I use Namecheap.com as a registrar, and they resale SSL Certs from a number of other companies, including Comodo.
These are the steps I went through to set up an SSL cert.
| (() => { | |
| const getSelector = target => { | |
| const tag = target.tagName.toLowerCase(); | |
| const classSelector = Array.from(target.classList) | |
| .map(_ => '.' + _) | |
| .join('') | |
| const idSelector = target.id ? ('#' + target.id) : ''; |
I use Namecheap.com as a registrar, and they resale SSL Certs from a number of other companies, including Comodo.
These are the steps I went through to set up an SSL cert.
Real world application with a lot of pages (or "screens") have to deal with problem managing the pages' DOM and memory efficiently and at the same provide a nice smooth transition effect between pages. This is not a real problem when you do it in native apps since Android or iOS already handle the hard work for you, but when come to JavaScript, HTML, and CSS, running on mobile browsers, this is the real challenge.
There are 2 common approaches to solve this problem:
display) to transit between pages.| (function () { | |
| String.prototype.padRight = function(l,c) {return this+Array(l-this.length+1).join(c||" ")}; | |
| // intersection | |
| const intersect = xs => ys => { | |
| const zs = createSet(ys); | |
| return filter(x => zs.has(x) | |
| ? true | |
| : false | |
| ) (xs); |
| Hòa learn to code. |
| // Fix this bug: http://bugs.mysql.com/bug.php?id=65941 | |
| // Usage: | |
| // node fix_mysqldump_single_quote_espace.js data.sql > data_fixed.sql | |
| const fs = require('fs') | |
| const file = process.argv.pop(); | |
| const inputStream = fs.createReadStream(file, 'utf-8'); | |
| const outputStream = fs.createWriteStream('output', 'utf-8'); | |
| let backslashStack = []; |
| def elem2dict(node): | |
| """ | |
| Convert an lxml.etree node tree into an object. | |
| Notice: Since the xml and object (json) structure is not the same, | |
| this utils will not work correctly if there is an xml element that | |
| contains multiple duplicate child elements. For example: | |
| <root> | |
| <name>Hello</name> | |
| <name>Is it me</name> | |
| <hello>You looking for</hello> |
| <script> | |
| var calc = function () { | |
| var value = (this instanceof Number ? +this : 0); | |
| if (!arguments.length) return value; | |
| return calc.bind(arguments[0] + value); | |
| } | |
| console.log(calc(1)(8)(3)(99)()); | |
| </script> |
| s='substring'; | |
| a=20140702230000+''; | |
| d=new Date(a[s](0,4)+'-'+a[s](4,6)+'-'+a[s](6,8)+'T'+a[s](8,10)+':'+a[s](10,12)+':'+a[s](12,14)+'.000Z'); | |
| d=(new Date(d-3600000)).toISOString().split('-').join('').split('T').join('').split(':').join('').split('.')[0]; |
| data:image/gif;base64,R0lGODlhAQABAIAAAAAAAP///yH5BAEAAAAALAAAAAABAAEAAAIBRAA7 |