Last active
          March 9, 2020 07:44 
        
      - 
      
- 
        Save Asif-Iqbal-Bhatti/7f6c90c775085d157a63198ae03085a6 to your computer and use it in GitHub Desktop. 
    Mechanical properties from Energy vs Strain curve
  
        
  
    
      This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
      Learn more about bidirectional Unicode characters
    
  
  
    
  | #!/usr/bin/env python3 | |
| ''' | |
| # | Elastic Properties | |
| # | Code for calculating mechanical properties | |
| # from Energy vs Strain relationship | |
| # | |
| # Equations can be found at Golesorkhtabar, R., Pavone, P., Spitaler, J., | |
| # Puschnig, P. & Draxl, C. ElaStic: A tool for calculating second-order elastic | |
| # constants from first principles. Comput. Phys. Commun. 184, 1861–1873 (2013). | |
| OR http://wolf.ifj.edu.pl/elastic/index.html | |
| https://www.materialsproject.org/wiki/index.php/Elasticity_calculations | |
| ''' | |
| import numpy as np | |
| import math, scipy, os, sys | |
| from numpy import linalg as LA | |
| import statistics as st | |
| import ase.io | |
| np.set_printoptions(precision=3) | |
| CRED = '\033[91m';CEND = '\033[0m' | |
| CYEL = '\033[33m'; CEND = '\033[0m' | |
| CPIN = '\033[46m'; | |
| def mechanical_properties(): | |
| # Elastic constants have been obtained from SOEC approach mentioned in the above | |
| # paper. For three distortions of the crystal three constants are extracted: | |
| # C11, C44, C12. For cubic system the matrix is symmetric. | |
| print (CRED + "Values has to be supplied in the script::" + CEND) | |
| ########################## INPUT PARAMETERS assuming cubic ####################### | |
| c11=c22=c33=123.22 ; | |
| c44=c55=c66=47 | |
| B = 120 | |
| #c12=c21=c13=c31=c23=c32=(1/6) * (9 * B - 3 * c11) | |
| c12=c21=c13=c31=c23=c32=94.22 | |
| c14=c15=c16=c24=c25=c26=c34=c35=c36=0 | |
| c45=c46=c56=0 | |
| ################################################################################ | |
| print (CRED +"{:_^80s}".format("The STIFNESS MATRIX Cij is:")+ CEND) | |
| Cij=[ [c11,c12,c13,c14,c15,c16], | |
| [c21,c22,c23,c24,c25,c26], | |
| [c31,c32,c33,c34,c35,c36], | |
| [0 ,0 ,0 ,c44,c45,c46], | |
| [0 ,0 ,0 ,0 ,c55,c56], | |
| [0 ,0 ,0 ,0 ,0 ,c66] ] | |
| Cij=np.matrix(Cij).reshape((6,6)) | |
| print (Cij) | |
| ########------------Calculate variance and Mean of the Cij ----------- | |
| # ONLY for C11 , C22 , C33 | |
| Cij_stat = [ Cij[0,0] , Cij[1,1] , Cij[2,2] ] | |
| print (">>>", (Cij_stat) ) | |
| STD = np.std(Cij_stat); Var = np.var(Cij_stat) ; Mean = np.mean(Cij_stat) | |
| print ("{:6.3s} {:6.3s} {:6.3s}".format("C", "STD", "Var") ) | |
| print ("{:6.3f} {:6.3f} {:6.3f}".format(Mean, STD/np.sqrt(3), Var) ) | |
| ######## ------------------------------------------------------------ | |
| evals, eigenvec = LA.eig(Cij) | |
| print ("-"*40) | |
| print("Eigenvalues are: ", evals>0) | |
| print ("-"*40) | |
| # ### Compliance tensor s_{ij}$ $(GPa^{-1})$ | |
| # s_{ij} = C_{ij}^{-1}$ | |
| print (CRED +"{:_^80s}".format("The COMPLIANCE MATRIX Sij is:")+ CEND) | |
| Sij = np.linalg.inv(Cij) | |
| print ("{} ".format(Sij)) | |
| print ("-"*80) | |
| ######## -----------------------------VOIGT------------------------------- | |
| '''Voigt bulk modulus (GPa)''' | |
| #9K_v = (C_{11}+C_{22}+C_{33}) + 2(C_{12} + C_{23} + C_{31}) | |
| Bv = ((Cij[0,0] + Cij[1,1] + Cij[2,2]) + 2 * (Cij[0,1] + Cij[1,2] + Cij[2,0])) / 9.0 | |
| '''Voigt shear modulus (GPa)''' | |
| #15*G_v = (C_{11}+C_{22}+C_{33}) - (C_{12} + C_{23} + C_{31}) + 3(C_{44} + C_{55} + C_{66})$ | |
| Gv = ((Cij[0,0] + Cij[1,1] + Cij[2,2]) - (Cij[0,1] + Cij[1,2] + Cij[2,0]) | |
| + 3 * (Cij[3,3] + Cij[4,4] + Cij[5,5]))/15.0 | |
| ## Young's: Voigt | |
| Ev = (9*Bv*Gv)/(3*Bv + Gv) | |
| ## Poisson's ratio: Voigt | |
| NuV = (3*Bv - Ev)/(6*Bv) | |
| ######## -----------------------------REUSS------------------------------- | |
| # Reuss bulk modulus K_R $(GPa)$ | |
| # 1/K_R = (s_{11}+s_{22}+s_{33}) + 2(s_{12} + s_{23} + s_{31})$ | |
| Br = 1/((Sij[0,0] + Sij[1,1] + Sij[2,2]) + 2*(Sij[0,1] + Sij[1,2] + Sij[2,0])) | |
| # Reuss shear modulus G_v $(GPa)$ | |
| # 15/G_R = 4*(s_{11}+s_{22}+s_{33}) - 4*(s_{12} + s_{23} + s_{31}) + 3(s_{44} + s_{55} + s_{66})$ | |
| Gr = (4 * (Sij[0,0] + Sij[1,1] + Sij[2,2]) - 4*(Sij[0,1] + Sij[1,2] + Sij[2,0]) | |
| + 3 * (Sij[3,3] + Sij[4,4] + Sij[5,5])) | |
| Gr = 15.0/Gr | |
| ## Young's: Reuss | |
| Er = (9*Br*Gr)/(3*Br + Gr) | |
| ## Poisson's ratio: Reuss | |
| NuR = (3*Br - Er)/(6*Br) | |
| ########################################################################## | |
| ######## -----------------------------Averages------------------------------- | |
| # #Hill bulk modulus K_{VRH}$ $(GPa)$ | |
| # K_{VRH} = (K_R + K_v)/2 | |
| B_H = (Bv + Br)/2 | |
| #print ("VRH bulk modulus (GPa): %20.8f " %(B_H) ) | |
| # Hill shear modulus G_{VRH}$ $(GPa)$ | |
| # G_{VRH} = (G_R + G_v)/2 | |
| G_H = (Gv + Gr)/2 | |
| #print ("VRH shear modulus (GPa): %20.8f " %(G_H) ) | |
| # Young modulus E = 9BG/(3B+G) | |
| #E_H = (9 * B_H * G_H) / (3 * B_H + G_H) | |
| E_H = (Ev + Er)/2 | |
| #print ("Young modulus E : {:1.8s} {:20.8f}".format(" ",E_H) ) | |
| # ### Isotropic Poisson ratio $\mu | |
| # $\mu = (3K_{VRH} - 2G_{VRH})/(6K_{VRH} + 2G_{VRH})$ | |
| #nu_H = (3 * B_H - 2 * G_H) / (6 * B_H + 2 * G_H ) | |
| nu_H = (NuV + NuR) / 2 | |
| #print ("Isotropic Poisson ratio: {:15.8f} ".format(nu_H) ) | |
| ## Elastic Anisotropy | |
| ## Zener anisotropy for cubic crystals only | |
| A = 2*(c44)/(c11-c12) | |
| # Universal Elastic Anisotropy AU | |
| AU = (Bv/Br) + 5*(Gv/Gr) - 6.0 | |
| # C' tetragonal shear modulus | |
| C = (c11-c12)/2 | |
| ratio_V = Bv/Gv | |
| ratio_R = Br/Gr | |
| print ("{:30.8s} {:20.8s} {:20.8s} {:20.8s}".format(" ","Voigt", "Reuss ", "Hill") ) | |
| print ("{:_^80}".format("GPa")) | |
| print ("{:16.20s} {:20.3f} {:20.3f} {:20.3f}".format("Bulk Modulus",Bv, Br, B_H) ) | |
| print ("{:16.20s} {:20.3f} {:20.3f} {:20.3f}".format("Shear Modulus",Gv, Gr, G_H) ) | |
| print ("{:16.20s} {:20.3f} {:20.3f} {:20.3f}".format("Young Modulus",Ev, Er, E_H) ) | |
| print ("{:16.20s} {:20.3f} {:20.3f} {:20.3f}".format("Poisson ratio ", NuV, NuR, nu_H) ) | |
| print ("{:16.20s} {:20.3f} {:20.3f} {:20.3f}({:5.3f})".format("B/G ratio ",Bv/Gv,Br/Gr, B_H/G_H, G_H/B_H) ) | |
| print ("{:16.20s} {:20.3s} {:20.3s} {:20.3f}".format("Avr ratio ",'','', (Gv-Gr)/(Gv+Gr)) ) | |
| print ("{:16.20s} {:20.3s} {:20.3s} {:20.3f}".format("Zener ratio ",'','', A) ) | |
| print ("{:16.20s} {:20.3s} {:20.3s} {:20.3f}".format("AU ",'','', AU) ) | |
| print ("{:16.20s} {:20.3s} {:20.3s} {:20.3f}".format("Cauchy pressure ",'','', (c12-c44)) ) | |
| print ("{:16.20s} {:20.3s} {:20.3s} {:20.3f}".format("C'tetra Shear ",'','', C) ) | |
| print ("-"*80) | |
| return Sij | |
| def elastic_anisotropy(S): | |
| #Elastic anisotropy of crystals is important since it correlates with the | |
| #possibility to induce micro-cracks in materials | |
| v=[] | |
| f = open('CONTCAR','r') | |
| lines = f.readlines() | |
| f.close() | |
| s = float(lines[1]) | |
| for i in range(2,5,1): | |
| l = s*float(lines[i].split()[0]), s*float(lines[i].split()[1]), s*float(lines[i].split()[2]) | |
| v.append( l ) | |
| v = np.mat(v) | |
| print("Reading lattice vectors into matrix form") | |
| print(v[:]) | |
| # l1, l2, l3 are the direction cosines | |
| n1 = np.linalg.norm(v[0]) | |
| n2 = np.linalg.norm(v[1]) | |
| n3 = np.linalg.norm(v[2]) | |
| l1 = math.degrees(math.acos(np.dot(v[0],np.transpose(v[1]))/(n1*n2))) | |
| l2 = math.degrees(math.acos(np.dot(v[1],np.transpose(v[2]))/(n2*n3))) | |
| l3 = math.degrees(math.acos(np.dot(v[2],np.transpose(v[0]))/(n3*n1))) | |
| print ("l's are direction Cosines:: l1={:6.6f} l2={:6.6f} l3={:6.6f}".format(l1, l2, l3) ) | |
| B = 1/(3*(S[0,0] + 2*S[0,1] )) | |
| G = 1/( S[3,3] +4*(S[0,0] - S[0,1] -1/(2*S[3,3]) ) * (l1**2 * l2**2 + l2**2 * l3**2 + l1**2 * l3**2) ) | |
| E = 1/( S[0,0] -2*(S[0,0] - S[0,1] -1/(2*S[3,3]) ) * (l1**2 * l2**2 + l2**2 * l3**2 + l1**2 * l3**2) ) | |
| print ("B={:6.6f} G={:6.6f} E={:6.6f}".format(B, G, E) ) | |
| ############ | |
| def local_lattice_distortion_DEF1(): | |
| #print ("The lattice distortion in paracrystals is measured by the lattice distortion parameter g") | |
| #print (Back.YELLOW + "Wang, S. Atomic structure modeling of multi-principal-element alloys by the principle") | |
| #print (Back.YELLOW + "of maximum entropy. Entropy 15, 5536–5548 (2013).") | |
| print (">"*10,"HUME ROTHERY RULE") | |
| C_i=C=0.2 ; r_avg = 0.0; del_sum=0.0 | |
| elements = ["Nb", "Hf", "Ta", "Ti", "Zr"] | |
| eta = { | |
| "Nb" : 1.98, | |
| "Hf" : 2.08, | |
| "Ta" : 2.00, | |
| "Ti" : 1.76, | |
| "Zr" : 2.06, } | |
| print (" {element: atomic radius}") | |
| print (eta) | |
| for i in elements: | |
| r_avg = r_avg + C * eta[i] | |
| for j in elements: | |
| del_sum = del_sum + C * ( 1 - float(eta[j]) / r_avg )**2 | |
| del_sum = 100 * np.sqrt(del_sum) | |
| print("HEA_atomic_size_mismatch: \u03B4={}".format(del_sum)) | |
| ############ | |
| def local_lattice_distortion_DEF2(): | |
| print (">"*10,"local_lattice_distortion_DEF2") | |
| print (" Song, H. et al. Local lattice distortion in high-entropy alloys.") | |
| print (" Phys. Rev. Mater. 1, 23404 (2017).") | |
| print (" (***) Different definition of the atomic radius for the description ") | |
| print (" of the local lattice distortion in HEAs") | |
| if not os.path.exists('POSCAR' and 'CONTCAR'): | |
| print ('>>> ERROR: POSCAR & CONTCAR does not exist (Both should be in the same directory)') | |
| sys.exit(0) | |
| print('Reading POSCAR and CONTCAR ... \n') | |
| x = []; y =[]; z=[] | |
| xp =[]; yp = []; zp = []; temp=0 | |
| f = open('POSCAR','r') | |
| lines_poscar = f.readlines() | |
| f.close() | |
| f = open('CONTCAR','r') | |
| lines_contcar = f.readlines() | |
| f.close() | |
| file_P = ase.io.read('POSCAR') | |
| pos = file_P.get_cell_lengths_and_angles() | |
| print (CRED + "POSCAR=>Length&Angles->{}".format(pos) + CEND) | |
| file_C = ase.io.read('CONTCAR') | |
| con = file_C.get_cell_lengths_and_angles() | |
| print (CRED + "CONTCAR=>Length&Angles->{}".format(con) + CEND) | |
| print ("Cell vectors difference:: ",con-pos) | |
| sum_atoms = lines_poscar[6].split() ### reading 7th lines for reading # of atoms | |
| sum_atoms = [int(i) for i in sum_atoms] | |
| sum_atoms = sum(sum_atoms) | |
| for i in lines_poscar: | |
| if "Direct" in i: | |
| lp=lines_poscar.index(i) | |
| for j in lines_contcar: | |
| if "Direct" in j: | |
| lc=lines_contcar.index(j) | |
| for i in range(sum_atoms): | |
| x, y, z = lines_poscar[lp+1+i].split() | |
| xc, yc, zc = lines_contcar[lp+1+i].split() | |
| x = float(x); y = float(y); z = float(z) | |
| xc = float(xc); yc = float(yc); zc = float(zc) | |
| temp = temp + np.sqrt( (x-xc)**2 + (y-yc)**2 + (z-zc)**2 ) | |
| temp = temp/sum_atoms | |
| print("local lattice distortion (LLD): \u0394d={}".format(temp)) | |
| if __name__ == "__main__": | |
| S = mechanical_properties() | |
| print ("_"*30,"Elastic Anisotropy Analysis","_"*30) | |
| elastic_anisotropy(S) | |
| print ("") | |
| print ("_"*30,"Lattice Distortion Analysis","_"*30) | |
| #local_lattice_distortion_DEF1() | |
| print ("") | |
| local_lattice_distortion_DEF2() | |
  
    Sign up for free
    to join this conversation on GitHub.
    Already have an account?
    Sign in to comment