This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| import sys | |
| sys.path.append("/usr/local/lib/python2.7/site-packages/") | |
| from rdkit import Chem | |
| from rdkit.Chem import AllChem | |
| from rdkit.Chem import Draw | |
| from rdkit.sping import PIL | |
| filename = sys.argv[1] | |
| file = open(filename, "r+") |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| from rdkit import Chem | |
| from rdkit.Chem import AllChem | |
| parent_smiles = 'c1ccccc1' | |
| rxn_smarts_list = ['[cX3;H1:1]>>[*:1]F','[cX3;H1:1]>>[*:1]O'] | |
| molecule_substitutions = {} | |
| molecules = [] | |
| mol = Chem.MolFromSmiles(parent_smiles) | |
| molecule_substitutions[0] = [mol] | |
| molecules.append(mol) |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| from rdkit import Chem | |
| from rdkit.Chem import AllChem | |
| #reactant_smiles = "C12=CC=CC=CC1CC=C2" | |
| #reactant_smiles = "N#CC1(C#N)C2C=CC=CC=C2C=C1C3=CC=CC=C3" | |
| reactant_smiles = "N#CC1(C#N)C2C=CC=C(C=CC=C3)C3=C2C=C1C4=CC=CC=C4" | |
| reactant = Chem.MolFromSmiles(reactant_smiles) | |
| print Chem.MolToSmiles(reactant) | |
| Chem.Kekulize(reactant,clearAromaticFlags=True) |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| from rdkit import Chem | |
| from rdkit.Chem import AllChem | |
| from itertools import islice | |
| smiles_list = ['C12=CC=CC=CC1CC=C2'] | |
| #smiles_list = ['C1=CC2CC=CC2=c2ccccc2=C1'] | |
| rxn_smarts_list = ['[CX3,cX3;H1:1]~[CX3,cX3;H1:2]>>[c:1]1[c:2]cccc1'] | |
| molecules = [] | |
| mol = Chem.MolFromSmiles(smiles_list[0]) | |
| molecules.append(mol) |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| from rdkit import Chem | |
| import itertools | |
| atoms = ["C","N","O","F","Si","P","S","Cl","Br","I"] | |
| bonds = ["","=","#"] | |
| raw_smiles = [] | |
| mols = [] | |
| smiles_list = [] |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| from rdkit import Chem | |
| from rdkit.Chem import AllChem | |
| from itertools import islice | |
| raw_smiles = ['NCCN'] | |
| smiles_list = ['NCCN'] | |
| rxn_smarts_list = ['[C:1][*:2][C:3]>>[C:1]1[*:2][C:3]1','[C:1][C:2]>>[C:1][C][C:2]'] | |
| molecules = [] | |
| mol = Chem.MolFromSmiles(smiles_list[0]) |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| #!/usr/bin/env python | |
| import copy | |
| import numpy as np | |
| import matplotlib as mpl | |
| import matplotlib.pyplot as plt | |
| import matplotlib.animation as animation | |
| """ |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| import numpy as np | |
| import matplotlib.pyplot as plt | |
| from IPython.display import clear_output | |
| import time | |
| n_particles = 100 | |
| for x in range(50): | |
| clear_output(wait=True) | |
| positions_x = [np.random.random() for i in range(n_particles)] |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| from rdkit import Chem | |
| from rdkit.Chem import Draw | |
| from rdkit.Chem.Draw import IPythonConsole | |
| import string | |
| filename_smiles = "/Users/jan/Desktop/diels_alder.smiles" | |
| molecules = [] | |
| names = [] |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| from rdkit import Chem | |
| import itertools | |
| smiles = 'CNCC[NH+](C)CC(F)C' | |
| mol = Chem.MolFromSmiles(smiles) | |
| N_atoms = mol.GetSubstructMatches(Chem.MolFromSmarts('N([*])[*]')) | |
| chiral = Chem.FindMolChiralCenters(mol, includeUnassigned=True) |