1dWtWbPmwIEDuspvEiT9B9ejCqTPVFQwIhGjp8c0Nio3VwYFZU+Zcn7fPq7q6ga5XD5w4EAA9+/fV9lFo6OjxWIxgBUrVrQ7DsuudhKJRCEhISqriqgh6o0K1+DBGDkSdXWKq1eVm78dNerppKT//vorV3V1g4aGxvjx4wEkJSWp5ooRERGvvPJKU1NTcHDw3r17W43DyuXy1atXs6tHo6KiNm3apJqqiJriOsdJH/p+w4YJFhaRkZHKjeymcw4ODlxV1Q319fVOTk5Dhw4Vi8WzZ88ODw/vu26pQqHYsGEDAE1Nze3bt7dbDLvaSV9fXyqV9lEZhEcoRoXsiy++ALBy5UrlxsbGRj09PZFIVFFRwVVhXVJeXu7h4QHAwMBAQ6P5/kksFs+ZMycqKurevXu9eK2GhoalS5cCYBfYt1vMlClTABgZGSUlJfXipQl/UYwKGTsn4+jo2KqdXRmemJjISVVd0rJg08rK6vLlyyUlJdHR0T4+Ptra2myeamhouLu7h4WF3b59u+eXu3v3rqWlpaGh4a+//tr208LCQna1k5WV1ZUrV3p+OSIMFKNC1tDQoKOjo6GhUVVVpdz+9ttvA/j444+5KqyTrl27xi4wcnR0vHv3rvJH5eXl0dHREonEwMCgZYTK0dExJCTkxo0bPbloRkZGuwvslYvJz8/vySWIwFCMChy7VOjEiRPKjfv37wcwf/58rqrqjPPnz7MLjFxdXUtKSh53WE1NTXx8/PLly9mpfOU8TU9P761iUlNT2WLc3NxKS0t767REGChGBS4oKAjAv//9b+XGO3fuADA3N+eqqg5JpVJ9fX0Avr6+NTU1nflKXV0dm6fKC+Dt7e2DgoKSkpIUCkW3i4mPj2eL8fPzq62t7fZ5iFBRjArct99+C2DBggWt2s3NzQHktXriXj20LNhklxx19esymSwpKSkoKGjIkCEteWpra8vmqVwu79LZ9u3bx6526l4xpD+gGBU4dtN4S0vLVu3e3t4AfvzxR06qeoLw8HCRSAQgODi4J11IRilPraysWvLUzMxs+fLl8fHxjY8+ldCusLCwlmJ6UgkRNopRgVMoFOygXqtZkdDQUAAbNmzgqrC2Olyw2W1yuTw9PT0kJGTkyJEteWpsbMzmaUNDQ9uvyGSyN998ky1mx44dvVgMER6KUeFjNw+OjY1VbkxISADg4eHBVVWt1dd/sXYtAF1d3QMHDvTddbKyskJCQkaPHt2Sp4MHD5ZIJNHR0dXV1X/WUr9kyRJ29agadtiJuqEYFb6QkBAA7777rnJjWVmZSCTS09PrzL1tn6usZGbMaNDWlkydeurUKdVc88qVKyEhIWPHjm3J0wEDBrzwwgvR0dEzZ85k4/X06dOqKYbwGsWo8B09ehTA1KlTW7Wzd7gZGRmcVPWX4mLm2WcZgLGwYLgoJicnJzw83N3dnR0GZW/kaYE96TzamkT4XF1dRSJRenq6TCZjW9h3vrNLSi9evMhlcTk5mDIFGRkYMQJJSRg3TvUl2NnZrV27Njk5OTc397PPPjMxMZHL5Z988olyR5WQJ1DR/uGEQ8bGxiNGjLh9+/bVq1dlMtn3339/8ODBMWPGTJ06NTMz08nJibPK0tPh7Y0HD+Digp9/hpkZZ5UAAGxtbdetW3f37t2IiIi8vDxuiyE8okl7fPUHxcXFTz31lJaW1rJly06dOlVVVXXz5s3ExMQ9e/akpqY2NDTY2NiwK8xV58QJeHujvByzZ+PoURgZqfTqj1deXn7w4MGBAweye5QQ0jGuRxWIirTszf7yyy/n5uZGRUX5+Pi0bKOpqanp7u4eHh5eWFioimq+/ZYRixmAefllRh3muJTcvn0bgIWFBdeFEN6gGO0XIiIi2C3mgoKClB/jKS0tfdyGSbdu3eqrasLDGQ0NBmCCgpguPlOkAi0rbVtthkLI41CMCpxCoWAXPIlEorCwsMcdVlZWtm/fPl9f35a3CYlEIhcXlzPbtzO9mKcKBRMczACMSMRs3dprp+1t8+bNAxATE8N1IYQfKEaFrKmp6dVXXwWgpaW1e/fuznyl1YZJ911cGIBxdGSCg5ke7lLc1MQEBjIAo63NfPddj07Vx9gJg3feeYfrQgg/UIwK1h9//MH2qgwMDI4ePdrVr9fW1h48eFD2yivM4MEM0Pzn6aeZf/yD6cwGdDU1TG4u8+dzQQzDMI2NjJcXM2AAc+xYV4tRsWPHjgGYMmUK14UQfhAxDKO6+SyiKuXl5b6+vikpKSYmJlKplN3uvpvkcpw7h9hYxMTg3r3mRhsbLFgAX19Mn45HX/eGS5ewYQOSkiCXQySCqyu2bsWUKQBQU4OcHKj9eszy8nJTU1M9Pb2qqqpWL7MjpB1c5zjpfbm5uU8//TSA4cOHZ2dn99p5ZTImKYkJCmKGDv2rf2pqyixfzsTHN0+4Z2UxAwYw3t5MSgrz4AGTlsYsWcJoa/d0QEDl1OURL8IHFKNCk5mZaW1tDcDJyamgoKBPriGXM2fPMuvXM8OH/5Wn7C4n3t6Mk9Mja5jkcsbdnXFx6ZNK+sxLL70EICoqiutCCA/Qw6CCcurUKQ8Pj4KCghkzZiQnJw8dOrRPLqOhgcmT8emnyM1FVhZCQuDggJkzUV+PxES8+CLE4kcOXrECFy6guLhPiukb7JOy7DsBCXkyGvcRjsOHDy9btqy+vn7hwoX79+9vWbrUt8aMwZgx2LQJTU3Iy0NjI+zsWh8zYgQA5OTA0lIVJfWGSZMmgWKUdA71RgVi+/btixcvrq+vX7NmTcsDSyolFkOhAIA/V/L/RUcHAP7cGIUXxo0bp6Ojc/369YcPH3JdC1F3FKNCsGXLljVr1jAMExIS8sUXX7APLHHAwgIiEX7/vXX73bsAYG2t+oq6TUdHx9nZWaFQcLwDFuEDilF+k8vlq1at2rhxo6amZlRUFMcbzRgaYsIE/PJL6/aEBAwfDnt7LmrqPhoeJZ1EMcpjDQ0NS5cu3blzp76+/uHDh1977TWuKwLefx/HjiEiAi3rkb/+Gt99hw8+wJ+bIvMFOzyalpbGdSFE3dHye76qqKiYP39+cnKykZGRVCp1d3fnuqI/bduGf/wD+vp4+mncuYPycvzrX/jnP3kXo7du3Ro1apSlpWVRURHXtRC1RjHKS0VFRV5eXleuXLGyskpISFC7fdpLS3HqFEpKYGSE6dNhYcF1Qd3BMIyZmVlZWdnvv/9uzauBXaJitOCJf65du+bl5ZWfn+/o6JiQkDBs2DCuK2rD1BT+/lwX0VPsHlcJCQnnz5+nGCVPQGOjPHP+/Plp06bl5+e7ubmdOXNGHTNUQGh4lHQGxSifSKXSmTNnlpaW+vn5nTx50sTEhOuKBI4m60ln0Ngob+zbt++1116TyWQrV67cuXMn7TykAmVlZWZmZvr6+pWVlfQfnDwO9Ub5YcuWLYGBgTKZLDg4eM+ePfRPWjVMTEzs7e1ramquXbvGdS1EfVGMqju5XP73v/9948aNGhoaO3bsCAsL47qi/oWGR0mHKEbV3bZt2/773//q6urGxsauXr2a63L6HRoeJR2iGFV3b7zxhp+f3/HjxxcuXMh1Lf0RxSjpEE0xEfIkDQ0NhoaGTU1NlZWV7Gv+CGmFeqOEPImOjs7YsWMVCsWlS5e4roWoKYpRQjpA9/XkyShGCekATdaTJ6MYJaQDLb3R2traiRMn/t///d9vv/3GdVFEjdAUEyEdYBjGxMSkoqLiq6++atnUdcSIEYsXL160aNGkSZNEfNsDkPQu6o0S0gF2qycARkZGSUlJQUFBlpaWd+7c2bp1q5ubm42NzapVq6RSqYxXL5sivYhilJCOTZgwAUB6erqHh0dERERBQUFSUlJwcPBTTz1VUFCwc+fO+fPnW1hYBAQESKXSxsZGruslKkU39YR0oLKycubMmZWVldHR0VOmTFH+iGGYCxcuxMXFxcXF3blzh200MjKaP3/+P5ctGzltGlT/ilaichSjhDxJYWGhl5dXZmamtbX1mTNn7OzsHnfk1atXY2Njjxw5wr5M9A8HB4O7dzFzJiQSLFwIWrovXBSjhDzWjRs35s6dm5+f7+DgkJCQYGNj05lvZWdnH//pp7diYtDycmY9PXh6YtEi+PrC0LAPKyZcoBglpH1paWk+Pj4lJSWurq4bNmzYuHGjj4+PRCJxd3fv7NR8fj4OHUJsLM6dg0IBAJqacHODRIIlS3j6iirSFsUoIe1ITExcvHhxdXW1r6/vDz/88P7770dERLAf2dvbs0udXF1dO5unJSU4dgyxsfjlFzQ1AUp56u+PoUP77PcgqkAxSkhrX3/99d/+9rempqYVK1bs2rVLS0tLLpefO3cuNjb2wIEDLe9bNjMz8/T0lEgknp6eYrG4U6cuKcHhwzh4ECdPgp3Q19DAmjX4M6MJH1GMEvKIiIiIdevWMQwTHBy8efPmVv1NhUKRkpJy5MiRuLi427dvs40mJibz5s2TSCRz587V1tbu1GUqK5GYCKkUhw5hyxa8+SYYBr/+ipQU1NRg2DD4+KBzQ7GEewwhhGEYhlEoFO+88w4AkUj06aefdnhwWloau3S05V+TkZFRQEBA5c8/M3V1nb1qdTVTXc1UVDDTpzM6OszUqYxEwowcyWhrMxERPf2ViEpQjBLCMAzT0NCwdOlSANra2j/88EOXvpuVlRUWFubu7g5gpLExo6XF6OkxPj5MdDRTVdWpUyxdylhaMtnZzT8qFMzmzYxIxJw82cXfg3CAbuoJAR4+LA4KGvX995p6eocPH54+fXr3TnPz5s3i48enRUcjPb25SVcXc+c2L3UyMmr/awUFsLVFZCT+fGAfABgG48dj2DDEx3evGKIyFKOk37t3D/PmISMjx8urevNmZ2fnXjgnu9TpyBGcOgX2WfuWqfkXXoCl5SMHHzgAiQRZWRgz5pH2t97C99+jtLQX6iF9iZ6pJ/1bTg6mTkVGBuzt7bdt650MBWBjg7VrkZiI4mJER8PHBxoaOHsWb78Na2t4eCAiAgUFzQezQdl22ZO1NcrLmxecEjVGMUr6sfR0PPccbt2CiwvOnYPSZFGvMTVFQACkUhQVYdcuzJsHLa3mPLWxwZ49AKCnBwBVVa2/W1kJXV1o0D9SdUf/h0h/deIEZs3CgweYPRsnTsDcvG8vZ2qKV1/Fzz+jogLx8Vi+HAYGmDwZABwcAODmzdZfyc6Go2PfVkV6A42Nkn7pu++wciWamvDyy9izB51cPN+76uqa+6EKBZ56Cs7OOHgQLctU79yBkxM+/BDvvstBbaQrKEZJ/xMRgfXroVAgKAiff64Wd82JifDxwYIFCAiApSUyMvDRRzA1RXIybbWn/ihGSX/CMAgNRWgoRCKEheG997guSElqKj78EMnJ+OMP2NpCIsEHH2DQIK7LIh2jGCX9hkyGVauwZw+0tbF3L158keuCiEBQjJJ+w88P8fEYOBBxcXj+ea6rIcKhxXUBhHRFaSkuXcK0adDR+asxKwt1dXBxaf6xoQFnz+L33zFgACZNwrBhze2BgUhNxU8/wc1N1WUTQaPeKOGVo0fh7Y2CgkcWq69YgTt3kJwMAL/8gsBAlJZi1Cjcv4+yMgQG4ssvm2O3pgYGBtxUToRLDeYoCekt169jwQJ4eqKiApmZePAAx47hxx+xfn3zAZShpA9QjBIB+eQTWFggMhL6+s0tc+bgX//CV1/h3j1OKyNCRjFKBOTXXzFjRuu19PPmoamp+ZafkD5AU0yEhyZOfGTNfGUlnn0WAIqL29kx3ta2+SNC+gbFKOGh8HCYmPz149atqK0FALEY9fWtD2ZbOvluD0K6jmKU8JCHxyMz9d98gzt3AMDeHrm5rQ9mPxoxQlXFkX6HxkaJgPj6IiEBJSWPNH79NUxM4O7OUU1E+ChGiYCsX4/Bg+HtjeRk1NUhNxehoYiMRFhY815KhPQBuqknAmJsjDNn8NZbmDGj+dUdtrbYtw/Ll3NdGREyeoqJ8ArDoKmp9XyRXA6GgZZSn6C6GgUFGDgQ1tYqLpD0QxSjhBDSIzQ2SgghPUIxSgghPUIxSgghPUIxSgghPUIxSgghPfL/4hEEkYUdDJEAAAEVelRYdHJka2l0UEtMIHJka2l0IDIwMjIuMDMuMgAAeJx7v2/tPQYg4GWAAEYoG4QbGNkYEkBizGwMGkCamYUDQjPBaDYHiDibQwaIZmbEy4CqxTALrICRkRtoOSOTBhMjswIziwILawYTK1sCG3sGEztHAgdnBhMnlwIXtwYTF48CJ0uCCCMbCycHOxur+DKoq8GAN+9P8YEHW5fsB3Hat+scOOI7YR+InXDC4cD9ddPtQewJhxftX5xmB1Yjck5xX9meVjsQ+3zux325hnfBajbHqNi/e6nnAGK/yWFx+BcpCGYfqZVwiHjsC1azp3CRvWSbL9j83Mmn7IWLr4LNLJvv4FDlyXEAxG5Q+2B3kEsbzBYDAF6qQyF2KHO4AAABdHpUWHRNT0wgcmRraXQgMjAyMi4wMy4yAAB4nH2TUW7DIAyG33MKX6DINgabx7appmlqIm3d7rD33V+zU3WkEhrEEZAPG347E0R7n9++f+Cv8TxNAPjP01qDr4yI0xViAKfLy+sC59vx9Fg5r5/L7QMox4PRn9njbb0+VgjOcMjJiNkYDpTYqqFvSbi1vpeD5FSbKTqJTpJJHpAZ1vCJ7jMiJLKCLANQAvSQSqXlcKmStYzIEsExUTGMOyWuxDiKXe+guEshj61sqDQA1UFMVdxNA06aM7INOHOOE9ZGYj7wsxKNuLZx2bhq9c+GwmUkI3l+/FxcG7a6yYioqCOSNrK4S1fPdapVi47UIXYhXXBsfo1IEnETKyMycuPyeHSRLZ3KJY/0uSzzU6HcS+e0LnMvnejc6yN67kXg30B6qsmt9Hz6BGrPmrhpz424WU+BuLWutLjRXlHaXrRTjuNFvFOItpW8U0JiV9lfeH+9mD/+Kh9PvzErr8ImvuxyAAAAvXpUWHRTTUlMRVMgcmRraXQgMjAyMi4wMy4yAAB4nCWOyw0CUQhFW3GpCUP4w8vE1RRgEbZh8d6n7Dgc4F7X/fl6vN763qX/7va5H86jZkOHsk0NnYdxrWk6BEAnHMhZIDkp66QYCOzWXNvq8M4AE9YcUSdslpr4jwW8UKy2jTSdwhWYLTJu9y0ZSy1NANxU28DHkEV4JCzpxDcYv0giva8oJxTbsas6QZBRVjshv9qK2Z+ilkRsVG3p9Ph8AaOXNezpZQiBAAAAAElFTkSuQmCC\n", | |
"text/plain": [ | |
"<rdkit.Chem.rdchem.Mol at 0x7f35cdc30400>" | |
] | |
}, | |
"execution_count": 2, | |
"metadata": {}, | |
"output_type": "execute_result" | |
} | |
], | |
"source": [ | |
"mol = dm.to_mol(\"CC(=O)OC1=CC=CC=C1C(=O)O\")\n", | |
"mol" | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"execution_count": 3, | |
"id": "c5008433-e2dd-4920-9f0d-3c71716e180e", | |
"metadata": {}, | |
"outputs": [ | |
{ | |
"data": { | |
"image/svg+xml": [ | |
"<svg xmlns=\"http://www.w3.org/2000/svg\" xmlns:rdkit=\"http://www.rdkit.org/xml\" xmlns:xlink=\"http://www.w3.org/1999/xlink\" version=\"1.1\" baseProfile=\"full\" xml:space=\"preserve\" width=\"600px\" height=\"300px\" viewBox=\"0 0 600 300\">\n", | |
"<!-- END OF HEADER -->\n", | |
"<rect style=\"opacity:1.0;fill:#FFFFFF;stroke:none\" width=\"600.0\" height=\"300.0\" x=\"0.0\" y=\"0.0\"> </rect>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 22.3,199.1 L 61.9,163.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 56.7,164.5 L 52.2,143.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 52.2,143.3 L 47.6,122.0\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 67.1,162.3 L 62.6,141.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 62.6,141.0 L 58.0,119.8\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-1 atom-3\" d=\"M 61.9,163.4 L 82.9,170.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-1 atom-3\" d=\"M 82.9,170.2 L 103.9,177.0\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 121.3,172.0 L 136.7,158.0\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 136.7,158.0 L 152.2,144.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 152.2,144.1 L 141.0,92.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 160.9,134.1 L 153.1,97.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 141.0,92.0 L 180.6,56.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-6 atom-7\" d=\"M 180.6,56.3 L 231.3,72.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-6 atom-7\" d=\"M 184.9,68.9 L 220.4,80.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-7 atom-8\" d=\"M 231.3,72.7 L 242.4,124.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 242.4,124.8 L 202.9,160.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 229.3,122.3 L 201.7,147.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 202.9,160.5 L 214.0,212.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-10 atom-11\" d=\"M 215.6,207.6 L 236.6,214.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-10 atom-11\" d=\"M 236.6,214.4 L 257.6,221.2\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-10 atom-11\" d=\"M 212.4,217.7 L 233.4,224.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-10 atom-11\" d=\"M 233.4,224.5 L 254.4,231.3\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-10 atom-12\" d=\"M 214.0,212.6 L 198.6,226.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-10 atom-12\" d=\"M 198.6,226.6 L 183.1,240.5\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-12 atom-9 atom-4\" d=\"M 202.9,160.5 L 152.2,144.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-2\" d=\"M 43.8 111.3 Q 43.8 107.7, 45.6 105.7 Q 47.4 103.7, 50.8 103.7 Q 54.1 103.7, 55.9 105.7 Q 57.7 107.7, 57.7 111.3 Q 57.7 115.0, 55.9 117.1 Q 54.1 119.2, 50.8 119.2 Q 47.4 119.2, 45.6 117.1 Q 43.8 115.0, 43.8 111.3 M 50.8 117.5 Q 53.1 117.5, 54.3 115.9 Q 55.6 114.4, 55.6 111.3 Q 55.6 108.4, 54.3 106.9 Q 53.1 105.4, 50.8 105.4 Q 48.5 105.4, 47.2 106.9 Q 46.0 108.4, 46.0 111.3 Q 46.0 114.4, 47.2 115.9 Q 48.5 117.5, 50.8 117.5 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-3\" d=\"M 105.7 179.9 Q 105.7 176.2, 107.5 174.2 Q 109.3 172.2, 112.6 172.2 Q 115.9 172.2, 117.7 174.2 Q 119.5 176.2, 119.5 179.9 Q 119.5 183.5, 117.7 185.6 Q 115.9 187.7, 112.6 187.7 Q 109.3 187.7, 107.5 185.6 Q 105.7 183.5, 105.7 179.9 M 112.6 186.0 Q 114.9 186.0, 116.1 184.4 Q 117.4 182.9, 117.4 179.9 Q 117.4 176.9, 116.1 175.4 Q 114.9 173.9, 112.6 173.9 Q 110.3 173.9, 109.0 175.4 Q 107.8 176.9, 107.8 179.9 Q 107.8 182.9, 109.0 184.4 Q 110.3 186.0, 112.6 186.0 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-11\" d=\"M 257.8 229.1 Q 257.8 225.5, 259.6 223.4 Q 261.3 221.4, 264.7 221.4 Q 268.0 221.4, 269.8 223.4 Q 271.6 225.5, 271.6 229.1 Q 271.6 232.7, 269.8 234.8 Q 268.0 236.9, 264.7 236.9 Q 261.4 236.9, 259.6 234.8 Q 257.8 232.8, 257.8 229.1 M 264.7 235.2 Q 267.0 235.2, 268.2 233.7 Q 269.5 232.1, 269.5 229.1 Q 269.5 226.1, 268.2 224.6 Q 267.0 223.1, 264.7 223.1 Q 262.4 223.1, 261.1 224.6 Q 259.9 226.1, 259.9 229.1 Q 259.9 232.1, 261.1 233.7 Q 262.4 235.2, 264.7 235.2 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-12\" d=\"M 153.9 240.9 L 155.9 240.9 L 155.9 247.3 L 163.7 247.3 L 163.7 240.9 L 165.7 240.9 L 165.7 256.0 L 163.7 256.0 L 163.7 249.0 L 155.9 249.0 L 155.9 256.0 L 153.9 256.0 L 153.9 240.9 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-12\" d=\"M 167.5 248.4 Q 167.5 244.7, 169.3 242.7 Q 171.1 240.7, 174.4 240.7 Q 177.8 240.7, 179.6 242.7 Q 181.4 244.7, 181.4 248.4 Q 181.4 252.0, 179.6 254.1 Q 177.7 256.2, 174.4 256.2 Q 171.1 256.2, 169.3 254.1 Q 167.5 252.1, 167.5 248.4 M 174.4 254.5 Q 176.7 254.5, 178.0 253.0 Q 179.2 251.4, 179.2 248.4 Q 179.2 245.4, 178.0 243.9 Q 176.7 242.4, 174.4 242.4 Q 172.1 242.4, 170.9 243.9 Q 169.6 245.4, 169.6 248.4 Q 169.6 251.4, 170.9 253.0 Q 172.1 254.5, 174.4 254.5 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"note\" d=\"M 16.4 196.4 Q 15.0 196.4, 14.3 195.4 Q 13.6 194.4, 13.6 192.5 Q 13.6 190.7, 14.3 189.7 Q 15.0 188.7, 16.4 188.7 Q 17.8 188.7, 18.5 189.7 Q 19.2 190.7, 19.2 192.5 Q 19.2 194.4, 18.5 195.4 Q 17.8 196.4, 16.4 196.4 M 16.4 195.6 Q 17.2 195.6, 17.7 194.8 Q 18.1 194.0, 18.1 192.5 Q 18.1 191.1, 17.7 190.3 Q 17.2 189.5, 16.4 189.5 Q 15.6 189.5, 15.1 190.3 Q 14.7 191.1, 14.7 192.5 Q 14.7 194.0, 15.1 194.8 Q 15.6 195.6, 16.4 195.6 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 61.9 175.0 L 63.6 175.0 L 63.6 169.4 L 61.7 170.0 L 61.5 169.3 L 63.8 168.3 L 64.6 168.4 L 64.6 175.0 L 66.0 175.0 L 66.0 175.9 L 61.9 175.9 L 61.9 175.0 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 44.5 91.6 Q 44.8 90.9, 45.5 90.5 Q 46.1 90.1, 47.0 90.1 Q 48.2 90.1, 48.8 90.7 Q 49.5 91.3, 49.5 92.4 Q 49.5 93.6, 48.6 94.6 Q 47.8 95.7, 46.1 96.9 L 49.6 96.9 L 49.6 97.7 L 44.5 97.7 L 44.5 97.0 Q 45.9 96.0, 46.8 95.3 Q 47.6 94.5, 48.0 93.9 Q 48.4 93.2, 48.4 92.5 Q 48.4 91.8, 48.0 91.4 Q 47.7 91.0, 47.0 91.0 Q 46.4 91.0, 46.0 91.2 Q 45.6 91.5, 45.3 92.0 L 44.5 91.6 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 117.4 197.0 Q 118.1 197.2, 118.5 197.7 Q 118.9 198.2, 118.9 198.9 Q 118.9 199.6, 118.5 200.1 Q 118.2 200.6, 117.6 200.8 Q 117.0 201.1, 116.3 201.1 Q 115.5 201.1, 114.9 200.8 Q 114.3 200.5, 113.8 200.0 L 114.4 199.3 Q 114.9 199.9, 115.2 200.1 Q 115.6 200.3, 116.3 200.3 Q 117.0 200.3, 117.4 199.9 Q 117.8 199.5, 117.8 198.9 Q 117.8 198.2, 117.3 197.8 Q 116.9 197.5, 116.0 197.5 L 115.5 197.5 L 115.5 196.7 L 115.9 196.7 Q 116.8 196.7, 117.2 196.3 Q 117.6 196.0, 117.6 195.3 Q 117.6 194.8, 117.3 194.5 Q 116.9 194.2, 116.3 194.2 Q 115.7 194.2, 115.3 194.4 Q 114.9 194.7, 114.6 195.2 L 113.8 194.8 Q 114.1 194.2, 114.7 193.8 Q 115.4 193.4, 116.3 193.4 Q 117.4 193.4, 118.0 193.9 Q 118.7 194.4, 118.7 195.3 Q 118.7 195.9, 118.4 196.3 Q 118.0 196.8, 117.4 197.0 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 145.7 142.6 L 146.6 142.6 L 146.6 143.4 L 145.7 143.4 L 145.7 145.2 L 144.7 145.2 L 144.7 143.4 L 140.8 143.4 L 140.8 142.7 L 144.1 137.6 L 145.7 137.6 L 145.7 142.6 M 142.0 142.6 L 144.7 142.6 L 144.7 138.3 L 142.0 142.6 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 132.8 88.3 Q 133.4 88.3, 134.0 88.6 Q 134.5 88.9, 134.8 89.4 Q 135.1 89.9, 135.1 90.7 Q 135.1 91.4, 134.7 92.0 Q 134.4 92.6, 133.8 92.8 Q 133.1 93.1, 132.4 93.1 Q 131.7 93.1, 131.1 92.9 Q 130.5 92.6, 130.0 92.1 L 130.7 91.5 Q 131.0 91.8, 131.5 92.1 Q 132.0 92.3, 132.5 92.3 Q 133.1 92.3, 133.6 91.8 Q 134.1 91.4, 134.1 90.7 Q 134.1 89.9, 133.6 89.5 Q 133.1 89.1, 132.4 89.1 Q 131.7 89.1, 131.0 89.4 L 130.4 89.1 L 130.8 85.5 L 134.7 85.5 L 134.5 86.3 L 131.7 86.3 L 131.4 88.6 Q 132.1 88.3, 132.8 88.3 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 179.1 46.7 Q 179.7 46.7, 180.2 47.0 Q 180.8 47.3, 181.1 47.8 Q 181.3 48.3, 181.3 49.0 Q 181.3 49.7, 181.0 50.3 Q 180.7 50.9, 180.1 51.2 Q 179.5 51.5, 178.8 51.5 Q 177.5 51.5, 176.8 50.6 Q 176.1 49.7, 176.1 47.9 Q 176.1 45.9, 176.9 44.8 Q 177.8 43.8, 179.4 43.8 Q 179.9 43.8, 180.3 43.9 Q 180.7 44.0, 181.0 44.2 L 180.6 45.0 Q 180.1 44.7, 179.4 44.7 Q 178.3 44.7, 177.8 45.3 Q 177.2 46.0, 177.2 47.4 Q 177.6 47.1, 178.0 46.9 Q 178.5 46.7, 179.1 46.7 M 178.8 50.6 Q 179.2 50.6, 179.6 50.4 Q 179.9 50.2, 180.1 49.8 Q 180.3 49.5, 180.3 49.0 Q 180.3 48.3, 179.9 48.0 Q 179.5 47.6, 178.9 47.6 Q 178.4 47.6, 178.0 47.8 Q 177.5 48.0, 177.2 48.3 Q 177.2 49.5, 177.6 50.1 Q 178.0 50.6, 178.8 50.6 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 239.3 63.8 L 235.4 63.8 L 235.4 63.0 L 240.4 63.0 L 240.4 63.7 L 237.3 70.5 L 236.3 70.5 L 239.3 63.8 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 252.0 127.4 Q 252.7 127.7, 253.1 128.1 Q 253.5 128.6, 253.5 129.3 Q 253.5 129.9, 253.2 130.4 Q 252.9 130.9, 252.3 131.2 Q 251.7 131.5, 250.9 131.5 Q 249.6 131.5, 248.9 130.9 Q 248.2 130.3, 248.2 129.3 Q 248.2 128.7, 248.5 128.2 Q 248.8 127.8, 249.5 127.4 Q 249.0 127.1, 248.7 126.7 Q 248.5 126.3, 248.5 125.7 Q 248.5 124.8, 249.1 124.3 Q 249.8 123.7, 250.9 123.7 Q 252.0 123.7, 252.6 124.3 Q 253.3 124.8, 253.3 125.7 Q 253.3 126.2, 252.9 126.6 Q 252.6 127.0, 252.0 127.4 M 250.9 124.5 Q 250.2 124.5, 249.9 124.8 Q 249.5 125.1, 249.5 125.7 Q 249.5 126.1, 249.8 126.3 Q 250.0 126.6, 250.3 126.7 Q 250.7 126.9, 251.3 127.1 Q 251.8 126.8, 252.0 126.4 Q 252.2 126.1, 252.2 125.7 Q 252.2 125.1, 251.8 124.8 Q 251.5 124.5, 250.9 124.5 M 250.9 130.7 Q 251.6 130.7, 252.0 130.3 Q 252.5 129.9, 252.5 129.3 Q 252.5 128.9, 252.2 128.6 Q 252.0 128.4, 251.7 128.2 Q 251.3 128.1, 250.7 127.9 L 250.3 127.7 Q 249.7 128.0, 249.5 128.4 Q 249.3 128.8, 249.3 129.3 Q 249.3 129.9, 249.7 130.3 Q 250.2 130.7, 250.9 130.7 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 211.2 159.4 Q 212.6 159.4, 213.2 160.4 Q 213.9 161.3, 213.9 163.1 Q 213.9 165.1, 213.1 166.1 Q 212.2 167.2, 210.6 167.2 Q 210.2 167.2, 209.8 167.1 Q 209.4 166.9, 209.0 166.7 L 209.4 166.0 Q 210.0 166.3, 210.6 166.3 Q 211.7 166.3, 212.2 165.6 Q 212.8 164.9, 212.8 163.5 Q 212.5 163.9, 212.0 164.1 Q 211.5 164.2, 211.0 164.2 Q 210.3 164.2, 209.8 163.9 Q 209.3 163.7, 209.0 163.1 Q 208.7 162.6, 208.7 162.0 Q 208.7 161.2, 209.0 160.7 Q 209.3 160.1, 209.9 159.8 Q 210.5 159.4, 211.2 159.4 M 209.8 161.9 Q 209.8 162.6, 210.1 163.0 Q 210.5 163.4, 211.2 163.4 Q 211.6 163.4, 212.1 163.2 Q 212.5 163.0, 212.8 162.7 Q 212.8 161.4, 212.4 160.9 Q 212.0 160.3, 211.2 160.3 Q 210.8 160.3, 210.5 160.5 Q 210.1 160.7, 209.9 161.1 Q 209.8 161.5, 209.8 161.9 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 222.3 203.7 L 224.0 203.7 L 224.0 198.1 L 222.2 198.6 L 221.9 198.0 L 224.2 197.0 L 225.0 197.1 L 225.0 203.7 L 226.5 203.7 L 226.5 204.5 L 222.3 204.5 L 222.3 203.7 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 229.7 204.6 Q 228.3 204.6, 227.6 203.6 Q 226.9 202.6, 226.9 200.8 Q 226.9 198.9, 227.6 197.9 Q 228.3 196.9, 229.7 196.9 Q 231.1 196.9, 231.8 197.9 Q 232.4 198.9, 232.4 200.8 Q 232.4 202.6, 231.7 203.6 Q 231.1 204.6, 229.7 204.6 M 229.7 203.8 Q 230.5 203.8, 230.9 203.0 Q 231.4 202.3, 231.4 200.8 Q 231.4 199.3, 230.9 198.5 Q 230.5 197.8, 229.7 197.8 Q 228.9 197.8, 228.4 198.5 Q 228.0 199.3, 228.0 200.8 Q 228.0 202.3, 228.4 203.0 Q 228.9 203.8, 229.7 203.8 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 277.2 237.5 L 278.9 237.5 L 278.9 231.8 L 277.1 232.4 L 276.8 231.7 L 279.1 230.7 L 279.9 230.8 L 279.9 237.5 L 281.4 237.5 L 281.4 238.3 L 277.2 238.3 L 277.2 237.5 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 282.2 237.5 L 283.9 237.5 L 283.9 231.8 L 282.1 232.4 L 281.8 231.7 L 284.1 230.7 L 284.9 230.8 L 284.9 237.5 L 286.4 237.5 L 286.4 238.3 L 282.2 238.3 L 282.2 237.5 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 166.1 233.9 L 167.7 233.9 L 167.7 228.3 L 165.9 228.9 L 165.7 228.2 L 168.0 227.2 L 168.8 227.3 L 168.8 233.9 L 170.2 233.9 L 170.2 234.8 L 166.1 234.8 L 166.1 233.9 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 170.7 228.7 Q 171.0 227.9, 171.6 227.6 Q 172.3 227.1, 173.2 227.1 Q 174.4 227.1, 175.0 227.8 Q 175.6 228.4, 175.6 229.5 Q 175.6 230.6, 174.8 231.6 Q 174.0 232.7, 172.3 233.9 L 175.8 233.9 L 175.8 234.8 L 170.7 234.8 L 170.7 234.1 Q 172.1 233.1, 172.9 232.3 Q 173.8 231.6, 174.2 230.9 Q 174.6 230.2, 174.6 229.5 Q 174.6 228.8, 174.2 228.4 Q 173.8 228.0, 173.2 228.0 Q 172.6 228.0, 172.2 228.2 Q 171.8 228.5, 171.5 229.0 L 170.7 228.7 \" fill=\"#000000\"/>\n", | |
"<path class=\"bond-0 atom-7 atom-2\" d=\"M 323.3,199.1 L 362.9,163.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-2 atom-11\" d=\"M 357.7,164.5 L 353.1,143.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-2 atom-11\" d=\"M 353.1,143.3 L 348.6,122.0\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-2 atom-11\" d=\"M 368.1,162.3 L 363.6,141.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-2 atom-11\" d=\"M 363.6,141.0 L 359.0,119.8\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-9\" d=\"M 362.9,163.4 L 383.9,170.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-9\" d=\"M 383.9,170.2 L 404.9,177.0\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-9 atom-12\" d=\"M 422.3,172.0 L 437.7,158.0\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-9 atom-12\" d=\"M 437.7,158.0 L 453.1,144.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-12 atom-10\" d=\"M 453.1,144.1 L 442.0,92.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-12 atom-10\" d=\"M 461.9,134.1 L 454.1,97.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-10 atom-0\" d=\"M 442.0,92.0 L 481.6,56.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-0 atom-6\" d=\"M 481.6,56.3 L 532.3,72.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-0 atom-6\" d=\"M 485.9,68.9 L 521.4,80.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-6 atom-1\" d=\"M 532.3,72.7 L 543.4,124.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-1 atom-4\" d=\"M 543.4,124.8 L 503.8,160.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-1 atom-4\" d=\"M 530.3,122.3 L 502.6,147.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-4 atom-8\" d=\"M 503.8,160.5 L 515.0,212.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-8 atom-5\" d=\"M 516.6,207.6 L 537.6,214.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-8 atom-5\" d=\"M 537.6,214.4 L 558.6,221.2\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-8 atom-5\" d=\"M 513.3,217.7 L 534.3,224.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-8 atom-5\" d=\"M 534.3,224.5 L 555.3,231.3\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-8 atom-3\" d=\"M 515.0,212.6 L 499.5,226.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-8 atom-3\" d=\"M 499.5,226.6 L 484.1,240.5\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-12 atom-4 atom-12\" d=\"M 503.8,160.5 L 453.1,144.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-3\" d=\"M 454.9 240.9 L 456.9 240.9 L 456.9 247.3 L 464.6 247.3 L 464.6 240.9 L 466.7 240.9 L 466.7 256.0 L 464.6 256.0 L 464.6 249.0 L 456.9 249.0 L 456.9 256.0 L 454.9 256.0 L 454.9 240.9 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-3\" d=\"M 468.5 248.4 Q 468.5 244.7, 470.3 242.7 Q 472.1 240.7, 475.4 240.7 Q 478.8 240.7, 480.6 242.7 Q 482.3 244.7, 482.3 248.4 Q 482.3 252.0, 480.5 254.1 Q 478.7 256.2, 475.4 256.2 Q 472.1 256.2, 470.3 254.1 Q 468.5 252.1, 468.5 248.4 M 475.4 254.5 Q 477.7 254.5, 479.0 253.0 Q 480.2 251.4, 480.2 248.4 Q 480.2 245.4, 479.0 243.9 Q 477.7 242.4, 475.4 242.4 Q 473.1 242.4, 471.9 243.9 Q 470.6 245.4, 470.6 248.4 Q 470.6 251.4, 471.9 253.0 Q 473.1 254.5, 475.4 254.5 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-5\" d=\"M 558.7 229.1 Q 558.7 225.5, 560.5 223.4 Q 562.3 221.4, 565.7 221.4 Q 569.0 221.4, 570.8 223.4 Q 572.6 225.5, 572.6 229.1 Q 572.6 232.7, 570.8 234.8 Q 569.0 236.9, 565.7 236.9 Q 562.3 236.9, 560.5 234.8 Q 558.7 232.8, 558.7 229.1 M 565.7 235.2 Q 568.0 235.2, 569.2 233.7 Q 570.5 232.1, 570.5 229.1 Q 570.5 226.1, 569.2 224.6 Q 568.0 223.1, 565.7 223.1 Q 563.4 223.1, 562.1 224.6 Q 560.9 226.1, 560.9 229.1 Q 560.9 232.1, 562.1 233.7 Q 563.4 235.2, 565.7 235.2 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-9\" d=\"M 406.7 179.9 Q 406.7 176.2, 408.4 174.2 Q 410.2 172.2, 413.6 172.2 Q 416.9 172.2, 418.7 174.2 Q 420.5 176.2, 420.5 179.9 Q 420.5 183.5, 418.7 185.6 Q 416.9 187.7, 413.6 187.7 Q 410.3 187.7, 408.4 185.6 Q 406.7 183.5, 406.7 179.9 M 413.6 186.0 Q 415.9 186.0, 417.1 184.4 Q 418.4 182.9, 418.4 179.9 Q 418.4 176.9, 417.1 175.4 Q 415.9 173.9, 413.6 173.9 Q 411.3 173.9, 410.0 175.4 Q 408.8 176.9, 408.8 179.9 Q 408.8 182.9, 410.0 184.4 Q 411.3 186.0, 413.6 186.0 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-11\" d=\"M 344.8 111.3 Q 344.8 107.7, 346.6 105.7 Q 348.4 103.7, 351.8 103.7 Q 355.1 103.7, 356.9 105.7 Q 358.7 107.7, 358.7 111.3 Q 358.7 115.0, 356.9 117.1 Q 355.1 119.2, 351.8 119.2 Q 348.4 119.2, 346.6 117.1 Q 344.8 115.0, 344.8 111.3 M 351.8 117.5 Q 354.1 117.5, 355.3 115.9 Q 356.5 114.4, 356.5 111.3 Q 356.5 108.4, 355.3 106.9 Q 354.1 105.4, 351.8 105.4 Q 349.4 105.4, 348.2 106.9 Q 347.0 108.4, 347.0 111.3 Q 347.0 114.4, 348.2 115.9 Q 349.4 117.5, 351.8 117.5 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"note\" d=\"M 479.7 51.5 Q 478.3 51.5, 477.6 50.5 Q 476.9 49.5, 476.9 47.7 Q 476.9 45.8, 477.6 44.8 Q 478.3 43.8, 479.7 43.8 Q 481.1 43.8, 481.8 44.8 Q 482.5 45.8, 482.5 47.7 Q 482.5 49.5, 481.8 50.5 Q 481.1 51.5, 479.7 51.5 M 479.7 50.7 Q 480.5 50.7, 481.0 49.9 Q 481.4 49.1, 481.4 47.7 Q 481.4 46.2, 481.0 45.4 Q 480.5 44.7, 479.7 44.7 Q 478.9 44.7, 478.5 45.4 Q 478.0 46.2, 478.0 47.7 Q 478.0 49.1, 478.5 49.9 Q 478.9 50.7, 479.7 50.7 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 550.0 130.5 L 551.6 130.5 L 551.6 124.9 L 549.8 125.4 L 549.6 124.8 L 551.9 123.8 L 552.6 123.9 L 552.6 130.5 L 554.1 130.5 L 554.1 131.4 L 550.0 131.4 L 550.0 130.5 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 362.2 169.8 Q 362.5 169.1, 363.2 168.7 Q 363.8 168.3, 364.7 168.3 Q 365.9 168.3, 366.5 168.9 Q 367.2 169.5, 367.2 170.6 Q 367.2 171.7, 366.3 172.8 Q 365.5 173.8, 363.8 175.1 L 367.3 175.1 L 367.3 175.9 L 362.2 175.9 L 362.2 175.2 Q 363.6 174.2, 364.4 173.4 Q 365.3 172.7, 365.7 172.0 Q 366.1 171.4, 366.1 170.7 Q 366.1 169.9, 365.7 169.5 Q 365.4 169.1, 364.7 169.1 Q 364.1 169.1, 363.7 169.4 Q 363.3 169.6, 363.0 170.2 L 362.2 169.8 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 472.8 230.8 Q 473.5 231.0, 473.9 231.5 Q 474.2 232.0, 474.2 232.7 Q 474.2 233.3, 473.9 233.8 Q 473.6 234.3, 473.0 234.6 Q 472.4 234.9, 471.7 234.9 Q 470.9 234.9, 470.2 234.6 Q 469.6 234.3, 469.2 233.7 L 469.8 233.1 Q 470.2 233.6, 470.6 233.8 Q 471.0 234.0, 471.7 234.0 Q 472.3 234.0, 472.8 233.7 Q 473.2 233.3, 473.2 232.7 Q 473.2 231.9, 472.7 231.6 Q 472.3 231.2, 471.4 231.2 L 470.8 231.2 L 470.8 230.5 L 471.3 230.5 Q 472.1 230.5, 472.6 230.1 Q 473.0 229.7, 473.0 229.1 Q 473.0 228.6, 472.7 228.3 Q 472.3 228.0, 471.7 228.0 Q 471.0 228.0, 470.7 228.2 Q 470.3 228.4, 470.0 229.0 L 469.2 228.6 Q 469.5 228.0, 470.1 227.6 Q 470.8 227.1, 471.7 227.1 Q 472.8 227.1, 473.4 227.7 Q 474.1 228.2, 474.1 229.1 Q 474.1 229.7, 473.8 230.1 Q 473.4 230.6, 472.8 230.8 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 514.3 164.4 L 515.2 164.4 L 515.2 165.3 L 514.3 165.3 L 514.3 167.0 L 513.3 167.0 L 513.3 165.3 L 509.4 165.3 L 509.4 164.6 L 512.7 159.5 L 514.3 159.5 L 514.3 164.4 M 510.6 164.4 L 513.3 164.4 L 513.3 160.2 L 510.6 164.4 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 582.8 233.6 Q 583.4 233.6, 584.0 233.8 Q 584.5 234.1, 584.8 234.7 Q 585.1 235.2, 585.1 235.9 Q 585.1 236.7, 584.7 237.2 Q 584.4 237.8, 583.7 238.1 Q 583.1 238.4, 582.4 238.4 Q 581.7 238.4, 581.1 238.1 Q 580.5 237.9, 580.0 237.4 L 580.7 236.7 Q 581.0 237.1, 581.5 237.3 Q 582.0 237.5, 582.5 237.5 Q 583.1 237.5, 583.6 237.1 Q 584.1 236.7, 584.1 235.9 Q 584.1 235.1, 583.6 234.7 Q 583.1 234.4, 582.4 234.4 Q 581.7 234.4, 581.0 234.6 L 580.4 234.4 L 580.8 230.7 L 584.7 230.7 L 584.5 231.6 L 581.7 231.6 L 581.4 233.8 Q 582.1 233.6, 582.8 233.6 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 539.2 65.9 Q 539.8 65.9, 540.4 66.2 Q 540.9 66.4, 541.2 67.0 Q 541.5 67.5, 541.5 68.1 Q 541.5 68.9, 541.1 69.5 Q 540.8 70.0, 540.2 70.3 Q 539.7 70.7, 538.9 70.7 Q 537.6 70.7, 536.9 69.8 Q 536.2 68.8, 536.2 67.0 Q 536.2 65.0, 537.1 64.0 Q 537.9 62.9, 539.5 62.9 Q 540.0 62.9, 540.4 63.1 Q 540.8 63.2, 541.2 63.4 L 540.8 64.1 Q 540.2 63.8, 539.5 63.8 Q 538.5 63.8, 537.9 64.5 Q 537.4 65.2, 537.3 66.6 Q 537.7 66.2, 538.2 66.1 Q 538.7 65.9, 539.2 65.9 M 538.9 69.8 Q 539.3 69.8, 539.7 69.6 Q 540.0 69.4, 540.2 69.0 Q 540.4 68.6, 540.4 68.2 Q 540.4 67.5, 540.0 67.1 Q 539.7 66.7, 539.0 66.7 Q 538.5 66.7, 538.1 66.9 Q 537.6 67.1, 537.3 67.4 Q 537.4 68.7, 537.8 69.2 Q 538.1 69.8, 538.9 69.8 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 318.8 189.6 L 314.9 189.6 L 314.9 188.7 L 319.9 188.7 L 319.9 189.5 L 316.8 196.3 L 315.8 196.3 L 318.8 189.6 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 507.7 209.7 Q 508.4 210.0, 508.8 210.5 Q 509.2 210.9, 509.2 211.6 Q 509.2 212.3, 508.9 212.8 Q 508.5 213.3, 507.9 213.6 Q 507.3 213.8, 506.6 213.8 Q 505.3 213.8, 504.6 213.2 Q 503.9 212.7, 503.9 211.6 Q 503.9 211.0, 504.2 210.6 Q 504.5 210.1, 505.2 209.7 Q 504.7 209.5, 504.4 209.1 Q 504.1 208.6, 504.1 208.0 Q 504.1 207.1, 504.8 206.6 Q 505.4 206.1, 506.5 206.1 Q 507.6 206.1, 508.3 206.6 Q 508.9 207.1, 508.9 208.0 Q 508.9 208.6, 508.6 209.0 Q 508.3 209.4, 507.7 209.7 M 506.5 206.9 Q 505.9 206.9, 505.5 207.2 Q 505.2 207.5, 505.2 208.0 Q 505.2 208.4, 505.4 208.7 Q 505.7 208.9, 506.0 209.1 Q 506.3 209.2, 507.0 209.4 Q 507.5 209.1, 507.6 208.8 Q 507.8 208.4, 507.8 208.0 Q 507.8 207.5, 507.5 207.2 Q 507.2 206.9, 506.5 206.9 M 506.6 213.0 Q 507.3 213.0, 507.7 212.6 Q 508.1 212.3, 508.1 211.6 Q 508.1 211.2, 507.9 211.0 Q 507.7 210.7, 507.3 210.6 Q 507.0 210.4, 506.4 210.2 L 505.9 210.1 Q 505.4 210.4, 505.2 210.8 Q 504.9 211.1, 504.9 211.6 Q 504.9 212.3, 505.4 212.6 Q 505.8 213.0, 506.6 213.0 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 417.2 193.4 Q 418.6 193.4, 419.2 194.3 Q 419.9 195.2, 419.9 197.0 Q 419.9 199.0, 419.1 200.0 Q 418.2 201.1, 416.6 201.1 Q 416.2 201.1, 415.8 201.0 Q 415.4 200.9, 415.0 200.6 L 415.4 199.9 Q 415.9 200.2, 416.6 200.2 Q 417.7 200.2, 418.2 199.5 Q 418.8 198.9, 418.8 197.4 Q 418.5 197.8, 418.0 198.0 Q 417.5 198.2, 417.0 198.2 Q 416.3 198.2, 415.8 197.9 Q 415.3 197.6, 415.0 197.1 Q 414.7 196.5, 414.7 195.9 Q 414.7 195.1, 415.0 194.6 Q 415.3 194.0, 415.9 193.7 Q 416.5 193.4, 417.2 193.4 M 415.7 195.9 Q 415.7 196.5, 416.1 196.9 Q 416.5 197.3, 417.2 197.3 Q 417.6 197.3, 418.1 197.1 Q 418.5 196.9, 418.8 196.6 Q 418.8 195.4, 418.4 194.8 Q 418.0 194.2, 417.2 194.2 Q 416.8 194.2, 416.5 194.5 Q 416.1 194.7, 415.9 195.0 Q 415.7 195.4, 415.7 195.9 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 428.7 92.2 L 430.4 92.2 L 430.4 86.6 L 428.5 87.2 L 428.3 86.5 L 430.6 85.5 L 431.4 85.6 L 431.4 92.2 L 432.8 92.2 L 432.8 93.1 L 428.7 93.1 L 428.7 92.2 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 436.1 93.2 Q 434.7 93.2, 434.0 92.1 Q 433.3 91.1, 433.3 89.3 Q 433.3 87.5, 434.0 86.5 Q 434.7 85.5, 436.1 85.5 Q 437.5 85.5, 438.1 86.5 Q 438.8 87.5, 438.8 89.3 Q 438.8 91.1, 438.1 92.1 Q 437.4 93.2, 436.1 93.2 M 436.1 92.3 Q 436.9 92.3, 437.3 91.6 Q 437.7 90.8, 437.7 89.3 Q 437.7 87.8, 437.3 87.1 Q 436.9 86.3, 436.1 86.3 Q 435.2 86.3, 434.8 87.1 Q 434.4 87.8, 434.4 89.3 Q 434.4 90.8, 434.8 91.6 Q 435.2 92.3, 436.1 92.3 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 343.7 96.9 L 345.3 96.9 L 345.3 91.2 L 343.5 91.8 L 343.3 91.2 L 345.6 90.1 L 346.3 90.3 L 346.3 96.9 L 347.8 96.9 L 347.8 97.7 L 343.7 97.7 L 343.7 96.9 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 348.7 96.9 L 350.3 96.9 L 350.3 91.2 L 348.5 91.8 L 348.3 91.2 L 350.6 90.1 L 351.3 90.3 L 351.3 96.9 L 352.8 96.9 L 352.8 97.7 L 348.7 97.7 L 348.7 96.9 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 431.6 141.6 L 433.3 141.6 L 433.3 136.0 L 431.4 136.5 L 431.2 135.9 L 433.5 134.9 L 434.3 135.0 L 434.3 141.6 L 435.8 141.6 L 435.8 142.5 L 431.6 142.5 L 431.6 141.6 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 436.2 136.3 Q 436.5 135.6, 437.2 135.2 Q 437.8 134.8, 438.7 134.8 Q 439.9 134.8, 440.5 135.4 Q 441.2 136.1, 441.2 137.2 Q 441.2 138.3, 440.3 139.3 Q 439.5 140.4, 437.8 141.6 L 441.3 141.6 L 441.3 142.5 L 436.2 142.5 L 436.2 141.7 Q 437.6 140.7, 438.4 140.0 Q 439.3 139.3, 439.7 138.6 Q 440.1 137.9, 440.1 137.2 Q 440.1 136.5, 439.7 136.1 Q 439.4 135.7, 438.7 135.7 Q 438.1 135.7, 437.7 135.9 Q 437.3 136.2, 437.0 136.7 L 436.2 136.3 \" fill=\"#000000\"/>\n", | |
"</svg>" | |
], | |
"text/plain": [ | |
"<IPython.core.display.SVG object>" | |
] | |
}, | |
"execution_count": 3, | |
"metadata": {}, | |
"output_type": "execute_result" | |
} | |
], | |
"source": [ | |
"mol = dm.to_mol(\"CC(=O)OC1=CC=CC=C1C(=O)O\")\n", | |
"mol2 = dm.randomize_atoms(mol)\n", | |
"dm.to_image([mol, mol2], indices=True)" | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"execution_count": 4, | |
"id": "bc56a6d0-c4e2-4260-955f-9d171790c6a8", | |
"metadata": {}, | |
"outputs": [ | |
{ | |
"data": { | |
"text/plain": [ | |
"'ef3ab3a6ad681393e4a948a5014b5264'" | |
] | |
}, | |
"execution_count": 4, | |
"metadata": {}, | |
"output_type": "execute_result" | |
} | |
], | |
"source": [ | |
"# Copy a molecule\n", | |
"mol = dm.to_mol(\"CC(=O)OC1=CC=CC=C1C(=O)O\")\n", | |
"copied_mol = dm.copy_mol(mol)\n", | |
"\n", | |
"# Check two mols are the same\n", | |
"assert dm.same_mol(mol, copied_mol) == True\n", | |
"\n", | |
"# Generate a unique id for your molecule\n", | |
"dm.unique_id(mol)" | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"execution_count": 5, | |
"id": "1cbb8db9-c8ff-49b8-be71-8cc3d683f7eb", | |
"metadata": {}, | |
"outputs": [ | |
{ | |
"data": { | |
"image/png": "iVBORw0KGgoAAAANSUhEUgAAAcIAAACWCAIAAADCEh9HAAAABmJLR0QA/wD/AP+gvaeTAAAgAElEQVR4nO3deVwT19oH8CcJoCxBNtlUkEWhIAiCgBK3VutSpNcFtVZsvVaqVwmorXq13mitFT9VG9S3FreKltqqYA1Wa9GKBVQKQWQXLVaRRZFNkT3M+8ehYySAKEkmhOf7x/2Uk0nmSW/5cebMmXNYFEUBQgih18VmugCEEOrZMEYRQqhbMEYRQqhbMEYRQqhbMEYRQqhbMEYRUiKKgrt3IS8PGhuZLgXJDcYoQsoiEoG1Nfj6gp8f9O8PYWGA0w3VggbTBSDUO2RkwNy5cOQIzJ0LACAWw9Sp0L8/LF7MdGWou1g4/R4hZeDz4cEDiIl53vLVV/DjjyAWM1cTkg+8qEdIKfLywMvrhRZvb8jLw+t6NYAxipBSPHsGOjovtOjqQkMDNDczVBCSG4xRhJTCxgbu3n2hpaAABg0CTU2GCkJygzGKkFJMmgQ//ADV1a0/trTAt9/C5MmM1oTkA28xIaQULS3wr3/BrVvw0UegpwcnTkBJCSQkQP/+TFeGugtjFCFlaWmBn3+GK1egqQmGD4fAwLajpahnwhhFSCl++QVqa+Gdd55H56lTUFEBs2eDkRGjlaHuwhhFSCmsreH+fbh3D6ysWltcXSEzEzIywMWF0cpQd+EtJoSUgsUCgBdmicq2oJ4JYxQhpWCzAQBaWjprQT0TxihCSoG9UfWFMYqQUmCMqi+MUYSUAmNUfWGMIqQUGKPqC2NUPZWWwsWLL6ywfukSPHvGXEEIbzGpL4xR9fT77zBpEuzY8bxlyhQoLGSuIIS9UfWFMaq2bG1hxw4oKGC6DkRgjKovjFG1NWAABAXBihVM14EIjFH1hTGqzjZsgIwMOHmS6ToQYIyqM4xRNVFQAEePQkgI8Hiwbl1rI5cLu3bBypVQU8NocQiAx+UaGRjkSN1QGsNmswAS8RZTz4c7g/ZUZWVw/TokJ8P165CSAk+ePH9JQwNcXVv/ec4cOHgQwsIYqRE997S2trKqqlmq78lisQAA1wZSAxijPUZjY+PNm/euXRtCorPNvaPBg8HHB7y9wdsbRoyA6OjnL+3dC97eOK+GYbKhiTGqNjBGVVpxcbFYLE5KSkpMTExLS+vb17Kq6g75vdPVBTc38PAADw8YNw6srTv8kKFDYfly2LpVaVWjdsiGJpvNBoAW/PvW82GMqpaamprU1NTr169fv349OTm5tLSUfonNZtva9l2woM7FRdvbG5ydgcPp8HN4PLCweP7jhg0wfDgYGiqydNQp7I2qMYxRVfHf//73/PnzWVlZEomEbjQxMfHx8fH29vbx8fHy8tLX1+/ip1lZPV8dGAC0taG2Flxc4Mcf4c035Vs46hLZvifGqNrAGFUJ4eHhMTEx+fn5GhoaTk5OPB7P19fXw8PDycmJ/LK9lEQCubkwbFiHBxQXQ1kZBAdDejru6csA7I2qMYxRlfDdd9/l5+cfPnz4vffe69u3bxffVVoKKSkgFoNYDImJUFUFJSVgbt7+watXw5EjkJMD334LwcFyqxx1EY6NqjGMUZVQXFwMAFOnTu08Q+vr69PS0lJSRl69qnn9Oty//8Kr9vZQXNxhjGppwVdfwbvvgkAA770HJiZyKx51BfZG1RjGKPOamprKy8s5HE7/9rYsl75ZLxaL6+vrXV2rMzI0AYDLBVdX8PAAHg/GjQNT05ecyN8fpk6F8+dh40bYt08RXwV1CMdG1RjGKPNKSkpaWloGDBjAkbr1fuDAAZFIlJycXFZWRjdyOBxXV9d33/07NNTV2xscHVvXWuu6Xbvg4kXYvx8WLwZPT3l9A/RyeFGvxjBGmVdSUgIAFtITlACSkpLOnj0LAObm5p6enh4eHh4eHjwez/BVZi01NcE330B8PJw+3dri6AjBwbBrF4SGQkICdO32FZIDOkZv3LhhYGBgYGCAvVG1gfvUM+/06dMzZ8709/c/c+YM3ZiUlFRYWDhq1CjrTibWv0xlJTg4QFkZnDoFs2a1Nj59Cg4OUFICx4/DvHndrB11VVRUVHZ2dn5+fnR09LBhw4qKiqZNm+bk5DR37lw7Ozumq0PdgkuTMI/cX7K0tJRu9PX1nTdvXncyFAAMDWHLFgCAlSuhtra1kcttbfz0U1wPX0lqa2vz8/OFQmF0dLSurq5EIqmsrIyKioqKirpz5w7T1aHuwhhlXrsX9fKyZAl4ekJh4Qsr4S9aBF5e8OABbN+uiHOiF8TGxjo7O3/++ef19fUBAQE5OTk5OTlxcXFOTk45OTlTpkyZNGlSVlYW02WibqAQ0/79738DwP79+xX0+UlJFItFaWtTd+++0KijUztx4ucFBQUKOi/Kycl5++23yS/aiBEjEhISpF9tbGwUCoUGBgYAoKGhERQU9OjRI6ZKRd2BMcq8KVOmAMDZs2cVd4p58ygAas6cFxo//jgEAGbOnKm48/ZaFRUVfD6fTL0wMjISCoXNzc3tHlleXs7n8zU0NADA0NAwLCysoaFBydWibsIYZZ6rqysAiMVixZ2isJDS1aUAqMuXnzeWlpaSh/R//fVXxZ26t5FIJJGRkWQKMOljPn78+KXvys3NnTZtGum3Ojg4xMbGKqFUJC8Yo8wjv3IlJSUKPcuWLZSBQcW8eV9Kd4u2bdsGAE5OTo2NjQo9ey8RHx/v+s+K2W+++WZmZuYrvT0uLs7Z2Zm8feLEia/6dsQUjFGGNTY2stlsDQ2Nji765KWujnJ3HwkA33zzDd3Y0NAwdOhQAAgPD1fo2dXegwcPAgMDyVTQQYMGRUZGdn78tm3bdu3aJfvXq7GxMSIiwsTEBAdMexCMUYbdu3cPAAYMGEC3NDY2nj179ubNm3I/V0xMDBmqKysroxtFIhEZlcNf19dTW1sbFhamp6cHADo6OgKBoK6urvO3FBcXk8UThg4dKhKJZA/AAdOeBWOUYdeuXQOAkSNH0i0FBQWkR6OI002ePBkAli9fLt04depUAPj4448VcUb1JhKJbGxsyGW4n5/f33//3cU3xsXFubi40Jf/7f7VlB4wHTp06IkTJ+RaO5IbjFGGRUdHA4C/vz/dkpSUBADe3t6KOF1OTo6mpiaHw0lPT6cbb9++3adPHzabnZKSooiTqqXc3FzyNwkA3N3d//jjj1f9hKampoiICDIyzmazAwMDS0tLZQ9rM2CakZEhj/KRPGGMMmzv3r0AsHTpUrrl5MmTADBjxgwFnTEkJAQAeDxeS0sL3bh69WoAGD16tHQjaheZzESuuDuazFRVVdXFf5MVFRVr167V0tICAD09PYFAUF9f3+YYHDBVcRijDNuwYQMAbN68mW4JDw+Xve6Wo+rqanNzcwCQvkh88uQJeYzqhx9+UNB51YDsZCbpUWbpY0xNTb/77ruuf/KtW7cCAgJIl9Pe3r7d63ccMFVZGKMMW7RoEQAcOHCAblm3bh0AfPHFF4o7aUREBBmSk248dOgQAJiZmYWGhkZFReXn52PPVFp8fPzw4cNJ0k2YMKHdi+uEhAR3d3dyzLx58171FOfPn3/jjTfI1NGOpqDl5eW98847OGCqUjBGGSb7CNMHH3wAAIcOHVLcSSUSSURERJuLx127dpHrSvpBYX19fV9fXz6fHxkZmZWVpbh6VFxJScncuXPJvxMbG5vo6GjZY4qKiugJTwMHDoyMjHy9P0JNTU179uy5cOFC54fFxsY6ODjQt7bwDx6zMEYZRmZrp6Wl0S2TJk0CgPPnzyuzjJ9++onNZrNYrE8//XTLli3+/v6yS6VYWFj4+/tv2bLl119/LS8vV2Z5zDpz5oyurm5Hk5kaGhqEQiGXywUAbW3ttWvXPn36VAlVkQFTAwMDT0/Pn3/+WQlnRB3BGGUYuW8gfYuW3JZVxLzRjsTHx/fp0wcAduzYId1eVFQkEokEAoGfn5+JzOZNFhYWfn5+AoFAJBJVVFQorVrlI2sYtjuNQSQS2dra0r3Cu9KrvyjF9u3bFTqSjroCV79nUmNjY3l5uYaGhnRIkeVHFbRunqzs7OwZM2Y0NDT85z//IffraZaWlpaWltOnT6cLE4vFZGOoq1evlpSUnD17lizRz+FwHBwcPP7h6enZ9f1NVR+5VG/z/8i9e/eWLFkSFxcHAK6uruHh4ePHj1d+bWQQhsLF1xmFMcok8hy9mZkZvQtTfX19VVWVlpaWbO9PEYqKiqZOnVpZWTlnzpw9e/Z0frB0qkokkry8PPE/UlNTyTKax44dAwANDY2hQ4fSG5+4u7uzX3XTKFXS7m4fXC43LS3N0NBQIBAsX76c3EBXPtzQSRVgjDKJLNgsve59cXExRVEWFhYsxW+TVF1dPW3atMLCwnHjxh09evSVko7D4Tg7Ozs7Oy9cuBAA6uvr09PTU/6Rn58vnapcLtfb2/vChQs9NEzbjSojI6OTJ0+6uroaGxszVBcAbi+qGjBGmSS7fQibzZ49e/Yr7Vv3eurr66dPn56RkeHs7Hz69GkyNgoAFEWR38ydO3eePXt25MiRXl5eI0eO7Hw7k759+/r4+Pj4+JAfnz59evPmTbqvmpubm5GR4eXlde3aNU1NTUV/NbnrKKomTJig5Er27NkjEAiCg4M3b97ceW1ImTBGmSQ7DDp48GDyFJNCtbS0BAYGJiQkDBgw4Ny5c9KpvWrVqpaWlq+//vry5cvx8fHx8fGkvV+/fsOGDePxeL6+vl5eXmZmZp18PpfL5fF4PB6P/Pjo0SNfX1+xWPz777/TD1D2IKoTVQ0NDZWVlbX0vlqqVFtv1iMvstSGQndh6sSqVatOnTrVr1+/c+fOWVlZ0e07d+4UCoURERE5OTmHDh2KjY393//+N3XqVBMTk+rq6qSkpO3bt/v7+5ubmw8ePHj27Nm5ubldOZ2pqemCBQsA4NSpU4r6SoqkOlElW4nq1NabYYwyicSoqalpF48vLS2V7om8nrCwsPDwcC0trejoaHqNYQD48ccf16xZw2KxDh48OGzYMDMzMz8/v82bN587d66srEx68pORkdG9e/eio6PJk+BdQaavnz59urm5uZv1K5/q3MaRDU3Vqa03wxhl0pgxY6ysrNavX79u3bqioqKXHr9y5UpLS8uQkJD79++/3hmPHz++fv16NpsdFRX11ltv0e3x8fEffvhhS0vLzp07Sc+xDXKPftOmTbGxsWVlZdnZ2UePHqWnTL6Uo6Ojk5NTeXk5PUrQg6hOjw97o6oJY5RJCxYsMDc3r6ys3L59u52d3aJFi27evNnRwRKJpLi4uLq6evfu3fb29vPnz09JSXml012+fHnRokUURe3atWv27Nl0e1ZWFpk6+sknn6xcufKln8Nms52cnOhnH7uInFEJI79ypzpRJdv3VJ3aejOMUSZpamomJyenpqYGBgZKJJIjR464ubnxeLyTJ09KJJI2B3M4nCtXrojF4sDAQAA4fvy4l5eXp6fn0aNHu3KlnJmZSbJy7dq1ZK084sGDB9OmTauqqpo3b952+e1b/+jRo/Dw8G+//ZZuITEaExPT467rVSeqsDeqopT4xBTqTEFBwdq1a+mb5ra2tmFhYZWVle0eXFJSIhAI6BmLFhYWAoGgk+fcCwoKyOJ47733nvQyFuXl5WRJofHjx8suc9kdZPHpQYMGSZ+OnOvSpUtyPJESkEVA8vLymC6E2r17NwAEBwfTLUePHgWAwMBABqtCGKOq5cmTJxEREY6OjiQf9fX1+Xx+R09q19TU7Nu3j17pR09PT3rBPdrjx4/JB06YMEE6K2tra8mcpGHDhnWU16+tpaWFzAH4888/6cbPPvsMAJYtWybfcykaSf+cnBymC6HIk2YrVqygW8gDDgsWLGCwKoQX9aqFy+UGBQVlZ2eLRKKJEyc+efJk9+7ddnZ206dPv3jxYpuDdXV1ly5dmpubGxcX5+fn9+zZMzs7uzbH1NXVvfvuu3l5eS4uLjExMdLT7N9///3ExEQrK6sLFy4YGBjI94uwWKwZM2bAi5Oc6Ot62SELVSZ74bxv375169aR7QiVCcdGVRTDMY46dePGjaCgIHqZjxEjRkRGRna0oG9ubm6blubm5pkzZwKAjY0NecxU2uHDh01MTBS3t09CQgI5tfR1Pek7X758WUEnVQSy5pb0iqujR48GgKSkJCVX8s0338CL3fmoqCgAmD9/vpIrQdKwN6rS3NzcIiIi/v77b4FA0L9//7S0tA8++MDKymrTpk3l5eVtDqaHAmihoaExMTHGxsbnzp2TneS/aNGiv/76i96fUu5Gjx5taWl59+7dtLQ0upHEes+ah686szXxFpNqwhjtAczMzDZt2lRYWBgZGeni4lJaWrp58+YBAwYsXLgwOzu7o3d9/vnne/fu1dbWPnPmjGzCEvr6+gqrGthstmxokuv66OjoHnRdrzqX0osWLaqoqNi5c2cntSHlwxjtMfr06bNw4cKMjIyEhISAgIDm5uZjx465uLhMmjQpNja2za/0999/v2nTJg6H8/333/v6+jJVMwnNEydO0C0jRoywt7cvLS29evUqU1W9KtXpA/bp08fQ0FBHR4fxSpA0jNGeh8fjnThxIi8vj8/n6+joXLx40d/f38HBITw8nDwqeu7cOTLNXigUkv4gU8aMGWNhYVFQUJCenk43zpo1C3rUdb3qxKgs1amkN8MY7ans7e3Dw8Pv378fFhY2cODA27dvh4aGWltbL168eM6cOc3NzRs3blyxYgWzRbLZ7I7u1588ebKnXIqqztioLIxRVYAx2rMZGRmtXbv23r17IpHI19f38ePH3333XUNDw8KFC+klKZkl+wyop6ennZ1dSUnJtWvXmKvrFahyb1R1Ar03wxhVB2w2e/r06YmJiVevXh04cCCZ56SE9fO7YuzYsaampg0NDY8ePaIbe9b9etW5xSRLdSrpzTBG1cqoUaOWLl0KAKdPn2a6llYcDiclJeXu3bvS6wGSLuqpU6d6xO+/KvdGVaeS3gxjVN0EBAQAwJkzZxobG5mupZWVlVWbrjHZleTBgwfXr19nqqquw7FR1DmMUXUzZMiQ4cOHV1VVyT48qjpYLFYPul+PvVHUOYxRNURfMjNdSGfoW0+qHwGyfc/Fixdv27ZNei9C5cjMzGzz2ILq9It7M4xRNTRnzhwAOH36tOpc18vy8fGxsrIqLCx81cWnlU+2xxcQEDBo0KAJEyaEh4cr53GsioqKkJAQd3f3AwcOdF4bUj6MUTU0dOhQFxeXqqqqy5cvM11Lh1gsVk+5X99uVMXGxpaXl4eGho4cOfLKlSuKO3tzczPZ72D37t0cDqfNWgoYo6oAY1Q99YgdO3rKdX27UfXjjz+KRCIbG5sbN26MHz9++vTpf/31l9xPffny5REjRoSEhFRWVr711ltpaWkbNmx4aW1I2RS8ghRiRl5eHgAYGxs3NTUxXUuHWlpaBg0aBAApKSlM19KhO3fumJmZAcDq1aubm5vbvNrQ0CAUCskKL5qamnw+v6qqSi7nLSwsJLvFAIC9vf2JEyfaPWbKlCmmpqbSCzkj5cMYVVtOTk4A8NtvvzFdSGeCg4MBYO3atUwX0o6nT5+uW7eOLHRN/tfFxSUuLk72yKKiog8//JDc7Zk2beWBA5RE8vrnffaM2riRmjhRBAB6enphYWGy+7s8e/ZMIBBoa2sDgIGBgbyyG70ejFG1JRAIACAoKKhNe0ZGRl1dHSMlySKjijY2NkwX8oKWlpYTJ06QTVBYLFZgYGBkZCS9s8DEiROll3CmpaSkTJo01cTkIQDl5ka9xsrULS3U8ePUoEEUAKWv37JkyeqioiLZw0Qi0eDBg0kxfn5+f//996t/RSRPGKNqKzMzEwBMTEykr+vJcOTPP//MYGHSJBKJkZERh8P55JNPOtmST5nEYjHZogoAPD09r169StobGxuFQmG/fv3I9XtQUFBZWZns20UiytaWAqAAKD8/6s6drp73xg1q7NjWN44YQSUktHNMbm7u5MmTSW3u7u4J7R6ElA5jVJ2RvdguXrxIt4SFhYEq7YB2/PhxNputp6dHLpwDAwPb7egpx+PHj/l8PofDAQALC4uIiAiJzMW59DFGRkZCoVB29LmhgRIKKX19CoDS1KT4fKrza+7ycorPpzgcCoAyNqaEQkpmDJaqqKjg8/kaGhr0eWUHahFTMEbVGdmJc+nSpXRLQUEBi8XicrmqcF1/+fJlMuYYHBwcEBBAsonFYk2cOFEkEknv4KRoTU1N0j1NPp9fXV3dyfE5OTlTpkwhvUJHR8dffvlF9pjiYmrRIorNpgAoMzPqn05tW8nJlKFha+CuWtVO4EokksjIyP79+wOAhoZGR71gxCCMUXVGFkvu37+/dI9pxIgRACASiRgsjKKozMxMsh3p6tWrScvt27f5fL6uri6Jp6FDhwqFwmfPnim6kkuXLg0bNowe98zOzu7iG2NiYugB06Cg/9261c4xYjE1dizVvz/V0Q7WdXWUjQ311ltUu73wy5epuXO/f43akDJhjKo5sguT9E6cX375JQAsXLiQuaKowsJCMtVp7ty5bS6cq6qqhEIhub0DAP369ePz+ffv31dEGffv36cnFQ0ZMoTsxfJKyICpoaHhG2+kampSQUFUuz3FgoLOPqS0tJ3GBw+owECKxaJMTCQuLrzTp0+/am1IaTBG1dz69esBYPny5XQLmSVuYGDQ0NDASElVVVVkO9Lx48fLTuUhJBKJSCQi+xgDgJaWVkBAwLVr1+RVA5kwRHau1tXVFQgEHVXSFQ8f1gQFtQ5umphQ//d/VHdm69bWUmFhlJ4eBUDp6FACAaUCAzCoMxijao5sbmxubi59R2L48OEA0O6InqLV1dWR++DDhg2r7OhCV0pqampgYCC5tQIAHh4ekZGR3XymQCQSWVtb05OZSkpKuvNptJwcaurU1lvtDg7U2bOvVxtlY/P8Rj/OZeoRMEbVn729PQBcuXKFbvniiy8A4MMPP1RyJRKJhKyPN2DAgDbX6U1NTSkpKTU1Ne2+sbi4WCAQGBkZkTC1sbEJCwurqKh41QLS0tLGjBlDJ3JSUtJrfpOOxcVRTk6tOThxYvsjnu3KzaUmT259o5sb9ccfci8NKQrGqPpbt24duRtOt9y6dYuR63o+n0+GO2/evCndHhYWNm7cODMzM319fT6ff+/evXbf/vTp04iICDKLCwC4XG5QUFBeXl5XTl1eXk5PVDI2NhYKhbKTmeSlsZESCql+/Vrvv9MDpunplFj8/LCHD6nr1ymKoioqKD6f0tCgACgjo/YnPCFVhjGq/lJTU8l1vXRwkNHJ8+fPK62MrVu3AkDfvn3bTBr//vvvWSwWm80mT6+SKUfz5s1LTk5u93MkEklcXJyfnx9ZlYPNZvv5+bX7jCbR1NQUERFhYmIi98feO/fwIUUPmBobU8eOUf7+lJYWlZvbesDJk5SbGxUdTRkbUwCUhgYVHEy9eg8bMQ9jtFcg83ISExPpFrJv6OLFi5VTQFRUFMlKsv8S7ffffydTR7/++muKosRicWBgoKamZldGQtPT04OCgshz5QDg5uYWERHRZj7spUuXyB+MTh7iVCh6wPTIEcrfn3JwoN56iyIzYkmMXr1KsVjUhAlURoaSS0NygzHaK3z66acAEBISQrfk5+eHhYXd6fqzit1w6dIlLS0tAAgPD5duz8jIIFNH16xZI91eUlIiEAiMjY1J/FlYWAgEgo4eFX348GFYWNiAAQPIwWZmZgKBoKysTHoyU0crJCnNb79REgnl70/t2kXZ21PHjlHUPzFKUVQH3W7UY2CM9grJycnkxo4yHw0iUlNTybOe69evl24vLCwcOHAgAMybN6/dYcpnz57t27ePzHsFAD09vU4eIa+vrz98+DCZgUCeKyXBzeVyt2/fztTUrjb8/am9e6nYWMrMjKqoeB6jqKfDGO0tbG1tAeBqR88kticmJiY6Oro7U98LCgrMzc0BYP78+dIJ/vjxY5KPEyZMeOmEzYSEBD8/PyMjo47u47c5OCAgQFNT08jIaNasWQqat/96SIySf/jPfzBG1QfGaG+xevVqAFi1alXX3+Lu7k46dwYGBhMnThQIBCKR6OHDh118e1lZmYODAwC8+eab0v3B2tpaX19fAHBxcenK1FGi6+s/PX36FAC0tbW7eLzS0DF69y7F5VICAcaomsAY7S2uXbsGAIMGDer6df3mzZsnT55Mz9ak2djYzJkz56uvvoqPj29sbGz3vbW1teQZJFdXV+k7483NzWQLpoEDBxYWFsrhi8kg07ns7OwU8eHdQccoRVFbt1J6ehijagJjtLdoaWkhD6rv27fvyZMnr/TeoqIikUgkEAj8/PwMDQ3pPGWz2e1+VHNz87/+9S8SuG2eEQoJCSEzN3PpiT/yFh8fDwA8Hk9Bn//apGO0oYFydMQYVRMYo73I1q1bR40aRRLQ1tY2MDBQKBQmJCTU1tZ2/UOam5szMjIOHTq0bNmyOXPmtHvM8uXLSVbKzo3/888/rays5Lje8OHDh728vCIiIuiWH374AQA6qo1BiYnU7dvPf8zNpVR7hxfUVRijvcv+/fs9PT3piZmElpaWp6fnsmXLDh8+nJmZ2c31gMnmJdra2h09ainf++Zr1qwBgK1bt9ItO3bsAIDQ0FA5ngWhTmgA6k2WLFmyZMmS5ubmW7duicVisViclJR048aN1NTU1NTUffv2AYCurq6bm5vHP5ycnMjzQl1x8ODBzZs3czicqKgoen2mNshUJHkpKSkBAEtLyzYtFhYWcjwLQp3AGO2NNDQ0nJ2dnZ2dFy5cCAA1NTXp6enif+Tm5iYlJSUlJZGD9fX1XVxcSKSOGTPGxsamo4/95Zdfli1bBgDh4eEzZsxQzncpLi4GjFHEKIxRBHp6ejwej97Hrbq6OjMzk3RUExISSktLpVPVwsKC7qiOGjWKPKsOACkpKXPnzm1ubhYIBGRsVDlkY1S2Bb5czWgAAAZLSURBVCGFYlEUxXQNSKXdv38/5R9isbi6upp+icViDRkyZOTIkTY2NhEREWVlZR999NGBAweUWZ6BgUF1dfXjx4/ph0cdHBzy8/Ozs7PptU4QUiiMUfRqiouLk5KSEhMTxWLxjRs3amtrSTsZUY2Pj6eXWKYo6qeffrK1tfXy8lJQMbW1tbq6un369Kmrq6MHcPX19Z8+fVpZWUke2EdI0TBG0etramrKyspKSUk5ePBgSkrKyJEjk5OT6Tjbv3//xx9/7OnpmZyczGazFVHAnTt3hgwZMnjw4Lt375KWmpoaLperra1N5ztCiqaQ/7hRL6Gpqenu7h4UFBQfH29lZZWSknL06FH61cDAQGtr69TU1MOHDyuoANnb9DgwipQPYxTJgY6ODlmVee3atfTgqba29vbt2wFgw4YNVVVVijgv3l9CqgBjFMnH+++/P2bMmIcPH5I8JebOnTt+/PhHjx59/vnnijgpznZCqgBjFMkHi8UKDw/ncDjh4eFkcRBi7969Ghoae/bsycrKkvtJZUMTe6NI+TBGkdy4u7svWrSosbGRbF1HODs7k+emQkND5X7GjRs3ZmVlkYcICOyNIuXDGEXytHXrVgMDg99+++3cuXN045YtW4yMjBITE8+fz5Pv6bhcrrOzM46NImZhjCJ5MjU1JUuThISENDQ0kEZjY+MdO46Zm2cFBzvW1yu2AOyNIuXDGEVytmLFChcXlzt37uzevZtuXLhwWr9+9n/9Bbt2Kfbs2BtFyofT75H8xcXFvf3225aWA8XiAnPz1kX5EhNh7FjQ1obcXLCyUtSpuVxuTU0NPsKElAl7o0j+Jk2atGLFnqam1HXrni9syuPBrFlQWwvr1yvqvDU1NTU1NTo6OpihSJmwN4oUoqAAnJ2hoQGuXgUfn9bGwkJ44w2orYX4eBg7Vv4nvXXrlqOjo52d3Z07d+T/6Qh1AHujSCFsbWH1aqAoWLECWlpaGwcNgk8+AYqC0FCQSOR/UtlnQxFSAoxRpCjr14OVFYjFEBn5vHHNGrC2hhs34MiRbn343bt3jx8/vnPnTulGvL+EGIHLNiNF0dGBbdvg/fdh3TqYORP69Wtt3LkTrlyBmTNf7dPoJfqTkpL++OOPhw8fAkCfPn1WrFjRp08fcgyJUZzthJQMYxQp0HvvQUQE/PEHfPEFfPVVa+OsWTBr1svf29ICOTmQnAxisSQxcUROTrZEaiDA1NTU29vb29u7sbGRjlGcNIoYgTGKFIjFAqEQRo6E8HD46CNwcHjJ8dXVkJICiYkgFsPVq1BRQZo5gwebsVg5Tk5OPB7P19e3o432cGwUMQJjFCmWuzssXgz790NwMPz2W2dHenlBSsoLLdbWMGoUeHvD6NH7hw+3oHudHcGxUcQIjFGkcNu2QXQ0xMXB2bPg59fhYf37g64uuLmBhwd4eMC4cWBtTb84uPNT1NXVicXivLw8wIt6pHQ4bxQpQ3g4hIaCnR1kZ0NHfcrHj8HQEDicrn6m9K5QqampDQ0NLBZrzZo1n332mZ6enrwqR+ilsDeKlGH5cjh6FCZPfj6HVNY/WzV3qKqqKllKeXk5/ZKGhoabm5uPj09wcDBmKFIy7I0iJZFIQCQCXV14++3WlqwsKCyEqVM7fEtzM2Rnw7VrkJwMDx9u+PXXbdL/uVpaWnp7e/v4+Hh7e3t6eurq6ir4GyDUPuyNIiXhcODLLyEzE9LTwdERAOD33+HChbYxWlICqakgFoNYDImJQO/hNG6cj4aGhqurK7lT7+Hh4ezsrOzvgFB7MEaRUo0YAcHBEBf3vKW+HsRiSE6G5GS4fh3u33/h+CFDwNsbvL1h1Khxrq7PNDU1ASEVgzGKlCokBDZuhB9+gPnzW1uiouCjj54fwOWCqyt4eACPB+PGgakp/Yq+citFqKswRpFSaWnBjh0QFATTprW2+PjA8OHg49Pa63R0BDau9IB6FIxRpGz+/nDgAGzcCEOGAAA4O0N6OtM1IdQN+HcfMWD3boiMhNxcputASB4wRhEDbGxgzRo4dIjpOhCSB4xRxIw1a8DWlukiEJIHnH6PlCc3FywsgN4nqbgYamvB3p7RmhDqNoxRhBDqFryoRwihbsEYRQihbsEYRQihbsEYRQihbsEYRQihbvl/cI6lNOGx6awAAAF/elRYdHJka2l0UEtMIHJka2l0IDIwMjIuMDMuMgAAeJx7v2/tPQYg4GWAAEYgFgZiMSBuYORg0AAJMrE5gGkWNocMEM3MCGewQ2SYsahAEyBeJfFauBkYOZgYmTx4mJg9eJhZPHhYWD14WNmAmJ2BncODh4PTg4eTy4OHi9uDh5vHg4eH14OHl8+Dh4/fg4dfwINHQNCDR1DIg4eN0YNHiB2IgWoFgOpEWNgY2VhZmJlYOdiFuDjZuIEqhbhYeXkE+PnE30GDCQyEI7ZHObgH+TmAODl60Q6KS+/Yg9iT3aY7hD+vArPlmqY7NImz7gexp8jEOGyPXAxm39rL4dAcwAFmH3XjcAhbVw5WfyYi3N7i2xKwOD+/of0SBqMDIPZsDbf9m7LcwGyXR4f3i7E9B6uZ8MH+wCPmA2C2Ak/cAS3r2XvB5nyfdeCaCDvYzCl60w7s9WIEu9Ou3+/A6S2iYLaThtwBz1mtYDUrAhv2axvYgtn8phz7TQr0wWaKAQDu/FnwOvDgPQAAAfJ6VFh0TU9MIHJka2l0IDIwMjIuMDMuMgAAeJx9VFuO2zAM/PcpdAEbfEkkPzfJYlEU6wBt2jv0f++Pknaz0gJC7ZCQ5JFIDkdZSj4/bt//fJTPh27LUgr85+fu5TcDwPJeclAur2/f9nJ9vFyeK9f7r/3xs6AXotgT71fsy+P+/lzBci+8CaoIxICIVWPTBsfTd1K5Jo5EwQpuGjjzCY4DJ/FZudX47Abgs/PkxLE05rLCVtHNYQKsZc/A7CRSVtxIG2qdAFucSBtGXLPjRI5kbQLUE0jOlAG9aQWZ4CxwsJkgBuUZ2UzbDOgHsDk2bmWlTQ1pSg5CFBOpqQpULStvCEBtxg9iHBpBKwML58hATHkGzd5E2FAGVDs2AUTSM2i2J8JKcwm2IxXQqt5m0OzQKlE/qSSNNZifp1pPZHNGa0EtEKDpDNmy/lSZinMgmYO0WddRz5pEkUBDcCAhTJwh7SQqiJRDacoOOK0o+3QKA9pRfLOgdwZ93W9fbsl5by73/dbvDaX16yFh3G+BpHWx51u7pGNSWheuhGmXJ8bUugolzLvWJAxHSUk6xEE5kg5pEIikQx50IOlQhnZLOqxDW3MaTRvaJ+lQhzZJOrShHZIOfaBdoqhO1ZGx9woJz4VeAtG/Y3lsyEh/zp9/eTFe/gLUp/uoSHD68QAAAPl6VFh0U01JTEVTIHJka2l0IDIwMjIuMDMuMgAAeJwdkMmNRDEIRFOZY7eELTaD0VfHMEH4PhF08FPm4uWpCgp+P0fO+TuvcRSXneP3i0PtfeTn+7Lpku5kU9Uy6QFQTyGZCVD0OB5pSTxrM5c2MQ+jwXNJ7WqTlToNmZohmx6dYrGqNYaCQDy3i1S1au+Mi6IkLGjozC2KUjBkOq+kYVOYFTIYlrF1/c2+EROGquK4aDELYkHvUd49OVdWOKCjq+ZC/IVooY2iTIp0srJUO1XTLzFDoC6PJehdA3vvBX0QBhrks+IW9Ww3A+bYSBg9t5bp3VbkYqf39x8bllDFskDa6gAAAABJRU5ErkJggg==\n", | |
"text/plain": [ | |
"<rdkit.Chem.rdchem.Mol at 0x7f35cda6fd60>" | |
] | |
}, | |
"execution_count": 5, | |
"metadata": {}, | |
"output_type": "execute_result" | |
} | |
], | |
"source": [ | |
"mol = dm.to_mol(\"O=c1ccnc(c1)-c1cnc2cc3ccnc3cc12\", sanitize=False)\n", | |
"mol" | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"execution_count": 6, | |
"id": "5e13bf67-117f-4d63-81ea-0257e06fb85b", | |
"metadata": {}, | |
"outputs": [ | |
{ | |
"name": "stdout", | |
"output_type": "stream", | |
"text": [ | |
"O=c1cc[nH]c(C2=CN=c3cc4c(cc32)=NC=C4)c1\n" | |
] | |
}, | |
{ | |
"data": { | |
"image/png": "iVBORw0KGgoAAAANSUhEUgAAAcIAAACWCAIAAADCEh9HAAAABmJLR0QA/wD/AP+gvaeTAAAgAElEQVR4nO3deVyU1f4H8O8M27Avyu4SioKogXLNEm+aktpt0q4GGDSWmmOY4S5lGWVWpJjj7oSUY0o6lNdIvRbcrprrzwVFQQzEhdgGWYZtBhjm/P443HEcEBBmnmcGv+9Xr15ynpl5vvLCD+d5znnO4RBCACGEUFdx2S4AIYRMG8YoQgh1C8YoQgh1C8YoQgh1C8YoQgh1C8Yo6pbmZrh0CW7ffqixsBCyslgqCCHGYYyibqmthb/9Df72N5DJHjRu2QLTp7NXE0LMwhhFeqBQwIoVbBeBEEswRpEeLFoE338Px4+zXQdCbMAYRXoQEgLh4TB/PjQ0sF0KQozDGEX6sX49FBXBunVs14EQ4zBGkX707QsffwxffPHQqH1dHXsFIcQUjFGkN4sXw8CBD401PfMMDB0Kn3wCt26xVxZCBoYxivTGwgK2bYODB+HUKQCAwkIoKIDsbPj0Uxg0CMaOhc2boaiI7SoR0jeMUaRP48ZBVBScPg0A4O0NMhmkpoJAAHZ2cPo0LFoEffvC2LGwaRMUF7NdK0J6wsH1RlF3yOXg5AS//AJ8fktLaSn4+4ObG9y8+eBlSiWkpUFKCvzrX1BbCwDA5cJzz0FYGMycCe7uLFSOkL5gjKKua2oCDgeOH4egIOjd+0H79etQXQ1jxrTxlpoa+OUXOHAAfv21ZXaUuTlMnAjh4fDPfzY4O1sxVDpC+oMxirooMxNeeQUSE2HSpK68XS6Hn3+GlBT47TdobAQeD3i8/kOH9p01a1ZERISjo6O+60XIUDBGUVfI5RAcDLduQUwMbNrUrY+qqIBDh+DMmbsSia9KpQIAHo83efLkiIiIV155xc7OTj8VI2QwGKOoK6KiIDkZnn4azp8HHk8/n1lRUXH48OGUlJRjx45p8jQ0NDQsLGz69OmYp8hoYYyix7ZjByxYAHZ2cPEi+Pnp//PLy8uPHDminafW1tYTJ04MCwubMWOGra2t/k+JUDdgjKLHc+0ajB4NCgXs2weRkYY9V1FRUUpKilQqPXv2LP1BdXBwmDp1anh4+D/+8Q8zMzPDnh6hzsEYRY+hthZGjYKcHIiOhu3bmTvvX3/99dNPP6WkpJw5c4YQ4unpeeHCBW9vb+YqQOjRMEbRYxAIYO9eGD4czp8Ha2sWCrh9+/ZXX30lFov//ve/nzx5koUKEGoFn2JCnZWYCHv3gp0dSKW6GXr/PkM1+Pj4zJw5EwDwih4ZD4xR1ClZWbB4MQDA9u3g7//QoYoKCA6GOXNAoWCikubmZsAYRcYEYxR1rK4OwsOhvh7efhsEgocOEQJz58K9e5CVBcwkGx27Nzc3Z+JkCHUCxijq2LvvQnY2DB3axkz7jRvh0CFwdoYDB8DSkolisDeKjA3GKOrADz/8evRoqa0tpKSAjc1Dhy5cgA8+AA4Hvv0WnnpK/6deu3btiy++eOLECe1GjFFkbDBGUXuys7PnzZvB5Y5ITCwdMuShQ1VVEBEBjY2weDG8+qpBzp6RkZGenl5eXq7diDGKjA3GKHokpVIZGRlZV1f30kuTX39ddzG7uXPh9m0YNQri4w1VQJuJiTGKjA3GKHqkhQsXXr16dfDgwZs3b9Y5tGULHDwITk6GvSWKMYpMAsYoatuBAweSkpJ4PJ5UKrW3t9c+lJFRTzdcSkoCHx8D1tBmYtKReoxRZDxw1ghqQ15enlAoBICtW7cGBgZqH6qtrY2MHDVy5KRRoxKmT7cwaBltzm2i2YoTnpDxwN4o0qVUKsPDw6urqyMiIubOnatzdP78+Tk5OXV1x7/6qtnQleBFPTIJGKNI1+LFizMyMnx9fb/55hudQzt27EhOTrazs5NKpTx9rTP6aBijyCRgjKKHpKSkiMViekvUwcFB+9C1a9eWLVsGAGKx2M8Q64y2gjGKTALGKHrg1q1b8+bNAwCRSDRixAjtQ7W1teHh4QqFIjo6OtLQ64z+D8YoMgkYo6hFQ0NDeHi4XC4PCwubP3++ztHo6OicnJzhw4dv2LCBsZIwRpFJwOHOJ1pdXV1RUZFMJistLd21a9fly5d9fX137dql87LExMS9e/fSW6LWDK4z2uZIPS5NgowN/iz2ZA0NDeXl5ZWVlcXFxUVFRfT/2l9WVlZqXuzi4mJlZbVu3TqdW6LZ2dmLFi0CALFY7K+zRp6BYW8UmQSMUROmUqlkMllJSUlJSYlMJisqKiotLaV/KCsrKy4urqqqav8TrK2tPTw8PD09XV1dc3JyKioqEhISpk6dqh1SAwcOnDdvnkKhYOyWqAbGKDIJGKNGraysrOR/aD5q56ZMJmv/7ZaWlm5ubp6enu7u7m5ubl5eXm5ubh4eHh4eHm5ubt7e3tq7FldVVQUGBp45c+aLL75YvXq1pt3KymrTpk1qtdpQf8lHwxhFJgFj1Hilp6cvXbr02rVr7bzG2dnZ09PT2dnZy8vL09OT/l/zpYeHB5fb2VFEJyen77//fsKECWvWrHnxxRefffZZ7aOd/xw9whhFJgFj1Ejl5uZOmTKFx+MFBATQ6+7W/Uo3Nzf9ptvzzz+/ZMmShISEqKioK1eu6DxKz7w2H5/HGEXGBmPUSG3YsKG5uTkyMrL1o0QGtXbt2vT09CtXrixZsqT1kD3D2nx8HmMUGRucN2qMZDLZnj17OBzOkiVLGD61lZVVcnKytbV1UlKSVCpl+Ow68KIemQSMUWO0efNmhUIxbdq0ITorzjNiyJAh69atA4B33nmnoKCA+QI02lkoD+eNIuOBMWp06urqdu7cCQAr6KKebHj33Xf5fH5lZeWcOXNYGaOnsDeKTALGqNFJTEwsLy8fO3bsmDFj2KqBw+F8++23Hh4e6enpm1pvB8oUjFFkEjBGjYtKpRKJRMBqV5RydXX97rvvOBzOBx98cPXqVVZqaGfZZoxRZDwwRo3L/v3779696+fnx+fztdvv3Lkjl8sZLmbKlCnz589vaGiIjIxUKBQMnx2wN4pMBMaocfn6668BYOXKlToTQhcuXNivX7+0tDSG69m4ceOwYcOys7Pff/99hk8NGKPIRGCMGpFjx45lZGS4u7vrPL1+/fr1o0ePqlQqnTVAGcDj8fbs2WNpablly5YjR44wfHbc0g6ZBIxRI7J+/XoAWLJkic7+HOvXryeEzJ07t3fv3sxXNWLEiDVr1hBC5syZU1payuSpS0pKKioqLB/ewRm3tEPGBmPUWFy9evW///2vvb29zpLJhYWF+/fvNzMzo6vVsWLFihUTJkyQyWSzZ88mhDB2XmdnZ2dnZ51GvKhHxgZj1Fh8+eWXhJD58+c7OTlpt2/cuLGxsTE8PHzgwIFs1cblciUSiYuLy7///e/ExES2yqAwRpGxwRg1Crdv3/7pp58sLCzee+897fbq6mr6YPvy5ctZKq1Fnz596NP9S5YsuXnzJouVYIwiY4MxahQ2bNigUqmioqL69eun3b5t2za5XB4aGjpy5Ei2atOYMWOGQCCor6+PjIxsbGxkq4zq6mpgaeE+hNrEYfJWF2pTRUVFv3796uvrMzMzhw0bpmlvaGjw8fEpLi7+9ddfJ02axGKFGrW1tSNGjMjLy1u1atXnn3/O5KmzsrIOHz78yy+/nDlzxsvLy8fH59ChQ7169WKyBoTaRhDb4uLiAIDP5+u007uQTz/9tFqtZqWwNp06dcrMzIzL5f7++++GPldTU1N6ejqdM6v5iXV0dKSL9vft2/fUqVOGrgGhDmGMsqyurs7V1RUATpw4od2uVqsDAgIAYN++fWzV9igfffQRAPTp06eiosIQn19fX5+amioUCt3c3DTp6ebmJhAIUlNTGxoaCgoKxo4dCwDm5uZxcXHNzc2GKAOhTsIYZdmWLVsAYNSoUTrt//rXv2iHq7GxkZXC2tHU1ES3GHnttdf0+LFlZWUSiSQsLMzW1laTngMGDIiJifnjjz90uuRNTU1xcXH0DunEiROLi4v1WAlCjwVjlE0qlYpOY/rxxx91DtHlnUQiESuFdejWrVt0i5Hud5bz8/NFIlFoaKhmRj2Xyw0ODo6Li7tx40b7701PT/fw8AAAd3f33377rZuVINQ1GKNs2r9/P+1wqVQq7fZTp04BgIuLS01NDVu1dYjOxHJ0dLx9+3YX3n79+vW4uLjg4GBNx5PH44WGhopEoqKios5/TklJSWhoKACYmZnFxcXpfCcRYgDGKJtGjx4NADt37tRpnzZtGgCsXr2alao6Lzw8HABCQkI6GV4qleqPP/6IiYnx9vbWpKeLi0tYWJhEIqmuru5aGSqVSnOB/8ILLzxWCiPUfRijrElPT6cjJ/X19drtOTk5XC6Xx+MZ//2+ioqKvn37AsDnn3/ezstqa2tTU1MFAoGjo6MmPfv37y8UClNTU/V18/f333/39PSk39Jjx47p5TP1SyaTrV27ViKRbNy4EXvNPQnGKGsmT54MAJ999plO+9y5cwHgnXfeYaWqx/Xbb79xuVxzc/Nz587pHJLJZBKJhM/na68tEhAQEBsb23rISC9KS0vpBFsOhxMbG2s8UZWRkSEUCm1sbACAPuw7fvz4wsJCtutC+oExyo7MzEwOh2Nra3v//n3t9pKSEh6Px+Vy//zzT7Zqe1x0+9KBAwfSq/Jbt26JRKKQkBAOh0Oj08zMLCQkJD4+/ubNm4YuRq1Wx8fH00dFx40bx25UNTc3p6am0lu3dOgsNDT0iy++8PLyAgBXV9ejR4+yWB7SF4xRdrzxxhsAsHjxYp322NhYvU8kMjSlUhkYGEifFPD19dV0PG1tbWfMmLFnz57y8nKGSzp+/Di7UVVVVSUSifr370+/FQ4ODkKhUDPxQCaTvfTSS7TXHBMTY4Rz2tpw8yb58EMyfTqZPp2sXk3y8tguyIhgjLKgoKDAwsLC3Nz8zp072u3V1dX0iu/s2bNs1dY1mZmZ1tbW9NZnr169BAKBVCpld5qBTCabMmUK81GVk5MTExNDr98BYNCgQSKRqPW3Qq1Wi0QiCwsLAHjmmWe6NtuBOfv2EQsLEhxMli4lS5aQoCBiaUmkUrbLMhYYoyxYvHgxAERFRem002Wbx48fz0pV3bF3714A8Pb2PnHihPE8U6QdVaNHjzZoVDU3N6elpfH5fHorg16/p6amtn8L+Ny5c0899RQA9O7d+/Dhw4Yrr1vy8wmPRxYufNCiVpM5c4iNDbl3j72yjAjGKNMqKiroI+GXL1/Wbm9sbKRPjh85coSt2trX0NAwffr0NqOB7m6ya9cuVgprn6GjSi6Xi0QiegoAsLe3FwqFWVlZnXx7WVnZyy+/rOk1NzQ06L3CrmhuJppKPv6Y2NqS2tqHXlBZSXg8snYt86UZIYxRpq1duxYAJk+erNP+3XffAcCQIUOMpzeng863Hz58uE6MHjt2jD5HpFAo2KqtfQaKqps3b8bExGgeXR04cGB8fHwX1hmgvWY6n2HUqFG3bt3SS3ldJJcTsZj4+ZEtW1paXnqJjBjRxiuHDSPTpjFZmtHCGGWUUqmkcxvT09O129VqNV0ib/fu3WzV1j7NUinff/+9zqGJEycCQHx8PCuFdZJOVOXn53f5o3Su3+kDCFKptJvzq/7v//7Px8eHPhgmZeW2Y3Y2iY4mtrYEgACQf/yjpf255x78WdukSeTvf2eyQKOFMcqonTt3AkBgYKBOh06tVv/8888zZswwlmu6Vn7++WcA6NOnj85YzZUrVzgcjr29fWVlJVu1dZ52VKWkpDzu26urq8Visb+/P01POzs7oVB4/fr1Dt947do1oVB48uTJ9l9WVVX12muvMX2B39xM0tIIn084nJYADQkhUinR/FYIDSWjR7fxxpEj247XJw/GKENUKtWJEyfoMz/79+9nu5zHRhem27hxo057REQEACxfvpyVqrqga1GVm5sbGxur2SZrwIAB8fHxHU7k0um3/vOf/+zwRNq95uDg4DyDziuqriZiMRkypCU9eTwiEJBr13RftmgR6dWL6PS1GxqIoyNZudKA5ZkOjFHDUigUaWlpMTEx9FreycnJ2to6IyOD7boez/nz5wHA2dlZZ+JOfn6+ubm5hYXF3bt32aqtCzofVWq1umvX73K5XCwW+/n5dW3c6eLFi3TpLwcHB4P80s3NJbGxxMmpJUB9fEh8PHnUb4Vz5wgA0Rk/3LqVcDjE1H6SDQRj1CDKy8slEsn06dO1l84cNGjQ8OHDAWDYsGFGOxrTpldffRUAPvzwQ532hQsXAsBbb73FSlXddOHChXaiil6/09vBAMDj8QQCQWZmZocf++eff8bExNDJGN0Zd5LL5bSnDwB0C6zH/YTW1Gq14tdfyZQpD67fJ04khw6RDkc1Fy0ilpZk5Upy7Bj597/JsmXE3JzExna/pJ4BY1Sf7ty5IxaL+Xw+natIBQQExMXFXbx4kRBSW1s7ePBg07oKpkulWFlZ6aycVF5ebmtry+FwrrW+DDQRbUZVXl5ebGyss7Mzbffy8oqLi9N5Zrc1A407SSQSa2trABg5cmRubm6XP6empkYsFg8dOvTD8eMJALGyIgIB6cRvBZKdTeRyolaTpCQyejSxsyN2duS558iePV0upufBGNWD69evx8fHt36KXCQSFRQU6Lz44sWLFhYWXC5XZ7DeaL399tsAMH/+fJ12uoXUyy+/zEpVerR582YrKys622zChAmaPUdfeOGFgwcPdpiDtN86ZMgQ7X6rHn+1XLp0iT5ia29vn5yc/Lhvz83NXbx4sWZtrb8FBZGvvnrk9buG9riTsa4dbjwwRruILp0ZGxtLe5eUjY0Nn8+XSCTtD1uvWbMGALy9vTvs47BOs1RKdna2drtmC6njx4+zVZseXbp0ycfHx8HBAQCsrKwEAsHVq1c7fJfOuJOPj09nxp26oLq6+vXXX9f0muvq6jrzrj/++CMsLIyu0kLvAkskkqampg7eJpcTkYj4+rZc9dva4hz7DmGMPh7Nbmvu7u6a9HR1daW7rSmVys58SHNz87hx4zo5dMuuDz74AABmzJih075161Zoawsp03Xo0CEA8Pf37/B3Gx130k4oev3ecUJ1j0QioY/qBwQEtDPLSqFQSCQSzU7d9LfClStXOj7BY407IS0Yo51y//59utuaZugAtHZb68JzR/n5+bTv89133xmgXv3QLJVy5swZ7XaVSkUvM1tvIWW66DNa7Q+Xae4waidUZ8ad9CUrK4ue3c7Obu/evTpH8/PzY2NjXVxcaHmenp5xcXFlZWUdfKhaTdLSSFgYMTN7aN6ogX8r9CQYo+1pZ7c1nYvcLtizZw8A2NraGu3SogkJCQDw/PPP67Q/agspk0Zv9X788cdtHr1165Z2QnVy3MkQampqoqKiNBf4tbW1hJBz5869+uqrmt7x2LFjDxw40HHvuKaGiMVk6NCW9KTjTp24m4F0YIy2oZ3d1vS7DDC94TVq1CgjXHFSs1TKL7/8onOIbiG1Y8cOVgozkLfeegsAEhMTWx/au3evZtxp3LhxP/74I+u/PyQSCZ1L5+/vn5mZSbvSlpaWYWFhOpcObcrLyyv58EPi6NgSoP37d2rcCT0CxmgLzW5rffr00aSns7Mz3W1NLpcb4qSVlZV0Zd+4uDhDfH53SCQS+q9U55bFf/7zH2hrCylTN2HCBABoc5fm0tJSBweHzt5hZEp2djadhmxtbb1+/fovv/yytLS0w3dpxp1ix40jACQ4mEgkeP3eTRijhBCSlJSkvdtav3793nvvvfT0dEMPGhBCTp48aWZmZm5u3plOBJOCgoLavHVL10JuvYWUqaN3e3Nycto8apy/M+rr62NiYjQX+O2sk11bW7tjxw7tpwmWvfsuPoOkLxij5OzZs88//zwYeLe1dtCNQ3x8fAzU5+2CI0eO0ClZOo+c0y2kbGxsjH+q1mNRq9U8Hg8AOjmXyKjs3r2bXuC///77rY8WFhbGxcX16tWLBqiHh0dcXJxMJmO+zh4MY7RlwITP57NVQGNj4zPPPNPhMDGTxo8fDwDr1q3TaadbSC1atIiVqgynuLiYTlxju5Auys7Otre39/Pz037SjF6/a0ZH6bxRI7wL3wNgjJJ9+/YBQGRkJIs15Obm0qlUP/zwA4tlUBcuXAAABweHqqoq7fZHbSHVA9C1V4KDg9kupItUKpW5uTmXy21oaFAqlRKJ5Omnn6bp2flxJ9RlXHjiNTc3A4BmsggrfH19161bBwDR0dH37t1jsRIA0FSifb8YADZs2NDU1BQREaHZ8LLHoN9zOjPBFBUWFqpUKk9Pz2+//dbb2/vNN9/MzMz09PRcs2ZNQUGBVCp97rnn2K6xJ8MYNYoYBYDo6OipU6dWVVUJBAJaEivy8/MPHjxoYWFBV2/SqKysTEpKAoBly5axVJoBmXqMauq3trYuLy8PDg4Wi8X5+fmrV692c3Nju7qeD2P0kTFaWVlZWVnJZCW7du3y8PA4efLkxo0bmTyvtoSEhObmZoFAoD3xCwC2b99eU1MzadIkuntdD0NjiC6qbYo0MTpz5szz589fvHhRKBTSQTPEAIxRUKlU0CpGFQqFi4uLt7c3k5W4urru3r2bw+GsWrWK3qBkmEwmowUsXbpUu72hoWHbtm0AsGLFCuarYgCNIdO9WaGJUSsrKzpciZiEMdrSG9UMaGo3Mn+lP3ny5AULFjQ1Nb355pv19fUMnz0jI8Pc3JzP52seG6ckEklxcXFgYCDdva7nMfWL+oKCAjDl3rSpwxhtOzFZvGGakJAwfPjwGzdurFy5kuFTT548+d69e5s3b9ZupFtuAMD777+vWVC1h3FxGTF06DN9+5p8b5TtQp5QGKNGF6M8Hi85OZnH423fvv3w4cMMn93Jyempp57Sbjl06NCNGzd8fHzoTnA9j0IB6emJeXnnPTzcO361UcIYZRfGaNuJSW+Y6lzpM2bYsGH0acs5c+aUlJSwUoMGXedp6dKlbH03DO3ePSAE+vYF0+1q3717F0z53q6pwxg1ut4otXTp0okTJ5aVlc2ePZsQwlYZJ0+ePHv2rIuLC10AqUei83RNtydXXV0tl8vt7Ow06/ghhmGMGmmMcrlciUTSq1evY8eO7dy5k60y1q9fDwDvvfee9nrVPYypxyjtiuIVPYswRtu+fmc9RgHA29v7m2++AYClS5dev36d+QJycnKOHj1qY2Pz7rvvMn92xph6jOKNUdZhjBppb5SaPn36W2+9pVQqZ82a1djYyPDZ161bp1arZ8+eTXev66kwRlE39cxBg8fSzhAT6zEKAFu3bj19+nRGRsbHH38cHx+v3w9Xq9UymUwmkxUVFclkstLS0uLiYplMVlxcXFJScvfuXTMzsyVLluj3pMbG1GMUJ42yDmO0vd6oMYxN29ra7tu3LyQkZP369ZMmTaKLtHeeQqEoLi4uKiqqrKykf9D+8t69e/QXRpsCAwMTEhIGDhzY7b+EUTP1GMXeKOvYjwnWGdtFvVqt1uz8Q40aNWrVqlWffvrpm2++efXqVe0B2ZqaGtqRLCkpKSkpad2v7PBWgJubm5ubm4eHh4eHh5ubm5eXF/3S09PTw8Ojd+/eBvlLGg1C4K+/AABMtzOHMco6jFGji9G5c+c2NzeLxWJra2tN40cfffTbb7+dPXt2zJgx/v7+ZWVl9LpboVC0/2lOTk6enp6urq5eXl7u7u7u7u6enp5ubm6enp7u7u5ubm7G0ONmUWkpKJXg6go2NmyX0lUYo6x7ov8JUUYVo99///3u3bttbGxWrVrl7++vaTc3N1+5cmVERIRMJrt586amncfjOTs7e3l5eXp6av6g+bJv374ODg4M/xVMi6lf0Tc3NxcVFXG5XJ0VuRCTMEaNKEZzc3Pp1KKtW7dqZygAyOXyZcuWNTY2hoaGzp07V9OvpJvwoC4z9RgtLCxsamry8vKytLRku5YnF8Zo2/NGmX8YVKlUhoeH19TUzJw5c/bs2TpHo6Oj8/Pzg4ODDx48aGVlxVhVPZ6px6ipL/HXM+C8UWPpjcbExFy5cmXQoEF0yr227du3//DDD/b29snJyZih+tUzYhRvjLILY9QoYlQqlSYmJvJ4PKlUam9vr33o2rVry5cvB4CdO3cOHjyYmXqeHL17Q0AAmO6cLoxRY4Axyn6M5uXlzZs3DwA2bdoUFBSkfai2tjY8PFyhUCxYsCAyMpKBYp40H30EWVkwbRrbdXQVzr03BhijLMdoQ0NDREREdXV1eHi4UCjUORodHZ2TkzN8+HC6Wh3qvKAgWLTooZayMrC0hIMHYetW4HDgo48eOurtDZ99xmSB+oG9UWOAMcpyjK5YYWlvv2HwYP/ExESdQ998883evXvt7OykUqn2HFLUGU1NoPN8FiHQ1ARqNQAAlwvr10N2Niul6RPGqDHAkfq2H59nZqT+xx9hyxaOldX4c+cyHBwe2sfx+vXr9GH2HTt26Ex+Qt3n6AhjxkB0NBw/bsKrNQPGqHHA3ihrW9rdvQvz5wMAfP01BAU9lKF1dXXh4eH19fVCofCNN94wXA1PsoQEOHsWJBK26+iGmpqaqqoqGxubXr16sV3LEw17o+xc1Dc1wcyZUFEBr70GCxboHl2wYMGNGzeGDRvG4ob1PcCZM6C9IbTORqv+/rBwIaxYAa+8AiaaQrh3iJHA3ig7Mbp8OZw7B/37g1iseyg5ueLYsSt2dnYpKSk2pvuktxFQKKC09MF/ZWW6L/j0U7C0hNhYNorTB4xRI4G90bYT09XVNTQ0NDAw0BBnPHwYtmwBCwvYvx90ts/JyoJ581zs7DJ27TqJt0S7aeJE2LbtwZcyGaSkPPQCe3vYsAGiolrurpgcvDFqJDBG247R8ePHjx8/3hCnKyiAt94CQmD9enj22YcOKZUQFQX19RARwY2IMMjZkY6ZMyEpCZYvZ7uOR1AqlcnJyYWFhatXr259FCeNGgm8qGd0pj29JVpeDnGSFOcAAAZwSURBVHw+xMToHl2wAK5ehYAA2LqVgVpQi61b4fx5KC4GAFAo4KuvgPHtWtpQXFz8ySef9O3bd+7cuZ9//nlpaWnr12Bv1EhgjDK6ColKBYMGQf/+sGeP7jyb/fvhu++Ax4PkZBNe+9IU+fnB8uVAN7FeuhTefx/GjoX8fNbquXTp0qxZs/r37//pp5/ev38/ODh48+bNjo6OrV+JMWok8KKe0d6otTXs3g3374Oz80PtublAn2Datg0Mcz/2ibNype6C9vb2kJAAgYEwYADExT10aNUqcHCAsWPBygrS0uDCBRgxAr75BiIimCu4sbHx559/3rhx49mzZwHAwsIiLCxMKBSGhoY+6i0Yo8aCPPHGjBkDAAsWLMjPz2elAIWCBAURABIRwcr50UPkchIRQQAIABEISH29wc9YXFwcHx/v7e1N/0m6ubnFxsbeu3ev/XepVCoLCwsul9vQ0GDwElG7MEbJX3/95eXlRX+CAwIC4uLi8vLymCxAKCQAZNAgIpczeVrUHomEWFsTADJiBPnzT0Od5eLFi0KhkMdrefhixIgRYrG4vqPkViqVUql01KhRLi4u06ZNM1RxqNMwRolKpUpNTY2KitKsUMfhcMaMGbNp06bCwkJDn/3AAQJAeDxy+bKhT4Uez+XLxNeXABB7e5KcrM9PbmhokEqlISEh9OeNy+Xy+fy0tLQO3/jXX399+OGHrq6u9I3u7u5FRUX6rAx1CcboAwqFIjU1VSAQaPKUy+WGhISIRCID/bDm5hIHBwJAxGJDfDzqrupq8vrrDy7w6+q6+4GlpaXx8fGafZMcHR1jYmLu3r3b4RsvXrwoEAgsLCzoG0eOHNmZfitiBsZoGzR5amdnp5OnJSUl+jqLUklGjiQAJDxcXx+JDEIiITY2BIAEBJBr17r4IZcuXRIKhZqVuvz9/UUiUV1HwUz7rfT2PQCYmZl1st+KmIQx2p7q6up9+/ZNmzZNs3WHubn522+fTkoiFRXd/fCFCwkA8fXFW6ImICuLDBtGAIi1NUlMfIw30ltGmtF2zfW7Wq1u/40lJSXa406urq6xsbGd6bci5mGMdkpdXZ1UKuXz+b169ebxFADEzIyEhBCxmFRVdfEz//tf4uNDLl3Sa6HIYGpqyBtvtFzgf/DB0Q47koSQmpoazfW7i4vLypUr79y50+G7dMadgoKCxGJxZ06H2IIx+ngqKpRJSWTSJGJu3vIvysqKTJtG9u0jNTVtv+X0aXLq1EMtJSUkLY2oVKSxkYGSkT4lJZHQ0Fx6VZ6Zmdnh6/l8/uDBg0UiUW1tbfuvpNfvrfuteiocGRDGaBeVlxOJhPD5D/KUxyN8PpFIdPOUjvampz9okUoJAKmuZrhkpB83btwYPnw4AFhbW4tEovZfXFlZ2eEH0nEnzaPxdNypM/1WZCQwRrvr/n3dPLW2bslT2v/w9SX29sTPjyiVLW/BGDV19fX1Mf9bE0EgENQ86kqkI5cvX9Yed/Lz8+vMuBMyNhijelNYSEQiMmYM4XBa8tTBgRQVEV9fsngxcXEha9a0vBJjtGfYs2cPncvh5+d35cqVzr+xublZZ9wpNDQ0NTW1w3EnZJwwRvWvoICIRCQkhAwfTgghvr7kk0/I1q3Eyork5BCCMdqD5OTkPP300wDA4/E6vMAnhFRWVopEIs1T8A4ODjExMbdv3zZ8pciAMEYNSHNR/8knpKmJBAaSSZMIwRjtWRQKheYCf8aMGY+6GZqRkSEUCjXbGXRy3AmZBIxRg6MxSgg5fZpwOEQqxRjtgX788UcnJyeajxkZGZp2zfU7h8PB6/eeCtcbZc6YMTB7NqxYAUol26UgfZsxY8b58+eDgoL+/PPPZ599dtOmTXK5fNOmTQMGDJg6dWp6erq9vb1QKMzKykpLS3vllVc4Jr2tM3oYh9DlapHBDBoEb7zRssDl/fvg5wcDBsDFi1BdDf97dh/1EEqlcunSpTt27AAACwuLpqYmAPDz84uJiZk1a5bm2WLUw+CyzYzq3Ru++ALeeYftOpBh8Hi87du3v/jii19//XVVVZWHh0dMTAyfz8e+Z8+GvVGD0+6NAoBaDSEhcO4c9kZ7MkKIUqnUTAhFPRvGqMFdvw69eoGn54MWmQwKCiAoCBjZuAQhZFgYowgh1C04Uo8QQt2CMYoQQt2CMYoQQt2CMYoQQt2CMYoQQt3y/2sWlLF13MieAAABj3pUWHRyZGtpdFBLTCByZGtpdCAyMDIyLjAzLjIAAHice79v7T0GIOBlgABGIBYGYjEgbmDkYNAA0sxMbA5gmoXNIQNEMzPCGewOFiAGIzNcCQOMhqmACDBjMQMmgEMCrhNmFIIBU8rNwKjBxMiUwMScwcTMksDCmsDKpsDGrsHEzqHAwanBxMmVwMWdwcTNk8DDm8DLl8HEw6/BxC+gICCowcQqlMEkxJjAx6bAx5kgyK0gwsLGKMTKwszEys7Gx8nBxsXNw8vHycrPwy0oIP4OGjZgIFzntt8hIW+HHYjzTn+yQ2Zd3j4Qu2NKr4Nf/Z39IPaH304OkaYiB0BsY+439tOXbQWLp9gwOszom2ALYltIBNpzzSq3B7GdrofaL3oi6wBin7onuj9yvQ2Y3bh5737WovtgNUyFdgcu7zkLZm+ZmHZAua0K7AYVaf0DemeqwOYfY5+//2RiOJh9tEd2f0gZK1i9UW3GgaSV3GD3RG9deCBs702wmkrZhQe2c/iB3d+aGekw94UmWL0YAB9/XmFLdYU2AAAB9XpUWHRNT0wgcmRraXQgMjAyMi4wMy4yAAB4nH2US47bMAyG9z6FLhCBb4nLSTIoimIcoE17h+57f5R0mkgDCLVDQrE/03z88lby+H799vtPeR103bZS4D8/dy+/GAC2j5KLcn7/8nUvl/vb+Xnlcvu5338U9EIUz8T5mX273z6eV7DcilZvjVULVDYgbLGA4xhPUrkUqepugOUElZgcZAHyAQoJ9wCxNiJjXYASIFcQM2rlRJVRm9oC1LIXrF0EnDKioKOsQIuIVAGdEfN2A+2rFFtwUDtaaxnGraGvuP7gWBktAos16LDgPBKMlmhXYQzQpRPQAsSYzVFB3BeMopqo2ardUcAlm+LREmlBGjSmVRsxJ3PiAMiEAyAR0+Xb+RGzxZCZMmNvUXtfofJIlGKO8dZAuyDzqumoiUI1VCEPQCnIZU2WfYpMOTLFzAQ7BbxCc0QnraDMvR8yAgTHFdr/oSxd+iFNQIJlq/yQHHsDy/tmHKsF+L5fP22Sx7Y53/br2DaUNnaHhPHYA5I2lJ6nDj3Hn2JDtRjWhjgprA8NYpgPqVEYzoqSdIiTciQd0qQQSYc8KUHSoUwDl3So01zpYGyaHx6uTWOidNinaUhW5FPP5fgSvVqVzYvgryB0JKxTUZS9jUijhBzI3P78//zixXr7CwaP+yYTyJGvAAABCHpUWHRTTUlMRVMgcmRraXQgMjAyMi4wMy4yAAB4nCWQOW4EMQwEv+JwF9AQvA8MJprEkf0Aw5Fyv2Afb0qbEQWRXerva9KcP3+fv/Nx83V/XVPm1HtPOifLc9LH62FQEeIDQRyZYpwKVuXjQGDhQl1EWSXHQRDM3kQA1V3GwSBk4eMkSFWs9UapyMbJgFRCfRkDLbURQpJHrLTyoNKNxIR8MKgH5jg72NK0NxlKk5v0zeQ26Xw1b8fOrTC3Jo4h6430tNxaW9VtIQMUTdtfQWK0NzOR7RlILbw3ZW32UUpm2ue7E5S1WdGquSW4a+DFUkm6s6XqZMrVqcbNYlUjFRhNuqBAH8/XP/WmUeBabotnAAAAAElFTkSuQmCC\n", | |
"text/plain": [ | |
"<rdkit.Chem.rdchem.Mol at 0x7f35cda6ff40>" | |
] | |
}, | |
"execution_count": 6, | |
"metadata": {}, | |
"output_type": "execute_result" | |
} | |
], | |
"source": [ | |
"with dm.without_rdkit_log():\n", | |
" mol = dm.sanitize_mol(mol)\n", | |
"\n", | |
"print(dm.to_smiles(mol))\n", | |
"mol" | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"execution_count": 7, | |
"id": "a225d8fa-05d7-4b8b-81fb-868fe462336b", | |
"metadata": {}, | |
"outputs": [ | |
{ | |
"data": { | |
"text/plain": [ | |
"{'a_float': 2.658, 'a_string': 'hello mol', 'a_boolean': False}" | |
] | |
}, | |
"execution_count": 7, | |
"metadata": {}, | |
"output_type": "execute_result" | |
} | |
], | |
"source": [ | |
"mol = dm.to_mol(\"CC(=O)OC1=CC=CC=C1C(=O)O\")\n", | |
"\n", | |
"props = dict(a_float=2.658, a_string=\"hello mol\", a_boolean=False)\n", | |
"mol = dm.set_mol_props(mol, props)\n", | |
"\n", | |
"mol.GetPropsAsDict()" | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"execution_count": 8, | |
"id": "fa7e6681-cddc-4e8c-960d-dabe975edac3", | |
"metadata": {}, | |
"outputs": [ | |
{ | |
"data": { | |
"image/png": "iVBORw0KGgoAAAANSUhEUgAAAcIAAACWCAIAAADCEh9HAAAABmJLR0QA/wD/AP+gvaeTAAAfe0lEQVR4nO3deVhUZfsH8HuA2FcRFZBFQU1NRBlzNzS0tFwQVCwQlBjT3Hozx7cs0l8L1tv12luGg1oChoJr5NWV5VaCG4hL7oIICo6KLAM44Azz/P44NBnCeGY558w5c3+u/nE4c87NNHzPPed5zjMiQggghBAylBXXBSCEEL9hjCKEkFEwRhFCyCgYowghZBSMUYQQMooN1wUgZKzqaigtBQDo1QtcXdv+tKkJLl4EAAgLY7swZCGwG0W898svIBaDWAwLFrTz05s3W3+q0bBeGbIMGKNIOLKy4MABrotAlgdjFAmEvT0AwMKF0NTEdSnIwmCMIoEIC4ORI+H6dUhJ4boUZGEwRpFAiETw+ecgEkFKCly9ynU1yJJgjCLhGDECXnsNmpth/nzAtSIQazBGkaCsXQvOzvD77/DDD1yXgiwGxigSFF9f+OADAIDly6GmhutqkGXAGEVC8/bb0L8/3L0L773HdSnIMmCMIqF55hlITQWRCNLS4PRprqtBFgBjFPFSYyNs3tzhBdDRoyE2FjQaePdddstCFgljFPHMpUuwciX4+8Mbb8CHH3Z4i+cXX4C7Oxw+DLm57NaHLA8uTYL4oaEBtm2DjRuhoKD1kVGjICmpw4lNXbvCxx/DokXw2Wes1YgsFMYoMneXLkFGBqSltY68u7nBrFnw1lsQEvKUJy5YABkZcOrUPx4sLISwMBCJmKoWWSCMUWSm6uthzx7IzPx7tZGwMJBIIDYWHB1p7cHKCtavh6FD//7gf+wYjB0LL70EmZng5sZI2cgC4bVRZHZOn4b588HXF+Lj4cABcHcHiQTOnYPCQpBI6GYoRSyGN974+5/19eDoCD/9BMOHw5UrJi8cWSgRfsEyMhP19bBtG8hkUFTU+gjN9rOhAe7dA3t78PFp56dKJdy5AwDQsycAQHExREXB+fPg4gLffQfR0ab9JZAlwhhF3Dt9GtLSICsLGhoAANzdYeZMWLQIBgxg5HBNTbBgAWzZAiIRLF4MX34JNnhxCxkBYxRxRqGA7dsNaT9NIi0NFi0ClQrCwyE7G7p0YfyISKgwRhEHTp48uXPn4dTUlY2NAACdO0N8PCQlQZ8+rJaRlwczZ8KdO+DnBzt3wvPPs3p0JBgYo4g9CoVi+/btGzZsOHPmDAAEB19wc+svkUBcHDg4cFNSZSVER8Px42BvD998A4mJ3JSBeA1jFLHh5MmTaWlp2dnZjY2NAODl5ZWQkJCUtLRXL1+uSwO1GlatgrVrAQAkEvj6a7C15bom5tXV1f3www9DhgwhhDyPfbiRCEKMqaurk8lkgwYN0r7fwsLCZDLZw4cPuS6trcxM4uhIAIhYTMrKuK6GSYWFhRKJxNnZGQCCgoJsbGxSUlK4LorfMEYRI6i/VScnJyo9PTw8JBLJhQsXTLLzS5dMspu2iopIjx4EgHh5kYMHGTkEh2pqar7++uuQv+79EolE48aNmzJlCvXPhIQEpVLJdY18hTGKTIlqP0NDQ5loPxUKkp5OIiIIAPnzT+P3146qKjJhAgEgNjZEMC2a7lPatm3bqB+FhobeuHGD21J5CmMUmQaj7WdBAUlKIi4uBIAAEE9PsmePSXbcDrWaJCcTKysCQGbPJg0NTB2IabW1tY+f0kQi0ciRI9s9pV2+fLlv374A4OnpuX//fk6q5TWMUWSUJ/9WIyIi0tPTTfIJUaEgMhkZPLg1PQFIWBiRyUhjo/H7forcXOLmRgBISAgpLmb8cKbV5pTWtWtXqVRarPPXqKuri4yMBABra+vk5OSWlhbWqhUAjFFkIAP+VvXZOZFIiLNza3q6uxOJhJw/b5J903X1KunfnwAQV1cGm18Tok5pAwcOpP6PWFlZRURE5OTkNDc303m6RqNJSUmxsrICgMmTJ9fW1jJdsGBgjCJDhIeHa/9Wx48fv2PHjkePHhm/27o6ztrPjuqJjCQApF+/hjVrPtZoNNzU8TRtTmndunUz+JT2888/e3h4AEDv3r1NdU1G8DBGkd6WL1/eq1cvT09PpttPhsaR9KLRkLVr1X5+o6geraamhuuK/ka1n9rBd237aeQprbi4mNqns7Pzjh07TFWtgGGMIr1RV0KPHTtm/K60E0t79rz0ePtpbvNKDx8+3KVLFwAIDg4+z/LFhfZQ7afjX0sPUO1nSUmJqfavVCoTEhKoi91LlixRqVSm2rMgYYwivbm4uABAdXW1MTs5fvz43LlztZ9DJ0167913ydWrpqrR9MrLy4cMGQIADg4OW7Zs4aSGmpoaJtrPjshksmeeeQYAwsPD7969y8QhhAFjFOmnsrISALy8vAx7OqMTS5mmVCrnzZtHlS2RSBgKr3Yx3X525OjRo97e3gDg5+d38uRJpg/HUxijSD+///47AIwYMULfJzI6sZRNMpnM1tYWAEaPHn3nzh1Gj0W1nwP+WniV6fazXRUVFcOHDwcAOzu7TZs2sXZcHsEYRfrZuHEjAMTHx9Pcvs3EUn61nx3Jy8vz8fEBAF9f3+PHjzNxiDbtp7e3t1Qq5eouI5VKJZVKtW04zRlUlgNjFOlnxYoVAPDxxx8/dUtGJ5Zy7t69e2PHjqV6tHXr1plqt1T7+dxzz3HYfnYkMzOTinWxWFwm7OVb9IQxivRD3euSnZ2tezPtmhfaiaXCa2Ee79Hi4uKM7K+ps47DXwuvctt+dqSoqKhHjx7UxfGDwlu+xVAYo0g/VKNUVFSke7OUlBSBtZ8d+eGHH6gebdCgQaWlpfo+vbq6ut3202znGFVVVU2YMAEAcIU9LYxRpAeNRkO1SwqFQveWjY2N5vA5lB1nz57t2bMnAHTu3PnXX3+l+aw27aePj49UKjUgiNmnVquTk5Op20Znz57dwN/lW0wEYxTpoby8nJptw3UhZqeurm7q1KkAYG1tnZKSouO2Uar97N+/P1/az47k5ua6ubkBQEhIiOA/c+iGMYr0cPDgQQAYM2YM14WYo8eX9pgyZcqTS3u0237evHmTk2pN4urVq/369QMAV1fXPbxYvoUZGKNIDxs2bACAxMRErgsxX/v27XN3dweAPn36XLx4kRAil8tTUlKCgoL43n62S6FQREdHU7eNSqVSy1xhD2MU6eGdd94BABxY0O3KlStUj+bi4jJ69GjqfkoACAgIWLNmze3bt7ku0MSoNtza2hoAXnnlFSPvEuYjjFGkh8mTJwPArl27uC7E3NXX18+YMcPW1tbW1lZg7WdHzG31FjbhFywjPfTt2/fKlSvnz5/X3p6IOlJWVhYYGOjh4XHhwgXqlifBu3XrVlRUVEFBgbOz86ZNm2bNmsV1RSyx4roAxBsajaa0tFQkElGTe5BuxcXFADBgwAALyVAA8PPz++OPPxITExsaGmJiYubPn69Sqbguig0Yo4iusrKy5uZmX19f7f2dSIfr168DQK9evbguhFX29vabNm2iVm9JS0uLiIiQy+VcF8U4jFFEl2XmgsEs+eWSSCT5+fn+/v5//PGHWCw+ceIE1xUxC2MU0WXJuWAAC3+5xGJxYWHhuHHjKioqwsPDv/rqK64rYhDGKKLLwnNBX9TL1bt3b64L4YyXl9f+/fulUmlzc/OyZcvmzJmjVCq5LooRGKOILswF+lpaWqjhOO2se8tELV+SlZXl5OSUmZk5atSomzdvcl2U6WGMIrqwG6WPGo7r3r279tZPSzZ79uz8/PygoKCioqIhQ4b89ttvXFdkYhijiBa1Wn3z5k0rKytquUmkG55y2hg4cGBRUdHUqVOrqqomTpy4du1aIc1YxxhFtJSWlqpUKn9/f3t7e65r4QGM0SdRy5dQdxKvXLkyMjKyrq6O66JMA2MU0YK5oBd8udpFLV+Sm5vr7u7+448/Dh069NKlS1wXZQIYo4gWzAW94MulwyuvvFJQUDBgwICrV68OGzZs9+7dXFdkLIxRRAvmgl7w5dItODj42LFjM2fOrK+vj46OXrlyZUtLC9dFGQ5jFNGCuUCfWq0uKyvD4TjdnJ2dt2/f/sUXX1hbW2/ZsuXBgwdcV2Q4jFFEC04apY8ajgsICMDhON1EItHy5csXLlx49+7d5ORkrssxHMYoerpHjx6Vl5fb2NgEBARwXQsPYOdugODgYK5LMBzGKHq6kpKSlpaWwMBAW1tbrmvhAYxRvQjg5cIYRU8ngDc6m/Dl0osAXi6MUfR0Anijs+natWuALxc9whiOs+G6AKPcuHGjpqbGyspq0KBBT/70zp07lZWV7u7uFr48hPEwRvWCLxd91HBcYGAgr4fj+N2NrlixQiwWDx48eMeOHU/+9LvvvhOLxe+++y77hQkM5gJ9zc3Nt27dsrGxCQwM5LoWHhDGDBB+x6jWkiVLamtrua5CsDBG6btx4wY1HKf9XmWkgzDeWkKIUQcHB7lc/uGHH3JdiDAplcqKigpbW1t/f3+ua+EBYeQCa4TxcgkhRhcuXOjg4LB+/fqTJ09yXYsAlZSUaDSanj172tjw+0o6O4SRC6wRxnCcEGLU19d38eLFGo1m0aJFOu7MbWpqys7OnjFjRmhoqJeXV2Bg4OTJk3Nzc9kslY+E8UZnDcaoXoTxcgkhRgFg1apVPj4+hYWF3377bUfbvP/++zExMXv37q2rqwsICGhubt63b9/UqVM///xzNkvlHWG80VkjjDETdghmOE4gMeri4vLpp58CwKpVqyorK9vdZuHChampqXK5vLS0tLCwsLKyknrKmjVr6uvrWS2XVzBG9YIvF32CGY4TSIwCwJw5c1544QWFQvH222+3u0FQUNCbb77p6elJ/VMkEq1YscLJyamxsfHMmTMsVsozmAv04XCcXgTz1hJOjIpEov/97382NjY5OTn79+9/6vYKhUKhUHh7ewNAVVUV8wXylWDe6ywoLi6mhuOsra25roUHBPPWEk6MAkBISMjixYsBYNmyZSqV6skN8vLyYmJievfu7ejo6Obm1qlTp+LiYgDg9ZKxjGpsbJTL5fb29t27d+e6Fh4QTC6wQzAvl9CmsKxevTo7O/vKlStPjjX95z//WbFiBSGkX79+UVFRXl5etra2mzdvxlZUh+vXrxNCgoODrawEdcZliGBygR2CebmEFqMuLi5ffvnl7NmzV69ePXfuXO3jpaWlK1euBICMjIy4uDjt4/v27cMY1UEwb3R24MulF8HMahBgixETExMREVFTU7N582btg/n5+S0tLb179348Q9u4dOmSXC5npUbewEmjesEYpU9Iw3ECjFEA+Pbbb+3s7B7/FmwPDw8AaGxsfPya6U8//URdGwWAmpqaKVOmhIWFHTt2jOVqzRnmgl7w5aJPSMNxwozRXr16vfPOO48/MmzYMBcXl9u3b0+ZMuX7779PS0ubNm3a1KlT7ezsqA3UarWfn19lZeXYsWNTU1O5qNocYS7Q19DQgMNx9AnprSXMGAWAVatWPb4QrKen5+7duwMCAn755Zd58+bNnz8/Ly9PJpNRF0wBwMvL68CBA1KpVKVSLVy4MDY29uHDhxzVbkaE9F5nWnFxMQ7H0SeotxbhM7lcXlJSUltb2+5Pq6qqSkpK5HK59hGlUpmfn799+/ZDhw41NTURQurr60tKShoaGrTbbN++3cnJCQBCQ0Nv3LjB9K9gzqi1B52cnDQaDde18EBOTg4AREZGcl0IPyQmJgJAamoq14WYAL9H6rt27arjp56entp7lij29vYjRox4/BFnZ2dnZ+fHH5k1a9bAgQOnT59+9uzZIUOGZGVlTZgwwYQ18wjVLwQHB4tEoqduXF9f7+LiwnxR5guH4/QipG4UP32049lnnz1x4kRkZOSDBw8mTZr00UcfaTQaroviAP35KDU1NYMGDZo/f367dz1YCCHlAguE9HJhjLbP1dV1165dKSkphJDVq1dPmzbNAlfXp/9Gz8/Pv3XrVlpa2ksvvXTv3j3mSzNHQsoFpglsOA5jtEMikUgqle7bt8/Dw+Onn34aOnToxYsXuS6KVfRz4dVXX83Pz/f39z98+PDgwYNPnDjBfHVmB2OUPoENxwnhd2DUxIkTz549KxaLr127NmzYsJ07d3JdEUvOnTt35MgRAOjWrRud7cVicWFh4bhx4yoqKsLDw7/66itm6zMzdXV19+/fd3Jyoha7QboJ7JSDMfp0/v7+R48eTUhIaGhomDlz5tKlS9VqNddFMaWpqWnHjh3jx48PDQ29ffu2g4NDUlJSYWEhned6eXnt379fKpU2NzcvW7Zszpw5SqWS6YLNhF7DcUhgMcrvCU8s++9//0t9H9H48eOr7t/nuhwTO3PmzIIFC9zc3Kg3hru7e0JCQkhICAA4Ojpu3bqV/q6ysrKoSWODBw8uLS1lrGQzkpWVBQDR0dFcF8IPCQkJALBx40auCzENjFH9HD161Nvbe4Svr+q558jJk1yXYwJKpTInJyciIkJ7Zg0LC5PJZNRc2qampqSkJOpxiUTS3NxMc7dnz54NCgoCgM6dO//6669M/gZmYfXq1QDw73//m+tC+IGad3jkyBGuCzENjFG93b59uzoqigAQe3vy/fdcl2O4ixcvSqXSTp06USnp5uYmkUjOnj375Jbp6ekODg4AMGrUqMrKSpr7r6urmzZtGgBYW1unpKQIew5/bGwsAHz33XdcF8IPXl5eAFBRUcF1IaaBMWoQlYpIpQSAABCJhNDu0cyB7vazI6dPn6a+d8zHxyc/P5/msTQaTUpKCjUaO2XKlI7uNxOAoUOHAkBeXh7XhfCA8O6Owxg1QmYmcXQkACQsjJSVcV3N0124cEEqlVKLXWnbz3PnztF8+v3796nwtbGxoWbU0rRv3z53d3cA6NOnz8WLFw2q3dxRTf3du3e5LoQHCgoKAGDgwIFcF2IyGKPGOXOG9OhBAIiXFzl4kOtq2qdQKNLT059sPxsbG/XdlVqtlkql1GD066+/Tn8P169fHzBgAAC4uLjs3LlT3+OauQcPHgCAq6sr14Xwg/CG4zBGjVZVRSZMIADExobo06OxoLCwUCKRaG91d3d316v97Ihhq7fU19fPmjUL/rqvQa1WG1mG+Th+/Dh1cuK6EH4Q3nAcxqgpqNUkOZlYWREAMns20XmRkQ0KBdmwofTll6m2USQSjRkzZuvWrUql0lRHuHz5ct++fQHA09Nz//799J8ok8moLyV/+eWXHzx4YKp6uJWRkQEAMTExXBfCD8IbjsMYNZ3cXOLmRgBISAgpLuamhsJCIpEQZ2dq+GtmePi//vWvy5cvM3Gourq6yMhIbXfZ0tJC84m///47dWeUn5/fqVOnmKiNZR988AEAfPDBB1wXwg/CG47DGDWpq1dJ//4EgLi6kj172DuuQkFkMjJ4cOvkAWrUSyYj+l/91MvjA/GTJ0+uqamh+cTbt28PGzYMAOzt7Tdv3sxokSyIiYkBgIyMDK4L4QfhDcdhjJqaQkGiowkAEYmIVEpo92gG+mf7SdzdiURC/vyT2YP+088//0yN/vfu3fvChQs0n9XU1LRkyRIDJvabobCwMAA4fvw414XwgCCH4zBGGaDRkJQUYm1NAMikSaS62vSHqKsjMhkZNKht+/nwoemPRUNZWZlYLAYAZ2fnHTt20H+idmL/yJEj6U/sNzfUHbRVVVVcF8IDghyOwxhlzP79xNOTAJAnRx7Ky8mGDWTJEvLaa+TNN8mnn+pxX6kZtJ/tUiqV1I3SIpFoyZIlKpWK5hO1E/u9vLwOHTrEaJFMoFbZcHd357oQfhDkcBzGKJNKS8lLL5Hy8r8faWggEgmxsfm7i9T+N2IE0fGJ2Mzaz45oB+JfeOGFx78FSzeDJ/Zzi5pPRi2OZ2dnJ6ShZ+YIcjgOY5RFDx+SYcMIALG1JfPnkx9/JIWF5PBh8sknxNu7tbUsLGz7LKr9dHJqTU8PDyKR6ApcrlGrtwBA9+7dT9Lusg2e2M++mpqab775hlr7iuq+qW4aAJYuXfro0SOuCzRrghyOwxhl0dKlrTlYUND2RzU1ZOhQAkB69ybU7E6Fgnz9NRkwoDU9RSLy4oskO5sX9+9XVFQMHz4cAOzs7PRaDG3v3r3UdcbQ0NCSkhLmKjSMtv2kQtPDw0MikVCjaoat3mKBBDkchzHKFrmc2NoSAJKe3v4GZWWtd+hTE4AqK1s/+5t9+9kulUollUoNGIi/cuVKv379AKBTp06//PILo0XSVFtbK5PJQkND29xN+/CfV1ROnz4dEBCg7+otlkaQw3EYo2xZv54AkC5diI4PfQkJBIBERLT+c/VqkpPDi/azI5mZmY6OjlTu3Lx5k+azFArF9OnTDZjYb3Jt2s+uXbtKpdLiju+t4OlFXtbcvXuX6uK5LsTEMEbZEhtLAEhkpK5tMjIIAHFxYXy2KYvOnDnTo0cPaiD+wIEDNJ9FTey3trYGgFdffZX+xH6ToNrPgQMHUulpZWUVERGRk5NDp6fm0UVe9uXl5QHA0KFDuS7ExDBG2RIeTgDI8uW6tjl2rPVKKBNTTblTVVU1YcIEA3o07cT+Pn363GflW1v0bT87sm3bNgNWbxG877//HgBiY2O5LsTEMEbZQt2p+dFHurb588/WGBXc9xep1erk5GTqttHZs2frXiL6cWVlZUOGDGF6miHVfmoH37XtpzHD7gav3iJg7733HgCsXr2a60JMDGOULaNGEQCycqWubU6ebI3Re/fYKotVubm51AhDSEgI/RavsbGRfuzqi2o/qQu4ANCtWzepVGqqSQLa1Vusra2Tk5M5vMhrJqKjowEgKyuL60JMDGOULZGRBIDMmaNrm717CQB55hldw1A8d/Xq1f79+1N3Ve9hc/WWf6qpqTF5+9muNqu3CPhrVOigLjcXPDnhj+cwRtnyf/9HAEi/frq2ee89AkDEYrZq4kZ9fT3VlXAyEM9o+9kRw1ZvERiNRkOtIM7ygCELMEbZcvp06wf206fb3+DRIxIYSABIcjKrhXFBo9GsW7fOxsYGACZNmlTN/JAa1X5SX2TCaPvZEYNXbxGMiooKasIG14WYHsYoi0aPJgBk+HDS7ir0H35IAIijIxHKt84+1eHDh7t06QIAwcHB58+fZ+gobdpPb29vqVTKyei5wau3CMORI0cAYMSIEVwXYnoYoyy6fLn11viRI/9x7/zdu2TRotZedf167urjQHl5+fPPPw8ADg4OW7ZsMeGeqfbzueee46r97Ih29Zbw8HAhLV38VGlpaQAQHx/PdSGmhzHKrvx80qVLa2L6+JCwMPLss61f4mRjQ774guv6OKBUKhMTE7W3jRofc1T7Sd3hrm0/S81pDpl29RY/Pz/6q7fwF3VK8/X19fb2/uyzz7gux/QwRllXW0vWrCFhYa232ItEpEcPIpEQZr4xiS9kMpmtrS0AjB49+s6dOwbsobq6WiaTUdMAHm8/zfOzs8Grt/CIRqM5ePDgrFmz7OzsqP8piYmJXBfFCIxRTtXVEQF9z7CRCgoK/P39AcDX11evFYDatJ8+Pj7m1n62y+DVW8wfv05pxsMYRWbk3r1748aNo3q0devW6d5YGH+r2tVbxGJxWVkZ1+UYi6enNCNhjCLz8niPFhcX9/CJ5f01Gs1vv/0WFxdnb2//+N8q/RWkzE1RUZF29ZaDBw9yXY4hhHFKMxjGKDJHWVlZ1NIegwYN0vYycrk8JSUlKChIeH+rBq/ewi3qlDZjxgzqurYATmmGwRhFZurcuXNUYnp6en722WdRUVHUPCEACAgIWLNmTYWwJtgavHoLJwR8SjMAxigyX9XV1RMnTgQA6k5KS/hbNWz1Fta0tLRQ7af2lObr62uB7WcbIkIIIGSuNBrNhg0b7Ozs5HL53LlzfXx8uK6IcdeuXZs+ffrFixddXV3T09OnTZvGdUUAAHK5PD09fePGjSUlJQBgZWU1btw4iUQSGRlJ3dRryTBGETI79fX18+bN27lzp0gkWrFixaeffkp92GefRqM5dOhQWlra3r17VSoVAPj6+sbGxi5cuJCanYYAYxQh80QI+fzzz99///2WlpZJkyZt3bqVurLBGqr9TEtLu3HjBgBYW1uPHTtWIpFMnz6d+nIXpIUxipD5OnLkyKxZs+7duxccHLx7927tClXMebL97N69++uvv47tpw4YowiZtVu3bkVHR586dcrBwSE1NTU+Pp6hA1Htp0wmKy0tBWw/9YExipC5a2pqWrRo0ebNmwFAIpF888032oFy43XUfr711lt+fn6mOoqwYYwixA9paWmLFy9+9OjRmDFjsrOzu3XrZuQO79y5k5GRge2n8TBGEeKNwsLCqKio8vJyX1/fnTt3Dhs2zICddNR+Llq0qHv37qYu2SJgjCLEJ/fv34+JiTl06JCdnd3atWuXLl1K/7lU+7lhw4abN28CgK2t7dSpUyUSyYsvvigSiZiq2AJgjCLEM2q1etWqVWvXrgWAuLg4mUymXVGpXdr2c8+ePWq1GgCCg4PfeOONuXPnUl/igoyEMYoQL23bti0pKamxsXHw4MG7du0KDAx8cpvKysrMzExsP5mGMYoQX507dy4qKqqkpKRz585ZWVnjx4+nHn+y/ezVq1diYiK2nwzBGEWIxxQKRXx8/N69e62trT/55JPY2NitW7empqaWlZUBtp9swRhFiN80Gk1ycvInn3xCCLGystJoNADQp0+fpKSk+Pj4zp07c12g8GGMIiQEubm527ZtO3XqVFhYGLafLMMYRUg4VCqVCW9wQjRhjCKEkFG4WcQQIYQEA2MUIYSMgjGKEEJGwRhFCCGj/D+quQGbEY+s1QAAARB6VFh0cmRraXRQS0wgcmRraXQgMjAyMi4wMy4yAAB4nHu/b+09BiDgZYAARiDmgfIbGLkVNEBijBwMIJqZiQ1Cs7AxZIBoZkY2hgQQA0ozMeGnmRnZIQYwww3gBtrIyKTAxKzBxMzCwMLKwMrGwMbOwM7BwMHJwMnFwMWtwcTNpMDJwiDCxMbEzcXJwszGysbOwckiPgvqXDDg0VXpPxDzd7EtiPPncdCB+ZaR+0Hs+cWf96+5PnUfiH0s1HL/hKA5YPHXQdr2EeFaYLZh0Rv7QI4zYLZrsr9D7sMWMFtEM9ahpOOJHYi97Yigw6F/6+1BbLWsJPs96wPB7MV+0/Y1b7kPZjO9uL5/fu8MMFsMABfOO8ioIHU/AAABcnpUWHRNT0wgcmRraXQgMjAyMi4wMy4yAAB4nH2TyU7EMAxA7/0K/8BE3uLEBw6zIIRgOhIM3Dly5/+F01FJR4pI6ihOn9146QRtvJ1evn/gb/BpmgDwn8fd4VMQcTpD28Dh8el5huN1f1hPjpeP+foOxEASNjHv2f31cl5PCOYv2GnSImQGmLAiFmmbZYT15/71gVae4QI7SeyZLMMOU9WaJW/4lRQ4wo6SI3k4DpKdzWhAaiMxFRZvPikxExcckDlITGbOos3ELIuPPm4BUtwtfC4esyuiDsASYISjqM0jJZRK7AOwLqDmbMLxWtUkjxx6cJy4FBOKK0hRNx5whEsstaouDis51joCo0S39Ek2D5dFi7mNSL6l3KoVq0GSU+XRxx/n010X3PricJlPvS/a5F72UEB6bUMB7QWkkNyrRCHWa0EhpWecQmrPK4V4Tx812aaJloU2+eC2EG/ibmq/XrT9YpS38W6ja/r6x8R++gUwHandS6uPqQAAALp6VFh0U01JTEVTIHJka2l0IDIwMjIuMDMuMgAAeJwdjrkNwzAMRVdJmQAywfuA4Uq9M0CQInt4+FBWRT0+fvJz/r7vScecPNfj85j0uJ6bgoZQDARMxC7HvglwWbMNITVNrBlBIdXNuNh9eQjBUm6ju8zEMXYE92LR5bmbVM9Sp7S4LCsde8cr6v1HSZJF1Mylj1B1sXYYOKIJgYSWr+BMVeF2kgoz7/1cYl5thUbcV3p6VwRUlDxe1x+BFzMYg6TfeQAAAABJRU5ErkJggg==\n", | |
"text/plain": [ | |
"<rdkit.Chem.rdchem.Mol at 0x7f35cda90220>" | |
] | |
}, | |
"execution_count": 8, | |
"metadata": {}, | |
"output_type": "execute_result" | |
} | |
], | |
"source": [ | |
"mol = dm.to_mol(\"[Na]OC1=CC2CCCCC2N=C1\")\n", | |
"mol" | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"execution_count": 9, | |
"id": "91a011a0-08a4-41f9-9bd0-c6ef326291e8", | |
"metadata": {}, | |
"outputs": [ | |
{ | |
"data": { | |
"image/svg+xml": [ | |
"<svg xmlns=\"http://www.w3.org/2000/svg\" xmlns:rdkit=\"http://www.rdkit.org/xml\" xmlns:xlink=\"http://www.w3.org/1999/xlink\" version=\"1.1\" baseProfile=\"full\" xml:space=\"preserve\" width=\"900px\" height=\"300px\" viewBox=\"0 0 900 300\">\n", | |
"<!-- END OF HEADER -->\n", | |
"<rect style=\"opacity:1.0;fill:#FFFFFF;stroke:none\" width=\"900.0\" height=\"300.0\" x=\"0.0\" y=\"0.0\"> </rect>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 44.2,168.1 L 65.6,159.9\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 65.6,159.9 L 87.1,151.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 87.1,151.6 L 130.4,186.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 100.6,148.1 L 130.9,172.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 130.4,186.5 L 182.4,166.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 182.4,166.5 L 225.8,201.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 225.8,201.5 L 277.8,181.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 277.8,181.4 L 286.4,126.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-6 atom-7\" d=\"M 286.4,126.4 L 243.0,91.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-7 atom-8\" d=\"M 243.0,91.4 L 191.0,111.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 191.0,111.4 L 175.4,98.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 175.4,98.8 L 159.8,86.2\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 132.2,82.4 L 114.0,89.5\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 114.0,89.5 L 95.7,96.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 130.8,94.9 L 118.0,99.9\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 118.0,99.9 L 105.2,104.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-10 atom-1\" d=\"M 95.7,96.5 L 87.1,151.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-8 atom-3\" d=\"M 191.0,111.4 L 182.4,166.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-0\" d=\"M 13.6 163.8 L 15.8 163.8 L 15.8 170.5 L 23.8 170.5 L 23.8 163.8 L 26.0 163.8 L 26.0 179.6 L 23.8 179.6 L 23.8 172.3 L 15.8 172.3 L 15.8 179.6 L 13.6 179.6 L 13.6 163.8 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-0\" d=\"M 27.9 171.7 Q 27.9 167.9, 29.7 165.8 Q 31.6 163.7, 35.1 163.7 Q 38.6 163.7, 40.5 165.8 Q 42.4 167.9, 42.4 171.7 Q 42.4 175.5, 40.5 177.7 Q 38.6 179.9, 35.1 179.9 Q 31.6 179.9, 29.7 177.7 Q 27.9 175.5, 27.9 171.7 M 35.1 178.1 Q 37.5 178.1, 38.8 176.5 Q 40.1 174.8, 40.1 171.7 Q 40.1 168.6, 38.8 167.0 Q 37.5 165.4, 35.1 165.4 Q 32.7 165.4, 31.4 167.0 Q 30.1 168.6, 30.1 171.7 Q 30.1 174.9, 31.4 176.5 Q 32.7 178.1, 35.1 178.1 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-9\" d=\"M 136.6 68.6 L 141.7 77.0 Q 142.2 77.8, 143.1 79.3 Q 143.9 80.8, 143.9 80.9 L 143.9 68.6 L 146.0 68.6 L 146.0 84.4 L 143.9 84.4 L 138.3 75.3 Q 137.7 74.2, 137.0 73.0 Q 136.3 71.7, 136.1 71.4 L 136.1 84.4 L 134.1 84.4 L 134.1 68.6 L 136.6 68.6 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"atom-9\" d=\"M 147.9 81.8 L 150.1 81.8 L 150.1 84.0 L 147.9 84.0 L 147.9 81.8 M 147.9 74.1 L 150.1 74.1 L 150.1 76.4 L 147.9 76.4 L 147.9 74.1 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"atom-9\" d=\"M 152.6 82.6 L 156.1 82.6 L 156.1 70.8 L 152.3 72.0 L 151.8 70.7 L 156.6 68.5 L 158.2 68.8 L 158.2 82.6 L 161.3 82.6 L 161.3 84.4 L 152.6 84.4 L 152.6 82.6 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"legend\" d=\"M 127.2 284.4 Q 127.2 282.4, 128.2 281.2 Q 129.2 280.1, 131.1 280.1 Q 132.9 280.1, 133.9 281.2 Q 135.0 282.4, 135.0 284.4 Q 135.0 286.4, 133.9 287.5 Q 132.9 288.6, 131.1 288.6 Q 129.2 288.6, 128.2 287.5 Q 127.2 286.4, 127.2 284.4 M 128.7 284.4 Q 128.7 285.9, 129.3 286.6 Q 129.9 287.4, 131.1 287.4 Q 132.2 287.4, 132.8 286.6 Q 133.4 285.9, 133.4 284.4 Q 133.4 282.9, 132.8 282.1 Q 132.2 281.3, 131.1 281.3 Q 129.9 281.3, 129.3 282.1 Q 128.7 282.9, 128.7 284.4 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 136.9 280.3 L 137.1 281.4 Q 138.0 280.1, 139.4 280.1 Q 139.8 280.1, 140.4 280.3 L 140.2 281.6 Q 139.5 281.5, 139.1 281.5 Q 138.4 281.5, 138.0 281.7 Q 137.6 282.0, 137.2 282.6 L 137.2 288.5 L 135.7 288.5 L 135.7 280.3 L 136.9 280.3 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 140.7 277.2 L 142.1 277.2 L 142.1 278.5 L 140.7 278.5 L 140.7 277.2 M 140.7 280.3 L 142.1 280.3 L 142.1 288.5 L 140.7 288.5 L 140.7 280.3 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 151.0 280.2 L 151.0 289.0 Q 151.0 292.5, 147.2 292.5 Q 145.4 292.5, 143.8 291.7 L 144.3 290.6 Q 145.2 291.0, 145.8 291.2 Q 146.4 291.3, 147.2 291.3 Q 148.4 291.3, 148.9 290.8 Q 149.5 290.2, 149.5 289.0 L 149.5 287.6 Q 148.6 288.6, 147.1 288.6 Q 145.4 288.6, 144.4 287.6 Q 143.5 286.5, 143.5 284.5 Q 143.5 282.4, 144.6 281.3 Q 145.8 280.1, 147.7 280.1 Q 148.8 280.1, 149.7 280.4 L 149.8 280.2 L 151.0 280.2 M 147.2 287.4 Q 148.0 287.4, 148.6 287.0 Q 149.2 286.5, 149.5 285.7 L 149.5 281.5 Q 148.7 281.3, 147.7 281.3 Q 146.5 281.3, 145.8 282.1 Q 145.0 283.0, 145.0 284.5 Q 145.0 285.9, 145.6 286.7 Q 146.2 287.4, 147.2 287.4 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 152.3 277.2 L 153.8 277.2 L 153.8 278.5 L 152.3 278.5 L 152.3 277.2 M 152.3 280.3 L 153.8 280.3 L 153.8 288.5 L 152.3 288.5 L 152.3 280.3 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 159.4 280.1 Q 160.8 280.1, 161.4 280.9 Q 162.1 281.6, 162.1 283.0 L 162.1 288.5 L 160.6 288.5 L 160.6 283.2 Q 160.6 282.2, 160.3 281.7 Q 159.9 281.3, 159.1 281.3 Q 158.3 281.3, 157.7 281.7 Q 157.1 282.0, 156.7 282.6 L 156.7 288.5 L 155.2 288.5 L 155.2 280.3 L 156.4 280.3 L 156.6 281.4 Q 157.7 280.1, 159.4 280.1 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 163.4 286.3 Q 163.4 284.9, 164.4 284.2 Q 165.5 283.5, 167.4 283.5 L 168.6 283.5 L 168.6 283.2 Q 168.6 282.2, 168.2 281.7 Q 167.8 281.3, 166.8 281.3 Q 166.1 281.3, 165.6 281.4 Q 165.1 281.5, 164.3 281.9 L 163.8 280.9 Q 165.3 280.1, 166.8 280.1 Q 168.5 280.1, 169.3 280.9 Q 170.1 281.6, 170.1 283.2 L 170.1 288.5 L 169.0 288.5 Q 169.0 288.4, 168.9 288.2 Q 168.9 287.9, 168.8 287.5 Q 167.6 288.7, 166.1 288.7 Q 164.8 288.7, 164.1 288.0 Q 163.4 287.4, 163.4 286.3 M 164.9 286.2 Q 164.9 286.8, 165.3 287.2 Q 165.6 287.5, 166.4 287.5 Q 167.0 287.5, 167.6 287.2 Q 168.2 286.9, 168.6 286.4 L 168.6 284.6 L 167.5 284.6 Q 166.2 284.6, 165.5 285.0 Q 164.9 285.4, 164.9 286.2 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 171.4 276.3 L 172.8 276.3 L 172.8 288.5 L 171.4 288.5 L 171.4 276.3 \" fill=\"#000000\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 335.1,162.9 L 356.5,154.7\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 356.5,154.7 L 378.0,146.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 339.1,173.3 L 360.5,165.0\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 360.5,165.0 L 382.0,156.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 380.0,151.6 L 423.3,186.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 423.3,186.5 L 475.3,166.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 475.3,166.5 L 518.7,201.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 518.7,201.5 L 570.6,181.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 570.6,181.4 L 579.2,126.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-6 atom-7\" d=\"M 579.2,126.4 L 535.9,91.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-7 atom-8\" d=\"M 535.9,91.4 L 483.9,111.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 483.9,111.4 L 468.3,98.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 468.3,98.8 L 452.7,86.2\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 425.1,82.4 L 406.8,89.5\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 406.8,89.5 L 388.6,96.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 423.6,94.9 L 410.9,99.9\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 410.9,99.9 L 398.1,104.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-10 atom-1\" d=\"M 388.6,96.5 L 380.0,151.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-8 atom-3\" d=\"M 483.9,111.4 L 475.3,166.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-0\" d=\"M 320.8 171.7 Q 320.8 167.9, 322.6 165.8 Q 324.5 163.7, 328.0 163.7 Q 331.5 163.7, 333.4 165.8 Q 335.2 167.9, 335.2 171.7 Q 335.2 175.5, 333.3 177.7 Q 331.5 179.9, 328.0 179.9 Q 324.5 179.9, 322.6 177.7 Q 320.8 175.5, 320.8 171.7 M 328.0 178.1 Q 330.4 178.1, 331.7 176.5 Q 333.0 174.8, 333.0 171.7 Q 333.0 168.6, 331.7 167.0 Q 330.4 165.4, 328.0 165.4 Q 325.6 165.4, 324.3 167.0 Q 323.0 168.6, 323.0 171.7 Q 323.0 174.9, 324.3 176.5 Q 325.6 178.1, 328.0 178.1 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-9\" d=\"M 429.4 68.6 L 434.6 77.0 Q 435.1 77.8, 435.9 79.3 Q 436.8 80.8, 436.8 80.9 L 436.8 68.6 L 438.9 68.6 L 438.9 84.4 L 436.7 84.4 L 431.2 75.3 Q 430.5 74.2, 429.9 73.0 Q 429.2 71.7, 429.0 71.4 L 429.0 84.4 L 426.9 84.4 L 426.9 68.6 L 429.4 68.6 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"atom-9\" d=\"M 440.8 81.8 L 443.0 81.8 L 443.0 84.0 L 440.8 84.0 L 440.8 81.8 M 440.8 74.1 L 443.0 74.1 L 443.0 76.4 L 440.8 76.4 L 440.8 74.1 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"atom-9\" d=\"M 445.5 82.6 L 449.0 82.6 L 449.0 70.8 L 445.2 72.0 L 444.7 70.7 L 449.5 68.5 L 451.1 68.8 L 451.1 82.6 L 454.2 82.6 L 454.2 84.4 L 445.5 84.4 L 445.5 82.6 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"legend\" d=\"M 421.8 284.1 L 423.2 284.1 L 420.3 292.3 L 418.4 292.3 L 415.5 284.1 L 417.1 284.1 L 419.4 291.0 L 421.8 284.1 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 423.4 290.1 Q 423.4 288.8, 424.4 288.1 Q 425.5 287.3, 427.4 287.3 L 428.6 287.3 L 428.6 287.0 Q 428.6 286.0, 428.2 285.6 Q 427.8 285.1, 426.8 285.1 Q 426.1 285.1, 425.6 285.3 Q 425.1 285.4, 424.3 285.7 L 423.8 284.7 Q 425.3 283.9, 426.8 283.9 Q 428.5 283.9, 429.3 284.7 Q 430.1 285.4, 430.1 287.0 L 430.1 292.3 L 429.0 292.3 Q 429.0 292.2, 428.9 292.0 Q 428.9 291.7, 428.8 291.3 Q 427.6 292.5, 426.1 292.5 Q 424.9 292.5, 424.1 291.8 Q 423.4 291.2, 423.4 290.1 M 424.9 290.1 Q 424.9 290.7, 425.3 291.0 Q 425.7 291.3, 426.4 291.3 Q 427.0 291.3, 427.6 291.0 Q 428.2 290.7, 428.6 290.2 L 428.6 288.5 L 427.5 288.5 Q 426.2 288.5, 425.5 288.9 Q 424.9 289.3, 424.9 290.1 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 432.6 284.1 L 432.8 285.2 Q 433.6 283.9, 435.0 283.9 Q 435.5 283.9, 436.1 284.1 L 435.9 285.4 Q 435.2 285.3, 434.8 285.3 Q 434.1 285.3, 433.7 285.6 Q 433.2 285.8, 432.9 286.4 L 432.9 292.3 L 431.4 292.3 L 431.4 284.1 L 432.6 284.1 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 436.3 281.0 L 437.8 281.0 L 437.8 282.4 L 436.3 282.4 L 436.3 281.0 M 436.3 284.1 L 437.8 284.1 L 437.8 292.3 L 436.3 292.3 L 436.3 284.1 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 439.2 290.1 Q 439.2 288.8, 440.2 288.1 Q 441.3 287.3, 443.2 287.3 L 444.5 287.3 L 444.5 287.0 Q 444.5 286.0, 444.0 285.6 Q 443.6 285.1, 442.6 285.1 Q 441.9 285.1, 441.4 285.3 Q 440.9 285.4, 440.1 285.7 L 439.7 284.7 Q 441.2 283.9, 442.6 283.9 Q 444.4 283.9, 445.2 284.7 Q 446.0 285.4, 446.0 287.0 L 446.0 292.3 L 444.8 292.3 Q 444.8 292.2, 444.7 292.0 Q 444.7 291.7, 444.6 291.3 Q 443.4 292.5, 441.9 292.5 Q 440.7 292.5, 439.9 291.8 Q 439.2 291.2, 439.2 290.1 M 440.7 290.1 Q 440.7 290.7, 441.1 291.0 Q 441.5 291.3, 442.2 291.3 Q 442.8 291.3, 443.4 291.0 Q 444.0 290.7, 444.5 290.2 L 444.5 288.5 L 443.3 288.5 Q 442.0 288.5, 441.3 288.9 Q 440.7 289.3, 440.7 290.1 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 451.5 283.9 Q 452.8 283.9, 453.5 284.7 Q 454.2 285.4, 454.2 286.9 L 454.2 292.3 L 452.7 292.3 L 452.7 287.0 Q 452.7 286.0, 452.3 285.6 Q 451.9 285.1, 451.1 285.1 Q 450.3 285.1, 449.7 285.5 Q 449.1 285.8, 448.7 286.4 L 448.7 292.3 L 447.2 292.3 L 447.2 284.1 L 448.4 284.1 L 448.6 285.2 Q 449.7 283.9, 451.5 283.9 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 455.4 285.2 L 455.4 284.1 L 457.0 284.1 L 457.2 281.7 L 458.4 281.7 L 458.4 284.1 L 460.9 284.1 L 460.9 285.2 L 458.4 285.2 L 458.4 289.8 Q 458.4 291.2, 459.6 291.2 Q 460.0 291.2, 460.7 291.0 L 461.0 292.0 Q 460.1 292.4, 459.3 292.4 Q 458.2 292.4, 457.5 291.8 Q 456.9 291.1, 456.9 289.9 L 456.9 285.2 L 455.4 285.2 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"\" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 477.1 285.3 L 474.9 285.3 L 474.4 288.2 L 476.6 288.2 L 476.4 289.3 L 474.2 289.3 L 473.7 292.3 L 472.4 292.3 L 472.9 289.3 L 470.2 289.3 L 469.7 292.3 L 468.5 292.3 L 469.0 289.3 L 466.7 289.3 L 466.9 288.2 L 469.2 288.2 L 469.7 285.3 L 467.4 285.3 L 467.6 284.1 L 469.9 284.1 L 470.4 281.0 L 471.6 281.0 L 471.1 284.1 L 473.8 284.1 L 474.3 281.0 L 475.6 281.0 L 475.1 284.1 L 477.3 284.1 L 477.1 285.3 M 473.1 288.2 L 473.6 285.3 L 470.9 285.3 L 470.4 288.2 L 473.1 288.2 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 478.3 291.0 L 480.7 291.0 L 480.7 282.6 L 478.0 283.4 L 477.6 282.5 L 481.1 280.9 L 482.3 281.1 L 482.3 291.0 L 484.5 291.0 L 484.5 292.3 L 478.3 292.3 L 478.3 291.0 \" fill=\"#000000\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 644.2,168.1 L 665.6,159.9\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 665.6,159.9 L 687.1,151.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 687.1,151.6 L 730.4,186.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 700.6,148.1 L 730.9,172.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 730.4,186.5 L 782.4,166.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 782.4,166.5 L 825.8,201.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 825.8,201.5 L 877.8,181.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 877.8,181.4 L 886.4,126.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-6 atom-7\" d=\"M 886.4,126.4 L 843.0,91.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-7 atom-8\" d=\"M 843.0,91.4 L 791.0,111.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 791.0,111.4 L 775.4,98.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 775.4,98.8 L 759.8,86.2\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 732.2,82.4 L 714.0,89.5\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 714.0,89.5 L 695.7,96.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 730.8,94.9 L 718.0,99.9\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 718.0,99.9 L 705.2,104.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-10 atom-1\" d=\"M 695.7,96.5 L 687.1,151.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-8 atom-3\" d=\"M 791.0,111.4 L 782.4,166.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-0\" d=\"M 613.6 163.8 L 615.8 163.8 L 615.8 170.5 L 623.8 170.5 L 623.8 163.8 L 626.0 163.8 L 626.0 179.6 L 623.8 179.6 L 623.8 172.3 L 615.8 172.3 L 615.8 179.6 L 613.6 179.6 L 613.6 163.8 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-0\" d=\"M 627.9 171.7 Q 627.9 167.9, 629.7 165.8 Q 631.6 163.7, 635.1 163.7 Q 638.6 163.7, 640.5 165.8 Q 642.4 167.9, 642.4 171.7 Q 642.4 175.5, 640.5 177.7 Q 638.6 179.9, 635.1 179.9 Q 631.6 179.9, 629.7 177.7 Q 627.9 175.5, 627.9 171.7 M 635.1 178.1 Q 637.5 178.1, 638.8 176.5 Q 640.1 174.8, 640.1 171.7 Q 640.1 168.6, 638.8 167.0 Q 637.5 165.4, 635.1 165.4 Q 632.7 165.4, 631.4 167.0 Q 630.1 168.6, 630.1 171.7 Q 630.1 174.9, 631.4 176.5 Q 632.7 178.1, 635.1 178.1 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-9\" d=\"M 736.6 68.6 L 741.7 77.0 Q 742.2 77.8, 743.1 79.3 Q 743.9 80.8, 743.9 80.9 L 743.9 68.6 L 746.0 68.6 L 746.0 84.4 L 743.9 84.4 L 738.3 75.3 Q 737.7 74.2, 737.0 73.0 Q 736.3 71.7, 736.1 71.4 L 736.1 84.4 L 734.1 84.4 L 734.1 68.6 L 736.6 68.6 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"atom-9\" d=\"M 747.9 81.8 L 750.1 81.8 L 750.1 84.0 L 747.9 84.0 L 747.9 81.8 M 747.9 74.1 L 750.1 74.1 L 750.1 76.4 L 747.9 76.4 L 747.9 74.1 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"atom-9\" d=\"M 752.6 82.6 L 756.1 82.6 L 756.1 70.8 L 752.3 72.0 L 751.8 70.7 L 756.6 68.5 L 758.2 68.8 L 758.2 82.6 L 761.3 82.6 L 761.3 84.4 L 752.6 84.4 L 752.6 82.6 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"legend\" d=\"M 721.4 284.1 L 722.8 284.1 L 719.9 292.3 L 718.0 292.3 L 715.1 284.1 L 716.7 284.1 L 719.0 291.0 L 721.4 284.1 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 723.0 290.1 Q 723.0 288.8, 724.0 288.1 Q 725.1 287.3, 727.0 287.3 L 728.2 287.3 L 728.2 287.0 Q 728.2 286.0, 727.8 285.6 Q 727.4 285.1, 726.4 285.1 Q 725.7 285.1, 725.2 285.3 Q 724.7 285.4, 723.9 285.7 L 723.4 284.7 Q 724.9 283.9, 726.4 283.9 Q 728.1 283.9, 728.9 284.7 Q 729.7 285.4, 729.7 287.0 L 729.7 292.3 L 728.6 292.3 Q 728.6 292.2, 728.5 292.0 Q 728.5 291.7, 728.4 291.3 Q 727.2 292.5, 725.7 292.5 Q 724.5 292.5, 723.7 291.8 Q 723.0 291.2, 723.0 290.1 M 724.5 290.1 Q 724.5 290.7, 724.9 291.0 Q 725.3 291.3, 726.0 291.3 Q 726.6 291.3, 727.2 291.0 Q 727.8 290.7, 728.2 290.2 L 728.2 288.5 L 727.1 288.5 Q 725.8 288.5, 725.1 288.9 Q 724.5 289.3, 724.5 290.1 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 732.2 284.1 L 732.4 285.2 Q 733.2 283.9, 734.6 283.9 Q 735.1 283.9, 735.7 284.1 L 735.5 285.4 Q 734.8 285.3, 734.4 285.3 Q 733.7 285.3, 733.3 285.6 Q 732.8 285.8, 732.5 286.4 L 732.5 292.3 L 731.0 292.3 L 731.0 284.1 L 732.2 284.1 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 735.9 281.0 L 737.4 281.0 L 737.4 282.4 L 735.9 282.4 L 735.9 281.0 M 735.9 284.1 L 737.4 284.1 L 737.4 292.3 L 735.9 292.3 L 735.9 284.1 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 738.8 290.1 Q 738.8 288.8, 739.8 288.1 Q 740.9 287.3, 742.8 287.3 L 744.1 287.3 L 744.1 287.0 Q 744.1 286.0, 743.6 285.6 Q 743.2 285.1, 742.2 285.1 Q 741.5 285.1, 741.0 285.3 Q 740.5 285.4, 739.7 285.7 L 739.3 284.7 Q 740.8 283.9, 742.2 283.9 Q 744.0 283.9, 744.8 284.7 Q 745.6 285.4, 745.6 287.0 L 745.6 292.3 L 744.4 292.3 Q 744.4 292.2, 744.3 292.0 Q 744.3 291.7, 744.2 291.3 Q 743.0 292.5, 741.5 292.5 Q 740.3 292.5, 739.5 291.8 Q 738.8 291.2, 738.8 290.1 M 740.3 290.1 Q 740.3 290.7, 740.7 291.0 Q 741.1 291.3, 741.8 291.3 Q 742.4 291.3, 743.0 291.0 Q 743.6 290.7, 744.1 290.2 L 744.1 288.5 L 742.9 288.5 Q 741.6 288.5, 740.9 288.9 Q 740.3 289.3, 740.3 290.1 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 751.1 283.9 Q 752.4 283.9, 753.1 284.7 Q 753.8 285.4, 753.8 286.9 L 753.8 292.3 L 752.3 292.3 L 752.3 287.0 Q 752.3 286.0, 751.9 285.6 Q 751.5 285.1, 750.7 285.1 Q 749.9 285.1, 749.3 285.5 Q 748.7 285.8, 748.3 286.4 L 748.3 292.3 L 746.8 292.3 L 746.8 284.1 L 748.0 284.1 L 748.2 285.2 Q 749.3 283.9, 751.1 283.9 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 755.0 285.2 L 755.0 284.1 L 756.6 284.1 L 756.8 281.7 L 758.0 281.7 L 758.0 284.1 L 760.5 284.1 L 760.5 285.2 L 758.0 285.2 L 758.0 289.8 Q 758.0 291.2, 759.2 291.2 Q 759.6 291.2, 760.3 291.0 L 760.6 292.0 Q 759.7 292.4, 758.9 292.4 Q 757.8 292.4, 757.1 291.8 Q 756.5 291.1, 756.5 289.9 L 756.5 285.2 L 755.0 285.2 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"\" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 776.7 285.3 L 774.5 285.3 L 774.0 288.2 L 776.2 288.2 L 776.0 289.3 L 773.8 289.3 L 773.3 292.3 L 772.0 292.3 L 772.5 289.3 L 769.8 289.3 L 769.3 292.3 L 768.1 292.3 L 768.6 289.3 L 766.3 289.3 L 766.5 288.2 L 768.8 288.2 L 769.3 285.3 L 767.0 285.3 L 767.2 284.1 L 769.5 284.1 L 770.0 281.0 L 771.2 281.0 L 770.7 284.1 L 773.4 284.1 L 773.9 281.0 L 775.2 281.0 L 774.7 284.1 L 776.9 284.1 L 776.7 285.3 M 772.7 288.2 L 773.2 285.3 L 770.5 285.3 L 770.0 288.2 L 772.7 288.2 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 777.3 283.1 Q 777.7 282.1, 778.7 281.5 Q 779.7 280.9, 781.1 280.9 Q 782.8 280.9, 783.7 281.8 Q 784.7 282.7, 784.7 284.4 Q 784.7 286.0, 783.4 287.6 Q 782.2 289.2, 779.6 291.0 L 784.9 291.0 L 784.9 292.3 L 777.2 292.3 L 777.2 291.2 Q 779.4 289.7, 780.6 288.6 Q 781.9 287.5, 782.5 286.5 Q 783.1 285.5, 783.1 284.4 Q 783.1 283.3, 782.5 282.7 Q 782.0 282.1, 781.1 282.1 Q 780.1 282.1, 779.5 282.5 Q 778.9 282.9, 778.5 283.7 L 777.3 283.1 \" fill=\"#000000\"/>\n", | |
"</svg>" | |
], | |
"text/plain": [ | |
"<IPython.core.display.SVG object>" | |
] | |
}, | |
"execution_count": 9, | |
"metadata": {}, | |
"output_type": "execute_result" | |
} | |
], | |
"source": [ | |
"mol = dm.to_mol(\"OC1=CC2CCCCC2[N:1]=C1\")\n", | |
"variants = dm.enumerate_tautomers(mol, n_variants=10)\n", | |
"\n", | |
"dm.to_image([mol] + variants, legends=[\"original\", \"variant #1\", \"variant #2\"])" | |
] | |
}, | |
{ | |
"cell_type": "markdown", | |
"id": "e007f2f9-7512-4e2d-9de0-574ed1f90fc0", | |
"metadata": {}, | |
"source": [ | |
"## `dm.convert`" | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"execution_count": 10, | |
"id": "f98521a1-1b4e-4a1c-8566-adb5ae6fc002", | |
"metadata": {}, | |
"outputs": [ | |
{ | |
"name": "stdout", | |
"output_type": "stream", | |
"text": [ | |
"SMILES: CC(=O)Oc1ccccc1C(=O)O\n", | |
"SELFIES: [C][C][=Branch1][C][=O][O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][O]\n", | |
"Inchi: InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12)\n", | |
"Inchikey: BSYNRYMUTXBXSQ-UHFFFAOYSA-N\n" | |
] | |
} | |
], | |
"source": [ | |
"mol = dm.to_mol(\"CC(=O)OC1=CC=CC=C1C(=O)O\")\n", | |
"\n", | |
"# To SMILES\n", | |
"print(f\"SMILES: {dm.to_smiles(mol)}\")\n", | |
"\n", | |
"# To SELFIES\n", | |
"print(f\"SELFIES: {dm.to_selfies(mol)}\")\n", | |
"\n", | |
"# To Inchi\n", | |
"print(f\"Inchi: {dm.to_inchi(mol)}\")\n", | |
"\n", | |
"# To Inchikey\n", | |
"print(f\"Inchikey: {dm.to_inchikey(mol)}\")\n", | |
"\n", | |
"# From Inchi\n", | |
"assert dm.same_mol(mol, dm.from_inchi(\"InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12)\"))\n", | |
"\n", | |
"# From SELFIES\n", | |
"assert dm.same_mol(\n", | |
" mol,\n", | |
" dm.from_selfies(\n", | |
" \"[C][C][=Branch1][C][=O][O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][O]\"\n", | |
" ),\n", | |
")" | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"execution_count": 11, | |
"id": "09a020aa-fa5b-4c82-a751-adcf4a345df6", | |
"metadata": {}, | |
"outputs": [ | |
{ | |
"data": { | |
"text/html": [ | |
"<div>\n", | |
"<style scoped>\n", | |
" .dataframe tbody tr th:only-of-type {\n", | |
" vertical-align: middle;\n", | |
" }\n", | |
"\n", | |
" .dataframe tbody tr th {\n", | |
" vertical-align: top;\n", | |
" }\n", | |
"\n", | |
" .dataframe thead th {\n", | |
" text-align: right;\n", | |
" }\n", | |
"</style>\n", | |
"<table border=\"1\" class=\"dataframe\">\n", | |
" <thead>\n", | |
" <tr style=\"text-align: right;\">\n", | |
" <th></th>\n", | |
" <th>iupac</th>\n", | |
" <th>smiles</th>\n", | |
" <th>expt</th>\n", | |
" <th>calc</th>\n", | |
" </tr>\n", | |
" </thead>\n", | |
" <tbody>\n", | |
" <tr>\n", | |
" <th>0</th>\n", | |
" <td>4-methoxy-N,N-dimethyl-benzamide</td>\n", | |
" <td>CN(C)C(=O)c1ccc(cc1)OC</td>\n", | |
" <td>-11.01</td>\n", | |
" <td>-9.625</td>\n", | |
" </tr>\n", | |
" <tr>\n", | |
" <th>1</th>\n", | |
" <td>methanesulfonyl chloride</td>\n", | |
" <td>CS(=O)(=O)Cl</td>\n", | |
" <td>-4.87</td>\n", | |
" <td>-6.219</td>\n", | |
" </tr>\n", | |
" <tr>\n", | |
" <th>2</th>\n", | |
" <td>3-methylbut-1-ene</td>\n", | |
" <td>CC(C)C=C</td>\n", | |
" <td>1.83</td>\n", | |
" <td>2.452</td>\n", | |
" </tr>\n", | |
" </tbody>\n", | |
"</table>\n", | |
"</div>" | |
], | |
"text/plain": [ | |
" iupac smiles expt calc\n", | |
"0 4-methoxy-N,N-dimethyl-benzamide CN(C)C(=O)c1ccc(cc1)OC -11.01 -9.625\n", | |
"1 methanesulfonyl chloride CS(=O)(=O)Cl -4.87 -6.219\n", | |
"2 3-methylbut-1-ene CC(C)C=C 1.83 2.452" | |
] | |
}, | |
"execution_count": 11, | |
"metadata": {}, | |
"output_type": "execute_result" | |
} | |
], | |
"source": [ | |
"# Load the Freesolv dataset\n", | |
"df = dm.data.freesolv()\n", | |
"df.head(3)" | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"execution_count": 12, | |
"id": "bff77a40-1a58-47c4-9c1a-4c9e9b793606", | |
"metadata": {}, | |
"outputs": [ | |
{ | |
"name": "stdout", | |
"output_type": "stream", | |
"text": [ | |
"{'iupac': '4-methoxy-N,N-dimethyl-benzamide', 'expt': -11.01, 'calc': -9.625}\n" | |
] | |
}, | |
{ | |
"data": { | |
"image/svg+xml": [ | |
"<svg xmlns=\"http://www.w3.org/2000/svg\" xmlns:rdkit=\"http://www.rdkit.org/xml\" xmlns:xlink=\"http://www.w3.org/1999/xlink\" version=\"1.1\" baseProfile=\"full\" xml:space=\"preserve\" width=\"600px\" height=\"300px\" viewBox=\"0 0 600 300\">\n", | |
"<!-- END OF HEADER -->\n", | |
"<rect style=\"opacity:1.0;fill:#FFFFFF;stroke:none\" width=\"600.0\" height=\"300.0\" x=\"0.0\" y=\"0.0\"> </rect>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 13.6,140.2 L 31.9,136.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 31.9,136.1 L 50.2,132.0\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 58.7,123.0 L 64.1,106.0\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 64.1,106.0 L 69.4,88.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-1 atom-3\" d=\"M 62.5,137.3 L 74.2,150.1\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-1 atom-3\" d=\"M 74.2,150.1 L 85.9,162.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 90.1,164.2 L 84.8,181.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 84.8,181.2 L 79.4,198.2\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 81.8,161.6 L 76.4,178.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 76.4,178.6 L 71.1,195.6\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-3 atom-5\" d=\"M 85.9,162.9 L 128.6,153.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 128.6,153.3 L 141.7,111.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 139.0,149.7 L 148.1,120.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-6 atom-7\" d=\"M 141.7,111.6 L 184.4,102.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-7 atom-8\" d=\"M 184.4,102.1 L 214.1,134.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-7 atom-8\" d=\"M 182.4,112.8 L 203.2,135.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 214.1,134.3 L 201.0,176.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 201.0,176.0 L 158.3,185.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 192.6,168.9 L 162.8,175.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-8 atom-11\" d=\"M 214.1,134.3 L 231.8,130.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-8 atom-11\" d=\"M 231.8,130.3 L 249.6,126.3\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-11 atom-12\" d=\"M 263.9,132.5 L 275.1,144.7\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-11 atom-12\" d=\"M 275.1,144.7 L 286.4,156.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-12 atom-10 atom-5\" d=\"M 158.3,185.6 L 128.6,153.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-1\" d=\"M 53.6 124.5 L 57.7 131.0 Q 58.1 131.7, 58.7 132.9 Q 59.4 134.0, 59.4 134.1 L 59.4 124.5 L 61.0 124.5 L 61.0 136.9 L 59.3 136.9 L 55.0 129.7 Q 54.5 128.8, 53.9 127.9 Q 53.4 126.9, 53.2 126.6 L 53.2 136.9 L 51.6 136.9 L 51.6 124.5 L 53.6 124.5 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"atom-4\" d=\"M 67.2 204.7 Q 67.2 201.7, 68.6 200.0 Q 70.1 198.4, 72.9 198.4 Q 75.6 198.4, 77.1 200.0 Q 78.5 201.7, 78.5 204.7 Q 78.5 207.7, 77.1 209.4 Q 75.6 211.1, 72.9 211.1 Q 70.1 211.1, 68.6 209.4 Q 67.2 207.7, 67.2 204.7 M 72.9 209.7 Q 74.7 209.7, 75.8 208.4 Q 76.8 207.1, 76.8 204.7 Q 76.8 202.2, 75.8 201.0 Q 74.7 199.8, 72.9 199.8 Q 71.0 199.8, 69.9 201.0 Q 68.9 202.2, 68.9 204.7 Q 68.9 207.2, 69.9 208.4 Q 71.0 209.7, 72.9 209.7 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-11\" d=\"M 251.1 124.8 Q 251.1 121.8, 252.5 120.1 Q 254.0 118.5, 256.8 118.5 Q 259.5 118.5, 261.0 120.1 Q 262.4 121.8, 262.4 124.8 Q 262.4 127.8, 261.0 129.5 Q 259.5 131.2, 256.8 131.2 Q 254.0 131.2, 252.5 129.5 Q 251.1 127.8, 251.1 124.8 M 256.8 129.8 Q 258.6 129.8, 259.7 128.5 Q 260.7 127.2, 260.7 124.8 Q 260.7 122.3, 259.7 121.1 Q 258.6 119.9, 256.8 119.9 Q 254.9 119.9, 253.8 121.1 Q 252.8 122.3, 252.8 124.8 Q 252.8 127.3, 253.8 128.5 Q 254.9 129.8, 256.8 129.8 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 409.3,172.0 L 425.5,162.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 425.5,162.6 L 441.7,153.2\" style=\"fill:none;fill-rule:evenodd;stroke:#CCCC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 450.4,143.2 L 463.1,135.9\" style=\"fill:none;fill-rule:evenodd;stroke:#CCCC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 463.1,135.9 L 475.7,128.5\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 454.8,150.8 L 467.4,143.4\" style=\"fill:none;fill-rule:evenodd;stroke:#CCCC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 467.4,143.4 L 480.1,136.1\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-1 atom-3\" d=\"M 455.5,155.9 L 462.0,167.0\" style=\"fill:none;fill-rule:evenodd;stroke:#CCCC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-1 atom-3\" d=\"M 462.0,167.0 L 468.4,178.1\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-1 atom-3\" d=\"M 448.0,160.2 L 454.4,171.3\" style=\"fill:none;fill-rule:evenodd;stroke:#CCCC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-1 atom-3\" d=\"M 454.4,171.3 L 460.8,182.5\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-1 atom-4\" d=\"M 442.8,142.5 L 435.1,129.3\" style=\"fill:none;fill-rule:evenodd;stroke:#CCCC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-1 atom-4\" d=\"M 435.1,129.3 L 427.5,116.1\" style=\"fill:none;fill-rule:evenodd;stroke:#00CC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-1\" d=\"M 443.7 154.3 Q 443.8 154.4, 444.4 154.6 Q 445.0 154.9, 445.6 155.0 Q 446.2 155.2, 446.9 155.2 Q 448.0 155.2, 448.7 154.6 Q 449.4 154.0, 449.4 153.0 Q 449.4 152.4, 449.0 151.9 Q 448.7 151.5, 448.2 151.3 Q 447.7 151.1, 446.8 150.8 Q 445.7 150.5, 445.0 150.2 Q 444.4 149.8, 443.9 149.2 Q 443.4 148.5, 443.4 147.4 Q 443.4 145.8, 444.5 144.9 Q 445.6 143.9, 447.7 143.9 Q 449.1 143.9, 450.7 144.6 L 450.3 145.9 Q 448.8 145.3, 447.7 145.3 Q 446.5 145.3, 445.8 145.8 Q 445.2 146.3, 445.2 147.2 Q 445.2 147.9, 445.5 148.3 Q 445.9 148.7, 446.4 148.9 Q 446.9 149.1, 447.7 149.4 Q 448.8 149.7, 449.5 150.1 Q 450.2 150.4, 450.6 151.1 Q 451.1 151.8, 451.1 153.0 Q 451.1 154.8, 450.0 155.7 Q 448.8 156.6, 446.9 156.6 Q 445.8 156.6, 445.0 156.4 Q 444.2 156.1, 443.2 155.7 L 443.7 154.3 \" fill=\"#CCCC00\"/>\n", | |
"<path class=\"atom-2\" d=\"M 479.4 128.3 Q 479.4 125.3, 480.8 123.6 Q 482.3 121.9, 485.0 121.9 Q 487.8 121.9, 489.3 123.6 Q 490.7 125.3, 490.7 128.3 Q 490.7 131.3, 489.2 133.0 Q 487.8 134.7, 485.0 134.7 Q 482.3 134.7, 480.8 133.0 Q 479.4 131.3, 479.4 128.3 M 485.0 133.3 Q 486.9 133.3, 488.0 132.0 Q 489.0 130.7, 489.0 128.3 Q 489.0 125.8, 488.0 124.6 Q 486.9 123.3, 485.0 123.3 Q 483.2 123.3, 482.1 124.6 Q 481.1 125.8, 481.1 128.3 Q 481.1 130.8, 482.1 132.0 Q 483.2 133.3, 485.0 133.3 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-3\" d=\"M 463.3 188.0 Q 463.3 185.0, 464.8 183.4 Q 466.3 181.7, 469.0 181.7 Q 471.8 181.7, 473.3 183.4 Q 474.7 185.0, 474.7 188.0 Q 474.7 191.0, 473.2 192.7 Q 471.7 194.4, 469.0 194.4 Q 466.3 194.4, 464.8 192.7 Q 463.3 191.0, 463.3 188.0 M 469.0 193.0 Q 470.9 193.0, 471.9 191.8 Q 473.0 190.5, 473.0 188.0 Q 473.0 185.6, 471.9 184.4 Q 470.9 183.1, 469.0 183.1 Q 467.1 183.1, 466.1 184.3 Q 465.1 185.6, 465.1 188.0 Q 465.1 190.5, 466.1 191.8 Q 467.1 193.0, 469.0 193.0 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-4\" d=\"M 414.2 112.6 Q 414.2 109.5, 415.7 107.9 Q 417.1 106.3, 419.9 106.3 Q 422.4 106.3, 423.8 108.1 L 422.6 109.1 Q 421.6 107.7, 419.9 107.7 Q 418.0 107.7, 417.0 109.0 Q 416.0 110.2, 416.0 112.6 Q 416.0 115.1, 417.0 116.3 Q 418.1 117.6, 420.0 117.6 Q 421.4 117.6, 423.0 116.8 L 423.5 118.1 Q 422.8 118.5, 421.9 118.8 Q 420.9 119.0, 419.8 119.0 Q 417.1 119.0, 415.7 117.4 Q 414.2 115.7, 414.2 112.6 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-4\" d=\"M 424.5 105.6 L 426.1 105.6 L 426.1 118.8 L 424.5 118.8 L 424.5 105.6 \" fill=\"#00CC00\"/>\n", | |
"</svg>" | |
], | |
"text/plain": [ | |
"<IPython.core.display.SVG object>" | |
] | |
}, | |
"execution_count": 12, | |
"metadata": {}, | |
"output_type": "execute_result" | |
} | |
], | |
"source": [ | |
"# Convert the dataframe to a list of mols\n", | |
"mols = dm.from_df(df, smiles_column=\"smiles\")\n", | |
"\n", | |
"# Dataframe columns are preserved as mol properties\n", | |
"print(mols[0].GetPropsAsDict())\n", | |
"\n", | |
"dm.to_image(mols[:2])" | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"execution_count": 14, | |
"id": "a560b5a9-f7a0-4c82-92d5-194f34debe79", | |
"metadata": {}, | |
"outputs": [ | |
{ | |
"data": { | |
"text/html": [ | |
"<div>\n", | |
"<style scoped>\n", | |
" .dataframe tbody tr th:only-of-type {\n", | |
" vertical-align: middle;\n", | |
" }\n", | |
"\n", | |
" .dataframe tbody tr th {\n", | |
" vertical-align: top;\n", | |
" }\n", | |
"\n", | |
" .dataframe thead th {\n", | |
" text-align: right;\n", | |
" }\n", | |
"</style>\n", | |
"<table border=\"1\" class=\"dataframe\">\n", | |
" <thead>\n", | |
" <tr style=\"text-align: right;\">\n", | |
" <th></th>\n", | |
" <th>smiles</th>\n", | |
" <th>mol</th>\n", | |
" <th>iupac</th>\n", | |
" <th>expt</th>\n", | |
" <th>calc</th>\n", | |
" </tr>\n", | |
" </thead>\n", | |
" <tbody>\n", | |
" <tr>\n", | |
" <th>0</th>\n", | |
" <td>COc1ccc(C(=O)N(C)C)cc1</td>\n", | |
" <td><img data-content=\"rdkit/molecule\" src=\"data:i...</td>\n", | |
" <td>4-methoxy-N,N-dimethyl-benzamide</td>\n", | |
" <td>-11.01</td>\n", | |
" <td>-9.625</td>\n", | |
" </tr>\n", | |
" <tr>\n", | |
" <th>1</th>\n", | |
" <td>CS(=O)(=O)Cl</td>\n", | |
" <td><img data-content=\"rdkit/molecule\" src=\"data:i...</td>\n", | |
" <td>methanesulfonyl chloride</td>\n", | |
" <td>-4.87</td>\n", | |
" <td>-6.219</td>\n", | |
" </tr>\n", | |
" </tbody>\n", | |
"</table>\n", | |
"</div>" | |
], | |
"text/plain": [ | |
" smiles mol \\\n", | |
"0 COc1ccc(C(=O)N(C)C)cc1 <img data-content=\"rdkit/molecule\" src=\"data:i... \n", | |
"1 CS(=O)(=O)Cl <img data-content=\"rdkit/molecule\" src=\"data:i... \n", | |
"\n", | |
" iupac expt calc \n", | |
"0 4-methoxy-N,N-dimethyl-benzamide -11.01 -9.625 \n", | |
"1 methanesulfonyl chloride -4.87 -6.219 " | |
] | |
}, | |
"execution_count": 14, | |
"metadata": {}, | |
"output_type": "execute_result" | |
} | |
], | |
"source": [ | |
"# Convert a list of molecule to a dataframe\n", | |
"df = dm.to_df(mols, mol_column=\"mol\")\n", | |
"df.head(2)" | |
] | |
}, | |
{ | |
"cell_type": "markdown", | |
"id": "f77aa4eb-e0c7-43a5-8c90-5f5aa999b741", | |
"metadata": {}, | |
"source": [ | |
"## `dm.io`" | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"execution_count": 15, | |
"id": "288673fd-60db-4bc6-9ded-52a7eec997d8", | |
"metadata": {}, | |
"outputs": [], | |
"source": [ | |
"# Load the Freesolv dataset\n", | |
"df = dm.data.freesolv()\n", | |
"\n", | |
"# Save a dataframe or a list of molecules to an SDF file\n", | |
"_, fpath = tempfile.mkstemp()\n", | |
"dm.to_sdf(df, urlpath=fpath, smiles_column=\"smiles\")" | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"execution_count": 17, | |
"id": "f10f249b-2d22-40d7-9a87-71b9bb7fbd62", | |
"metadata": {}, | |
"outputs": [ | |
{ | |
"name": "stdout", | |
"output_type": "stream", | |
"text": [ | |
"\n", | |
" RDKit 2D\n", | |
"\n", | |
" 13 13 0 0 0 0 0 0 0 0999 V2000\n", | |
" 5.2500 -1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n", | |
" 3.7500 -1.2990 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n", | |
" 3.0000 -2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n", | |
" 3.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n", | |
" 3.7500 1.2990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n", | |
" 1.5000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n" | |
] | |
} | |
], | |
"source": [ | |
"%%bash -s $fpath\n", | |
"head -n 10 $1" | |
] | |
}, | |
{ | |
"cell_type": "markdown", | |
"id": "708d926f-f335-4800-a88e-858044f3f841", | |
"metadata": {}, | |
"source": [ | |
"## `dm.cluster`" | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"execution_count": 33, | |
"id": "7a3e8741-0fb6-40a6-9899-b14842f853a3", | |
"metadata": {}, | |
"outputs": [ | |
{ | |
"data": { | |
"image/svg+xml": [ | |
"<svg xmlns=\"http://www.w3.org/2000/svg\" xmlns:rdkit=\"http://www.rdkit.org/xml\" xmlns:xlink=\"http://www.w3.org/1999/xlink\" version=\"1.1\" baseProfile=\"full\" xml:space=\"preserve\" width=\"300px\" height=\"200px\" viewBox=\"0 0 300 200\">\n", | |
"<!-- END OF HEADER -->\n", | |
"<rect style=\"opacity:1.0;fill:#FFFFFF;stroke:none\" width=\"300.0\" height=\"200.0\" x=\"0.0\" y=\"0.0\"> </rect>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 36.7,50.0 L 63.3,50.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 63.3,50.0 L 75.1,50.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 75.1,50.0 L 86.8,50.0\" style=\"fill:none;fill-rule:evenodd;stroke:#33CCCC;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-1 atom-3\" d=\"M 63.3,50.0 L 63.3,61.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-1 atom-3\" d=\"M 63.3,61.0 L 63.3,72.1\" style=\"fill:none;fill-rule:evenodd;stroke:#00CC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-1 atom-4\" d=\"M 63.3,50.0 L 63.3,39.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-1 atom-4\" d=\"M 63.3,39.1 L 63.3,28.3\" style=\"fill:none;fill-rule:evenodd;stroke:#00CC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-0 atom-5\" d=\"M 36.7,50.0 L 24.9,50.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-0 atom-5\" d=\"M 24.9,50.0 L 13.2,50.0\" style=\"fill:none;fill-rule:evenodd;stroke:#33CCCC;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-0 atom-6\" d=\"M 36.7,50.0 L 36.7,39.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-0 atom-6\" d=\"M 36.7,39.0 L 36.7,28.0\" style=\"fill:none;fill-rule:evenodd;stroke:#33CCCC;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-0 atom-7\" d=\"M 36.7,50.0 L 36.7,61.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-0 atom-7\" d=\"M 36.7,61.0 L 36.7,72.1\" style=\"fill:none;fill-rule:evenodd;stroke:#00CC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-2\" d=\"M 87.7 46.2 L 92.2 46.2 L 92.2 47.0 L 88.7 47.0 L 88.7 49.3 L 91.8 49.3 L 91.8 50.2 L 88.7 50.2 L 88.7 53.7 L 87.7 53.7 L 87.7 46.2 \" fill=\"#33CCCC\"/>\n", | |
"<path class=\"atom-3\" d=\"M 60.4 76.8 Q 60.4 75.0, 61.3 74.0 Q 62.2 73.0, 63.8 73.0 Q 65.4 73.0, 66.2 74.1 L 65.5 74.7 Q 64.9 73.9, 63.8 73.9 Q 62.7 73.9, 62.1 74.6 Q 61.5 75.4, 61.5 76.8 Q 61.5 78.3, 62.1 79.1 Q 62.7 79.9, 63.9 79.9 Q 64.8 79.9, 65.7 79.4 L 66.0 80.2 Q 65.7 80.4, 65.1 80.6 Q 64.5 80.7, 63.8 80.7 Q 62.2 80.7, 61.3 79.7 Q 60.4 78.7, 60.4 76.8 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-3\" d=\"M 66.6 72.5 L 67.6 72.5 L 67.6 80.6 L 66.6 80.6 L 66.6 72.5 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-4\" d=\"M 60.4 23.6 Q 60.4 21.7, 61.3 20.7 Q 62.2 19.7, 63.8 19.7 Q 65.4 19.7, 66.2 20.8 L 65.5 21.4 Q 64.9 20.6, 63.8 20.6 Q 62.7 20.6, 62.1 21.4 Q 61.5 22.1, 61.5 23.6 Q 61.5 25.1, 62.1 25.8 Q 62.7 26.6, 63.9 26.6 Q 64.8 26.6, 65.7 26.1 L 66.0 26.9 Q 65.7 27.2, 65.1 27.3 Q 64.5 27.5, 63.8 27.5 Q 62.2 27.5, 61.3 26.5 Q 60.4 25.5, 60.4 23.6 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-4\" d=\"M 66.6 19.3 L 67.6 19.3 L 67.6 27.4 L 66.6 27.4 L 66.6 19.3 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-5\" d=\"M 7.8 46.2 L 12.3 46.2 L 12.3 47.0 L 8.8 47.0 L 8.8 49.3 L 11.9 49.3 L 11.9 50.2 L 8.8 50.2 L 8.8 53.7 L 7.8 53.7 L 7.8 46.2 \" fill=\"#33CCCC\"/>\n", | |
"<path class=\"atom-6\" d=\"M 34.4 19.6 L 38.9 19.6 L 38.9 20.4 L 35.5 20.4 L 35.5 22.7 L 38.5 22.7 L 38.5 23.6 L 35.5 23.6 L 35.5 27.1 L 34.4 27.1 L 34.4 19.6 \" fill=\"#33CCCC\"/>\n", | |
"<path class=\"atom-7\" d=\"M 33.8 76.8 Q 33.8 75.0, 34.7 74.0 Q 35.5 73.0, 37.2 73.0 Q 38.8 73.0, 39.6 74.1 L 38.9 74.7 Q 38.3 73.9, 37.2 73.9 Q 36.1 73.9, 35.5 74.6 Q 34.9 75.4, 34.9 76.8 Q 34.9 78.3, 35.5 79.1 Q 36.1 79.9, 37.3 79.9 Q 38.2 79.9, 39.1 79.4 L 39.4 80.2 Q 39.0 80.4, 38.4 80.6 Q 37.8 80.7, 37.2 80.7 Q 35.5 80.7, 34.7 79.7 Q 33.8 78.7, 33.8 76.8 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-7\" d=\"M 40.0 72.5 L 41.0 72.5 L 41.0 80.6 L 40.0 80.6 L 40.0 72.5 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 132.5,50.0 L 159.1,50.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 159.1,50.0 L 170.9,50.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 170.9,50.0 L 182.6,50.0\" style=\"fill:none;fill-rule:evenodd;stroke:#33CCCC;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-1 atom-3\" d=\"M 159.1,50.0 L 159.1,61.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-1 atom-3\" d=\"M 159.1,61.0 L 159.1,72.0\" style=\"fill:none;fill-rule:evenodd;stroke:#33CCCC;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-1 atom-4\" d=\"M 159.1,50.0 L 159.1,39.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-1 atom-4\" d=\"M 159.1,39.0 L 159.1,28.0\" style=\"fill:none;fill-rule:evenodd;stroke:#33CCCC;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-0 atom-5\" d=\"M 132.5,50.0 L 126.3,41.9 L 128.6,40.6 Z\" style=\"fill:#000000;fill-rule:evenodd;fill-opacity:1;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;\"/>\n", | |
"<path class=\"bond-4 atom-0 atom-5\" d=\"M 126.3,41.9 L 124.7,31.1 L 120.1,33.8 Z\" style=\"fill:#33CCCC;fill-rule:evenodd;fill-opacity:1;stroke:#33CCCC;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;\"/>\n", | |
"<path class=\"bond-4 atom-0 atom-5\" d=\"M 126.3,41.9 L 128.6,40.6 L 124.7,31.1 Z\" style=\"fill:#33CCCC;fill-rule:evenodd;fill-opacity:1;stroke:#33CCCC;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;\"/>\n", | |
"<path class=\"bond-5 atom-0 atom-6\" d=\"M 132.5,50.0 L 126.6,60.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-0 atom-6\" d=\"M 126.6,60.2 L 120.7,70.4\" style=\"fill:none;fill-rule:evenodd;stroke:#7F4C19;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-2\" d=\"M 183.5 46.2 L 188.0 46.2 L 188.0 47.1 L 184.5 47.1 L 184.5 49.4 L 187.6 49.4 L 187.6 50.3 L 184.5 50.3 L 184.5 53.8 L 183.5 53.8 L 183.5 46.2 \" fill=\"#33CCCC\"/>\n", | |
"<path class=\"atom-3\" d=\"M 156.9 72.9 L 161.4 72.9 L 161.4 73.7 L 157.9 73.7 L 157.9 76.0 L 161.0 76.0 L 161.0 76.9 L 157.9 76.9 L 157.9 80.4 L 156.9 80.4 L 156.9 72.9 \" fill=\"#33CCCC\"/>\n", | |
"<path class=\"atom-4\" d=\"M 156.9 19.6 L 161.4 19.6 L 161.4 20.5 L 157.9 20.5 L 157.9 22.8 L 161.0 22.8 L 161.0 23.6 L 157.9 23.6 L 157.9 27.1 L 156.9 27.1 L 156.9 19.6 \" fill=\"#33CCCC\"/>\n", | |
"<path class=\"atom-5\" d=\"M 117.0 23.2 L 121.4 23.2 L 121.4 24.0 L 118.0 24.0 L 118.0 26.3 L 121.1 26.3 L 121.1 27.2 L 118.0 27.2 L 118.0 30.7 L 117.0 30.7 L 117.0 23.2 \" fill=\"#33CCCC\"/>\n", | |
"<path class=\"atom-6\" d=\"M 115.7 72.9 Q 116.4 73.1, 116.8 73.5 Q 117.1 73.9, 117.1 74.6 Q 117.1 75.6, 116.5 76.2 Q 115.8 76.8, 114.5 76.8 L 112.0 76.8 L 112.0 69.3 L 114.2 69.3 Q 115.5 69.3, 116.2 69.8 Q 116.8 70.3, 116.8 71.3 Q 116.8 72.4, 115.7 72.9 M 113.0 70.1 L 113.0 72.5 L 114.2 72.5 Q 115.0 72.5, 115.4 72.2 Q 115.8 71.9, 115.8 71.3 Q 115.8 70.1, 114.2 70.1 L 113.0 70.1 M 114.5 76.0 Q 115.3 76.0, 115.7 75.6 Q 116.1 75.3, 116.1 74.6 Q 116.1 74.0, 115.6 73.7 Q 115.2 73.4, 114.4 73.4 L 113.0 73.4 L 113.0 76.0 L 114.5 76.0 \" fill=\"#7F4C19\"/>\n", | |
"<path class=\"atom-6\" d=\"M 118.4 71.4 L 118.5 72.1 Q 119.1 71.3, 120.1 71.3 Q 120.4 71.3, 120.8 71.4 L 120.6 72.3 Q 120.1 72.2, 119.9 72.2 Q 119.4 72.2, 119.1 72.3 Q 118.9 72.5, 118.6 72.9 L 118.6 76.8 L 117.6 76.8 L 117.6 71.4 L 118.4 71.4 \" fill=\"#7F4C19\"/>\n", | |
"<path class=\"note\" d=\"M 134.3 42.9 Q 134.3 42.1, 134.6 41.5 Q 134.8 40.9, 135.2 40.2 L 135.5 40.4 Q 135.2 41.0, 135.0 41.6 Q 134.8 42.2, 134.8 42.9 Q 134.8 43.6, 135.0 44.2 Q 135.2 44.8, 135.5 45.4 L 135.2 45.6 Q 134.8 44.9, 134.6 44.3 Q 134.3 43.7, 134.3 42.9 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 137.7 44.4 L 136.8 42.9 L 136.8 42.9 L 136.2 42.9 L 136.2 44.4 L 135.6 44.4 L 135.6 40.7 L 136.8 40.7 Q 137.4 40.7, 137.7 40.9 Q 138.1 41.2, 138.1 41.8 Q 138.1 42.2, 137.9 42.4 Q 137.7 42.7, 137.3 42.8 L 138.2 44.4 L 137.7 44.4 M 136.2 42.4 L 136.8 42.4 Q 137.1 42.4, 137.3 42.3 Q 137.5 42.1, 137.5 41.8 Q 137.5 41.4, 137.3 41.3 Q 137.1 41.1, 136.8 41.1 L 136.2 41.1 L 136.2 42.4 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 139.5 42.9 Q 139.5 43.7, 139.3 44.3 Q 139.1 44.9, 138.7 45.6 L 138.4 45.4 Q 138.7 44.8, 138.9 44.2 Q 139.1 43.6, 139.1 42.9 Q 139.1 42.2, 138.9 41.6 Q 138.7 41.0, 138.4 40.4 L 138.7 40.2 Q 139.1 40.9, 139.3 41.5 Q 139.5 42.1, 139.5 42.9 \" fill=\"#000000\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 237.9,50.0 L 264.5,50.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 264.5,50.0 L 275.9,50.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 275.9,50.0 L 287.4,50.0\" style=\"fill:none;fill-rule:evenodd;stroke:#00CC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-1 atom-3\" d=\"M 264.5,50.0 L 264.5,61.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-1 atom-3\" d=\"M 264.5,61.0 L 264.5,72.1\" style=\"fill:none;fill-rule:evenodd;stroke:#00CC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-1 atom-4\" d=\"M 264.5,50.0 L 264.5,39.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-1 atom-4\" d=\"M 264.5,39.1 L 264.5,28.3\" style=\"fill:none;fill-rule:evenodd;stroke:#00CC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-0 atom-5\" d=\"M 237.9,50.0 L 225.3,50.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-0 atom-5\" d=\"M 225.3,50.0 L 212.6,50.0\" style=\"fill:none;fill-rule:evenodd;stroke:#00CC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-0 atom-6\" d=\"M 237.9,50.0 L 237.9,39.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-0 atom-6\" d=\"M 237.9,39.1 L 237.9,28.3\" style=\"fill:none;fill-rule:evenodd;stroke:#00CC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-0 atom-7\" d=\"M 237.9,50.0 L 237.9,61.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-0 atom-7\" d=\"M 237.9,61.0 L 237.9,72.1\" style=\"fill:none;fill-rule:evenodd;stroke:#00CC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-2\" d=\"M 288.2 50.2 Q 288.2 48.3, 289.1 47.4 Q 290.0 46.4, 291.7 46.4 Q 293.2 46.4, 294.0 47.5 L 293.3 48.0 Q 292.7 47.2, 291.7 47.2 Q 290.5 47.2, 289.9 48.0 Q 289.3 48.8, 289.3 50.2 Q 289.3 51.7, 289.9 52.5 Q 290.6 53.2, 291.8 53.2 Q 292.6 53.2, 293.6 52.7 L 293.9 53.5 Q 293.5 53.8, 292.9 53.9 Q 292.3 54.1, 291.6 54.1 Q 290.0 54.1, 289.1 53.1 Q 288.2 52.1, 288.2 50.2 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-2\" d=\"M 294.5 45.9 L 295.5 45.9 L 295.5 54.0 L 294.5 54.0 L 294.5 45.9 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-3\" d=\"M 261.6 76.8 Q 261.6 75.0, 262.5 74.0 Q 263.4 73.0, 265.0 73.0 Q 266.6 73.0, 267.4 74.1 L 266.7 74.7 Q 266.1 73.9, 265.0 73.9 Q 263.9 73.9, 263.3 74.6 Q 262.7 75.4, 262.7 76.8 Q 262.7 78.3, 263.3 79.1 Q 263.9 79.9, 265.2 79.9 Q 266.0 79.9, 267.0 79.4 L 267.3 80.2 Q 266.9 80.4, 266.3 80.6 Q 265.7 80.7, 265.0 80.7 Q 263.4 80.7, 262.5 79.7 Q 261.6 78.7, 261.6 76.8 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-3\" d=\"M 267.9 72.5 L 268.8 72.5 L 268.8 80.6 L 267.9 80.6 L 267.9 72.5 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-4\" d=\"M 261.6 23.6 Q 261.6 21.7, 262.5 20.7 Q 263.4 19.7, 265.0 19.7 Q 266.6 19.7, 267.4 20.8 L 266.7 21.4 Q 266.1 20.6, 265.0 20.6 Q 263.9 20.6, 263.3 21.4 Q 262.7 22.1, 262.7 23.6 Q 262.7 25.1, 263.3 25.8 Q 263.9 26.6, 265.2 26.6 Q 266.0 26.6, 267.0 26.1 L 267.3 26.9 Q 266.9 27.2, 266.3 27.3 Q 265.7 27.5, 265.0 27.5 Q 263.4 27.5, 262.5 26.5 Q 261.6 25.5, 261.6 23.6 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-4\" d=\"M 267.9 19.3 L 268.8 19.3 L 268.8 27.4 L 267.9 27.4 L 267.9 19.3 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-5\" d=\"M 204.5 50.2 Q 204.5 48.3, 205.4 47.4 Q 206.3 46.4, 208.0 46.4 Q 209.5 46.4, 210.4 47.5 L 209.7 48.0 Q 209.0 47.2, 208.0 47.2 Q 206.8 47.2, 206.2 48.0 Q 205.6 48.8, 205.6 50.2 Q 205.6 51.7, 206.2 52.5 Q 206.9 53.2, 208.1 53.2 Q 208.9 53.2, 209.9 52.7 L 210.2 53.5 Q 209.8 53.8, 209.2 53.9 Q 208.6 54.1, 207.9 54.1 Q 206.3 54.1, 205.4 53.1 Q 204.5 52.1, 204.5 50.2 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-5\" d=\"M 210.8 45.9 L 211.8 45.9 L 211.8 54.0 L 210.8 54.0 L 210.8 45.9 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-6\" d=\"M 235.0 23.6 Q 235.0 21.7, 235.9 20.7 Q 236.7 19.7, 238.4 19.7 Q 240.0 19.7, 240.8 20.8 L 240.1 21.4 Q 239.5 20.6, 238.4 20.6 Q 237.3 20.6, 236.7 21.4 Q 236.1 22.1, 236.1 23.6 Q 236.1 25.1, 236.7 25.8 Q 237.3 26.6, 238.5 26.6 Q 239.4 26.6, 240.3 26.1 L 240.6 26.9 Q 240.2 27.2, 239.6 27.3 Q 239.0 27.5, 238.4 27.5 Q 236.7 27.5, 235.9 26.5 Q 235.0 25.5, 235.0 23.6 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-6\" d=\"M 241.2 19.3 L 242.2 19.3 L 242.2 27.4 L 241.2 27.4 L 241.2 19.3 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-7\" d=\"M 235.0 76.8 Q 235.0 75.0, 235.9 74.0 Q 236.7 73.0, 238.4 73.0 Q 240.0 73.0, 240.8 74.1 L 240.1 74.7 Q 239.5 73.9, 238.4 73.9 Q 237.3 73.9, 236.7 74.6 Q 236.1 75.4, 236.1 76.8 Q 236.1 78.3, 236.7 79.1 Q 237.3 79.9, 238.5 79.9 Q 239.4 79.9, 240.3 79.4 L 240.6 80.2 Q 240.2 80.4, 239.6 80.6 Q 239.0 80.7, 238.4 80.7 Q 236.7 80.7, 235.9 79.7 Q 235.0 78.7, 235.0 76.8 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-7\" d=\"M 241.2 72.5 L 242.2 72.5 L 242.2 80.6 L 241.2 80.6 L 241.2 72.5 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 31.2,150.0 L 57.9,150.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 57.9,150.0 L 69.3,150.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 69.3,150.0 L 80.7,150.0\" style=\"fill:none;fill-rule:evenodd;stroke:#00CC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-1 atom-3\" d=\"M 57.9,150.0 L 57.9,161.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-1 atom-3\" d=\"M 57.9,161.0 L 57.9,172.1\" style=\"fill:none;fill-rule:evenodd;stroke:#00CC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-1 atom-4\" d=\"M 57.9,150.0 L 57.9,139.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-1 atom-4\" d=\"M 57.9,139.1 L 57.9,128.3\" style=\"fill:none;fill-rule:evenodd;stroke:#00CC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-0 atom-5\" d=\"M 31.2,150.0 L 25.3,139.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-0 atom-5\" d=\"M 25.3,139.6 L 19.3,129.3\" style=\"fill:none;fill-rule:evenodd;stroke:#00CC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-0 atom-6\" d=\"M 31.2,150.0 L 25.3,160.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-0 atom-6\" d=\"M 25.3,160.3 L 19.3,170.6\" style=\"fill:none;fill-rule:evenodd;stroke:#00CC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-2\" d=\"M 81.6 150.2 Q 81.6 148.3, 82.5 147.4 Q 83.3 146.4, 85.0 146.4 Q 86.6 146.4, 87.4 147.5 L 86.7 148.0 Q 86.1 147.2, 85.0 147.2 Q 83.9 147.2, 83.3 148.0 Q 82.7 148.8, 82.7 150.2 Q 82.7 151.7, 83.3 152.5 Q 83.9 153.2, 85.1 153.2 Q 86.0 153.2, 86.9 152.7 L 87.2 153.5 Q 86.8 153.8, 86.2 153.9 Q 85.6 154.1, 85.0 154.1 Q 83.3 154.1, 82.5 153.1 Q 81.6 152.1, 81.6 150.2 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-2\" d=\"M 87.8 145.9 L 88.8 145.9 L 88.8 154.0 L 87.8 154.0 L 87.8 145.9 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-3\" d=\"M 55.0 176.8 Q 55.0 175.0, 55.8 174.0 Q 56.7 173.0, 58.4 173.0 Q 59.9 173.0, 60.8 174.1 L 60.1 174.7 Q 59.5 173.9, 58.4 173.9 Q 57.2 173.9, 56.6 174.6 Q 56.0 175.4, 56.0 176.8 Q 56.0 178.3, 56.7 179.1 Q 57.3 179.9, 58.5 179.9 Q 59.3 179.9, 60.3 179.4 L 60.6 180.2 Q 60.2 180.4, 59.6 180.6 Q 59.0 180.7, 58.4 180.7 Q 56.7 180.7, 55.8 179.7 Q 55.0 178.7, 55.0 176.8 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-3\" d=\"M 61.2 172.5 L 62.2 172.5 L 62.2 180.6 L 61.2 180.6 L 61.2 172.5 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-4\" d=\"M 55.0 123.6 Q 55.0 121.7, 55.8 120.7 Q 56.7 119.7, 58.4 119.7 Q 59.9 119.7, 60.8 120.8 L 60.1 121.4 Q 59.5 120.6, 58.4 120.6 Q 57.2 120.6, 56.6 121.4 Q 56.0 122.1, 56.0 123.6 Q 56.0 125.1, 56.7 125.8 Q 57.3 126.6, 58.5 126.6 Q 59.3 126.6, 60.3 126.1 L 60.6 126.9 Q 60.2 127.2, 59.6 127.3 Q 59.0 127.5, 58.4 127.5 Q 56.7 127.5, 55.8 126.5 Q 55.0 125.5, 55.0 123.6 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-4\" d=\"M 61.2 119.3 L 62.2 119.3 L 62.2 127.4 L 61.2 127.4 L 61.2 119.3 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-5\" d=\"M 11.2 127.2 Q 11.2 125.3, 12.1 124.3 Q 13.0 123.3, 14.6 123.3 Q 16.2 123.3, 17.0 124.4 L 16.3 125.0 Q 15.7 124.2, 14.6 124.2 Q 13.5 124.2, 12.9 125.0 Q 12.3 125.7, 12.3 127.2 Q 12.3 128.6, 12.9 129.4 Q 13.5 130.2, 14.7 130.2 Q 15.6 130.2, 16.5 129.7 L 16.8 130.5 Q 16.5 130.7, 15.9 130.9 Q 15.3 131.0, 14.6 131.0 Q 13.0 131.0, 12.1 130.0 Q 11.2 129.0, 11.2 127.2 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-5\" d=\"M 17.4 122.9 L 18.4 122.9 L 18.4 130.9 L 17.4 130.9 L 17.4 122.9 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-6\" d=\"M 11.2 173.3 Q 11.2 171.4, 12.1 170.4 Q 13.0 169.4, 14.6 169.4 Q 16.2 169.4, 17.0 170.5 L 16.3 171.1 Q 15.7 170.3, 14.6 170.3 Q 13.5 170.3, 12.9 171.1 Q 12.3 171.8, 12.3 173.3 Q 12.3 174.8, 12.9 175.5 Q 13.5 176.3, 14.7 176.3 Q 15.6 176.3, 16.5 175.8 L 16.8 176.6 Q 16.5 176.8, 15.9 177.0 Q 15.3 177.1, 14.6 177.1 Q 13.0 177.1, 12.1 176.1 Q 11.2 175.1, 11.2 173.3 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-6\" d=\"M 17.4 169.0 L 18.4 169.0 L 18.4 177.0 L 17.4 177.0 L 17.4 169.0 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 132.5,150.0 L 159.1,150.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 159.1,150.0 L 170.9,150.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 170.9,150.0 L 182.6,150.0\" style=\"fill:none;fill-rule:evenodd;stroke:#33CCCC;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-1 atom-3\" d=\"M 159.1,150.0 L 159.1,161.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-1 atom-3\" d=\"M 159.1,161.0 L 159.1,172.0\" style=\"fill:none;fill-rule:evenodd;stroke:#33CCCC;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-1 atom-4\" d=\"M 159.1,150.0 L 159.1,139.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-1 atom-4\" d=\"M 159.1,139.0 L 159.1,128.0\" style=\"fill:none;fill-rule:evenodd;stroke:#33CCCC;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-0 atom-5\" d=\"M 132.5,150.0 L 125.8,141.1 L 128.1,139.8 Z\" style=\"fill:#000000;fill-rule:evenodd;fill-opacity:1;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;\"/>\n", | |
"<path class=\"bond-4 atom-0 atom-5\" d=\"M 125.8,141.1 L 123.7,129.5 L 119.1,132.2 Z\" style=\"fill:#00CC00;fill-rule:evenodd;fill-opacity:1;stroke:#00CC00;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;\"/>\n", | |
"<path class=\"bond-4 atom-0 atom-5\" d=\"M 125.8,141.1 L 128.1,139.8 L 123.7,129.5 Z\" style=\"fill:#00CC00;fill-rule:evenodd;fill-opacity:1;stroke:#00CC00;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;\"/>\n", | |
"<path class=\"bond-5 atom-0 atom-6\" d=\"M 132.5,150.0 L 126.6,160.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-0 atom-6\" d=\"M 126.6,160.2 L 120.7,170.4\" style=\"fill:none;fill-rule:evenodd;stroke:#7F4C19;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-2\" d=\"M 183.5 146.2 L 188.0 146.2 L 188.0 147.1 L 184.5 147.1 L 184.5 149.4 L 187.6 149.4 L 187.6 150.3 L 184.5 150.3 L 184.5 153.8 L 183.5 153.8 L 183.5 146.2 \" fill=\"#33CCCC\"/>\n", | |
"<path class=\"atom-3\" d=\"M 156.9 172.9 L 161.4 172.9 L 161.4 173.7 L 157.9 173.7 L 157.9 176.0 L 161.0 176.0 L 161.0 176.9 L 157.9 176.9 L 157.9 180.4 L 156.9 180.4 L 156.9 172.9 \" fill=\"#33CCCC\"/>\n", | |
"<path class=\"atom-4\" d=\"M 156.9 119.6 L 161.4 119.6 L 161.4 120.5 L 157.9 120.5 L 157.9 122.8 L 161.0 122.8 L 161.0 123.6 L 157.9 123.6 L 157.9 127.1 L 156.9 127.1 L 156.9 119.6 \" fill=\"#33CCCC\"/>\n", | |
"<path class=\"atom-5\" d=\"M 112.5 127.2 Q 112.5 125.3, 113.3 124.4 Q 114.2 123.4, 115.9 123.4 Q 117.4 123.4, 118.3 124.5 L 117.6 125.0 Q 117.0 124.2, 115.9 124.2 Q 114.8 124.2, 114.1 125.0 Q 113.5 125.8, 113.5 127.2 Q 113.5 128.7, 114.2 129.5 Q 114.8 130.2, 116.0 130.2 Q 116.8 130.2, 117.8 129.7 L 118.1 130.5 Q 117.7 130.8, 117.1 130.9 Q 116.5 131.1, 115.9 131.1 Q 114.2 131.1, 113.3 130.1 Q 112.5 129.1, 112.5 127.2 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-5\" d=\"M 118.7 122.9 L 119.7 122.9 L 119.7 131.0 L 118.7 131.0 L 118.7 122.9 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-6\" d=\"M 115.7 172.9 Q 116.4 173.1, 116.8 173.5 Q 117.1 173.9, 117.1 174.6 Q 117.1 175.6, 116.5 176.2 Q 115.8 176.8, 114.5 176.8 L 112.0 176.8 L 112.0 169.3 L 114.2 169.3 Q 115.5 169.3, 116.2 169.8 Q 116.8 170.3, 116.8 171.3 Q 116.8 172.4, 115.7 172.9 M 113.0 170.1 L 113.0 172.5 L 114.2 172.5 Q 115.0 172.5, 115.4 172.2 Q 115.8 171.9, 115.8 171.3 Q 115.8 170.1, 114.2 170.1 L 113.0 170.1 M 114.5 176.0 Q 115.3 176.0, 115.7 175.6 Q 116.1 175.3, 116.1 174.6 Q 116.1 174.0, 115.6 173.7 Q 115.2 173.4, 114.4 173.4 L 113.0 173.4 L 113.0 176.0 L 114.5 176.0 \" fill=\"#7F4C19\"/>\n", | |
"<path class=\"atom-6\" d=\"M 118.4 171.4 L 118.5 172.1 Q 119.1 171.3, 120.1 171.3 Q 120.4 171.3, 120.8 171.4 L 120.6 172.3 Q 120.1 172.2, 119.9 172.2 Q 119.4 172.2, 119.1 172.3 Q 118.9 172.5, 118.6 172.9 L 118.6 176.8 L 117.6 176.8 L 117.6 171.4 L 118.4 171.4 \" fill=\"#7F4C19\"/>\n", | |
"<path class=\"note\" d=\"M 134.3 142.9 Q 134.3 142.1, 134.6 141.5 Q 134.8 140.9, 135.2 140.2 L 135.5 140.4 Q 135.2 141.0, 135.0 141.6 Q 134.8 142.2, 134.8 142.9 Q 134.8 143.6, 135.0 144.2 Q 135.2 144.8, 135.5 145.4 L 135.2 145.6 Q 134.8 144.9, 134.6 144.3 Q 134.3 143.7, 134.3 142.9 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 137.7 144.4 L 136.8 142.9 L 136.8 142.9 L 136.2 142.9 L 136.2 144.4 L 135.6 144.4 L 135.6 140.7 L 136.8 140.7 Q 137.4 140.7, 137.7 140.9 Q 138.1 141.2, 138.1 141.8 Q 138.1 142.2, 137.9 142.4 Q 137.7 142.7, 137.3 142.8 L 138.2 144.4 L 137.7 144.4 M 136.2 142.4 L 136.8 142.4 Q 137.1 142.4, 137.3 142.3 Q 137.5 142.1, 137.5 141.8 Q 137.5 141.4, 137.3 141.3 Q 137.1 141.1, 136.8 141.1 L 136.2 141.1 L 136.2 142.4 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 139.5 142.9 Q 139.5 143.7, 139.3 144.3 Q 139.1 144.9, 138.7 145.6 L 138.4 145.4 Q 138.7 144.8, 138.9 144.2 Q 139.1 143.6, 139.1 142.9 Q 139.1 142.2, 138.9 141.6 Q 138.7 141.0, 138.4 140.4 L 138.7 140.2 Q 139.1 140.9, 139.3 141.5 Q 139.5 142.1, 139.5 142.9 \" fill=\"#000000\"/>\n", | |
"</svg>" | |
], | |
"text/plain": [ | |
"<IPython.core.display.SVG object>" | |
] | |
}, | |
"execution_count": 33, | |
"metadata": {}, | |
"output_type": "execute_result" | |
} | |
], | |
"source": [ | |
"# Get some mols\n", | |
"df = dm.data.freesolv()\n", | |
"mols = df[\"smiles\"].apply(dm.to_mol)\n", | |
"\n", | |
"# Cluster the mols\n", | |
"clusters, mol_clusters = dm.cluster_mols(mols, cutoff=0.5)\n", | |
"\n", | |
"# Cluster #1\n", | |
"dm.to_image(\n", | |
" mol_clusters[4],\n", | |
" mol_size=(100, 100),\n", | |
" n_cols=3,\n", | |
" max_mols=9,\n", | |
")" | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"execution_count": 35, | |
"id": "8bb89551-89fe-4077-b8a7-2ad1c4340f95", | |
"metadata": {}, | |
"outputs": [ | |
{ | |
"data": { | |
"image/svg+xml": [ | |
"<svg xmlns=\"http://www.w3.org/2000/svg\" xmlns:rdkit=\"http://www.rdkit.org/xml\" xmlns:xlink=\"http://www.w3.org/1999/xlink\" version=\"1.1\" baseProfile=\"full\" xml:space=\"preserve\" width=\"450px\" height=\"300px\" viewBox=\"0 0 450 300\">\n", | |
"<!-- END OF HEADER -->\n", | |
"<rect style=\"opacity:1.0;fill:#FFFFFF;stroke:none\" width=\"450.0\" height=\"300.0\" x=\"0.0\" y=\"0.0\"> </rect>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 75.8,56.0 L 82.5,52.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 82.5,52.1 L 89.1,48.3\" style=\"fill:none;fill-rule:evenodd;stroke:#00CC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-0 atom-2\" d=\"M 75.8,56.0 L 68.4,51.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-0 atom-2\" d=\"M 68.4,51.7 L 60.9,47.4\" style=\"fill:none;fill-rule:evenodd;stroke:#00CC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-1\" d=\"M 89.7 47.0 Q 89.7 45.7, 90.3 45.0 Q 90.9 44.3, 92.0 44.3 Q 93.1 44.3, 93.7 45.1 L 93.2 45.5 Q 92.8 45.0, 92.0 45.0 Q 91.3 45.0, 90.8 45.5 Q 90.4 46.0, 90.4 47.0 Q 90.4 48.0, 90.9 48.5 Q 91.3 49.1, 92.1 49.1 Q 92.7 49.1, 93.4 48.7 L 93.6 49.3 Q 93.3 49.5, 92.9 49.6 Q 92.5 49.7, 92.0 49.7 Q 90.9 49.7, 90.3 49.0 Q 89.7 48.3, 89.7 47.0 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-1\" d=\"M 94.0 44.0 L 94.6 44.0 L 94.6 49.6 L 94.0 49.6 L 94.0 44.0 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-2\" d=\"M 55.4 47.0 Q 55.4 45.7, 56.0 45.0 Q 56.6 44.3, 57.7 44.3 Q 58.8 44.3, 59.4 45.1 L 58.9 45.5 Q 58.4 45.0, 57.7 45.0 Q 56.9 45.0, 56.5 45.5 Q 56.1 46.0, 56.1 47.0 Q 56.1 48.0, 56.5 48.5 Q 57.0 49.1, 57.8 49.1 Q 58.4 49.1, 59.0 48.7 L 59.2 49.3 Q 59.0 49.5, 58.6 49.6 Q 58.1 49.7, 57.7 49.7 Q 56.6 49.7, 56.0 49.0 Q 55.4 48.3, 55.4 47.0 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-2\" d=\"M 59.6 44.0 L 60.3 44.0 L 60.3 49.6 L 59.6 49.6 L 59.6 44.0 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 255.6,50.0 L 246.5,65.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 251.1,50.5 L 244.7,61.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 246.5,65.9 L 228.2,65.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 228.2,65.9 L 219.0,50.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 230.0,61.6 L 223.6,50.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 219.0,50.0 L 228.2,34.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 228.2,34.1 L 246.5,34.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 230.9,37.8 L 243.7,37.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-3 atom-6\" d=\"M 219.0,50.0 L 211.0,50.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-3 atom-6\" d=\"M 211.0,50.0 L 203.0,50.0\" style=\"fill:none;fill-rule:evenodd;stroke:#CCCC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-5 atom-0\" d=\"M 246.5,34.1 L 255.6,50.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-6\" d=\"M 194.4 47.4 L 195.1 47.4 L 195.1 49.6 L 197.7 49.6 L 197.7 47.4 L 198.4 47.4 L 198.4 52.6 L 197.7 52.6 L 197.7 50.2 L 195.1 50.2 L 195.1 52.6 L 194.4 52.6 L 194.4 47.4 \" fill=\"#CCCC00\"/>\n", | |
"<path class=\"atom-6\" d=\"M 199.3 51.8 Q 199.3 51.8, 199.6 51.9 Q 199.8 52.0, 200.1 52.1 Q 200.3 52.1, 200.6 52.1 Q 201.1 52.1, 201.4 51.9 Q 201.7 51.7, 201.7 51.2 Q 201.7 51.0, 201.5 50.8 Q 201.4 50.6, 201.1 50.5 Q 200.9 50.4, 200.6 50.3 Q 200.1 50.2, 199.8 50.0 Q 199.6 49.9, 199.4 49.6 Q 199.2 49.3, 199.2 48.9 Q 199.2 48.2, 199.6 47.8 Q 200.0 47.4, 200.9 47.4 Q 201.5 47.4, 202.2 47.7 L 202.0 48.3 Q 201.4 48.0, 200.9 48.0 Q 200.4 48.0, 200.2 48.2 Q 199.9 48.4, 199.9 48.8 Q 199.9 49.1, 200.0 49.2 Q 200.2 49.4, 200.4 49.5 Q 200.6 49.6, 200.9 49.7 Q 201.4 49.9, 201.7 50.0 Q 202.0 50.1, 202.2 50.4 Q 202.4 50.7, 202.4 51.2 Q 202.4 52.0, 201.9 52.4 Q 201.4 52.7, 200.6 52.7 Q 200.2 52.7, 199.8 52.6 Q 199.5 52.5, 199.1 52.4 L 199.3 51.8 \" fill=\"#CCCC00\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 370.0,90.6 L 362.1,74.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 362.1,74.1 L 343.9,72.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 359.7,70.2 L 346.9,69.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 343.9,72.6 L 340.7,66.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 340.7,66.0 L 337.5,59.3\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 338.2,52.9 L 342.3,47.0\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 342.3,47.0 L 346.4,41.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 342.4,53.2 L 345.3,49.0\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 345.3,49.0 L 348.2,44.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 346.4,41.0 L 354.2,41.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 354.2,41.6 L 362.1,42.3\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 366.1,45.7 L 369.3,52.3\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 369.3,52.3 L 372.5,59.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 363.8,49.2 L 366.0,53.9\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 366.0,53.9 L 368.2,58.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-6 atom-7\" d=\"M 372.5,59.0 L 380.1,59.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-6 atom-7\" d=\"M 380.1,59.6 L 387.8,60.2\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-7 atom-8\" d=\"M 393.0,57.2 L 397.0,51.3\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-7 atom-8\" d=\"M 397.0,51.3 L 401.1,45.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 399.5,46.1 L 396.3,39.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 396.3,39.5 L 393.2,32.9\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 402.8,44.6 L 399.6,38.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 399.6,38.0 L 396.5,31.3\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-8 atom-10\" d=\"M 401.1,45.3 L 409.0,46.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-8 atom-10\" d=\"M 409.0,46.0 L 416.8,46.6\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-10 atom-11\" d=\"M 421.6,43.6 L 425.7,37.7\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-10 atom-11\" d=\"M 425.7,37.7 L 429.7,31.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-10 atom-12\" d=\"M 420.9,50.0 L 424.1,56.7\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-10 atom-12\" d=\"M 424.1,56.7 L 427.2,63.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-12 atom-4 atom-13\" d=\"M 346.4,41.0 L 343.2,34.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-12 atom-4 atom-13\" d=\"M 343.2,34.4 L 340.0,27.7\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-13 atom-13 atom-14\" d=\"M 340.7,21.3 L 344.8,15.4\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-13 atom-13 atom-14\" d=\"M 344.8,15.4 L 348.9,9.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-14 atom-13 atom-15\" d=\"M 335.9,24.3 L 328.1,23.7\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-14 atom-13 atom-15\" d=\"M 328.1,23.7 L 320.3,23.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-15 atom-2 atom-16\" d=\"M 343.9,72.6 L 333.5,87.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-16 atom-6 atom-1\" d=\"M 372.5,59.0 L 362.1,74.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-3\" d=\"M 334.9 53.5 L 336.6 56.2 Q 336.7 56.5, 337.0 57.0 Q 337.3 57.5, 337.3 57.5 L 337.3 53.5 L 338.0 53.5 L 338.0 58.7 L 337.3 58.7 L 335.4 55.7 Q 335.2 55.3, 335.0 54.9 Q 334.8 54.5, 334.7 54.4 L 334.7 58.7 L 334.0 58.7 L 334.0 53.5 L 334.9 53.5 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"atom-5\" d=\"M 363.5 39.9 L 365.2 42.6 Q 365.3 42.9, 365.6 43.4 Q 365.9 43.9, 365.9 43.9 L 365.9 39.9 L 366.6 39.9 L 366.6 45.1 L 365.9 45.1 L 364.1 42.1 Q 363.8 41.7, 363.6 41.3 Q 363.4 40.9, 363.3 40.8 L 363.3 45.1 L 362.7 45.1 L 362.7 39.9 L 363.5 39.9 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"atom-7\" d=\"M 388.4 60.4 Q 388.4 59.2, 389.0 58.5 Q 389.6 57.8, 390.7 57.8 Q 391.9 57.8, 392.5 58.5 Q 393.1 59.2, 393.1 60.4 Q 393.1 61.7, 392.5 62.4 Q 391.9 63.1, 390.7 63.1 Q 389.6 63.1, 389.0 62.4 Q 388.4 61.7, 388.4 60.4 M 390.7 62.5 Q 391.5 62.5, 392.0 62.0 Q 392.4 61.5, 392.4 60.4 Q 392.4 59.4, 392.0 58.9 Q 391.5 58.4, 390.7 58.4 Q 390.0 58.4, 389.5 58.9 Q 389.1 59.4, 389.1 60.4 Q 389.1 61.5, 389.5 62.0 Q 390.0 62.5, 390.7 62.5 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-9\" d=\"M 390.9 28.8 Q 390.9 27.6, 391.5 26.9 Q 392.1 26.2, 393.2 26.2 Q 394.4 26.2, 395.0 26.9 Q 395.6 27.6, 395.6 28.8 Q 395.6 30.1, 395.0 30.8 Q 394.4 31.5, 393.2 31.5 Q 392.1 31.5, 391.5 30.8 Q 390.9 30.1, 390.9 28.8 M 393.2 30.9 Q 394.0 30.9, 394.5 30.4 Q 394.9 29.9, 394.9 28.8 Q 394.9 27.8, 394.5 27.3 Q 394.0 26.8, 393.2 26.8 Q 392.5 26.8, 392.0 27.3 Q 391.6 27.8, 391.6 28.8 Q 391.6 29.9, 392.0 30.4 Q 392.5 30.9, 393.2 30.9 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-10\" d=\"M 418.2 44.2 L 419.9 46.9 Q 420.1 47.2, 420.4 47.7 Q 420.6 48.2, 420.6 48.2 L 420.6 44.2 L 421.3 44.2 L 421.3 49.4 L 420.6 49.4 L 418.8 46.4 Q 418.6 46.0, 418.4 45.6 Q 418.1 45.2, 418.1 45.1 L 418.1 49.4 L 417.4 49.4 L 417.4 44.2 L 418.2 44.2 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"atom-13\" d=\"M 337.4 21.9 L 339.1 24.6 Q 339.2 24.9, 339.5 25.4 Q 339.8 25.9, 339.8 25.9 L 339.8 21.9 L 340.5 21.9 L 340.5 27.1 L 339.8 27.1 L 337.9 24.1 Q 337.7 23.7, 337.5 23.3 Q 337.3 22.9, 337.2 22.8 L 337.2 27.1 L 336.5 27.1 L 336.5 21.9 L 337.4 21.9 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"bond-0 atom-1 atom-0\" d=\"M 94.3,152.3 L 94.4,151.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-0 atom-1 atom-0\" d=\"M 100.3,153.4 L 100.5,151.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-0 atom-1 atom-0\" d=\"M 106.4,154.5 L 106.6,150.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 88.2,151.3 L 78.0,166.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 78.0,166.4 L 59.7,165.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 59.7,165.1 L 51.7,148.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 51.7,148.6 L 62.0,133.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 62.0,133.5 L 69.6,134.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 69.6,134.0 L 77.3,134.6\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-5 atom-7\" d=\"M 60.5,129.0 L 59.4,129.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-5 atom-7\" d=\"M 59.1,124.6 L 56.9,125.6\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-5 atom-7\" d=\"M 57.6,120.1 L 54.3,121.7\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-4 atom-8\" d=\"M 51.7,148.6 L 44.3,149.0 L 44.5,147.2 Z\" style=\"fill:#000000;fill-rule:evenodd;fill-opacity:1;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;\"/>\n", | |
"<path class=\"bond-7 atom-4 atom-8\" d=\"M 44.3,149.0 L 37.2,145.7 L 36.9,149.4 Z\" style=\"fill:#FF0000;fill-rule:evenodd;fill-opacity:1;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;\"/>\n", | |
"<path class=\"bond-7 atom-4 atom-8\" d=\"M 44.3,149.0 L 44.5,147.2 L 37.2,145.7 Z\" style=\"fill:#FF0000;fill-rule:evenodd;fill-opacity:1;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;\"/>\n", | |
"<path class=\"bond-8 atom-3 atom-9\" d=\"M 56.6,168.5 L 57.7,169.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-3 atom-9\" d=\"M 53.6,172.0 L 55.6,173.3\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-3 atom-9\" d=\"M 50.5,175.4 L 53.5,177.4\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-2 atom-10\" d=\"M 78.0,166.4 L 81.8,172.4 L 80.2,173.2 Z\" style=\"fill:#000000;fill-rule:evenodd;fill-opacity:1;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;\"/>\n", | |
"<path class=\"bond-9 atom-2 atom-10\" d=\"M 81.8,172.4 L 82.4,179.9 L 85.7,178.3 Z\" style=\"fill:#FF0000;fill-rule:evenodd;fill-opacity:1;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;\"/>\n", | |
"<path class=\"bond-9 atom-2 atom-10\" d=\"M 81.8,172.4 L 80.2,173.2 L 82.4,179.9 Z\" style=\"fill:#FF0000;fill-rule:evenodd;fill-opacity:1;stroke:#FF0000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;\"/>\n", | |
"<path class=\"bond-10 atom-0 atom-11\" d=\"M 106.5,152.6 L 110.5,146.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-0 atom-11\" d=\"M 110.5,146.7 L 114.5,140.8\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-6 atom-1\" d=\"M 81.9,138.1 L 85.1,144.7\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-6 atom-1\" d=\"M 85.1,144.7 L 88.2,151.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-6\" d=\"M 77.9 134.8 Q 77.9 133.6, 78.5 132.9 Q 79.1 132.2, 80.3 132.2 Q 81.4 132.2, 82.0 132.9 Q 82.6 133.6, 82.6 134.8 Q 82.6 136.1, 82.0 136.8 Q 81.4 137.5, 80.3 137.5 Q 79.1 137.5, 78.5 136.8 Q 77.9 136.1, 77.9 134.8 M 80.3 136.9 Q 81.1 136.9, 81.5 136.4 Q 81.9 135.9, 81.9 134.8 Q 81.9 133.8, 81.5 133.3 Q 81.1 132.8, 80.3 132.8 Q 79.5 132.8, 79.0 133.3 Q 78.6 133.8, 78.6 134.8 Q 78.6 135.9, 79.0 136.4 Q 79.5 136.9, 80.3 136.9 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-7\" d=\"M 47.0 114.4 L 47.7 114.4 L 47.7 116.7 L 50.3 116.7 L 50.3 114.4 L 51.0 114.4 L 51.0 119.6 L 50.3 119.6 L 50.3 117.2 L 47.7 117.2 L 47.7 119.6 L 47.0 119.6 L 47.0 114.4 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-7\" d=\"M 51.7 117.0 Q 51.7 115.8, 52.3 115.1 Q 52.9 114.4, 54.0 114.4 Q 55.2 114.4, 55.8 115.1 Q 56.4 115.8, 56.4 117.0 Q 56.4 118.3, 55.8 119.0 Q 55.2 119.7, 54.0 119.7 Q 52.9 119.7, 52.3 119.0 Q 51.7 118.3, 51.7 117.0 M 54.0 119.1 Q 54.8 119.1, 55.3 118.6 Q 55.7 118.1, 55.7 117.0 Q 55.7 116.0, 55.3 115.5 Q 54.8 115.0, 54.0 115.0 Q 53.3 115.0, 52.8 115.5 Q 52.4 116.0, 52.4 117.0 Q 52.4 118.1, 52.8 118.6 Q 53.3 119.1, 54.0 119.1 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-8\" d=\"M 26.4 144.7 L 27.1 144.7 L 27.1 146.9 L 29.8 146.9 L 29.8 144.7 L 30.5 144.7 L 30.5 149.9 L 29.8 149.9 L 29.8 147.5 L 27.1 147.5 L 27.1 149.9 L 26.4 149.9 L 26.4 144.7 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-8\" d=\"M 31.1 147.3 Q 31.1 146.1, 31.7 145.4 Q 32.3 144.7, 33.5 144.7 Q 34.6 144.7, 35.2 145.4 Q 35.9 146.1, 35.9 147.3 Q 35.9 148.6, 35.2 149.3 Q 34.6 150.0, 33.5 150.0 Q 32.3 150.0, 31.7 149.3 Q 31.1 148.6, 31.1 147.3 M 33.5 149.4 Q 34.3 149.4, 34.7 148.9 Q 35.1 148.3, 35.1 147.3 Q 35.1 146.3, 34.7 145.8 Q 34.3 145.3, 33.5 145.3 Q 32.7 145.3, 32.3 145.8 Q 31.8 146.3, 31.8 147.3 Q 31.8 148.4, 32.3 148.9 Q 32.7 149.4, 33.5 149.4 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-9\" d=\"M 42.4 177.7 L 43.1 177.7 L 43.1 179.9 L 45.7 179.9 L 45.7 177.7 L 46.4 177.7 L 46.4 182.9 L 45.7 182.9 L 45.7 180.5 L 43.1 180.5 L 43.1 182.9 L 42.4 182.9 L 42.4 177.7 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-9\" d=\"M 47.0 180.3 Q 47.0 179.0, 47.7 178.3 Q 48.3 177.6, 49.4 177.6 Q 50.6 177.6, 51.2 178.3 Q 51.8 179.0, 51.8 180.3 Q 51.8 181.5, 51.2 182.2 Q 50.6 182.9, 49.4 182.9 Q 48.3 182.9, 47.7 182.2 Q 47.0 181.5, 47.0 180.3 M 49.4 182.4 Q 50.2 182.4, 50.6 181.8 Q 51.1 181.3, 51.1 180.3 Q 51.1 179.2, 50.6 178.7 Q 50.2 178.2, 49.4 178.2 Q 48.6 178.2, 48.2 178.7 Q 47.8 179.2, 47.8 180.3 Q 47.8 181.3, 48.2 181.8 Q 48.6 182.4, 49.4 182.4 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-10\" d=\"M 83.6 182.9 Q 83.6 181.7, 84.2 181.0 Q 84.8 180.3, 85.9 180.3 Q 87.1 180.3, 87.7 181.0 Q 88.3 181.7, 88.3 182.9 Q 88.3 184.2, 87.7 184.9 Q 87.1 185.6, 85.9 185.6 Q 84.8 185.6, 84.2 184.9 Q 83.6 184.2, 83.6 182.9 M 85.9 185.0 Q 86.7 185.0, 87.1 184.5 Q 87.6 184.0, 87.6 182.9 Q 87.6 181.9, 87.1 181.4 Q 86.7 180.9, 85.9 180.9 Q 85.1 180.9, 84.7 181.4 Q 84.3 181.9, 84.3 182.9 Q 84.3 184.0, 84.7 184.5 Q 85.1 185.0, 85.9 185.0 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-10\" d=\"M 88.7 180.3 L 89.4 180.3 L 89.4 182.6 L 92.0 182.6 L 92.0 180.3 L 92.7 180.3 L 92.7 185.5 L 92.0 185.5 L 92.0 183.1 L 89.4 183.1 L 89.4 185.5 L 88.7 185.5 L 88.7 180.3 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-11\" d=\"M 114.4 137.5 Q 114.4 136.3, 115.0 135.6 Q 115.6 134.9, 116.8 134.9 Q 117.9 134.9, 118.5 135.6 Q 119.2 136.3, 119.2 137.5 Q 119.2 138.8, 118.5 139.5 Q 117.9 140.2, 116.8 140.2 Q 115.6 140.2, 115.0 139.5 Q 114.4 138.8, 114.4 137.5 M 116.8 139.6 Q 117.6 139.6, 118.0 139.1 Q 118.4 138.5, 118.4 137.5 Q 118.4 136.5, 118.0 136.0 Q 117.6 135.4, 116.8 135.4 Q 116.0 135.4, 115.6 136.0 Q 115.1 136.5, 115.1 137.5 Q 115.1 138.5, 115.6 139.1 Q 116.0 139.6, 116.8 139.6 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-11\" d=\"M 119.5 134.9 L 120.2 134.9 L 120.2 137.1 L 122.9 137.1 L 122.9 134.9 L 123.6 134.9 L 123.6 140.1 L 122.9 140.1 L 122.9 137.7 L 120.2 137.7 L 120.2 140.1 L 119.5 140.1 L 119.5 134.9 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"note\" d=\"M 89.1 157.2 Q 89.1 156.7, 89.3 156.2 Q 89.4 155.8, 89.7 155.3 L 89.9 155.5 Q 89.7 155.9, 89.6 156.3 Q 89.4 156.7, 89.4 157.2 Q 89.4 157.7, 89.6 158.1 Q 89.7 158.5, 89.9 158.9 L 89.7 159.0 Q 89.4 158.6, 89.3 158.2 Q 89.1 157.7, 89.1 157.2 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 91.4 158.2 L 90.8 157.2 L 90.8 157.2 L 90.4 157.2 L 90.4 158.2 L 90.0 158.2 L 90.0 155.6 L 90.8 155.6 Q 91.2 155.6, 91.4 155.8 Q 91.7 156.0, 91.7 156.4 Q 91.7 156.7, 91.5 156.9 Q 91.4 157.0, 91.1 157.1 L 91.8 158.2 L 91.4 158.2 M 90.4 156.9 L 90.8 156.9 Q 91.0 156.9, 91.2 156.8 Q 91.3 156.6, 91.3 156.4 Q 91.3 156.2, 91.2 156.1 Q 91.0 155.9, 90.8 155.9 L 90.4 155.9 L 90.4 156.9 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 92.7 157.2 Q 92.7 157.7, 92.5 158.2 Q 92.4 158.6, 92.1 159.0 L 91.9 158.9 Q 92.1 158.5, 92.2 158.1 Q 92.4 157.7, 92.4 157.2 Q 92.4 156.7, 92.2 156.3 Q 92.1 155.9, 91.9 155.5 L 92.1 155.3 Q 92.4 155.8, 92.5 156.2 Q 92.7 156.7, 92.7 157.2 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 73.5 161.3 Q 73.5 160.8, 73.7 160.4 Q 73.8 160.0, 74.1 159.5 L 74.3 159.6 Q 74.1 160.1, 74.0 160.5 Q 73.9 160.8, 73.9 161.3 Q 73.9 161.8, 74.0 162.2 Q 74.1 162.6, 74.3 163.1 L 74.1 163.2 Q 73.8 162.7, 73.7 162.3 Q 73.5 161.9, 73.5 161.3 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 74.5 162.0 Q 74.6 162.0, 74.7 162.1 Q 74.8 162.1, 74.9 162.1 Q 75.1 162.2, 75.2 162.2 Q 75.4 162.2, 75.6 162.0 Q 75.7 161.9, 75.7 161.7 Q 75.7 161.6, 75.7 161.5 Q 75.6 161.4, 75.5 161.4 Q 75.4 161.3, 75.2 161.3 Q 75.0 161.2, 74.8 161.1 Q 74.7 161.0, 74.6 160.9 Q 74.5 160.8, 74.5 160.5 Q 74.5 160.2, 74.7 160.0 Q 74.9 159.8, 75.4 159.8 Q 75.7 159.8, 76.0 160.0 L 75.9 160.2 Q 75.6 160.1, 75.4 160.1 Q 75.1 160.1, 75.0 160.2 Q 74.8 160.3, 74.9 160.5 Q 74.9 160.6, 74.9 160.7 Q 75.0 160.8, 75.1 160.8 Q 75.2 160.9, 75.4 161.0 Q 75.6 161.0, 75.8 161.1 Q 75.9 161.2, 76.0 161.3 Q 76.1 161.5, 76.1 161.7 Q 76.1 162.1, 75.9 162.3 Q 75.6 162.5, 75.2 162.5 Q 75.0 162.5, 74.8 162.4 Q 74.6 162.4, 74.4 162.3 L 74.5 162.0 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 77.1 161.3 Q 77.1 161.9, 76.9 162.3 Q 76.8 162.7, 76.5 163.2 L 76.3 163.1 Q 76.5 162.6, 76.6 162.2 Q 76.7 161.8, 76.7 161.3 Q 76.7 160.8, 76.6 160.5 Q 76.5 160.1, 76.3 159.6 L 76.5 159.5 Q 76.8 160.0, 76.9 160.4 Q 77.1 160.8, 77.1 161.3 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 61.4 160.5 Q 61.4 159.9, 61.5 159.5 Q 61.7 159.1, 62.0 158.6 L 62.2 158.7 Q 61.9 159.2, 61.8 159.6 Q 61.7 160.0, 61.7 160.5 Q 61.7 161.0, 61.8 161.3 Q 61.9 161.7, 62.2 162.2 L 62.0 162.3 Q 61.7 161.9, 61.5 161.4 Q 61.4 161.0, 61.4 160.5 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 62.4 161.1 Q 62.4 161.1, 62.5 161.2 Q 62.6 161.2, 62.8 161.2 Q 62.9 161.3, 63.0 161.3 Q 63.3 161.3, 63.4 161.2 Q 63.6 161.0, 63.6 160.8 Q 63.6 160.7, 63.5 160.6 Q 63.4 160.5, 63.3 160.5 Q 63.2 160.4, 63.0 160.4 Q 62.8 160.3, 62.6 160.2 Q 62.5 160.2, 62.4 160.0 Q 62.3 159.9, 62.3 159.6 Q 62.3 159.3, 62.5 159.1 Q 62.8 158.9, 63.2 158.9 Q 63.5 158.9, 63.8 159.1 L 63.8 159.3 Q 63.4 159.2, 63.2 159.2 Q 63.0 159.2, 62.8 159.3 Q 62.7 159.4, 62.7 159.6 Q 62.7 159.7, 62.8 159.8 Q 62.8 159.9, 62.9 160.0 Q 63.0 160.0, 63.2 160.1 Q 63.4 160.1, 63.6 160.2 Q 63.7 160.3, 63.8 160.4 Q 63.9 160.6, 63.9 160.8 Q 63.9 161.2, 63.7 161.4 Q 63.4 161.6, 63.0 161.6 Q 62.8 161.6, 62.6 161.5 Q 62.5 161.5, 62.3 161.4 L 62.4 161.1 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 64.9 160.5 Q 64.9 161.0, 64.7 161.4 Q 64.6 161.9, 64.3 162.3 L 64.1 162.2 Q 64.3 161.7, 64.5 161.3 Q 64.6 161.0, 64.6 160.5 Q 64.6 160.0, 64.5 159.6 Q 64.3 159.2, 64.1 158.7 L 64.3 158.6 Q 64.6 159.1, 64.7 159.5 Q 64.9 159.9, 64.9 160.5 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 56.0 149.5 Q 56.0 149.0, 56.2 148.5 Q 56.3 148.1, 56.6 147.6 L 56.8 147.8 Q 56.6 148.2, 56.5 148.6 Q 56.4 149.0, 56.4 149.5 Q 56.4 150.0, 56.5 150.4 Q 56.6 150.8, 56.8 151.2 L 56.6 151.3 Q 56.3 150.9, 56.2 150.4 Q 56.0 150.0, 56.0 149.5 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 58.3 150.5 L 57.7 149.5 L 57.7 149.5 L 57.3 149.5 L 57.3 150.5 L 56.9 150.5 L 56.9 147.9 L 57.7 147.9 Q 58.1 147.9, 58.4 148.1 Q 58.6 148.3, 58.6 148.7 Q 58.6 149.0, 58.4 149.2 Q 58.3 149.3, 58.1 149.4 L 58.7 150.5 L 58.3 150.5 M 57.3 149.2 L 57.7 149.2 Q 57.9 149.2, 58.1 149.0 Q 58.2 148.9, 58.2 148.7 Q 58.2 148.5, 58.1 148.3 Q 57.9 148.2, 57.7 148.2 L 57.3 148.2 L 57.3 149.2 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 59.6 149.5 Q 59.6 150.0, 59.5 150.4 Q 59.3 150.9, 59.0 151.3 L 58.8 151.2 Q 59.0 150.8, 59.2 150.4 Q 59.3 150.0, 59.3 149.5 Q 59.3 149.0, 59.2 148.6 Q 59.0 148.2, 58.8 147.8 L 59.0 147.6 Q 59.3 148.1, 59.5 148.5 Q 59.6 149.0, 59.6 149.5 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 62.9 139.4 Q 62.9 138.9, 63.0 138.4 Q 63.2 138.0, 63.5 137.5 L 63.7 137.7 Q 63.5 138.1, 63.3 138.5 Q 63.2 138.9, 63.2 139.4 Q 63.2 139.9, 63.3 140.3 Q 63.5 140.7, 63.7 141.1 L 63.5 141.2 Q 63.2 140.8, 63.0 140.3 Q 62.9 139.9, 62.9 139.4 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 65.2 140.4 L 64.6 139.4 L 64.5 139.4 L 64.1 139.4 L 64.1 140.4 L 63.8 140.4 L 63.8 137.8 L 64.5 137.8 Q 65.0 137.8, 65.2 138.0 Q 65.4 138.2, 65.4 138.6 Q 65.4 138.9, 65.3 139.1 Q 65.2 139.2, 64.9 139.3 L 65.6 140.4 L 65.2 140.4 M 64.1 139.1 L 64.5 139.1 Q 64.8 139.1, 64.9 138.9 Q 65.1 138.8, 65.1 138.6 Q 65.1 138.4, 64.9 138.2 Q 64.8 138.1, 64.5 138.1 L 64.1 138.1 L 64.1 139.1 \" fill=\"#000000\"/>\n", | |
"<path class=\"note\" d=\"M 66.5 139.4 Q 66.5 139.9, 66.3 140.3 Q 66.2 140.8, 65.9 141.2 L 65.7 141.1 Q 65.9 140.7, 66.0 140.3 Q 66.1 139.9, 66.1 139.4 Q 66.1 138.9, 66.0 138.5 Q 65.9 138.1, 65.7 137.7 L 65.9 137.5 Q 66.2 138.0, 66.3 138.4 Q 66.5 138.9, 66.5 139.4 \" fill=\"#000000\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 238.8,150.0 L 229.6,165.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 234.2,150.5 L 227.8,161.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 229.6,165.8 L 211.3,165.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 211.3,165.8 L 202.2,150.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 213.1,161.6 L 206.7,150.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 202.2,150.0 L 211.3,134.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 211.3,134.1 L 229.6,134.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 214.1,137.8 L 226.9,137.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 229.6,134.1 L 233.2,127.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 233.2,127.9 L 236.8,121.7\" style=\"fill:none;fill-rule:evenodd;stroke:#00CC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-4 atom-7\" d=\"M 211.3,134.1 L 207.2,127.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-4 atom-7\" d=\"M 207.2,127.0 L 203.1,119.9\" style=\"fill:none;fill-rule:evenodd;stroke:#00CC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-3 atom-8\" d=\"M 202.2,150.0 L 193.5,150.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-3 atom-8\" d=\"M 193.5,150.0 L 184.8,150.0\" style=\"fill:none;fill-rule:evenodd;stroke:#00CC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-2 atom-9\" d=\"M 211.3,165.8 L 207.2,172.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-2 atom-9\" d=\"M 207.2,172.9 L 203.1,180.0\" style=\"fill:none;fill-rule:evenodd;stroke:#00CC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-1 atom-10\" d=\"M 229.6,165.8 L 233.3,172.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-1 atom-10\" d=\"M 233.3,172.2 L 237.0,178.6\" style=\"fill:none;fill-rule:evenodd;stroke:#00CC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-0 atom-11\" d=\"M 238.8,150.0 L 246.6,150.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-0 atom-11\" d=\"M 246.6,150.0 L 254.5,150.0\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-11 atom-12\" d=\"M 258.9,153.2 L 261.7,157.9\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-11 atom-12\" d=\"M 261.7,157.9 L 264.4,162.6\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-12 atom-11 atom-13\" d=\"M 257.3,145.9 L 260.0,141.2\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-12 atom-11 atom-13\" d=\"M 260.0,141.2 L 262.7,136.5\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-12 atom-11 atom-13\" d=\"M 260.5,147.7 L 263.2,143.0\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-12 atom-11 atom-13\" d=\"M 263.2,143.0 L 265.9,138.3\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-13 atom-5 atom-0\" d=\"M 229.6,134.1 L 238.8,150.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-6\" d=\"M 236.8 118.4 Q 236.8 117.2, 237.4 116.5 Q 238.0 115.8, 239.1 115.8 Q 240.2 115.8, 240.8 116.6 L 240.3 117.0 Q 239.9 116.4, 239.1 116.4 Q 238.4 116.4, 237.9 116.9 Q 237.5 117.4, 237.5 118.4 Q 237.5 119.5, 238.0 120.0 Q 238.4 120.5, 239.2 120.5 Q 239.8 120.5, 240.5 120.2 L 240.7 120.7 Q 240.4 120.9, 240.0 121.0 Q 239.6 121.1, 239.1 121.1 Q 238.0 121.1, 237.4 120.4 Q 236.8 119.7, 236.8 118.4 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-6\" d=\"M 241.1 115.5 L 241.7 115.5 L 241.7 121.0 L 241.1 121.0 L 241.1 115.5 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-7\" d=\"M 197.5 118.4 Q 197.5 117.2, 198.1 116.5 Q 198.8 115.8, 199.9 115.8 Q 201.0 115.8, 201.5 116.6 L 201.1 117.0 Q 200.6 116.4, 199.9 116.4 Q 199.1 116.4, 198.7 116.9 Q 198.3 117.4, 198.3 118.4 Q 198.3 119.5, 198.7 120.0 Q 199.2 120.5, 200.0 120.5 Q 200.6 120.5, 201.2 120.2 L 201.4 120.7 Q 201.2 120.9, 200.7 121.0 Q 200.3 121.1, 199.9 121.1 Q 198.8 121.1, 198.1 120.4 Q 197.5 119.7, 197.5 118.4 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-7\" d=\"M 201.8 115.5 L 202.5 115.5 L 202.5 121.0 L 201.8 121.0 L 201.8 115.5 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-8\" d=\"M 179.2 150.1 Q 179.2 148.9, 179.8 148.2 Q 180.5 147.5, 181.6 147.5 Q 182.7 147.5, 183.2 148.3 L 182.8 148.7 Q 182.3 148.1, 181.6 148.1 Q 180.8 148.1, 180.4 148.6 Q 180.0 149.2, 180.0 150.1 Q 180.0 151.2, 180.4 151.7 Q 180.8 152.2, 181.7 152.2 Q 182.3 152.2, 182.9 151.9 L 183.1 152.4 Q 182.9 152.6, 182.4 152.7 Q 182.0 152.8, 181.6 152.8 Q 180.5 152.8, 179.8 152.1 Q 179.2 151.4, 179.2 150.1 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-8\" d=\"M 183.5 147.2 L 184.2 147.2 L 184.2 152.7 L 183.5 152.7 L 183.5 147.2 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-9\" d=\"M 197.5 181.8 Q 197.5 180.6, 198.1 179.9 Q 198.8 179.2, 199.9 179.2 Q 201.0 179.2, 201.5 180.0 L 201.1 180.4 Q 200.6 179.8, 199.9 179.8 Q 199.1 179.8, 198.7 180.3 Q 198.3 180.9, 198.3 181.8 Q 198.3 182.9, 198.7 183.4 Q 199.2 183.9, 200.0 183.9 Q 200.6 183.9, 201.2 183.6 L 201.4 184.1 Q 201.2 184.3, 200.7 184.4 Q 200.3 184.5, 199.9 184.5 Q 198.8 184.5, 198.1 183.8 Q 197.5 183.1, 197.5 181.8 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-9\" d=\"M 201.8 178.9 L 202.5 178.9 L 202.5 184.4 L 201.8 184.4 L 201.8 178.9 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-10\" d=\"M 236.8 181.8 Q 236.8 180.6, 237.4 179.9 Q 238.0 179.2, 239.1 179.2 Q 240.2 179.2, 240.8 180.0 L 240.3 180.4 Q 239.9 179.8, 239.1 179.8 Q 238.4 179.8, 237.9 180.3 Q 237.5 180.9, 237.5 181.8 Q 237.5 182.9, 238.0 183.4 Q 238.4 183.9, 239.2 183.9 Q 239.8 183.9, 240.5 183.6 L 240.7 184.1 Q 240.4 184.3, 240.0 184.4 Q 239.6 184.5, 239.1 184.5 Q 238.0 184.5, 237.4 183.8 Q 236.8 183.1, 236.8 181.8 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-10\" d=\"M 241.1 178.9 L 241.7 178.9 L 241.7 184.4 L 241.1 184.4 L 241.1 178.9 \" fill=\"#00CC00\"/>\n", | |
"<path class=\"atom-11\" d=\"M 255.9 147.4 L 257.6 150.1 Q 257.8 150.4, 258.1 150.9 Q 258.3 151.4, 258.4 151.4 L 258.4 147.4 L 259.1 147.4 L 259.1 152.6 L 258.3 152.6 L 256.5 149.6 Q 256.3 149.2, 256.1 148.8 Q 255.9 148.4, 255.8 148.3 L 255.8 152.6 L 255.1 152.6 L 255.1 147.4 L 255.9 147.4 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"atom-11\" d=\"M 259.7 148.3 L 260.6 148.3 L 260.6 147.3 L 261.0 147.3 L 261.0 148.3 L 261.9 148.3 L 261.9 148.7 L 261.0 148.7 L 261.0 149.6 L 260.6 149.6 L 260.6 148.7 L 259.7 148.7 L 259.7 148.3 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"atom-12\" d=\"M 263.9 165.8 Q 263.9 164.6, 264.5 163.9 Q 265.1 163.2, 266.2 163.2 Q 267.4 163.2, 268.0 163.9 Q 268.6 164.6, 268.6 165.8 Q 268.6 167.1, 268.0 167.8 Q 267.4 168.5, 266.2 168.5 Q 265.1 168.5, 264.5 167.8 Q 263.9 167.1, 263.9 165.8 M 266.2 167.9 Q 267.0 167.9, 267.5 167.4 Q 267.9 166.9, 267.9 165.8 Q 267.9 164.8, 267.5 164.3 Q 267.0 163.8, 266.2 163.8 Q 265.4 163.8, 265.0 164.3 Q 264.6 164.8, 264.6 165.8 Q 264.6 166.9, 265.0 167.4 Q 265.4 167.9, 266.2 167.9 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-12\" d=\"M 269.0 164.0 L 270.8 164.0 L 270.8 164.4 L 269.0 164.4 L 269.0 164.0 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-13\" d=\"M 263.9 134.1 Q 263.9 132.9, 264.5 132.2 Q 265.1 131.5, 266.2 131.5 Q 267.4 131.5, 268.0 132.2 Q 268.6 132.9, 268.6 134.1 Q 268.6 135.4, 268.0 136.1 Q 267.4 136.8, 266.2 136.8 Q 265.1 136.8, 264.5 136.1 Q 263.9 135.4, 263.9 134.1 M 266.2 136.2 Q 267.0 136.2, 267.5 135.7 Q 267.9 135.2, 267.9 134.1 Q 267.9 133.1, 267.5 132.6 Q 267.0 132.1, 266.2 132.1 Q 265.4 132.1, 265.0 132.6 Q 264.6 133.1, 264.6 134.1 Q 264.6 135.2, 265.0 135.7 Q 265.4 136.2, 266.2 136.2 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 306.8,152.0 L 322.7,142.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 322.7,142.8 L 338.5,152.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 338.5,152.0 L 354.4,142.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 354.4,142.8 L 370.2,152.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 370.2,152.0 L 386.1,142.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 386.1,142.8 L 401.9,152.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-6 atom-7\" d=\"M 401.9,152.0 L 417.8,142.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-7 atom-8\" d=\"M 417.8,142.8 L 424.4,146.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-7 atom-8\" d=\"M 424.4,146.7 L 431.1,150.5\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-8\" d=\"M 432.5 149.4 L 434.2 152.1 Q 434.3 152.4, 434.6 152.9 Q 434.9 153.4, 434.9 153.4 L 434.9 149.4 L 435.6 149.4 L 435.6 154.6 L 434.9 154.6 L 433.1 151.6 Q 432.8 151.2, 432.6 150.8 Q 432.4 150.4, 432.3 150.3 L 432.3 154.6 L 431.7 154.6 L 431.7 149.4 L 432.5 149.4 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"atom-8\" d=\"M 436.2 149.4 L 436.9 149.4 L 436.9 151.6 L 439.6 151.6 L 439.6 149.4 L 440.3 149.4 L 440.3 154.6 L 439.6 154.6 L 439.6 152.2 L 436.9 152.2 L 436.9 154.6 L 436.2 154.6 L 436.2 149.4 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"atom-8\" d=\"M 440.9 154.4 Q 441.0 154.1, 441.3 153.9 Q 441.6 153.7, 442.0 153.7 Q 442.5 153.7, 442.8 154.0 Q 443.1 154.3, 443.1 154.8 Q 443.1 155.3, 442.7 155.7 Q 442.4 156.2, 441.6 156.8 L 443.2 156.8 L 443.2 157.2 L 440.9 157.2 L 440.9 156.8 Q 441.5 156.4, 441.9 156.1 Q 442.3 155.7, 442.5 155.4 Q 442.6 155.1, 442.6 154.8 Q 442.6 154.5, 442.5 154.3 Q 442.3 154.1, 442.0 154.1 Q 441.8 154.1, 441.6 154.2 Q 441.4 154.3, 441.3 154.6 L 440.9 154.4 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 90.1,245.9 L 79.3,231.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 85.5,245.8 L 78.0,235.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 79.3,231.0 L 71.9,233.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 71.9,233.5 L 64.5,235.9\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 61.9,239.9 L 61.9,247.5\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 61.9,247.5 L 61.9,255.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 65.6,242.2 L 65.6,247.5\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 65.6,247.5 L 65.6,252.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 61.9,255.0 L 69.3,257.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 69.3,257.4 L 76.7,259.8\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-0\" d=\"M 81.6,257.5 L 85.8,251.7\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-0\" d=\"M 85.8,251.7 L 90.1,245.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-2\" d=\"M 60.8 234.1 L 62.5 236.9 Q 62.6 237.1, 62.9 237.6 Q 63.2 238.1, 63.2 238.1 L 63.2 234.1 L 63.9 234.1 L 63.9 239.3 L 63.2 239.3 L 61.3 236.3 Q 61.1 235.9, 60.9 235.5 Q 60.7 235.1, 60.6 235.0 L 60.6 239.3 L 59.9 239.3 L 59.9 234.1 L 60.8 234.1 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"atom-4\" d=\"M 78.2 258.1 L 79.9 260.8 Q 80.0 261.1, 80.3 261.6 Q 80.6 262.1, 80.6 262.1 L 80.6 258.1 L 81.3 258.1 L 81.3 263.3 L 80.6 263.3 L 78.7 260.3 Q 78.5 259.9, 78.3 259.5 Q 78.1 259.1, 78.0 259.0 L 78.0 263.3 L 77.3 263.3 L 77.3 258.1 L 78.2 258.1 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"atom-4\" d=\"M 77.3 263.8 L 78.0 263.8 L 78.0 266.0 L 80.6 266.0 L 80.6 263.8 L 81.3 263.8 L 81.3 269.0 L 80.6 269.0 L 80.6 266.6 L 78.0 266.6 L 78.0 269.0 L 77.3 269.0 L 77.3 263.8 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 163.0,284.6 L 168.4,279.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 168.4,279.5 L 173.9,274.5\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 175.7,268.9 L 174.1,261.6\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 174.1,261.6 L 172.4,254.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-1 atom-3\" d=\"M 179.0,272.9 L 186.5,275.2\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-1 atom-3\" d=\"M 186.5,275.2 L 193.9,277.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 193.9,277.6 L 207.4,265.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 207.4,265.1 L 224.8,270.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 224.8,270.6 L 238.3,258.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 224.4,266.0 L 233.8,257.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-6 atom-7\" d=\"M 238.3,258.2 L 255.3,264.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-7 atom-8\" d=\"M 255.3,264.9 L 255.3,283.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-7 atom-8\" d=\"M 259.0,267.6 L 258.9,280.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 255.3,283.2 L 271.1,292.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 271.1,292.4 L 287.0,283.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 271.7,287.8 L 282.8,281.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-10 atom-11\" d=\"M 287.0,283.2 L 287.0,264.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-11 atom-12\" d=\"M 287.0,264.9 L 271.2,255.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-11 atom-12\" d=\"M 282.8,266.7 L 271.7,260.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-12 atom-12 atom-13\" d=\"M 271.2,255.8 L 273.9,237.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-13 atom-13 atom-14\" d=\"M 273.9,237.7 L 261.5,224.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-14 atom-14 atom-15\" d=\"M 261.5,224.2 L 243.3,225.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-15 atom-15 atom-16\" d=\"M 243.3,225.6 L 232.9,240.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-15 atom-15 atom-16\" d=\"M 238.7,225.7 L 231.5,236.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-16 atom-16 atom-17\" d=\"M 232.9,240.7 L 214.7,239.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-17 atom-17 atom-18\" d=\"M 214.7,239.2 L 206.8,222.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-17 atom-17 atom-18\" d=\"M 216.8,235.2 L 211.3,223.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-18 atom-18 atom-19\" d=\"M 206.8,222.7 L 217.1,207.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-19 atom-19 atom-20\" d=\"M 217.1,207.6 L 235.4,209.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-19 atom-19 atom-20\" d=\"M 219.6,211.5 L 232.3,212.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-20 atom-16 atom-6\" d=\"M 232.9,240.7 L 238.3,258.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-21 atom-12 atom-7\" d=\"M 271.2,255.8 L 255.3,264.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-22 atom-20 atom-15\" d=\"M 235.4,209.0 L 243.3,225.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-1\" d=\"M 175.3 269.5 L 177.0 272.3 Q 177.2 272.6, 177.4 273.1 Q 177.7 273.5, 177.7 273.6 L 177.7 269.5 L 178.4 269.5 L 178.4 274.7 L 177.7 274.7 L 175.9 271.7 Q 175.7 271.4, 175.4 271.0 Q 175.2 270.6, 175.1 270.4 L 175.1 274.7 L 174.5 274.7 L 174.5 269.5 L 175.3 269.5 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 327.0,219.3 L 340.6,231.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 340.6,231.6 L 339.1,238.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 339.1,238.9 L 337.5,246.3\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 339.8,252.2 L 344.0,256.0\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 344.0,256.0 L 348.1,259.7\" style=\"fill:none;fill-rule:evenodd;stroke:#FF7F00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 349.5,265.5 L 345.6,269.8\" style=\"fill:none;fill-rule:evenodd;stroke:#FF7F00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 345.6,269.8 L 341.7,274.1\" style=\"fill:none;fill-rule:evenodd;stroke:#CCCC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 346.8,263.0 L 342.9,267.3\" style=\"fill:none;fill-rule:evenodd;stroke:#FF7F00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 342.9,267.3 L 339.0,271.6\" style=\"fill:none;fill-rule:evenodd;stroke:#CCCC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-3 atom-5\" d=\"M 352.6,263.8 L 356.8,267.6\" style=\"fill:none;fill-rule:evenodd;stroke:#FF7F00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-3 atom-5\" d=\"M 356.8,267.6 L 361.0,271.3\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 367.0,273.1 L 374.2,270.7\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 374.2,270.7 L 381.4,268.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-6 atom-7\" d=\"M 381.4,268.4 L 395.0,280.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-3 atom-8\" d=\"M 352.6,259.3 L 356.5,255.0\" style=\"fill:none;fill-rule:evenodd;stroke:#FF7F00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-3 atom-8\" d=\"M 356.5,255.0 L 360.4,250.7\" style=\"fill:none;fill-rule:evenodd;stroke:#CCCC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 364.9,248.7 L 372.7,250.3\" style=\"fill:none;fill-rule:evenodd;stroke:#CCCC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 372.7,250.3 L 380.5,252.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 380.5,252.0 L 385.5,246.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 385.5,246.5 L 390.5,240.9\" style=\"fill:none;fill-rule:evenodd;stroke:#CCCC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-10 atom-11\" d=\"M 395.1,238.9 L 402.9,240.6\" style=\"fill:none;fill-rule:evenodd;stroke:#CCCC00;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-10 atom-11\" d=\"M 402.9,240.6 L 410.7,242.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-11 atom-12\" d=\"M 410.7,242.2 L 423.0,228.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-2\" d=\"M 334.4 249.5 Q 334.4 248.3, 335.0 247.6 Q 335.6 246.9, 336.8 246.9 Q 337.9 246.9, 338.6 247.6 Q 339.2 248.3, 339.2 249.5 Q 339.2 250.8, 338.6 251.5 Q 337.9 252.2, 336.8 252.2 Q 335.7 252.2, 335.0 251.5 Q 334.4 250.8, 334.4 249.5 M 336.8 251.6 Q 337.6 251.6, 338.0 251.1 Q 338.4 250.6, 338.4 249.5 Q 338.4 248.5, 338.0 248.0 Q 337.6 247.5, 336.8 247.5 Q 336.0 247.5, 335.6 248.0 Q 335.1 248.5, 335.1 249.5 Q 335.1 250.6, 335.6 251.1 Q 336.0 251.6, 336.8 251.6 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-3\" d=\"M 350.3 259.2 Q 351.1 259.2, 351.6 259.6 Q 352.0 260.0, 352.0 260.7 Q 352.0 261.4, 351.6 261.8 Q 351.1 262.2, 350.3 262.2 L 349.4 262.2 L 349.4 264.4 L 348.7 264.4 L 348.7 259.2 L 350.3 259.2 M 350.3 261.6 Q 350.8 261.6, 351.0 261.4 Q 351.3 261.2, 351.3 260.7 Q 351.3 260.2, 351.0 260.0 Q 350.8 259.8, 350.3 259.8 L 349.4 259.8 L 349.4 261.6 L 350.3 261.6 \" fill=\"#FF7F00\"/>\n", | |
"<path class=\"atom-4\" d=\"M 336.7 277.1 Q 336.7 277.2, 337.0 277.3 Q 337.2 277.4, 337.5 277.4 Q 337.7 277.5, 338.0 277.5 Q 338.5 277.5, 338.8 277.3 Q 339.1 277.0, 339.1 276.6 Q 339.1 276.3, 338.9 276.1 Q 338.8 276.0, 338.6 275.9 Q 338.3 275.8, 338.0 275.7 Q 337.5 275.5, 337.2 275.4 Q 337.0 275.3, 336.8 275.0 Q 336.6 274.7, 336.6 274.2 Q 336.6 273.6, 337.0 273.2 Q 337.5 272.8, 338.3 272.8 Q 338.9 272.8, 339.6 273.1 L 339.4 273.6 Q 338.8 273.4, 338.4 273.4 Q 337.8 273.4, 337.6 273.6 Q 337.3 273.8, 337.3 274.1 Q 337.3 274.4, 337.4 274.6 Q 337.6 274.8, 337.8 274.8 Q 338.0 274.9, 338.4 275.1 Q 338.8 275.2, 339.1 275.3 Q 339.4 275.5, 339.6 275.8 Q 339.8 276.1, 339.8 276.6 Q 339.8 277.3, 339.3 277.7 Q 338.8 278.1, 338.0 278.1 Q 337.6 278.1, 337.2 278.0 Q 336.9 277.9, 336.5 277.7 L 336.7 277.1 \" fill=\"#CCCC00\"/>\n", | |
"<path class=\"atom-5\" d=\"M 361.6 274.0 Q 361.6 272.8, 362.2 272.1 Q 362.8 271.4, 364.0 271.4 Q 365.1 271.4, 365.7 272.1 Q 366.3 272.8, 366.3 274.0 Q 366.3 275.3, 365.7 276.0 Q 365.1 276.7, 364.0 276.7 Q 362.8 276.7, 362.2 276.0 Q 361.6 275.3, 361.6 274.0 M 364.0 276.1 Q 364.8 276.1, 365.2 275.6 Q 365.6 275.1, 365.6 274.0 Q 365.6 273.0, 365.2 272.5 Q 364.8 272.0, 364.0 272.0 Q 363.2 272.0, 362.7 272.5 Q 362.3 273.0, 362.3 274.0 Q 362.3 275.1, 362.7 275.6 Q 363.2 276.1, 364.0 276.1 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-8\" d=\"M 361.2 250.0 Q 361.2 250.0, 361.5 250.1 Q 361.7 250.2, 362.0 250.3 Q 362.3 250.3, 362.5 250.3 Q 363.0 250.3, 363.3 250.1 Q 363.6 249.8, 363.6 249.4 Q 363.6 249.1, 363.4 249.0 Q 363.3 248.8, 363.1 248.7 Q 362.9 248.6, 362.5 248.5 Q 362.0 248.3, 361.8 248.2 Q 361.5 248.1, 361.3 247.8 Q 361.1 247.5, 361.1 247.1 Q 361.1 246.4, 361.5 246.0 Q 362.0 245.6, 362.9 245.6 Q 363.5 245.6, 364.1 245.9 L 364.0 246.4 Q 363.3 246.2, 362.9 246.2 Q 362.4 246.2, 362.1 246.4 Q 361.8 246.6, 361.8 247.0 Q 361.8 247.2, 362.0 247.4 Q 362.1 247.6, 362.3 247.7 Q 362.5 247.8, 362.9 247.9 Q 363.3 248.0, 363.6 248.2 Q 363.9 248.3, 364.1 248.6 Q 364.3 248.9, 364.3 249.4 Q 364.3 250.1, 363.8 250.5 Q 363.3 250.9, 362.5 250.9 Q 362.1 250.9, 361.7 250.8 Q 361.4 250.7, 361.0 250.5 L 361.2 250.0 \" fill=\"#CCCC00\"/>\n", | |
"<path class=\"atom-10\" d=\"M 391.3 240.2 Q 391.4 240.2, 391.6 240.3 Q 391.9 240.4, 392.1 240.5 Q 392.4 240.5, 392.7 240.5 Q 393.2 240.5, 393.5 240.3 Q 393.7 240.1, 393.7 239.7 Q 393.7 239.4, 393.6 239.2 Q 393.5 239.0, 393.2 238.9 Q 393.0 238.8, 392.7 238.7 Q 392.2 238.6, 391.9 238.4 Q 391.6 238.3, 391.4 238.0 Q 391.3 237.8, 391.3 237.3 Q 391.3 236.6, 391.7 236.2 Q 392.1 235.8, 393.0 235.8 Q 393.6 235.8, 394.3 236.1 L 394.1 236.7 Q 393.5 236.4, 393.0 236.4 Q 392.5 236.4, 392.3 236.6 Q 392.0 236.8, 392.0 237.2 Q 392.0 237.5, 392.1 237.6 Q 392.3 237.8, 392.5 237.9 Q 392.7 238.0, 393.0 238.1 Q 393.5 238.3, 393.8 238.4 Q 394.1 238.6, 394.3 238.9 Q 394.5 239.1, 394.5 239.7 Q 394.5 240.4, 394.0 240.8 Q 393.5 241.1, 392.7 241.1 Q 392.2 241.1, 391.9 241.0 Q 391.6 240.9, 391.1 240.8 L 391.3 240.2 \" fill=\"#CCCC00\"/>\n", | |
"</svg>" | |
], | |
"text/plain": [ | |
"<IPython.core.display.SVG object>" | |
] | |
}, | |
"execution_count": 35, | |
"metadata": {}, | |
"output_type": "execute_result" | |
} | |
], | |
"source": [ | |
"# Get some mols\n", | |
"df = dm.data.freesolv()\n", | |
"mols = df[\"smiles\"].apply(dm.to_mol)\n", | |
"\n", | |
"# Pick diverse molecules\n", | |
"indices, picks = dm.pick_diverse(mols, npick=9)\n", | |
"dm.to_image(picks, mol_size=(150, 100), n_cols=3)" | |
] | |
}, | |
{ | |
"cell_type": "markdown", | |
"id": "7d09c4e3-814e-4c1d-ab3c-faa577e5aa10", | |
"metadata": {}, | |
"source": [ | |
"## `dm.fragment`" | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"execution_count": 36, | |
"id": "6d085a1a-babb-49ef-8f23-467464b9e0ab", | |
"metadata": {}, | |
"outputs": [ | |
{ | |
"data": { | |
"image/png": "iVBORw0KGgoAAAANSUhEUgAAAcIAAACWCAIAAADCEh9HAAAABmJLR0QA/wD/AP+gvaeTAAAgAElEQVR4nO3deViTV9o/8DsbGMCgbELFBQtuaCwiIElkUeJWQeR1ay2l7bSKMy3Wdkasnb51OlVHr87l8vat22trp660RURAIFjAJCCILC5AoUVQEQGVnRCy/f54/IUYEVmSPA/N/bnmD+ccknPnInz7LOc5h6bRaAAhhNBg0ckuACGEhjeMUYQQGhKMUYQQGhKMUYQQGhKMUTR4ra2tZJeAEPmYZBeAhqWampqdO3dmZGTIZDKBQMDn8729vf38/FgsFtmlIWRqNJzwhAaqoaFh3rx5FRUVI0aM6Orq0rZzOBwej8fj8QQCga+vr7W1NYlFImQyGKNoYFpaWubPn19YWMjlcrOyspqamiQSiVQqlUgkZWVl2q8Tg8GYMmUKcaAaEBAwceJEUqtGyIgwRtEAyGSyRYsWicViDw8PsVg8ZswY3d4HDx5cvXqViNSCggK5XK7tcnFxISJVIBB4eXnR6XhRHv1xYIyi/lIoFOHh4SkpKa6urhKJZMKECX38cGdnZ2FhIRGpOTk5jx8/1naNHDnSz8+PiFQej2dlZWX82hEyIoxR1C9qtfr1118/e/aso6Pj5cuXp06dOqCXV1VVac/9S0tLte1MJnPy5MnEgWpQUND48eMNXThCRocxil5Mo9FER0cfOXKEw+FkZmbOnj17KO9WV1dXUFBAROrVq1e7u7u1XXjuj4YjjFH0YrGxsXv27GGz2ampqQEBAc/+QF5eXmVlJZ/Pd3NzG9A7t7e35+XlESf+ubm5bW1t2i47O7vt27d/8MEHQ60eISPDGEUvsHPnzk8//ZTFYiUkJCxdurTXn9mwYcORI0cAwNnZec6cOcQRpY+Pj6WlZf8HUqlU5eXlxFGqVCqtqqqaOXNmRETE9u3bDfJBEDISjFHUl0OHDm3cuJFOp588eXLt2rXP+7H//Oc/8fHxOTk5jY2N2kZra2tfX1/iPhKPx+NwOAMa+uzZs2vXrvX09Lx58+bgPwBCxocxip4rPj5+9erVarX60KFD69ev789L7t+/rz2cLCws1P12TZo0ibjoyefzPT09X/hWSqXSycmpqampoqLCw8Nj8B8DISPDGEW9E4lEoaGhcrl89+7dW7ZsGcQ7tLa25ufna2/Q6z7v5OLi4u3tTUSqr6+vhYVFr++wbt26U6dO/fvf//7oo48G+TEQMj6MUdSL3NxcoVDY0dHxySef7Ny5c+hvKJfLibvzUqk0Jyfn4cOH2i4bGxs/Pz+BQBAdHe3s7Kz7qjNnzrz22mtBQUGZmZlDrwEhI8EYRfpKSkqCg4Obmpreeuutb7/9lkajGXwI3Wmk2kdI79696+rqqvtjLS0tTk5OKpWqvr7e3t7e4GUgZBAYo+gplZWV8+bNq6+vj4iIiIuLYzAYxh6xoaEhJyfnxo0bn3322bO9QqEwIyPjhx9+eOONN4xdCUKDg9ObUY979+4JhcL6+nqhUHjq1CkTZCgAODk5hYeH95qhABAaGgoAFy5cMEElCA0OHo2iJxobGwMCAsrLy/39/UUiEUWWuaupqXFzc7O2tn748OGAZqEiZDJ4NIoAAFpaWhYvXlxeXs7lcpOTkymSoQAwYcIELpfb3t6enZ1Ndi0I9Q5jFIFMJgsNDS0sLPTw8EhPTx89ejTZFT0lLCwMABITE8kuBKHeYYyaO4VCsXLlSrFY7OrqKhKJ9JYQpQLi8mhiYiJegELUhDFq1tRq9ZtvvpmSkuLo6CgSifpeQpQsc+bMcXV1vXv3bnFxMdm1INQLjFHzpdFoNm7ceObMGQ6Hk5qaOtAlRE2GRqO9+uqrgOf1iKowRs3X1q1bjxw5wmazL1y4MMQlRI0Npz0hKsMJT2Zq165d27Zt63v5O+qQy+WOjo7t7e137tzRe9IJIdLh0ag5qq2t3bFjB51O/+GHH6ifoQBgaWkpFAo1Gg0ekCIKwhg1R1euXGEymcHBwWvWrCG7lv7S3q8nuxCE9GGMmqNx48a1tLRUVlYOo0s6oaGhDAYjMzNTd6MRhKgAY9Qc+fj4jB079s6dOyUlJXpdpaWluqvYUYe9vb2/v79cLk9LSyO7FoSegjFqjp43heiDDz7w9PQ8efIkSXW9AN6vR9SEMWqmeo0kf3//Zxupg3gqNCkpSalUkl0LQj1wwpOZksvlDg4OHR0dulOIWlpaHB0dAaC+vp5qT9YTpk6d+uuvv2ZnZ/e6zzNCpMCjUTNlaWkZEhKi0WiSkpK0jba2tvPmzVMoFBcvXiSxtj7gMiWIgjBGzRcRSXqn8BS//kiUl5CQQHYhCPXAk3rz1djY6OLiwmQyGxsbR44cSTRWV1e7ubnZ2to2NDQ8b8NOEqlUKmdn54cPH5aWlk6bNo3schACwKNRc+bo6Dh37ly5XJ6enq5tnDhx4owZM1paWi5fvkxibc/DYDBwmRJENRijZq3XU/heT/apg+KXHZAZwpN6s1ZWVjZ9+nR7e/sHDx4wmUyiMS8vb+7cuRMmTLh9+7Yxdlceovb2dkdHx+7u7vv371NwkWlkhvBo1KxNmzZt8uTJjx49ys3N1Tb6+Pi4uLjU1NRcv36dxNqex8bGJjg4WK1Wp6SkkF0LQgAYo+jZc2Q6nb5s2TKgwPXH5ubmwsLCZ9tx2hOiFIxRc0dE0rlz53QbqXD9sbOzc9myZYGBgWKxWK9ryZIlNBotPT39jTfeOHTo0I0bN9RqNSlFIgR4bRRppxCVl5dPmTKFaJTJZI6Ojp2dnWQtk6xQKMLDw1NSUlxdXSUSie4mUWq1OjIy8tSpUywWS6FQEI0jR4708/Pj8/ne3t4BAQG2tramrxmZLw0ye2+++SYA7N69W7dx+fLlAHDo0CHT16NSqYiFUB0dHcvKyvR6P/zwQwDgcDinT5/+5ptv1q1bN3HiRN2vNIvF8vX13bx5808//VRXV2f6+pG5wRhFmh9//BEABAKBbuOxY8cAYOnSpSYuRq1Wr1+/ngjKa9eu6fV+8sknAMBms7OysnTb6+rqEhMTY2Nj+Xy+3lMDLi4uq1at2rdvX0FBgUqlMuFHQeYCT+pR71OIGhoaXnrpJb1nnEwgNjZ2z549bDY7NTVVb/2RAwcObNq0icVixcfHEzfBetXR0VFUVCSVSiUSSU5OzuPHj7Vd2nN/gUDA5/PZbLYRPwkyH2TnOKKExYsXA8B3332n28jj8QDg559/NlkZO3bsAAAWi5WcnKzXdfz4cRqNRqPRvv322/6/oVKpvHnz5uHDhyMjI6dPn677zWcymd7e3jExMd9//31NTY1BPwcyLxijSKPRaL755hsAiIiI0G3ctWsXALz11lumrIFOp58+fVqvKz4+nng6YO/evUMZ4v79+3jujwwOYxRpNBpNbW0tjUaztraWyWTaxlu3bgGAvb29Uqk0dgEnT56k0+k0Gu3w4cN6XSKRyNLSEgB27NhhwBFbW1vT09M///xzoVCod9XC3t4+NDQ0Li7OgMOhPzCMUfSEt7c3AOidTU+ePBkAxGKxUYdOS0sjjg31ZgtoNJrc3FwbGxsAiImJMV4Buuf+bm5uRJguWrRI7yoHQr3CGEVPbN++HQA2bNig2/jxxx8DwN/+9jfjjSuVSq2trQHgk08+0eu6fv06sQh/VFSUWq02Xg16ampqtmzZAgBeXl4mGxQNXxij6AnisUsXFxfdwMrKygKAV155xUiDFhcXjxo1CgCio6P1uiorK52dnQEgPDxcoVAYqYDn6erqIs70b9++beKh0bCDMYp6EPPY8/PztS0KheL8+fMdHR3GGK6iooKYXxUREaF3+fXevXtEMSEhIV1dXcYY/YVWrlwJAF9//TUpo6NhBJ+pRz2IFZF1H6VnMplhYWFWVlYGH+vu3btCobC+vl4oFJ46dYrBYGi7Hj58uHDhwurq6rlz5547d464v2R6xMICuAAKeiGcfo96pKenL1q0aNasWcXFxUYdqLGxMSAgoLy83N/fXyQSEddGCa2trQsWLCgoKJg5c2ZWVpadnZ1RK+nD48ePx4wZQ6PRGhoaiCsPCPUKj0ZRj+Dg4FGjRpWUlNy+fdt4o7S0tCxevLi8vHzWrFnJycm6GSqTycLCwgoKCtzd3dPT00nMUACws7Pj8XgKhUJ3kxWEnoUxinqwWKyFCxcCgO6uy4Ylk8lCQ0MLCws9PDzS0tKIG/EEhUKxevXq7OzssWPHikQi4v4SuaiwYCCiPoxR9BRj72C8d+9esVg8fvz4S5cu6W4BotFo1q9fn5SU5ODgkJ6errdoE1nCw8MBICUlRalUkl0Loi68NoqeUlFR4enpyWazHR0dtUt4TJ8+3VCbMimVyo8//vgvf/kLMbFfa/Pmzfv27eNwOJcuXZozZ45BxjKI6dOnl5WVZWZmBgUFkV0LoiqSZwogKmlubvby8gIAvefNnZycwsPDv/rqq5ycHLlcbvBxtcvfZWZmGvzNhyg2NhYANm/eTHYhiLrwaBQ9IZPJFi9efPnyZXd396ysrObmZmKtucuXL9fU1Gh/jMVicblc4kA1ODjYwcFhiOMSy98xGIy4uLiIiIghvpvBSaVSgUAwadKk33//nexaEEVhjCIAAIVCsWLFiuTkZFdXV7FYrHdp8v79+0SkSqXSoqIi3Y2PJk2aNJRz/++///7tt98GgGPHjhH/oBq1Wv3SSy/V19ffvHnT09OT7HIQFWGMIlCr1evWrTtz5oyDg8Ply5enTZvWxw+3tbXl5eURkZqTk9PZ2antGjNmjI+PDxGpPj4+L5w2f+7cudWrVyuVyr179xJbg1DTzo8/VhcW/ik83GXTJrJrQVSEMWruNBrNxo0bDx8+zOFwfvnlF2Kdp35SKpW//vorcaCanZ19584dbZeVlZWXl5e3t7dAIJg/f769vb3eazMyMpYtWyaXy3fs2LFt2zbDfBgjSUiAFSvA3x9ycsguBVERxqi527p16+7du3vdtGOg+n/un5eXJxQK29vbY2Ji9u/fP+QPYWSdneDoCF1dUFsLFJjNiqgGY9Ss7d+//8MPP2SxWOfOnSMeqDeUR48e5ebmEqlaUFDQ1dWl7XJ2dm5tbe3s7PzTn/509OhRQ02lMq7QUEhKgqNH4d13yS4FUQ7GqPk6fvz4O++8Q6PRTp48uXbtWuMNpFQqS0pKiKPU7OzshoaG119/XaVSnTx5UndFEko7cgQ2bICwMDh/nuxSEOVgjJqp+Pj41atXq9XqgwcPbtiwwZRD//rrr/b29kOfKWVSdXUwdiyMGAEPH4IR1rtCwxo+DGqORCIRcTy4c+dOE2coAEyZMmWYZSgAuLiAjw/IZJCRQXYpiHIwRs1Obm7uihUr5HL5pk2btm7dSnY5w0doKAAALlOCnoEn9abQ1QUyGegsZgSdnaDRgM4ScSZy/fr1oKCgpqamqKio7777bnjc3qGI69dh1ixwcoK6OqDj8Qfqgd8GU/jqK7Czg7Nne1o++gjee8/UZfz222+LFi1qampasWLFsWPHMEMHhssFNzdoaID8fLJLQdSCMWoiNjaweTO0tJBWwL1794RC4YMHD0JCQk6fPj1sbpFTCp7Xo95gjJqIry+4u8Onn5IzemNjo3Z3o4SEBLJ2Nxr2wsIAAHB3JvQ0jFETodFg/344cgSuXjX10K2trUuWLCkrK+NyuSkpKdamvyL7hxEQAKNHw82bUFlJdimIQphkF2BGvLzg3XchOrrn2ppKBffvw7hxRhyU2LTj2rVr7u7uept2oAFjsWDLFrC2BlI3iUJUgzFqUrt2wbRpcOTIk/9bVAQ+PuDiAt7eIBAAnw++vvD0islDolAoVq1adfnyZVdXV4rsbjTsbd0KpaWQkAByOUyeDEFBwMQ/InOH3wCTsrWFXbvgr3+FBQuATofaWrCzg7o6SEoCYhO5kSNh7lzg84HPh7lzwcZm8GOp1eo333wzOTmZUrsbDW9KJbz7Lpw9Czwe2NjAF1+AnR1cuAAvv0x2ZYhMOG/UFL78ErKynjz/otFAYCBcuQIrV8KpU6DRQFkZSKVP/vfbbz2vYjKBy30SqQIBjB07gBGHsvwdeq4dO2DvXvjlF+ByAQBaWyEiAh4/hmvXAGePmTGMUVPQjVEAuHULvLyexKie+nrIzwepFCQSKCgAufxJu5/fgzt3ZhMLzXl7e/v5+bFYrD5G1C5/d/HixcDAQIN/IjP10ksQHQ3//d89LbduwYwZIJEAn09eWYhkGKNGJJNBWBj8+c8wdSo0NIBummVlAZsNfn4vePnVqyCRgFQKKlViWtpybReHw+HxeDwej8/n+/n56d18N97yd2atvh6cnSE1FRYteqqdw4GdO+H990kqC5EPY9RYurth+XJITYWXX4bSUgPcOKqqqiLWmpNIJGVlZdpfHIPBmDJlCnGgGhAQkJWVRSx/d+LEiddee22ooyKtqip4+WXIywNf36faJ06EjRshKgoqK2HOHGCzSaoPkQZj1CjUanj9dTh7Fhwd4fJlmDrVwO9fV1cnlUqJ3ZAKCwuVSqW2y8LCoru7++DBg9HR0QYe1cy1tMDo0RAfD+HhPY1qNVhZwcGDIJfDxo3AZMKsWcDng7c3BAXB+PHklYtMB2PU8DQaiI6GI0eAw4HMTJg9+8UvOXECsrNBIAAeDzw8BjZcZ2dnYWGhdjNkOp0+bdq0HNw1yBi8vMDbG/7v/3paLl6EV1+FigrIzYW9e+H6dVCpeno9PIDHe/J7nTYNb0P9UWGMGl5sLOzZA2w2pKZCPzc3+q//gvj4J/92cgJf3yczSQUCGDFiAENfu3Ztzpw5Li4utbW1uPKI4cXHw9q1cOgQREUBgwHFxbByJcydCydOPPmBtja4cgWkUsjJgStXoK2t57X29uDvD3x+ZUDAuNmzRwzo94qoDWPUwHbuhE8/BRYLEhJg6dL+vqq4GDIzn8x5evCgp53NBh8fWLo0ccYMBo/H688zSG5ubtXV1fn5+T4+PoP6BKhP330HsbHQ0QE2NtDUBFFRcOBA79dDVSooL38y60IqhaoqotlrzJibjx7NmjWL2OMvMDDQycnJpB8BGRrGqCEdPAh//jPQ6XDyJAx6c6P793v+9IqKQKMBO7tpjx6VwzP7a/Z6vPnBBx98/fXXn3322RdffDGUz4KeS6WCigro7oZJk2DkyP6+6s4dkEi6ior8MzJu3Lih0jn3nzJlCo/HEwgEPB5vqsGvoyPjwxg1mJ9/hjVrQK2GQ4dg/XrDvGdTE1y5IpdIvpBIJFevXpXJZNouZ2dnPp8/b968TZs26b4kPT190aJFXC63pKTEMEUgQ2ttbb1y5QpxkzAvL6+9vV3b5eDgQERqSEiIl5cXiUWi/sMYNQyRCJYtg+5u2L0btmwxyhDa/TWvXbuWnZ19584dAHg2LhUKhZOTU3Nzc1VVlZubm1FKQYajUqnKy8uJO4Risbi6uppoX7VqVUxMjEAgILU61C8YowaQk1OxcKFHRwdt61bYtctEg1ZWVubk5DCZzHXr1ul1rVmzJi4ubv/+/TExMSaqBhlIdXW1RCI5ffp0SkqKn5/flStXyK4IvRjG6FCVlJQEBwdPnbr0lVeO/+//Mqlwe/zEiRORkZEhISEikYjsWtBgyGQyBweHrq6ue/fuubi4kF0OegFctnlIKisrid2NXFxk//M/VJlitHTpUiaTmZ2d3dzcTHYtaDDYbPaCBQvUanUSsfAXojaM0cEjdjeqr68XCoWnTp2izu5GdnZ2AoFAoVCkpqaSXQsapNDQUAC4gPs+DQcYo4PU2NgoFApramr8/f3PnTtHtd2NwsLCAP8Ih7OwsDA6nZ6RkdHR0UF2LegFMEYHo6WlZfHixeXl5bNmzUpOTqbg7kbLly8HgOTk5O7ubrJrQYMxZswYHx8fmUyWoV1gEVEVxuiAEbsbFRYWenh4UHZ3o0mTJnl6era0tIjFYrJrQYOEpxTDBcbowCgUipUrV4rFYmJ3ozFjxpBd0XPhH+Fwp/0N6j7yhCgIY3QA1Gp1ZGRkSkqKo6OjSCSaMGEC2RX1hbhHkZCQQHYhaJBmzJjh7u7e0NCQl5dHdi2oLxij/UXsbnT27FlbW9vU1FTqP/vs5+fn7OxcU1Nz48YNsmtBg7Rs2TLAUwrKwxjtr/r6+qSkJDabnZSUNLs/a4iSjU6nEzuIJCYmkl0LGiTilAJ/gxSHMdpf6enpDx48IJaNILuW/iIuruEf4fAVEBAwevTo0tLSyspKsmtBz4Ux2l88Hk+tVhcVFenu2EFxQqHQysrq6tWrtbW1ZNeCBoPJZC5ZsgTwvJ7aMEb7y93dfdq0aY8fP5ZIJLrt7e3tP//88++//05WYX1gs9khISEajSY5OZnsWtAg4YwL6sMYHYBez5FjY2NXrlz5ww8/kFTUC+AzhcPdkiVLLCwsxGLxo0ePyK4F9Q5jdACISDp//rxuI3EvlbLXH4lnCi9duoTPFA5THA4nMDBQpVJdvHiR7FpQ7zBGB8Df33/MmDFVVVW3bt3SNs6fP3/kyJFFRUXaBXcpxcnJydfXVyaT4aJ5wxfer6c4jNEBoNPpS5cuhae/0JaWlgsXLgQAyl5/xItrw93y5ctpNNrFixflcjnZtaBeYIwOTK+XGimeU0R5SUlJ+EzhMDV+/Hgul9ve3p6VlUV2LagXGKMDs2jRIisrq7y8vAc6+yAvW7aMyWT+8ssv1Fwm2dPT08PDo6GhAXekGL4o/p9qM4cxOjBWVlbz589Xq9W6p/B2dnY8Hk+hUKSnp5NYWx/wmcLhjojRhIQE3PWHgjBGB6zX6/0Un1eE9yiGO29vb1dX19ra2uLiYrJrQfowRgcsNDSURqOJRKLOzk5tY3h4OACkpKRQ8xmngIAAe3v7srKyiooKsmtBg0Gj0Sg+tc6cYYwOmIuLy7PLkru7u0+dOvXZZ5wogsFgLF68GCh8vIxeCE8pKAtjdDCofL++pqbmp59+eradIuWhQVuwYAExQ/nu3btk14KegjE6GNqnQtVqtV6j3jNOJkZsU7pmzZpz587pdfH5fAaD0dXVRc3LDuiFLC0thUKhRqPB/xZSDcboYHC5XDc3t4aGhvz8fG0j8YzT77//XlpaSkpVLS0tS5curaysnDlzZnBwsG6XTCZbt26dSqXicrlMJpOU8tDQUfxOptnCGB2kZ5cp6fUZJ5Pp7OzU3Whv1KhR2i6FQrFq1ars7OyxY8du27bN9LUhQwkNDWUwGJmZmW1tbWTXgnpgjA5SH9OeTB+jfWy0p1aro6KikpOTHRwc0tPTJ06caOLakAHZ29v7+/vL5fK0tDSya0E6NGhQuru7ia2VKyoqtI0dHR1WVlZ0Or2urs5klSiVyjVr1gCAo6NjWVmZXu+HH34IABwO5+rVqyYrCRnPnj17ACAyMpLsQlAPPBodJBaLRUwhSkpK0jZaWVkFBwfrPeNkVJo+N9rbtm3bvn372Gx2YmLinDlzTFMSMqoVK1YAwPnz52/cuKHBJ5qoAWN08Hq93m/imwCxsbFHjx5ls9kXLlzQ22jvwIEDu3btYrFYcXFxgYGBpqkHGZu7u/uqVatGjx7N5XJHjRolFAq3b9+ekZEhk8nILs2MkX04PIw1NzdbWFgwGIyHDx9qG2tra2k0GpvN7ujoMHYBX375JQCwWKzk5GS9ruPHj9NoNBqN9u233xq7DGR6UVFRrq6uun/IFhYWPB7vr3/9a0JCQkNDA9kFmheM0SFZsGABAJw4cUK30cfHBwASExONOvQ333wDAHQ6/cyZM3pd8fHxxKymvXv3GrUGRK7a2trExMTY2Fg+n89isXRT1cXFZdWqVfv27SsoKFCr1WRX+geHMTok+/fvB4DVq1frNv7zn/8EgPfee8944548eZJOp9NotMOHD+t1iUQiS0tLANixY4fxCkBU09bWJhaL//Wvfy1btkx3uhsAcDickJCQzz//XCQSyWQysiv9A8IYHRJi4xAOhyOXy7WNJSUlABAYGGikQdPS0iwsLABg9+7del25ubk2NjYAEBMTY6TREfUplcqbN28ePnw4MjLSzc1NN1KZTKa3t3dMTExcXBye+xsKxuhQcblcAEhLS9Nt1J0FZVhSqdTa2hoAtm3bptd1/fp1Yg5WVFQUnschrdra2ri4uJiYGG9vbzr9qbvKkyZNioyMPHz48M2bN/E7M2gYo0P197//HQDef/99E4xVXFxMnK9FR0frdVVWVjo7OwNAeHi4QqEwQTFoONI997e1tdWNVFtbWzz3HxyaBqeeDU1+fr6fn9/48eOrq6tpNJrxBqqsrJw3b159fX1ERERcXByDwdB21dbWCgSC6urqkJCQpKQk4tooQn1TKpVFRUXS/6+urk7bFRYWRu4iO8MLxuhQaTSacePG1dbWFhUVvfLKK0Ya5e7du/PmzaupqREKhRcuXNANyocPHwYGBpaWls6dO1ckEhHXRhEaqKqqKm2kvvHGG7GxsWRXNHyQfDT8h7B+/XoA+Mc//mGk929oaCAeT/L3929vb9ftamlpIR5Pmjlz5qNHj4xUAEKoD/gUkwEQqz39+OOPRnqS5McffywvL589e/bFixeJ+0sEmUwWFhZWUFDg7u6enp5uZ2dnjNERQn3Dk3oD6Orqmj179oMHD9ra2mbNmsXn8729vYODg8eNG2eoIY4ePRoeHu7o6KhtUSgUERERSUlJY8eOlUgkuHQTQmTBGDUMuVzO4/FKSkpUKpW2cfLkyTweTyAQ8Hi8qVOnGvAGlEajeeedd44fP+7g4JCdnT19+nRDvTNCaKAwRg2po6ODuPUpkUikUmlTU5O2i8Ph+Pr68vl8gUDA5/PZbPZQBtq8efO+ffs4HM6lS5dw6SaEyIUxaiwqlaq8vJyIVIlEcvv2bW0Xk8kkzv0FAkFQUJDuqXp/bNu2bdeuXWw2OyUlJSgoyMB1I4QGCGPURO7fv09E6rVr1/Lz8xUKhbZr0qRJ2qPU6YafnOkAAADySURBVNOn933uf+DAgU2bNjEYjLi4uIiICOMXjhB6AYxRErS3txcXF2sPVJubm7Vduuf+AoFgxIgRui/8/vvv3377bQA4duwY8Q+EEOkwRkmme+4vFouJtU4ILBaLy+USkRocHCwWi1evXq1UKvfu3UtsDYIQogKMUWq5ffu2RCLJycmRSCSlpaVqtZpop9FoFhYWcrn8yy+//PTTT8ktEiGkC2OUutra2vLy8ojLqWKx+L333mOz2V988QXZdSGEnoIxOjwoFAqlUjnEaVIIIWPAGEUIoSHBZ+oRQmhIMEYRQmhIMEYRQmhIMEYRQmhI/h8yE0D1fin6kQAAAVR6VFh0cmRraXRQS0wgcmRraXQgMjAyMi4wMy4yAAB4nHu/b+09BiDgZYAARiAWBGIhIG5gZGNIAIkxQ2gmJhjNwaAAouHCDhpAmpmFzSEDRDMzIgQgNDuEZkZSQA6DG+g8RiYGJmagkQwsrAysbBlMbOwJ7BwKHJwZTJxcCVzcGUzcPAk8vBlM7HwZTHz8CfwCGUwCrAm8HAkiTGysAvx87GxsnFzcPLwc4teg3gUDwRK/cw4uywQPgDgLu+Y7pLL92A9im7RPdEg/zgBmH2xzdah6o7EPxH5er+mg1LrIHsRu/DDd3u30WTDbtFzdruguE5idrrBs/67MSDCbcaLIgUbbWrDeFRJFBxye77QFsXefmXlAcl8D2Hy/k90HUg1kwG74wmV1oPyyIZjtJ/Jxf6LXdbAaab17+49rCzmAXR1ptp8vKgLMnnPU3v7PNicwWwwAJdZUjGQ0DQ8AAAHFelRYdE1PTCByZGtpdCAyMDIyLjAzLjIAAHicfVRbjtswDPzPKXiBCHxJJD83yWJRFJsAbdo79H/vj5Jxs/ICQuWQoJWxTM4MfIBaPy7f/3zA5+LL4QCA//lFBPwWRDy8QxVwen37doXz/eX03Dnffl3vP4EMyPOZvL5iX+639+cOwRlGUzU0gyM3tm4mgA0faz7KCdQW3ocxHKmF2Ii+AMoD2NWsKxyxdRTU1YkKN5CGPqRjAWlojNWJPU/kNtRVGKjxiOG+wI3EUSM35By9jRxpjAXOElevk66URSeioAXOE5eTcpgPzf9dgw0XwCggN2H6NwqrCa5GIYQrHKWZJ9EPQOCabypljtocB2eb2Qdid1z1SbxBZbiwVCeqqF1XUNlaDRxBUZWZ96R1AdVtfHcp3rMaTtFtBe0b1KTnYKkVuwQvDy2NkiAj5hgpvzim6ivkppJpEEb5RJOGleqv18sXR28eP92ul+nxung6OW9Apl8pQ6crKaNP71HGmBbTDJtO0gyfhqGMmLbQDNqLr5WIdiJrJeKdllqJZCeZViLdKaP1rr7jXyvR2PGslch2fGqlCfHa0NluEbmnre6fn5WsD38BMtPfMauV9y8AAADnelRYdFNNSUxFUyByZGtpdCAyMDIyLjAzLjIAAHicJZDLjQQhDERT2eOM5Lb8/4hjB7BB9H0jmODXMBwQei6qCu77/r0ffp7X9cjfM0ves/HP5xVollRwCUp6JizDLo+Ei7H1C9wyHS5CJyVTWIpUoQdxWIfDEgyrmTFKdDQsRq6kDYJy+2ytujGMDzM3w5oM6awYVNYyoumhwl9rsVQa60sxa9qNinq8dN80LAqxXZPI6xCNUtlPMSPzY9YUfVBmuZ7EKp2ec4jijoNSPQvmC0pHvSY7WWSGilq7wgBrph5AJibw/vwDlo1GWBze6RkAAAAASUVORK5CYII=\n", | |
"text/plain": [ | |
"<rdkit.Chem.rdchem.Mol at 0x7f35c6655060>" | |
] | |
}, | |
"execution_count": 36, | |
"metadata": {}, | |
"output_type": "execute_result" | |
} | |
], | |
"source": [ | |
"mol = dm.to_mol(\"CCCOCc1cc(c2ncccc2)ccc1\")\n", | |
"mol" | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"execution_count": 38, | |
"id": "ef8d4224-92b2-4842-8d4f-52230c64a2ea", | |
"metadata": {}, | |
"outputs": [ | |
{ | |
"data": { | |
"image/svg+xml": [ | |
"<svg xmlns=\"http://www.w3.org/2000/svg\" xmlns:rdkit=\"http://www.rdkit.org/xml\" xmlns:xlink=\"http://www.w3.org/1999/xlink\" version=\"1.1\" baseProfile=\"full\" xml:space=\"preserve\" width=\"450px\" height=\"300px\" viewBox=\"0 0 450 300\">\n", | |
"<!-- END OF HEADER -->\n", | |
"<rect style=\"opacity:1.0;fill:#FFFFFF;stroke:none\" width=\"450.0\" height=\"300.0\" x=\"0.0\" y=\"0.0\"> </rect>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 6.8,64.6 L 19.5,55.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 19.5,55.4 L 33.8,61.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 33.8,61.8 L 38.8,58.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 38.8,58.1 L 43.9,54.4\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 49.0,53.7 L 54.8,56.3\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 54.8,56.3 L 60.7,58.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 60.7,58.9 L 73.3,49.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 73.3,49.7 L 71.7,34.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 76.2,47.0 L 75.0,36.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-6 atom-7\" d=\"M 71.7,34.1 L 84.3,24.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-7 atom-8\" d=\"M 84.3,24.9 L 98.6,31.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-7 atom-8\" d=\"M 85.2,28.7 L 95.2,33.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 98.6,31.3 L 100.3,46.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 100.3,46.8 L 114.6,53.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-10 atom-11\" d=\"M 114.6,53.2 L 116.2,68.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-10 atom-11\" d=\"M 117.9,55.2 L 119.1,66.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-11 atom-12\" d=\"M 116.2,68.7 L 130.5,75.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-12 atom-12 atom-13\" d=\"M 130.5,75.1 L 143.2,65.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-12 atom-12 atom-13\" d=\"M 130.6,71.2 L 139.4,64.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-13 atom-13 atom-14\" d=\"M 143.2,65.9 L 141.5,50.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-14 atom-14 atom-15\" d=\"M 141.5,50.3 L 135.5,47.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-14 atom-14 atom-15\" d=\"M 135.5,47.6 L 129.4,44.9\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-14 atom-14 atom-15\" d=\"M 138.4,52.4 L 134.2,50.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-14 atom-14 atom-15\" d=\"M 134.2,50.5 L 130.0,48.6\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-15 atom-9 atom-16\" d=\"M 100.3,46.8 L 87.6,56.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-15 atom-9 atom-16\" d=\"M 96.5,45.7 L 87.7,52.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-16 atom-16 atom-5\" d=\"M 87.6,56.0 L 73.3,49.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-17 atom-15 atom-10\" d=\"M 125.0,45.6 L 119.8,49.4\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-17 atom-15 atom-10\" d=\"M 119.8,49.4 L 114.6,53.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-3\" d=\"M 44.4 52.6 Q 44.4 51.5, 44.9 50.9 Q 45.4 50.3, 46.4 50.3 Q 47.4 50.3, 47.9 50.9 Q 48.4 51.5, 48.4 52.6 Q 48.4 53.7, 47.9 54.3 Q 47.4 54.9, 46.4 54.9 Q 45.4 54.9, 44.9 54.3 Q 44.4 53.7, 44.4 52.6 M 46.4 54.4 Q 47.1 54.4, 47.4 53.9 Q 47.8 53.5, 47.8 52.6 Q 47.8 51.7, 47.4 51.3 Q 47.1 50.8, 46.4 50.8 Q 45.7 50.8, 45.4 51.3 Q 45.0 51.7, 45.0 52.6 Q 45.0 53.5, 45.4 53.9 Q 45.7 54.4, 46.4 54.4 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-15\" d=\"M 126.2 41.7 L 127.7 44.1 Q 127.8 44.3, 128.1 44.7 Q 128.3 45.2, 128.3 45.2 L 128.3 41.7 L 128.9 41.7 L 128.9 46.2 L 128.3 46.2 L 126.7 43.6 Q 126.6 43.3, 126.4 43.0 Q 126.2 42.6, 126.1 42.5 L 126.1 46.2 L 125.5 46.2 L 125.5 41.7 L 126.2 41.7 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 211.5,53.9 L 225.0,46.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 225.0,46.1 L 238.5,53.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 331.8,65.0 L 338.2,66.5\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 338.2,66.5 L 344.5,67.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 344.5,67.9 L 355.1,56.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 355.1,56.4 L 350.4,41.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 357.4,53.2 L 354.1,42.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 350.4,41.5 L 361.0,29.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 361.0,29.9 L 376.3,33.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 362.6,33.5 L 373.3,35.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 376.3,33.4 L 381.0,48.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-6 atom-7\" d=\"M 381.0,48.3 L 396.2,51.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-7 atom-8\" d=\"M 396.2,51.7 L 400.9,66.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-7 atom-8\" d=\"M 399.9,53.0 L 403.2,63.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 400.9,66.6 L 416.2,70.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 416.2,70.1 L 426.8,58.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 415.5,66.2 L 422.9,58.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-10 atom-11\" d=\"M 426.8,58.5 L 422.1,43.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-11 atom-12\" d=\"M 422.1,43.6 L 415.6,42.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-11 atom-12\" d=\"M 415.6,42.2 L 409.0,40.7\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-11 atom-12\" d=\"M 419.5,46.2 L 414.9,45.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-11 atom-12\" d=\"M 414.9,45.2 L 410.3,44.2\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-12 atom-6 atom-13\" d=\"M 381.0,48.3 L 370.4,59.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-12 atom-6 atom-13\" d=\"M 377.1,47.9 L 369.7,56.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-13 atom-13 atom-2\" d=\"M 370.4,59.8 L 355.1,56.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-14 atom-12 atom-7\" d=\"M 404.6,42.6 L 400.4,47.1\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-14 atom-12 atom-7\" d=\"M 400.4,47.1 L 396.2,51.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-0\" d=\"M 323.2 62.3 L 323.8 62.3 L 323.8 64.2 L 326.1 64.2 L 326.1 62.3 L 326.7 62.3 L 326.7 66.7 L 326.1 66.7 L 326.1 64.7 L 323.8 64.7 L 323.8 66.7 L 323.2 66.7 L 323.2 62.3 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-0\" d=\"M 327.2 64.5 Q 327.2 63.4, 327.8 62.8 Q 328.3 62.2, 329.3 62.2 Q 330.2 62.2, 330.8 62.8 Q 331.3 63.4, 331.3 64.5 Q 331.3 65.6, 330.8 66.2 Q 330.2 66.8, 329.3 66.8 Q 328.3 66.8, 327.8 66.2 Q 327.2 65.6, 327.2 64.5 M 329.3 66.3 Q 329.9 66.3, 330.3 65.8 Q 330.7 65.4, 330.7 64.5 Q 330.7 63.6, 330.3 63.2 Q 329.9 62.7, 329.3 62.7 Q 328.6 62.7, 328.2 63.2 Q 327.9 63.6, 327.9 64.5 Q 327.9 65.4, 328.2 65.8 Q 328.6 66.3, 329.3 66.3 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-12\" d=\"M 405.9 38.0 L 407.3 40.3 Q 407.4 40.6, 407.7 41.0 Q 407.9 41.4, 407.9 41.4 L 407.9 38.0 L 408.5 38.0 L 408.5 42.4 L 407.9 42.4 L 406.3 39.8 Q 406.2 39.5, 406.0 39.2 Q 405.8 38.9, 405.7 38.8 L 405.7 42.4 L 405.2 42.4 L 405.2 38.0 L 405.9 38.0 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 51.4,151.4 L 65.8,145.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 65.8,145.3 L 78.3,154.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 78.3,154.7 L 84.3,152.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 84.3,152.2 L 90.2,149.7\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-3\" d=\"M 90.7 148.6 Q 90.7 147.5, 91.2 146.9 Q 91.8 146.3, 92.7 146.3 Q 93.7 146.3, 94.2 146.9 Q 94.8 147.5, 94.8 148.6 Q 94.8 149.7, 94.2 150.3 Q 93.7 150.9, 92.7 150.9 Q 91.8 150.9, 91.2 150.3 Q 90.7 149.7, 90.7 148.6 M 92.7 150.4 Q 93.4 150.4, 93.8 149.9 Q 94.1 149.5, 94.1 148.6 Q 94.1 147.7, 93.8 147.3 Q 93.4 146.8, 92.7 146.8 Q 92.1 146.8, 91.7 147.3 Q 91.3 147.7, 91.3 148.6 Q 91.3 149.5, 91.7 149.9 Q 92.1 150.4, 92.7 150.4 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-3\" d=\"M 95.1 146.4 L 95.7 146.4 L 95.7 148.3 L 97.9 148.3 L 97.9 146.4 L 98.6 146.4 L 98.6 150.8 L 97.9 150.8 L 97.9 148.8 L 95.7 148.8 L 95.7 150.8 L 95.1 150.8 L 95.1 146.4 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 184.5,169.6 L 194.0,157.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 194.0,157.2 L 188.0,142.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 196.0,153.9 L 191.8,143.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 188.0,142.8 L 197.5,130.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 197.5,130.4 L 213.0,132.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 199.4,133.8 L 210.3,135.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 213.0,132.4 L 219.0,146.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 219.0,146.8 L 234.5,148.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-6 atom-7\" d=\"M 234.5,148.9 L 240.5,163.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-6 atom-7\" d=\"M 238.3,149.8 L 242.5,160.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-7 atom-8\" d=\"M 240.5,163.3 L 256.0,165.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 256.0,165.3 L 265.5,152.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 255.0,161.6 L 261.6,152.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 265.5,152.9 L 259.5,138.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-10 atom-11\" d=\"M 259.5,138.5 L 252.9,137.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-10 atom-11\" d=\"M 252.9,137.6 L 246.2,136.7\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-10 atom-11\" d=\"M 257.1,141.3 L 252.5,140.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-10 atom-11\" d=\"M 252.5,140.7 L 247.8,140.1\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-5 atom-12\" d=\"M 219.0,146.8 L 209.5,159.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-5 atom-12\" d=\"M 215.1,146.8 L 208.4,155.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-12 atom-12 atom-1\" d=\"M 209.5,159.3 L 194.0,157.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-13 atom-11 atom-6\" d=\"M 241.9,139.2 L 238.2,144.0\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-13 atom-11 atom-6\" d=\"M 238.2,144.0 L 234.5,148.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-11\" d=\"M 243.0 134.2 L 244.5 136.6 Q 244.6 136.8, 244.9 137.2 Q 245.1 137.7, 245.1 137.7 L 245.1 134.2 L 245.7 134.2 L 245.7 138.7 L 245.1 138.7 L 243.5 136.1 Q 243.4 135.8, 243.2 135.5 Q 243.0 135.1, 242.9 135.0 L 242.9 138.7 L 242.3 138.7 L 242.3 134.2 L 243.0 134.2 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 347.9,155.0 L 361.5,147.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 361.5,147.2 L 375.0,155.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 375.0,155.0 L 380.5,151.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 380.5,151.9 L 386.0,148.7\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 391.1,148.7 L 396.6,151.9\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 396.6,151.9 L 402.1,155.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-3\" d=\"M 386.5 147.2 Q 386.5 146.2, 387.0 145.6 Q 387.6 145.0, 388.5 145.0 Q 389.5 145.0, 390.1 145.6 Q 390.6 146.2, 390.6 147.2 Q 390.6 148.3, 390.0 148.9 Q 389.5 149.5, 388.5 149.5 Q 387.6 149.5, 387.0 148.9 Q 386.5 148.3, 386.5 147.2 M 388.5 149.0 Q 389.2 149.0, 389.6 148.6 Q 390.0 148.1, 390.0 147.2 Q 390.0 146.4, 389.6 145.9 Q 389.2 145.5, 388.5 145.5 Q 387.9 145.5, 387.5 145.9 Q 387.1 146.3, 387.1 147.2 Q 387.1 148.1, 387.5 148.6 Q 387.9 149.0, 388.5 149.0 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 114.1,248.9 L 106.3,262.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 110.2,249.4 L 104.7,258.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 106.3,262.4 L 90.6,262.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 90.6,262.4 L 82.8,248.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 92.2,258.8 L 86.7,249.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 82.8,248.9 L 67.2,248.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 67.2,248.9 L 59.4,235.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 63.3,248.4 L 57.8,238.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 59.4,235.3 L 43.7,235.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-6 atom-7\" d=\"M 43.7,235.3 L 35.9,248.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-6 atom-7\" d=\"M 45.3,238.9 L 39.8,248.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-7 atom-8\" d=\"M 35.9,248.9 L 43.7,262.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 43.7,262.4 L 50.4,262.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 50.4,262.4 L 57.2,262.4\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 45.7,259.3 L 50.4,259.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 50.4,259.3 L 55.1,259.3\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-3 atom-10\" d=\"M 82.8,248.9 L 90.6,235.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-10 atom-11\" d=\"M 90.6,235.3 L 106.3,235.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-10 atom-11\" d=\"M 93.0,238.5 L 103.9,238.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-11 atom-0\" d=\"M 106.3,235.3 L 114.1,248.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-12 atom-9 atom-4\" d=\"M 60.9,259.7 L 64.1,254.3\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-12 atom-9 atom-4\" d=\"M 64.1,254.3 L 67.2,248.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-9\" d=\"M 58.4 260.2 L 59.8 262.6 Q 60.0 262.8, 60.2 263.2 Q 60.4 263.6, 60.4 263.7 L 60.4 260.2 L 61.0 260.2 L 61.0 264.7 L 60.4 264.7 L 58.9 262.1 Q 58.7 261.8, 58.5 261.4 Q 58.3 261.1, 58.3 261.0 L 58.3 264.7 L 57.7 264.7 L 57.7 260.2 L 58.4 260.2 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 241.5,250.0 L 233.7,263.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 237.6,250.5 L 232.1,260.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 233.7,263.5 L 218.0,263.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 218.0,263.5 L 214.9,258.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 214.9,258.1 L 211.8,252.7\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 219.8,260.4 L 217.6,256.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 217.6,256.6 L 215.4,252.8\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 211.8,247.3 L 214.9,241.9\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 214.9,241.9 L 218.0,236.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 218.0,236.5 L 233.7,236.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 220.4,239.6 L 231.3,239.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-0\" d=\"M 233.7,236.5 L 241.5,250.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-3\" d=\"M 209.2 247.8 L 210.7 250.1 Q 210.8 250.4, 211.0 250.8 Q 211.3 251.2, 211.3 251.2 L 211.3 247.8 L 211.9 247.8 L 211.9 252.2 L 211.3 252.2 L 209.7 249.6 Q 209.5 249.3, 209.3 249.0 Q 209.1 248.7, 209.1 248.6 L 209.1 252.2 L 208.5 252.2 L 208.5 247.8 L 209.2 247.8 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 326.2,250.1 L 341.0,245.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 341.0,245.0 L 352.8,255.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 352.8,255.2 L 359.0,253.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 359.0,253.1 L 365.1,251.0\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 370.2,252.3 L 374.8,256.3\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 374.8,256.3 L 379.5,260.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 379.5,260.3 L 394.2,255.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 394.2,255.1 L 397.2,239.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 397.7,253.4 L 399.8,242.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-6 atom-7\" d=\"M 397.2,239.8 L 411.9,234.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-7 atom-8\" d=\"M 411.9,234.6 L 423.8,244.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-7 atom-8\" d=\"M 411.7,238.5 L 420.0,245.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 423.8,244.9 L 420.8,260.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 420.8,260.2 L 406.1,265.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 417.6,258.0 L 407.3,261.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-10 atom-5\" d=\"M 406.1,265.4 L 394.2,255.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-3\" d=\"M 365.6 250.1 Q 365.6 249.0, 366.1 248.4 Q 366.6 247.8, 367.6 247.8 Q 368.6 247.8, 369.1 248.4 Q 369.6 249.0, 369.6 250.1 Q 369.6 251.2, 369.1 251.8 Q 368.6 252.4, 367.6 252.4 Q 366.6 252.4, 366.1 251.8 Q 365.6 251.2, 365.6 250.1 M 367.6 251.9 Q 368.3 251.9, 368.7 251.4 Q 369.0 251.0, 369.0 250.1 Q 369.0 249.2, 368.7 248.8 Q 368.3 248.3, 367.6 248.3 Q 366.9 248.3, 366.6 248.8 Q 366.2 249.2, 366.2 250.1 Q 366.2 251.0, 366.6 251.4 Q 366.9 251.9, 367.6 251.9 \" fill=\"#FF0000\"/>\n", | |
"</svg>" | |
], | |
"text/plain": [ | |
"<IPython.core.display.SVG object>" | |
] | |
}, | |
"execution_count": 38, | |
"metadata": {}, | |
"output_type": "execute_result" | |
} | |
], | |
"source": [ | |
"with dm.without_rdkit_log():\n", | |
" frags = dm.fragment.brics(mol)\n", | |
"dm.to_image(frags, n_cols=3, mol_size=(150, 100))" | |
] | |
}, | |
{ | |
"cell_type": "markdown", | |
"id": "3c28a554-7d08-413c-9106-b344a9e4d989", | |
"metadata": {}, | |
"source": [ | |
"## `dm.scaffold`" | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"execution_count": 54, | |
"id": "73e70b05-0e30-43fd-99ad-e51f0ae76472", | |
"metadata": {}, | |
"outputs": [ | |
{ | |
"data": { | |
"image/svg+xml": [ | |
"<svg xmlns=\"http://www.w3.org/2000/svg\" xmlns:rdkit=\"http://www.rdkit.org/xml\" xmlns:xlink=\"http://www.w3.org/1999/xlink\" version=\"1.1\" baseProfile=\"full\" xml:space=\"preserve\" width=\"750px\" height=\"200px\" viewBox=\"0 0 750 200\">\n", | |
"<!-- END OF HEADER -->\n", | |
"<rect style=\"opacity:1.0;fill:#FFFFFF;stroke:none\" width=\"750.0\" height=\"200.0\" x=\"0.0\" y=\"0.0\"> </rect>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 142.9,152.8 L 148.8,129.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 148.8,129.7 L 171.8,123.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 171.8,123.2 L 177.8,100.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 177.8,100.1 L 200.8,93.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 179.9,94.5 L 196.0,90.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 200.8,93.6 L 206.7,70.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 206.7,70.5 L 189.6,53.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 200.8,71.4 L 188.9,59.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-6 atom-7\" d=\"M 189.6,53.7 L 166.6,60.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-7 atom-8\" d=\"M 166.6,60.2 L 160.7,83.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-7 atom-8\" d=\"M 170.4,64.9 L 166.2,81.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-6 atom-9\" d=\"M 189.6,53.7 L 192.0,44.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-6 atom-9\" d=\"M 192.0,44.3 L 194.5,34.9\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-5 atom-10\" d=\"M 206.7,70.5 L 216.3,67.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-5 atom-10\" d=\"M 216.3,67.8 L 225.9,65.1\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-2 atom-11\" d=\"M 171.8,123.2 L 178.4,129.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-2 atom-11\" d=\"M 178.4,129.7 L 185.0,136.1\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-1 atom-12\" d=\"M 148.8,129.7 L 141.9,123.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-1 atom-12\" d=\"M 141.9,123.0 L 135.1,116.2\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-12 atom-12 atom-13\" d=\"M 132.8,108.8 L 135.2,99.3\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-12 atom-12 atom-13\" d=\"M 135.2,99.3 L 137.6,89.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-13 atom-12 atom-14\" d=\"M 128.4,113.9 L 118.5,116.6\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-13 atom-12 atom-14\" d=\"M 118.5,116.6 L 108.7,119.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-14 atom-14 atom-15\" d=\"M 111.0,120.0 L 108.6,129.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-14 atom-14 atom-15\" d=\"M 108.6,129.5 L 106.1,138.9\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-14 atom-14 atom-15\" d=\"M 106.4,118.8 L 103.9,128.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-14 atom-14 atom-15\" d=\"M 103.9,128.3 L 101.5,137.8\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-15 atom-14 atom-16\" d=\"M 108.7,119.4 L 102.1,112.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-15 atom-14 atom-16\" d=\"M 102.1,112.9 L 95.5,106.5\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-16 atom-16 atom-17\" d=\"M 87.7,103.8 L 78.1,106.4\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-16 atom-16 atom-17\" d=\"M 78.1,106.4 L 68.6,109.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-17 atom-17 atom-18\" d=\"M 68.6,109.1 L 51.5,92.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-18 atom-18 atom-19\" d=\"M 51.5,92.4 L 28.5,98.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-18 atom-18 atom-19\" d=\"M 46.7,88.8 L 30.6,93.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-19 atom-19 atom-20\" d=\"M 28.5,98.8 L 11.4,82.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-20 atom-20 atom-21\" d=\"M 11.4,82.1 L 17.3,59.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-20 atom-20 atom-21\" d=\"M 16.9,79.8 L 21.0,63.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-21 atom-21 atom-22\" d=\"M 17.3,59.0 L 40.3,52.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-22 atom-22 atom-23\" d=\"M 40.3,52.5 L 57.4,69.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-22 atom-22 atom-23\" d=\"M 39.5,58.4 L 51.5,70.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-23 atom-8 atom-3\" d=\"M 160.7,83.4 L 177.8,100.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-24 atom-23 atom-18\" d=\"M 57.4,69.2 L 51.5,92.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-9\" d=\"M 192.5 30.6 Q 192.5 29.0, 193.3 28.1 Q 194.1 27.2, 195.6 27.2 Q 197.1 27.2, 197.9 28.1 Q 198.7 29.0, 198.7 30.6 Q 198.7 32.3, 197.9 33.2 Q 197.1 34.1, 195.6 34.1 Q 194.1 34.1, 193.3 33.2 Q 192.5 32.3, 192.5 30.6 M 195.6 33.4 Q 196.6 33.4, 197.2 32.7 Q 197.7 32.0, 197.7 30.6 Q 197.7 29.3, 197.2 28.6 Q 196.6 27.9, 195.6 27.9 Q 194.5 27.9, 194.0 28.6 Q 193.4 29.3, 193.4 30.6 Q 193.4 32.0, 194.0 32.7 Q 194.5 33.4, 195.6 33.4 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-9\" d=\"M 199.2 27.2 L 200.1 27.2 L 200.1 30.1 L 203.5 30.1 L 203.5 27.2 L 204.5 27.2 L 204.5 34.0 L 203.5 34.0 L 203.5 30.9 L 200.1 30.9 L 200.1 34.0 L 199.2 34.0 L 199.2 27.2 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-10\" d=\"M 226.6 64.0 Q 226.6 62.4, 227.4 61.5 Q 228.3 60.6, 229.8 60.6 Q 231.3 60.6, 232.1 61.5 Q 232.9 62.4, 232.9 64.0 Q 232.9 65.7, 232.0 66.6 Q 231.2 67.6, 229.8 67.6 Q 228.3 67.6, 227.4 66.6 Q 226.6 65.7, 226.6 64.0 M 229.8 66.8 Q 230.8 66.8, 231.3 66.1 Q 231.9 65.4, 231.9 64.0 Q 231.9 62.7, 231.3 62.0 Q 230.8 61.4, 229.8 61.4 Q 228.7 61.4, 228.2 62.0 Q 227.6 62.7, 227.6 64.0 Q 227.6 65.4, 228.2 66.1 Q 228.7 66.8, 229.8 66.8 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-10\" d=\"M 233.3 60.7 L 234.3 60.7 L 234.3 63.6 L 237.7 63.6 L 237.7 60.7 L 238.6 60.7 L 238.6 67.5 L 237.7 67.5 L 237.7 64.3 L 234.3 64.3 L 234.3 67.5 L 233.3 67.5 L 233.3 60.7 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-11\" d=\"M 185.8 140.0 Q 185.8 138.3, 186.6 137.4 Q 187.4 136.5, 188.9 136.5 Q 190.4 136.5, 191.2 137.4 Q 192.0 138.3, 192.0 140.0 Q 192.0 141.6, 191.2 142.6 Q 190.4 143.5, 188.9 143.5 Q 187.4 143.5, 186.6 142.6 Q 185.8 141.6, 185.8 140.0 M 188.9 142.7 Q 190.0 142.7, 190.5 142.0 Q 191.1 141.3, 191.1 140.0 Q 191.1 138.6, 190.5 138.0 Q 190.0 137.3, 188.9 137.3 Q 187.9 137.3, 187.3 138.0 Q 186.8 138.6, 186.8 140.0 Q 186.8 141.3, 187.3 142.0 Q 187.9 142.7, 188.9 142.7 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-11\" d=\"M 192.5 136.6 L 193.4 136.6 L 193.4 139.5 L 196.9 139.5 L 196.9 136.6 L 197.8 136.6 L 197.8 143.4 L 196.9 143.4 L 196.9 140.3 L 193.4 140.3 L 193.4 143.4 L 192.5 143.4 L 192.5 136.6 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-12\" d=\"M 130.2 109.6 L 132.4 113.2 Q 132.7 113.5, 133.0 114.1 Q 133.4 114.8, 133.4 114.8 L 133.4 109.6 L 134.3 109.6 L 134.3 116.3 L 133.4 116.3 L 131.0 112.4 Q 130.7 112.0, 130.4 111.4 Q 130.1 110.9, 130.0 110.7 L 130.0 116.3 L 129.1 116.3 L 129.1 109.6 L 130.2 109.6 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"atom-15\" d=\"M 99.6 142.6 Q 99.6 140.9, 100.4 140.0 Q 101.3 139.1, 102.8 139.1 Q 104.3 139.1, 105.1 140.0 Q 105.9 140.9, 105.9 142.6 Q 105.9 144.2, 105.0 145.2 Q 104.2 146.1, 102.8 146.1 Q 101.3 146.1, 100.4 145.2 Q 99.6 144.2, 99.6 142.6 M 102.8 145.3 Q 103.8 145.3, 104.3 144.6 Q 104.9 143.9, 104.9 142.6 Q 104.9 141.2, 104.3 140.6 Q 103.8 139.9, 102.8 139.9 Q 101.7 139.9, 101.2 140.6 Q 100.6 141.2, 100.6 142.6 Q 100.6 143.9, 101.2 144.6 Q 101.7 145.3, 102.8 145.3 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-16\" d=\"M 88.5 102.7 Q 88.5 101.1, 89.3 100.2 Q 90.1 99.3, 91.6 99.3 Q 93.1 99.3, 93.9 100.2 Q 94.7 101.1, 94.7 102.7 Q 94.7 104.3, 93.9 105.3 Q 93.1 106.2, 91.6 106.2 Q 90.1 106.2, 89.3 105.3 Q 88.5 104.3, 88.5 102.7 M 91.6 105.4 Q 92.6 105.4, 93.2 104.8 Q 93.7 104.1, 93.7 102.7 Q 93.7 101.4, 93.2 100.7 Q 92.6 100.0, 91.6 100.0 Q 90.6 100.0, 90.0 100.7 Q 89.4 101.4, 89.4 102.7 Q 89.4 104.1, 90.0 104.8 Q 90.6 105.4, 91.6 105.4 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"legend\" d=\"M 102.6 186.0 Q 102.6 183.5, 103.8 182.0 Q 105.1 180.6, 107.4 180.6 Q 109.7 180.6, 111.0 182.0 Q 112.2 183.5, 112.2 186.0 Q 112.2 188.5, 111.0 190.0 Q 109.7 191.4, 107.4 191.4 Q 105.1 191.4, 103.8 190.0 Q 102.6 188.6, 102.6 186.0 M 107.4 190.2 Q 109.0 190.2, 109.9 189.2 Q 110.7 188.1, 110.7 186.0 Q 110.7 183.9, 109.9 182.9 Q 109.0 181.8, 107.4 181.8 Q 105.8 181.8, 104.9 182.9 Q 104.0 183.9, 104.0 186.0 Q 104.0 188.1, 104.9 189.2 Q 105.8 190.2, 107.4 190.2 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 114.1 183.6 L 114.2 184.7 Q 115.0 183.5, 116.4 183.5 Q 116.8 183.5, 117.3 183.7 L 117.1 184.9 Q 116.5 184.8, 116.1 184.8 Q 115.5 184.8, 115.1 185.0 Q 114.7 185.2, 114.4 185.8 L 114.4 191.3 L 113.0 191.3 L 113.0 183.6 L 114.1 183.6 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 117.6 180.8 L 118.9 180.8 L 118.9 182.0 L 117.6 182.0 L 117.6 180.8 M 117.6 183.6 L 118.9 183.6 L 118.9 191.3 L 117.6 191.3 L 117.6 183.6 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 127.1 183.6 L 127.1 191.7 Q 127.1 195.0, 123.7 195.0 Q 122.0 195.0, 120.5 194.2 L 121.0 193.2 Q 121.8 193.6, 122.3 193.8 Q 122.9 193.9, 123.7 193.9 Q 124.8 193.9, 125.3 193.4 Q 125.7 192.9, 125.7 191.7 L 125.7 190.4 Q 124.9 191.4, 123.6 191.4 Q 122.0 191.4, 121.1 190.4 Q 120.2 189.4, 120.2 187.6 Q 120.2 185.7, 121.2 184.6 Q 122.3 183.5, 124.1 183.5 Q 125.1 183.5, 126.0 183.8 L 126.0 183.6 L 127.1 183.6 M 123.6 190.3 Q 124.4 190.3, 125.0 189.9 Q 125.5 189.4, 125.7 188.7 L 125.7 184.8 Q 125.0 184.6, 124.1 184.6 Q 123.0 184.6, 122.3 185.4 Q 121.6 186.2, 121.6 187.6 Q 121.6 188.9, 122.1 189.6 Q 122.7 190.3, 123.6 190.3 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 128.4 180.8 L 129.7 180.8 L 129.7 182.0 L 128.4 182.0 L 128.4 180.8 M 128.4 183.6 L 129.7 183.6 L 129.7 191.3 L 128.4 191.3 L 128.4 183.6 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 135.0 183.5 Q 136.2 183.5, 136.9 184.2 Q 137.5 184.9, 137.5 186.2 L 137.5 191.3 L 136.1 191.3 L 136.1 186.3 Q 136.1 185.4, 135.8 185.0 Q 135.4 184.6, 134.6 184.6 Q 133.9 184.6, 133.4 184.9 Q 132.8 185.2, 132.4 185.8 L 132.4 191.3 L 131.0 191.3 L 131.0 183.6 L 132.2 183.6 L 132.3 184.7 Q 133.3 183.5, 135.0 183.5 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 138.6 189.2 Q 138.6 188.0, 139.6 187.3 Q 140.6 186.7, 142.4 186.7 L 143.5 186.7 L 143.5 186.4 Q 143.5 185.4, 143.1 185.0 Q 142.7 184.6, 141.8 184.6 Q 141.2 184.6, 140.7 184.7 Q 140.2 184.8, 139.5 185.2 L 139.1 184.2 Q 140.5 183.5, 141.8 183.5 Q 143.4 183.5, 144.2 184.2 Q 144.9 184.9, 144.9 186.4 L 144.9 191.3 L 143.8 191.3 Q 143.8 191.2, 143.8 191.0 Q 143.7 190.8, 143.7 190.4 Q 142.6 191.5, 141.2 191.5 Q 140.0 191.5, 139.3 190.8 Q 138.6 190.2, 138.6 189.2 M 140.0 189.2 Q 140.0 189.7, 140.4 190.1 Q 140.8 190.4, 141.4 190.4 Q 142.0 190.4, 142.6 190.1 Q 143.1 189.8, 143.5 189.3 L 143.5 187.7 L 142.5 187.7 Q 141.3 187.7, 140.7 188.1 Q 140.0 188.4, 140.0 189.2 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 146.1 180.0 L 147.4 180.0 L 147.4 191.3 L 146.1 191.3 L 146.1 180.0 \" fill=\"#000000\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 397.7,100.8 L 421.6,101.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 421.6,101.4 L 434.2,81.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 434.2,81.1 L 458.1,81.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 437.9,76.4 L 454.6,76.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 458.1,81.7 L 470.6,61.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 470.6,61.4 L 459.2,40.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 464.7,60.5 L 456.7,45.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 459.2,40.3 L 435.3,39.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-6 atom-7\" d=\"M 435.3,39.7 L 422.8,60.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-6 atom-7\" d=\"M 437.5,45.2 L 428.8,59.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-0 atom-8\" d=\"M 397.7,100.8 L 392.8,108.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-0 atom-8\" d=\"M 392.8,108.8 L 387.8,116.9\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 381.9,121.0 L 371.6,120.7\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 371.6,120.7 L 361.3,120.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 363.4,121.7 L 358.4,129.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 358.4,129.8 L 353.4,137.9\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 359.3,119.2 L 354.3,127.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 354.3,127.3 L 349.3,135.3\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-9 atom-11\" d=\"M 361.3,120.4 L 356.8,112.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-9 atom-11\" d=\"M 356.8,112.1 L 352.3,103.7\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-11 atom-12\" d=\"M 346.0,99.3 L 336.0,99.0\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-11 atom-12\" d=\"M 336.0,99.0 L 326.0,98.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-12 atom-12 atom-13\" d=\"M 326.0,98.8 L 314.7,77.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-13 atom-13 atom-14\" d=\"M 314.7,77.7 L 327.2,57.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-13 atom-13 atom-14\" d=\"M 312.5,72.2 L 321.2,57.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-14 atom-14 atom-15\" d=\"M 327.2,57.4 L 315.8,36.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-15 atom-15 atom-16\" d=\"M 315.8,36.3 L 291.9,35.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-15 atom-15 atom-16\" d=\"M 312.1,41.0 L 295.4,40.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-16 atom-16 atom-17\" d=\"M 291.9,35.7 L 279.4,56.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-17 atom-17 atom-18\" d=\"M 279.4,56.0 L 290.8,77.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-17 atom-17 atom-18\" d=\"M 285.3,56.9 L 293.3,71.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-18 atom-7 atom-2\" d=\"M 422.8,60.0 L 434.2,81.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-19 atom-18 atom-13\" d=\"M 290.8,77.1 L 314.7,77.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-8\" d=\"M 383.7 117.7 L 385.9 121.3 Q 386.2 121.7, 386.5 122.3 Q 386.9 123.0, 386.9 123.0 L 386.9 117.7 L 387.8 117.7 L 387.8 124.5 L 386.9 124.5 L 384.5 120.6 Q 384.2 120.1, 383.9 119.6 Q 383.6 119.1, 383.5 118.9 L 383.5 124.5 L 382.7 124.5 L 382.7 117.7 L 383.7 117.7 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"atom-8\" d=\"M 388.6 117.7 L 389.5 117.7 L 389.5 120.6 L 393.0 120.6 L 393.0 117.7 L 393.9 117.7 L 393.9 124.5 L 393.0 124.5 L 393.0 121.4 L 389.5 121.4 L 389.5 124.5 L 388.6 124.5 L 388.6 117.7 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"atom-10\" d=\"M 345.7 140.8 Q 345.7 139.2, 346.5 138.3 Q 347.3 137.4, 348.8 137.4 Q 350.3 137.4, 351.1 138.3 Q 351.9 139.2, 351.9 140.8 Q 351.9 142.5, 351.1 143.4 Q 350.3 144.3, 348.8 144.3 Q 347.3 144.3, 346.5 143.4 Q 345.7 142.5, 345.7 140.8 M 348.8 143.6 Q 349.8 143.6, 350.4 142.9 Q 350.9 142.2, 350.9 140.8 Q 350.9 139.5, 350.4 138.8 Q 349.8 138.2, 348.8 138.2 Q 347.8 138.2, 347.2 138.8 Q 346.6 139.5, 346.6 140.8 Q 346.6 142.2, 347.2 142.9 Q 347.8 143.6, 348.8 143.6 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-11\" d=\"M 346.8 99.4 Q 346.8 97.8, 347.6 96.9 Q 348.4 96.0, 349.9 96.0 Q 351.4 96.0, 352.3 96.9 Q 353.1 97.8, 353.1 99.4 Q 353.1 101.1, 352.2 102.0 Q 351.4 102.9, 349.9 102.9 Q 348.5 102.9, 347.6 102.0 Q 346.8 101.1, 346.8 99.4 M 349.9 102.2 Q 351.0 102.2, 351.5 101.5 Q 352.1 100.8, 352.1 99.4 Q 352.1 98.1, 351.5 97.4 Q 351.0 96.8, 349.9 96.8 Q 348.9 96.8, 348.3 97.4 Q 347.8 98.1, 347.8 99.4 Q 347.8 100.8, 348.3 101.5 Q 348.9 102.2, 349.9 102.2 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"legend\" d=\"M 333.6 192.5 L 332.2 192.5 L 331.0 183.2 L 327.9 192.5 L 326.4 192.5 L 323.3 183.2 L 322.1 192.5 L 320.7 192.5 L 322.1 181.2 L 324.0 181.2 L 327.2 190.3 L 330.3 181.2 L 332.2 181.2 L 333.6 192.5 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 341.7 184.3 L 341.7 192.5 L 340.4 192.5 L 340.3 191.4 Q 339.2 192.6, 337.5 192.6 Q 336.1 192.6, 335.4 191.9 Q 334.7 191.2, 334.7 189.7 L 334.7 184.3 L 336.2 184.3 L 336.2 189.6 Q 336.2 190.6, 336.5 191.0 Q 336.9 191.5, 337.8 191.5 Q 338.5 191.5, 339.1 191.1 Q 339.8 190.8, 340.2 190.2 L 340.2 184.3 L 341.7 184.3 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 344.2 184.3 L 344.4 185.4 Q 345.2 184.1, 346.6 184.1 Q 347.1 184.1, 347.7 184.3 L 347.5 185.6 Q 346.8 185.5, 346.4 185.5 Q 345.7 185.5, 345.3 185.8 Q 344.8 186.0, 344.5 186.6 L 344.5 192.5 L 343.0 192.5 L 343.0 184.3 L 344.2 184.3 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 347.9 188.4 Q 347.9 186.4, 348.9 185.3 Q 349.9 184.1, 351.9 184.1 Q 353.7 184.1, 354.7 185.5 L 353.7 186.2 Q 353.3 185.8, 352.9 185.6 Q 352.5 185.3, 351.9 185.3 Q 350.7 185.3, 350.1 186.1 Q 349.5 186.9, 349.5 188.4 Q 349.5 189.9, 350.1 190.7 Q 350.8 191.4, 352.0 191.4 Q 352.6 191.4, 353.1 191.3 Q 353.6 191.1, 354.1 190.9 L 354.6 191.9 Q 353.4 192.6, 351.9 192.6 Q 349.9 192.6, 348.9 191.5 Q 347.9 190.4, 347.9 188.4 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 355.1 192.5 L 355.1 180.4 L 356.6 180.4 L 356.6 192.5 L 355.1 192.5 M 358.6 187.8 L 362.1 192.5 L 360.3 192.5 L 356.9 187.8 L 359.8 184.3 L 361.5 184.3 L 358.6 187.8 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 362.1 188.4 Q 362.1 186.4, 363.2 185.3 Q 364.2 184.1, 366.1 184.1 Q 367.9 184.1, 368.9 185.3 Q 370.0 186.4, 370.0 188.4 Q 370.0 190.4, 368.9 191.5 Q 367.9 192.6, 366.1 192.6 Q 364.2 192.6, 363.2 191.5 Q 362.1 190.4, 362.1 188.4 M 363.7 188.4 Q 363.7 189.9, 364.3 190.7 Q 364.9 191.4, 366.1 191.4 Q 367.2 191.4, 367.8 190.7 Q 368.4 189.9, 368.4 188.4 Q 368.4 186.9, 367.8 186.1 Q 367.2 185.3, 366.1 185.3 Q 364.9 185.3, 364.3 186.1 Q 363.7 186.9, 363.7 188.4 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"\" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 376.5 190.7 Q 376.6 190.8, 377.1 191.0 Q 377.6 191.2, 378.2 191.4 Q 378.8 191.5, 379.4 191.5 Q 380.5 191.5, 381.1 191.0 Q 381.7 190.5, 381.7 189.6 Q 381.7 188.9, 381.4 188.6 Q 381.1 188.2, 380.6 188.0 Q 380.1 187.8, 379.3 187.5 Q 378.3 187.2, 377.7 186.9 Q 377.1 186.6, 376.7 186.0 Q 376.3 185.4, 376.3 184.4 Q 376.3 183.0, 377.2 182.1 Q 378.2 181.2, 380.1 181.2 Q 381.4 181.2, 382.9 181.8 L 382.6 183.1 Q 381.2 182.5, 380.2 182.5 Q 379.1 182.5, 378.5 183.0 Q 377.9 183.4, 377.9 184.2 Q 377.9 184.8, 378.2 185.2 Q 378.5 185.5, 378.9 185.8 Q 379.4 186.0, 380.2 186.2 Q 381.2 186.5, 381.8 186.8 Q 382.4 187.2, 382.8 187.8 Q 383.3 188.5, 383.3 189.6 Q 383.3 191.1, 382.2 192.0 Q 381.2 192.8, 379.5 192.8 Q 378.4 192.8, 377.7 192.6 Q 376.9 192.4, 376.0 192.0 L 376.5 190.7 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 384.0 188.4 Q 384.0 186.4, 385.0 185.3 Q 386.0 184.1, 388.0 184.1 Q 389.9 184.1, 390.8 185.5 L 389.8 186.2 Q 389.4 185.8, 389.0 185.6 Q 388.6 185.3, 388.0 185.3 Q 386.8 185.3, 386.2 186.1 Q 385.6 186.9, 385.6 188.4 Q 385.6 189.9, 386.2 190.7 Q 386.9 191.4, 388.1 191.4 Q 388.7 191.4, 389.2 191.3 Q 389.7 191.1, 390.3 190.9 L 390.7 191.9 Q 389.5 192.6, 388.0 192.6 Q 386.0 192.6, 385.0 191.5 Q 384.0 190.4, 384.0 188.4 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 391.2 190.3 Q 391.2 189.0, 392.3 188.2 Q 393.3 187.5, 395.3 187.5 L 396.5 187.5 L 396.5 187.2 Q 396.5 186.2, 396.0 185.8 Q 395.6 185.3, 394.6 185.3 Q 393.9 185.3, 393.4 185.4 Q 392.9 185.6, 392.1 185.9 L 391.7 184.9 Q 393.2 184.1, 394.6 184.1 Q 396.4 184.1, 397.2 184.9 Q 398.0 185.6, 398.0 187.2 L 398.0 192.5 L 396.8 192.5 Q 396.8 192.4, 396.7 192.2 Q 396.7 191.9, 396.6 191.5 Q 395.5 192.7, 393.9 192.7 Q 392.7 192.7, 391.9 192.0 Q 391.2 191.4, 391.2 190.3 M 392.7 190.2 Q 392.7 190.9, 393.1 191.2 Q 393.5 191.5, 394.2 191.5 Q 394.8 191.5, 395.5 191.2 Q 396.1 190.9, 396.5 190.4 L 396.5 188.6 L 395.4 188.6 Q 394.0 188.6, 393.4 189.0 Q 392.7 189.4, 392.7 190.2 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 399.2 185.4 L 399.2 184.3 L 400.7 184.3 L 400.7 183.1 Q 400.7 181.7, 401.4 181.0 Q 402.1 180.3, 403.3 180.3 Q 403.8 180.3, 404.3 180.5 Q 404.7 180.6, 405.2 180.8 L 404.8 181.8 Q 404.1 181.5, 403.4 181.5 Q 402.8 181.5, 402.5 181.9 Q 402.2 182.3, 402.2 183.0 L 402.2 184.3 L 404.7 184.3 L 404.7 185.4 L 402.2 185.4 L 402.2 195.0 L 400.7 195.0 L 400.7 185.4 L 399.2 185.4 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 404.8 185.4 L 404.8 184.3 L 406.3 184.3 L 406.3 183.1 Q 406.3 181.7, 407.0 181.0 Q 407.7 180.3, 408.9 180.3 Q 409.5 180.3, 409.9 180.5 Q 410.3 180.6, 410.9 180.8 L 410.4 181.8 Q 409.7 181.5, 409.0 181.5 Q 408.4 181.5, 408.1 181.9 Q 407.8 182.3, 407.8 183.0 L 407.8 184.3 L 410.3 184.3 L 410.3 185.4 L 407.8 185.4 L 407.8 195.0 L 406.3 195.0 L 406.3 185.4 L 404.8 185.4 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 410.4 188.4 Q 410.4 186.4, 411.5 185.3 Q 412.5 184.1, 414.3 184.1 Q 416.2 184.1, 417.2 185.3 Q 418.3 186.4, 418.3 188.4 Q 418.3 190.4, 417.2 191.5 Q 416.2 192.6, 414.3 192.6 Q 412.5 192.6, 411.5 191.5 Q 410.4 190.4, 410.4 188.4 M 412.0 188.4 Q 412.0 189.9, 412.6 190.7 Q 413.2 191.4, 414.3 191.4 Q 415.5 191.4, 416.1 190.7 Q 416.7 189.9, 416.7 188.4 Q 416.7 186.9, 416.1 186.1 Q 415.5 185.3, 414.3 185.3 Q 413.2 185.3, 412.6 186.1 Q 412.0 186.9, 412.0 188.4 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 419.0 180.4 L 420.5 180.4 L 420.5 192.5 L 419.0 192.5 L 419.0 180.4 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 429.3 180.4 L 429.3 192.5 L 428.1 192.5 L 427.9 191.5 Q 427.0 192.6, 425.5 192.6 Q 423.7 192.6, 422.8 191.6 Q 421.8 190.5, 421.8 188.5 Q 421.8 186.5, 423.0 185.3 Q 424.1 184.1, 426.1 184.1 Q 426.9 184.1, 427.8 184.4 L 427.8 180.4 L 429.3 180.4 M 425.5 191.4 Q 426.4 191.4, 427.0 191.0 Q 427.6 190.5, 427.8 189.7 L 427.8 185.6 Q 427.0 185.3, 426.1 185.3 Q 424.8 185.3, 424.1 186.2 Q 423.4 187.0, 423.4 188.5 Q 423.4 189.9, 423.9 190.7 Q 424.5 191.4, 425.5 191.4 \" fill=\"#000000\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 650.1,104.5 L 669.3,105.0\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 674.0,101.2 L 683.9,85.2\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 686.6,84.8 L 705.7,85.3\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 689.6,80.1 L 702.9,80.4\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;stroke-dasharray:6,0,6\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 710.5,81.5 L 720.3,65.5\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 707.9,76.6 L 714.8,65.4\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;stroke-dasharray:6,0,6\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 718.3,60.8 L 709.5,44.4\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 712.8,60.6 L 706.6,49.2\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;stroke-dasharray:6,0,6\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 706.8,43.9 L 687.7,43.4\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 703.8,48.6 L 690.5,48.2\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;stroke-dasharray:6,0,6\"/>\n", | |
"<path class=\"bond-6 atom-6 atom-7\" d=\"M 685.1,43.8 L 675.2,59.8\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-6 atom-7\" d=\"M 687.6,48.7 L 680.7,59.9\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;stroke-dasharray:6,0,6\"/>\n", | |
"<path class=\"bond-7 atom-0 atom-8\" d=\"M 647.5,104.9 L 637.6,120.9\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 632.8,124.7 L 613.7,124.2\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 613.1,125.8 L 603.2,141.8\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 609.0,123.3 L 599.1,139.3\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-9 atom-11\" d=\"M 609.0,119.9 L 600.2,103.5\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-11 atom-12\" d=\"M 597.6,103.0 L 578.4,102.5\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-12 atom-12 atom-13\" d=\"M 573.8,98.2 L 564.9,81.8\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-13 atom-13 atom-14\" d=\"M 567.1,77.5 L 576.9,61.5\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-13 atom-13 atom-14\" d=\"M 564.5,72.6 L 571.4,61.4\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;stroke-dasharray:6,0,6\"/>\n", | |
"<path class=\"bond-14 atom-14 atom-15\" d=\"M 574.9,56.8 L 566.1,40.4\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-14 atom-14 atom-15\" d=\"M 569.4,56.6 L 563.2,45.2\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;stroke-dasharray:6,0,6\"/>\n", | |
"<path class=\"bond-15 atom-15 atom-16\" d=\"M 563.4,39.9 L 544.3,39.4\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-15 atom-15 atom-16\" d=\"M 560.4,44.6 L 547.1,44.2\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;stroke-dasharray:6,0,6\"/>\n", | |
"<path class=\"bond-16 atom-16 atom-17\" d=\"M 541.7,39.8 L 531.8,55.8\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-16 atom-16 atom-17\" d=\"M 544.2,44.7 L 537.3,55.9\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;stroke-dasharray:6,0,6\"/>\n", | |
"<path class=\"bond-17 atom-17 atom-18\" d=\"M 529.6,60.1 L 538.5,76.5\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-17 atom-17 atom-18\" d=\"M 535.2,60.3 L 541.4,71.8\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;stroke-dasharray:6,0,6\"/>\n", | |
"<path class=\"bond-18 atom-7 atom-2\" d=\"M 673.0,64.1 L 681.9,80.5\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-18 atom-7 atom-2\" d=\"M 678.6,64.3 L 684.8,75.8\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;stroke-dasharray:6,0,6\"/>\n", | |
"<path class=\"bond-19 atom-18 atom-13\" d=\"M 543.2,80.8 L 562.3,81.3\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-19 atom-18 atom-13\" d=\"M 546.2,76.1 L 559.5,76.5\" style=\"fill:none;fill-rule:evenodd;stroke:#191919;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;stroke-dasharray:6,0,6\"/>\n", | |
"<path class=\"atom-0\" d=\"M 646.5 103.7 L 647.5 102.6 L 646.1 102.4 L 646.3 101.7 L 647.6 102.3 L 647.4 101.0 L 648.1 101.0 L 647.9 102.3 L 649.1 101.7 L 649.3 102.4 L 648.0 102.6 L 649.0 103.6 L 648.4 104.1 L 647.7 102.8 L 647.1 104.1 L 646.5 103.7 \" fill=\"#191919\"/>\n", | |
"<path class=\"atom-1\" d=\"M 670.4 104.3 L 671.4 103.3 L 670.0 103.0 L 670.2 102.4 L 671.5 103.0 L 671.3 101.6 L 672.0 101.6 L 671.8 103.0 L 673.0 102.4 L 673.2 103.0 L 671.9 103.3 L 672.9 104.3 L 672.3 104.7 L 671.6 103.5 L 671.0 104.7 L 670.4 104.3 \" fill=\"#191919\"/>\n", | |
"<path class=\"atom-2\" d=\"M 682.9 84.0 L 683.9 82.9 L 682.6 82.7 L 682.8 82.0 L 684.0 82.6 L 683.8 81.3 L 684.5 81.3 L 684.3 82.6 L 685.6 82.0 L 685.8 82.7 L 684.4 82.9 L 685.4 83.9 L 684.8 84.4 L 684.1 83.1 L 683.5 84.4 L 682.9 84.0 \" fill=\"#191919\"/>\n", | |
"<path class=\"atom-3\" d=\"M 706.8 84.6 L 707.8 83.6 L 706.5 83.3 L 706.7 82.7 L 707.9 83.3 L 707.7 81.9 L 708.4 81.9 L 708.2 83.3 L 709.5 82.7 L 709.7 83.3 L 708.3 83.6 L 709.3 84.6 L 708.7 85.0 L 708.1 83.8 L 707.4 85.0 L 706.8 84.6 \" fill=\"#191919\"/>\n", | |
"<path class=\"atom-4\" d=\"M 719.3 64.3 L 720.3 63.2 L 719.0 63.0 L 719.2 62.3 L 720.4 62.9 L 720.2 61.6 L 721.0 61.6 L 720.8 62.9 L 722.0 62.3 L 722.2 63.0 L 720.9 63.2 L 721.8 64.2 L 721.2 64.7 L 720.6 63.4 L 719.9 64.7 L 719.3 64.3 \" fill=\"#191919\"/>\n", | |
"<path class=\"atom-5\" d=\"M 708.0 43.2 L 708.9 42.2 L 707.6 41.9 L 707.8 41.3 L 709.0 41.9 L 708.9 40.5 L 709.6 40.5 L 709.4 41.9 L 710.6 41.3 L 710.8 41.9 L 709.5 42.2 L 710.4 43.2 L 709.9 43.6 L 709.2 42.4 L 708.5 43.6 L 708.0 43.2 \" fill=\"#191919\"/>\n", | |
"<path class=\"atom-6\" d=\"M 684.1 42.6 L 685.0 41.5 L 683.7 41.3 L 683.9 40.6 L 685.1 41.2 L 685.0 39.9 L 685.7 39.9 L 685.5 41.2 L 686.7 40.6 L 686.9 41.3 L 685.6 41.5 L 686.5 42.5 L 686.0 43.0 L 685.3 41.7 L 684.6 43.0 L 684.1 42.6 \" fill=\"#191919\"/>\n", | |
"<path class=\"atom-7\" d=\"M 671.5 62.9 L 672.5 61.9 L 671.2 61.6 L 671.4 61.0 L 672.6 61.6 L 672.4 60.2 L 673.2 60.2 L 673.0 61.6 L 674.2 61.0 L 674.4 61.6 L 673.1 61.9 L 674.0 62.9 L 673.4 63.3 L 672.8 62.1 L 672.1 63.3 L 671.5 62.9 \" fill=\"#191919\"/>\n", | |
"<path class=\"atom-8\" d=\"M 633.9 124.0 L 634.9 123.0 L 633.6 122.7 L 633.8 122.1 L 635.0 122.7 L 634.9 121.3 L 635.6 121.3 L 635.4 122.7 L 636.6 122.1 L 636.8 122.7 L 635.5 123.0 L 636.4 124.0 L 635.9 124.4 L 635.2 123.2 L 634.5 124.4 L 633.9 124.0 \" fill=\"#191919\"/>\n", | |
"<path class=\"atom-9\" d=\"M 610.0 123.4 L 611.0 122.3 L 609.7 122.1 L 609.9 121.4 L 611.1 122.0 L 611.0 120.7 L 611.7 120.7 L 611.5 122.0 L 612.7 121.4 L 612.9 122.1 L 611.6 122.3 L 612.5 123.3 L 612.0 123.8 L 611.3 122.5 L 610.6 123.8 L 610.0 123.4 \" fill=\"#191919\"/>\n", | |
"<path class=\"atom-10\" d=\"M 597.5 143.7 L 598.5 142.7 L 597.2 142.4 L 597.4 141.8 L 598.6 142.4 L 598.4 141.0 L 599.1 141.0 L 598.9 142.4 L 600.2 141.8 L 600.4 142.4 L 599.1 142.7 L 600.0 143.7 L 599.4 144.1 L 598.8 142.9 L 598.1 144.1 L 597.5 143.7 \" fill=\"#191919\"/>\n", | |
"<path class=\"atom-11\" d=\"M 598.7 102.3 L 599.7 101.3 L 598.3 101.0 L 598.5 100.4 L 599.8 101.0 L 599.6 99.6 L 600.3 99.6 L 600.1 101.0 L 601.3 100.4 L 601.5 101.0 L 600.2 101.3 L 601.2 102.3 L 600.6 102.7 L 599.9 101.5 L 599.3 102.7 L 598.7 102.3 \" fill=\"#191919\"/>\n", | |
"<path class=\"atom-12\" d=\"M 574.8 101.7 L 575.8 100.6 L 574.4 100.4 L 574.6 99.7 L 575.9 100.3 L 575.7 99.0 L 576.4 99.0 L 576.2 100.3 L 577.4 99.7 L 577.6 100.4 L 576.3 100.6 L 577.3 101.6 L 576.7 102.1 L 576.0 100.8 L 575.4 102.1 L 574.8 101.7 \" fill=\"#191919\"/>\n", | |
"<path class=\"atom-13\" d=\"M 563.4 80.6 L 564.4 79.6 L 563.1 79.3 L 563.3 78.7 L 564.5 79.3 L 564.3 77.9 L 565.0 77.9 L 564.8 79.3 L 566.1 78.7 L 566.3 79.3 L 564.9 79.6 L 565.9 80.6 L 565.3 81.0 L 564.6 79.8 L 564.0 81.0 L 563.4 80.6 \" fill=\"#191919\"/>\n", | |
"<path class=\"atom-14\" d=\"M 575.9 60.3 L 576.9 59.2 L 575.6 59.0 L 575.8 58.3 L 577.0 58.9 L 576.8 57.6 L 577.6 57.6 L 577.4 58.9 L 578.6 58.3 L 578.8 59.0 L 577.5 59.2 L 578.4 60.2 L 577.8 60.7 L 577.2 59.4 L 576.5 60.7 L 575.9 60.3 \" fill=\"#191919\"/>\n", | |
"<path class=\"atom-15\" d=\"M 564.5 39.2 L 565.5 38.2 L 564.2 37.9 L 564.4 37.3 L 565.6 37.9 L 565.5 36.5 L 566.2 36.5 L 566.0 37.9 L 567.2 37.3 L 567.4 37.9 L 566.1 38.2 L 567.0 39.2 L 566.5 39.6 L 565.8 38.4 L 565.1 39.6 L 564.5 39.2 \" fill=\"#191919\"/>\n", | |
"<path class=\"atom-16\" d=\"M 540.6 38.6 L 541.6 37.5 L 540.3 37.3 L 540.5 36.6 L 541.7 37.2 L 541.6 35.9 L 542.3 35.9 L 542.1 37.2 L 543.3 36.6 L 543.5 37.3 L 542.2 37.5 L 543.1 38.5 L 542.6 39.0 L 541.9 37.7 L 541.2 39.0 L 540.6 38.6 \" fill=\"#191919\"/>\n", | |
"<path class=\"atom-17\" d=\"M 528.1 58.9 L 529.1 57.9 L 527.8 57.6 L 528.0 57.0 L 529.2 57.6 L 529.0 56.2 L 529.8 56.2 L 529.6 57.6 L 530.8 57.0 L 531.0 57.6 L 529.7 57.9 L 530.6 58.9 L 530.0 59.3 L 529.4 58.1 L 528.7 59.3 L 528.1 58.9 \" fill=\"#191919\"/>\n", | |
"<path class=\"atom-18\" d=\"M 539.5 80.0 L 540.5 78.9 L 539.2 78.7 L 539.4 78.0 L 540.6 78.6 L 540.4 77.3 L 541.1 77.3 L 540.9 78.6 L 542.2 78.0 L 542.4 78.7 L 541.0 78.9 L 542.0 79.9 L 541.4 80.4 L 540.7 79.1 L 540.1 80.4 L 539.5 80.0 \" fill=\"#191919\"/>\n", | |
"<path class=\"legend\" d=\"M 552.5 187.0 L 552.5 191.7 Q 550.9 192.6, 548.5 192.6 Q 546.0 192.6, 544.7 191.1 Q 543.4 189.6, 543.4 186.8 Q 543.4 184.0, 544.7 182.5 Q 546.0 181.0, 548.5 181.0 Q 549.9 181.0, 550.8 181.5 Q 551.8 181.9, 552.4 182.7 L 551.4 183.6 Q 550.3 182.3, 548.5 182.3 Q 546.8 182.3, 545.9 183.5 Q 545.0 184.6, 545.0 186.8 Q 545.0 189.1, 545.9 190.2 Q 546.9 191.4, 548.7 191.4 Q 549.9 191.4, 551.0 191.0 L 551.0 187.0 L 552.5 187.0 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 553.7 188.4 Q 553.7 186.4, 554.7 185.3 Q 555.7 184.1, 557.5 184.1 Q 559.4 184.1, 560.2 185.2 Q 561.0 186.3, 561.0 188.3 L 561.0 188.6 L 555.2 188.6 Q 555.3 190.0, 555.9 190.7 Q 556.5 191.4, 557.7 191.4 Q 558.3 191.4, 558.9 191.3 Q 559.5 191.1, 560.2 190.8 L 560.7 191.8 Q 559.8 192.3, 559.1 192.5 Q 558.4 192.6, 557.6 192.6 Q 555.7 192.6, 554.7 191.5 Q 553.7 190.4, 553.7 188.4 M 557.5 185.3 Q 556.6 185.3, 556.0 185.9 Q 555.5 186.4, 555.3 187.5 L 559.4 187.5 Q 559.3 186.4, 558.8 185.8 Q 558.4 185.3, 557.5 185.3 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 565.9 184.1 Q 567.2 184.1, 567.9 184.9 Q 568.6 185.6, 568.6 187.1 L 568.6 192.5 L 567.1 192.5 L 567.1 187.2 Q 567.1 186.2, 566.7 185.8 Q 566.3 185.3, 565.5 185.3 Q 564.7 185.3, 564.1 185.7 Q 563.5 186.0, 563.1 186.6 L 563.1 192.5 L 561.6 192.5 L 561.6 184.3 L 562.8 184.3 L 563.0 185.4 Q 564.1 184.1, 565.9 184.1 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 569.8 188.4 Q 569.8 186.4, 570.8 185.3 Q 571.8 184.1, 573.7 184.1 Q 575.5 184.1, 576.3 185.2 Q 577.1 186.3, 577.1 188.3 L 577.1 188.6 L 571.3 188.6 Q 571.4 190.0, 572.0 190.7 Q 572.6 191.4, 573.8 191.4 Q 574.4 191.4, 575.0 191.3 Q 575.6 191.1, 576.3 190.8 L 576.8 191.8 Q 575.9 192.3, 575.2 192.5 Q 574.5 192.6, 573.7 192.6 Q 571.9 192.6, 570.8 191.5 Q 569.8 190.4, 569.8 188.4 M 573.7 185.3 Q 572.7 185.3, 572.1 185.9 Q 571.6 186.4, 571.4 187.5 L 575.5 187.5 Q 575.4 186.4, 574.9 185.8 Q 574.5 185.3, 573.7 185.3 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 578.9 184.3 L 579.1 185.4 Q 579.9 184.1, 581.4 184.1 Q 581.8 184.1, 582.4 184.3 L 582.2 185.6 Q 581.5 185.5, 581.1 185.5 Q 580.4 185.5, 580.0 185.8 Q 579.5 186.0, 579.2 186.6 L 579.2 192.5 L 577.7 192.5 L 577.7 184.3 L 578.9 184.3 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 582.7 181.2 L 584.1 181.2 L 584.1 182.6 L 582.7 182.6 L 582.7 181.2 M 582.7 184.3 L 584.1 184.3 L 584.1 192.5 L 582.7 192.5 L 582.7 184.3 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 585.5 188.4 Q 585.5 186.4, 586.5 185.3 Q 587.5 184.1, 589.4 184.1 Q 591.3 184.1, 592.3 185.5 L 591.3 186.2 Q 590.9 185.8, 590.4 185.6 Q 590.0 185.3, 589.4 185.3 Q 588.3 185.3, 587.7 186.1 Q 587.0 186.9, 587.0 188.4 Q 587.0 189.9, 587.7 190.7 Q 588.3 191.4, 589.5 191.4 Q 590.2 191.4, 590.7 191.3 Q 591.1 191.1, 591.7 190.9 L 592.1 191.9 Q 590.9 192.6, 589.4 192.6 Q 587.5 192.6, 586.5 191.5 Q 585.5 190.4, 585.5 188.4 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"\" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 610.9 192.5 L 609.5 192.5 L 608.3 183.2 L 605.2 192.5 L 603.7 192.5 L 600.6 183.2 L 599.5 192.5 L 598.0 192.5 L 599.4 181.2 L 601.3 181.2 L 604.5 190.3 L 607.6 181.2 L 609.5 181.2 L 610.9 192.5 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 619.0 184.3 L 619.0 192.5 L 617.7 192.5 L 617.6 191.4 Q 616.5 192.6, 614.8 192.6 Q 613.4 192.6, 612.7 191.9 Q 612.0 191.2, 612.0 189.7 L 612.0 184.3 L 613.5 184.3 L 613.5 189.6 Q 613.5 190.6, 613.9 191.0 Q 614.2 191.5, 615.1 191.5 Q 615.8 191.5, 616.4 191.1 Q 617.1 190.8, 617.5 190.2 L 617.5 184.3 L 619.0 184.3 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 621.5 184.3 L 621.7 185.4 Q 622.5 184.1, 624.0 184.1 Q 624.4 184.1, 625.0 184.3 L 624.8 185.6 Q 624.1 185.5, 623.7 185.5 Q 623.0 185.5, 622.6 185.8 Q 622.1 186.0, 621.8 186.6 L 621.8 192.5 L 620.3 192.5 L 620.3 184.3 L 621.5 184.3 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 625.2 188.4 Q 625.2 186.4, 626.2 185.3 Q 627.2 184.1, 629.2 184.1 Q 631.1 184.1, 632.0 185.5 L 631.0 186.2 Q 630.6 185.8, 630.2 185.6 Q 629.8 185.3, 629.2 185.3 Q 628.0 185.3, 627.4 186.1 Q 626.8 186.9, 626.8 188.4 Q 626.8 189.9, 627.4 190.7 Q 628.1 191.4, 629.3 191.4 Q 630.0 191.4, 630.4 191.3 Q 630.9 191.1, 631.5 190.9 L 631.9 191.9 Q 630.7 192.6, 629.2 192.6 Q 627.2 192.6, 626.2 191.5 Q 625.2 190.4, 625.2 188.4 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 632.4 192.5 L 632.4 180.4 L 633.9 180.4 L 633.9 192.5 L 632.4 192.5 M 635.9 187.8 L 639.4 192.5 L 637.6 192.5 L 634.2 187.8 L 637.1 184.3 L 638.8 184.3 L 635.9 187.8 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 639.5 188.4 Q 639.5 186.4, 640.5 185.3 Q 641.5 184.1, 643.4 184.1 Q 645.2 184.1, 646.2 185.3 Q 647.3 186.4, 647.3 188.4 Q 647.3 190.4, 646.2 191.5 Q 645.2 192.6, 643.4 192.6 Q 641.5 192.6, 640.5 191.5 Q 639.5 190.4, 639.5 188.4 M 641.0 188.4 Q 641.0 189.9, 641.6 190.7 Q 642.2 191.4, 643.4 191.4 Q 644.5 191.4, 645.1 190.7 Q 645.7 189.9, 645.7 188.4 Q 645.7 186.9, 645.1 186.1 Q 644.5 185.3, 643.4 185.3 Q 642.2 185.3, 641.6 186.1 Q 641.0 186.9, 641.0 188.4 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"\" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 653.8 190.7 Q 653.9 190.8, 654.4 191.0 Q 654.9 191.2, 655.5 191.4 Q 656.1 191.5, 656.7 191.5 Q 657.8 191.5, 658.4 191.0 Q 659.0 190.5, 659.0 189.6 Q 659.0 188.9, 658.7 188.6 Q 658.4 188.2, 657.9 188.0 Q 657.4 187.8, 656.6 187.5 Q 655.6 187.2, 655.0 186.9 Q 654.4 186.6, 654.0 186.0 Q 653.6 185.4, 653.6 184.4 Q 653.6 183.0, 654.5 182.1 Q 655.5 181.2, 657.4 181.2 Q 658.7 181.2, 660.2 181.8 L 659.9 183.1 Q 658.5 182.5, 657.5 182.5 Q 656.4 182.5, 655.8 183.0 Q 655.2 183.4, 655.2 184.2 Q 655.2 184.8, 655.5 185.2 Q 655.8 185.5, 656.2 185.8 Q 656.7 186.0, 657.5 186.2 Q 658.5 186.5, 659.1 186.8 Q 659.7 187.2, 660.1 187.8 Q 660.6 188.5, 660.6 189.6 Q 660.6 191.1, 659.5 192.0 Q 658.5 192.8, 656.8 192.8 Q 655.7 192.8, 655.0 192.6 Q 654.2 192.4, 653.3 192.0 L 653.8 190.7 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 661.3 188.4 Q 661.3 186.4, 662.3 185.3 Q 663.3 184.1, 665.3 184.1 Q 667.2 184.1, 668.1 185.5 L 667.1 186.2 Q 666.7 185.8, 666.3 185.6 Q 665.9 185.3, 665.3 185.3 Q 664.1 185.3, 663.5 186.1 Q 662.9 186.9, 662.9 188.4 Q 662.9 189.9, 663.5 190.7 Q 664.2 191.4, 665.4 191.4 Q 666.1 191.4, 666.5 191.3 Q 667.0 191.1, 667.6 190.9 L 668.0 191.9 Q 666.8 192.6, 665.3 192.6 Q 663.3 192.6, 662.3 191.5 Q 661.3 190.4, 661.3 188.4 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 668.5 190.3 Q 668.5 189.0, 669.6 188.2 Q 670.6 187.5, 672.6 187.5 L 673.8 187.5 L 673.8 187.2 Q 673.8 186.2, 673.3 185.8 Q 672.9 185.3, 671.9 185.3 Q 671.3 185.3, 670.7 185.4 Q 670.2 185.6, 669.4 185.9 L 669.0 184.9 Q 670.5 184.1, 671.9 184.1 Q 673.7 184.1, 674.5 184.9 Q 675.3 185.6, 675.3 187.2 L 675.3 192.5 L 674.1 192.5 Q 674.1 192.4, 674.1 192.2 Q 674.0 191.9, 673.9 191.5 Q 672.8 192.7, 671.2 192.7 Q 670.0 192.7, 669.3 192.0 Q 668.5 191.4, 668.5 190.3 M 670.0 190.2 Q 670.0 190.9, 670.4 191.2 Q 670.8 191.5, 671.5 191.5 Q 672.1 191.5, 672.8 191.2 Q 673.4 190.9, 673.8 190.4 L 673.8 188.6 L 672.7 188.6 Q 671.3 188.6, 670.7 189.0 Q 670.0 189.4, 670.0 190.2 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 676.5 185.4 L 676.5 184.3 L 678.0 184.3 L 678.0 183.1 Q 678.0 181.7, 678.7 181.0 Q 679.4 180.3, 680.6 180.3 Q 681.1 180.3, 681.6 180.5 Q 682.0 180.6, 682.5 180.8 L 682.1 181.8 Q 681.4 181.5, 680.7 181.5 Q 680.1 181.5, 679.8 181.9 Q 679.5 182.3, 679.5 183.0 L 679.5 184.3 L 682.0 184.3 L 682.0 185.4 L 679.5 185.4 L 679.5 195.0 L 678.0 195.0 L 678.0 185.4 L 676.5 185.4 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 682.1 185.4 L 682.1 184.3 L 683.6 184.3 L 683.6 183.1 Q 683.6 181.7, 684.3 181.0 Q 685.0 180.3, 686.2 180.3 Q 686.8 180.3, 687.2 180.5 Q 687.7 180.6, 688.2 180.8 L 687.7 181.8 Q 687.0 181.5, 686.3 181.5 Q 685.7 181.5, 685.4 181.9 Q 685.1 182.3, 685.1 183.0 L 685.1 184.3 L 687.6 184.3 L 687.6 185.4 L 685.1 185.4 L 685.1 195.0 L 683.6 195.0 L 683.6 185.4 L 682.1 185.4 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 687.7 188.4 Q 687.7 186.4, 688.8 185.3 Q 689.8 184.1, 691.7 184.1 Q 693.5 184.1, 694.5 185.3 Q 695.6 186.4, 695.6 188.4 Q 695.6 190.4, 694.5 191.5 Q 693.5 192.6, 691.7 192.6 Q 689.8 192.6, 688.8 191.5 Q 687.7 190.4, 687.7 188.4 M 689.3 188.4 Q 689.3 189.9, 689.9 190.7 Q 690.5 191.4, 691.7 191.4 Q 692.8 191.4, 693.4 190.7 Q 694.0 189.9, 694.0 188.4 Q 694.0 186.9, 693.4 186.1 Q 692.8 185.3, 691.7 185.3 Q 690.5 185.3, 689.9 186.1 Q 689.3 186.9, 689.3 188.4 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 696.3 180.4 L 697.8 180.4 L 697.8 192.5 L 696.3 192.5 L 696.3 180.4 \" fill=\"#000000\"/>\n", | |
"<path class=\"legend\" d=\"M 706.6 180.4 L 706.6 192.5 L 705.4 192.5 L 705.2 191.5 Q 704.3 192.6, 702.8 192.6 Q 701.0 192.6, 700.1 191.6 Q 699.1 190.5, 699.1 188.5 Q 699.1 186.5, 700.3 185.3 Q 701.4 184.1, 703.4 184.1 Q 704.2 184.1, 705.1 184.4 L 705.1 180.4 L 706.6 180.4 M 702.9 191.4 Q 703.7 191.4, 704.3 191.0 Q 704.9 190.5, 705.1 189.7 L 705.1 185.6 Q 704.3 185.3, 703.4 185.3 Q 702.1 185.3, 701.4 186.2 Q 700.7 187.0, 700.7 188.5 Q 700.7 189.9, 701.2 190.7 Q 701.8 191.4, 702.9 191.4 \" fill=\"#000000\"/>\n", | |
"</svg>" | |
], | |
"text/plain": [ | |
"<IPython.core.display.SVG object>" | |
] | |
}, | |
"execution_count": 54, | |
"metadata": {}, | |
"output_type": "execute_result" | |
} | |
], | |
"source": [ | |
"# A molecule\n", | |
"mol = dm.to_mol(\"CC(C(C1=CC(=C(C=C1)O)O)O)N(C)C(=O)OCC2=CC=CC=C2\")\n", | |
"\n", | |
"# Extract the Murcko scaffold\n", | |
"scaffold = dm.to_scaffold_murcko(mol)\n", | |
"\n", | |
"# Extract the generic Murcko scaffold\n", | |
"scaffold_generic = dm.to_scaffold_murcko(mol, make_generic=True)\n", | |
"\n", | |
"legends = [\"Original\", \"Murcko Scaffold\", \"Generic Murcko Scaffold\"]\n", | |
"dm.to_image([mol, scaffold, scaffold_generic], legends=legends, mol_size=(250, 200))" | |
] | |
}, | |
{ | |
"cell_type": "markdown", | |
"id": "491aeee8-2ce5-4e59-8fcd-abc852e42c32", | |
"metadata": {}, | |
"source": [ | |
"## `dm.fp` and `dm.similarity`" | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"execution_count": 58, | |
"id": "d1f2d102-e2bb-4b1f-b4e4-d0c0f20b027c", | |
"metadata": {}, | |
"outputs": [ | |
{ | |
"data": { | |
"text/plain": [ | |
"['maccs',\n", | |
" 'ecfp',\n", | |
" 'topological',\n", | |
" 'atompair',\n", | |
" 'rdkit',\n", | |
" 'pattern',\n", | |
" 'layered',\n", | |
" 'erg',\n", | |
" 'estate',\n", | |
" 'avalon-count',\n", | |
" 'rdkit-count',\n", | |
" 'ecfp-count',\n", | |
" 'fcfp-count',\n", | |
" 'topological-count',\n", | |
" 'atompair-count']" | |
] | |
}, | |
"execution_count": 58, | |
"metadata": {}, | |
"output_type": "execute_result" | |
} | |
], | |
"source": [ | |
"list(dm.list_supported_fingerprints().keys())" | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"execution_count": 61, | |
"id": "d6503ac9-ad56-4799-9f3f-dd2b3fcd6dd0", | |
"metadata": {}, | |
"outputs": [ | |
{ | |
"data": { | |
"image/svg+xml": [ | |
"<svg xmlns=\"http://www.w3.org/2000/svg\" xmlns:rdkit=\"http://www.rdkit.org/xml\" xmlns:xlink=\"http://www.w3.org/1999/xlink\" version=\"1.1\" baseProfile=\"full\" xml:space=\"preserve\" width=\"600px\" height=\"150px\" viewBox=\"0 0 600 150\">\n", | |
"<!-- END OF HEADER -->\n", | |
"<rect style=\"opacity:1.0;fill:#FFFFFF;stroke:none\" width=\"600.0\" height=\"150.0\" x=\"0.0\" y=\"0.0\"> </rect>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 15.0,104.2 L 42.0,79.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 38.4,80.6 L 35.3,66.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 35.3,66.1 L 32.2,51.7\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 45.5,79.1 L 42.4,64.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 42.4,64.6 L 39.3,50.1\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-1 atom-3\" d=\"M 42.0,79.9 L 56.3,84.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-1 atom-3\" d=\"M 56.3,84.5 L 70.6,89.2\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 82.5,85.7 L 93.0,76.2\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 93.0,76.2 L 103.5,66.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 103.5,66.7 L 95.9,31.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 109.5,59.9 L 104.2,35.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 95.9,31.2 L 122.9,6.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-6 atom-7\" d=\"M 122.9,6.8 L 157.5,18.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-6 atom-7\" d=\"M 125.9,15.4 L 150.1,23.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-7 atom-8\" d=\"M 157.5,18.0 L 165.1,53.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 165.1,53.6 L 138.1,77.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 156.2,51.8 L 137.3,68.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 138.1,77.9 L 145.7,113.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-10 atom-11\" d=\"M 146.8,110.0 L 161.2,114.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-10 atom-11\" d=\"M 161.2,114.6 L 175.5,119.3\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-10 atom-11\" d=\"M 144.6,116.9 L 158.9,121.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-10 atom-11\" d=\"M 158.9,121.6 L 173.3,126.2\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-10 atom-12\" d=\"M 145.7,113.5 L 135.2,123.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-11 atom-10 atom-12\" d=\"M 135.2,123.0 L 124.7,132.5\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-12 atom-9 atom-4\" d=\"M 138.1,77.9 L 103.5,66.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-2\" d=\"M 29.6 44.4 Q 29.6 41.9, 30.9 40.5 Q 32.1 39.1, 34.4 39.1 Q 36.6 39.1, 37.9 40.5 Q 39.1 41.9, 39.1 44.4 Q 39.1 46.9, 37.9 48.3 Q 36.6 49.7, 34.4 49.7 Q 32.1 49.7, 30.9 48.3 Q 29.6 46.9, 29.6 44.4 M 34.4 48.5 Q 35.9 48.5, 36.8 47.5 Q 37.6 46.4, 37.6 44.4 Q 37.6 42.3, 36.8 41.3 Q 35.9 40.3, 34.4 40.3 Q 32.8 40.3, 31.9 41.3 Q 31.1 42.3, 31.1 44.4 Q 31.1 46.4, 31.9 47.5 Q 32.8 48.5, 34.4 48.5 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-3\" d=\"M 71.8 91.1 Q 71.8 88.6, 73.0 87.3 Q 74.3 85.9, 76.5 85.9 Q 78.8 85.9, 80.1 87.3 Q 81.3 88.6, 81.3 91.1 Q 81.3 93.6, 80.0 95.0 Q 78.8 96.4, 76.5 96.4 Q 74.3 96.4, 73.0 95.0 Q 71.8 93.6, 71.8 91.1 M 76.5 95.3 Q 78.1 95.3, 79.0 94.2 Q 79.8 93.2, 79.8 91.1 Q 79.8 89.1, 79.0 88.1 Q 78.1 87.0, 76.5 87.0 Q 75.0 87.0, 74.1 88.1 Q 73.3 89.1, 73.3 91.1 Q 73.3 93.2, 74.1 94.2 Q 75.0 95.3, 76.5 95.3 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-11\" d=\"M 175.6 124.7 Q 175.6 122.2, 176.8 120.8 Q 178.0 119.5, 180.3 119.5 Q 182.6 119.5, 183.8 120.8 Q 185.0 122.2, 185.0 124.7 Q 185.0 127.2, 183.8 128.6 Q 182.6 130.0, 180.3 130.0 Q 178.0 130.0, 176.8 128.6 Q 175.6 127.2, 175.6 124.7 M 180.3 128.9 Q 181.9 128.9, 182.7 127.8 Q 183.6 126.8, 183.6 124.7 Q 183.6 122.7, 182.7 121.6 Q 181.9 120.6, 180.3 120.6 Q 178.7 120.6, 177.9 121.6 Q 177.0 122.6, 177.0 124.7 Q 177.0 126.8, 177.9 127.8 Q 178.7 128.9, 180.3 128.9 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-12\" d=\"M 104.7 132.7 L 106.1 132.7 L 106.1 137.1 L 111.4 137.1 L 111.4 132.7 L 112.8 132.7 L 112.8 143.0 L 111.4 143.0 L 111.4 138.3 L 106.1 138.3 L 106.1 143.0 L 104.7 143.0 L 104.7 132.7 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-12\" d=\"M 114.0 137.8 Q 114.0 135.4, 115.2 134.0 Q 116.4 132.6, 118.7 132.6 Q 121.0 132.6, 122.2 134.0 Q 123.5 135.4, 123.5 137.8 Q 123.5 140.3, 122.2 141.8 Q 121.0 143.2, 118.7 143.2 Q 116.5 143.2, 115.2 141.8 Q 114.0 140.4, 114.0 137.8 M 118.7 142.0 Q 120.3 142.0, 121.1 141.0 Q 122.0 139.9, 122.0 137.8 Q 122.0 135.8, 121.1 134.8 Q 120.3 133.8, 118.7 133.8 Q 117.2 133.8, 116.3 134.8 Q 115.5 135.8, 115.5 137.8 Q 115.5 139.9, 116.3 141.0 Q 117.2 142.0, 118.7 142.0 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 218.9,75.1 L 252.1,60.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 248.5,59.8 L 250.0,45.0\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 250.0,45.0 L 251.5,30.2\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 255.7,60.6 L 257.2,45.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 257.2,45.8 L 258.8,31.0\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-1 atom-3\" d=\"M 252.1,60.2 L 263.9,68.7\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-1 atom-3\" d=\"M 263.9,68.7 L 275.6,77.2\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 287.5,78.8 L 301.1,72.7\" style=\"fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 301.1,72.7 L 314.7,66.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 314.7,66.6 L 318.4,30.5\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 322.5,62.0 L 325.1,36.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 318.4,30.5 L 351.6,15.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-6 atom-7\" d=\"M 351.6,15.6 L 381.1,36.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-6 atom-7\" d=\"M 351.8,24.7 L 372.4,39.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-7 atom-8\" d=\"M 381.1,36.9 L 377.4,73.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 377.4,73.1 L 344.2,87.9\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 369.4,68.7 L 346.2,79.1\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 344.2,87.9 L 342.7,102.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-10\" d=\"M 342.7,102.8 L 341.1,117.7\" style=\"fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-9 atom-4\" d=\"M 344.2,87.9 L 314.7,66.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"atom-2\" d=\"M 251.1 24.1 Q 251.1 21.6, 252.3 20.2 Q 253.5 18.8, 255.8 18.8 Q 258.1 18.8, 259.3 20.2 Q 260.5 21.6, 260.5 24.1 Q 260.5 26.6, 259.3 28.0 Q 258.1 29.4, 255.8 29.4 Q 253.5 29.4, 252.3 28.0 Q 251.1 26.6, 251.1 24.1 M 255.8 28.2 Q 257.4 28.2, 258.2 27.2 Q 259.1 26.1, 259.1 24.1 Q 259.1 22.0, 258.2 21.0 Q 257.4 20.0, 255.8 20.0 Q 254.2 20.0, 253.4 21.0 Q 252.5 22.0, 252.5 24.1 Q 252.5 26.1, 253.4 27.2 Q 254.2 28.2, 255.8 28.2 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-3\" d=\"M 276.8 81.5 Q 276.8 79.1, 278.0 77.7 Q 279.3 76.3, 281.6 76.3 Q 283.8 76.3, 285.1 77.7 Q 286.3 79.1, 286.3 81.5 Q 286.3 84.0, 285.0 85.4 Q 283.8 86.9, 281.6 86.9 Q 279.3 86.9, 278.0 85.4 Q 276.8 84.0, 276.8 81.5 M 281.6 85.7 Q 283.1 85.7, 284.0 84.6 Q 284.8 83.6, 284.8 81.5 Q 284.8 79.5, 284.0 78.5 Q 283.1 77.5, 281.6 77.5 Q 280.0 77.5, 279.1 78.5 Q 278.3 79.5, 278.3 81.5 Q 278.3 83.6, 279.1 84.6 Q 280.0 85.7, 281.6 85.7 \" fill=\"#FF0000\"/>\n", | |
"<path class=\"atom-10\" d=\"M 338.2 118.9 L 341.6 124.4 Q 341.9 124.9, 342.4 125.9 Q 343.0 126.9, 343.0 126.9 L 343.0 118.9 L 344.4 118.9 L 344.4 129.2 L 343.0 129.2 L 339.3 123.3 Q 338.9 122.6, 338.5 121.8 Q 338.0 121.0, 337.9 120.7 L 337.9 129.2 L 336.6 129.2 L 336.6 118.9 L 338.2 118.9 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"atom-10\" d=\"M 345.6 118.9 L 347.0 118.9 L 347.0 123.3 L 352.2 123.3 L 352.2 118.9 L 353.6 118.9 L 353.6 129.2 L 352.2 129.2 L 352.2 124.5 L 347.0 124.5 L 347.0 129.2 L 345.6 129.2 L 345.6 118.9 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"atom-10\" d=\"M 354.9 128.9 Q 355.1 128.2, 355.7 127.9 Q 356.3 127.5, 357.2 127.5 Q 358.2 127.5, 358.8 128.1 Q 359.3 128.6, 359.3 129.6 Q 359.3 130.6, 358.6 131.6 Q 357.8 132.5, 356.3 133.6 L 359.4 133.6 L 359.4 134.4 L 354.9 134.4 L 354.9 133.7 Q 356.1 132.8, 356.9 132.2 Q 357.6 131.5, 358.0 130.9 Q 358.4 130.3, 358.4 129.7 Q 358.4 129.0, 358.0 128.6 Q 357.7 128.3, 357.2 128.3 Q 356.6 128.3, 356.2 128.5 Q 355.9 128.7, 355.6 129.2 L 354.9 128.9 \" fill=\"#0000FF\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 563.0,93.2 L 531.5,111.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-0 atom-0 atom-1\" d=\"M 554.6,89.6 L 532.6,102.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-1 atom-1 atom-2\" d=\"M 531.5,111.4 L 500.0,93.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 500.0,93.2 L 468.5,111.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-2 atom-2 atom-3\" d=\"M 491.6,89.6 L 469.6,102.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-3 atom-3 atom-4\" d=\"M 468.5,111.4 L 437.0,93.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 437.0,93.2 L 437.0,56.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-4 atom-4 atom-5\" d=\"M 444.3,87.7 L 444.3,62.3\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-5 atom-5 atom-6\" d=\"M 437.0,56.8 L 468.5,38.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-6 atom-7\" d=\"M 468.5,38.6 L 500.0,56.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-6 atom-6 atom-7\" d=\"M 469.6,47.7 L 491.6,60.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-7 atom-7 atom-8\" d=\"M 500.0,56.8 L 531.5,38.6\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 531.5,38.6 L 563.0,56.8\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-8 atom-8 atom-9\" d=\"M 532.6,47.7 L 554.6,60.4\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-9 atom-9 atom-0\" d=\"M 563.0,56.8 L 563.0,93.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"<path class=\"bond-10 atom-7 atom-2\" d=\"M 500.0,56.8 L 500.0,93.2\" style=\"fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1\"/>\n", | |
"</svg>" | |
], | |
"text/plain": [ | |
"<IPython.core.display.SVG object>" | |
] | |
}, | |
"execution_count": 61, | |
"metadata": {}, | |
"output_type": "execute_result" | |
} | |
], | |
"source": [ | |
"mol1 = dm.to_mol(\"CC(=O)Oc1ccccc1C(=O)O\")\n", | |
"mol2 = dm.to_mol(\"CC(=O)Oc1ccccc1N\")\n", | |
"mol3 = dm.to_mol(\"c1cc2ccccc2cc1\")\n", | |
"\n", | |
"dm.to_image([mol1, mol2, mol3], mol_size=(200, 150))" | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"execution_count": 62, | |
"id": "f83cf126-ba22-4171-8afa-ca6e408777b0", | |
"metadata": {}, | |
"outputs": [ | |
{ | |
"data": { | |
"text/plain": [ | |
"array([[1, 1, 1, ..., 0, 0, 0],\n", | |
" [1, 0, 1, ..., 0, 0, 0],\n", | |
" [0, 0, 0, ..., 0, 0, 0]], dtype=uint8)" | |
] | |
}, | |
"execution_count": 62, | |
"metadata": {}, | |
"output_type": "execute_result" | |
} | |
], | |
"source": [ | |
"# Compute fingerprints\n", | |
"fp1 = dm.to_fp(mol1, fp_type=\"ecfp\", nBits=2048)\n", | |
"fp2 = dm.to_fp(mol2, fp_type=\"ecfp\", nBits=2048)\n", | |
"fp3 = dm.to_fp(mol3, fp_type=\"ecfp\", nBits=2048)\n", | |
"\n", | |
"fps = np.array([fp1, fp2, fp3])\n", | |
"fps" | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"execution_count": 64, | |
"id": "b6ad5924-351c-4938-9bf7-02a5271aa898", | |
"metadata": {}, | |
"outputs": [ | |
{ | |
"data": { | |
"text/plain": [ | |
"array([[1. , 0.325 , 0.08571429],\n", | |
" [0.325 , 1. , 0.1 ],\n", | |
" [0.08571429, 0.1 , 1. ]])" | |
] | |
}, | |
"execution_count": 64, | |
"metadata": {}, | |
"output_type": "execute_result" | |
} | |
], | |
"source": [ | |
"# Compute distances/similarities\n", | |
"distances = dm.pdist([mol1, mol2, mol3], fp_type=\"ecfp\", nBits=2048)\n", | |
"similarities = 1 - distances\n", | |
"similarities" | |
] | |
}, | |
{ | |
"cell_type": "markdown", | |
"id": "d66b820f-c108-435a-b300-3afb82bade0b", | |
"metadata": {}, | |
"source": [ | |
"## `dm.conformers`" | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"execution_count": 65, | |
"id": "95ea4295-f654-4224-8636-6b6a145214b4", | |
"metadata": {}, | |
"outputs": [ | |
{ | |
"data": { | |
"text/plain": [ | |
"18" | |
] | |
}, | |
"execution_count": 65, | |
"metadata": {}, | |
"output_type": "execute_result" | |
} | |
], | |
"source": [ | |
"mol = dm.to_mol(\"O=C(C)Oc1ccccc1C(=O)O\")\n", | |
"\n", | |
"# Generate conformers\n", | |
"mol = dm.conformers.generate(mol, n_confs=None, rms_cutoff=0.5, minimize_energy=False)\n", | |
"mol.GetNumConformers()" | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"execution_count": 66, | |
"id": "6754e0cf-3ab4-48b6-acfe-ce529292d694", | |
"metadata": {}, | |
"outputs": [ | |
{ | |
"data": { | |
"text/plain": [ | |
"array([332.32744758, 332.9694191 , 327.6102489 , 336.34704967,\n", | |
" 330.68335373, 328.71789468, 334.26080305, 327.34812497,\n", | |
" 330.13868996, 331.51024942])" | |
] | |
}, | |
"execution_count": 66, | |
"metadata": {}, | |
"output_type": "execute_result" | |
} | |
], | |
"source": [ | |
"# Compute SASA from conformers (not on windows)\n", | |
"sasa = dm.conformers.sasa(mol)\n", | |
"sasa[:10]" | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"execution_count": 68, | |
"id": "1d20b74c-9c8d-40c8-a544-13687168770b", | |
"metadata": {}, | |
"outputs": [ | |
{ | |
"data": { | |
"text/plain": [ | |
"array([[4.67577303e-08, 8.90381000e-01, 1.28252725e+00, 4.15550972e-02],\n", | |
" [8.90381000e-01, 0.00000000e+00, 1.00286711e+00, 8.89637491e-01],\n", | |
" [1.28252725e+00, 1.00286711e+00, 0.00000000e+00, 1.28446123e+00],\n", | |
" [4.15550972e-02, 8.89637491e-01, 1.28446123e+00, 0.00000000e+00]])" | |
] | |
}, | |
"execution_count": 68, | |
"metadata": {}, | |
"output_type": "execute_result" | |
} | |
], | |
"source": [ | |
"rmsd = dm.conformers.rmsd(mol)\n", | |
"rmsd[:4, :4]" | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"execution_count": null, | |
"id": "d9c70fbb-f79a-404b-9a1c-d04e78bbdd25", | |
"metadata": {}, | |
"outputs": [ | |
{ | |
"data": { | |
"application/vnd.jupyter.widget-view+json": { | |
"model_id": "9a76d12804c64ad9bc96f0b6beb668af", | |
"version_major": 2, | |
"version_minor": 0 | |
}, | |
"text/plain": [] | |
}, | |
"metadata": {}, | |
"output_type": "display_data" | |
}, | |
{ | |
"data": { | |
"application/vnd.jupyter.widget-view+json": { | |
"model_id": "d9e278c416704aa3bf90e9887f926d97", | |
"version_major": 2, | |
"version_minor": 0 | |
}, | |
"text/plain": [ | |
"GridspecLayout(children=(NGLWidget(layout=Layout(align_self='stretch', grid_area='widget001', width='auto')), …" | |
] | |
}, | |
"metadata": {}, | |
"output_type": "display_data" | |
} | |
], | |
"source": [ | |
"dm.viz.conformers(mol, n_cols=4, n_confs=9, width=\"auto\", align_conf=False)" | |
] | |
}, | |
{ | |
"cell_type": "markdown", | |
"id": "f98201a7-2236-432e-bf07-a6f2f7671984", | |
"metadata": {}, | |
"source": [ | |
"## `dm.parallelized`" | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"execution_count": 70, | |
"id": "6b7eeb54-6bb2-4c64-ac34-7cef020a7e76", | |
"metadata": {}, | |
"outputs": [ | |
{ | |
"data": { | |
"application/vnd.jupyter.widget-view+json": { | |
"model_id": "dc5d87b2f6fd4eb1aea14f7800c2cc2c", | |
"version_major": 2, | |
"version_minor": 0 | |
}, | |
"text/plain": [ | |
" 0%| | 0/642 [00:00<?, ?it/s]" | |
] | |
}, | |
"metadata": {}, | |
"output_type": "display_data" | |
} | |
], | |
"source": [ | |
"# Get some mols\n", | |
"df = dm.data.freesolv()\n", | |
"mols = df[\"smiles\"].apply(dm.to_mol).tolist()[:1_000]\n", | |
"\n", | |
"# A function to apply to every elements (molecule) of the input list\n", | |
"def process_mol(mol):\n", | |
" mol = dm.conformers.generate(mol, n_confs=None, rms_cutoff=0.5, minimize_energy=False)\n", | |
" return mol\n", | |
"\n", | |
"# Process the input list (`mols`) in parallel\n", | |
"processed_mols = dm.parallelized(process_mol, inputs_list=mols, n_jobs=-1, progress=True)" | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"execution_count": null, | |
"id": "596ec86a-62dc-4567-aeb5-13930ab01695", | |
"metadata": {}, | |
"outputs": [], | |
"source": [] | |
} | |
], | |
"metadata": { | |
"kernelspec": { | |
"display_name": "Python [conda env:datamol]", | |
"language": "python", | |
"name": "conda-env-datamol-py" | |
}, | |
"language_info": { | |
"codemirror_mode": { | |
"name": "ipython", | |
"version": 3 | |
}, | |
"file_extension": ".py", | |
"mimetype": "text/x-python", | |
"name": "python", | |
"nbconvert_exporter": "python", | |
"pygments_lexer": "ipython3", | |
"version": "3.10.4" | |
}, | |
"widgets": { | |
"application/vnd.jupyter.widget-state+json": { | |
"state": { | |
"005d70183f704447ab7062529b2bdf2a": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_4c196345f1ac48f4b082ec67d02e7bac", | |
"max" | |
], | |
"target": [ | |
"IPY_MODEL_f3f3d3bb75264390a52645aec4e26f41", | |
"max_frame" | |
] | |
} | |
}, | |
"01da06fd55c944d99d1224e663b247d9": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "PlayModel", | |
"state": { | |
"layout": "IPY_MODEL_7c70e1553ab64d8591f6779fecb2577b", | |
"max": 0, | |
"style": "IPY_MODEL_659638d225874613995217073462cff8" | |
} | |
}, | |
"01ed7c7d6ff844e58b89a78bb6d5cc6d": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"051125b331614f3aaf595557e5ce30d3": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"0678b4548c61437a87029d413e32bf2e": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "DescriptionStyleModel", | |
"state": { | |
"description_width": "" | |
} | |
}, | |
"072b642327fa4d01b563c7797be87c65": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "HBoxModel", | |
"state": { | |
"children": [ | |
"IPY_MODEL_5a65a4eba8b24df9902d40b084127fa0", | |
"IPY_MODEL_c7d5689fb98643ebb661b3f80710bc8e" | |
], | |
"layout": "IPY_MODEL_a8762409668f43f5a8136b2fb05a2e46" | |
} | |
}, | |
"086ee5bfa88c4e1c879ac7c585c38f8b": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "ImageModel", | |
"state": { | |
"layout": "IPY_MODEL_3e591bb8dde342ad85221befe0a901ac", | |
"width": "900.0" | |
} | |
}, | |
"0b2675ec7712404faa6fc659c8cc1f7b": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"0badab992ef14d04a4ab5edddc7925f8": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "PlayModel", | |
"state": { | |
"layout": "IPY_MODEL_051125b331614f3aaf595557e5ce30d3", | |
"max": 0, | |
"style": "IPY_MODEL_31b8b583115d4601af961287c7bb48e3" | |
} | |
}, | |
"0bb9692db7bd40a9b7ce359490667b50": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "IntSliderModel", | |
"state": { | |
"layout": "IPY_MODEL_7f39878bfadd4ac9adf21259ce6d5697", | |
"max": 0, | |
"style": "IPY_MODEL_7db74b3de75b4157aecb8fd1b8745355" | |
} | |
}, | |
"0db3dcfffc9d4edb9811035cd8ff5550": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_01da06fd55c944d99d1224e663b247d9", | |
"value" | |
], | |
"target": [ | |
"IPY_MODEL_eed254131ef24e5fb6a1949df1470e86", | |
"value" | |
] | |
} | |
}, | |
"0ee50be7385b4d10a93c3fac7dcbf1bb": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_8ad8792e8da0430fa8fb32d7ead8a6eb", | |
"max" | |
], | |
"target": [ | |
"IPY_MODEL_3f9e656f74184cb6ad04e30abc213d91", | |
"max_frame" | |
] | |
} | |
}, | |
"0f111728ddf74110a89a47c27263b571": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "HBoxModel", | |
"state": { | |
"children": [ | |
"IPY_MODEL_4d6e51bf404e4b9fb74fdb1f7d5a4a7e", | |
"IPY_MODEL_fb0aaa945a1446ebb5b185288569b594" | |
], | |
"layout": "IPY_MODEL_7663a1d1d2164166b96886807e0d620a" | |
} | |
}, | |
"0fdf9526f13a4ca2aaa15eb4bb423e79": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_2d2d3f6a54764647943f146fc508161d", | |
"max" | |
], | |
"target": [ | |
"IPY_MODEL_f3f3d3bb75264390a52645aec4e26f41", | |
"max_frame" | |
] | |
} | |
}, | |
"109e70a1b1b040b48d52970a161a8931": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_7d02333a46264197a05d34362cb81762", | |
"max" | |
], | |
"target": [ | |
"IPY_MODEL_3f0295800431414b84b6d3f253f442be", | |
"max_frame" | |
] | |
} | |
}, | |
"12fc69be15194f4691e7e89a9232d6f6": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "SliderStyleModel", | |
"state": { | |
"description_width": "" | |
} | |
}, | |
"168b89b9b2ba400bbf9d32c8049ecc7c": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": { | |
"width": "34px" | |
} | |
}, | |
"16ad100a59c245c2b9c37c6efd3a9310": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"17de0ea19fb6425f88102e7c9e508e15": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "ProgressStyleModel", | |
"state": { | |
"description_width": "" | |
} | |
}, | |
"17e6bbc6cc114d888d8fc1e02f3018a0": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "ButtonStyleModel", | |
"state": {} | |
}, | |
"186e3566750b430494e74a8cc040f12e": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": { | |
"width": "34px" | |
} | |
}, | |
"195ff3aaf6dc48038137dd3430b855f3": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "HTMLModel", | |
"state": { | |
"layout": "IPY_MODEL_cdcad421799f41a58c8a76058259ad55", | |
"style": "IPY_MODEL_7660d6a94adc47e8b69ed2856aa9f52b", | |
"value": " 642/642 [00:31<00:00, 1.56it/s]" | |
} | |
}, | |
"1a5c7ed6474f45ddaf7fcb9b467596e3": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"1c1f92d51c2f452696da54f8fb46bf9c": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"1d481aa6fb014ab1a4a23faed79dd5fa": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "ButtonModel", | |
"state": { | |
"icon": "compress", | |
"layout": "IPY_MODEL_94cc8cc0f7224ceea6e8907abf671582", | |
"style": "IPY_MODEL_3fbb534f3f6b45d6bf4c0e792c50908f" | |
} | |
}, | |
"1d6e961cdb4647a8a952b9f36596a428": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_7d02333a46264197a05d34362cb81762", | |
"value" | |
], | |
"target": [ | |
"IPY_MODEL_3f0295800431414b84b6d3f253f442be", | |
"frame" | |
] | |
} | |
}, | |
"1f27a87dd64b4ec5afa31bb14c8fb0b5": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "ButtonModel", | |
"state": { | |
"icon": "compress", | |
"layout": "IPY_MODEL_9ef46025309342fab18b7c9dee269024", | |
"style": "IPY_MODEL_45f0fdf2bc2a41f2a15dc7823ae1af90" | |
} | |
}, | |
"20cb1e66cabb41b4951cb82f6a89aafa": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "IntSliderModel", | |
"state": { | |
"layout": "IPY_MODEL_e9a61b3a1d5a497493e3669f8cdec24b", | |
"max": 0, | |
"style": "IPY_MODEL_56c050513370446fa01933ca471b20a0" | |
} | |
}, | |
"20df1992cb0a4b7eb37951c944a0c194": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "ButtonModel", | |
"state": { | |
"icon": "compress", | |
"layout": "IPY_MODEL_168b89b9b2ba400bbf9d32c8049ecc7c", | |
"style": "IPY_MODEL_b4695c8d29e9420b902ad7007e321c6e" | |
} | |
}, | |
"21eeb6436bdc48c8bb044251e0c53ec2": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "DescriptionStyleModel", | |
"state": { | |
"description_width": "" | |
} | |
}, | |
"21f7ae84551b40d2b56a0edb29ffb987": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_20cb1e66cabb41b4951cb82f6a89aafa", | |
"max" | |
], | |
"target": [ | |
"IPY_MODEL_3f0295800431414b84b6d3f253f442be", | |
"max_frame" | |
] | |
} | |
}, | |
"221b6a1c074c49d5838f5aa029f63add": { | |
"model_module": "nglview-js-widgets", | |
"model_module_version": "3.0.1", | |
"model_name": "NGLModel", | |
"state": { | |
"_camera_orientation": [ | |
12.417370427684604, | |
-7.5097609088009385, | |
-8.706272047847357, | |
0, | |
1.093723224554105, | |
13.527860445426866, | |
-10.108784867329266, | |
0, | |
11.445499175944834, | |
6.854724872561955, | |
10.411535225496076, | |
0, | |
-0.21700000762939453, | |
1.0559999346733093, | |
-0.3605000078678131, | |
1 | |
], | |
"_camera_str": "orthographic", | |
"_gui_theme": null, | |
"_ibtn_fullscreen": "IPY_MODEL_8e9a2516532240c5889768c960b71ead", | |
"_igui": null, | |
"_iplayer": "IPY_MODEL_3246681c032b4610b542f6b99dd20517", | |
"_ngl_color_dict": {}, | |
"_ngl_coordinate_resource": {}, | |
"_ngl_full_stage_parameters": { | |
"ambientColor": 14540253, | |
"ambientIntensity": 0.2, | |
"backgroundColor": "white", | |
"cameraEyeSep": 0.3, | |
"cameraFov": 40, | |
"cameraType": "perspective", | |
"clipDist": 10, | |
"clipFar": 100, | |
"clipNear": 0, | |
"fogFar": 100, | |
"fogNear": 50, | |
"hoverTimeout": 0, | |
"impostor": true, | |
"lightColor": 14540253, | |
"lightIntensity": 1, | |
"mousePreset": "default", | |
"panSpeed": 1, | |
"quality": "medium", | |
"rotateSpeed": 2, | |
"sampleLevel": 0, | |
"tooltip": true, | |
"workerDefault": true, | |
"zoomSpeed": 1.2 | |
}, | |
"_ngl_msg_archive": [ | |
{ | |
"args": [ | |
{ | |
"binary": false, | |
"data": "HETATM 1 O1 UNL 1 2.013 -1.384 -0.572 1.00 0.00 O \nHETATM 2 C1 UNL 1 1.999 -1.561 0.675 1.00 0.00 C \nHETATM 3 C2 UNL 1 3.151 -2.162 1.410 1.00 0.00 C \nHETATM 4 O2 UNL 1 0.833 -1.159 1.336 1.00 0.00 O \nHETATM 5 C3 UNL 1 -0.242 -0.598 0.652 1.00 0.00 C \nHETATM 6 C4 UNL 1 -0.366 0.754 0.440 1.00 0.00 C \nHETATM 7 C5 UNL 1 -1.423 1.330 -0.236 1.00 0.00 C \nHETATM 8 C6 UNL 1 -2.420 0.504 -0.733 1.00 0.00 C \nHETATM 9 C7 UNL 1 -2.324 -0.859 -0.536 1.00 0.00 C \nHETATM 10 C8 UNL 1 -1.238 -1.414 0.155 1.00 0.00 C \nHETATM 11 C9 UNL 1 -1.158 -2.854 0.350 1.00 0.00 C \nHETATM 12 O3 UNL 1 -0.178 -3.330 0.971 1.00 0.00 O \nHETATM 13 O4 UNL 1 -2.124 -3.705 -0.126 1.00 0.00 O \nCONECT 1 2 2\nCONECT 2 3 4\nCONECT 4 5\nCONECT 5 6 6 10\nCONECT 6 7\nCONECT 7 8 8\nCONECT 8 9\nCONECT 9 10 10\nCONECT 10 11\nCONECT 11 12 12 13\nEND\n", | |
"type": "blob" | |
} | |
], | |
"kwargs": { | |
"defaultRepresentation": false, | |
"ext": "pdb" | |
}, | |
"methodName": "loadFile", | |
"reconstruc_color_scheme": false, | |
"target": "Stage", | |
"type": "call_method" | |
}, | |
{ | |
"args": [ | |
"auto", | |
"" | |
], | |
"kwargs": {}, | |
"methodName": "setSize", | |
"reconstruc_color_scheme": false, | |
"target": "Widget", | |
"type": "call_method" | |
}, | |
{ | |
"args": [ | |
[ | |
"221b6a1c074c49d5838f5aa029f63add", | |
"3838f51e694a44b1816347cec8fe9d54", | |
"3f0295800431414b84b6d3f253f442be", | |
"3f9e656f74184cb6ad04e30abc213d91", | |
"6f98921f9645445fa2984faf6dd8f50b", | |
"84ea53606c7b4ea094a2997568820ae8", | |
"96bfb611c08e4e28ba1806a0c23e72ad", | |
"9e98dca4c3c84a2ea0fea1747b5a90ff", | |
"f3f3d3bb75264390a52645aec4e26f41" | |
] | |
], | |
"kwargs": {}, | |
"methodName": "setSyncCamera", | |
"reconstruc_color_scheme": false, | |
"target": "Widget", | |
"type": "call_method" | |
} | |
], | |
"_ngl_original_stage_parameters": { | |
"ambientColor": 14540253, | |
"ambientIntensity": 0.2, | |
"backgroundColor": "white", | |
"cameraEyeSep": 0.3, | |
"cameraFov": 40, | |
"cameraType": "perspective", | |
"clipDist": 10, | |
"clipFar": 100, | |
"clipNear": 0, | |
"fogFar": 100, | |
"fogNear": 50, | |
"hoverTimeout": 0, | |
"impostor": true, | |
"lightColor": 14540253, | |
"lightIntensity": 1, | |
"mousePreset": "default", | |
"panSpeed": 1, | |
"quality": "medium", | |
"rotateSpeed": 2, | |
"sampleLevel": 0, | |
"tooltip": true, | |
"workerDefault": true, | |
"zoomSpeed": 1.2 | |
}, | |
"_ngl_repr_dict": { | |
"0": { | |
"0": { | |
"params": { | |
"aspectRatio": 1.5, | |
"assembly": "default", | |
"bondScale": 0.3, | |
"bondSpacing": 0.75, | |
"clipCenter": { | |
"x": 0, | |
"y": 0, | |
"z": 0 | |
}, | |
"clipNear": 0, | |
"clipRadius": 0, | |
"colorMode": "hcl", | |
"colorReverse": false, | |
"colorScale": "", | |
"colorScheme": "element", | |
"colorValue": 9474192, | |
"cylinderOnly": false, | |
"defaultAssembly": "", | |
"depthWrite": true, | |
"diffuse": 16777215, | |
"diffuseInterior": false, | |
"disableImpostor": false, | |
"disablePicking": false, | |
"flatShaded": false, | |
"interiorColor": 2236962, | |
"interiorDarkening": 0, | |
"lazy": false, | |
"lineOnly": false, | |
"linewidth": 2, | |
"matrix": { | |
"elements": [ | |
1, | |
0, | |
0, | |
0, | |
0, | |
1, | |
0, | |
0, | |
0, | |
0, | |
1, | |
0, | |
0, | |
0, | |
0, | |
1 | |
] | |
}, | |
"metalness": 0, | |
"multipleBond": "off", | |
"opacity": 1, | |
"openEnded": true, | |
"quality": "high", | |
"radialSegments": 20, | |
"radiusData": {}, | |
"radiusScale": 2, | |
"radiusSize": 0.15, | |
"radiusType": "size", | |
"roughness": 0.4, | |
"sele": "", | |
"side": "double", | |
"sphereDetail": 2, | |
"useInteriorColor": true, | |
"useWorker": true, | |
"visible": true, | |
"wireframe": false | |
}, | |
"type": "ball+stick" | |
} | |
} | |
}, | |
"_ngl_serialize": false, | |
"_ngl_version": "2.0.0-dev.36", | |
"_ngl_view_id": [ | |
"1A4041E9-90D8-44D6-ACA4-C5872BA4E412", | |
"9249E572-F6A4-4BFB-A6F9-594E3EA7DCD5" | |
], | |
"_player_dict": {}, | |
"_scene_position": {}, | |
"_scene_rotation": {}, | |
"_synced_model_ids": [ | |
"221b6a1c074c49d5838f5aa029f63add", | |
"3838f51e694a44b1816347cec8fe9d54", | |
"3f0295800431414b84b6d3f253f442be", | |
"3f9e656f74184cb6ad04e30abc213d91", | |
"6f98921f9645445fa2984faf6dd8f50b", | |
"84ea53606c7b4ea094a2997568820ae8", | |
"96bfb611c08e4e28ba1806a0c23e72ad", | |
"9e98dca4c3c84a2ea0fea1747b5a90ff", | |
"f3f3d3bb75264390a52645aec4e26f41" | |
], | |
"_synced_repr_model_ids": [], | |
"_view_height": "", | |
"_view_width": "", | |
"background": "white", | |
"frame": 0, | |
"gui_style": null, | |
"layout": "IPY_MODEL_31717deed16a41a5b46bd95419549e29", | |
"max_frame": 0, | |
"n_components": 1, | |
"picked": {} | |
} | |
}, | |
"223634346e2b45b294e64f6421330a90": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"22c176c07fed492ba33f46f4e734de14": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_2d2d3f6a54764647943f146fc508161d", | |
"value" | |
], | |
"target": [ | |
"IPY_MODEL_4c196345f1ac48f4b082ec67d02e7bac", | |
"value" | |
] | |
} | |
}, | |
"24cef0915a5145f281e87020abf57679": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "SliderStyleModel", | |
"state": { | |
"description_width": "" | |
} | |
}, | |
"25b35248c60741599e9e8f4b99464011": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_4d6e51bf404e4b9fb74fdb1f7d5a4a7e", | |
"value" | |
], | |
"target": [ | |
"IPY_MODEL_fb0aaa945a1446ebb5b185288569b594", | |
"value" | |
] | |
} | |
}, | |
"272bb638751841d89fb02602bc8965e9": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": { | |
"align_self": "stretch", | |
"grid_area": "widget006", | |
"width": "auto" | |
} | |
}, | |
"27b22bf5e8bb42de95edc80d45a9461b": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "ImageModel", | |
"state": { | |
"layout": "IPY_MODEL_f884a8753a634ef0ad7a2423c04f8e60", | |
"width": "900.0" | |
} | |
}, | |
"2d2d3f6a54764647943f146fc508161d": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "PlayModel", | |
"state": { | |
"layout": "IPY_MODEL_0b2675ec7712404faa6fc659c8cc1f7b", | |
"max": 0, | |
"style": "IPY_MODEL_c67214a2b8c64b7eaff05582e40ad398" | |
} | |
}, | |
"2ee18aa8aa9d474fad3e14a257f14826": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_fb0aaa945a1446ebb5b185288569b594", | |
"max" | |
], | |
"target": [ | |
"IPY_MODEL_6f98921f9645445fa2984faf6dd8f50b", | |
"max_frame" | |
] | |
} | |
}, | |
"31717deed16a41a5b46bd95419549e29": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": { | |
"align_self": "stretch", | |
"grid_area": "widget004", | |
"width": "auto" | |
} | |
}, | |
"31b8b583115d4601af961287c7bb48e3": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "DescriptionStyleModel", | |
"state": { | |
"description_width": "" | |
} | |
}, | |
"3246681c032b4610b542f6b99dd20517": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "HBoxModel", | |
"state": { | |
"children": [ | |
"IPY_MODEL_01da06fd55c944d99d1224e663b247d9", | |
"IPY_MODEL_eed254131ef24e5fb6a1949df1470e86" | |
], | |
"layout": "IPY_MODEL_1a5c7ed6474f45ddaf7fcb9b467596e3" | |
} | |
}, | |
"3283759f5e754187849a4b5bca1ec17f": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"3531613cf1b84d7daa0dce206cccde61": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"3782c5383d81482f8c84adfb382bf8d8": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_415ded3a610948a39a727094ba149620", | |
"value" | |
], | |
"target": [ | |
"IPY_MODEL_3f9e656f74184cb6ad04e30abc213d91", | |
"frame" | |
] | |
} | |
}, | |
"3838f51e694a44b1816347cec8fe9d54": { | |
"model_module": "nglview-js-widgets", | |
"model_module_version": "3.0.1", | |
"model_name": "NGLModel", | |
"state": { | |
"_camera_orientation": [ | |
12.417370427684604, | |
-7.5097609088009385, | |
-8.706272047847357, | |
0, | |
1.093723224554105, | |
13.527860445426866, | |
-10.108784867329266, | |
0, | |
11.445499175944834, | |
6.854724872561955, | |
10.411535225496076, | |
0, | |
-0.21700000762939453, | |
1.0559999346733093, | |
-0.3605000078678131, | |
1 | |
], | |
"_camera_str": "orthographic", | |
"_gui_theme": null, | |
"_ibtn_fullscreen": "IPY_MODEL_d80f5c271ba84bc1942af6e9ef950b70", | |
"_igui": null, | |
"_iplayer": "IPY_MODEL_7f1506813e3d4638af9dff9f3f5a8ce5", | |
"_ngl_color_dict": {}, | |
"_ngl_coordinate_resource": {}, | |
"_ngl_full_stage_parameters": { | |
"ambientColor": 14540253, | |
"ambientIntensity": 0.2, | |
"backgroundColor": "white", | |
"cameraEyeSep": 0.3, | |
"cameraFov": 40, | |
"cameraType": "perspective", | |
"clipDist": 10, | |
"clipFar": 100, | |
"clipNear": 0, | |
"fogFar": 100, | |
"fogNear": 50, | |
"hoverTimeout": 0, | |
"impostor": true, | |
"lightColor": 14540253, | |
"lightIntensity": 1, | |
"mousePreset": "default", | |
"panSpeed": 1, | |
"quality": "medium", | |
"rotateSpeed": 2, | |
"sampleLevel": 0, | |
"tooltip": true, | |
"workerDefault": true, | |
"zoomSpeed": 1.2 | |
}, | |
"_ngl_msg_archive": [ | |
{ | |
"args": [ | |
{ | |
"binary": false, | |
"data": "HETATM 1 O1 UNL 1 1.214 -1.031 2.228 1.00 0.00 O \nHETATM 2 C1 UNL 1 1.703 -1.586 1.210 1.00 0.00 C \nHETATM 3 C2 UNL 1 2.955 -2.358 1.393 1.00 0.00 C \nHETATM 4 O2 UNL 1 1.043 -1.433 0.017 1.00 0.00 O \nHETATM 5 C3 UNL 1 -0.129 -0.706 -0.136 1.00 0.00 C \nHETATM 6 C4 UNL 1 -0.147 0.648 -0.419 1.00 0.00 C \nHETATM 7 C5 UNL 1 -1.360 1.328 -0.562 1.00 0.00 C \nHETATM 8 C6 UNL 1 -2.569 0.674 -0.425 1.00 0.00 C \nHETATM 9 C7 UNL 1 -2.535 -0.676 -0.142 1.00 0.00 C \nHETATM 10 C8 UNL 1 -1.335 -1.356 -0.000 1.00 0.00 C \nHETATM 11 C9 UNL 1 -1.325 -2.784 0.297 1.00 0.00 C \nHETATM 12 O3 UNL 1 -2.385 -3.448 0.436 1.00 0.00 O \nHETATM 13 O4 UNL 1 -0.139 -3.487 0.441 1.00 0.00 O \nCONECT 1 2 2\nCONECT 2 3 4\nCONECT 4 5\nCONECT 5 6 6 10\nCONECT 6 7\nCONECT 7 8 8\nCONECT 8 9\nCONECT 9 10 10\nCONECT 10 11\nCONECT 11 12 12 13\nEND\n", | |
"type": "blob" | |
} | |
], | |
"kwargs": { | |
"defaultRepresentation": false, | |
"ext": "pdb" | |
}, | |
"methodName": "loadFile", | |
"reconstruc_color_scheme": false, | |
"target": "Stage", | |
"type": "call_method" | |
}, | |
{ | |
"args": [ | |
"auto", | |
"" | |
], | |
"kwargs": {}, | |
"methodName": "setSize", | |
"reconstruc_color_scheme": false, | |
"target": "Widget", | |
"type": "call_method" | |
}, | |
{ | |
"args": [ | |
[ | |
"221b6a1c074c49d5838f5aa029f63add", | |
"3838f51e694a44b1816347cec8fe9d54", | |
"3f0295800431414b84b6d3f253f442be", | |
"3f9e656f74184cb6ad04e30abc213d91", | |
"6f98921f9645445fa2984faf6dd8f50b", | |
"84ea53606c7b4ea094a2997568820ae8", | |
"96bfb611c08e4e28ba1806a0c23e72ad", | |
"9e98dca4c3c84a2ea0fea1747b5a90ff", | |
"f3f3d3bb75264390a52645aec4e26f41" | |
] | |
], | |
"kwargs": {}, | |
"methodName": "setSyncCamera", | |
"reconstruc_color_scheme": false, | |
"target": "Widget", | |
"type": "call_method" | |
} | |
], | |
"_ngl_original_stage_parameters": { | |
"ambientColor": 14540253, | |
"ambientIntensity": 0.2, | |
"backgroundColor": "white", | |
"cameraEyeSep": 0.3, | |
"cameraFov": 40, | |
"cameraType": "perspective", | |
"clipDist": 10, | |
"clipFar": 100, | |
"clipNear": 0, | |
"fogFar": 100, | |
"fogNear": 50, | |
"hoverTimeout": 0, | |
"impostor": true, | |
"lightColor": 14540253, | |
"lightIntensity": 1, | |
"mousePreset": "default", | |
"panSpeed": 1, | |
"quality": "medium", | |
"rotateSpeed": 2, | |
"sampleLevel": 0, | |
"tooltip": true, | |
"workerDefault": true, | |
"zoomSpeed": 1.2 | |
}, | |
"_ngl_repr_dict": { | |
"0": { | |
"0": { | |
"params": { | |
"aspectRatio": 1.5, | |
"assembly": "default", | |
"bondScale": 0.3, | |
"bondSpacing": 0.75, | |
"clipCenter": { | |
"x": 0, | |
"y": 0, | |
"z": 0 | |
}, | |
"clipNear": 0, | |
"clipRadius": 0, | |
"colorMode": "hcl", | |
"colorReverse": false, | |
"colorScale": "", | |
"colorScheme": "element", | |
"colorValue": 9474192, | |
"cylinderOnly": false, | |
"defaultAssembly": "", | |
"depthWrite": true, | |
"diffuse": 16777215, | |
"diffuseInterior": false, | |
"disableImpostor": false, | |
"disablePicking": false, | |
"flatShaded": false, | |
"interiorColor": 2236962, | |
"interiorDarkening": 0, | |
"lazy": false, | |
"lineOnly": false, | |
"linewidth": 2, | |
"matrix": { | |
"elements": [ | |
1, | |
0, | |
0, | |
0, | |
0, | |
1, | |
0, | |
0, | |
0, | |
0, | |
1, | |
0, | |
0, | |
0, | |
0, | |
1 | |
] | |
}, | |
"metalness": 0, | |
"multipleBond": "off", | |
"opacity": 1, | |
"openEnded": true, | |
"quality": "high", | |
"radialSegments": 20, | |
"radiusData": {}, | |
"radiusScale": 2, | |
"radiusSize": 0.15, | |
"radiusType": "size", | |
"roughness": 0.4, | |
"sele": "", | |
"side": "double", | |
"sphereDetail": 2, | |
"useInteriorColor": true, | |
"useWorker": true, | |
"visible": true, | |
"wireframe": false | |
}, | |
"type": "ball+stick" | |
} | |
} | |
}, | |
"_ngl_serialize": false, | |
"_ngl_version": "2.0.0-dev.36", | |
"_ngl_view_id": [ | |
"910507A2-8DC7-470D-B834-FCE9BEDDE9DF", | |
"690D08EB-92B8-4403-BB12-D4D4A6F72BE2" | |
], | |
"_player_dict": {}, | |
"_scene_position": {}, | |
"_scene_rotation": {}, | |
"_synced_model_ids": [ | |
"221b6a1c074c49d5838f5aa029f63add", | |
"3838f51e694a44b1816347cec8fe9d54", | |
"3f0295800431414b84b6d3f253f442be", | |
"3f9e656f74184cb6ad04e30abc213d91", | |
"6f98921f9645445fa2984faf6dd8f50b", | |
"84ea53606c7b4ea094a2997568820ae8", | |
"96bfb611c08e4e28ba1806a0c23e72ad", | |
"9e98dca4c3c84a2ea0fea1747b5a90ff", | |
"f3f3d3bb75264390a52645aec4e26f41" | |
], | |
"_synced_repr_model_ids": [], | |
"_view_height": "", | |
"_view_width": "", | |
"background": "white", | |
"frame": 0, | |
"gui_style": null, | |
"layout": "IPY_MODEL_661b903a9be34e8bba887b0c31029638", | |
"max_frame": 0, | |
"n_components": 1, | |
"picked": {} | |
} | |
}, | |
"3ade81ac72c54d3bbd0a2e3dec8d8214": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "IntSliderModel", | |
"state": { | |
"layout": "IPY_MODEL_acf8f8561c4f46eba945fb5f6efc98d2", | |
"max": 0, | |
"style": "IPY_MODEL_e50180f678d341b4ad80bffef5c9c037" | |
} | |
}, | |
"3b122670400c47eb93751ebdf6dfc0af": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_7b9f27483c804e8b85e8f49acd868ad7", | |
"value" | |
], | |
"target": [ | |
"IPY_MODEL_96bfb611c08e4e28ba1806a0c23e72ad", | |
"frame" | |
] | |
} | |
}, | |
"3d4d986804724e3ba3a84f162853e21a": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "HBoxModel", | |
"state": { | |
"children": [ | |
"IPY_MODEL_2d2d3f6a54764647943f146fc508161d", | |
"IPY_MODEL_4c196345f1ac48f4b082ec67d02e7bac" | |
], | |
"layout": "IPY_MODEL_16ad100a59c245c2b9c37c6efd3a9310" | |
} | |
}, | |
"3e591bb8dde342ad85221befe0a901ac": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"3f0295800431414b84b6d3f253f442be": { | |
"model_module": "nglview-js-widgets", | |
"model_module_version": "3.0.1", | |
"model_name": "NGLModel", | |
"state": { | |
"_camera_orientation": [ | |
12.417370427684604, | |
-7.5097609088009385, | |
-8.706272047847357, | |
0, | |
1.093723224554105, | |
13.527860445426866, | |
-10.108784867329266, | |
0, | |
11.445499175944834, | |
6.854724872561955, | |
10.411535225496076, | |
0, | |
-0.21700000762939453, | |
1.0559999346733093, | |
-0.3605000078678131, | |
1 | |
], | |
"_camera_str": "orthographic", | |
"_gui_theme": null, | |
"_ibtn_fullscreen": "IPY_MODEL_d7c7f657260d4ec0b160142fc53835e3", | |
"_igui": null, | |
"_iplayer": "IPY_MODEL_bfa70edc02a64d768fa054f5141a7b75", | |
"_ngl_color_dict": {}, | |
"_ngl_coordinate_resource": {}, | |
"_ngl_full_stage_parameters": { | |
"ambientColor": 14540253, | |
"ambientIntensity": 0.2, | |
"backgroundColor": "white", | |
"cameraEyeSep": 0.3, | |
"cameraFov": 40, | |
"cameraType": "perspective", | |
"clipDist": 10, | |
"clipFar": 100, | |
"clipNear": 0, | |
"fogFar": 100, | |
"fogNear": 50, | |
"hoverTimeout": 0, | |
"impostor": true, | |
"lightColor": 14540253, | |
"lightIntensity": 1, | |
"mousePreset": "default", | |
"panSpeed": 1, | |
"quality": "medium", | |
"rotateSpeed": 2, | |
"sampleLevel": 0, | |
"tooltip": true, | |
"workerDefault": true, | |
"zoomSpeed": 1.2 | |
}, | |
"_ngl_msg_archive": [ | |
{ | |
"args": [ | |
{ | |
"binary": false, | |
"data": "HETATM 1 O1 UNL 1 2.019 -1.468 -0.654 1.00 0.00 O \nHETATM 2 C1 UNL 1 1.901 -1.659 0.568 1.00 0.00 C \nHETATM 3 C2 UNL 1 2.923 -2.319 1.419 1.00 0.00 C \nHETATM 4 O2 UNL 1 0.744 -1.234 1.191 1.00 0.00 O \nHETATM 5 C3 UNL 1 -0.306 -0.609 0.576 1.00 0.00 C \nHETATM 6 C4 UNL 1 -0.391 0.761 0.444 1.00 0.00 C \nHETATM 7 C5 UNL 1 -1.456 1.383 -0.179 1.00 0.00 C \nHETATM 8 C6 UNL 1 -2.489 0.612 -0.698 1.00 0.00 C \nHETATM 9 C7 UNL 1 -2.430 -0.758 -0.580 1.00 0.00 C \nHETATM 10 C8 UNL 1 -1.342 -1.361 0.055 1.00 0.00 C \nHETATM 11 C9 UNL 1 -1.283 -2.808 0.178 1.00 0.00 C \nHETATM 12 O3 UNL 1 -2.202 -3.495 -0.283 1.00 0.00 O \nHETATM 13 O4 UNL 1 -0.219 -3.414 0.801 1.00 0.00 O \nCONECT 1 2 2\nCONECT 2 3 4\nCONECT 4 5\nCONECT 5 6 6 10\nCONECT 6 7\nCONECT 7 8 8\nCONECT 8 9\nCONECT 9 10 10\nCONECT 10 11\nCONECT 11 12 12 13\nEND\n", | |
"type": "blob" | |
} | |
], | |
"kwargs": { | |
"defaultRepresentation": false, | |
"ext": "pdb" | |
}, | |
"methodName": "loadFile", | |
"reconstruc_color_scheme": false, | |
"target": "Stage", | |
"type": "call_method" | |
}, | |
{ | |
"args": [ | |
"auto", | |
"" | |
], | |
"kwargs": {}, | |
"methodName": "setSize", | |
"reconstruc_color_scheme": false, | |
"target": "Widget", | |
"type": "call_method" | |
}, | |
{ | |
"args": [ | |
[ | |
"221b6a1c074c49d5838f5aa029f63add", | |
"3838f51e694a44b1816347cec8fe9d54", | |
"3f0295800431414b84b6d3f253f442be", | |
"3f9e656f74184cb6ad04e30abc213d91", | |
"6f98921f9645445fa2984faf6dd8f50b", | |
"84ea53606c7b4ea094a2997568820ae8", | |
"96bfb611c08e4e28ba1806a0c23e72ad", | |
"9e98dca4c3c84a2ea0fea1747b5a90ff", | |
"f3f3d3bb75264390a52645aec4e26f41" | |
] | |
], | |
"kwargs": {}, | |
"methodName": "setSyncCamera", | |
"reconstruc_color_scheme": false, | |
"target": "Widget", | |
"type": "call_method" | |
} | |
], | |
"_ngl_original_stage_parameters": { | |
"ambientColor": 14540253, | |
"ambientIntensity": 0.2, | |
"backgroundColor": "white", | |
"cameraEyeSep": 0.3, | |
"cameraFov": 40, | |
"cameraType": "perspective", | |
"clipDist": 10, | |
"clipFar": 100, | |
"clipNear": 0, | |
"fogFar": 100, | |
"fogNear": 50, | |
"hoverTimeout": 0, | |
"impostor": true, | |
"lightColor": 14540253, | |
"lightIntensity": 1, | |
"mousePreset": "default", | |
"panSpeed": 1, | |
"quality": "medium", | |
"rotateSpeed": 2, | |
"sampleLevel": 0, | |
"tooltip": true, | |
"workerDefault": true, | |
"zoomSpeed": 1.2 | |
}, | |
"_ngl_repr_dict": { | |
"0": { | |
"0": { | |
"params": { | |
"aspectRatio": 1.5, | |
"assembly": "default", | |
"bondScale": 0.3, | |
"bondSpacing": 0.75, | |
"clipCenter": { | |
"x": 0, | |
"y": 0, | |
"z": 0 | |
}, | |
"clipNear": 0, | |
"clipRadius": 0, | |
"colorMode": "hcl", | |
"colorReverse": false, | |
"colorScale": "", | |
"colorScheme": "element", | |
"colorValue": 9474192, | |
"cylinderOnly": false, | |
"defaultAssembly": "", | |
"depthWrite": true, | |
"diffuse": 16777215, | |
"diffuseInterior": false, | |
"disableImpostor": false, | |
"disablePicking": false, | |
"flatShaded": false, | |
"interiorColor": 2236962, | |
"interiorDarkening": 0, | |
"lazy": false, | |
"lineOnly": false, | |
"linewidth": 2, | |
"matrix": { | |
"elements": [ | |
1, | |
0, | |
0, | |
0, | |
0, | |
1, | |
0, | |
0, | |
0, | |
0, | |
1, | |
0, | |
0, | |
0, | |
0, | |
1 | |
] | |
}, | |
"metalness": 0, | |
"multipleBond": "off", | |
"opacity": 1, | |
"openEnded": true, | |
"quality": "high", | |
"radialSegments": 20, | |
"radiusData": {}, | |
"radiusScale": 2, | |
"radiusSize": 0.15, | |
"radiusType": "size", | |
"roughness": 0.4, | |
"sele": "", | |
"side": "double", | |
"sphereDetail": 2, | |
"useInteriorColor": true, | |
"useWorker": true, | |
"visible": true, | |
"wireframe": false | |
}, | |
"type": "ball+stick" | |
} | |
} | |
}, | |
"_ngl_serialize": false, | |
"_ngl_version": "2.0.0-dev.36", | |
"_ngl_view_id": [ | |
"DB168CBC-9EFA-4F4B-94B2-5E4D648DD1F4", | |
"F26FAE63-0D37-4B02-8B1D-AC8688C1818B" | |
], | |
"_player_dict": {}, | |
"_scene_position": {}, | |
"_scene_rotation": {}, | |
"_synced_model_ids": [ | |
"221b6a1c074c49d5838f5aa029f63add", | |
"3838f51e694a44b1816347cec8fe9d54", | |
"3f0295800431414b84b6d3f253f442be", | |
"3f9e656f74184cb6ad04e30abc213d91", | |
"6f98921f9645445fa2984faf6dd8f50b", | |
"84ea53606c7b4ea094a2997568820ae8", | |
"96bfb611c08e4e28ba1806a0c23e72ad", | |
"9e98dca4c3c84a2ea0fea1747b5a90ff", | |
"f3f3d3bb75264390a52645aec4e26f41" | |
], | |
"_synced_repr_model_ids": [], | |
"_view_height": "", | |
"_view_width": "", | |
"background": "white", | |
"frame": 0, | |
"gui_style": null, | |
"layout": "IPY_MODEL_7b4a000239d343a293fe7a3a8e088dcd", | |
"max_frame": 0, | |
"n_components": 1, | |
"picked": {} | |
} | |
}, | |
"3f9e656f74184cb6ad04e30abc213d91": { | |
"model_module": "nglview-js-widgets", | |
"model_module_version": "3.0.1", | |
"model_name": "NGLModel", | |
"state": { | |
"_camera_orientation": [ | |
12.417370427684604, | |
-7.5097609088009385, | |
-8.706272047847357, | |
0, | |
1.093723224554105, | |
13.527860445426866, | |
-10.108784867329266, | |
0, | |
11.445499175944834, | |
6.854724872561955, | |
10.411535225496076, | |
0, | |
-0.21700000762939453, | |
1.0559999346733093, | |
-0.3605000078678131, | |
1 | |
], | |
"_camera_str": "orthographic", | |
"_gui_theme": null, | |
"_ibtn_fullscreen": "IPY_MODEL_e3e6cd7a70a442518d21b18e00fed122", | |
"_igui": null, | |
"_iplayer": "IPY_MODEL_c70897dc748d4a64a36f3a25565c737a", | |
"_ngl_color_dict": {}, | |
"_ngl_coordinate_resource": {}, | |
"_ngl_full_stage_parameters": { | |
"ambientColor": 14540253, | |
"ambientIntensity": 0.2, | |
"backgroundColor": "white", | |
"cameraEyeSep": 0.3, | |
"cameraFov": 40, | |
"cameraType": "perspective", | |
"clipDist": 10, | |
"clipFar": 100, | |
"clipNear": 0, | |
"fogFar": 100, | |
"fogNear": 50, | |
"hoverTimeout": 0, | |
"impostor": true, | |
"lightColor": 14540253, | |
"lightIntensity": 1, | |
"mousePreset": "default", | |
"panSpeed": 1, | |
"quality": "medium", | |
"rotateSpeed": 2, | |
"sampleLevel": 0, | |
"tooltip": true, | |
"workerDefault": true, | |
"zoomSpeed": 1.2 | |
}, | |
"_ngl_msg_archive": [ | |
{ | |
"args": [ | |
{ | |
"binary": false, | |
"data": "HETATM 1 O1 UNL 1 1.054 -1.197 2.286 1.00 0.00 O \nHETATM 2 C1 UNL 1 1.662 -1.617 1.251 1.00 0.00 C \nHETATM 3 C2 UNL 1 2.934 -2.330 1.440 1.00 0.00 C \nHETATM 4 O2 UNL 1 1.071 -1.365 0.034 1.00 0.00 O \nHETATM 5 C3 UNL 1 -0.137 -0.685 -0.101 1.00 0.00 C \nHETATM 6 C4 UNL 1 -0.193 0.683 -0.242 1.00 0.00 C \nHETATM 7 C5 UNL 1 -1.368 1.391 -0.378 1.00 0.00 C \nHETATM 8 C6 UNL 1 -2.554 0.667 -0.370 1.00 0.00 C \nHETATM 9 C7 UNL 1 -2.519 -0.704 -0.229 1.00 0.00 C \nHETATM 10 C8 UNL 1 -1.312 -1.399 -0.093 1.00 0.00 C \nHETATM 11 C9 UNL 1 -1.286 -2.842 0.054 1.00 0.00 C \nHETATM 12 O3 UNL 1 -2.342 -3.512 0.064 1.00 0.00 O \nHETATM 13 O4 UNL 1 -0.081 -3.494 0.186 1.00 0.00 O \nCONECT 1 2 2\nCONECT 2 3 4\nCONECT 4 5\nCONECT 5 6 6 10\nCONECT 6 7\nCONECT 7 8 8\nCONECT 8 9\nCONECT 9 10 10\nCONECT 10 11\nCONECT 11 12 12 13\nEND\n", | |
"type": "blob" | |
} | |
], | |
"kwargs": { | |
"defaultRepresentation": false, | |
"ext": "pdb" | |
}, | |
"methodName": "loadFile", | |
"reconstruc_color_scheme": false, | |
"target": "Stage", | |
"type": "call_method" | |
}, | |
{ | |
"args": [ | |
"auto", | |
"" | |
], | |
"kwargs": {}, | |
"methodName": "setSize", | |
"reconstruc_color_scheme": false, | |
"target": "Widget", | |
"type": "call_method" | |
}, | |
{ | |
"args": [ | |
[ | |
"221b6a1c074c49d5838f5aa029f63add", | |
"3838f51e694a44b1816347cec8fe9d54", | |
"3f0295800431414b84b6d3f253f442be", | |
"3f9e656f74184cb6ad04e30abc213d91", | |
"6f98921f9645445fa2984faf6dd8f50b", | |
"84ea53606c7b4ea094a2997568820ae8", | |
"96bfb611c08e4e28ba1806a0c23e72ad", | |
"9e98dca4c3c84a2ea0fea1747b5a90ff", | |
"f3f3d3bb75264390a52645aec4e26f41" | |
] | |
], | |
"kwargs": {}, | |
"methodName": "setSyncCamera", | |
"reconstruc_color_scheme": false, | |
"target": "Widget", | |
"type": "call_method" | |
} | |
], | |
"_ngl_original_stage_parameters": { | |
"ambientColor": 14540253, | |
"ambientIntensity": 0.2, | |
"backgroundColor": "white", | |
"cameraEyeSep": 0.3, | |
"cameraFov": 40, | |
"cameraType": "perspective", | |
"clipDist": 10, | |
"clipFar": 100, | |
"clipNear": 0, | |
"fogFar": 100, | |
"fogNear": 50, | |
"hoverTimeout": 0, | |
"impostor": true, | |
"lightColor": 14540253, | |
"lightIntensity": 1, | |
"mousePreset": "default", | |
"panSpeed": 1, | |
"quality": "medium", | |
"rotateSpeed": 2, | |
"sampleLevel": 0, | |
"tooltip": true, | |
"workerDefault": true, | |
"zoomSpeed": 1.2 | |
}, | |
"_ngl_repr_dict": { | |
"0": { | |
"0": { | |
"params": { | |
"aspectRatio": 1.5, | |
"assembly": "default", | |
"bondScale": 0.3, | |
"bondSpacing": 0.75, | |
"clipCenter": { | |
"x": 0, | |
"y": 0, | |
"z": 0 | |
}, | |
"clipNear": 0, | |
"clipRadius": 0, | |
"colorMode": "hcl", | |
"colorReverse": false, | |
"colorScale": "", | |
"colorScheme": "element", | |
"colorValue": 9474192, | |
"cylinderOnly": false, | |
"defaultAssembly": "", | |
"depthWrite": true, | |
"diffuse": 16777215, | |
"diffuseInterior": false, | |
"disableImpostor": false, | |
"disablePicking": false, | |
"flatShaded": false, | |
"interiorColor": 2236962, | |
"interiorDarkening": 0, | |
"lazy": false, | |
"lineOnly": false, | |
"linewidth": 2, | |
"matrix": { | |
"elements": [ | |
1, | |
0, | |
0, | |
0, | |
0, | |
1, | |
0, | |
0, | |
0, | |
0, | |
1, | |
0, | |
0, | |
0, | |
0, | |
1 | |
] | |
}, | |
"metalness": 0, | |
"multipleBond": "off", | |
"opacity": 1, | |
"openEnded": true, | |
"quality": "high", | |
"radialSegments": 20, | |
"radiusData": {}, | |
"radiusScale": 2, | |
"radiusSize": 0.15, | |
"radiusType": "size", | |
"roughness": 0.4, | |
"sele": "", | |
"side": "double", | |
"sphereDetail": 2, | |
"useInteriorColor": true, | |
"useWorker": true, | |
"visible": true, | |
"wireframe": false | |
}, | |
"type": "ball+stick" | |
} | |
} | |
}, | |
"_ngl_serialize": false, | |
"_ngl_version": "2.0.0-dev.36", | |
"_ngl_view_id": [ | |
"650DC4C3-7852-4279-8145-EC31F13E232F", | |
"26DD0CF2-EDC2-4B09-AB2F-31948922FC4D" | |
], | |
"_player_dict": {}, | |
"_scene_position": {}, | |
"_scene_rotation": {}, | |
"_synced_model_ids": [ | |
"221b6a1c074c49d5838f5aa029f63add", | |
"3838f51e694a44b1816347cec8fe9d54", | |
"3f0295800431414b84b6d3f253f442be", | |
"3f9e656f74184cb6ad04e30abc213d91", | |
"6f98921f9645445fa2984faf6dd8f50b", | |
"84ea53606c7b4ea094a2997568820ae8", | |
"96bfb611c08e4e28ba1806a0c23e72ad", | |
"9e98dca4c3c84a2ea0fea1747b5a90ff", | |
"f3f3d3bb75264390a52645aec4e26f41" | |
], | |
"_synced_repr_model_ids": [], | |
"_view_height": "", | |
"_view_width": "", | |
"background": "white", | |
"frame": 0, | |
"gui_style": null, | |
"layout": "IPY_MODEL_ae656959268549679b8a8579baf64fab", | |
"max_frame": 0, | |
"n_components": 1, | |
"picked": {} | |
} | |
}, | |
"3fbb534f3f6b45d6bf4c0e792c50908f": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "ButtonStyleModel", | |
"state": {} | |
}, | |
"415ded3a610948a39a727094ba149620": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "PlayModel", | |
"state": { | |
"layout": "IPY_MODEL_b4bf87e7cecf4bbdbef23252c6f382e7", | |
"max": 0, | |
"style": "IPY_MODEL_c164d0cf82d240b19caff016d0a28d14" | |
} | |
}, | |
"428017ecb6f543a2b390605842332c01": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_5a65a4eba8b24df9902d40b084127fa0", | |
"max" | |
], | |
"target": [ | |
"IPY_MODEL_9e98dca4c3c84a2ea0fea1747b5a90ff", | |
"max_frame" | |
] | |
} | |
}, | |
"43779d737e0b4820bd270110051ed2ab": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_0bb9692db7bd40a9b7ce359490667b50", | |
"max" | |
], | |
"target": [ | |
"IPY_MODEL_96bfb611c08e4e28ba1806a0c23e72ad", | |
"max_frame" | |
] | |
} | |
}, | |
"44168f4aad004552b1201cbcb5ac15c7": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_0badab992ef14d04a4ab5edddc7925f8", | |
"max" | |
], | |
"target": [ | |
"IPY_MODEL_84ea53606c7b4ea094a2997568820ae8", | |
"max_frame" | |
] | |
} | |
}, | |
"44600221d78a4eb796181871c72e3652": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_5a65a4eba8b24df9902d40b084127fa0", | |
"value" | |
], | |
"target": [ | |
"IPY_MODEL_c7d5689fb98643ebb661b3f80710bc8e", | |
"value" | |
] | |
} | |
}, | |
"45cabcdbda654faa97205461730899cb": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": { | |
"align_self": "stretch", | |
"grid_area": "widget003", | |
"width": "auto" | |
} | |
}, | |
"45f0fdf2bc2a41f2a15dc7823ae1af90": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "ButtonStyleModel", | |
"state": {} | |
}, | |
"4c196345f1ac48f4b082ec67d02e7bac": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "IntSliderModel", | |
"state": { | |
"layout": "IPY_MODEL_e20ae870911141299bb6f8369b6045a6", | |
"max": 0, | |
"style": "IPY_MODEL_c96655388b774f1c837b9f94b9fe8f21" | |
} | |
}, | |
"4d6e51bf404e4b9fb74fdb1f7d5a4a7e": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "PlayModel", | |
"state": { | |
"layout": "IPY_MODEL_62502cdb0dfb49f281f1c03abb93a14a", | |
"max": 0, | |
"style": "IPY_MODEL_e6cce0ea0dde4119947087fc1f5a3149" | |
} | |
}, | |
"4fc6c35878f74c91bc33f5d4fb969b8e": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_3ade81ac72c54d3bbd0a2e3dec8d8214", | |
"max" | |
], | |
"target": [ | |
"IPY_MODEL_3838f51e694a44b1816347cec8fe9d54", | |
"max_frame" | |
] | |
} | |
}, | |
"50320502db8f4201bb5c39148f066c9b": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_89424cdfc23b4a218672983cccab885c", | |
"value" | |
], | |
"target": [ | |
"IPY_MODEL_3838f51e694a44b1816347cec8fe9d54", | |
"frame" | |
] | |
} | |
}, | |
"51f2c3c4a1c1459496d9396afd4f1cad": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"51f84ffeb3334f5db5bb87328d2c6228": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "ImageModel", | |
"state": { | |
"layout": "IPY_MODEL_ada5f7f931854821ad0d929797a90e68", | |
"width": "900.0" | |
} | |
}, | |
"54dcc4ac58424439833e068c374c5162": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"56c050513370446fa01933ca471b20a0": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "SliderStyleModel", | |
"state": { | |
"description_width": "" | |
} | |
}, | |
"59079b97a2424310818a641df4168528": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"5a65a4eba8b24df9902d40b084127fa0": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "PlayModel", | |
"state": { | |
"layout": "IPY_MODEL_f5b86c79d785465998d6242453c0eb4e", | |
"max": 0, | |
"style": "IPY_MODEL_e900516305b6490798d4de803e29c9de" | |
} | |
}, | |
"5aecdffbcae248ac999ec97fedfff922": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "ImageModel", | |
"state": { | |
"layout": "IPY_MODEL_54dcc4ac58424439833e068c374c5162", | |
"width": "900.0" | |
} | |
}, | |
"5b0b6a6b97b843e68f26233e849f4ff2": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_4d6e51bf404e4b9fb74fdb1f7d5a4a7e", | |
"value" | |
], | |
"target": [ | |
"IPY_MODEL_6f98921f9645445fa2984faf6dd8f50b", | |
"frame" | |
] | |
} | |
}, | |
"5eb544dc78704160a1bd7120c48f1852": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_415ded3a610948a39a727094ba149620", | |
"max" | |
], | |
"target": [ | |
"IPY_MODEL_3f9e656f74184cb6ad04e30abc213d91", | |
"max_frame" | |
] | |
} | |
}, | |
"5f42dabf1d7d4d1892b3983b4c5bd7b9": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_2d2d3f6a54764647943f146fc508161d", | |
"value" | |
], | |
"target": [ | |
"IPY_MODEL_f3f3d3bb75264390a52645aec4e26f41", | |
"frame" | |
] | |
} | |
}, | |
"6166aea759da44aba384d1aef2d5304f": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": { | |
"width": "34px" | |
} | |
}, | |
"62502cdb0dfb49f281f1c03abb93a14a": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"659638d225874613995217073462cff8": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "DescriptionStyleModel", | |
"state": { | |
"description_width": "" | |
} | |
}, | |
"661b903a9be34e8bba887b0c31029638": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": { | |
"align_self": "stretch", | |
"grid_area": "widget009", | |
"width": "auto" | |
} | |
}, | |
"663bc345382248918d40ada777b260bf": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"6f98921f9645445fa2984faf6dd8f50b": { | |
"model_module": "nglview-js-widgets", | |
"model_module_version": "3.0.1", | |
"model_name": "NGLModel", | |
"state": { | |
"_camera_orientation": [ | |
12.417370427684604, | |
-7.5097609088009385, | |
-8.706272047847357, | |
0, | |
1.093723224554105, | |
13.527860445426866, | |
-10.108784867329266, | |
0, | |
11.445499175944834, | |
6.854724872561955, | |
10.411535225496076, | |
0, | |
-0.21700000762939453, | |
1.0559999346733093, | |
-0.3605000078678131, | |
1 | |
], | |
"_camera_str": "orthographic", | |
"_gui_theme": null, | |
"_ibtn_fullscreen": "IPY_MODEL_1f27a87dd64b4ec5afa31bb14c8fb0b5", | |
"_igui": null, | |
"_iplayer": "IPY_MODEL_0f111728ddf74110a89a47c27263b571", | |
"_ngl_color_dict": {}, | |
"_ngl_coordinate_resource": {}, | |
"_ngl_full_stage_parameters": { | |
"ambientColor": 14540253, | |
"ambientIntensity": 0.2, | |
"backgroundColor": "white", | |
"cameraEyeSep": 0.3, | |
"cameraFov": 40, | |
"cameraType": "perspective", | |
"clipDist": 10, | |
"clipFar": 100, | |
"clipNear": 0, | |
"fogFar": 100, | |
"fogNear": 50, | |
"hoverTimeout": 0, | |
"impostor": true, | |
"lightColor": 14540253, | |
"lightIntensity": 1, | |
"mousePreset": "default", | |
"panSpeed": 1, | |
"quality": "medium", | |
"rotateSpeed": 2, | |
"sampleLevel": 0, | |
"tooltip": true, | |
"workerDefault": true, | |
"zoomSpeed": 1.2 | |
}, | |
"_ngl_msg_archive": [ | |
{ | |
"args": [ | |
{ | |
"binary": false, | |
"data": "HETATM 1 O1 UNL 1 1.061 -1.105 2.266 1.00 0.00 O \nHETATM 2 C1 UNL 1 1.769 -1.505 1.300 1.00 0.00 C \nHETATM 3 C2 UNL 1 3.050 -2.186 1.520 1.00 0.00 C \nHETATM 4 O2 UNL 1 1.230 -1.244 0.036 1.00 0.00 O \nHETATM 5 C3 UNL 1 0.010 -0.594 -0.116 1.00 0.00 C \nHETATM 6 C4 UNL 1 -0.140 0.748 -0.222 1.00 0.00 C \nHETATM 7 C5 UNL 1 -1.375 1.356 -0.372 1.00 0.00 C \nHETATM 8 C6 UNL 1 -2.481 0.512 -0.411 1.00 0.00 C \nHETATM 9 C7 UNL 1 -2.361 -0.858 -0.306 1.00 0.00 C \nHETATM 10 C8 UNL 1 -1.108 -1.402 -0.159 1.00 0.00 C \nHETATM 11 C9 UNL 1 -1.008 -2.861 -0.050 1.00 0.00 C \nHETATM 12 O3 UNL 1 0.117 -3.370 0.084 1.00 0.00 O \nHETATM 13 O4 UNL 1 -2.118 -3.677 -0.091 1.00 0.00 O \nCONECT 1 2 2\nCONECT 2 3 4\nCONECT 4 5\nCONECT 5 6 6 10\nCONECT 6 7\nCONECT 7 8 8\nCONECT 8 9\nCONECT 9 10 10\nCONECT 10 11\nCONECT 11 12 12 13\nEND\n", | |
"type": "blob" | |
} | |
], | |
"kwargs": { | |
"defaultRepresentation": false, | |
"ext": "pdb" | |
}, | |
"methodName": "loadFile", | |
"reconstruc_color_scheme": false, | |
"target": "Stage", | |
"type": "call_method" | |
}, | |
{ | |
"args": [ | |
"auto", | |
"" | |
], | |
"kwargs": {}, | |
"methodName": "setSize", | |
"reconstruc_color_scheme": false, | |
"target": "Widget", | |
"type": "call_method" | |
}, | |
{ | |
"args": [ | |
[ | |
"221b6a1c074c49d5838f5aa029f63add", | |
"3838f51e694a44b1816347cec8fe9d54", | |
"3f0295800431414b84b6d3f253f442be", | |
"3f9e656f74184cb6ad04e30abc213d91", | |
"6f98921f9645445fa2984faf6dd8f50b", | |
"84ea53606c7b4ea094a2997568820ae8", | |
"96bfb611c08e4e28ba1806a0c23e72ad", | |
"9e98dca4c3c84a2ea0fea1747b5a90ff", | |
"f3f3d3bb75264390a52645aec4e26f41" | |
] | |
], | |
"kwargs": {}, | |
"methodName": "setSyncCamera", | |
"reconstruc_color_scheme": false, | |
"target": "Widget", | |
"type": "call_method" | |
} | |
], | |
"_ngl_original_stage_parameters": { | |
"ambientColor": 14540253, | |
"ambientIntensity": 0.2, | |
"backgroundColor": "white", | |
"cameraEyeSep": 0.3, | |
"cameraFov": 40, | |
"cameraType": "perspective", | |
"clipDist": 10, | |
"clipFar": 100, | |
"clipNear": 0, | |
"fogFar": 100, | |
"fogNear": 50, | |
"hoverTimeout": 0, | |
"impostor": true, | |
"lightColor": 14540253, | |
"lightIntensity": 1, | |
"mousePreset": "default", | |
"panSpeed": 1, | |
"quality": "medium", | |
"rotateSpeed": 2, | |
"sampleLevel": 0, | |
"tooltip": true, | |
"workerDefault": true, | |
"zoomSpeed": 1.2 | |
}, | |
"_ngl_repr_dict": { | |
"0": { | |
"0": { | |
"params": { | |
"aspectRatio": 1.5, | |
"assembly": "default", | |
"bondScale": 0.3, | |
"bondSpacing": 0.75, | |
"clipCenter": { | |
"x": 0, | |
"y": 0, | |
"z": 0 | |
}, | |
"clipNear": 0, | |
"clipRadius": 0, | |
"colorMode": "hcl", | |
"colorReverse": false, | |
"colorScale": "", | |
"colorScheme": "element", | |
"colorValue": 9474192, | |
"cylinderOnly": false, | |
"defaultAssembly": "", | |
"depthWrite": true, | |
"diffuse": 16777215, | |
"diffuseInterior": false, | |
"disableImpostor": false, | |
"disablePicking": false, | |
"flatShaded": false, | |
"interiorColor": 2236962, | |
"interiorDarkening": 0, | |
"lazy": false, | |
"lineOnly": false, | |
"linewidth": 2, | |
"matrix": { | |
"elements": [ | |
1, | |
0, | |
0, | |
0, | |
0, | |
1, | |
0, | |
0, | |
0, | |
0, | |
1, | |
0, | |
0, | |
0, | |
0, | |
1 | |
] | |
}, | |
"metalness": 0, | |
"multipleBond": "off", | |
"opacity": 1, | |
"openEnded": true, | |
"quality": "high", | |
"radialSegments": 20, | |
"radiusData": {}, | |
"radiusScale": 2, | |
"radiusSize": 0.15, | |
"radiusType": "size", | |
"roughness": 0.4, | |
"sele": "", | |
"side": "double", | |
"sphereDetail": 2, | |
"useInteriorColor": true, | |
"useWorker": true, | |
"visible": true, | |
"wireframe": false | |
}, | |
"type": "ball+stick" | |
} | |
} | |
}, | |
"_ngl_serialize": false, | |
"_ngl_version": "2.0.0-dev.36", | |
"_ngl_view_id": [ | |
"4DB3B33E-E73C-4DF7-A67F-2F6A72453E4B", | |
"B7F41999-56A7-43C5-B22C-6D1B4C6E7162" | |
], | |
"_player_dict": {}, | |
"_scene_position": {}, | |
"_scene_rotation": {}, | |
"_synced_model_ids": [ | |
"221b6a1c074c49d5838f5aa029f63add", | |
"3838f51e694a44b1816347cec8fe9d54", | |
"3f0295800431414b84b6d3f253f442be", | |
"3f9e656f74184cb6ad04e30abc213d91", | |
"6f98921f9645445fa2984faf6dd8f50b", | |
"84ea53606c7b4ea094a2997568820ae8", | |
"96bfb611c08e4e28ba1806a0c23e72ad", | |
"9e98dca4c3c84a2ea0fea1747b5a90ff", | |
"f3f3d3bb75264390a52645aec4e26f41" | |
], | |
"_synced_repr_model_ids": [], | |
"_view_height": "", | |
"_view_width": "", | |
"background": "white", | |
"frame": 0, | |
"gui_style": null, | |
"layout": "IPY_MODEL_272bb638751841d89fb02602bc8965e9", | |
"max_frame": 0, | |
"n_components": 1, | |
"picked": {} | |
} | |
}, | |
"73ad6176bef84ea491d2e78d7f8b2375": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_0badab992ef14d04a4ab5edddc7925f8", | |
"value" | |
], | |
"target": [ | |
"IPY_MODEL_b919e362ed944b60949f8064be4cef38", | |
"value" | |
] | |
} | |
}, | |
"7484cdb1228e47518e069b789a376b71": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"763853c0a6824ab582b38aa74fa818a3": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "ImageModel", | |
"state": { | |
"layout": "IPY_MODEL_01ed7c7d6ff844e58b89a78bb6d5cc6d", | |
"width": "900.0" | |
} | |
}, | |
"7660d6a94adc47e8b69ed2856aa9f52b": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "DescriptionStyleModel", | |
"state": { | |
"description_width": "" | |
} | |
}, | |
"7663a1d1d2164166b96886807e0d620a": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"7757228f95ba41068cde1df1df1d8be5": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "ButtonStyleModel", | |
"state": {} | |
}, | |
"77cc3264594d44b9912cb504f193f758": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "ImageModel", | |
"state": { | |
"layout": "IPY_MODEL_ed385d6e019044159f62d5a16b299576", | |
"width": "900.0" | |
} | |
}, | |
"7954a5d275224488b6f28287bacf6f28": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"7b4a000239d343a293fe7a3a8e088dcd": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": { | |
"align_self": "stretch", | |
"grid_area": "widget002", | |
"width": "auto" | |
} | |
}, | |
"7b9f27483c804e8b85e8f49acd868ad7": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "PlayModel", | |
"state": { | |
"layout": "IPY_MODEL_a98249ce8797475aa27b62eef78de501", | |
"max": 0, | |
"style": "IPY_MODEL_b442163450e44287a33883572ca5f0e5" | |
} | |
}, | |
"7c70e1553ab64d8591f6779fecb2577b": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"7d02333a46264197a05d34362cb81762": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "PlayModel", | |
"state": { | |
"layout": "IPY_MODEL_663bc345382248918d40ada777b260bf", | |
"max": 0, | |
"style": "IPY_MODEL_0678b4548c61437a87029d413e32bf2e" | |
} | |
}, | |
"7d1bd3a6b04b4af58c4bd41123bd14ea": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "ImageModel", | |
"state": { | |
"layout": "IPY_MODEL_ac0b685e7c6f483e8909ec645c1429c0", | |
"width": "900.0" | |
} | |
}, | |
"7db74b3de75b4157aecb8fd1b8745355": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "SliderStyleModel", | |
"state": { | |
"description_width": "" | |
} | |
}, | |
"7ed104022485474f8a08f1671c1384cf": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "SliderStyleModel", | |
"state": { | |
"description_width": "" | |
} | |
}, | |
"7f1506813e3d4638af9dff9f3f5a8ce5": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "HBoxModel", | |
"state": { | |
"children": [ | |
"IPY_MODEL_89424cdfc23b4a218672983cccab885c", | |
"IPY_MODEL_3ade81ac72c54d3bbd0a2e3dec8d8214" | |
], | |
"layout": "IPY_MODEL_aee2c8542c464dba9ef51f0e732f2917" | |
} | |
}, | |
"7f39878bfadd4ac9adf21259ce6d5697": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"7f42f49c7b0e4427a8c647c651a7216a": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_01da06fd55c944d99d1224e663b247d9", | |
"max" | |
], | |
"target": [ | |
"IPY_MODEL_221b6a1c074c49d5838f5aa029f63add", | |
"max_frame" | |
] | |
} | |
}, | |
"8076b578f45f4f40942ce05c28a88b3c": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "ButtonStyleModel", | |
"state": {} | |
}, | |
"83ba8d7839344681a9aed653e84c4099": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "ButtonModel", | |
"state": { | |
"icon": "compress", | |
"layout": "IPY_MODEL_8db059f7635d43cf939646c7c3ccd5ce", | |
"style": "IPY_MODEL_8684d3a1d4ca479286a54539b55faff0" | |
} | |
}, | |
"84ea53606c7b4ea094a2997568820ae8": { | |
"model_module": "nglview-js-widgets", | |
"model_module_version": "3.0.1", | |
"model_name": "NGLModel", | |
"state": { | |
"_camera_orientation": [ | |
12.417370427684604, | |
-7.5097609088009385, | |
-8.706272047847357, | |
0, | |
1.093723224554105, | |
13.527860445426866, | |
-10.108784867329266, | |
0, | |
11.445499175944834, | |
6.854724872561955, | |
10.411535225496076, | |
0, | |
-0.21700000762939453, | |
1.0559999346733093, | |
-0.3605000078678131, | |
1 | |
], | |
"_camera_str": "orthographic", | |
"_gui_theme": null, | |
"_ibtn_fullscreen": "IPY_MODEL_83ba8d7839344681a9aed653e84c4099", | |
"_igui": null, | |
"_iplayer": "IPY_MODEL_b07ebcf83b7641c48d2d0df167cfdd03", | |
"_ngl_color_dict": {}, | |
"_ngl_coordinate_resource": {}, | |
"_ngl_full_stage_parameters": { | |
"ambientColor": 14540253, | |
"ambientIntensity": 0.2, | |
"backgroundColor": "white", | |
"cameraEyeSep": 0.3, | |
"cameraFov": 40, | |
"cameraType": "perspective", | |
"clipDist": 10, | |
"clipFar": 100, | |
"clipNear": 0, | |
"fogFar": 100, | |
"fogNear": 50, | |
"hoverTimeout": 0, | |
"impostor": true, | |
"lightColor": 14540253, | |
"lightIntensity": 1, | |
"mousePreset": "default", | |
"panSpeed": 1, | |
"quality": "medium", | |
"rotateSpeed": 2, | |
"sampleLevel": 0, | |
"tooltip": true, | |
"workerDefault": true, | |
"zoomSpeed": 1.2 | |
}, | |
"_ngl_msg_archive": [ | |
{ | |
"args": [ | |
{ | |
"binary": false, | |
"data": "HETATM 1 O1 UNL 1 1.893 -1.391 -0.590 1.00 0.00 O \nHETATM 2 C1 UNL 1 1.784 -1.631 0.645 1.00 0.00 C \nHETATM 3 C2 UNL 1 2.925 -2.318 1.311 1.00 0.00 C \nHETATM 4 O2 UNL 1 0.632 -1.265 1.365 1.00 0.00 O \nHETATM 5 C3 UNL 1 -0.363 -0.631 0.639 1.00 0.00 C \nHETATM 6 C4 UNL 1 -0.343 0.742 0.543 1.00 0.00 C \nHETATM 7 C5 UNL 1 -1.363 1.347 -0.197 1.00 0.00 C \nHETATM 8 C6 UNL 1 -2.352 0.593 -0.808 1.00 0.00 C \nHETATM 9 C7 UNL 1 -2.366 -0.784 -0.708 1.00 0.00 C \nHETATM 10 C8 UNL 1 -1.353 -1.367 0.026 1.00 0.00 C \nHETATM 11 C9 UNL 1 -1.300 -2.815 0.178 1.00 0.00 C \nHETATM 12 O3 UNL 1 -2.175 -3.543 -0.358 1.00 0.00 O \nHETATM 13 O4 UNL 1 -0.305 -3.453 0.904 1.00 0.00 O \nCONECT 1 2 2\nCONECT 2 3 4\nCONECT 4 5\nCONECT 5 6 6 10\nCONECT 6 7\nCONECT 7 8 8\nCONECT 8 9\nCONECT 9 10 10\nCONECT 10 11\nCONECT 11 12 12 13\nEND\n", | |
"type": "blob" | |
} | |
], | |
"kwargs": { | |
"defaultRepresentation": false, | |
"ext": "pdb" | |
}, | |
"methodName": "loadFile", | |
"reconstruc_color_scheme": false, | |
"target": "Stage", | |
"type": "call_method" | |
}, | |
{ | |
"args": [ | |
"auto", | |
"" | |
], | |
"kwargs": {}, | |
"methodName": "setSize", | |
"reconstruc_color_scheme": false, | |
"target": "Widget", | |
"type": "call_method" | |
}, | |
{ | |
"args": [ | |
[ | |
"221b6a1c074c49d5838f5aa029f63add", | |
"3838f51e694a44b1816347cec8fe9d54", | |
"3f0295800431414b84b6d3f253f442be", | |
"3f9e656f74184cb6ad04e30abc213d91", | |
"6f98921f9645445fa2984faf6dd8f50b", | |
"84ea53606c7b4ea094a2997568820ae8", | |
"96bfb611c08e4e28ba1806a0c23e72ad", | |
"9e98dca4c3c84a2ea0fea1747b5a90ff", | |
"f3f3d3bb75264390a52645aec4e26f41" | |
] | |
], | |
"kwargs": {}, | |
"methodName": "setSyncCamera", | |
"reconstruc_color_scheme": false, | |
"target": "Widget", | |
"type": "call_method" | |
} | |
], | |
"_ngl_original_stage_parameters": { | |
"ambientColor": 14540253, | |
"ambientIntensity": 0.2, | |
"backgroundColor": "white", | |
"cameraEyeSep": 0.3, | |
"cameraFov": 40, | |
"cameraType": "perspective", | |
"clipDist": 10, | |
"clipFar": 100, | |
"clipNear": 0, | |
"fogFar": 100, | |
"fogNear": 50, | |
"hoverTimeout": 0, | |
"impostor": true, | |
"lightColor": 14540253, | |
"lightIntensity": 1, | |
"mousePreset": "default", | |
"panSpeed": 1, | |
"quality": "medium", | |
"rotateSpeed": 2, | |
"sampleLevel": 0, | |
"tooltip": true, | |
"workerDefault": true, | |
"zoomSpeed": 1.2 | |
}, | |
"_ngl_repr_dict": { | |
"0": { | |
"0": { | |
"params": { | |
"aspectRatio": 1.5, | |
"assembly": "default", | |
"bondScale": 0.3, | |
"bondSpacing": 0.75, | |
"clipCenter": { | |
"x": 0, | |
"y": 0, | |
"z": 0 | |
}, | |
"clipNear": 0, | |
"clipRadius": 0, | |
"colorMode": "hcl", | |
"colorReverse": false, | |
"colorScale": "", | |
"colorScheme": "element", | |
"colorValue": 9474192, | |
"cylinderOnly": false, | |
"defaultAssembly": "", | |
"depthWrite": true, | |
"diffuse": 16777215, | |
"diffuseInterior": false, | |
"disableImpostor": false, | |
"disablePicking": false, | |
"flatShaded": false, | |
"interiorColor": 2236962, | |
"interiorDarkening": 0, | |
"lazy": false, | |
"lineOnly": false, | |
"linewidth": 2, | |
"matrix": { | |
"elements": [ | |
1, | |
0, | |
0, | |
0, | |
0, | |
1, | |
0, | |
0, | |
0, | |
0, | |
1, | |
0, | |
0, | |
0, | |
0, | |
1 | |
] | |
}, | |
"metalness": 0, | |
"multipleBond": "off", | |
"opacity": 1, | |
"openEnded": true, | |
"quality": "high", | |
"radialSegments": 20, | |
"radiusData": {}, | |
"radiusScale": 2, | |
"radiusSize": 0.15, | |
"radiusType": "size", | |
"roughness": 0.4, | |
"sele": "", | |
"side": "double", | |
"sphereDetail": 2, | |
"useInteriorColor": true, | |
"useWorker": true, | |
"visible": true, | |
"wireframe": false | |
}, | |
"type": "ball+stick" | |
} | |
} | |
}, | |
"_ngl_serialize": false, | |
"_ngl_version": "2.0.0-dev.36", | |
"_ngl_view_id": [ | |
"B7AD049A-9F13-4CA0-9E6E-F6BA1DCE09E7", | |
"2BDE1A86-C1BE-48A1-AA06-B95392518896" | |
], | |
"_player_dict": {}, | |
"_scene_position": {}, | |
"_scene_rotation": {}, | |
"_synced_model_ids": [ | |
"221b6a1c074c49d5838f5aa029f63add", | |
"3838f51e694a44b1816347cec8fe9d54", | |
"3f0295800431414b84b6d3f253f442be", | |
"3f9e656f74184cb6ad04e30abc213d91", | |
"6f98921f9645445fa2984faf6dd8f50b", | |
"84ea53606c7b4ea094a2997568820ae8", | |
"96bfb611c08e4e28ba1806a0c23e72ad", | |
"9e98dca4c3c84a2ea0fea1747b5a90ff", | |
"f3f3d3bb75264390a52645aec4e26f41" | |
], | |
"_synced_repr_model_ids": [], | |
"_view_height": "", | |
"_view_width": "", | |
"background": "white", | |
"frame": 0, | |
"gui_style": null, | |
"layout": "IPY_MODEL_beb658671ac946d096a69b637c04d04d", | |
"max_frame": 0, | |
"n_components": 1, | |
"picked": {} | |
} | |
}, | |
"85b6fbd72f054afc80f44634c60ef5a7": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": { | |
"width": "34px" | |
} | |
}, | |
"8684d3a1d4ca479286a54539b55faff0": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "ButtonStyleModel", | |
"state": {} | |
}, | |
"86ea67773d7844c8aac6a79fbcb351b0": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_89424cdfc23b4a218672983cccab885c", | |
"value" | |
], | |
"target": [ | |
"IPY_MODEL_3ade81ac72c54d3bbd0a2e3dec8d8214", | |
"value" | |
] | |
} | |
}, | |
"89424cdfc23b4a218672983cccab885c": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "PlayModel", | |
"state": { | |
"layout": "IPY_MODEL_bc74f43636704607a9ba25386f8fd795", | |
"max": 0, | |
"style": "IPY_MODEL_21eeb6436bdc48c8bb044251e0c53ec2" | |
} | |
}, | |
"89577122049d4bc0b6c9b9f6152778c9": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"8a52ef2b78aa452abea08fee5f6d4157": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"8a5992883d134978a2abb7f2269b9f35": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": { | |
"align_self": "stretch", | |
"grid_area": "widget001", | |
"width": "auto" | |
} | |
}, | |
"8ad8792e8da0430fa8fb32d7ead8a6eb": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "IntSliderModel", | |
"state": { | |
"layout": "IPY_MODEL_df9d73101cfa4dad915c51db3a07b243", | |
"max": 0, | |
"style": "IPY_MODEL_df3b1560289147e8a7b5cfc96764bd94" | |
} | |
}, | |
"8db059f7635d43cf939646c7c3ccd5ce": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": { | |
"width": "34px" | |
} | |
}, | |
"8e9a2516532240c5889768c960b71ead": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "ButtonModel", | |
"state": { | |
"icon": "compress", | |
"layout": "IPY_MODEL_85b6fbd72f054afc80f44634c60ef5a7", | |
"style": "IPY_MODEL_b1b529ab88a5497d9c865e8b9a2ff220" | |
} | |
}, | |
"8fd508b9b4d44f60980e58e73be65ed5": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": { | |
"width": "34px" | |
} | |
}, | |
"9237b9dab9c54cb38dff35a5949cd9c1": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_0badab992ef14d04a4ab5edddc7925f8", | |
"value" | |
], | |
"target": [ | |
"IPY_MODEL_84ea53606c7b4ea094a2997568820ae8", | |
"frame" | |
] | |
} | |
}, | |
"94cc8cc0f7224ceea6e8907abf671582": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": { | |
"width": "34px" | |
} | |
}, | |
"96a7cfe7ad9649eba8e662a791903d3e": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_5a65a4eba8b24df9902d40b084127fa0", | |
"value" | |
], | |
"target": [ | |
"IPY_MODEL_9e98dca4c3c84a2ea0fea1747b5a90ff", | |
"frame" | |
] | |
} | |
}, | |
"96bfb611c08e4e28ba1806a0c23e72ad": { | |
"model_module": "nglview-js-widgets", | |
"model_module_version": "3.0.1", | |
"model_name": "NGLModel", | |
"state": { | |
"_camera_orientation": [ | |
12.417370427684597, | |
-7.509760908800933, | |
-8.706272047847351, | |
0, | |
1.093723224554104, | |
13.527860445426851, | |
-10.108784867329254, | |
0, | |
11.445499175944821, | |
6.854724872561946, | |
10.411535225496062, | |
0, | |
-0.21700000762939453, | |
1.0559999346733093, | |
-0.3605000078678131, | |
1 | |
], | |
"_camera_str": "orthographic", | |
"_gui_theme": null, | |
"_ibtn_fullscreen": "IPY_MODEL_1d481aa6fb014ab1a4a23faed79dd5fa", | |
"_igui": null, | |
"_iplayer": "IPY_MODEL_cf3e982a6aab4d9ba161175892e4f0e1", | |
"_ngl_color_dict": {}, | |
"_ngl_coordinate_resource": {}, | |
"_ngl_full_stage_parameters": { | |
"ambientColor": 14540253, | |
"ambientIntensity": 0.2, | |
"backgroundColor": "white", | |
"cameraEyeSep": 0.3, | |
"cameraFov": 40, | |
"cameraType": "perspective", | |
"clipDist": 10, | |
"clipFar": 100, | |
"clipNear": 0, | |
"fogFar": 100, | |
"fogNear": 50, | |
"hoverTimeout": 0, | |
"impostor": true, | |
"lightColor": 14540253, | |
"lightIntensity": 1, | |
"mousePreset": "default", | |
"panSpeed": 1, | |
"quality": "medium", | |
"rotateSpeed": 2, | |
"sampleLevel": 0, | |
"tooltip": true, | |
"workerDefault": true, | |
"zoomSpeed": 1.2 | |
}, | |
"_ngl_msg_archive": [ | |
{ | |
"args": [ | |
{ | |
"binary": false, | |
"data": "HETATM 1 O1 UNL 1 1.974 -1.344 -0.559 1.00 0.00 O \nHETATM 2 C1 UNL 1 1.969 -1.556 0.694 1.00 0.00 C \nHETATM 3 C2 UNL 1 3.114 -2.183 1.368 1.00 0.00 C \nHETATM 4 O2 UNL 1 0.807 -1.150 1.356 1.00 0.00 O \nHETATM 5 C3 UNL 1 -0.254 -0.553 0.646 1.00 0.00 C \nHETATM 6 C4 UNL 1 -0.349 0.784 0.445 1.00 0.00 C \nHETATM 7 C5 UNL 1 -1.407 1.324 -0.257 1.00 0.00 C \nHETATM 8 C6 UNL 1 -2.377 0.475 -0.756 1.00 0.00 C \nHETATM 9 C7 UNL 1 -2.320 -0.880 -0.576 1.00 0.00 C \nHETATM 10 C8 UNL 1 -1.230 -1.391 0.142 1.00 0.00 C \nHETATM 11 C9 UNL 1 -1.127 -2.830 0.358 1.00 0.00 C \nHETATM 12 O3 UNL 1 -0.157 -3.291 0.999 1.00 0.00 O \nHETATM 13 O4 UNL 1 -2.075 -3.716 -0.124 1.00 0.00 O \nCONECT 1 2 2\nCONECT 2 3 4\nCONECT 4 5\nCONECT 5 6 6 10\nCONECT 6 7\nCONECT 7 8 8\nCONECT 8 9\nCONECT 9 10 10\nCONECT 10 11\nCONECT 11 12 12 13\nEND\n", | |
"type": "blob" | |
} | |
], | |
"kwargs": { | |
"defaultRepresentation": false, | |
"ext": "pdb" | |
}, | |
"methodName": "loadFile", | |
"reconstruc_color_scheme": false, | |
"target": "Stage", | |
"type": "call_method" | |
}, | |
{ | |
"args": [ | |
"auto", | |
"" | |
], | |
"kwargs": {}, | |
"methodName": "setSize", | |
"reconstruc_color_scheme": false, | |
"target": "Widget", | |
"type": "call_method" | |
}, | |
{ | |
"args": [ | |
[ | |
"221b6a1c074c49d5838f5aa029f63add", | |
"3838f51e694a44b1816347cec8fe9d54", | |
"3f0295800431414b84b6d3f253f442be", | |
"3f9e656f74184cb6ad04e30abc213d91", | |
"6f98921f9645445fa2984faf6dd8f50b", | |
"84ea53606c7b4ea094a2997568820ae8", | |
"96bfb611c08e4e28ba1806a0c23e72ad", | |
"9e98dca4c3c84a2ea0fea1747b5a90ff", | |
"f3f3d3bb75264390a52645aec4e26f41" | |
] | |
], | |
"kwargs": {}, | |
"methodName": "setSyncCamera", | |
"reconstruc_color_scheme": false, | |
"target": "Widget", | |
"type": "call_method" | |
} | |
], | |
"_ngl_original_stage_parameters": { | |
"ambientColor": 14540253, | |
"ambientIntensity": 0.2, | |
"backgroundColor": "white", | |
"cameraEyeSep": 0.3, | |
"cameraFov": 40, | |
"cameraType": "perspective", | |
"clipDist": 10, | |
"clipFar": 100, | |
"clipNear": 0, | |
"fogFar": 100, | |
"fogNear": 50, | |
"hoverTimeout": 0, | |
"impostor": true, | |
"lightColor": 14540253, | |
"lightIntensity": 1, | |
"mousePreset": "default", | |
"panSpeed": 1, | |
"quality": "medium", | |
"rotateSpeed": 2, | |
"sampleLevel": 0, | |
"tooltip": true, | |
"workerDefault": true, | |
"zoomSpeed": 1.2 | |
}, | |
"_ngl_repr_dict": { | |
"0": { | |
"0": { | |
"params": { | |
"aspectRatio": 1.5, | |
"assembly": "default", | |
"bondScale": 0.3, | |
"bondSpacing": 0.75, | |
"clipCenter": { | |
"x": 0, | |
"y": 0, | |
"z": 0 | |
}, | |
"clipNear": 0, | |
"clipRadius": 0, | |
"colorMode": "hcl", | |
"colorReverse": false, | |
"colorScale": "", | |
"colorScheme": "element", | |
"colorValue": 9474192, | |
"cylinderOnly": false, | |
"defaultAssembly": "", | |
"depthWrite": true, | |
"diffuse": 16777215, | |
"diffuseInterior": false, | |
"disableImpostor": false, | |
"disablePicking": false, | |
"flatShaded": false, | |
"interiorColor": 2236962, | |
"interiorDarkening": 0, | |
"lazy": false, | |
"lineOnly": false, | |
"linewidth": 2, | |
"matrix": { | |
"elements": [ | |
1, | |
0, | |
0, | |
0, | |
0, | |
1, | |
0, | |
0, | |
0, | |
0, | |
1, | |
0, | |
0, | |
0, | |
0, | |
1 | |
] | |
}, | |
"metalness": 0, | |
"multipleBond": "off", | |
"opacity": 1, | |
"openEnded": true, | |
"quality": "high", | |
"radialSegments": 20, | |
"radiusData": {}, | |
"radiusScale": 2, | |
"radiusSize": 0.15, | |
"radiusType": "size", | |
"roughness": 0.4, | |
"sele": "", | |
"side": "double", | |
"sphereDetail": 2, | |
"useInteriorColor": true, | |
"useWorker": true, | |
"visible": true, | |
"wireframe": false | |
}, | |
"type": "ball+stick" | |
} | |
} | |
}, | |
"_ngl_serialize": false, | |
"_ngl_version": "2.0.0-dev.36", | |
"_ngl_view_id": [ | |
"358F0706-427B-4D84-9314-0090E0346D95", | |
"61383307-8A89-4493-82BF-B931B1C7CE91" | |
], | |
"_player_dict": {}, | |
"_scene_position": {}, | |
"_scene_rotation": {}, | |
"_synced_model_ids": [ | |
"221b6a1c074c49d5838f5aa029f63add", | |
"3838f51e694a44b1816347cec8fe9d54", | |
"3f0295800431414b84b6d3f253f442be", | |
"3f9e656f74184cb6ad04e30abc213d91", | |
"6f98921f9645445fa2984faf6dd8f50b", | |
"84ea53606c7b4ea094a2997568820ae8", | |
"96bfb611c08e4e28ba1806a0c23e72ad", | |
"9e98dca4c3c84a2ea0fea1747b5a90ff", | |
"f3f3d3bb75264390a52645aec4e26f41" | |
], | |
"_synced_repr_model_ids": [], | |
"_view_height": "", | |
"_view_width": "", | |
"background": "white", | |
"frame": 0, | |
"gui_style": null, | |
"layout": "IPY_MODEL_8a5992883d134978a2abb7f2269b9f35", | |
"max_frame": 0, | |
"n_components": 1, | |
"picked": {} | |
} | |
}, | |
"9865d4e50ccb4791bf0e5004f1661bf6": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "DescriptionStyleModel", | |
"state": { | |
"description_width": "" | |
} | |
}, | |
"9a76d12804c64ad9bc96f0b6beb668af": { | |
"model_module": "nglview-js-widgets", | |
"model_module_version": "3.0.1", | |
"model_name": "ColormakerRegistryModel", | |
"state": { | |
"_msg_ar": [], | |
"_msg_q": [], | |
"_ready": true, | |
"layout": "IPY_MODEL_7954a5d275224488b6f28287bacf6f28" | |
} | |
}, | |
"9bf693641a164d41b994d296bc121a5b": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"9e98dca4c3c84a2ea0fea1747b5a90ff": { | |
"model_module": "nglview-js-widgets", | |
"model_module_version": "3.0.1", | |
"model_name": "NGLModel", | |
"state": { | |
"_camera_orientation": [ | |
12.417370427684604, | |
-7.5097609088009385, | |
-8.706272047847357, | |
0, | |
1.093723224554105, | |
13.527860445426866, | |
-10.108784867329266, | |
0, | |
11.445499175944834, | |
6.854724872561955, | |
10.411535225496076, | |
0, | |
-0.21700000762939453, | |
1.0559999346733093, | |
-0.3605000078678131, | |
1 | |
], | |
"_camera_str": "orthographic", | |
"_gui_theme": null, | |
"_ibtn_fullscreen": "IPY_MODEL_9f15d31b9aea4ee5a580d62204a9ca2b", | |
"_igui": null, | |
"_iplayer": "IPY_MODEL_072b642327fa4d01b563c7797be87c65", | |
"_ngl_color_dict": {}, | |
"_ngl_coordinate_resource": {}, | |
"_ngl_full_stage_parameters": { | |
"ambientColor": 14540253, | |
"ambientIntensity": 0.2, | |
"backgroundColor": "white", | |
"cameraEyeSep": 0.3, | |
"cameraFov": 40, | |
"cameraType": "perspective", | |
"clipDist": 10, | |
"clipFar": 100, | |
"clipNear": 0, | |
"fogFar": 100, | |
"fogNear": 50, | |
"hoverTimeout": 0, | |
"impostor": true, | |
"lightColor": 14540253, | |
"lightIntensity": 1, | |
"mousePreset": "default", | |
"panSpeed": 1, | |
"quality": "medium", | |
"rotateSpeed": 2, | |
"sampleLevel": 0, | |
"tooltip": true, | |
"workerDefault": true, | |
"zoomSpeed": 1.2 | |
}, | |
"_ngl_msg_archive": [ | |
{ | |
"args": [ | |
{ | |
"binary": false, | |
"data": "HETATM 1 O1 UNL 1 1.103 -1.077 2.242 1.00 0.00 O \nHETATM 2 C1 UNL 1 1.666 -1.558 1.240 1.00 0.00 C \nHETATM 3 C2 UNL 1 2.962 -2.301 1.413 1.00 0.00 C \nHETATM 4 O2 UNL 1 1.080 -1.394 0.001 1.00 0.00 O \nHETATM 5 C3 UNL 1 -0.133 -0.694 -0.124 1.00 0.00 C \nHETATM 6 C4 UNL 1 -0.153 0.680 -0.338 1.00 0.00 C \nHETATM 7 C5 UNL 1 -1.348 1.359 -0.459 1.00 0.00 C \nHETATM 8 C6 UNL 1 -2.514 0.627 -0.361 1.00 0.00 C \nHETATM 9 C7 UNL 1 -2.512 -0.735 -0.149 1.00 0.00 C \nHETATM 10 C8 UNL 1 -1.314 -1.386 -0.032 1.00 0.00 C \nHETATM 11 C9 UNL 1 -1.294 -2.810 0.189 1.00 0.00 C \nHETATM 12 O3 UNL 1 -2.372 -3.437 0.273 1.00 0.00 O \nHETATM 13 O4 UNL 1 -0.106 -3.511 0.314 1.00 0.00 O \nCONECT 1 2 2\nCONECT 2 3 4\nCONECT 4 5\nCONECT 5 6 6 10\nCONECT 6 7\nCONECT 7 8 8\nCONECT 8 9\nCONECT 9 10 10\nCONECT 10 11\nCONECT 11 12 12 13\nEND\n", | |
"type": "blob" | |
} | |
], | |
"kwargs": { | |
"defaultRepresentation": false, | |
"ext": "pdb" | |
}, | |
"methodName": "loadFile", | |
"reconstruc_color_scheme": false, | |
"target": "Stage", | |
"type": "call_method" | |
}, | |
{ | |
"args": [ | |
"auto", | |
"" | |
], | |
"kwargs": {}, | |
"methodName": "setSize", | |
"reconstruc_color_scheme": false, | |
"target": "Widget", | |
"type": "call_method" | |
}, | |
{ | |
"args": [ | |
[ | |
"221b6a1c074c49d5838f5aa029f63add", | |
"3838f51e694a44b1816347cec8fe9d54", | |
"3f0295800431414b84b6d3f253f442be", | |
"3f9e656f74184cb6ad04e30abc213d91", | |
"6f98921f9645445fa2984faf6dd8f50b", | |
"84ea53606c7b4ea094a2997568820ae8", | |
"96bfb611c08e4e28ba1806a0c23e72ad", | |
"9e98dca4c3c84a2ea0fea1747b5a90ff", | |
"f3f3d3bb75264390a52645aec4e26f41" | |
] | |
], | |
"kwargs": {}, | |
"methodName": "setSyncCamera", | |
"reconstruc_color_scheme": false, | |
"target": "Widget", | |
"type": "call_method" | |
} | |
], | |
"_ngl_original_stage_parameters": { | |
"ambientColor": 14540253, | |
"ambientIntensity": 0.2, | |
"backgroundColor": "white", | |
"cameraEyeSep": 0.3, | |
"cameraFov": 40, | |
"cameraType": "perspective", | |
"clipDist": 10, | |
"clipFar": 100, | |
"clipNear": 0, | |
"fogFar": 100, | |
"fogNear": 50, | |
"hoverTimeout": 0, | |
"impostor": true, | |
"lightColor": 14540253, | |
"lightIntensity": 1, | |
"mousePreset": "default", | |
"panSpeed": 1, | |
"quality": "medium", | |
"rotateSpeed": 2, | |
"sampleLevel": 0, | |
"tooltip": true, | |
"workerDefault": true, | |
"zoomSpeed": 1.2 | |
}, | |
"_ngl_repr_dict": { | |
"0": { | |
"0": { | |
"params": { | |
"aspectRatio": 1.5, | |
"assembly": "default", | |
"bondScale": 0.3, | |
"bondSpacing": 0.75, | |
"clipCenter": { | |
"x": 0, | |
"y": 0, | |
"z": 0 | |
}, | |
"clipNear": 0, | |
"clipRadius": 0, | |
"colorMode": "hcl", | |
"colorReverse": false, | |
"colorScale": "", | |
"colorScheme": "element", | |
"colorValue": 9474192, | |
"cylinderOnly": false, | |
"defaultAssembly": "", | |
"depthWrite": true, | |
"diffuse": 16777215, | |
"diffuseInterior": false, | |
"disableImpostor": false, | |
"disablePicking": false, | |
"flatShaded": false, | |
"interiorColor": 2236962, | |
"interiorDarkening": 0, | |
"lazy": false, | |
"lineOnly": false, | |
"linewidth": 2, | |
"matrix": { | |
"elements": [ | |
1, | |
0, | |
0, | |
0, | |
0, | |
1, | |
0, | |
0, | |
0, | |
0, | |
1, | |
0, | |
0, | |
0, | |
0, | |
1 | |
] | |
}, | |
"metalness": 0, | |
"multipleBond": "off", | |
"opacity": 1, | |
"openEnded": true, | |
"quality": "high", | |
"radialSegments": 20, | |
"radiusData": {}, | |
"radiusScale": 2, | |
"radiusSize": 0.15, | |
"radiusType": "size", | |
"roughness": 0.4, | |
"sele": "", | |
"side": "double", | |
"sphereDetail": 2, | |
"useInteriorColor": true, | |
"useWorker": true, | |
"visible": true, | |
"wireframe": false | |
}, | |
"type": "ball+stick" | |
} | |
} | |
}, | |
"_ngl_serialize": false, | |
"_ngl_version": "2.0.0-dev.36", | |
"_ngl_view_id": [ | |
"511F4947-E2D0-44E2-B6CB-76C27F207D3F", | |
"9B730A38-62CB-48EA-A92E-BB3FDD20661E" | |
], | |
"_player_dict": {}, | |
"_scene_position": {}, | |
"_scene_rotation": {}, | |
"_synced_model_ids": [ | |
"221b6a1c074c49d5838f5aa029f63add", | |
"3838f51e694a44b1816347cec8fe9d54", | |
"3f0295800431414b84b6d3f253f442be", | |
"3f9e656f74184cb6ad04e30abc213d91", | |
"6f98921f9645445fa2984faf6dd8f50b", | |
"84ea53606c7b4ea094a2997568820ae8", | |
"96bfb611c08e4e28ba1806a0c23e72ad", | |
"9e98dca4c3c84a2ea0fea1747b5a90ff", | |
"f3f3d3bb75264390a52645aec4e26f41" | |
], | |
"_synced_repr_model_ids": [], | |
"_view_height": "", | |
"_view_width": "", | |
"background": "white", | |
"frame": 0, | |
"gui_style": null, | |
"layout": "IPY_MODEL_45cabcdbda654faa97205461730899cb", | |
"max_frame": 0, | |
"n_components": 1, | |
"picked": {} | |
} | |
}, | |
"9ef46025309342fab18b7c9dee269024": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": { | |
"width": "34px" | |
} | |
}, | |
"9f15d31b9aea4ee5a580d62204a9ca2b": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "ButtonModel", | |
"state": { | |
"icon": "compress", | |
"layout": "IPY_MODEL_a5216cab3aa14f018ccad08fd65d4094", | |
"style": "IPY_MODEL_7757228f95ba41068cde1df1df1d8be5" | |
} | |
}, | |
"a4e7475e9cd0467daa1985774d94921f": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_89424cdfc23b4a218672983cccab885c", | |
"max" | |
], | |
"target": [ | |
"IPY_MODEL_3838f51e694a44b1816347cec8fe9d54", | |
"max_frame" | |
] | |
} | |
}, | |
"a5216cab3aa14f018ccad08fd65d4094": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": { | |
"width": "34px" | |
} | |
}, | |
"a83341a1d35e4b9386f3c58268bffebb": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_c7d5689fb98643ebb661b3f80710bc8e", | |
"max" | |
], | |
"target": [ | |
"IPY_MODEL_9e98dca4c3c84a2ea0fea1747b5a90ff", | |
"max_frame" | |
] | |
} | |
}, | |
"a8762409668f43f5a8136b2fb05a2e46": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"a98249ce8797475aa27b62eef78de501": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"ac0b685e7c6f483e8909ec645c1429c0": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"acf8f8561c4f46eba945fb5f6efc98d2": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"ada5f7f931854821ad0d929797a90e68": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"ae3e9647a7fc4934889f0958cff4e379": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_415ded3a610948a39a727094ba149620", | |
"value" | |
], | |
"target": [ | |
"IPY_MODEL_8ad8792e8da0430fa8fb32d7ead8a6eb", | |
"value" | |
] | |
} | |
}, | |
"ae656959268549679b8a8579baf64fab": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": { | |
"align_self": "stretch", | |
"grid_area": "widget005", | |
"width": "auto" | |
} | |
}, | |
"aee2c8542c464dba9ef51f0e732f2917": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"afb0b0fa21fa45ae8674208a7d718c26": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_7d02333a46264197a05d34362cb81762", | |
"value" | |
], | |
"target": [ | |
"IPY_MODEL_20cb1e66cabb41b4951cb82f6a89aafa", | |
"value" | |
] | |
} | |
}, | |
"b07ebcf83b7641c48d2d0df167cfdd03": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "HBoxModel", | |
"state": { | |
"children": [ | |
"IPY_MODEL_0badab992ef14d04a4ab5edddc7925f8", | |
"IPY_MODEL_b919e362ed944b60949f8064be4cef38" | |
], | |
"layout": "IPY_MODEL_3531613cf1b84d7daa0dce206cccde61" | |
} | |
}, | |
"b1b529ab88a5497d9c865e8b9a2ff220": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "ButtonStyleModel", | |
"state": {} | |
}, | |
"b442163450e44287a33883572ca5f0e5": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "DescriptionStyleModel", | |
"state": { | |
"description_width": "" | |
} | |
}, | |
"b4695c8d29e9420b902ad7007e321c6e": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "ButtonStyleModel", | |
"state": {} | |
}, | |
"b4bf87e7cecf4bbdbef23252c6f382e7": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"b52c4f5cfcb74b19ae93e8a45721e730": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_01da06fd55c944d99d1224e663b247d9", | |
"value" | |
], | |
"target": [ | |
"IPY_MODEL_221b6a1c074c49d5838f5aa029f63add", | |
"frame" | |
] | |
} | |
}, | |
"b8c2db184b7144019bdb3474bfeb13a6": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_7b9f27483c804e8b85e8f49acd868ad7", | |
"max" | |
], | |
"target": [ | |
"IPY_MODEL_96bfb611c08e4e28ba1806a0c23e72ad", | |
"max_frame" | |
] | |
} | |
}, | |
"b919e362ed944b60949f8064be4cef38": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "IntSliderModel", | |
"state": { | |
"layout": "IPY_MODEL_f89139a537834ffbaea126b5ccd0582e", | |
"max": 0, | |
"style": "IPY_MODEL_7ed104022485474f8a08f1671c1384cf" | |
} | |
}, | |
"bc74f43636704607a9ba25386f8fd795": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"bc9abce5200d4948ab62aeba1070bf68": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "HTMLModel", | |
"state": { | |
"layout": "IPY_MODEL_9bf693641a164d41b994d296bc121a5b", | |
"style": "IPY_MODEL_9865d4e50ccb4791bf0e5004f1661bf6", | |
"value": "100%" | |
} | |
}, | |
"bd731b9620c849d8b0cd76bd05099afa": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_eed254131ef24e5fb6a1949df1470e86", | |
"max" | |
], | |
"target": [ | |
"IPY_MODEL_221b6a1c074c49d5838f5aa029f63add", | |
"max_frame" | |
] | |
} | |
}, | |
"beb658671ac946d096a69b637c04d04d": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": { | |
"align_self": "stretch", | |
"grid_area": "widget008", | |
"width": "auto" | |
} | |
}, | |
"bfa70edc02a64d768fa054f5141a7b75": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "HBoxModel", | |
"state": { | |
"children": [ | |
"IPY_MODEL_7d02333a46264197a05d34362cb81762", | |
"IPY_MODEL_20cb1e66cabb41b4951cb82f6a89aafa" | |
], | |
"layout": "IPY_MODEL_1c1f92d51c2f452696da54f8fb46bf9c" | |
} | |
}, | |
"c164d0cf82d240b19caff016d0a28d14": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "DescriptionStyleModel", | |
"state": { | |
"description_width": "" | |
} | |
}, | |
"c5ee826f9fe446c8aad4fe5119e84e11": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "ButtonStyleModel", | |
"state": {} | |
}, | |
"c67214a2b8c64b7eaff05582e40ad398": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "DescriptionStyleModel", | |
"state": { | |
"description_width": "" | |
} | |
}, | |
"c70897dc748d4a64a36f3a25565c737a": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "HBoxModel", | |
"state": { | |
"children": [ | |
"IPY_MODEL_415ded3a610948a39a727094ba149620", | |
"IPY_MODEL_8ad8792e8da0430fa8fb32d7ead8a6eb" | |
], | |
"layout": "IPY_MODEL_cfea0d5318a545dda07a5a339403232f" | |
} | |
}, | |
"c7d5689fb98643ebb661b3f80710bc8e": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "IntSliderModel", | |
"state": { | |
"layout": "IPY_MODEL_8a52ef2b78aa452abea08fee5f6d4157", | |
"max": 0, | |
"style": "IPY_MODEL_12fc69be15194f4691e7e89a9232d6f6" | |
} | |
}, | |
"c96655388b774f1c837b9f94b9fe8f21": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "SliderStyleModel", | |
"state": { | |
"description_width": "" | |
} | |
}, | |
"cdcad421799f41a58c8a76058259ad55": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"ceb4c05e942d410eaedd8ffec68eb45f": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_b919e362ed944b60949f8064be4cef38", | |
"max" | |
], | |
"target": [ | |
"IPY_MODEL_84ea53606c7b4ea094a2997568820ae8", | |
"max_frame" | |
] | |
} | |
}, | |
"cf3e982a6aab4d9ba161175892e4f0e1": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "HBoxModel", | |
"state": { | |
"children": [ | |
"IPY_MODEL_7b9f27483c804e8b85e8f49acd868ad7", | |
"IPY_MODEL_0bb9692db7bd40a9b7ce359490667b50" | |
], | |
"layout": "IPY_MODEL_da9b2f07221f4d03917b0d0b478541fb" | |
} | |
}, | |
"cfea0d5318a545dda07a5a339403232f": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"d196d0e552a646588cfc5fb7327be5f2": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": { | |
"grid_template_areas": "\"widget001 widget002 widget003 widget004\"\n\"widget005 widget006 widget007 widget008\"\n\"widget009 . . .\"", | |
"grid_template_columns": "repeat(4, 1fr)", | |
"grid_template_rows": "repeat(3, 1fr)" | |
} | |
}, | |
"d280ee1ea0fc4007b2bccd38415d5c45": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "FloatProgressModel", | |
"state": { | |
"bar_style": "success", | |
"layout": "IPY_MODEL_59079b97a2424310818a641df4168528", | |
"max": 642, | |
"style": "IPY_MODEL_17de0ea19fb6425f88102e7c9e508e15", | |
"value": 642 | |
} | |
}, | |
"d7508743c56a4eceb065bc5f52242448": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "SliderStyleModel", | |
"state": { | |
"description_width": "" | |
} | |
}, | |
"d7c7f657260d4ec0b160142fc53835e3": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "ButtonModel", | |
"state": { | |
"icon": "compress", | |
"layout": "IPY_MODEL_6166aea759da44aba384d1aef2d5304f", | |
"style": "IPY_MODEL_17e6bbc6cc114d888d8fc1e02f3018a0" | |
} | |
}, | |
"d80f5c271ba84bc1942af6e9ef950b70": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "ButtonModel", | |
"state": { | |
"icon": "compress", | |
"layout": "IPY_MODEL_8fd508b9b4d44f60980e58e73be65ed5", | |
"style": "IPY_MODEL_c5ee826f9fe446c8aad4fe5119e84e11" | |
} | |
}, | |
"d9dfe6aecea746b8af811ca11bf72249": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "ImageModel", | |
"state": { | |
"layout": "IPY_MODEL_7484cdb1228e47518e069b789a376b71", | |
"width": "900.0" | |
} | |
}, | |
"d9e278c416704aa3bf90e9887f926d97": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "GridBoxModel", | |
"state": { | |
"children": [ | |
"IPY_MODEL_96bfb611c08e4e28ba1806a0c23e72ad", | |
"IPY_MODEL_3f0295800431414b84b6d3f253f442be", | |
"IPY_MODEL_9e98dca4c3c84a2ea0fea1747b5a90ff", | |
"IPY_MODEL_221b6a1c074c49d5838f5aa029f63add", | |
"IPY_MODEL_3f9e656f74184cb6ad04e30abc213d91", | |
"IPY_MODEL_6f98921f9645445fa2984faf6dd8f50b", | |
"IPY_MODEL_f3f3d3bb75264390a52645aec4e26f41", | |
"IPY_MODEL_84ea53606c7b4ea094a2997568820ae8", | |
"IPY_MODEL_3838f51e694a44b1816347cec8fe9d54" | |
], | |
"layout": "IPY_MODEL_d196d0e552a646588cfc5fb7327be5f2" | |
} | |
}, | |
"da9b2f07221f4d03917b0d0b478541fb": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"dc5d87b2f6fd4eb1aea14f7800c2cc2c": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "HBoxModel", | |
"state": { | |
"children": [ | |
"IPY_MODEL_bc9abce5200d4948ab62aeba1070bf68", | |
"IPY_MODEL_d280ee1ea0fc4007b2bccd38415d5c45", | |
"IPY_MODEL_195ff3aaf6dc48038137dd3430b855f3" | |
], | |
"layout": "IPY_MODEL_89577122049d4bc0b6c9b9f6152778c9" | |
} | |
}, | |
"df3b1560289147e8a7b5cfc96764bd94": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "SliderStyleModel", | |
"state": { | |
"description_width": "" | |
} | |
}, | |
"df9d73101cfa4dad915c51db3a07b243": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"e1929264c9ab48c9b8aa9dc28154390f": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_7b9f27483c804e8b85e8f49acd868ad7", | |
"value" | |
], | |
"target": [ | |
"IPY_MODEL_0bb9692db7bd40a9b7ce359490667b50", | |
"value" | |
] | |
} | |
}, | |
"e20ae870911141299bb6f8369b6045a6": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"e3e6cd7a70a442518d21b18e00fed122": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "ButtonModel", | |
"state": { | |
"icon": "compress", | |
"layout": "IPY_MODEL_186e3566750b430494e74a8cc040f12e", | |
"style": "IPY_MODEL_8076b578f45f4f40942ce05c28a88b3c" | |
} | |
}, | |
"e4cc3574fa104e2989ad689e6de07433": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": { | |
"align_self": "stretch", | |
"grid_area": "widget007", | |
"width": "auto" | |
} | |
}, | |
"e50180f678d341b4ad80bffef5c9c037": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "SliderStyleModel", | |
"state": { | |
"description_width": "" | |
} | |
}, | |
"e6cce0ea0dde4119947087fc1f5a3149": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "DescriptionStyleModel", | |
"state": { | |
"description_width": "" | |
} | |
}, | |
"e900516305b6490798d4de803e29c9de": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "DescriptionStyleModel", | |
"state": { | |
"description_width": "" | |
} | |
}, | |
"e9a61b3a1d5a497493e3669f8cdec24b": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"ed385d6e019044159f62d5a16b299576": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"eed254131ef24e5fb6a1949df1470e86": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "IntSliderModel", | |
"state": { | |
"layout": "IPY_MODEL_223634346e2b45b294e64f6421330a90", | |
"max": 0, | |
"style": "IPY_MODEL_24cef0915a5145f281e87020abf57679" | |
} | |
}, | |
"f3f3d3bb75264390a52645aec4e26f41": { | |
"model_module": "nglview-js-widgets", | |
"model_module_version": "3.0.1", | |
"model_name": "NGLModel", | |
"state": { | |
"_camera_orientation": [ | |
12.417370427684604, | |
-7.5097609088009385, | |
-8.706272047847357, | |
0, | |
1.093723224554105, | |
13.527860445426866, | |
-10.108784867329266, | |
0, | |
11.445499175944834, | |
6.854724872561955, | |
10.411535225496076, | |
0, | |
-0.21700000762939453, | |
1.0559999346733093, | |
-0.3605000078678131, | |
1 | |
], | |
"_camera_str": "orthographic", | |
"_gui_theme": null, | |
"_ibtn_fullscreen": "IPY_MODEL_20df1992cb0a4b7eb37951c944a0c194", | |
"_igui": null, | |
"_iplayer": "IPY_MODEL_3d4d986804724e3ba3a84f162853e21a", | |
"_ngl_color_dict": {}, | |
"_ngl_coordinate_resource": {}, | |
"_ngl_full_stage_parameters": { | |
"ambientColor": 14540253, | |
"ambientIntensity": 0.2, | |
"backgroundColor": "white", | |
"cameraEyeSep": 0.3, | |
"cameraFov": 40, | |
"cameraType": "perspective", | |
"clipDist": 10, | |
"clipFar": 100, | |
"clipNear": 0, | |
"fogFar": 100, | |
"fogNear": 50, | |
"hoverTimeout": 0, | |
"impostor": true, | |
"lightColor": 14540253, | |
"lightIntensity": 1, | |
"mousePreset": "default", | |
"panSpeed": 1, | |
"quality": "medium", | |
"rotateSpeed": 2, | |
"sampleLevel": 0, | |
"tooltip": true, | |
"workerDefault": true, | |
"zoomSpeed": 1.2 | |
}, | |
"_ngl_msg_archive": [ | |
{ | |
"args": [ | |
{ | |
"binary": false, | |
"data": "HETATM 1 O1 UNL 1 1.978 -1.438 -0.599 1.00 0.00 O \nHETATM 2 C1 UNL 1 1.889 -1.667 0.630 1.00 0.00 C \nHETATM 3 C2 UNL 1 2.936 -2.376 1.407 1.00 0.00 C \nHETATM 4 O2 UNL 1 0.740 -1.216 1.238 1.00 0.00 O \nHETATM 5 C3 UNL 1 -0.283 -0.548 0.589 1.00 0.00 C \nHETATM 6 C4 UNL 1 -0.384 0.801 0.427 1.00 0.00 C \nHETATM 7 C5 UNL 1 -1.444 1.397 -0.239 1.00 0.00 C \nHETATM 8 C6 UNL 1 -2.436 0.598 -0.758 1.00 0.00 C \nHETATM 9 C7 UNL 1 -2.374 -0.768 -0.618 1.00 0.00 C \nHETATM 10 C8 UNL 1 -1.290 -1.326 0.058 1.00 0.00 C \nHETATM 11 C9 UNL 1 -1.270 -2.778 0.181 1.00 0.00 C \nHETATM 12 O3 UNL 1 -2.175 -3.508 -0.293 1.00 0.00 O \nHETATM 13 O4 UNL 1 -0.227 -3.430 0.841 1.00 0.00 O \nCONECT 1 2 2\nCONECT 2 3 4\nCONECT 4 5\nCONECT 5 6 6 10\nCONECT 6 7\nCONECT 7 8 8\nCONECT 8 9\nCONECT 9 10 10\nCONECT 10 11\nCONECT 11 12 12 13\nEND\n", | |
"type": "blob" | |
} | |
], | |
"kwargs": { | |
"defaultRepresentation": false, | |
"ext": "pdb" | |
}, | |
"methodName": "loadFile", | |
"reconstruc_color_scheme": false, | |
"target": "Stage", | |
"type": "call_method" | |
}, | |
{ | |
"args": [ | |
"auto", | |
"" | |
], | |
"kwargs": {}, | |
"methodName": "setSize", | |
"reconstruc_color_scheme": false, | |
"target": "Widget", | |
"type": "call_method" | |
}, | |
{ | |
"args": [ | |
[ | |
"221b6a1c074c49d5838f5aa029f63add", | |
"3838f51e694a44b1816347cec8fe9d54", | |
"3f0295800431414b84b6d3f253f442be", | |
"3f9e656f74184cb6ad04e30abc213d91", | |
"6f98921f9645445fa2984faf6dd8f50b", | |
"84ea53606c7b4ea094a2997568820ae8", | |
"96bfb611c08e4e28ba1806a0c23e72ad", | |
"9e98dca4c3c84a2ea0fea1747b5a90ff", | |
"f3f3d3bb75264390a52645aec4e26f41" | |
] | |
], | |
"kwargs": {}, | |
"methodName": "setSyncCamera", | |
"reconstruc_color_scheme": false, | |
"target": "Widget", | |
"type": "call_method" | |
} | |
], | |
"_ngl_original_stage_parameters": { | |
"ambientColor": 14540253, | |
"ambientIntensity": 0.2, | |
"backgroundColor": "white", | |
"cameraEyeSep": 0.3, | |
"cameraFov": 40, | |
"cameraType": "perspective", | |
"clipDist": 10, | |
"clipFar": 100, | |
"clipNear": 0, | |
"fogFar": 100, | |
"fogNear": 50, | |
"hoverTimeout": 0, | |
"impostor": true, | |
"lightColor": 14540253, | |
"lightIntensity": 1, | |
"mousePreset": "default", | |
"panSpeed": 1, | |
"quality": "medium", | |
"rotateSpeed": 2, | |
"sampleLevel": 0, | |
"tooltip": true, | |
"workerDefault": true, | |
"zoomSpeed": 1.2 | |
}, | |
"_ngl_repr_dict": { | |
"0": { | |
"0": { | |
"params": { | |
"aspectRatio": 1.5, | |
"assembly": "default", | |
"bondScale": 0.3, | |
"bondSpacing": 0.75, | |
"clipCenter": { | |
"x": 0, | |
"y": 0, | |
"z": 0 | |
}, | |
"clipNear": 0, | |
"clipRadius": 0, | |
"colorMode": "hcl", | |
"colorReverse": false, | |
"colorScale": "", | |
"colorScheme": "element", | |
"colorValue": 9474192, | |
"cylinderOnly": false, | |
"defaultAssembly": "", | |
"depthWrite": true, | |
"diffuse": 16777215, | |
"diffuseInterior": false, | |
"disableImpostor": false, | |
"disablePicking": false, | |
"flatShaded": false, | |
"interiorColor": 2236962, | |
"interiorDarkening": 0, | |
"lazy": false, | |
"lineOnly": false, | |
"linewidth": 2, | |
"matrix": { | |
"elements": [ | |
1, | |
0, | |
0, | |
0, | |
0, | |
1, | |
0, | |
0, | |
0, | |
0, | |
1, | |
0, | |
0, | |
0, | |
0, | |
1 | |
] | |
}, | |
"metalness": 0, | |
"multipleBond": "off", | |
"opacity": 1, | |
"openEnded": true, | |
"quality": "high", | |
"radialSegments": 20, | |
"radiusData": {}, | |
"radiusScale": 2, | |
"radiusSize": 0.15, | |
"radiusType": "size", | |
"roughness": 0.4, | |
"sele": "", | |
"side": "double", | |
"sphereDetail": 2, | |
"useInteriorColor": true, | |
"useWorker": true, | |
"visible": true, | |
"wireframe": false | |
}, | |
"type": "ball+stick" | |
} | |
} | |
}, | |
"_ngl_serialize": false, | |
"_ngl_version": "2.0.0-dev.36", | |
"_ngl_view_id": [ | |
"48D97F17-0ADC-43C0-ADEC-C84965409B79", | |
"4A910231-97C8-4EA4-9D81-0390D706D4E4" | |
], | |
"_player_dict": {}, | |
"_scene_position": {}, | |
"_scene_rotation": {}, | |
"_synced_model_ids": [ | |
"221b6a1c074c49d5838f5aa029f63add", | |
"3838f51e694a44b1816347cec8fe9d54", | |
"3f0295800431414b84b6d3f253f442be", | |
"3f9e656f74184cb6ad04e30abc213d91", | |
"6f98921f9645445fa2984faf6dd8f50b", | |
"84ea53606c7b4ea094a2997568820ae8", | |
"96bfb611c08e4e28ba1806a0c23e72ad", | |
"9e98dca4c3c84a2ea0fea1747b5a90ff", | |
"f3f3d3bb75264390a52645aec4e26f41" | |
], | |
"_synced_repr_model_ids": [], | |
"_view_height": "", | |
"_view_width": "", | |
"background": "white", | |
"frame": 0, | |
"gui_style": null, | |
"layout": "IPY_MODEL_e4cc3574fa104e2989ad689e6de07433", | |
"max_frame": 0, | |
"n_components": 1, | |
"picked": {} | |
} | |
}, | |
"f3fe2263328d4627b07d5cc6d0fb549d": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "ImageModel", | |
"state": { | |
"layout": "IPY_MODEL_51f2c3c4a1c1459496d9396afd4f1cad", | |
"width": "900.0" | |
} | |
}, | |
"f5b86c79d785465998d6242453c0eb4e": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"f884a8753a634ef0ad7a2423c04f8e60": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"f89139a537834ffbaea126b5ccd0582e": { | |
"model_module": "@jupyter-widgets/base", | |
"model_module_version": "1.2.0", | |
"model_name": "LayoutModel", | |
"state": {} | |
}, | |
"fb0a74a1a23a4530a3c3e8c3d4d202ea": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "LinkModel", | |
"state": { | |
"source": [ | |
"IPY_MODEL_4d6e51bf404e4b9fb74fdb1f7d5a4a7e", | |
"max" | |
], | |
"target": [ | |
"IPY_MODEL_6f98921f9645445fa2984faf6dd8f50b", | |
"max_frame" | |
] | |
} | |
}, | |
"fb0aaa945a1446ebb5b185288569b594": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_module_version": "1.5.0", | |
"model_name": "IntSliderModel", | |
"state": { | |
"layout": "IPY_MODEL_3283759f5e754187849a4b5bca1ec17f", | |
"max": 0, | |
"style": "IPY_MODEL_d7508743c56a4eceb065bc5f52242448" | |
} | |
} | |
}, | |
"version_major": 2, | |
"version_minor": 0 | |
} | |
} | |
}, | |
"nbformat": 4, | |
"nbformat_minor": 5 | |
} |
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment