Created
May 3, 2019 13:34
-
-
Save McPrapor/5e23cb67b486c6be22b2e632d3a5e57d to your computer and use it in GitHub Desktop.
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
m4h0n3y@troislitresdevodka:~/Desktop/bml/CIK$ adb shell dmesg | |
[ 0.000000] -(0)[0:swapper]Initializing cgroup subsys cpu | |
[ 0.000000] -(0)[0:swapper]Initializing cgroup subsys cpuacct | |
[ 0.000000] -(0)[0:swapper]Linux version 3.18.99-MiSU (root@kmtk) (gcc version 4.9.x 20150123 (prerelease) (GCC) ) #6 SMP PREEMPT Fri May 3 13:31:24 UTC 2019 | |
[ 0.000000] -(0)[0:swapper]CPU: AArch64 Processor [410fd034] revision 4 | |
[ 0.000000] -(0)[0:swapper]Detected VIPT I-cache on CPU0 | |
[ 0.000000] -(0)[0:swapper]alternative: enabling workaround for ARM erratum 845719 | |
[ 0.000000] -(0)[0:swapper][PHY layout]atf-reserved-memory@43000000 : 0x43000000 - 0x4302ffff (0x30000) | |
[ 0.000000] -(0)[0:swapper][PHY layout]reserve-memory-ccci_md1 : 0xf6000000 - 0xfd00ffff (0x7010000) | |
[ 0.000000] -(0)[0:swapper][ccci0/util]reserve_mem_of_init, rptr=0x0x00000000f6000000, rsize=0x7010000 | |
[ 0.000000] -(0)[0:swapper]Reserved memory: initialized node reserve-memory-ccci_md1, compatible id mediatek,reserve-memory-ccci_md1 | |
[ 0.000000] -(0)[0:swapper][PHY layout]consys-reserve-memory : 0xfdc00000 - 0xfdcfffff (0x100000) | |
[ 0.000000] -(0)[0:swapper][WMT-CONSYS-HW][W]reserve_memory_consys_fn: name: consys-reserve-memory, base: 0xfdc00000, size: 0x100000 | |
[ 0.000000] -(0)[0:swapper]Reserved memory: initialized node consys-reserve-memory, compatible id mediatek,consys-reserve-memory | |
[ 0.000000] -(0)[0:swapper][memblock]ram_console-reserve-memory: 0x43f00000 - 0x43f10000 (0x10000) | |
[ 0.000000] -(0)[0:swapper]Reserved memory: initialized node ram_console-reserved-memory@43f00000, compatible id mediatek,ram_console | |
[ 0.000000] -(0)[0:swapper][PHY layout]kernel : 0x40000000 - 0x42ffffff (0x3000000) | |
[ 0.000000] -(0)[0:swapper][PHY layout]kernel : 0x43030000 - 0xf5ffffff (0xb2fd0000) | |
[ 0.000000] -(0)[0:swapper][PHY layout]kernel : 0xfd010000 - 0xfdbfffff (0xbf0000) | |
[ 0.000000] -(0)[0:swapper][PHY layout]kernel : 0xfdd00000 - 0xfddbffff (0xc0000) | |
[ 0.000000] -(0)[0:swapper]On node 0 totalpages: 748672 | |
[ 0.000000] -(0)[0:swapper] DMA zone: 10633 pages used for memmap | |
[ 0.000000] -(0)[0:swapper] DMA zone: 0 pages reserved | |
[ 0.000000] -(0)[0:swapper] DMA zone: 748672 pages, LIFO batch:31 | |
[ 0.000000] -(0)[0:swapper]psci: probing for conduit method from DT. | |
[ 0.000000] -(0)[0:swapper]psci: Using PSCI v0.1 Function IDs from DT | |
[ 0.000000] -(0)[0:swapper]PERCPU: Embedded 12 pages/cpu @ffffffc0bdba0000 s19584 r0 d29568 u49152 | |
[ 0.000000] -(0)[0:swapper]pcpu-alloc: s19584 r0 d29568 u49152 alloc=12*4096 | |
[ 0.000000] -(0)[0:swapper]pcpu-alloc: [0] 0 [0] 1 [0] 2 [0] 3 [0] 4 [0] 5 [0] 6 [0] 7 | |
[ 0.000000] -(0)[0:swapper]Built 1 zonelists in Zone order, mobility grouping on. Total pages: 738039 | |
[ 0.000000] -(0)[0:swapper][cpu_ntf] <00>ffffffc00014a534 (page_alloc_cpu_notify) | |
[ 0.000000] -(0)[0:swapper]Kernel command line: console=tty0 console=ttyMT0,921600n1 root=/dev/ram vmalloc=496M androidboot.hardware=mt6735 slub_max_order=0 slub_debug=O bootopt=64S3,32N2,64N2 buildvariant=user androidboot.selinux=permissive lcm=1-hx8394f_hd720_dsi_vdo_truly_v36 fps=5601 vram=16777216 androidboot.preloader=0.00000.00001 androidboot.signkey=v36bml_dugl androidboot.mode=normal androidboot.mrdump2EXT4=0 androidboot.projectmid=2 androidboot.combineROM=1 androidboot.ram=3G bootprof.pl_t=5469 bootprof.lk_t=4267 kernelflag=0x0 debugflag=0x0 androidboot.devicerev=1 abnrst=0 radioflag=0x0 radioflagex1=0x0 radioflagex2=0x0 kmemleak=off color_ID=BLU00 androidboot.cid=HTC__034 androidboot.mid=2PVG20000 androidboot.bootloader=1.01.0000 ro.op=0 td.sf=1 td.td=1 td.ofs=328 td.prd=1 td.dly=0 td.tmo=300 androidboot.lb=1 androidboot.alarmid=0 androidboot.alarmtime=0 boot_reason=4 androidboot.serialno=HQ67BBT41578 androidboot.bootreason=wdt_by_pass_pwk gpt=1 | |
[ 0.000000] -(0)[0:swapper]PID hash table entries: 4096 (order: 3, 32768 bytes) | |
[ 0.000000] -(0)[0:swapper]Dentry cache hash table entries: 524288 (order: 10, 4194304 bytes) | |
[ 0.000000] -(0)[0:swapper]Inode-cache hash table entries: 262144 (order: 9, 2097152 bytes) | |
[ 0.000000] -(0)[0:swapper]Memory: 2921964K/2994688K available (11015K kernel code, 1261K rwdata, 3752K rodata, 356K init, 4266K bss, 72724K reserved, 0K cma-reserved) | |
[ 0.000000] -(0)[0:swapper]Virtual kernel memory layout: | |
[ 0.000000] vmalloc : 0xffffff8000000000 - 0xffffffbdffff0000 ( 247 GB) | |
[ 0.000000] vmemmap : 0xffffffbe00000000 - 0xffffffbfc0000000 ( 7 GB maximum) | |
[ 0.000000] 0xffffffbe00000000 - 0xffffffbe02988200 ( 41 MB actual) | |
[ 0.000000] PCI I/O : 0xffffffbffa000000 - 0xffffffbffb000000 ( 16 MB) | |
[ 0.000000] fixed : 0xffffffbffbdfd000 - 0xffffffbffbdff000 ( 8 KB) | |
[ 0.000000] modules : 0xffffffbffc000000 - 0xffffffc000000000 ( 64 MB) | |
[ 0.000000] memory : 0xffffffc000000000 - 0xffffffc0bddc0000 ( 3037 MB) | |
[ 0.000000] .init : 0xffffffc000ef7000 - 0xffffffc000f50000 ( 356 KB) | |
[ 0.000000] .text : 0xffffffc000080000 - 0xffffffc000b42ed0 ( 11020 KB) | |
[ 0.000000] .data : 0xffffffc000f63000 - 0xffffffc00109e730 ( 1262 KB) | |
[ 0.000000] -(0)[0:swapper][cpu_ntf] <00>ffffffc00017fa38 (slab_cpuup_callback) | |
[ 0.000000] -(0)[0:swapper]SLUB: HWalign=64, Order=0-0, MinObjects=0, CPUs=8, Nodes=1 | |
[ 0.000000] -(0)[0:swapper/0][cpu_ntf] <00>ffffffc0000d4028 (sched_ilb_notifier) | |
[ 0.000000] -(0)[0:swapper/0]Preemptible hierarchical RCU implementation. | |
[ 0.000000] -(0)[0:swapper/0] CONFIG_RCU_FANOUT set to non-default value of 32 | |
[ 0.000000] -(0)[0:swapper/0][cpu_ntf] <00>ffffffc0000fef50 (rcu_cpu_notify) | |
[ 0.000000] -(0)[0:swapper/0][cpu_ntf] <00>ffffffc0003543c0 (radix_tree_callback) | |
[ 0.000000] -(0)[0:swapper/0]NR_IRQS:64 nr_irqs:64 0 | |
[ 0.000000] -(0)[0:swapper/0][cpu_ntf] <00>ffffffc00037e244 (gic_secondary_init) | |
[ 0.000000] -(0)[0:swapper/0][cpu_ntf] <00>ffffffc0001048c4 (timer_cpu_notify) | |
[ 0.000000] -(0)[0:swapper/0][cpu_ntf] <00>ffffffc000106d5c (hrtimer_cpu_notify) | |
[ 0.000000] -(0)[0:swapper/0]cpuxgpt_r.start = 0x10200000 | |
[ 0.000000] -(0)[0:swapper/0]mt_gpt_init: tmr_regs=0xffffff800000a000, tmr_irq=184, freq=13000000 | |
[ 0.000000] -(0)[0:swapper/0]gpt_devs_init: base_addr=0xffffff800000a010 | |
[ 0.000000] -(0)[0:swapper/0]gpt_devs_init: base_addr=0xffffff800000a020 | |
[ 0.000000] -(0)[0:swapper/0]gpt_devs_init: base_addr=0xffffff800000a030 | |
[ 0.000000] -(0)[0:swapper/0]gpt_devs_init: base_addr=0xffffff800000a040 | |
[ 0.000000] -(0)[0:swapper/0]gpt_devs_init: base_addr=0xffffff800000a050 | |
[ 0.000000] -(0)[0:swapper/0]gpt_devs_init: base_addr=0xffffff800000a060 | |
[ 0.000000] -(0)[0:swapper/0]setup_clksrc1: dev->base_addr=0xffffff800000a020 GPT2_CON=0x0 | |
[ 0.000000] -(0)[0:swapper/0]sched_clock: 32 bits at 13MHz, resolution 76ns, wraps every 330382100403ns | |
[ 0.000007] -(0)[0:swapper/0]setup_clksrc1: mt_cyclecounter.mult=0x99d89d8a mt_cyclecounter.shift=0x19 | |
[ 0.000017] -(0)[0:swapper/0]setup_clksrc2: dev->base_addr=0xffffff800000a020 GPT2_CON=0x31 | |
[ 0.000039] -(0)[0:swapper/0]GPT1_CMP = 43333, HZ = 300 | |
[ 0.000103] -(0)[0:swapper/0]cpuxgpt_r.start = 0x10200000 | |
[ 0.000118] -(0)[0:swapper/0]mt_gpt_init: get_cnt_GPT2=1489 | |
[ 0.000158] -(0)[0:swapper/0]arch_timer_init:arch_timer_rate(0xc65d40),PHYS_SECURE_PPI=29,PHYS_NONSECURE_PPI=30,VIRT_PPI=27,HYP_PPI=26 | |
[ 0.000169] -(0)[0:swapper/0]arch_timer_register:arch_timer_rate(0xc65d40),arch_timer_use_virtual=0 | |
[ 0.000185] -(0)[0:swapper/0]arch_timer_register:request_percpu_irq PHYS_SECURE_PPI err=0 | |
[ 0.000195] -(0)[0:swapper/0]arch_timer_register:request_percpu_irq PHYS_NONSECURE_PPI err=0 | |
[ 0.000209] -(0)[0:swapper/0][cpu_ntf] <00>ffffffc000406054 (arch_timer_cpu_notify) | |
[ 0.000453] -(0)[0:swapper/0]Architected cp15 timer(s) running at 13.00MHz (phys). | |
[ 0.001108] -(0)[0:swapper/0][cpu_ntf] <00>ffffffc00011a7b0 (hotplug_cfd) | |
[ 0.085643] (0)[0:swapper/0]console [ttyMT0] enabled | |
[ 0.086314] (0)[0:swapper/0]ram_console: buffer start: 0xffffff800001c000, size: 0x10000 | |
[ 0.095137] (0)[0:swapper/0]Calibrating delay loop (skipped), value calculated using timer frequency.. 26.08 BogoMIPS (lpj=43333) | |
[ 0.096407] (0)[0:swapper/0]pid_max: default: 32768 minimum: 301 | |
[ 0.097328] (0)[0:swapper/0][cpu_ntf] <00>ffffffc0001bb2c0 (buffer_cpu_notify) | |
[ 0.098284] (0)[0:swapper/0]Security Framework initialized | |
[ 0.099021] (0)[0:swapper/0]SELinux: Initializing. | |
[ 0.099712] (0)[0:swapper/0]SELinux: Starting in permissive mode | |
[ 0.099721] (0)[0:swapper/0]Yama: becoming mindful. | |
[ 0.100489] (0)[0:swapper/0]Mount-cache hash table entries: 8192 (order: 4, 65536 bytes) | |
[ 0.101590] (0)[0:swapper/0]Mountpoint-cache hash table entries: 8192 (order: 4, 65536 bytes) | |
[ 0.103308] (0)[0:swapper/0][cpu_ntf] <00>ffffffc000150280 (ratelimit_handler) | |
[ 0.104719] (0)[0:swapper/0]Initializing cgroup subsys freezer | |
[ 0.105494] (0)[0:swapper/0]Initializing cgroup subsys bfqio | |
[ 0.106260] (0)[0:swapper/0]Initializing cgroup subsys debug | |
[ 0.107065] (0)[0:swapper/0][cpu_ntf] <00>ffffffc0000a5b14 (smpboot_thread_call) | |
[ 0.108286] (0)[1:swapper/0]CPU0: update cpu_capacity 1024 | |
[ 0.109198] (0)[1:swapper/0]hw perfevents: enabled with arm/armv8-pmuv3 PMU driver, 7 counters available | |
[ 0.110462] (0)[1:swapper/0][cpu_ntf] <00>ffffffc0000a8fec (cpu_callback) | |
[ 0.113811] (0)[1:swapper/0][cpu_ntf] <00>ffffffc0000bf3ec (workqueue_cpu_up_callback) | |
[ 0.114835] (0)[1:swapper/0][cpu_ntf] <00>ffffffc0000bf738 (workqueue_cpu_down_callback) | |
[ 0.116522] (0)[1:swapper/0][cpu_ntf] <00>ffffffc0000cf888 (migration_call) | |
[ 0.117440] (0)[1:swapper/0][cpu_ntf] <00>ffffffc0000cab38 (sched_cpu_active) | |
[ 0.118365] (0)[1:swapper/0][cpu_ntf] <00>ffffffc0000cd6b4 (sched_cpu_inactive) | |
[ 0.129584] (0)[1:swapper/0]BOOTPROF: 129.572230: ON | |
[ 0.130504] (0)[1:swapper/0]init_get_max_DRAM_size done. phone_dram_sz: 0xc0000000, kernel_mem_sz: 0xbddc0000 | |
[ 0.135427] -(0)[1:swapper/0]SCHED: intersects new_mask: 2, cpu_active_mask: 1 | |
[ 0.135611] -(0)[1:swapper/0]SCHED: intersects new_mask: 2, cpu_active_mask: 1 | |
[ 0.135864] -(1)[0:swapper/1]CPU1: Booted secondary processor | |
[ 0.135873] -(1)[0:swapper/1]Detected VIPT I-cache on CPU1 | |
[ 0.135915] -(1)[0:swapper/1]CPU1: update cpu_capacity 1024 | |
[ 0.136413] -(0)[1:swapper/0]SCHED: intersects new_mask: 4, cpu_active_mask: 3 | |
[ 0.136565] -(0)[1:swapper/0]SCHED: intersects new_mask: 4, cpu_active_mask: 3 | |
[ 0.136792] -(2)[0:swapper/2]CPU2: Booted secondary processor | |
[ 0.136800] -(2)[0:swapper/2]Detected VIPT I-cache on CPU2 | |
[ 0.136834] -(2)[0:swapper/2]CPU2: update cpu_capacity 1024 | |
[ 0.137312] -(2)[1:swapper/0]SCHED: intersects new_mask: 8, cpu_active_mask: 7 | |
[ 0.137460] -(2)[1:swapper/0]SCHED: intersects new_mask: 8, cpu_active_mask: 7 | |
[ 0.137687] -(3)[0:swapper/3]CPU3: Booted secondary processor | |
[ 0.137695] -(3)[0:swapper/3]Detected VIPT I-cache on CPU3 | |
[ 0.137727] -(3)[0:swapper/3]CPU3: update cpu_capacity 1024 | |
[ 0.138175] -(2)[1:swapper/0]SCHED: intersects new_mask: 16, cpu_active_mask: 15 | |
[ 0.138332] -(2)[1:swapper/0]SCHED: intersects new_mask: 16, cpu_active_mask: 15 | |
[ 0.138595] -(4)[0:swapper/4]CPU4: Booted secondary processor | |
[ 0.138604] -(4)[0:swapper/4]Detected VIPT I-cache on CPU4 | |
[ 0.138646] -(4)[0:swapper/4]CPU4: update cpu_capacity 1024 | |
[ 0.155072] -(2)[1:swapper/0]SCHED: intersects new_mask: 32, cpu_active_mask: 31 | |
[ 0.155221] -(2)[1:swapper/0]SCHED: intersects new_mask: 32, cpu_active_mask: 31 | |
[ 0.155459] -(5)[0:swapper/5]CPU5: Booted secondary processor | |
[ 0.155467] -(5)[0:swapper/5]Detected VIPT I-cache on CPU5 | |
[ 0.155499] -(5)[0:swapper/5]CPU5: update cpu_capacity 1024 | |
[ 0.155965] -(2)[1:swapper/0]SCHED: intersects new_mask: 64, cpu_active_mask: 63 | |
[ 0.156114] -(2)[1:swapper/0]SCHED: intersects new_mask: 64, cpu_active_mask: 63 | |
[ 0.156352] -(6)[0:swapper/6]CPU6: Booted secondary processor | |
[ 0.156360] -(6)[0:swapper/6]Detected VIPT I-cache on CPU6 | |
[ 0.156392] -(6)[0:swapper/6]CPU6: update cpu_capacity 1024 | |
[ 0.156955] -(4)[1:swapper/0]SCHED: intersects new_mask: 128, cpu_active_mask: 127 | |
[ 0.157119] -(4)[1:swapper/0]SCHED: intersects new_mask: 128, cpu_active_mask: 127 | |
[ 0.157368] -(7)[0:swapper/7]CPU7: Booted secondary processor | |
[ 0.157377] -(7)[0:swapper/7]Detected VIPT I-cache on CPU7 | |
[ 0.157415] -(7)[0:swapper/7]CPU7: update cpu_capacity 1024 | |
[ 0.157514] (4)[1:swapper/0]Brought up 8 CPUs | |
[ 0.170439] (4)[1:swapper/0]SMP: Total of 8 processors activated (208.66 BogoMIPS). | |
[ 0.171497] -(0)[10:migration/0][name:alternative&]alternatives: patching kernel code | |
[ 0.173054] (4)[1:swapper/0][cpu_ntf] <00>ffffffc0000c8c74 (sched_domains_numa_masks_update) | |
[ 0.174167] (4)[1:swapper/0][cpu_ntf] <00>ffffffc0000d16f8 (cpuset_cpu_active) | |
[ 0.175104] (4)[1:swapper/0][cpu_ntf] <00>ffffffc0000d1768 (cpuset_cpu_inactive) | |
[ 0.176071] (4)[1:swapper/0][cpu_ntf] <00>ffffffc0000c97a8 (hotplug_hrtick) | |
[ 0.177502] (0)[1:swapper/0][cpu_ntf] <00>ffffffc0003bdaac (device_hotplug_notifier) | |
[ 0.189843] (0)[1:swapper/0][debug]DRAM size (dt) : 0x40000000 - 0x9fffffff (0x60000000) | |
[ 0.190913] (0)[1:swapper/0][debug]DRAM size (dt) : 0xa0000000 - 0xfddbffff (0x5ddc0000) | |
[ 0.192001] (0)[1:swapper/0][debug]orig_dram rank[0] : 0x40000000 - 0x9fffffff (0x60000000) | |
[ 0.193124] (0)[1:swapper/0][debug]orig_dram rank[1] : 0xa0000000 - 0xffffffff (0x60000000) | |
[ 0.194255] (0)[1:swapper/0][debug]mblock[0][r0] : 0x40000000 - 0x9fffffff (0x60000000) | |
[ 0.195335] (0)[1:swapper/0][debug]mblock[1][r1] : 0xa0000000 - 0xfddbffff (0x5ddc0000) | |
[ 0.196407] (0)[1:swapper/0][PHY layout]tee_reserved_mem : 0xfedc0000 - 0xffffffff (0x1240000) | |
[ 0.197571] (0)[1:swapper/0][debug]available DRAM size = 0xbddc0000 | |
[ 0.197571] [PHY layout]FB (dt) : 0xfddc0000 - 0xfedbffff (0x1000000) | |
[ 0.199271] (0)[1:swapper/0] | |
[ 0.199271] register_restart_handler- 0xffffffc00149a930, Notify call: - 0xffffffc00084c8c8 | |
[ 0.200777] (1)[1:swapper/0]ARCH_RESET register mtk_restart_handler ok!!!! | |
[ 0.203834] (3)[1:swapper/0]pinctrl core: initialized pinctrl subsystem | |
[ 0.205082] (3)[1:swapper/0]regulator-dummy: no parameters | |
[ 0.224646] (0)[1:swapper/0]BOOTPROF: 224.638153:of_init 18404154 ns | |
[ 0.227470] (0)[1:swapper/0]ramoops: using module parameters | |
[ 0.228343] (0)[1:swapper/0]ramoops: pstore:address is 0x43f10000, size is 0xe0000, console_size is 0x10000, pmsg_size is 0x10000 | |
[ 0.239649] (1)[1:swapper/0]console [pstore-1] enabled | |
[ 0.240463] (0)[1:swapper/0]pstore: Registered ramoops as persistent store backend | |
[ 0.241445] (0)[1:swapper/0]ramoops: attached 0xe0000@0x43f10000, ecc: 0/0 | |
[ 0.242638] (0)[1:swapper/0][PWRAP] mt_pwrap_init | |
[ 0.243639] (2)[1:swapper/0]PWRAP reg: 0xffffff80001c6000, irq: 195 | |
[ 0.244467] (2)[1:swapper/0][PWRAP] real init: version Revision | |
[ 0.245247] (2)[1:swapper/0][PWRAP] mt_pwrap_init---- debug1 | |
[ 0.246223] (2)[1:swapper/0][PWRAP] is_pwrap_init_done 1 | |
[ 0.246955] (2)[1:swapper/0][PWRAP] after MT6328 pwrap_write | |
[ 0.247704] (2)[1:swapper/0][PWRAP] mt_pwrap_init---- | |
[ 0.248430] (3)[1:swapper/0][GPIO] 575: GPIO base addr is 0xffffff80001cc000, get_gpio_vbase_early | |
[ 0.249752] (1)[1:swapper/0][DRAMC]get CQDMA_BASE_ADDR @ ffffff80001d0c00 | |
[ 0.250699] (1)[1:swapper/0][DRAMC]get DRAMCAO_BASE_ADDR @ ffffff80001ce000 | |
[ 0.251630] (1)[1:swapper/0][DRAMC]get DDRPHY_BASE_ADDR @ ffffff80001d4000 | |
[ 0.252549] (1)[1:swapper/0][DRAMC]get DRAMCNAO_BASE_ADDR @ ffffff80001d6000 | |
[ 0.253672] (0)[1:swapper/0][DFS] enable (dram base, dram rank1 base): (0x0000000040000000,0x00000000a0000000) | |
[ 0.254969] (0)[1:swapper/0][DRAMC]find dt_scan_dram_info | |
[ 0.255753] (0)[1:swapper/0][DRAMC Driver] Dram Data Rate = 1466 | |
[ 0.256538] (0)[1:swapper/0][DRAMC Driver] dram can support Frequency Hopping | |
[ 0.257767] (0)[1:swapper/0]mtk_wdt_init ok | |
[ 0.270858] (0)[1:swapper/0]cpuidle: using governor ladder | |
[ 0.284211] (0)[1:swapper/0]cpuidle: using governor menu | |
[ 0.297564] (0)[1:swapper/0]cpuidle: using governor mtk_governor | |
[ 0.299703] (0)[1:swapper/0]vdso: 2 pages (1 code @ ffffffc000f6a000, 1 data @ ffffffc000f69000) | |
[ 0.300877] (0)[1:swapper/0]hw-breakpoint: found 6 breakpoint and 4 watchpoint registers. | |
[ 0.306354] (0)[1:swapper/0]software IO TLB [mem 0xf3000000-0xf3400000] (4MB) mapped at [ffffffc0b3000000-ffffffc0b33fffff] | |
[ 0.308218] (0)[1:swapper/0]DMA: preallocated 256 KiB pool for atomic allocations | |
[ 0.309288] (0)[1:swapper/0]success to create gic debug driver | |
[ 0.310055] (0)[1:swapper/0]success to create dump_irq sysfs files | |
[ 0.311080] (0)[1:swapper/0][EIC] no builtin_entry property | |
[ 0.313681] (0)[1:swapper/0][SPM] find SCP_I2C0 node failed | |
[ 0.314411] (0)[1:swapper/0][SPM] base scp_i2c0_base failed | |
[ 0.315320] (0)[1:swapper/0][SPM] find SCP_I2C1 node failed | |
[ 0.316062] (0)[1:swapper/0][SPM] base scp_i2c1_base failed | |
[ 0.316953] (0)[1:swapper/0][SPM] find SCP_I2C2 node failed | |
[ 0.317681] (0)[1:swapper/0][SPM] base scp_i2c2_base failed | |
[ 0.318421] (0)[1:swapper/0][SPM] spm_base = ffffff8000248000, scp_i2c0_base = (null), scp_i2c1_base = (null), scp_i2c2_base = (null) | |
[ 0.320297] (0)[1:swapper/0][SPM] spm_irq_0 = 197, spm_irq_1 = 198, spm_irq_2 = 199, spm_irq_3 = 200 | |
[ 0.321963] -(3)[1:swapper/0][Power/cpufreq] [WARNING]pmic table not initialized | |
[ 0.322954] -(3)[1:swapper/0][SPM] [VcoreFS] SLEEP_DVFS_STA: 0x202 | |
[ 0.323748] -(3)[1:swapper/0][SPM] [VcoreFS] PCM_SRC_REQ : 0x2 | |
[ 0.324529] -(3)[1:swapper/0][SPM] [VcoreFS] PCM_REG13_DATA: 0x20041038 | |
[ 0.325386] -(3)[1:swapper/0][SPM] [VcoreFS] PCM_REG12_DATA: 0x0 | |
[ 0.326167] -(3)[1:swapper/0][SPM] [VcoreFS] PCM_REG12_MASK: 0x801001 | |
[ 0.327002] -(3)[1:swapper/0][SPM] [VcoreFS] AP_STANBY_CON : 0x24000000 | |
[ 0.327860] -(3)[1:swapper/0][SPM] [VcoreFS] PCM_IM_PTR : 0x40ba7298 (285) | |
[ 0.328781] -(3)[1:swapper/0][SPM] [VcoreFS] PCM_REG6_DATA : 0x1000100 | |
[ 0.329626] -(3)[1:swapper/0][SPM] [VcoreFS] PCM_REG11_DATA: 0x0 | |
[ 0.330407] -(3)[1:swapper/0][SPM] [VcoreFS] PCM_REG0_DATA : 0x0 | |
[ 0.331188] -(3)[1:swapper/0][SPM] [VcoreFS] PCM_REG1_DATA : 0x1 | |
[ 0.331969] -(3)[1:swapper/0][SPM] [VcoreFS] PCM_REG2_DATA : 0x0 | |
[ 0.332750] -(3)[1:swapper/0][SPM] [VcoreFS] PCM_REG3_DATA : 0x801001 | |
[ 0.333586] -(3)[1:swapper/0][SPM] [VcoreFS] PCM_REG4_DATA : 0x202 | |
[ 0.334388] -(3)[1:swapper/0][SPM] [VcoreFS] PCM_REG5_DATA : 0x1 | |
[ 0.335169] -(3)[1:swapper/0][SPM] [VcoreFS] PCM_REG7_DATA : 0x60015830 | |
[ 0.336026] -(3)[1:swapper/0][SPM] [VcoreFS] PCM_REG8_DATA : 0x10006608 | |
[ 0.336883] -(3)[1:swapper/0][SPM] [VcoreFS] PCM_REG9_DATA : 0x0 | |
[ 0.337664] -(3)[1:swapper/0][SPM] [VcoreFS] PCM_REG10_DATA: 0x0 | |
[ 0.338445] -(3)[1:swapper/0][SPM] [VcoreFS] PCM_REG14_DATA: 0x90100000 | |
[ 0.339302] -(3)[1:swapper/0][SPM] [VcoreFS] PCM_REG15_DATA: 42 | |
[ 0.340072] -(3)[1:swapper/0][SPM] [VcoreFS] STA: 0x202, REQ: 0x2 | |
[ 0.341885] (2)[1:swapper/0][Power/clkmgr] [mt_subsys_init]SYS_MD1, change state: (1->0) | |
[ 0.343396] (2)[1:swapper/0][Power/clkmgr] [00][CG_INFRA]=[0x0000008a] | |
[ 0.344277] (0)[1:swapper/0][Power/clkmgr] [01][CG_PERI ]=[0x7fc1fffc] | |
[ 0.345129] (0)[1:swapper/0][Power/clkmgr] [02][CG_DISP0]=[0xfff96bfc][0xfff96bfc] | |
[ 0.346114] (0)[1:swapper/0][Power/clkmgr] [03][CG_DISP1]=[0xfffffff3] | |
[ 0.346971] (0)[1:swapper/0][Power/clkmgr] [04][CG_IMAGE]=[0x00000fff] | |
[ 0.347839] (0)[1:swapper/0][Power/clkmgr] [05][CG_MFG ]=[0x00000001] | |
[ 0.348688] (0)[1:swapper/0][Power/clkmgr] [06][CG_AUDIO]=[0x0f0c0344] | |
[ 0.349546] (0)[1:swapper/0][Power/clkmgr] [07][CG_VDEC0]=[0x00000010][0x00000010] | |
[ 0.350532] (0)[1:swapper/0][Power/clkmgr] [08][CG_VDEC1]=[0x00000000][0x00000000] | |
[ 0.351527] (0)[1:swapper/0][Power/clkmgr] [09][CG_VENC ]=[0x00000000] | |
[ 0.352376] (0)[1:swapper/0]mt_clkmgr_init: CLKMGR_INCFILE_VER=CLKMGR_INCFILE_D3_LEGACY | |
[ 0.353468] (0)[1:swapper/0]BOOTPROF: 353.462769:mt_power_management_init 40577539 ns | |
[ 0.354605] (1)[1:swapper/0][PTP] [PTP][VCORE] - Kernel Got from DT (0x5A, 0x58, 0x0, 0x0) | |
[ 0.355848] (1)[1:swapper/0]### CIRQ init done. ### | |
[ 0.356542] (1)[1:swapper/0]Register the disp driver | |
[ 0.358106] (1)[1:swapper/0][DISP]init_log_buffer success | |
[ 0.358998] (1)[1:swapper/0][HTC DTB] CONFIG DATA: | |
[ 0.359634] (1)[1:swapper/0][HTC DTB] DEBUG_FLAG_INDEX: 0x00000000 | |
[ 0.360444] (1)[1:swapper/0][HTC DTB] KERNEL_FLAG_INDEX: 0x00000000 | |
[ 0.361312] (2)[1:swapper/0][HTC DTB] BOOTLOADER_FLAG_INDEX: 0x00000000 | |
[ 0.362192] (0)[1:swapper/0][HTC DTB] RADIO_FLAG_INDEX: 0x00000000 | |
[ 0.362999] (0)[1:swapper/0][HTC DTB] RADIO_FLAG_EX1_INDEX: 0x00000000 | |
[ 0.363855] (0)[1:swapper/0][HTC DTB] RADIO_FLAG_EX2_INDEX: 0x00000000 | |
[ 0.364720] (0)[1:swapper/0][HTC DTB] SKU DATA: | |
[ 0.365333] (0)[1:swapper/0][HTC DTB] sku (index:00000000, value:0004A204) added | |
[ 0.366291] (0)[1:swapper/0][HTC DTB] sku (index:00000001, value:800101FF) added | |
[ 0.367256] (0)[1:swapper/0][HTC DTB] sku (index:00000002, value:020000D4) added | |
[ 0.368241] (3)[1:swapper/0][HTC DTB] sku (index:00000003, value:06034010) added | |
[ 0.369200] (3)[1:swapper/0][HTC DTB] sku (index:00000004, value:00000136) added | |
[ 0.370165] (3)[1:swapper/0][HTC DTB] sku (index:00000005, value:051001BF) added | |
[ 0.371139] (3)[1:swapper/0][HTC DTB] sku (index:00000006, value:FFFFFFFF) added | |
[ 0.372116] (1)[1:swapper/0][HTC DTB] sku (index:00000007, value:FFFFFFFF) added | |
[ 0.373075] (1)[1:swapper/0][HTC DTB] sku (index:00000008, value:FFFFFFFF) added | |
[ 0.374039] (1)[1:swapper/0][HTC DTB] sku (index:00000009, value:FFFFFFFF) added | |
[ 0.375029] (2)[1:swapper/0][HTC DTB] sku (index:0000000A, value:E7B8FD03) added | |
[ 0.376004] (0)[1:swapper/0][HTC DTB] sku (index:0000000B, value:00000000) added | |
[ 0.376971] (0)[1:swapper/0][HTC DTB] hwid: 128 | |
[ 0.377575] (0)[1:swapper/0][HTC DTB] bomid: 1 | |
[ 0.378172] (0)[1:swapper/0][HTC DTB] sku1: 0x800101FF | |
[ 0.378859] (0)[1:swapper/0][HTC DTB] boot mode: normal | |
[ 0.379551] (0)[1:swapper/0]BOOTPROF: 379.546307:htc_devices_dtb_init 20569384 ns | |
[ 0.380633] (0)[1:swapper/0]chenlifeng:devices_sysfs_init | |
[ 0.381380] (3)[1:swapper/0]create main_devices sucesss1111 | |
[ 0.385136] (1)[1:swapper/0]******** MTK WDT driver probe!! ******** | |
[ 0.398602] (1)[1:swapper/0]mt6735 pinctrl probe | |
[ 0.399217] (1)[1:swapper/0]mtk_pctrl_init++++++ | |
[ 0.407514] (0)[1:swapper/0]BOOTPROF: 407.506384:arm64_device_init 26864077 ns | |
[ 0.426973] (1)[1:swapper/0]BOOTPROF: 426.965077:param_sysfs_init 16412307 ns | |
[ 0.442022] (2)[1:swapper/0][cpu_ntf] <00>ffffffc00032e030 (blk_cpu_notify) | |
[ 0.442945] (2)[1:swapper/0][cpu_ntf] <00>ffffffc00032e5c0 (blk_iopoll_cpu_notify) | |
[ 0.443937] (2)[1:swapper/0][cpu_ntf] <00>ffffffc000334514 (blk_mq_main_cpu_notify) | |
[ 0.444946] (2)[1:swapper/0][cpu_ntf] <00>ffffffc0003316f8 (blk_mq_queue_reinit_notify) | |
[ 0.446894] (2)[1:swapper/0]M4Um4u_probe 2, of_iomap: 0xffffff8000288000, irq_num: 178, pDev: ffffffc003371890 | |
[ 0.448284] (2)[1:swapper/0]M4U4G DRAM Mode is: 0 | |
[ 0.449294] (2)[1:swapper/0]M4Urequest_irq, irq_num=178 | |
[ 0.449989] (2)[1:swapper/0]M4Uconfig_port:MDP_RDMA,v1,s0 | |
[ 0.450704] (2)[1:swapper/0]M4Uconfig_port:MDP_WDMA,v1,s0 | |
[ 0.451419] (2)[1:swapper/0]M4Uconfig_port:MDP_WROT,v1,s0 | |
[ 0.452422] (2)[1:swapper/0]MMP: MMProfileEnable(): enable: 1 | |
[ 0.453184] (2)[1:swapper/0]MMP: MMProfileForceStart(): start: 1 | |
[ 0.471450] (0)[1:swapper/0]BOOTPROF: 471.440769:MTK_M4U_Init 25009230 ns | |
[ 0.472456] (0)[1:swapper/0][GPIO] version: mt-gpio | |
[ 0.473226] (0)[1:swapper/0][GPIO] 556: GPIO base addr is 0xffffff80001cc000, get_gpio_vbase | |
[ 0.474336] (0)[1:swapper/0][GPIO] Registering GPIO device | |
[ 0.475877] (1)[1:swapper/0][CMDQ][CMDQ] platform_dev: dev: ffffffc0032f0890, PA: 10217000, VA: ffffff80002a0000, irqId: 183, irqSecId:180 | |
[ 0.477478] (1)[1:swapper/0][CMDQ]set dma mask result: 0 | |
[ 0.478319] (3)[1:swapper/0][CMDQ]DEV: VA(mediatek,mmsys_config): 0xffffff80002a2000 | |
[ 0.479391] (3)[1:swapper/0][CMDQ]DEV: VA(mediatek,mdp_rdma): 0xffffff80002a4000 | |
[ 0.480416] (3)[1:swapper/0][CMDQ]DEV: VA(mediatek,mdp_rsz0): 0xffffff80002a6000 | |
[ 0.481454] (3)[1:swapper/0][CMDQ]DEV: VA(mediatek,mdp_rsz1): 0xffffff80002a8000 | |
[ 0.482522] (0)[1:swapper/0][CMDQ]DEV: VA(mediatek,mdp_wdma): 0xffffff80002aa000 | |
[ 0.483553] (0)[1:swapper/0][CMDQ]DEV: VA(mediatek,mdp_wrot): 0xffffff80002ac000 | |
[ 0.484579] (0)[1:swapper/0][CMDQ]DEV: VA(mediatek,mdp_tdshp): 0xffffff80002ae000 | |
[ 0.485823] (0)[1:swapper/0][CMDQ]DEV: VA(mediatek,VENC): 0x0 | |
[ 0.487740] (0)[1:swapper/0][CMDQ][ERR]DEV: init mm_mutex PA fail!! | |
[ 0.490961] (0)[1:swapper/0]MMP: MMProfileEnable(): enable: 1 | |
[ 0.491767] (3)[1:swapper/0]MMP: MMProfileForceStart(): start: 1 | |
[ 0.493252] (3)[1:swapper/0]BOOTPROF: 493.246769:cmdq_init 17609924 ns | |
[ 0.494521] (3)[1:swapper/0][Power/clkmgr] register_larb_monitor | |
[ 0.495729] (2)[1:swapper/0][ccci0/util]ccci_util_fo_init 0. | |
[ 0.496764] (2)[1:swapper/0][ccci0/util]using v1. | |
[ 0.497397] (2)[1:swapper/0][ccci0/util]Get MD info Tags | |
[ 0.498093] (2)[1:swapper/0][ccci0/util]md_inf[0]=0 | |
[ 0.498744] (2)[1:swapper/0][ccci0/util]md_inf[1]=0 | |
[ 0.499423] (0)[1:swapper/0][ccci0/util]md_inf[2]=0 | |
[ 0.500066] (0)[1:swapper/0][ccci0/util]md_inf[3]=0 | |
[ 0.500717] (0)[1:swapper/0][ccci0/util]META MD setting not found [0][0] | |
[ 0.501598] (0)[1:swapper/0][ccci0/util]FO:MTK_ENABLE_MD1 -> 00000001 | |
[ 0.502443] (0)[1:swapper/0][ccci0/util]FO:MTK_MD1_SUPPORT -> 00000005 | |
[ 0.503432] (0)[1:swapper/0][ccci1/util]md1 modem_total_size=0x7010000,md_size=0x7000000, smem_size=0x10000 | |
[ 0.504684] (0)[1:swapper/0][ccci1/util]MemStart: 0x0x00000000f6000000, MemSize:0x07000000 | |
[ 0.505778] (1)[1:swapper/0][ccci1/util]SMemStart: 0x0x00000000fd000000, SMemSize:0x00010000 | |
[ 0.506868] (1)[1:swapper/0][ccci0/util]FO:MTK_ENABLE_MD2 -> 00000000 | |
[ 0.507712] (1)[1:swapper/0][ccci2/util]md2 is disabled | |
[ 0.508407] (1)[1:swapper/0][ccci0/util]FO:MTK_ENABLE_MD3 -> 00000000 | |
[ 0.509262] (1)[1:swapper/0][ccci3/util]md3 is disabled | |
[ 0.509968] (2)[1:swapper/0][ccci0/util]FO:MTK_ENABLE_MD4 not found | |
[ 0.510784] (2)[1:swapper/0][ccci4/util]md4 is disabled | |
[ 0.511479] (2)[1:swapper/0][ccci0/util]FO:MTK_ENABLE_MD5 -> 00000000 | |
[ 0.512324] (2)[1:swapper/0][ccci5/util]md5 is disabled | |
[ 0.513028] (2)[1:swapper/0][ccci0/util]ccci_util_fo_init 2. | |
[ 0.513850] (0)[1:swapper/0][ccci0/util]ccci attr cnt 6 | |
[ 0.514545] (0)[1:swapper/0]BOOTPROF: 514.540308:ccci_util_init 18809308 ns | |
[ 0.515544] (0)[1:swapper/0][md0]ccci core init | |
[ 0.516449] (0)[1:swapper/0][md0]MTU=3456/1500, pool size 256/256/64/576 | |
[ 0.523484] (4)[1:swapper/0][md0]infra_ao_base:0xffffff80002ba000 | |
[ 0.524457] (4)[1:swapper/0][md0]dbgapb_base:0xffffff80002bc000 | |
[ 0.525402] (4)[1:swapper/0][md0]MD1_SIM3_HOT_PLUG_EINT: node 2 no found | |
[ 0.526326] (4)[1:swapper/0][md0]MD1_SIM4_HOT_PLUG_EINT: node 3 no found | |
[ 0.527196] (4)[1:swapper/0][md0]node 4 is NULL | |
[ 0.527824] (4)[1:swapper/0][CONN-MD-DFT][I]conn_md_init:init message queue list succeed | |
[ 0.528888] (4)[1:swapper/0][CONN-MD-DFT][I]conn_md_init:init active queue list succeed | |
[ 0.529922] (4)[1:swapper/0][CONN-MD-DFT][I]conn_md_init:init user information list succeed | |
[ 0.531075] (4)[1:swapper/0][CONN_MD_DMP][I]conn_md_dmp_init:alloc memory for msg log system done, size:0x00000430 | |
[ 0.532413] (4)[1:swapper/0][CONN-MD-DFT][I]conn_md_init:conn_md_dmp_init succeed | |
[ 0.533553] (0)[1:swapper/0][CONN-MD-DFT][I]conn_md_init:create conn_md_thread succeed, wakeup it | |
[ 0.535231] (0)[1:swapper/0]SCSI subsystem initialized | |
[ 0.536063] (0)[1:swapper/0]usbcore: registered new interface driver usbfs | |
[ 0.537005] (0)[1:swapper/0]usbcore: registered new interface driver hub | |
[ 0.538028] (0)[1:swapper/0]usbcore: registered new device driver usb | |
[ 0.539719] (0)[1:swapper/0]Advanced Linux Sound Architecture Driver Initialized. | |
[ 0.541256] (0)[1:swapper/0][cpu_ntf] <00>ffffffc000993f3c (dev_cpu_callback) | |
[ 0.542641] (0)[1:swapper/0]------------[ cut here ]------------ | |
[ 0.543432] (0)[1:swapper/0]WARNING: CPU: 0 PID: 1 at ../net/wireless/reg.c:511 regulatory_init+0x9c/0x158() | |
[ 0.544693] -(0)[1:swapper/0]db.txt is empty, you should update it... | |
[ 0.545297] -(0)[1:swapper/0]CPU: 0 PID: 1 Comm: swapper/0 Not tainted 3.18.99-MiSU #6 | |
[ 0.546332] -(0)[1:swapper/0]Hardware name: MT6753 (DT) | |
[ 0.547016] -(0)[1:swapper/0]Call trace: | |
[ 0.547542] -(0)[1:swapper/0][<ffffffc00008a830>] dump_backtrace+0x0/0x178 | |
[ 0.548429] -(0)[1:swapper/0][<ffffffc00008a9bc>] show_stack+0x14/0x1c | |
[ 0.549275] -(0)[1:swapper/0][<ffffffc000b34168>] dump_stack+0x88/0xac | |
[ 0.550122] -(0)[1:swapper/0][<ffffffc0000a5894>] warn_slowpath_fmt+0xcc/0x134 | |
[ 0.551053] -(0)[1:swapper/0][<ffffffc000f36930>] regulatory_init+0x9c/0x158 | |
[ 0.551964] -(0)[1:swapper/0][<ffffffc000f36820>] cfg80211_init+0x74/0xe8 | |
[ 0.552845] -(0)[1:swapper/0][<ffffffc000ef7d04>] do_one_initcall+0x1f8/0x214 | |
[ 0.553766] -(0)[1:swapper/0][<ffffffc000ef7e68>] kernel_init_freeable+0x148/0x1e8 | |
[ 0.554742] -(0)[1:swapper/0][<ffffffc000b2f4ec>] kernel_init+0x18/0x140 | |
[ 0.555630] (0)[1:swapper/0]---[ end trace 9ddbe3f2e878ff36 ]--- | |
[ 0.556590] (0)[4:kworker/0:0]cfg80211: Calling CRDA to update world regulatory domain | |
[ 0.559089] (1)[1:swapper/0]Switched to clocksource mt6735-gpt | |
[ 0.561652] (1)[1:swapper/0][PMIC] pmic_regulator_init_OF | |
[ 0.562739] (1)[1:swapper/0][PMIC] Get car_tune_value from cust header | |
[ 0.563603] (1)[1:swapper/0] pimix=170 | |
[ 0.564103] (1)[1:swapper/0][PMIC] ******** MT pmic driver probe!! ********170 | |
[ 0.565056] (1)[1:swapper/0][PMIC] [PMIC_INIT_SETTING_V1] delay to MT6311 init | |
[ 0.566160] (4)[1:swapper/0][PMIC] [pmic_thread_kthread_mt6325] kthread_create Done | |
[ 0.566197] (0)[69:pmic_thread][PMIC] [PMIC_INT] enter | |
[ 0.566202] (0)[69:pmic_thread][PMIC] [pmic_enable_charger_detection_int] PMIC | |
[ 0.566206] (0)[69:pmic_thread][PMIC] [pmic_enable_charger_detection_int] pmic_rdy=1 usb_rdy=0 | |
[ 0.566212] (0)[69:pmic_thread][PMIC] [PMIC_INT] pwrap_eint_status=0x1 | |
[ 0.566223] (0)[69:pmic_thread][PMIC] [PMIC_INT] addr[0x2c4]=0x0 | |
[ 0.566232] (0)[69:pmic_thread][PMIC] [PMIC_INT] addr[0x2c6]=0x0 | |
[ 0.566241] (0)[69:pmic_thread][PMIC] [PMIC_INT] addr[0x2c8]=0x53 | |
[ 0.566246] (0)[69:pmic_thread][PMIC] [PMIC_INT][RG_INT_STATUS_OV] | |
[ 0.566257] (0)[69:pmic_thread][PMIC] [PMIC_INT][RG_INT_STATUS_BVALID_DET] | |
[ 0.566269] (0)[69:pmic_thread][PMIC] [PMIC_INT][RG_INT_STATUS_WATCHDOG] | |
[ 0.566280] (0)[69:pmic_thread][PMIC] [PMIC_INT][RG_INT_STATUS_CHRDET] | |
[ 0.566293] (0)[69:pmic_thread][PWRAP] clear EINT flag mt_pmic_wrap_eint_status=0x0 | |
[ 0.566302] (0)[69:pmic_thread][PMIC] [PMIC_INT] after ,int_status_val[0x2c4]=0x0 | |
[ 0.566311] (0)[69:pmic_thread][PMIC] [PMIC_INT] after ,int_status_val[0x2c6]=0x0 | |
[ 0.566320] (0)[69:pmic_thread][PMIC] [PMIC_INT] after ,int_status_val[0x2c8]=0x2 | |
[ 0.580570] (4)[1:swapper/0][PMIC] [pmic_register_interrupt_callback] intno=0 | |
[ 0.581504] (4)[1:swapper/0][PMIC] [pmic_register_interrupt_callback] intno=1 | |
[ 0.582459] (4)[1:swapper/0][PMIC] [pmic_register_interrupt_callback] intno=2 | |
[ 0.583394] (4)[1:swapper/0][PMIC] [pmic_register_interrupt_callback] intno=3 | |
[ 0.584337] (4)[1:swapper/0][PMIC] [pmic_register_interrupt_callback] intno=6 | |
[ 0.585281] (4)[1:swapper/0][PMIC] [pmic_register_interrupt_callback] intno=7 | |
[ 0.586236] (4)[1:swapper/0][PMIC] [pmic_register_interrupt_callback] intno=38 | |
[ 0.587181] (4)[1:swapper/0][PMIC] [pmic_register_interrupt_callback] intno=42 | |
[ 0.588135] (4)[1:swapper/0][PMIC] [pmic_register_interrupt_callback] intno=43 | |
[ 0.589109] (4)[1:swapper/0][PMIC] [pmic_enable_interrupt] intno=0 en=1 str=PMIC shf=0 no=0 [0x2ac]=0xf | |
[ 0.590339] (4)[1:swapper/0][PMIC] [pmic_enable_interrupt] after [0x2ac]=0xf | |
[ 0.591270] (4)[1:swapper/0][PMIC] [pmic_enable_interrupt] intno=1 en=1 str=PMIC shf=0 no=1 [0x2ac]=0xf | |
[ 0.592512] (4)[1:swapper/0][PMIC] [pmic_enable_interrupt] after [0x2ac]=0xf | |
[ 0.593443] (4)[1:swapper/0][PMIC] [pmic_enable_interrupt] intno=2 en=1 str=PMIC shf=0 no=2 [0x2ac]=0xf | |
[ 0.594673] (4)[1:swapper/0][PMIC] [pmic_enable_interrupt] after [0x2ac]=0xf | |
[ 0.595604] (4)[1:swapper/0][PMIC] [pmic_enable_interrupt] intno=3 en=1 str=PMIC shf=0 no=3 [0x2ac]=0xf | |
[ 0.596846] (4)[1:swapper/0][PMIC] [pmic_enable_interrupt] after [0x2ac]=0xf | |
[ 0.597777] (4)[1:swapper/0][PMIC] [pmic_enable_interrupt] intno=38 en=1 str=PMIC shf=2 no=6 [0x2b8]=0x0 | |
[ 0.599019] (4)[1:swapper/0][PMIC] [pmic_enable_interrupt] after [0x2b8]=0x40 | |
[ 0.600247] (4)[1:swapper/0][PMIC] [CUST_EINT] CUST_EINT_MT_PMIC_MT6325_NUM=206 | |
[ 0.601194] (4)[1:swapper/0][PMIC] [CUST_EINT] CUST_EINT_PMIC_DEBOUNCE_CN=1 | |
[ 0.602104] (4)[1:swapper/0][PMIC] [CUST_EINT] CUST_EINT_PMIC_TYPE=4 | |
[ 0.602960] (4)[1:swapper/0][PMIC] [CUST_EINT] CUST_EINT_PMIC_DEBOUNCE_EN=1 | |
[ 0.603862] (4)[1:swapper/0][PMIC] [PMIC_EINT_SETTING] Done | |
[ 0.605019] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel bugl(name=VAUD28 id=0 en_reg=4f9 vol_reg=0) | |
[ 0.606264] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VAUD28 id=0 en_reg=4f9 vol_reg=0 reg/sel:0 voltage:0 [0x0]=0x9) | |
[ 0.607771] (4)[1:swapper/0][PMIC] regulator_enable(name=VAUD28 id=0 en_reg=4f9 vol_reg=0) [a04]=0xc102 | |
[ 0.609375] (4)[1:swapper/0]vaud28: 2800 mV | |
[ 0.609944] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel bugl(name=VAUD28 id=0 en_reg=4f9 vol_reg=0) | |
[ 0.611171] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VAUD28 id=0 en_reg=4f9 vol_reg=0 reg/sel:0 voltage:0 [0x0]=0x9) | |
[ 0.612793] (4)[1:swapper/0][PMIC] [regulator_register] pass to register VAUD28 | |
[ 0.613742] (4)[1:swapper/0][PMIC] [PMIC]mtk_ldos[3].config.init_data min_uv:2800000 max_uv:2800000 | |
[ 0.615021] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel bugl(name=VCN28 id=0 en_reg=527 vol_reg=0) | |
[ 0.616251] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VCN28 id=0 en_reg=527 vol_reg=0 reg/sel:0 voltage:0 [0x0]=0x9) | |
[ 0.617733] (4)[1:swapper/0]vcn28: 2800 mV | |
[ 0.618294] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel bugl(name=VCN28 id=0 en_reg=527 vol_reg=0) | |
[ 0.619523] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VCN28 id=0 en_reg=527 vol_reg=0 reg/sel:0 voltage:0 [0x0]=0x9) | |
[ 0.621084] (4)[1:swapper/0][PMIC] [regulator_register] pass to register VCN28 | |
[ 0.622021] (4)[1:swapper/0][PMIC] [PMIC]mtk_ldos[4].config.init_data min_uv:2800000 max_uv:2800000 | |
[ 0.623309] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VCAMA id=0 en_reg=520 vol_reg=63a reg/sel:3 voltage:2800000 [0xa0c]=0x100) | |
[ 0.624919] (4)[1:swapper/0]vcama: 1500 <--> 2800 mV at 2800 mV | |
[ 0.625723] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VCAMA id=0 en_reg=520 vol_reg=63a reg/sel:3 voltage:2800000 [0xa0c]=0x100) | |
[ 0.627411] (4)[1:swapper/0][PMIC] [regulator_register] pass to register VCAMA | |
[ 0.628348] (4)[1:swapper/0][PMIC] [PMIC]mtk_ldos[5].config.init_data min_uv:1500000 max_uv:2800000 | |
[ 0.629629] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VCN33_BT id=0 en_reg=53e vol_reg=63d reg/sel:0 voltage:3300000 [0xa14]=0x0) | |
[ 0.631250] (4)[1:swapper/0]vcn33_bt: 3300 <--> 3600 mV at 3300 mV | |
[ 0.632085] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VCN33_BT id=0 en_reg=53e vol_reg=63d reg/sel:0 voltage:3300000 [0xa14]=0x0) | |
[ 0.633798] (4)[1:swapper/0][PMIC] [regulator_register] pass to register VCN33_BT | |
[ 0.634767] (4)[1:swapper/0][PMIC] [PMIC]mtk_ldos[6].config.init_data min_uv:3300000 max_uv:3600000 | |
[ 0.636054] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VCN33_WIFI id=0 en_reg=53b vol_reg=63d reg/sel:0 voltage:3300000 [0xa12]=0x0) | |
[ 0.637697] (4)[1:swapper/0]vcn33_wifi: 3300 <--> 3600 mV at 3300 mV | |
[ 0.638555] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VCN33_WIFI id=0 en_reg=53b vol_reg=63d reg/sel:0 voltage:3300000 [0xa12]=0x0) | |
[ 0.640282] (4)[1:swapper/0][PMIC] [regulator_register] pass to register VCN33_WIFI | |
[ 0.641273] (4)[1:swapper/0][PMIC] [PMIC]mtk_ldos[7].config.init_data min_uv:3300000 max_uv:3600000 | |
[ 0.642549] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel bugl(name=VUSB33 id=0 en_reg=551 vol_reg=0) | |
[ 0.643770] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VUSB33 id=0 en_reg=551 vol_reg=0 reg/sel:0 voltage:0 [0x0]=0x9) | |
[ 0.645280] (4)[1:swapper/0][PMIC] regulator_enable(name=VUSB33 id=0 en_reg=551 vol_reg=0) [a1a]=0xc102 | |
[ 0.646895] (4)[1:swapper/0]vusb33: 3300 mV | |
[ 0.647464] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel bugl(name=VUSB33 id=0 en_reg=551 vol_reg=0) | |
[ 0.648690] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VUSB33 id=0 en_reg=551 vol_reg=0 reg/sel:0 voltage:0 [0x0]=0x9) | |
[ 0.650299] (4)[1:swapper/0][PMIC] [regulator_register] pass to register VUSB33 | |
[ 0.651247] (4)[1:swapper/0][PMIC] [PMIC]mtk_ldos[8].config.init_data min_uv:3300000 max_uv:3300000 | |
[ 0.652539] (4)[1:swapper/0][PMIC] regulator_enable(name=VEMC_3V3 id=0 en_reg=57d vol_reg=64b) [a24]=0xc102 | |
[ 0.654196] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VEMC_3V3 id=0 en_reg=57d vol_reg=64b reg/sel:2 voltage:3000000 [0xa24]=0xc102) | |
[ 0.655868] (4)[1:swapper/0]vemc_3v3: 1800 <--> 3300 mV at 3000 mV | |
[ 0.656698] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VEMC_3V3 id=0 en_reg=57d vol_reg=64b reg/sel:2 voltage:3000000 [0xa24]=0xc102) | |
[ 0.658430] (4)[1:swapper/0][PMIC] [regulator_register] pass to register VEMC_3V3 | |
[ 0.659415] (4)[1:swapper/0][PMIC] [PMIC]mtk_ldos[12].config.init_data min_uv:1800000 max_uv:3300000 | |
[ 0.660702] (4)[1:swapper/0][PMIC] regulator_enable(name=VMCH id=0 en_reg=55d vol_reg=64e) [a1c]=0xc102 | |
[ 0.662095] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VMCH id=0 en_reg=55d vol_reg=64e reg/sel:0 voltage:2900000 [0xa1c]=0xc102) | |
[ 0.663724] (4)[1:swapper/0]vmch: 2900 <--> 3300 mV at 2900 mV | |
[ 0.664510] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VMCH id=0 en_reg=55d vol_reg=64e reg/sel:0 voltage:2900000 [0xa1c]=0xc102) | |
[ 0.666218] (4)[1:swapper/0][PMIC] [regulator_register] pass to register VMCH | |
[ 0.667144] (4)[1:swapper/0][PMIC] [PMIC]mtk_ldos[13].config.init_data min_uv:2900000 max_uv:3300000 | |
[ 0.668432] (4)[1:swapper/0][PMIC] regulator_enable(name=VMC id=0 en_reg=56c vol_reg=653) [a20]=0xc102 | |
[ 0.669831] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VMC id=0 en_reg=56c vol_reg=653 reg/sel:1 voltage:2900000 [0xa20]=0xc102) | |
[ 0.671431] (4)[1:swapper/0]vmc: 1800 <--> 3300 mV at 2900 mV | |
[ 0.672213] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VMC id=0 en_reg=56c vol_reg=653 reg/sel:1 voltage:2900000 [0xa20]=0xc102) | |
[ 0.673896] (4)[1:swapper/0][PMIC] [regulator_register] pass to register VMC | |
[ 0.674811] (4)[1:swapper/0][PMIC] [PMIC]mtk_ldos[15].config.init_data min_uv:1800000 max_uv:3300000 | |
[ 0.676114] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VCAMAF id=0 en_reg=598 vol_reg=656 reg/sel:5 voltage:2800000 [0xa2a]=0x120) | |
[ 0.677735] (4)[1:swapper/0]vcamaf: 1200 <--> 3300 mV at 2800 mV | |
[ 0.678549] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VCAMAF id=0 en_reg=598 vol_reg=656 reg/sel:5 voltage:2800000 [0xa2a]=0x120) | |
[ 0.680265] (4)[1:swapper/0][PMIC] [regulator_register] pass to register VCAMAF | |
[ 0.681212] (4)[1:swapper/0][PMIC] [PMIC]mtk_ldos[16].config.init_data min_uv:1200000 max_uv:3300000 | |
[ 0.682523] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VGP1 id=0 en_reg=5a2 vol_reg=65e reg/sel:3 voltage:1800000 [0xa2c]=0xc102) | |
[ 0.684133] (4)[1:swapper/0]vgp1: 1200 <--> 3300 mV at 1800 mV | |
[ 0.684925] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VGP1 id=0 en_reg=5a2 vol_reg=65e reg/sel:3 voltage:1800000 [0xa2c]=0xc102) | |
[ 0.686626] (4)[1:swapper/0][PMIC] [regulator_register] pass to register VGP1 | |
[ 0.687552] (4)[1:swapper/0][PMIC] [PMIC]mtk_ldos[18].config.init_data min_uv:1200000 max_uv:3300000 | |
[ 0.688840] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VIBR id=0 en_reg=5df vol_reg=659 reg/sel:5 voltage:2800000 [0xa38]=0x100) | |
[ 0.690457] (4)[1:swapper/0]vibr: 1200 <--> 3300 mV at 2800 mV | |
[ 0.691243] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VIBR id=0 en_reg=5df vol_reg=659 reg/sel:5 voltage:2800000 [0xa38]=0x100) | |
[ 0.692930] (4)[1:swapper/0][PMIC] [regulator_register] pass to register VIBR | |
[ 0.693856] (4)[1:swapper/0][PMIC] [PMIC]mtk_ldos[19].config.init_data min_uv:1200000 max_uv:3300000 | |
[ 0.695136] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VCAMD id=0 en_reg=5f6 vol_reg=666 reg/sel:4 voltage:1300000 [0xa3c]=0x100) | |
[ 0.696763] (4)[1:swapper/0]vcamd: 900 <--> 1500 mV at 1300 mV | |
[ 0.697549] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VCAMD id=0 en_reg=5f6 vol_reg=666 reg/sel:4 voltage:1300000 [0xa3c]=0x100) | |
[ 0.699241] (4)[1:swapper/0][PMIC] [regulator_register] pass to register VCAMD | |
[ 0.700178] (4)[1:swapper/0][PMIC] [PMIC]mtk_ldos[20].config.init_data min_uv:900000 max_uv:1500000 | |
[ 0.701438] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel bugl(name=VCN18 id=0 en_reg=5ea vol_reg=0) | |
[ 0.702666] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VCN18 id=0 en_reg=5ea vol_reg=0 reg/sel:0 voltage:0 [0x0]=0x9) | |
[ 0.704146] (4)[1:swapper/0]vcn18: 1800 mV | |
[ 0.704709] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel bugl(name=VCN18 id=0 en_reg=5ea vol_reg=0) | |
[ 0.705937] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VCN18 id=0 en_reg=5ea vol_reg=0 reg/sel:0 voltage:0 [0x0]=0x9) | |
[ 0.707494] (4)[1:swapper/0][PMIC] [regulator_register] pass to register VCN18 | |
[ 0.708431] (4)[1:swapper/0][PMIC] [PMIC]mtk_ldos[24].config.init_data min_uv:1800000 max_uv:1800000 | |
[ 0.709725] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VCAMIO id=0 en_reg=600 vol_reg=672 reg/sel:3 voltage:1800000 [0xa3e]=0x100) | |
[ 0.711346] (4)[1:swapper/0]vcamio: 1200 <--> 1800 mV at 1800 mV | |
[ 0.712160] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VCAMIO id=0 en_reg=600 vol_reg=672 reg/sel:3 voltage:1800000 [0xa3e]=0x100) | |
[ 0.713856] (4)[1:swapper/0][PMIC] [regulator_register] pass to register VCAMIO | |
[ 0.714804] (4)[1:swapper/0][PMIC] [PMIC]mtk_ldos[25].config.init_data min_uv:1200000 max_uv:1800000 | |
[ 0.716101] (4)[1:swapper/0][PMIC] regulator_enable(name=VSRAM id=0 en_reg=60a vol_reg=677) [a40]=0xc102 | |
[ 0.717679] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VSRAM id=0 en_reg=60a vol_reg=677 reg/sel:104 voltage:1350000 [0x0]=0x9) | |
[ 0.719286] (4)[1:swapper/0]vsram: 700 <--> 1493 mV at 1350 mV | |
[ 0.720067] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VSRAM id=0 en_reg=60a vol_reg=677 reg/sel:104 voltage:1350000 [0x0]=0x9) | |
[ 0.721747] (4)[1:swapper/0][PMIC] [regulator_register] pass to register VSRAM | |
[ 0.722699] (4)[1:swapper/0][PMIC] [PMIC]mtk_ldos[26].config.init_data min_uv:700000 max_uv:1493750 | |
[ 0.723984] (4)[1:swapper/0][PMIC] regulator_enable(name=VM id=0 en_reg=61f vol_reg=663) [a46]=0xc102 | |
[ 0.725577] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VM id=0 en_reg=61f vol_reg=663 reg/sel:0 voltage:1240000 [0xa46]=0xc102) | |
[ 0.727184] (4)[1:swapper/0]vm: 1240 <--> 1540 mV at 1240 mV | |
[ 0.727948] (4)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VM id=0 en_reg=61f vol_reg=663 reg/sel:0 voltage:1240000 [0xa46]=0xc102) | |
[ 0.729627] (4)[1:swapper/0][PMIC] [regulator_register] pass to register VM | |
[ 0.730532] (4)[1:swapper/0][PMIC] [PMIC]mtk_ldos[27].config.init_data min_uv:1240000 max_uv:1540000 | |
[ 0.731817] (4)[1:swapper/0]Reg[0xec2]=0x8a12, Reg[0xec4]=0xb9a1, Reg[0x2ac]=0x8f | |
[ 0.732800] (4)[1:swapper/0][low_battery_protect_init] 3400 mV, 3250 mV, 3000 mV | |
[ 0.733756] (4)[1:swapper/0][PMIC] [low_battery_protect_init] Done | |
[ 0.734614] (4)[1:swapper/0]Reg[0xcd2]=0xc8a5, Reg[0xcd4]=0xbecf, Reg[0x2b8]=0x840 | |
[ 0.735593] (4)[1:swapper/0][battery_oc_protect_init] 4670 mA, 5500 mA | |
[ 0.736460] (4)[1:swapper/0][PMIC] [battery_oc_protect_init] Done | |
[ 0.737417] (0)[1:swapper/0]Create bat_percent_notify_thread : done | |
[ 0.738379] (4)[1:swapper/0]Create dlpt_notify_thread : done | |
[ 0.739165] (4)[1:swapper/0]POWER_UVLO_VOLT_LEVEL=2600, [0xf6a]=0x2 | |
[ 0.740007] (4)[1:swapper/0][PMIC] [PMIC] auxadc 26M test : Reg[0xe94]=0x8014, Reg[0x28a]=0x8102 | |
[ 0.741170] (4)[1:swapper/0][PMIC] proc_create pmic_debug_proc_fops | |
[ 0.741990] (4)[1:swapper/0][PMIC] proc_create pmic_dump_register_proc_fops | |
[ 0.742911] (4)[1:swapper/0][PMIC] [PMIC] pmic_debug_init : done. | |
[ 0.743826] (4)[1:swapper/0][PMIC] [pmic_ftm_init] Done | |
[ 0.744949] (4)[1:swapper/0][PMIC] [PMIC] device_create_file for EM : done. | |
[ 0.746336] (4)[1:swapper/0]BOOTPROF: 746.329693:pmic_mt_init 184677231 ns | |
[ 0.747893] (4)[1:swapper/0][MUSB]mt_usb_dts_probe 1524: first_connect, check_delay_done to 0 | |
[ 0.748995] (4)[1:swapper/0][MUSB]mt_usb_dts_probe 1528: set musb_connect_legacy to 0 | |
[ 0.750046] (4)[1:swapper/0][MUSB]mt_usb_dts_probe 1530: init connection_work | |
[ 0.750972] (4)[1:swapper/0][MUSB]mt_usb_dts_probe 1532: keep musb->power & mtk_usb_power in the samae value | |
[ 0.752777] (4)[1:swapper/0][MUSB]mt_usb_probe 1492: USB probe done! | |
[ 0.754201] (0)[1:swapper/0][ION]ion_init() | |
[ 0.755021] (0)[1:swapper/0][ION]ion_drv_probe() heap_nr=4 | |
[ 0.756247] (0)[1:swapper/0][ION]ion_sec_heap_create error: not support | |
[ 0.757111] (0)[1:swapper/0]ion_mtk_heap_create: error creating heap ion_sec_heap type 13 base 0 size 0 | |
[ 0.758690] (4)[1:swapper/0]MMP: MMProfileEnable(): enable: 1 | |
[ 0.759505] (4)[1:swapper/0]MMP: MMProfileForceStart(): start: 1 | |
[ 0.761778] (4)[1:swapper/0]TCP established hash table entries: 32768 (order: 6, 262144 bytes) | |
[ 0.763761] (4)[1:swapper/0]TCP bind hash table entries: 32768 (order: 7, 524288 bytes) | |
[ 0.765495] (4)[1:swapper/0]TCP: Hash tables configured (established 32768 bind 32768) | |
[ 0.766715] (4)[1:swapper/0]TCP: reno registered | |
[ 0.767390] (4)[1:swapper/0]UDP hash table entries: 2048 (order: 4, 65536 bytes) | |
[ 0.768515] (4)[1:swapper/0]UDP-Lite hash table entries: 2048 (order: 4, 65536 bytes) | |
[ 0.770497] (4)[1:swapper/0]Unpacking initramfs... | |
[ 1.322579] (0)[1:swapper/0]Freeing initrd memory: 792K | |
[ 1.323289] (0)[1:swapper/0]BOOTPROF: 1323.283540:populate_rootfs 553229847 ns | |
[ 1.325653] (0)[1:swapper/0][cpu_ntf] <00>ffffffc00009302c (cpu_pmu_notify) | |
[ 1.332547] (4)[1:swapper/0]futex hash table entries: 2048 (order: 5, 131072 bytes) | |
[ 1.333647] (4)[1:swapper/0]audit: initializing netlink subsys (disabled) | |
[ 1.334649] (4)[1:swapper/0]audit: type=2000 audit(1.266:1): initialized | |
[ 1.336114] (0)[1:swapper/0][cpu_ntf] <00>ffffffc000154dc4 (cpu_callback) | |
[ 1.350594] (4)[1:swapper/0]VFS: Disk quotas dquot_6.5.2 | |
[ 1.351485] (4)[1:swapper/0]Dquot-cache hash table entries: 512 (order 0, 4096 bytes) | |
[ 1.353828] (4)[1:swapper/0]exFAT: Version 1.2.9 | |
[ 1.357489] (0)[1:swapper/0]Registering sdcardfs 0.1 | |
[ 1.358793] (0)[1:swapper/0]fuse init (API version 7.23) | |
[ 1.361584] (0)[1:swapper/0]SELinux: Registering netfilter hooks | |
[ 1.365043] (0)[1:swapper/0]io scheduler noop registered | |
[ 1.365773] (0)[1:swapper/0]io scheduler deadline registered | |
[ 1.366667] (0)[1:swapper/0]io scheduler row registered | |
[ 1.367626] (0)[1:swapper/0]io scheduler cfq registered | |
[ 1.368581] (0)[1:swapper/0]io scheduler bfq registered (default) | |
[ 1.369391] (0)[1:swapper/0]BFQ I/O-scheduler: v7r8 | |
[ 1.369861] (0)[1:swapper/0][cpu_ntf] <00>ffffffc000375dd8 (percpu_counter_hotcpu_callback) | |
[ 1.371011] (0)[1:swapper/0]sysctl duplicate entry: /kernel/pty//max | |
[ 1.371624] -(0)[1:swapper/0]CPU: 0 PID: 1 Comm: swapper/0 Tainted: G W 3.18.99-MiSU #6 | |
[ 1.372779] -(0)[1:swapper/0]Hardware name: MT6753 (DT) | |
[ 1.373463] -(0)[1:swapper/0]Call trace: | |
[ 1.373990] -(0)[1:swapper/0][<ffffffc00008a830>] dump_backtrace+0x0/0x178 | |
[ 1.374876] -(0)[1:swapper/0][<ffffffc00008a9bc>] show_stack+0x14/0x1c | |
[ 1.375721] -(0)[1:swapper/0][<ffffffc000b34168>] dump_stack+0x88/0xac | |
[ 1.376570] -(0)[1:swapper/0][<ffffffc0001f9754>] __register_sysctl_table+0x400/0x67c | |
[ 1.377577] -(0)[1:swapper/0][<ffffffc0001f9e9c>] __register_sysctl_paths+0x22c/0x264 | |
[ 1.378585] -(0)[1:swapper/0][<ffffffc0001f9f1c>] register_sysctl_table+0x24/0x2c | |
[ 1.379549] -(0)[1:swapper/0][<ffffffc000f128c4>] pty_init+0x1a8/0x248 | |
[ 1.380398] -(0)[1:swapper/0][<ffffffc000ef7d04>] do_one_initcall+0x1f8/0x214 | |
[ 1.381319] -(0)[1:swapper/0][<ffffffc000ef7e68>] kernel_init_freeable+0x148/0x1e8 | |
[ 1.382295] -(0)[1:swapper/0][<ffffffc000b2f4ec>] kernel_init+0x18/0x140 | |
[ 1.386763] (0)[1:swapper/0]loop: module loaded | |
[ 1.388116] (0)[1:swapper/0][PMIC] [register_dlpt_notify] start | |
[ 1.388890] (0)[1:swapper/0][register_dlpt_notify] prio_val=0 | |
[ 1.389900] (4)[1:swapper/0][PBM] pbm_module_init : Done | |
[ 1.390627] (4)[1:swapper/0][VcoreFS] OPP 0: vcore_uv: 1162500, ddr_khz: 1466000 | |
[ 1.391585] (4)[1:swapper/0][VcoreFS] OPP 1: vcore_uv: 1150000, ddr_khz: 1313000 | |
[ 1.392585] (4)[1:swapper/0][VcoreFS] curr_vcore_uv: 1250000, curr_ddr_khz: 1466000 | |
[ 1.393582] (4)[1:swapper/0][VcoreFS] HPM : 1162500 (0x5a) | |
[ 1.394324] (4)[1:swapper/0][VcoreFS] TRANS2: 1158332 (0x5a) | |
[ 1.395072] (4)[1:swapper/0][VcoreFS] TRANS1: 1154166 (0x59) | |
[ 1.395837] (4)[1:swapper/0][VcoreFS] LPM : 1150000 (0x58) | |
[ 1.396669] (4)[1:swapper/0][Power/gpufreq] @_mt_gpufreq_init | |
[ 1.397831] (4)[1:swapper/0][Power/gpufreq] setup gpufreqs table | |
[ 1.399010] (4)[1:swapper/0][Power/gpufreq] GPU clock-frequency from DT = 450 MHz | |
[ 1.400015] (4)[1:swapper/0][Power/gpufreq] @_mt_gpufreq_get_dvfs_table_type: mmpll_spd_bond = 0x6 | |
[ 1.401169] (4)[1:swapper/0][Power/gpufreq] @_mt_gpufreq_get_dvfs_table_type: gpu_550m_enable = 0 | |
[ 1.402317] (4)[1:swapper/0][Power/gpufreq] @_mt_gpufreq_get_dvfs_table_type: efuse_spare2 = 0x3 | |
[ 1.403474] (4)[1:swapper/0][Power/gpufreq] mt_gpufreqs[0].gpufreq_khz = 448500 | |
[ 1.404421] (4)[1:swapper/0][Power/gpufreq] mt_gpufreqs[0].gpufreq_volt = 115000 | |
[ 1.405386] (4)[1:swapper/0][Power/gpufreq] mt_gpufreqs[1].gpufreq_khz = 299000 | |
[ 1.406353] (4)[1:swapper/0][Power/gpufreq] mt_gpufreqs[1].gpufreq_volt = 115000 | |
[ 1.407312] (4)[1:swapper/0][Power/gpufreq] @_mt_setup_gpufreqs_power_table: temp = 0 | |
[ 1.408332] (4)[1:swapper/0][Power/gpufreq] mt_gpufreqs_power[0].gpufreq_khz = 448500 | |
[ 1.409388] (4)[1:swapper/0][Power/gpufreq] mt_gpufreqs_power[0].gpufreq_volt = 115000 | |
[ 1.410411] (4)[1:swapper/0][Power/gpufreq] mt_gpufreqs_power[0].gpufreq_power = 1105 | |
[ 1.411431] (4)[1:swapper/0][Power/gpufreq] mt_gpufreqs_power[1].gpufreq_khz = 299000 | |
[ 1.412462] (4)[1:swapper/0][Power/gpufreq] mt_gpufreqs_power[1].gpufreq_volt = 115000 | |
[ 1.413484] (4)[1:swapper/0][Power/gpufreq] mt_gpufreqs_power[1].gpufreq_power = 746 | |
[ 1.414493] (4)[1:swapper/0][Power/gpufreq] mt_gpufreqs_power[2].gpufreq_khz = 299000 | |
[ 1.415512] (4)[1:swapper/0][Power/gpufreq] mt_gpufreqs_power[2].gpufreq_volt = 115000 | |
[ 1.416556] (4)[1:swapper/0][Power/gpufreq] mt_gpufreqs_power[2].gpufreq_power = 746 | |
[ 1.417568] (4)[1:swapper/0][Power/gpufreq] [ERROR]Set to LPM since GPU idx not found according to current Vcore = 1250 mV | |
[ 1.419042] (4)[1:swapper/0][Power/gpufreq] GPU current frequency = 299000KHz | |
[ 1.419986] (4)[1:swapper/0][Power/gpufreq] Current Vcore = 1250mV | |
[ 1.420790] (4)[1:swapper/0][Power/gpufreq] g_cur_gpu_OPPidx = 1 | |
[ 1.421714] (0)[1:swapper/0][PMIC] [register_low_battery_notify] start | |
[ 1.422588] (0)[1:swapper/0][register_low_battery_notify] prio_val=2 | |
[ 1.423415] (0)[1:swapper/0][PMIC] [register_battery_percent_notify] start | |
[ 1.424315] (0)[1:swapper/0][register_battery_percent_notify] prio_val=2 | |
[ 1.425237] (0)[1:swapper/0]BOOTPROF: 1425.231848:_mt_gpufreq_init 28561616 ns | |
[ 1.426272] (0)[1:swapper/0][HPS] hps_init | |
[ 1.426816] (0)[1:swapper/0][HPS] hps_cpu_init | |
[ 1.427416] (0)[1:swapper/0][HPS] hps_ctxt.little_cpumask: 0-7 | |
[ 1.428183] (0)[1:swapper/0][HPS] hps_ctxt.big_cpumask: | |
[ 1.428890] (0)[1:swapper/0][HPS] hps_cpu_init: little_cpu_id_min: 0, little_cpu_id_max: 7, big_cpu_id_min: 0, big_cpu_id_max: 0 | |
[ 1.430386] (0)[1:swapper/0][HPS] hps_core_init | |
[ 1.431131] (4)[1:swapper/0][HPS] hps_task_start success, ptr: ffffffc0b1c9c000, pid: 130 | |
[ 1.431146] (0)[130:hps_main][HPS] hps_ctxt.init_state: 0 | |
[ 1.431151] (0)[130:hps_main][HPS] hps_ctxt.state: 0 | |
[ 1.431155] (0)[130:hps_main][HPS] hps_ctxt.enabled: 1 | |
[ 1.431159] (0)[130:hps_main][HPS] hps_ctxt.suspend_enabled: 1 | |
[ 1.431163] (0)[130:hps_main][HPS] hps_ctxt.is_hmp: 0 | |
[ 1.431166] (0)[130:hps_main][HPS] hps_ctxt.little_cpu_id_min: 0 | |
[ 1.431170] (0)[130:hps_main][HPS] hps_ctxt.little_cpu_id_max: 7 | |
[ 1.431175] (0)[130:hps_main][HPS] hps_ctxt.big_cpu_id_min: 0 | |
[ 1.431178] (0)[130:hps_main][HPS] hps_ctxt.big_cpu_id_max: 0 | |
[ 1.438809] (4)[1:swapper/0][HPS] hps_procfs_init | |
[ 1.439884] (4)[1:swapper/0][HPS] hps_probe | |
[ 1.440610] (4)[1:swapper/0]MT_SCHED: Init complete, device major number = 248 | |
[ 1.441575] (4)[1:swapper/0][cpu_ntf] <00>ffffffc000402a50 (sched_cpu_notify) | |
[ 1.442956] (4)[1:swapper/0]11002000.apuart0: ttyMT0 at MMIO 0x11002000 (irq = 123, base_baud = 1625000) is a MTK UART | |
[ 1.444563] (4)[1:swapper/0][UART 0] create | |
[ 1.445120] (4)[1:swapper/0][UART 0] idx= 0 | |
[ 1.445703] (4)[1:swapper/0][ 0] ffffff80001fa000 (1024) ; | |
[ 1.446450] (4)[1:swapper/0][UART 0] idx= 1 | |
[ 1.447027] (4)[1:swapper/0][ 1] ffffff80001fb000 (1024) ; | |
[ 1.447744] (4)[1:swapper/0] | |
[ 1.448197] (4)[1:swapper/0]11003000.apuart1: ttyMT1 at MMIO 0x11003000 (irq = 124, base_baud = 1625000) is a MTK UART | |
[ 1.449810] (4)[1:swapper/0][UART 1] create | |
[ 1.450367] (4)[1:swapper/0][UART 1] idx= 2 | |
[ 1.451042] (4)[1:swapper/0][ 2] ffffff80001fc000 (8192) ; | |
[ 1.451760] (4)[1:swapper/0][UART 1] idx= 3 | |
[ 1.452477] (4)[1:swapper/0][ 3] ffffff80001fe000 (8192) ; | |
[ 1.453195] (4)[1:swapper/0] | |
[ 1.453660] (4)[1:swapper/0]11004000.apuart2: ttyMT2 at MMIO 0x11004000 (irq = 125, base_baud = 1625000) is a MTK UART | |
[ 1.455259] (4)[1:swapper/0][UART 2] create | |
[ 1.455837] (4)[1:swapper/0][UART 2] idx= 4 | |
[ 1.456521] (4)[1:swapper/0][ 4] ffffff8000200000 (8192) ; | |
[ 1.457239] (4)[1:swapper/0][UART 2] idx= 5 | |
[ 1.457926] (4)[1:swapper/0][ 5] ffffff8000202000 (8192) ; | |
[ 1.458643] (4)[1:swapper/0] | |
[ 1.459135] (4)[1:swapper/0]11005000.apuart3: ttyMT3 at MMIO 0x11005000 (irq = 126, base_baud = 1625000) is a MTK UART | |
[ 1.460733] (4)[1:swapper/0][UART 3] not support VFF, Cancel alloc | |
[ 1.461601] (4)[1:swapper/0]1100d000.apuart4: ttyMT4 at MMIO 0x1100d000 (irq = 127, base_baud = 1625000) is a MTK UART | |
[ 1.463205] (4)[1:swapper/0][UART 4] not support VFF, Cancel alloc | |
[ 1.464888] (4)[1:swapper/0]BOOTPROF: 1464.882233:mtk_uart_init 22337307 ns | |
[ 1.466744] (4)[1:swapper/0][MT AUXADC_probe3] get device tree info : start !! | |
[ 1.467726] (4)[1:swapper/0][AUXADC_AP] find node TEMPERATURE:0 | |
[ 1.468499] (4)[1:swapper/0][AUXADC_AP] find node TEMPERATURE1:1 | |
[ 1.469324] (4)[1:swapper/0][AUXADC_AP] find node ADC_FDD_RF_PARAMS_DYNAMIC_CUSTOM_CH:12 | |
[ 1.470371] (4)[1:swapper/0][MT AUXADC_AP] adc_channel_info_init : done !! | |
[ 1.471296] (4)[1:swapper/0]proc_create auxadc_debug_proc_fops | |
[ 1.472273] (4)[1:swapper/0]mt-auxadc: probe of 11001000.adc_hw failed with error -22 | |
[ 1.474841] (4)[1:swapper/0]<ALS/PS> alsps_driver_add | |
[ 1.475509] (4)[1:swapper/0]<ALS/PS> register alsps driver for the first time | |
[ 1.477015] (4)[1:swapper/0]<ALS/PS> als_ps_probe | |
[ 1.477817] (4)[1:swapper/0] mt_i2c_init driver us DT | |
[ 1.478649] (4)[1:swapper/0] mt_i2c_init driver us platform device | |
[ 1.479785] (4)[1:swapper/0] mt_i2c_probe+++++++++++++++++ | |
[ 1.480547] (4)[1:swapper/0]reg: 0xffffff8001fd2000, irq: 0x116, id: 0 | |
[ 1.481469] (4)[1:swapper/0] id: 0, reg: 0xffffff8001fd2000, dma_reg: 0xffffff8001fd0180, irq: 116 | |
[ 1.482672] (4)[1:swapper/0]i2c-bus0 speed is 100Khz | |
[ 1.483770] (4)[1:swapper/0]tps65132_parse_dt: get regulators node failed | |
[ 1.484654] (4)[1:swapper/0]tps65132_regulator_probe: parse device tree failed for tps65132, rc = -22 | |
[ 1.485887] (4)[1:swapper/0]tps65132: probe of 0-003e failed with error -22 | |
[ 1.486881] (4)[1:swapper/0]i2c-0: base(0xffffff8001fd2000),dmabase(0xffffff8001fd0180),irq(0x116) | |
[ 1.487795] (4)[1:swapper/0] mt_i2c_probe ok------------------ | |
[ 1.488619] (4)[1:swapper/0] mt_i2c_probe+++++++++++++++++ | |
[ 1.489406] (4)[1:swapper/0]reg: 0xffffff8001fd6000, irq: 0x117, id: 1 | |
[ 1.490329] (4)[1:swapper/0] id: 1, reg: 0xffffff8001fd6000, dma_reg: 0xffffff8001fd0200, irq: 117 | |
[ 1.491507] (4)[1:swapper/0]i2c-bus1 speed is 100Khz | |
[ 1.492574] (4)[1:swapper/0]i2c-1: base(0xffffff8001fd6000),dmabase(0xffffff8001fd0200),irq(0x117) | |
[ 1.493489] (4)[1:swapper/0] mt_i2c_probe ok------------------ | |
[ 1.494315] (4)[1:swapper/0] mt_i2c_probe+++++++++++++++++ | |
[ 1.495083] (4)[1:swapper/0]reg: 0xffffff8001fda000, irq: 0x118, id: 2 | |
[ 1.496024] (4)[1:swapper/0] id: 2, reg: 0xffffff8001fda000, dma_reg: 0xffffff8001fd0280, irq: 118 | |
[ 1.497208] (4)[1:swapper/0]i2c-bus2 speed is 100Khz | |
[ 1.498329] (4)[1:swapper/0]i2c i2c-2: Failed to register i2c client leds-lm3642 at 0x63 (-16) | |
[ 1.499468] (4)[1:swapper/0]i2c i2c-2: of_i2c: Failure registering /bus/i2c@11009000/lm3642@63 | |
[ 1.500653] (4)[1:swapper/0]i2c-2: base(0xffffff8001fda000),dmabase(0xffffff8001fd0280),irq(0x118) | |
[ 1.501566] (4)[1:swapper/0] mt_i2c_probe ok------------------ | |
[ 1.502392] (4)[1:swapper/0] mt_i2c_probe+++++++++++++++++ | |
[ 1.503177] (4)[1:swapper/0]reg: 0xffffff8001fde000, irq: 0x119, id: 3 | |
[ 1.504100] (4)[1:swapper/0] id: 3, reg: 0xffffff8001fde000, dma_reg: 0xffffff8001fd0300, irq: 119 | |
[ 1.505276] (4)[1:swapper/0]i2c-bus3 speed is 100Khz | |
[ 1.506201] (4)[1:swapper/0]i2c-3: base(0xffffff8001fde000),dmabase(0xffffff8001fd0300),irq(0x119) | |
[ 1.507116] (4)[1:swapper/0] mt_i2c_probe ok------------------ | |
[ 1.507941] (4)[1:swapper/0] mt_i2c_probe+++++++++++++++++ | |
[ 1.508701] (4)[1:swapper/0]reg: 0xffffff8001fe2000, irq: 0x120, id: 4 | |
[ 1.509644] (4)[1:swapper/0] id: 4, reg: 0xffffff8001fe2000, dma_reg: 0xffffff8001fd0380, irq: 120 | |
[ 1.510820] (4)[1:swapper/0]i2c-bus4 speed is 100Khz | |
[ 1.511567] (4)[1:swapper/0]i2c-4: base(0xffffff8001fe2000),dmabase(0xffffff8001fd0380),irq(0x120) | |
[ 1.512499] (4)[1:swapper/0] mt_i2c_probe ok------------------ | |
[ 1.513614] (4)[1:swapper/0]BOOTPROF: 1513.608618:mt_i2c_init 35788462 ns | |
[ 1.514578] (4)[1:swapper/0]i2c_common device init | |
[ 1.515525] (4)[1:swapper/0]i2c_common device probe | |
[ 1.516525] (4)[1:swapper/0][LED]get_cust_led_dtsi: get the leds info from device tree | |
[ 1.517899] (4)[1:swapper/0][LED]The amber's led mode is : 3 | |
[ 1.518641] (4)[1:swapper/0][LED]The amber's led data is : 1 | |
[ 1.519424] (4)[1:swapper/0][LED]The amber's pwm config data is 0 0 0 0 0 | |
[ 1.520627] (4)[1:swapper/0][LED]The green's led mode is : 3 | |
[ 1.521369] (4)[1:swapper/0][LED]The green's led data is : 2 | |
[ 1.522117] (4)[1:swapper/0][LED]The green's pwm config data is 0 0 0 0 0 | |
[ 1.523337] (4)[1:swapper/0][LED]The blue's led mode is : 0 | |
[ 1.524068] (4)[1:swapper/0][LED]The blue's led data is : 1 | |
[ 1.524806] (4)[1:swapper/0][LED]The blue's pwm config data is 0 0 0 0 0 | |
[ 1.526012] (4)[1:swapper/0][LED]The jogball-backlight's led mode is : 0 | |
[ 1.526884] (4)[1:swapper/0][LED]The jogball-backlight's led data is : 1 | |
[ 1.527764] (4)[1:swapper/0][LED]The jogball-backlight's pwm config data is 0 0 0 0 0 | |
[ 1.529103] (4)[1:swapper/0][LED]The keyboard-backlight's led mode is : 0 | |
[ 1.529986] (4)[1:swapper/0][LED]The keyboard-backlight's led data is : 1 | |
[ 1.530876] (4)[1:swapper/0][LED]The keyboard-backlight's pwm config data is 0 0 0 0 0 | |
[ 1.532204] (4)[1:swapper/0][LED]The button-backlight's led mode is : 0 | |
[ 1.533089] (4)[1:swapper/0][LED]The button-backlight's led data is : 1 | |
[ 1.533952] (4)[1:swapper/0][LED]The button-backlight's pwm config data is 0 0 0 0 0 | |
[ 1.535250] (4)[1:swapper/0][LED]The lcd-backlight's led mode is : 5 | |
[ 1.536102] (4)[1:swapper/0][LED]The lcd-backlight's led data is : 1 | |
[ 1.536933] (4)[1:swapper/0][LED]The lcd-backlight's pwm config data is 0 0 0 0 0 | |
[ 1.537905] (4)[1:swapper/0][LED]kernel:the backlight hw mode is BLS. | |
[ 1.539121] (4)[1:swapper/0]BOOTPROF: 1539.114849:mt65xx_leds_init 22868461 ns | |
[ 1.541147] (4)[1:swapper/0][Accdet]accdet_mod_init begin! | |
[ 1.542703] (4)[1:swapper/0][Accdet]accdet_probe begin! | |
[ 1.543801] (4)[1:swapper/0]input: ACCDET as /devices/virtual/input/input0 | |
[ 1.544900] (4)[1:swapper/0][PMIC] [pmic_register_interrupt_callback] intno=12 | |
[ 1.545872] (4)[1:swapper/0][PMIC] [pmic_register_interrupt_callback] intno=13 | |
[ 1.546817] (4)[1:swapper/0][Accdet]accdet_probe : ACCDET_INIT | |
[ 1.547586] (4)[1:swapper/0][ACCDET]Start accdet_get_dts_data | |
[ 1.549105] (4)[1:swapper/0][Accdet]mid-Key = 80, up_key = 220, down_key = 500 | |
[ 1.550061] (4)[1:swapper/0][Accdet]pwm_width = 500, pwm_thresh = 200 | |
[ 1.550061] deb0 = 800, deb1 = 800, mic_mode = 6 | |
[ 1.551522] (4)[1:swapper/0][Accdet]accdet hardware init | |
[ 1.553774] (4)[1:swapper/0] efusevalue = 0xffffea00, accdet_auxadc_offset = -11 | |
[ 1.554961] (0)[6:kworker/u16:0][Accdet]accdet interrupt happen:[Plug_out]current AB = 3 | |
[ 1.555008] (5)[1:swapper/0][Accdet]accdet_setup_eint | |
[ 1.556294] (5)[1:swapper/0][Accdet]accdet set EINT finished, accdet_irq=294, headsetdebounce=256000 | |
[ 1.556315] (5)[1:swapper/0][accdet] register_attributes ++ | |
[ 1.556454] (5)[1:swapper/0][accdet] register_attributes -- | |
[ 1.556458] (5)[1:swapper/0][Accdet]accdet_probe done! | |
[ 1.556655] (5)[1:swapper/0][Accdet]platform_driver_register done! | |
[ 1.556659] (5)[1:swapper/0][Accdet]accdet_mod_init done! | |
[ 1.556673] (5)[1:swapper/0]BOOTPROF: 1556.668233:accdet_mod_init 15519462 ns | |
[ 1.556694] (5)[1:swapper/0]ts3a225e_init | |
[ 1.557117] (5)[1:swapper/0]ts3a225e_probe | |
[ 1.557193] (5)[1:swapper/0]ts3a225e_i2c_probe | |
[ 1.557197] (5)[1:swapper/0]TS3A225E_read_byte | |
[ 1.564851] (0)[6:kworker/u16:0][Accdet]PLUG_OUT state not change! | |
[ 1.565663] (0)[6:kworker/u16:0][Accdet] do not send plug out event in plug out | |
[ 1.566646] (0)[6:kworker/u16:0][Accdet]check_cable_type:Clear interrupt:Done[0x0]! | |
[ 1.567637] (0)[6:kworker/u16:0][Accdet]cable type:[No_device], status switch:[Plug_out]->[Plug_out] | |
[ 1.568818] (0)[6:kworker/u16:0] [accdet] set state in cable_type status | |
[ 2.831496] (0)[130:hps_main][HPS] (0000)(8)DBG_HRT(800)(0)(0)(0) (8)(8)(8)(8)(1) (0)(0)(0) (6400)(15)(7) (15)(0)(15)(0)(0) wifi_base(0) | |
[ 3.555805] (5)[1:swapper/0]ERROR,492: id=3,addr: 3b, transfer timeout | |
[ 3.556658] (5)[1:swapper/0]I2C(3) dump info++++++++++++++++++++++ | |
[ 3.557476] (5)[1:swapper/0]I2C structure: | |
[ 3.557476] [I2C]Clk=17062,Id=3,Speed mode=0,St_rs=0,Dma_en=0,Op=3,Poll_en=0,Irq_stat=0 | |
[ 3.557476] [I2C]Trans_len=1,Trans_num=2,Trans_auxlen=1,Data_size=ffff,speed=100 | |
[ 3.557476] [I2C]Trans_stop=0,Trans_comp=0,Trans_error=0 | |
[ 3.560728] (5)[1:swapper/0]base address 0xffffff8001fde000 | |
[ 3.561468] (5)[1:swapper/0]I2C register: | |
[ 3.561468] [I2C]SLAVE_ADDR=76,INTR_MASK=ff,INTR_STAT=0,CONTROL=38,TRANSFER_LEN=1 | |
[ 3.561468] [I2C]TRANSAC_LEN=2,DELAY_LEN=2,TIMING=1410,START=1,FIFO_STAT=110 | |
[ 3.561468] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=43,EXT_CONF=8001,TRANSFER_LEN_AUX=1 | |
[ 3.564970] (5)[1:swapper/0]before enable DMA register(0x0): | |
[ 3.564970] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 3.564970] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 3.564970] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 3.567935] (5)[1:swapper/0]DMA register(0xffffff8001fd0300): | |
[ 3.567935] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 3.567935] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 3.567935] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 3.570898] (5)[1:swapper/0]I2C(3) dump info------------------------------ | |
[ 3.571796] (5)[1:swapper/0]ts3a225e_i2c_probe ID=0 | |
[ 3.572492] (5)[1:swapper/0]i2c-core: driver [TS3A225E] using legacy suspend method | |
[ 3.573482] (5)[1:swapper/0]i2c-core: driver [TS3A225E] using legacy resume method | |
[ 3.574540] (5)[1:swapper/0]BOOTPROF: 3574.534469:ts3a225e_init 2017837158 ns | |
[ 3.577290] (5)[1:swapper/0]mtk_rtc_common: rtc_init | |
[ 3.579178] (5)[1:swapper/0]mtk_rtc_common: read al time = 1970/01/01 00:00:00 (1) | |
[ 3.581146] (5)[1:swapper/0]mt-rtc mt-rtc: rtc core: registered mt-rtc as rtc0 | |
[ 3.582082] (5)[1:swapper/0][PMIC] [pmic_register_interrupt_callback] intno=9 | |
[ 3.583054] (5)[1:swapper/0][PMIC] [pmic_enable_interrupt] intno=9 en=1 str=RTC shf=0 no=9 [0x2ac]=0x108f | |
[ 3.584305] (5)[1:swapper/0][PMIC] [pmic_enable_interrupt] after [0x2ac]=0x128f | |
[ 4.333423] (0)[130:hps_main][HPS] (0000)(8)DBG_HRT(800)(0)(0)(0) (8)(8)(8)(8)(1) (0)(0)(0) (6400)(30)(6) (30)(0)(30)(0)(0) wifi_base(0) | |
[ 5.582446] (5)[1:swapper/0]ERROR,492: id=3,addr: 6b, transfer timeout | |
[ 5.583300] (5)[1:swapper/0]I2C(3) dump info++++++++++++++++++++++ | |
[ 5.584118] (5)[1:swapper/0]I2C structure: | |
[ 5.584118] [I2C]Clk=17062,Id=3,Speed mode=2,St_rs=0,Dma_en=0,Op=3,Poll_en=0,Irq_stat=0 | |
[ 5.584118] [I2C]Trans_len=1,Trans_num=2,Trans_auxlen=1,Data_size=ffff,speed=3400 | |
[ 5.584118] [I2C]Trans_stop=0,Trans_comp=0,Trans_error=0 | |
[ 5.587380] (5)[1:swapper/0]base address 0xffffff8001fde000 | |
[ 5.588119] (5)[1:swapper/0]I2C register: | |
[ 5.588119] [I2C]SLAVE_ADDR=d6,INTR_MASK=ff,INTR_STAT=0,CONTROL=3a,TRANSFER_LEN=1 | |
[ 5.588119] [I2C]TRANSAC_LEN=2,DELAY_LEN=2,TIMING=1010,START=1,FIFO_STAT=110 | |
[ 5.588119] [I2C]IO_CONFIG=0,HS=203,DCM_EN=0,DEBUGSTAT=4c,EXT_CONF=1800,TRANSFER_LEN_AUX=1 | |
[ 5.591621] (5)[1:swapper/0]before enable DMA register(0x0): | |
[ 5.591621] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 5.591621] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 5.591621] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 5.594585] (5)[1:swapper/0]DMA register(0xffffff8001fd0300): | |
[ 5.594585] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 5.594585] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 5.594585] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 5.597548] (5)[1:swapper/0]I2C(3) dump info------------------------------ | |
[ 5.835313] (0)[130:hps_main][HPS] (0000)(8)DBG_HRT(800)(0)(0)(0) (8)(8)(8)(8)(1) (0)(0)(0) (6400)(45)(5) (45)(0)(45)(0)(0) wifi_base(0) | |
[ 7.337217] (0)[130:hps_main][HPS] (0000)(8)DBG_HRT(800)(0)(0)(0) (8)(8)(8)(8)(1) (0)(0)(0) (6400)(60)(4) (60)(0)(60)(0)(0) wifi_base(0) | |
[ 7.595791] (5)[1:swapper/0]ERROR,492: id=3,addr: 6b, transfer timeout | |
[ 7.596641] (5)[1:swapper/0]I2C(3) dump info++++++++++++++++++++++ | |
[ 7.597460] (5)[1:swapper/0]I2C structure: | |
[ 7.597460] [I2C]Clk=17062,Id=3,Speed mode=2,St_rs=0,Dma_en=0,Op=3,Poll_en=0,Irq_stat=0 | |
[ 7.597460] [I2C]Trans_len=1,Trans_num=2,Trans_auxlen=1,Data_size=ffff,speed=3400 | |
[ 7.597460] [I2C]Trans_stop=0,Trans_comp=0,Trans_error=0 | |
[ 7.600719] (5)[1:swapper/0]base address 0xffffff8001fde000 | |
[ 7.601458] (5)[1:swapper/0]I2C register: | |
[ 7.601458] [I2C]SLAVE_ADDR=d6,INTR_MASK=ff,INTR_STAT=0,CONTROL=3a,TRANSFER_LEN=1 | |
[ 7.601458] [I2C]TRANSAC_LEN=2,DELAY_LEN=2,TIMING=1010,START=1,FIFO_STAT=110 | |
[ 7.601458] [I2C]IO_CONFIG=0,HS=203,DCM_EN=0,DEBUGSTAT=4c,EXT_CONF=1800,TRANSFER_LEN_AUX=1 | |
[ 7.604959] (5)[1:swapper/0]before enable DMA register(0x0): | |
[ 7.604959] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 7.604959] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 7.604959] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 7.607923] (5)[1:swapper/0]DMA register(0xffffff8001fd0300): | |
[ 7.607923] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 7.607923] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 7.607923] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 7.610885] (5)[1:swapper/0]I2C(3) dump info------------------------------ | |
[ 8.839100] (0)[130:hps_main][HPS] (0000)(8)DBG_HRT(800)(0)(0)(0) (8)(8)(8)(8)(1) (0)(0)(0) (6400)(75)(3) (75)(0)(75)(0)(0) wifi_base(0) | |
[ 9.609123] (5)[1:swapper/0]ERROR,492: id=3,addr: 6b, transfer timeout | |
[ 9.609972] (5)[1:swapper/0]I2C(3) dump info++++++++++++++++++++++ | |
[ 9.610792] (5)[1:swapper/0]I2C structure: | |
[ 9.610792] [I2C]Clk=17062,Id=3,Speed mode=2,St_rs=0,Dma_en=0,Op=3,Poll_en=0,Irq_stat=0 | |
[ 9.610792] [I2C]Trans_len=1,Trans_num=2,Trans_auxlen=1,Data_size=ffff,speed=3400 | |
[ 9.610792] [I2C]Trans_stop=0,Trans_comp=0,Trans_error=0 | |
[ 9.614050] (5)[1:swapper/0]base address 0xffffff8001fde000 | |
[ 9.614790] (5)[1:swapper/0]I2C register: | |
[ 9.614790] [I2C]SLAVE_ADDR=d6,INTR_MASK=ff,INTR_STAT=0,CONTROL=3a,TRANSFER_LEN=1 | |
[ 9.614790] [I2C]TRANSAC_LEN=2,DELAY_LEN=2,TIMING=1010,START=1,FIFO_STAT=110 | |
[ 9.614790] [I2C]IO_CONFIG=0,HS=203,DCM_EN=0,DEBUGSTAT=4c,EXT_CONF=1800,TRANSFER_LEN_AUX=1 | |
[ 9.618290] (5)[1:swapper/0]before enable DMA register(0x0): | |
[ 9.618290] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 9.618290] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 9.618290] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 9.621253] (5)[1:swapper/0]DMA register(0xffffff8001fd0300): | |
[ 9.621253] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 9.621253] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 9.621253] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 9.624215] (5)[1:swapper/0]I2C(3) dump info------------------------------ | |
[ 10.340982] (0)[130:hps_main][HPS] (0000)(8)DBG_HRT(800)(0)(0)(0) (8)(8)(8)(8)(1) (0)(0)(0) (6400)(90)(2) (90)(0)(90)(0)(0) wifi_base(0) | |
[ 11.622455] (5)[1:swapper/0]ERROR,492: id=3,addr: 6b, transfer timeout | |
[ 11.623304] (5)[1:swapper/0]I2C(3) dump info++++++++++++++++++++++ | |
[ 11.624124] (5)[1:swapper/0]I2C structure: | |
[ 11.624124] [I2C]Clk=17062,Id=3,Speed mode=2,St_rs=0,Dma_en=0,Op=3,Poll_en=0,Irq_stat=0 | |
[ 11.624124] [I2C]Trans_len=1,Trans_num=2,Trans_auxlen=1,Data_size=ffff,speed=3400 | |
[ 11.624124] [I2C]Trans_stop=0,Trans_comp=0,Trans_error=0 | |
[ 11.627383] (5)[1:swapper/0]base address 0xffffff8001fde000 | |
[ 11.628122] (5)[1:swapper/0]I2C register: | |
[ 11.628122] [I2C]SLAVE_ADDR=d6,INTR_MASK=ff,INTR_STAT=0,CONTROL=3a,TRANSFER_LEN=1 | |
[ 11.628122] [I2C]TRANSAC_LEN=2,DELAY_LEN=2,TIMING=1010,START=1,FIFO_STAT=110 | |
[ 11.628122] [I2C]IO_CONFIG=0,HS=203,DCM_EN=0,DEBUGSTAT=4c,EXT_CONF=1800,TRANSFER_LEN_AUX=1 | |
[ 11.631623] (5)[1:swapper/0]before enable DMA register(0x0): | |
[ 11.631623] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 11.631623] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 11.631623] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 11.634587] (5)[1:swapper/0]DMA register(0xffffff8001fd0300): | |
[ 11.634587] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 11.634587] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 11.634587] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 11.637550] (5)[1:swapper/0]I2C(3) dump info------------------------------ | |
[ 11.638914] (5)[1:swapper/0][PMIC] [Kernel_PMIC_INIT_SETTING_V1] 6328 PMIC Chip = 0x2820 | |
[ 11.639989] (5)[1:swapper/0][PMIC] [Kernel_PMIC_INIT_SETTING_V1] 2015-03-12... | |
[ 11.640925] (5)[1:swapper/0][PMIC] [Kernel_PMIC_INIT_SETTING_V1] is_battery_remove =0 is_wdt_reboot=1 | |
[ 11.642117] (5)[1:swapper/0][PMIC] [Kernel_PMIC_INIT_SETTING_V1] 2015-11-4... | |
[ 11.644049] -(5)[1:swapper/0]mtk_rtc_hal_common: rtc_spare_reg[12] = {16432, 1, 6} | |
[ 11.645038] (5)[1:swapper/0]BOOTPROF: 11645.033103:mt6311_init 8059726250 ns | |
[ 11.646452] (5)[1:swapper/0][bq24158] [0x0]=0xd0 [0x1]=0xf8 [0x2]=0xae [0x3]=0x51 [0x4]=0x38 [0x5]=0x3 [0x6]=0x7c | |
[ 11.651349] (5)[1:swapper/0]musb-hdrc: version 6.0, ?dma?, otg (peripheral+host) | |
[ 11.652794] (5)[1:swapper/0]musb probe | |
[ 11.653298] (5)[1:swapper/0][MUSB]musb_probe 2475: musb_removed to 0 | |
[ 11.654133] (5)[1:swapper/0][MUSB]musb_probe 2478: dts node from dts_np | |
[ 11.655067] (5)[1:swapper/0]musb probe reg: 0xffffff8002020000 ,0xffffff8002040000 , irq: 0x104 | |
[ 11.656478] (5)[1:swapper/0][MUSB]mt_usb_init 1266: mt_usb_init | |
[ 11.657419] (5)[1:swapper/0]usb_phy_generic.1.auto supply vcc not found, using dummy regulator | |
[ 11.658671] (5)[1:swapper/0][PMIC] regulator_get_voltage_sel bugl(name=VUSB33 id=0 en_reg=551 vol_reg=0) | |
[ 11.659925] (5)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VUSB33 id=0 en_reg=551 vol_reg=0 reg/sel:0 voltage:0 [0x0]=0x9) | |
[ 11.661418] (5)[1:swapper/0][MUSB]mt_usb_init 1312: regulator set vol ok, <3300000,3300000> | |
[ 11.662521] (5)[1:swapper/0][PMIC] [PMIC]regulator_is_enabled(name=VUSB33 id=0 en_reg=551 vol_reg=0 en=1) | |
[ 11.663750] (5)[1:swapper/0][MUSB]mt_usb_init 1318: enable USB regulator | |
[ 11.664746] (5)[1:swapper/0][MUSB]mt_usb_init 1330: musb platform init ff00 | |
[ 11.666444] (5)[1:swapper/0][MUSB]mt_usb_enable 345: begin <0,0>,<1,0,0,0> | |
[ 11.678297] (5)[1:swapper/0][MUSB]HQA_special 35: HQA, 0x18, before:88 | |
[ 11.679161] (5)[1:swapper/0][MUSB]HQA_special 39: HQA, 0x18, after:86 | |
[ 11.680012] (5)[1:swapper/0][MUSB]hs_slew_rate_cal 319: [USBPHY]slew calibration:FM_OUT =328,x=4195,value=4 | |
[ 11.681613] (5)[1:swapper/0][MUSB]usb_phy_recover 667: usb recovery success | |
[ 11.682542] (5)[1:swapper/0][MUSB]mt_usb_enable 369: end, <1,0,1,0> | |
[ 11.684025] (5)[136:kworker/5:1][MUSB]do_low_power_timer_monitor_work 77: state:IDLE_STAGE, last:0, balanced<0,0>, usb_state:NO-CDEV | |
[ 11.684063] (0)[1:swapper/0][MUSB]mt_usb_disable 378: begin, <1,1>,<1,1,1,0> | |
[ 11.684894] (0)[1:swapper/0][MUSB]usb_phy_savecurrent 572: usb save current success | |
[ 11.684900] (0)[1:swapper/0][MUSB]mt_usb_disable 384: end, <1,1,1,1> | |
[ 11.685024] (0)[1:swapper/0][MUSB]musb_core_init 1797: musb-hdrc: ConfigData=0x1f (UTMI-16, dyn FIFOs, HB-ISO Rx, HB-ISO Tx, SoftConn) | |
[ 11.685090] (0)[1:swapper/0][MUSB]fifo_setup 1499: Tx ep 1 fifo size is 512 fifo address is 8 | |
[ 11.685096] (0)[1:swapper/0][MUSB]fifo_setup 1509: Rx ep 1 fifo size is 512 fifo address is 48 | |
[ 11.685102] (0)[1:swapper/0][MUSB]fifo_setup 1499: Tx ep 2 fifo size is 512 fifo address is 88 | |
[ 11.685108] (0)[1:swapper/0][MUSB]fifo_setup 1509: Rx ep 2 fifo size is 512 fifo address is c8 | |
[ 11.685114] (0)[1:swapper/0][MUSB]fifo_setup 1499: Tx ep 3 fifo size is 512 fifo address is 108 | |
[ 11.685120] (0)[1:swapper/0][MUSB]fifo_setup 1509: Rx ep 3 fifo size is 512 fifo address is 148 | |
[ 11.685126] (0)[1:swapper/0][MUSB]fifo_setup 1499: Tx ep 4 fifo size is 512 fifo address is 188 | |
[ 11.685132] (0)[1:swapper/0][MUSB]fifo_setup 1509: Rx ep 4 fifo size is 512 fifo address is 1c8 | |
[ 11.685138] (0)[1:swapper/0][MUSB]fifo_setup 1499: Tx ep 5 fifo size is 512 fifo address is 208 | |
[ 11.685143] (0)[1:swapper/0][MUSB]fifo_setup 1509: Rx ep 5 fifo size is 512 fifo address is 248 | |
[ 11.685149] (0)[1:swapper/0][MUSB]fifo_setup 1499: Tx ep 6 fifo size is 512 fifo address is 288 | |
[ 11.685155] (0)[1:swapper/0][MUSB]fifo_setup 1509: Rx ep 6 fifo size is 512 fifo address is 2c8 | |
[ 11.685161] (0)[1:swapper/0][MUSB]fifo_setup 1499: Tx ep 7 fifo size is 512 fifo address is 308 | |
[ 11.685167] (0)[1:swapper/0][MUSB]fifo_setup 1509: Rx ep 7 fifo size is 512 fifo address is 348 | |
[ 11.685173] (0)[1:swapper/0][MUSB]fifo_setup 1499: Tx ep 8 fifo size is 512 fifo address is 388 | |
[ 11.685179] (0)[1:swapper/0][MUSB]fifo_setup 1509: Rx ep 8 fifo size is 512 fifo address is 3c8 | |
[ 11.685184] (0)[1:swapper/0][MUSB]musb_core_init 1827: ep_config_from_table 0 | |
[ 11.685191] (0)[1:swapper/0][MUSB]musb_core_init 1853: musb-hdrc: hw_ep 0shared, max 64 | |
[ 11.685198] (0)[1:swapper/0][MUSB]musb_core_init 1853: musb-hdrc: hw_ep 1tx, max 512 | |
[ 11.685204] (0)[1:swapper/0][MUSB]musb_core_init 1861: musb-hdrc: hw_ep 1rx, max 512 | |
[ 11.685211] (0)[1:swapper/0][MUSB]musb_core_init 1853: musb-hdrc: hw_ep 2tx, max 512 | |
[ 11.685217] (0)[1:swapper/0][MUSB]musb_core_init 1861: musb-hdrc: hw_ep 2rx, max 512 | |
[ 11.685223] (0)[1:swapper/0][MUSB]musb_core_init 1853: musb-hdrc: hw_ep 3tx, max 512 | |
[ 11.685229] (0)[1:swapper/0][MUSB]musb_core_init 1861: musb-hdrc: hw_ep 3rx, max 512 | |
[ 11.685235] (0)[1:swapper/0][MUSB]musb_core_init 1853: musb-hdrc: hw_ep 4tx, max 512 | |
[ 11.685241] (0)[1:swapper/0][MUSB]musb_core_init 1861: musb-hdrc: hw_ep 4rx, max 512 | |
[ 11.685247] (0)[1:swapper/0][MUSB]musb_core_init 1853: musb-hdrc: hw_ep 5tx, max 512 | |
[ 11.685253] (0)[1:swapper/0][MUSB]musb_core_init 1861: musb-hdrc: hw_ep 5rx, max 512 | |
[ 11.685260] (0)[1:swapper/0][MUSB]musb_core_init 1853: musb-hdrc: hw_ep 6tx, max 512 | |
[ 11.685266] (0)[1:swapper/0][MUSB]musb_core_init 1861: musb-hdrc: hw_ep 6rx, max 512 | |
[ 11.685272] (0)[1:swapper/0][MUSB]musb_core_init 1853: musb-hdrc: hw_ep 7tx, max 512 | |
[ 11.685278] (0)[1:swapper/0][MUSB]musb_core_init 1861: musb-hdrc: hw_ep 7rx, max 512 | |
[ 11.685284] (0)[1:swapper/0][MUSB]musb_core_init 1853: musb-hdrc: hw_ep 8tx, max 512 | |
[ 11.685290] (0)[1:swapper/0][MUSB]musb_core_init 1861: musb-hdrc: hw_ep 8rx, max 512 | |
[ 11.685295] (0)[1:swapper/0][MUSB]musb_core_init 1866: musb_core_init end | |
[ 11.685330] (0)[1:swapper/0][MUSB]init_peripheral_ep 2211: EP 0 name is ep0 | |
[ 11.685337] (0)[1:swapper/0][MUSB]init_peripheral_ep 2211: EP 1 name is ep1in | |
[ 11.685343] (0)[1:swapper/0][MUSB]init_peripheral_ep 2211: EP 1 name is ep1out | |
[ 11.685349] (0)[1:swapper/0][MUSB]init_peripheral_ep 2211: EP 2 name is ep2in | |
[ 11.685355] (0)[1:swapper/0][MUSB]init_peripheral_ep 2211: EP 2 name is ep2out | |
[ 11.685361] (0)[1:swapper/0][MUSB]init_peripheral_ep 2211: EP 3 name is ep3in | |
[ 11.685367] (0)[1:swapper/0][MUSB]init_peripheral_ep 2211: EP 3 name is ep3out | |
[ 11.685373] (0)[1:swapper/0][MUSB]init_peripheral_ep 2211: EP 4 name is ep4in | |
[ 11.685379] (0)[1:swapper/0][MUSB]init_peripheral_ep 2211: EP 4 name is ep4out | |
[ 11.685384] (0)[1:swapper/0][MUSB]init_peripheral_ep 2211: EP 5 name is ep5in | |
[ 11.685391] (0)[1:swapper/0][MUSB]init_peripheral_ep 2211: EP 5 name is ep5out | |
[ 11.685396] (0)[1:swapper/0][MUSB]init_peripheral_ep 2211: EP 6 name is ep6in | |
[ 11.685403] (0)[1:swapper/0][MUSB]init_peripheral_ep 2211: EP 6 name is ep6out | |
[ 11.685408] (0)[1:swapper/0][MUSB]init_peripheral_ep 2211: EP 7 name is ep7in | |
[ 11.685414] (0)[1:swapper/0][MUSB]init_peripheral_ep 2211: EP 7 name is ep7out | |
[ 11.685420] (0)[1:swapper/0][MUSB]init_peripheral_ep 2211: EP 8 name is ep8in | |
[ 11.685426] (0)[1:swapper/0][MUSB]init_peripheral_ep 2211: EP 8 name is ep8out | |
[ 11.685601] (0)[1:swapper/0][MUSB]mt_usb_disable 378: begin, <0,0>,<1,2,1,1> | |
[ 11.685622] (0)[1:swapper/0]musb core probe done base 0xffffff8002040000 | |
[ 11.685681] (0)[1:swapper/0]BOOTPROF: 11685.675873:musb_init 34326692 ns | |
[ 11.685774] (0)[1:swapper/0][MUSB]musb_do_idle 301: otg_state b_idle | |
[ 11.685810] (0)[1:swapper/0][BOOT_COMMON] [create_sysfs] No atag,meta found ! | |
[ 11.686198] (0)[1:swapper/0][HX8394F] tps65132_iic_init2 | |
[ 11.686205] (0)[1:swapper/0]Error: Driver 'tps65132' is already registered, aborting... | |
[ 11.686209] (0)[1:swapper/0][HX8394F] tps65132_iic_init success | |
[ 11.686220] (0)[1:swapper/0]*********hx8394d tps65132_iic_init | |
[ 11.686226] (0)[1:swapper/0]*********hx8394d tps65132_iic_init2 | |
[ 11.686231] (0)[1:swapper/0]Error: Driver 'tps65132' is already registered, aborting... | |
[ 11.686234] (0)[1:swapper/0]*********hx8394d tps65132_iic_init success | |
[ 11.688266] (0)[1:swapper/0][DISP]primary_display_init begin | |
[ 11.688381] (0)[1:swapper/0]ddp_mmp_init | |
[ 11.688386] (0)[1:swapper/0]MMP: MMProfileEnable(): enable: 1 | |
[ 11.688876] (0)[1:swapper/0]MMP: MMProfileForceStart(): start: 1 | |
[ 11.688891] (0)[1:swapper/0]ddp manager init | |
[ 11.688895] (0)[1:swapper/0]disp_init_irq | |
[ 11.689651] (1)[1:swapper/0][HX8394F] lcm_get_params 830 | |
[ 11.689868] (1)[1:swapper/0][DISP]__build_path_direct_link | |
[ 11.689882] (1)[1:swapper/0][DISP]dpmgr create path SUCCESS(0xffffffc0b1c80000) | |
[ 11.689906] (1)[1:swapper/0]M4Uconfig_port:DISP_OVL0,v1,s0 | |
[ 11.689923] (1)[1:swapper/0]M4Uconfig_port:DISP_RDMA0,v1,s0 | |
[ 11.689933] (1)[1:swapper/0]M4Uconfig_port:DISP_WDMA0,v1,s0 | |
[ 11.699904] (1)[1:swapper/0][HX8394F] lcm_set_util_funcs 824 | |
[ 11.700574] (1)[1:swapper/0][DISP]primary display BUILD cmdq trigger loop finished | |
[ 11.700696] (1)[1:swapper/0][DISP]primary display START cmdq trigger loop finished | |
[ 11.701647] (1)[1:swapper/0]M4Uconfig_port:DISP_WDMA0,v1,s0 | |
[ 11.765494] (4)[1:swapper/0][ION]ion_drv_create_heap: create heap: ion_fb_heap | |
[ 11.766668] (4)[1:swapper/0]BOOTPROF: 11766.661873:mtkfb_init 78947846 ns | |
[ 11.771856] (0)[1:swapper/0]mali 13040000.MALI: Continuing without Mali regulator control | |
[ 11.772966] (0)[1:swapper/0]mali 13040000.MALI: Continuing without Mali clock control | |
[ 11.775470] (0)[1:swapper/0]mali 13040000.MALI: GPU identified as 0x0720 r1p0 status 0 | |
[ 11.776795] (0)[1:swapper/0]mali 13040000.MALI: Protected mode not available | |
[ 11.779140] (0)[1:swapper/0]mali 13040000.MALI: Probed as mali0 | |
[ 11.783276] (0)[1:swapper/0]PinIdx(0) PwrType(0) val(1) | |
[ 11.783980] (0)[1:swapper/0][kd_camera_hw]PinIdx(0) PwrType(0) val(1) | |
[ 11.784821] (0)[1:swapper/0]PinIdx(1) PwrType(0) val(0) | |
[ 11.785521] (0)[1:swapper/0][kd_camera_hw]PinIdx(1) PwrType(0) val(0) | |
[ 11.786639] (0)[1:swapper/0]kd_camera_hw supply vcama_sub not found, using dummy regulator | |
[ 11.790135] (0)[1:swapper/0][PMIC] [register_low_battery_notify] start | |
[ 11.790986] (0)[1:swapper/0][register_low_battery_notify] prio_val=5 | |
[ 11.791821] (0)[1:swapper/0][PMIC] [register_battery_percent_notify] start | |
[ 11.792740] (0)[1:swapper/0][register_battery_percent_notify] prio_val=5 | |
[ 11.795358] (0)[1:swapper/0][md1]md_cldma_probe:md=ffffffc0b0864000,md->private_data=ffffffc0b0868000 | |
[ 11.809279] (0)[1:swapper/0][md0]skb pool is empty! size=1516 (0) | |
[ 11.842920] (0)[130:hps_main][HPS] (0000)(8)DBG_HRT(800)(71)(0)(0) (8)(8)(8)(8)(1) (0)(0)(0) (6400)(105)(1) (105)(71)(105)(0)(71) wifi_base(0) | |
[ 11.913033] (0)[1:swapper/0][md0]skb pool is empty! size=1516 (0) | |
[ 12.016276] (0)[1:swapper/0][md1]register modem 238 | |
[ 12.016920] (0)[1:swapper/0][md1]CLDMA modem is initializing | |
[ 12.027285] (0)[1:swapper/0][CONN-MD-DFT][W]conn_md_add_user:uid (0x00000005) is added to user list successfully | |
[ 12.029383] (4)[1:swapper/0][md1]MD Smem remap:[bc000000]->[40000000](c3c1bfbd:cbc9c7c5), invalid_map=0xbe000000 | |
[ 12.030692] (4)[1:swapper/0][md1]AP to MD share memory offset 0xBC000000 | |
[ 12.031336] (4)[1:swapper/0][md1]MD ROM mem remap:[b6000000]->[0](bdbbb9b7:c5c3c1bf) | |
[ 12.032762] (4)[1:swapper/0]BOOTPROF: 12032.755027:modem_cd_init 238403924 ns | |
[ 12.035604] (4)[1:swapper/0][WMT-DETECT][I]wmt_detect_driver_init:driver(major 154) installed success | |
[ 12.036864] (4)[1:swapper/0][SDIO-DETECT][I]sdio_detect_init:sdio_register_driver() ret=0 | |
[ 12.038619] (4)[1:swapper/0]MTK-BTIF[I]mtk_btif_probe:DO BTIF PROBE | |
[ 12.039911] (4)[1:swapper/0]MTK-BTIF[I]BTIF_init:p_btif_buffer get memory 0xffffffc0b0680000 | |
[ 12.041061] (4)[1:swapper/0]MTK-BTIF[I]BTIF_init:p_tx_queue get memory 0xffffffc0b0690000 | |
[ 12.042175] (4)[1:swapper/0]MTK-BTIF[I]BTIF_init:p_rx_queue get memory 0xffffffc0b06a0000 | |
[ 12.043263] (4)[1:swapper/0]MTK-BTIF[I]hal_btif_info_get:_btif_tx_fifo_init succeed | |
[ 12.044503] (4)[1:swapper/0]MTK-BTIF[I]_btif_set_default_setting:get btif irq(122),register base(0xffffff8003bbe000) | |
[ 12.045878] (4)[1:swapper/0]MTK-BTIF[I]_btif_set_default_setting:get interrupt flag(0x8) | |
[ 12.046924] (4)[1:swapper/0]MTK-BTIF[I]_btif_set_default_setting:get register phy base(0x1100c000) | |
[ 12.048187] (4)[1:swapper/0]MTK-BTIF-DMA[I]hal_dma_set_default_setting:get tx_dma irq(145),register base(0xffffff8003bd2900) | |
[ 12.049642] (4)[1:swapper/0]MTK-BTIF-DMA[I]hal_dma_set_default_setting:get interrupt flag(0x8) | |
[ 12.050753] (4)[1:swapper/0]MTK-BTIF-DMA[I]hal_dma_set_default_setting:get register phy base dma_dir(1)(0x11000900) | |
[ 12.052105] (4)[1:swapper/0]MTK-BTIF[I]_btif_vfifo_init:alloc vFIFO for BTIF succeed in arch64,vir addr:0xffffffc000e54ec8, | |
[ 12.053393] (4)[1:swapper/0]MTK-BTIF-DMA[I]hal_dma_set_default_setting:get rx_dma irq(146),register base(0xffffff8003bd4980) | |
[ 12.054847] (4)[1:swapper/0]MTK-BTIF-DMA[I]hal_dma_set_default_setting:get interrupt flag(0x8) | |
[ 12.055981] (4)[1:swapper/0]MTK-BTIF-DMA[I]hal_dma_set_default_setting:get register phy base dma_dir(0)(0x11000980) | |
[ 12.057322] (0)[1:swapper/0]MTK-BTIF[I]_btif_vfifo_init:alloc vFIFO for BTIF succeed in arch64,vir addr:0xffffffc000e54ec8, | |
[ 12.058649] (0)[1:swapper/0]MTK-BTIF[I]_btif_rx_btm_init:btif_rxd start to work! | |
[ 12.059646] (0)[1:swapper/0]MTK-BTIF[I]_btif_rx_btm_init:rx_spin_lock init succeed | |
[ 12.060626] (0)[1:swapper/0]MTK-BTIF[I]_btif_tx_ctx_init:nothing is done when btif tx in user's thread | |
[ 12.061830] (0)[1:swapper/0]MTK-BTIF[I]_btif_tx_ctx_init:succeed | |
[ 12.062637] (0)[1:swapper/0]MTK-BTIF[I]btif_chrdev_init:devuce number allocation succeed | |
[ 12.063683] (0)[1:swapper/0]MTK-BTIF[I]btif_chrdev_init:add btif dev to kernel succeed | |
[ 12.064739] (0)[1:swapper/0]MTK-BTIF[I]btif_chrdev_init:create class for btif succeed | |
[ 12.065855] (0)[1:swapper/0]MTK-BTIF[I]btif_chrdev_init:create device for btif succeed | |
[ 12.066892] (0)[1:swapper/0]BOOTPROF: 12066.886104:BTIF_init 28437462 ns | |
[ 12.068074] (0)[1:swapper/0]mckernelapi : Mobicore API module initialized! | |
[ 12.069006] (0)[1:swapper/0]MobiCore mcd: MobiCore Driver, Build: | |
[ 12.069826] (0)[1:swapper/0]MobiCore mcd: MobiCore mcDrvModuleApi version is 1.1 | |
[ 12.070784] (0)[1:swapper/0]MobiCore mcd: MobiCore t-base-Mediatek-Armv8-Android-302C-V007-20160127_140339_42 | |
[ 12.072218] (4)[1:swapper/0][cpu_ntf] <00>ffffffc000757134 (mobicore_cpu_callback) | |
[ 12.074319] (4)[1:swapper/0][LAST PC] CORE_0 PC = 0xffffffc00040c090(mtk_uart_write_allow), FP = 0xffffffc003047970, SP = 0xffffffc003047970 | |
[ 12.075971] (4)[1:swapper/0][LAST PC] CORE_1 PC = 0x0(), FP = 0x0, SP = 0x0 | |
[ 12.076882] (4)[1:swapper/0][LAST PC] CORE_2 PC = 0x0(), FP = 0x0, SP = 0x0 | |
[ 12.077792] (4)[1:swapper/0][LAST PC] CORE_3 PC = 0x0(), FP = 0x0, SP = 0x0 | |
[ 12.078703] (4)[1:swapper/0][LAST PC] CORE_4 PC = 0x0(), FP = 0x0, SP = 0x0 | |
[ 12.079627] (4)[1:swapper/0][LAST PC] CORE_5 PC = 0x0(), FP = 0x0, SP = 0x0 | |
[ 12.080537] (4)[1:swapper/0][LAST PC] CORE_6 PC = 0x0(), FP = 0x0, SP = 0x0 | |
[ 12.081448] (4)[1:swapper/0][LAST PC] CORE_7 PC = 0x0(), FP = 0x0, SP = 0x0 | |
[ 12.082368] (4)[1:swapper/0][cpu_ntf] <00>ffffffc00075de28 (dbgregs_hotplug_callback) | |
[ 12.083705] (4)[1:swapper/0]systracker probe | |
[ 12.084293] (4)[1:swapper/0]of_iomap for systracker @ 0xffffff8003bd8000 | |
[ 12.085177] (4)[1:swapper/0]systracker_platform_probe_default:80: irq # 169 | |
[ 12.086394] (4)[1:swapper/0]systracker init done | |
[ 12.088701] (4)[1:swapper/0][name:mtk_ts_cpu&][Power/CPU_Thermal]tscpu_init | |
[ 12.088888] (4)[1:swapper/0][name:mtk_ts_cpu&][Power/CPU_Thermal]thermal_prob | |
[ 12.097899] (4)[1:swapper/0][cmb_stub] thermal_ctrl_cb null | |
[ 12.100130] (4)[1:swapper/0][name:mtk_ts_cpu&][Power/CPU_Thermal]tscpu_bind binding OK, 1 | |
[ 12.101209] (4)[1:swapper/0][name:mtk_ts_cpu&][Power/CPU_Thermal]tscpu_bind binding OK, 2 | |
[ 12.101820] (4)[1:swapper/0][name:mtk_ts_cpu&][Power/CPU_Thermal]tscpu_bind binding OK, 3 | |
[ 12.102349] (4)[1:swapper/0][name:mtk_ts_cpu&][Power/CPU_Thermal]tscpu_bind binding OK, 4 | |
[ 12.102975] (4)[1:swapper/0][name:mtk_ts_cpu&][Power/CPU_Thermal]tscpu_bind binding OK, 0 | |
[ 12.103257] (4)[1:swapper/0] | |
[ 12.103257] MTK_SIP_KERNEL_WDT - 0xffffffc000781730 | |
[ 12.104318] (4)[1:swapper/0] | |
[ 12.104318] atf_aee_debug_virt_addr = 0xffffff8003be8000 | |
[ 12.105842] (4)[1:swapper/0][Hang_Detect] Initialize proc | |
[ 12.106550] (4)[1:swapper/0][Hang_Detect] create hang_detect thread | |
[ 12.107527] (4)[187:hang_detect][Hang_Detect] hang_detect thread starts. | |
[ 12.107783] (0)[1:swapper/0]mirdump: reserved 43ff0000+2000->ffffff8003bed000 | |
[ 12.107976] (0)[1:swapper/0]atf_log: inited | |
[ 12.107979] (0)[1:swapper/0]ATF reserved memory: 0xfedc0000 - 0xffffffff (0x1240000) | |
[ 12.108041] (0)[1:swapper/0]atf_buf_phy_ctl: 0x4275830784 | |
[ 12.108045] (0)[1:swapper/0]atf_buf_len: 19136512 | |
[ 12.108049] (0)[1:swapper/0]atf_buf_vir_ctl: ffffff8003be2000 | |
[ 12.108054] (0)[1:swapper/0]atf_log_vir_addr: ffffff8003c00100 | |
[ 12.108058] (0)[1:swapper/0]atf_log_len: 179968 | |
[ 12.108119] (0)[1:swapper/0][EMI MPU] Initialize EMI MPU. | |
[ 12.108334] (0)[1:swapper/0]get EMI_BASE_ADDR @ ffffff8003be4000 | |
[ 12.108454] (0)[1:swapper/0][EMI MPU] EMI_MPUP = 0x2 | |
[ 12.108458] (0)[1:swapper/0][EMI MPU] EMI_MPUQ = 0x0 | |
[ 12.108462] (0)[1:swapper/0][EMI MPU] EMI_MPUR = 0x0 | |
[ 12.108466] (0)[1:swapper/0][EMI MPU] EMI_MPUY = 0x0 | |
[ 12.108470] (0)[1:swapper/0][EMI MPU] EMI_MPUP2 = 0x0 | |
[ 12.108474] (0)[1:swapper/0][EMI MPU] EMI_MPUQ2 = 0x0 | |
[ 12.108478] (0)[1:swapper/0][EMI MPU] EMI_MPUR2 = 0x0 | |
[ 12.108483] (0)[1:swapper/0][EMI MPU] EMI_MPUY2 = 0x0 | |
[ 12.108487] (0)[1:swapper/0][EMI MPU] EMI_MPUS = 0x20010920 | |
[ 12.108492] (0)[1:swapper/0][EMI MPU] EMI_MPUT = 0x30081c0 | |
[ 12.108496] (0)[1:swapper/0][EMI MPU] EMI_WP_ADR = 0x0 | |
[ 12.108500] (0)[1:swapper/0][EMI MPU] EMI_WP_CTRL = 0x0 | |
[ 12.108504] (0)[1:swapper/0][EMI MPU] EMI_CHKER = 0x0 | |
[ 12.108508] (0)[1:swapper/0][EMI MPU] EMI_CHKER_TYPE = 0x0 | |
[ 12.108512] (0)[1:swapper/0][EMI MPU] EMI_CHKER_ADR = 0x0 | |
[ 12.108519] (0)[1:swapper/0]EMI_DAPC Init start | |
[ 12.108601] (0)[1:swapper/0][DEVAPC] AO_ADDRESS ffffff8003be6000 | |
[ 12.108715] (0)[1:swapper/0][DEVAPC] PD_ADDRESS ffffff8003bfa000, IRD: 166 | |
[ 12.108720] (0)[1:swapper/0]EMI_DAPC Init done | |
[ 12.108724] (0)[1:swapper/0][EMI MPU] Not 4G mode | |
[ 12.108744] (0)[1:swapper/0][EMI] EMI_CONA = 0x2a0a2 | |
[ 12.108748] (0)[1:swapper/0][EMI] Support channel number 2 | |
[ 12.108753] (0)[1:swapper/0][EMI] Channel 0 : rank 0 : 12 Gb, segment no : 6 | |
[ 12.108757] (0)[1:swapper/0][EMI] Channel 0 : rank 1 : 12 Gb, segment no : 6 | |
[ 12.108762] (0)[1:swapper/0][EMI] Channel 1 : rank 0 : 0 Gb, segment no : 0 | |
[ 12.108766] (0)[1:swapper/0][EMI] Channel 1 : rank 1 : 0 Gb, segment no : 0 | |
[ 12.109342] (1)[1:swapper/0]get EMI_BASE_ADDR @ ffffff8003bfc000 | |
[ 12.110489] (1)[1:swapper/0][BTCVSD] Auddrv_BTCVSD_Address_Map: | |
[ 12.110494] (1)[1:swapper/0][BTCVSD] infra_misc_offset=0x0 | |
[ 12.110498] (1)[1:swapper/0][BTCVSD] conn_bt_cvsd_mask=0x0 | |
[ 12.110502] (1)[1:swapper/0][BTCVSD] read_off=0x0 | |
[ 12.110506] (1)[1:swapper/0][BTCVSD] write_off=0x0 | |
[ 12.110510] (1)[1:swapper/0][BTCVSD] packet_ind=0x0 | |
[ 12.110514] (1)[1:swapper/0][BTCVSD] infra_base=0xffffff8003bfe000 | |
[ 12.110518] (1)[1:swapper/0][BTCVSD] btsys_pkv_physical_base=0xffffff8003c2e000 | |
[ 12.110522] (1)[1:swapper/0][BTCVSD] btsys_sram_bank2_physical_base=0x0 | |
[ 12.110526] (1)[1:swapper/0][BTCVSD] get btsys_sram_bank2_physical_base failed!!! | |
[ 12.110532] (1)[1:swapper/0]Disable_CVSD_Wakeup | |
[ 12.112194] (1)[1:swapper/0]mt-spi 1100a000.spi: spi.c: 1407: <mt_spi_probe>Controller at 0xffffff8003c30000 (irq 150) | |
[ 12.112295] (1)[1:swapper/0]mt-spi 1100a000.spi: master is unqueued, this is deprecated | |
[ 12.112809] (1)[1:swapper/0]spi spi0.1: spi.c: 1239: <mt_spi_setup>set up chip config,mode:1 | |
[ 12.114066] (1)[1:swapper/0]tun: Universal TUN/TAP device driver, 1.6 | |
[ 12.114071] (1)[1:swapper/0]tun: (C) 1999-2004 Max Krasnyansky <[email protected]> | |
[ 12.114158] (1)[1:swapper/0]PPP generic driver version 2.4.2 | |
[ 12.114293] (1)[1:swapper/0]PPP BSD Compression module registered | |
[ 12.114306] (1)[1:swapper/0]PPP Deflate Compression module registered | |
[ 12.114338] (1)[1:swapper/0]PPP MPPE Compression module registered | |
[ 12.114469] (1)[1:swapper/0]usbcore: registered new interface driver usb-storage | |
[ 12.114524] (1)[1:swapper/0]usbcore: registered new interface driver ums-alauda | |
[ 12.114573] (1)[1:swapper/0]usbcore: registered new interface driver ums-cypress | |
[ 12.114620] (1)[1:swapper/0]usbcore: registered new interface driver ums-datafab | |
[ 12.114667] (1)[1:swapper/0]usbcore: registered new interface driver ums-freecom | |
[ 12.114714] (1)[1:swapper/0]usbcore: registered new interface driver ums-isd200 | |
[ 12.114761] (1)[1:swapper/0]usbcore: registered new interface driver ums-jumpshot | |
[ 12.114808] (1)[1:swapper/0]usbcore: registered new interface driver ums-karma | |
[ 12.114862] (1)[1:swapper/0]usbcore: registered new interface driver ums-onetouch | |
[ 12.114917] (1)[1:swapper/0]usbcore: registered new interface driver ums-sddr09 | |
[ 12.114964] (1)[1:swapper/0]usbcore: registered new interface driver ums-sddr55 | |
[ 12.115012] (1)[1:swapper/0]usbcore: registered new interface driver ums-usbat | |
[ 12.115069] (1)[1:swapper/0]usbcore: registered new interface driver trancevibrator | |
[ 12.115702] (1)[1:swapper/0]kpd: Keypad probe start!!! | |
[ 12.115712] (1)[1:swapper/0]kpd: get kpd-clk fail, but not return, maybe kpd-clk is set by ccf. | |
[ 12.115777] (1)[1:swapper/0]kpd: kp base: 0xffffff8003c32000, addr:0xffffffc0014905f0, kp irq: 196 | |
[ 12.115811] (1)[1:swapper/0]kpd: key-debounce = 1024, sw-pwrkey = 116, hw-pwrkey = 8, hw-rstkey = 17, sw-rstkey = 115 | |
[ 12.115818] (1)[1:swapper/0]kpd: init_keymap_state done: ffff ffff ffff ffff ff! | |
[ 12.116026] (1)[1:swapper/0]input: mtk-kpd as /devices/soc/10003000.keypad/input/input1 | |
[ 12.116228] (1)[1:swapper/0]kpd: Normal Boot long press reboot selection | |
[ 12.116232] (1)[1:swapper/0]kpd: Enable normal mode LPRST | |
[ 12.116267] (1)[1:swapper/0]kpd: kpd_pdrv_probe Done | |
[ 12.117021] (1)[1:swapper/0][tpd_em_log] :register device successfully | |
[ 12.117032] (1)[1:swapper/0][HXTP] Himax 852xES touch panel driver init | |
[ 12.117061] (0)[146:kworker/u16:2][HXTP] himax852xes_init_async:Enter | |
[ 12.118003] (0)[146:kworker/u16:2][tpd]use-tpd-button = 0 | |
[ 12.118016] (0)[146:kworker/u16:2][tpd]tpd-filter-enable = 1, pixel_density = 320 | |
[ 12.118173] (1)[1:swapper/0]******** battery_meter_dts_probe!! ******** | |
[ 12.118403] (1)[1:swapper/0][battery_meter_probe] probe | |
[ 12.118408] (1)[1:swapper/0]__batt_meter_init_cust_data_from_cust_header | |
[ 12.118443] (1)[1:swapper/0]proc_create fgadc_proc_fops | |
[ 12.118703] (1)[1:swapper/0][battery_meter_driver] Initialization : DONE | |
[ 12.119139] (1)[1:swapper/0]device-mapper: uevent: version 1.0.3 | |
[ 12.119506] (1)[1:swapper/0]device-mapper: ioctl: 4.28.0-ioctl (2014-09-17) initialised: [email protected] | |
[ 12.121851] (0)[1:swapper/0][sd]of msdc DT probe msdc0! | |
[ 12.121877] (0)[1:swapper/0][sd]of_iomap for msdc @ 0xffffff8003c40000 | |
[ 12.121898] (0)[1:swapper/0][sd]msdc get irq # 111 | |
[ 12.121966] (0)[1:swapper/0][sd][MSDC0] hs200 ett setting for default is found in DT. | |
[ 12.121980] (0)[1:swapper/0][sd][MSDC0] hs400 ett setting for default is found in DT. | |
[ 12.122141] (0)[1:swapper/0][sd]of_iomap for gpio base @ 0xffffff8003c34000 | |
[ 12.123013] (0)[1:swapper/0][sd]of_iomap for APMIXED base @ 0xffffff8003c3c000 | |
[ 12.123111] (0)[1:swapper/0][sd]of_iomap for TOPCKGEN base @ 0xffffff8003c3e000 | |
[ 12.123380] (0)[1:swapper/0][sd]Yulong:Disable SD VMCH | |
[ 12.123788] (0)[1:swapper/0][PMIC] [PMIC]regulator_is_enabled(name=VEMC_3V3 id=0 en_reg=57d vol_reg=64b en=1) | |
[ 12.123809] (0)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VEMC_3V3 id=0 en_reg=57d vol_reg=64b reg/sel:2 voltage:3000000 [0xa24]=0xc102) | |
[ 12.123816] (0)[1:swapper/0][PMIC] regulator_set_voltage_sel(name=VEMC_3V3 id=0 en_reg=57d vol_reg=64b selector=2) | |
[ 12.123836] (0)[1:swapper/0][PMIC] [PMIC]regulator_is_enabled(name=VEMC_3V3 id=0 en_reg=57d vol_reg=64b en=1) | |
[ 12.149270] (0)[1:swapper/0][sd]msdc0 Set<400K> src:<400000K> sclk:<400K> timing<0> mode:0 div:250 | |
[ 12.159119] (0)[1:swapper/0][sd]MSDCPLL_PWR_CON0[0xffffff8003c3c24c][bit0~1 should be 2b'01]=0x80000001 | |
[ 12.159126] (0)[1:swapper/0][sd]MSDCPLL_CON0 [0xffffff8003c3c240][bit0 should be 1b'1]=0x101 | |
[ 12.159131] (0)[1:swapper/0][sd]CLK_CFG_2 [0xffffff8003c3e060][bit[31:24]should be 0x01]=0x1818100 | |
[ 12.159137] (0)[1:swapper/0][sd]CLK_CFG_3 [0xffffff8003c3e070][bit[15:0]should be 0x0202]=0x7020202 | |
[ 12.159142] (0)[1:swapper/0][sd]PERI_PDN_STA0 [0xffffff8003c38018][bit13=msdc0, bit14=msdc1,0:on,1:off]=0x77fddffc | |
[ 12.159303] (0)[1:swapper/0]mtk-msdc 11240000.msdc1: Got CD GPIO | |
[ 12.159334] (0)[1:swapper/0][sd]of msdc DT probe msdc1! | |
[ 12.159354] (0)[1:swapper/0][sd]of_iomap for msdc @ 0xffffff8003c60000 | |
[ 12.159372] (0)[1:swapper/0][sd]msdc get irq # 112 | |
[ 12.159407] (0)[1:swapper/0][sd][MSDC] ett-hs200-cells is not found in DT. | |
[ 12.159411] (0)[1:swapper/0][sd][MSDC] ett-hs400-cells is not found in DT. | |
[ 12.159932] (0)[1:swapper/0][sd][msdc_command_resp_polling]: msdc0 XXX CMD<52> MSDC_INT_CMDTMO Arg<0x00000c00> | |
[ 12.159935] (0)[1:swapper/0][sd]Yulong:Disable SD VMCH | |
[ 12.161473] (0)[1:swapper/0][sd][msdc_command_resp_polling]: msdc0 XXX CMD<52> MSDC_INT_CMDTMO Arg<0x80000c08> | |
[ 12.161475] (0)[1:swapper/0][PMIC] [PMIC]regulator_is_enabled(name=VMCH id=0 en_reg=55d vol_reg=64e en=1) | |
[ 12.161495] (0)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VMCH id=0 en_reg=55d vol_reg=64e reg/sel:0 voltage:2900000 [0xa1c]=0xc102) | |
[ 12.161502] (0)[1:swapper/0][PMIC] regulator_set_voltage_sel(name=VMCH id=0 en_reg=55d vol_reg=64e selector=1) | |
[ 12.161521] (0)[1:swapper/0][PMIC] [PMIC]regulator_is_enabled(name=VMCH id=0 en_reg=55d vol_reg=64e en=1) | |
[ 12.161534] (0)[1:swapper/0][PMIC] [PMIC]regulator_is_enabled(name=VMC id=0 en_reg=56c vol_reg=653 en=1) | |
[ 12.161553] (0)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VMC id=0 en_reg=56c vol_reg=653 reg/sel:1 voltage:2900000 [0xa20]=0xc102) | |
[ 12.161559] (0)[1:swapper/0][PMIC] regulator_set_voltage_sel(name=VMC id=0 en_reg=56c vol_reg=653 selector=2) | |
[ 12.161577] (0)[1:swapper/0][PMIC] [PMIC]regulator_is_enabled(name=VMC id=0 en_reg=56c vol_reg=653 en=1) | |
[ 12.161583] (0)[1:swapper/0][PMIC] [upmu_set_rg_vio18_184] old cal=0 new cal=14. | |
[ 12.161594] (0)[1:swapper/0][PMIC] [upmu_set_rg_vio18_184]:0 old cal=0 new cal=0. | |
[ 12.164598] (1)[146:kworker/u16:2][sd][msdc_command_resp_polling]: msdc0 XXX CMD<8> MSDC_INT_CMDTMO Arg<0x000001aa> | |
[ 12.165111] (1)[146:kworker/u16:2][sd][msdc_command_resp_polling]: msdc0 XXX CMD<5> MSDC_INT_CMDTMO Arg<0x00000000> | |
[ 12.165625] (1)[146:kworker/u16:2][sd][msdc_command_resp_polling]: msdc0 XXX CMD<5> MSDC_INT_CMDTMO Arg<0x00000000> | |
[ 12.166134] (1)[146:kworker/u16:2][sd][msdc_command_resp_polling]: msdc0 XXX CMD<5> MSDC_INT_CMDTMO Arg<0x00000000> | |
[ 12.166652] (1)[146:kworker/u16:2][sd][msdc_command_resp_polling]: msdc0 XXX CMD<5> MSDC_INT_CMDTMO Arg<0x00000000> | |
[ 12.167168] (1)[146:kworker/u16:2][sd][msdc_command_resp_polling]: msdc0 XXX CMD<55> MSDC_INT_CMDTMO Arg<0x00000000> | |
[ 12.167680] (1)[146:kworker/u16:2][sd][msdc_command_resp_polling]: msdc0 XXX CMD<55> MSDC_INT_CMDTMO Arg<0x00000000> | |
[ 12.168196] (1)[146:kworker/u16:2][sd][msdc_command_resp_polling]: msdc0 XXX CMD<55> MSDC_INT_CMDTMO Arg<0x00000000> | |
[ 12.182610] (0)[1:swapper/0][sd][msdc_command_resp_polling]: msdc0 XXX CMD<55> MSDC_INT_CMDTMO Arg<0x00000000> | |
[ 12.182613] (0)[1:swapper/0][sd]msdc1 Set<400K> src:<200000K> sclk:<400K> timing<0> mode:0 div:125 | |
[ 12.195639] (1)[146:kworker/u16:2]mmc0: BKOPS_EN bit is not set | |
[ 12.196085] (2)[1:swapper/0][sd]MSDCPLL_PWR_CON0[0xffffff8003c3c24c][bit0~1 should be 2b'01]=0x80000001 | |
[ 12.196091] (2)[1:swapper/0][sd]MSDCPLL_CON0 [0xffffff8003c3c240][bit0 should be 1b'1]=0x101 | |
[ 12.196097] (2)[1:swapper/0][sd]CLK_CFG_2 [0xffffff8003c3e060][bit[31:24]should be 0x01]=0x1818100 | |
[ 12.196103] (2)[1:swapper/0][sd]CLK_CFG_3 [0xffffff8003c3e070][bit[15:0]should be 0x0202]=0x7020202 | |
[ 12.196108] (2)[1:swapper/0][sd]PERI_PDN_STA0 [0xffffff8003c38018][bit13=msdc0, bit14=msdc1,0:on,1:off]=0x77fd9ffc | |
[ 12.196184] (2)[1:swapper/0]mtk-msdc: probe of 11260000.msdc3 failed with error 1 | |
[ 12.196964] (2)[1:swapper/0]BOOTPROF: 12196.958028:mt_msdc_init 75448231 ns | |
[ 12.197321] (2)[1:swapper/0]msdc @ 0xffffff8003c40000, id:0 | |
[ 12.197326] (2)[1:swapper/0]msdc @ 0xffffff8003c60000, id:1 | |
[ 12.197512] (2)[1:swapper/0]hidraw: raw HID events driver (C) Jiri Kosina | |
[ 12.198873] (2)[1:swapper/0]usbcore: registered new interface driver usbhid | |
[ 12.198877] (2)[1:swapper/0]usbhid: USB HID core driver | |
[ 12.199368] (1)[146:kworker/u16:2][sd]--- apply default emmc ett settings | |
[ 12.199374] (1)[146:kworker/u16:2][sd][MSDC, msdc_apply_ett_settings] hs200 ett, ett_count=12 | |
[ 12.199382] (1)[146:kworker/u16:2][sd]msdc_apply_ett_settings:msdc0,reg[0xb0],offset[0x380],val[0x0],readback[0x403c000f] | |
[ 12.199389] (1)[146:kworker/u16:2][sd]msdc_apply_ett_settings:msdc0,reg[0xb0],offset[0x7c00],val[0x0],readback[0x403c000f] | |
[ 12.199397] (1)[146:kworker/u16:2][sd]msdc_apply_ett_settings:msdc0,reg[0xb4],offset[0x38],val[0x1],readback[0xfffe00c9] | |
[ 12.199404] (1)[146:kworker/u16:2][sd]msdc_apply_ett_settings:msdc0,reg[0x4],offset[0x2],val[0x1],readback[0xa] | |
[ 12.199411] (1)[146:kworker/u16:2][sd]msdc_apply_ett_settings:msdc0,reg[0xf0],offset[0x1f0000],val[0xf],readback[0xf0000] | |
[ 12.199418] (1)[146:kworker/u16:2][sd]msdc_apply_ett_settings:msdc0,reg[0xf0],offset[0x7c00000],val[0x0],readback[0xf0000] | |
[ 12.199425] (1)[146:kworker/u16:2][sd]msdc_apply_ett_settings:msdc0,reg[0xb4],offset[0x7],val[0x1],readback[0xfffe00c9] | |
[ 12.199433] (1)[146:kworker/u16:2][sd]msdc_apply_ett_settings:msdc0,reg[0xf0],offset[0x1f],val[0xf],readback[0xf000f] | |
[ 12.199440] (1)[146:kworker/u16:2][sd]msdc_apply_ett_settings:msdc0,reg[0x4],offset[0x400],val[0x1],readback[0x40a] | |
[ 12.199447] (1)[146:kworker/u16:2][sd]msdc_apply_ett_settings:msdc0,reg[0xf8],offset[0x1f000000],val[0xf],readback[0xf000000] | |
[ 12.199455] (1)[146:kworker/u16:2][sd]msdc_apply_ett_settings:msdc0,reg[0xf0],offset[0x1f00],val[0x16],readback[0xf160f] | |
[ 12.199462] (1)[146:kworker/u16:2][sd]msdc_apply_ett_settings:msdc0,reg[0x4],offset[0x4],val[0x0],readback[0x40a] | |
[ 12.199725] (2)[1:swapper/0]ashmem: initialized | |
[ 12.200597] (2)[1:swapper/0]usbcore: registered new interface driver snd-usb-audio | |
[ 12.200744] (1)[146:kworker/u16:2][sd]msdc0 Set<200000K> src:<400000K> sclk:<200000K> timing<9> mode:0 div:0 | |
[ 12.200766] (1)[146:kworker/u16:2][sd]msdc0 Set<52000K> src:<400000K> sclk:<50000K> timing<1> mode:0 div:2 | |
[ 12.200867] (1)[146:kworker/u16:2][sd]--- apply default emmc ett settings | |
[ 12.200879] (1)[146:kworker/u16:2][sd][MSDC, msdc_apply_ett_settings] hs400 ett, ett_count=8 | |
[ 12.200886] (1)[146:kworker/u16:2][sd]msdc_apply_ett_settings:msdc0,reg[0xb0],offset[0x380],val[0x0],readback[0x403c000f] | |
[ 12.200893] (1)[146:kworker/u16:2][sd]msdc_apply_ett_settings:msdc0,reg[0xb0],offset[0x7c00],val[0x0],readback[0x403c000f] | |
[ 12.200901] (1)[146:kworker/u16:2][sd]msdc_apply_ett_settings:msdc0,reg[0x188],offset[0x7c],val[0x2],readback[0x14009] | |
[ 12.200908] (1)[146:kworker/u16:2][sd]msdc_apply_ett_settings:msdc0,reg[0x188],offset[0x1f000],val[0xe],readback[0xe009] | |
[ 12.200915] (1)[146:kworker/u16:2][sd]msdc_apply_ett_settings:msdc0,reg[0xb4],offset[0x38],val[0x1],readback[0xfffe00c8] | |
[ 12.200922] (1)[146:kworker/u16:2][sd]msdc_apply_ett_settings:msdc0,reg[0x4],offset[0x2],val[0x0],readback[0x8] | |
[ 12.200929] (1)[146:kworker/u16:2][sd]msdc_apply_ett_settings:msdc0,reg[0xf0],offset[0x1f0000],val[0xf],readback[0xf0000] | |
[ 12.200937] (1)[146:kworker/u16:2][sd]msdc_apply_ett_settings:msdc0,reg[0xf0],offset[0x7c00000],val[0xd],readback[0x34f0000] | |
[ 12.200959] (1)[146:kworker/u16:2][sd]msdc0 Set<200000K> src:<400000K> sclk:<200000K> timing<10> mode:3 div:0 | |
[ 12.200994] (1)[146:kworker/u16:2]mmc0: new HS400 MMC card at address 0001 | |
[ 12.201580] (2)[1:swapper/0]mtk_soc_offload_gdma_init | |
[ 12.201608] (1)[146:kworker/u16:2]mmcblk0: mmc0:0001 R21BMB 29.1 GiB | |
[ 12.201973] (1)[146:kworker/u16:2]mmcblk0boot0: mmc0:0001 R21BMB partition 1 4.00 MiB | |
[ 12.202054] (2)[1:swapper/0]OffloadService_mod_init | |
[ 12.202313] (2)[1:swapper/0]mtk_soc_capture_platform_init | |
[ 12.202335] (1)[146:kworker/u16:2]mmcblk0boot1: mmc0:0001 R21BMB partition 2 4.00 MiB | |
[ 12.202621] (2)[1:swapper/0]mtk_capture_probe | |
[ 12.202629] (2)[1:swapper/0]mtk_capture_probe: dev name mt-soc-ul1-pcm | |
[ 12.202713] (1)[146:kworker/u16:2]mmcblk0rpmb: mmc0:0001 R21BMB partition 3 4.00 MiB | |
[ 12.202881] (1)[146:kworker/u16:2]call yl_params_init! | |
[ 12.202886] (1)[146:kworker/u16:2]call yl_panic_init! | |
[ 12.203570] (2)[1:swapper/0]mtk_soc_dl1_probe: dev name mt-soc-dl1-pcm | |
[ 12.203595] (2)[1:swapper/0][ge_mt_soc_pcm_dl1] afe_irq_number=176 | |
[ 12.203620] (2)[1:swapper/0][ge_mt_soc_pcm_dl1] AFE_BASE_ADDRESS=0xffffff8003c7a000 | |
[ 12.203625] (2)[1:swapper/0][ge_mt_soc_pcm_dl1] AFE_BASE_PHY=0x11220000 | |
[ 12.203657] (2)[1:swapper/0]AudDrv_GPIO_probe | |
[ 12.204123] (2)[1:swapper/0]AudDrv_GPIO_probe pinctrl_lookup_state default fail -19 | |
[ 12.204131] (2)[1:swapper/0]AudDrv_GPIO_probe pinctrl_lookup_state extamp2-pullhigh fail -19 | |
[ 12.204137] (2)[1:swapper/0]AudDrv_GPIO_probe pinctrl_lookup_state extamp2-pulllow fail -19 | |
[ 12.204142] (2)[1:swapper/0]AudDrv_GPIO_probe pinctrl_lookup_state rcvspk-pullhigh fail -19 | |
[ 12.204147] (2)[1:swapper/0]AudDrv_GPIO_probe pinctrl_lookup_state rcvspk-pulllow fail -19 | |
[ 12.204312] (2)[1:swapper/0]Auddrv_Read_Efuse_HPOffset(+) | |
[ 12.204371] (2)[1:swapper/0]Auddrv_Read_Efuse_HPOffset polling 0xC1A=0x0 | |
[ 12.204789] (1)[146:kworker/u16:2]GPT:Primary header alternate_lba != Alt. header my_lba | |
[ 12.204795] (1)[146:kworker/u16:2]GPT:61040639 != 61071359 | |
[ 12.204799] (1)[146:kworker/u16:2]GPT:last_usable_lbas don't match. | |
[ 12.204804] (1)[146:kworker/u16:2]GPT:61039615 != 61070335 | |
[ 12.204810] (1)[146:kworker/u16:2]GPT:partition_entry_array_crc32 values don't match: 0x439772bb != 0x3ad29e74 | |
[ 12.204814] (1)[146:kworker/u16:2]GPT:Primary header thinks Alt. header is not at the end of the disk. | |
[ 12.204818] (1)[146:kworker/u16:2]GPT:61040639 != 61071359 | |
[ 12.204822] (1)[146:kworker/u16:2]GPT: Use GNU Parted to correct GPT errors. | |
[ 12.204957] (1)[146:kworker/u16:2] mmcblk0: p1 p2 p3 p4 p5 p6 p7 p8 p9 p10 p11 p12 p13 p14 p15 p16 p17 p18 p19 p20 p21 p22 p23 p24 p25 p26 p27 p28 p29 p30 p31 p32 p33 p34 p35 p36 p37 p38 p39 p40 p41 p42 p43 p44 p45 p46 p47 | |
[ 12.205382] (2)[1:swapper/0]HPoffset : efuse[0]=0x0 | |
[ 12.205409] (2)[1:swapper/0]Auddrv_Read_Efuse_HPOffset polling 0xC1A=0x0 | |
[ 12.206420] (2)[1:swapper/0]HPoffset : efuse[1]=0x0 | |
[ 12.206447] (2)[1:swapper/0]Auddrv_Read_Efuse_HPOffset polling 0xC1A=0x0 | |
[ 12.207457] (2)[1:swapper/0]HPoffset : efuse[2]=0x0 | |
[ 12.207475] (2)[1:swapper/0]RG_AUDHPLTRIM_VAUDP15 = 0 | |
[ 12.207479] (2)[1:swapper/0]RG_AUDHPRTRIM_VAUDP15 = 0 | |
[ 12.207483] (2)[1:swapper/0]RG_AUDHPLFINETRIM_VAUDP15 = 0 | |
[ 12.207487] (2)[1:swapper/0]RG_AUDHPRFINETRIM_VAUDP15 = 0 | |
[ 12.207491] (2)[1:swapper/0]RG_AUDHPLTRIM_VAUDP15_SPKHP = 0 | |
[ 12.207494] (2)[1:swapper/0]RG_AUDHPRTRIM_VAUDP15_SPKHP = 0 | |
[ 12.207498] (2)[1:swapper/0]RG_AUDHPLFINETRIM_VAUDP15_SPKHP = 0 | |
[ 12.207502] (2)[1:swapper/0]RG_AUDHPRFINETRIM_VAUDP15_SPKHP = 0 | |
[ 12.207506] (2)[1:swapper/0]Auddrv_Read_Efuse_HPOffset(-) | |
[ 12.207805] (2)[1:swapper/0]mtk_soc_dummy_platform_init | |
[ 12.208207] (2)[1:swapper/0]mtk_dummy_probe | |
[ 12.208214] (2)[1:swapper/0]mtk_dummy_probe: dev name mt-soc-dummy-pcm | |
[ 12.208378] (2)[1:swapper/0]mtk_soc_routing_platform_init | |
[ 12.208655] (2)[1:swapper/0]mtk_afe_routing_probe | |
[ 12.208663] (2)[1:swapper/0]mtk_afe_routing_probe: dev name mt-soc-routing-pcm | |
[ 12.208785] (2)[1:swapper/0]mtk_soc_capture2_platform_init | |
[ 12.209008] (2)[1:swapper/0]mtk_capture2_probe | |
[ 12.209014] (2)[1:swapper/0]mtk_capture2_probe: dev name mt-soc-ul2-pcm | |
[ 12.209160] (2)[1:swapper/0]mtk_soc_voice_platform_init | |
[ 12.209364] (2)[1:swapper/0]mtk_voice_probe | |
[ 12.209372] (2)[1:swapper/0]mtk_voice_probe: dev name mt-soc-voicemd1 | |
[ 12.209522] (2)[1:swapper/0]mtk_soc_voice_md2_platform_init | |
[ 12.209750] (2)[1:swapper/0]mtk_voice_md2_probe | |
[ 12.209757] (2)[1:swapper/0]mtk_voice_md2_probe: dev name mt-soc-voicemd2 | |
[ 12.209874] (2)[1:swapper/0]mtk_soc_voice_bt_platform_init | |
[ 12.210083] (2)[1:swapper/0]mtk_voice_bt_probe | |
[ 12.210090] (2)[1:swapper/0]mtk_voice_bt_probe: dev name mt-soc-voicemd1-bt | |
[ 12.210220] (2)[1:swapper/0]mtk_soc_voice_md2_bt_platform_init | |
[ 12.210449] (2)[1:swapper/0]mtk_voice_md2_bt_probe | |
[ 12.210457] (2)[1:swapper/0]mtk_voice_md2_bt_probe: dev name mt-soc-voicemd2-bt | |
[ 12.210900] (2)[1:swapper/0]mtk_i2s0_soc_platform_init | |
[ 12.211092] (2)[1:swapper/0]mtk_i2s0_probe | |
[ 12.211100] (2)[1:swapper/0]mtk_i2s0_probe: dev name mt-soc-i2s0-pcm | |
[ 12.211234] (2)[1:swapper/0]mtk_I2S0dl1_soc_platform_init | |
[ 12.211440] (2)[1:swapper/0]mtk_I2S0dl1_probe | |
[ 12.211448] (2)[1:swapper/0]mtk_I2S0dl1_probe: dev name mt-soc-i2s0dl1-pcm | |
[ 12.211581] (2)[1:swapper/0]mtk_soc_i2s0_awb_platform_init | |
[ 12.211792] (2)[1:swapper/0]mtk_i2s0_awb_probe | |
[ 12.211799] (2)[1:swapper/0]mtk_i2s0_awb_probe: dev name mt-soc-i2s0awb-pcm | |
[ 12.211922] (2)[1:swapper/0]mtk_soc_uldlloopback_platform_init | |
[ 12.212126] (2)[1:swapper/0]mtk_uldlloopback_probe | |
[ 12.212134] (2)[1:swapper/0]mtk_uldlloopback_probe: dev name mt-soc-uldlloopback-pcm | |
[ 12.212540] (2)[1:swapper/0]mtk_soc_dl2_probe: dev name mt-soc-dl2-pcm | |
[ 12.212660] (2)[1:swapper/0]mtk_mrgrx_soc_platform_init | |
[ 12.212874] (2)[1:swapper/0]mtk_mrgrx_probe | |
[ 12.212882] (2)[1:swapper/0]mtk_mrgrx_probe: dev name mt-soc-mrgrx-pcm | |
[ 12.213019] (2)[1:swapper/0]mtk_soc_mrgrx_awb_platform_init | |
[ 12.213221] (2)[1:swapper/0]mtk_mrgrx_awb_probe | |
[ 12.213229] (2)[1:swapper/0]mtk_mrgrx_awb_probe: dev name mt-soc-mrgrx-awb-pcm | |
[ 12.213361] (2)[1:swapper/0]mtk_fm_i2s_soc_platform_init | |
[ 12.213559] (2)[1:swapper/0]mtk_fm_i2s_probe | |
[ 12.213566] (2)[1:swapper/0]mtk_fm_i2s_probe: dev name mt-soc-fm-i2s-pcm | |
[ 12.213699] (2)[1:swapper/0]mtk_soc_fm_i2s_awb_platform_init | |
[ 12.213897] (2)[1:swapper/0]mtk_fm_i2s_awb_probe | |
[ 12.213904] (2)[1:swapper/0]mtk_fm_i2s_awb_probe: dev name mt-soc-fm-i2s-awb-pcm | |
[ 12.214036] (2)[1:swapper/0]mtk_soc_dl1_awb_platform_init | |
[ 12.214241] (2)[1:swapper/0]mtk_dl1_awb_probe | |
[ 12.214248] (2)[1:swapper/0]mtk_dl1_awb_probe: dev name mt-soc-dl1-awb-pcm | |
[ 12.214688] (2)[1:swapper/0]mtk_soc_bt_dai_platform_init | |
[ 12.214887] (2)[1:swapper/0]mtk_bt_dai_probe | |
[ 12.214894] (2)[1:swapper/0]mtk_bt_dai_probe: dev name mt-soc-voip-bt-in | |
[ 12.215011] (2)[1:swapper/0]mtk_dai_stub_init: | |
[ 12.215223] (2)[1:swapper/0]mtk_dai_stub_dev_probe name bus:mt_soc_dai_name@11220000 | |
[ 12.215231] (2)[1:swapper/0]mtk_dai_stub_dev_probe: dev name mt-soc-dai-driver | |
[ 12.215292] (2)[1:swapper/0]mtk_dai_stub_dev_probe: rc = 0 | |
[ 12.215391] (2)[1:swapper/0]mtk_routing_init: | |
[ 12.215604] (2)[1:swapper/0]mtk_routing_dev_probe name bus:mt_soc_routing_dai_name@11220000 | |
[ 12.215612] (2)[1:swapper/0]mtk_routing_dev_probe: dev name Routing-Control | |
[ 12.215715] (2)[1:swapper/0]mtk_dummy_codec_init: | |
[ 12.216012] (0)[1:swapper/0]mtk_dummy_codec_dev_probe: dev name mt-soc-dummy-codec | |
[ 12.216178] (0)[1:swapper/0]mtk_mt6331_codec_init: | |
[ 12.216402] (0)[1:swapper/0]mtk_mt6331_codec_dev_probe: dev name mt-soc-codec | |
[ 12.217675] (0)[1:swapper/0]soc-audio soc-audio: ASoC: machine mt-snd-card should use snd_soc_register_card() | |
[ 12.218356] (0)[1:swapper/0]mt6331_codec_probe() | |
[ 12.218560] (0)[1:swapper/0]mt6331_codec_init_reg | |
[ 12.218635] (0)[1:swapper/0]InitCodecDefault | |
[ 12.218871] (0)[1:swapper/0]mtk_afe_capture_probe | |
[ 12.218985] (0)[1:swapper/0]mtk_voice_platform_probe | |
[ 12.219219] (0)[1:swapper/0]dummy_codec_probe() | |
[ 12.219624] (0)[1:swapper/0]mtk_afe_uldlloopback_probe | |
[ 12.219648] (0)[1:swapper/0]mtk_afe_i2s0_probe | |
[ 12.219696] (0)[1:swapper/0]mtk_afe_mrgrx_probe | |
[ 12.219731] (0)[1:swapper/0]mtk_afe_mrgrx_awb_probe | |
[ 12.219959] (0)[1:swapper/0]mtk_afe_I2S0dl1_probe | |
[ 12.220019] (0)[1:swapper/0]mtk_afe_dl1_awb_probe | |
[ 12.220048] (0)[1:swapper/0]mtk_voice_bt_platform_probe | |
[ 12.220096] (0)[1:swapper/0]mtk_asoc_bt_dai_probe | |
[ 12.220208] (0)[1:swapper/0]mtk_afe_capture2_probe | |
[ 12.220344] (0)[1:swapper/0]mtk_i2s0_dl1_awb_probe | |
[ 12.220367] (0)[1:swapper/0]mtk_voice_md2_platform_probe | |
[ 12.220415] (0)[1:swapper/0]mtk_afe_routing_platform_probe | |
[ 12.220887] (0)[1:swapper/0]mtk_voice_md2_bt_platform_probe | |
[ 12.220945] (0)[1:swapper/0]mtk_afe_fm_i2s_probe | |
[ 12.220969] (0)[1:swapper/0]soc-audio soc-audio: control 2:0:0:cmb stub Audio Control:0 is already present | |
[ 12.220979] (0)[1:swapper/0]mt-soc-fm-i2s-pcm mt-soc-fm-i2s-pcm: ASoC: Failed to add cmb stub Audio Control: -16 | |
[ 12.221018] (0)[1:swapper/0]mtk_afe_fm_i2s_awb_probe | |
[ 12.221331] (0)[1:swapper/0]soc-audio soc-audio: mt-soc-codec-tx-dai <-> mt-soc-dl1dai-driver mapping ok | |
[ 12.221440] (0)[1:swapper/0]mtk_asoc_capture_pcm_new | |
[ 12.221447] (0)[1:swapper/0]soc-audio soc-audio: mt-soc-codec-rx-dai <-> mt-soc-ul1dai-driver mapping ok | |
[ 12.221623] (0)[1:swapper/0]mtk_soc_voice_new | |
[ 12.221630] (0)[1:swapper/0]soc-audio soc-audio: mt-soc-codec-voicemd1-dai <-> mt-soc-voicemd1dai-driver mapping ok | |
[ 12.221786] (0)[1:swapper/0]soc-audio soc-audio: mt-soc-hdmi-dummy-dai-codec <-> mt-soc-hdmidai-driver mapping ok | |
[ 12.221956] (0)[1:swapper/0]mtk_asoc_uldlloopbackpcm_new | |
[ 12.221964] (0)[1:swapper/0]soc-audio soc-audio: mt-soc-codec-uldlloopback-dai <-> mt-soc-uldlloopbackdai-driver mapping ok | |
[ 12.222121] (0)[1:swapper/0]mtk_asoc_pcm_i2s0_new | |
[ 12.222131] (0)[1:swapper/0]soc-audio soc-audio: mt-soc-i2s0-dummy-dai-codec <-> mt-soc-i2s0dai-driver mapping ok | |
[ 12.222289] (0)[1:swapper/0]mtk_asoc_pcm_mrgrx_new | |
[ 12.222297] (0)[1:swapper/0]soc-audio soc-audio: mt-soc-mrgrx-dai-codec <-> mt-soc-mrgrxdai-driver mapping ok | |
[ 12.222499] (0)[1:swapper/0]mtk_asoc_mrgrx_awb_pcm_new | |
[ 12.222507] (0)[1:swapper/0]soc-audio soc-audio: mt-soc-mrgrx-dummy-dai-codec <-> mt-soc-mrgrxdai-driver mapping ok | |
[ 12.222619] (0)[1:swapper/0]mtk_asoc_pcm_I2S0dl1_new | |
[ 12.222626] (0)[1:swapper/0]soc-audio soc-audio: mt-soc-codec-I2s0tx-dai <-> mt-soc-i2s0dl1dai-driver mapping ok | |
[ 12.222739] (0)[1:swapper/0]mtk_asoc_dl1_awb_pcm_new | |
[ 12.222746] (0)[1:swapper/0]soc-audio soc-audio: mt-soc-codec-dl1awb-dai <-> mt-soc-dl1awbdai-driver mapping ok | |
[ 12.222848] (0)[1:swapper/0]mtk_soc_voice_bt_new | |
[ 12.222856] (0)[1:swapper/0]soc-audio soc-audio: mt-soc-codec-voicemd1-bt-dai <-> mt-soc-voicemd1-btdai-driver mapping ok | |
[ 12.222967] (0)[1:swapper/0]soc-audio soc-audio: mt-soc-codec-voipcall-btout-dai <-> mt-soc-voipcall-btdai-out-driver mapping ok | |
[ 12.223087] (0)[1:swapper/0]mtk_asoc_bt_dai_pcm_new | |
[ 12.223095] (0)[1:swapper/0]soc-audio soc-audio: mt-soc-codec-voipcall-btin-dai <-> mt-soc-voipcall-btdai-in-driver mapping ok | |
[ 12.223201] (0)[1:swapper/0]soc-audio soc-audio: mt-soc-tdmrx-dai-codec <-> mt-soc-tdmrxdai-driver mapping ok | |
[ 12.223317] (0)[1:swapper/0]soc-audio soc-audio: mt-soc-fmmrg2tx-dummy-dai-codec <-> mt-soc-fmmrgtxdai-driver mapping ok | |
[ 12.223430] (0)[1:swapper/0]mtk_asoc_capture2_pcm_new | |
[ 12.223438] (0)[1:swapper/0]soc-audio soc-audio: mt-soc-codec-rx-dai2 <-> mt-soc-ul2dai-driver mapping ok | |
[ 12.223540] (0)[1:swapper/0]mtk_asoc_i2s0_awb_pcm_new | |
[ 12.223548] (0)[1:swapper/0]soc-audio soc-audio: mt-soc-codec-i2s0awb-dai <-> mt-soc-i2s0awbdai-driver mapping ok | |
[ 12.223713] (0)[1:swapper/0]mtk_soc_voice_md2_new | |
[ 12.223720] (0)[1:swapper/0]soc-audio soc-audio: mt-soc-codec-voicemd2-dai <-> mt-soc-voicemd2dai-driver mapping ok | |
[ 12.223844] (0)[1:swapper/0]mtk_asoc_routing_pcm_new | |
[ 12.223852] (0)[1:swapper/0]soc-audio soc-audio: mt-soc-dummy-dai-codec <-> Routing-Control mapping ok | |
[ 12.223965] (0)[1:swapper/0]mtk_soc_voice_md2_bt_new | |
[ 12.223973] (0)[1:swapper/0]soc-audio soc-audio: mt-soc-codec-voicemd2-bt-dai <-> mt-soc-voicemd2-btdai-driver mapping ok | |
[ 12.224079] (0)[1:swapper/0]soc-audio soc-audio: mt-soc-codec-hp-impedance-dai <-> mt-soc-hpimpedancedai-driver mapping ok | |
[ 12.224246] (0)[1:swapper/0]mtk_asoc_pcm_fm_i2s_new | |
[ 12.224254] (0)[1:swapper/0]soc-audio soc-audio: mt-soc-fm-i2s-dai-codec <-> mt-soc-fmi2S-driver mapping ok | |
[ 12.224420] (0)[1:swapper/0]mtk_asoc_fm_i2s_awb_pcm_new | |
[ 12.224428] (0)[1:swapper/0]soc-audio soc-audio: mt-soc-fm-i2s-dummy-dai-codec <-> mt-soc-fmi2S-driver mapping ok | |
[ 12.224484] (0)[1:swapper/0]compress asoc: mt-soc-offload-gdma-dai-codec <-> mt-soc-offload-gdma-driver mapping ok | |
[ 12.224602] (0)[1:swapper/0]soc-audio soc-audio: mt-soc-codec-tx-dai2 <-> mt-soc-dl2dai-driver mapping ok | |
[ 12.224921] (0)[1:swapper/0]mt-soc-dummy-codec mt-soc-dummy-codec: ASoC: Failed to create Voice_MD1_PLayback debugfs file | |
[ 12.224936] (0)[1:swapper/0]mt-soc-dummy-codec mt-soc-dummy-codec: ASoC: Failed to create Voice_MD2_PLayback debugfs file | |
[ 12.225011] (0)[1:swapper/0]mt-soc-dummy-codec mt-soc-dummy-codec: ASoC: Failed to create MultiMedia_Routing debugfs file | |
[ 12.225021] (0)[1:swapper/0]mt-soc-dummy-codec mt-soc-dummy-codec: ASoC: Failed to create MultiMedia_Routing debugfs file | |
[ 12.225042] (0)[1:swapper/0]mt-soc-dummy-codec mt-soc-dummy-codec: ASoC: Failed to create HMDI_PLayback debugfs file | |
[ 12.225057] (0)[1:swapper/0]mt-soc-dummy-codec mt-soc-dummy-codec: ASoC: Failed to create I2S0_PLayback debugfs file | |
[ 12.225071] (0)[1:swapper/0]mt-soc-dummy-codec mt-soc-dummy-codec: ASoC: Failed to create MRGRX_PLayback debugfs file | |
[ 12.225095] (0)[1:swapper/0]mt-soc-dummy-codec mt-soc-dummy-codec: ASoC: Failed to create ANC_Debug_Record_MOD debugfs file | |
[ 12.225117] (0)[1:swapper/0]mt-soc-dummy-codec mt-soc-dummy-codec: ASoC: Failed to create ANC_Debug_Record_ADC2 debugfs file | |
[ 12.225132] (0)[1:swapper/0]mt-soc-dummy-codec mt-soc-dummy-codec: ASoC: Failed to create ANC_Debug_Record_IO2 debugfs file | |
[ 12.225146] (0)[1:swapper/0]mt-soc-dummy-codec mt-soc-dummy-codec: ASoC: Failed to create FM_I2S_Playback debugfs file | |
[ 12.225213] (0)[1:swapper/0]mt-soc-codec mt-soc-codec: ASoC: Failed to create Voice_MD1_PLayback debugfs file | |
[ 12.225235] (0)[1:swapper/0]mt-soc-codec mt-soc-codec: ASoC: Failed to create Voice_MD2_PLayback debugfs file | |
[ 12.225264] (0)[1:swapper/0]mt-soc-codec mt-soc-codec: ASoC: Failed to create ULDL_Loopback debugfs file | |
[ 12.225295] (0)[1:swapper/0]mt-soc-codec mt-soc-codec: ASoC: Failed to create MRGRX_PLayback debugfs file | |
[ 12.225316] (0)[1:swapper/0]mt-soc-codec mt-soc-codec: ASoC: Failed to create FM_I2S_Playback debugfs file | |
[ 12.225331] (0)[1:swapper/0]mt-soc-codec mt-soc-codec: ASoC: Failed to create SPEAKER debugfs file | |
[ 12.225340] (0)[1:swapper/0]mt-soc-codec mt-soc-codec: ASoC: Failed to create HEADSET debugfs file | |
[ 12.225349] (0)[1:swapper/0]mt-soc-codec mt-soc-codec: ASoC: Failed to create EARPIECE debugfs file | |
[ 12.225387] (0)[1:swapper/0]mt-soc-dai-driver mt-soc-dai-driver: ASoC: Failed to create HMDI_PLayback debugfs file | |
[ 12.225458] (0)[1:swapper/0]mt-soc-dai-driver mt-soc-dai-driver: ASoC: Failed to create Voice_MD1_PLayback debugfs file | |
[ 12.225472] (0)[1:swapper/0]mt-soc-dai-driver mt-soc-dai-driver: ASoC: Failed to create Voice_MD2_PLayback debugfs file | |
[ 12.225486] (0)[1:swapper/0]mt-soc-dai-driver mt-soc-dai-driver: ASoC: Failed to create ULDL_Loopback debugfs file | |
[ 12.225508] (0)[1:swapper/0]mt-soc-dai-driver mt-soc-dai-driver: ASoC: Failed to create I2S0_PLayback debugfs file | |
[ 12.225531] (0)[1:swapper/0]mt-soc-dai-driver mt-soc-dai-driver: ASoC: Failed to create MRGRX_PLayback debugfs file | |
[ 12.225546] (0)[1:swapper/0]mt-soc-dai-driver mt-soc-dai-driver: ASoC: Failed to create MRGRX_CAPTURE debugfs file | |
[ 12.225606] (0)[1:swapper/0]mt-soc-dai-driver mt-soc-dai-driver: ASoC: Failed to create FM_I2S_Playback debugfs file | |
[ 12.225621] (0)[1:swapper/0]mt-soc-dai-driver mt-soc-dai-driver: ASoC: Failed to create FM_I2S_Capture debugfs file | |
[ 12.232324] (0)[1:swapper/0]Mirror/redirect action on | |
[ 12.232366] (0)[1:swapper/0]u32 classifier | |
[ 12.232370] (0)[1:swapper/0] Performance counters on | |
[ 12.232373] (0)[1:swapper/0] input device check on | |
[ 12.232377] (0)[1:swapper/0] Actions configured | |
[ 12.232446] (0)[1:swapper/0]Netfilter messages via NETLINK v0.30. | |
[ 12.232514] (0)[1:swapper/0]nf_conntrack version 0.5.0 (16384 buckets, 65536 max) | |
[ 12.233272] (0)[1:swapper/0]ctnetlink v0.93: registering with nfnetlink. | |
[ 12.234743] (0)[1:swapper/0]xt_time: kernel timezone is -0000 | |
[ 12.234902] (0)[1:swapper/0]ipip: IPv4 over IPv4 tunneling driver | |
[ 12.235779] (0)[1:swapper/0]ip_tables: (C) 2000-2006 Netfilter Core Team | |
[ 12.236132] (0)[1:swapper/0]arp_tables: (C) 2002 David S. Miller | |
[ 12.236239] (0)[1:swapper/0]TCP: cubic registered | |
[ 12.236252] (0)[1:swapper/0]Initializing XFRM netlink socket | |
[ 12.240374] (2)[1:swapper/0]mip6: Mobile IPv6 | |
[ 12.240415] (2)[1:swapper/0]ip6_tables: (C) 2000-2006 Netfilter Core Team | |
[ 12.240838] (2)[1:swapper/0]sit: IPv6 over IPv4 tunneling driver | |
[ 12.242463] (2)[1:swapper/0]bridge: automatic filtering via arp/ip/ip6tables has been deprecated. Update your scripts to load br_netfilter if you need this. | |
[ 12.242490] (2)[1:swapper/0]Bridge firewalling registered | |
[ 12.242502] (2)[1:swapper/0]Ebtables v2.0 registered | |
[ 12.242572] (2)[1:swapper/0]l2tp_core: L2TP core driver, V2.0 | |
[ 12.242596] (2)[1:swapper/0]l2tp_ppp: PPPoL2TP kernel driver, V2.0 | |
[ 12.242607] (2)[1:swapper/0]l2tp_ip: L2TP IP encapsulation support (L2TPv3) | |
[ 12.242763] (2)[1:swapper/0]l2tp_netlink: L2TP netlink interface | |
[ 12.242807] (2)[1:swapper/0]l2tp_eth: L2TP ethernet pseudowire support (L2TPv3) | |
[ 12.242848] (2)[1:swapper/0]l2tp_debugfs: L2TP debugfs support | |
[ 12.242859] (2)[1:swapper/0]l2tp_ip6: L2TP IP encapsulation support for IPv6 (L2TPv3) | |
[ 12.243007] (2)[1:swapper/0]8021q: 802.1Q VLAN Support v1.8 | |
[ 12.244395] (2)[1:swapper/0][cpu_ntf] <00>ffffffc0000860ac (fpsimd_cpu_hotplug_notifier) | |
[ 12.245491] (2)[1:swapper/0]Registered cp15_barrier emulation handler | |
[ 12.246464] (2)[1:swapper/0]Registered setend emulation handler | |
[ 12.246476] (2)[1:swapper/0][cpu_ntf] <00>ffffffc000096498 (insn_cpu_hotplug_notify) | |
[ 12.246861] (2)[1:swapper/0][cpu_ntf] <00>ffffffc0000f46a4 (console_cpu_notify) | |
[ 12.246907] (2)[1:swapper/0]registered taskstats version 1 | |
[ 12.247784] (5)[1:swapper/0]Key type encrypted registered | |
[ 12.249068] (5)[1:swapper/0][Power/dcm] [dcm_set_default]type:0x000000cb | |
[ 12.249116] (5)[1:swapper/0][Power/dcm] [ ARMCORE_DCM 0x00000001] current state:1 (0) | |
[ 12.249129] (5)[1:swapper/0][Power/dcm] [ MCUSYS_DCM 0x00000002] current state:1 (0) | |
[ 12.249136] (5)[1:swapper/0][Power/dcm] [ PERI_DCM 0x00000008] current state:1 (0) | |
[ 12.249147] (5)[1:swapper/0][Power/dcm] [ TOPCKG_DCM 0x00000040] current state:1 (0) | |
[ 12.249153] (5)[1:swapper/0][Power/dcm] [ EFUSE_DCM 0x00000080] current state:1 (0) | |
[ 12.249159] (5)[1:swapper/0][Power/dcm] | |
[ 12.249159] ******** dcm dump register ********* | |
[ 12.249165] (5)[1:swapper/0][Power/dcm] APMIXED_PLL_CON2 (0xffffff8003d2e008): 0x00000a0e | |
[ 12.249171] (5)[1:swapper/0][Power/dcm] MCUCFG_ACLKEN_DIV (0xffffff8003d24640): 0x00000012 | |
[ 12.249176] (5)[1:swapper/0][Power/dcm] MCUCFG_L2C_SRAM_CTRL (0xffffff8003d24648): 0x00200081 | |
[ 12.249182] (5)[1:swapper/0][Power/dcm] MCUCFG_CCI_CLK_CTRL (0xffffff8003d24660): 0x00000117 | |
[ 12.249188] (5)[1:swapper/0][Power/dcm] MCUCFG_BUS_FABRIC_DCM_CTRL (0xffffff8003d24668): 0x00000303 | |
[ 12.249193] (5)[1:swapper/0][Power/dcm] TOP_CKMUXSEL (0xffffff8003d28000): 0x00000005 | |
[ 12.249198] (5)[1:swapper/0][Power/dcm] TOP_CKDIV1 (0xffffff8003d28008): 0x00000000 | |
[ 12.249204] (5)[1:swapper/0][Power/dcm] INFRA_TOPCKGEN_DCMCTL (0xffffff8003d28010): 0x00000001 | |
[ 12.249209] (5)[1:swapper/0][Power/dcm] INFRA_TOPCKGEN_DCMDBC (0xffffff8003d28014): 0x00000001 | |
[ 12.249215] (5)[1:swapper/0][Power/dcm] INFRA_GLOBALCON_DCMCTL (0xffffff8003d28050): 0x00000303 | |
[ 12.249220] (5)[1:swapper/0][Power/dcm] INFRA_GLOBALCON_DCMDBC (0xffffff8003d28054): 0x01000100 | |
[ 12.249226] (5)[1:swapper/0][Power/dcm] INFRA_GLOBALCON_DCMFSEL (0xffffff8003d28058): 0x10100000 | |
[ 12.249232] (5)[1:swapper/0][Power/dcm] TOPCKG_DCM_CFG (0xffffff8003d22004): 0x00e00000 | |
[ 12.249237] (5)[1:swapper/0][Power/dcm] PERI_GLOBALCON_DCMCTL (0xffffff8003d2a050): 0x000000f3 | |
[ 12.249243] (5)[1:swapper/0][Power/dcm] PERI_GLOBALCON_DCMDBC (0xffffff8003d2a054): 0x000000f0 | |
[ 12.249248] (5)[1:swapper/0][Power/dcm] PERI_GLOBALCON_DCMFSEL (0xffffff8003d2a058): 0x00000000 | |
[ 12.249254] (5)[1:swapper/0][Power/dcm] DRAMC_PD_CTRL (0xffffff80001ce1dc): 0xd364557a | |
[ 12.249259] (5)[1:swapper/0][Power/dcm] DRAMC_CLKCTRL (0xffffff80001ce130): 0x50000000 | |
[ 12.249264] (5)[1:swapper/0][Power/dcm] DRAMC_PERFCTL0 (0xffffff80001ce1ec): 0x00004f11 | |
[ 12.249270] (5)[1:swapper/0][Power/dcm] DRAMC_GDDR3CTL1 (0xffffff80001ce0f4): 0x01f08000 | |
[ 12.249276] (5)[1:swapper/0][Power/dcm] DDRPHY_MEMPLL_DIVIDER (0xffffff80001d4640): 0xfe898032 | |
[ 12.249281] (5)[1:swapper/0][Power/dcm] EMI_CONM (0xffffff8003d26060): 0x0000061a | |
[ 12.249287] (5)[1:swapper/0][Power/dcm] EFUSE_REG_DCM_ON (0xffffff8003d2c55c): 0x00000001 | |
[ 12.249435] (5)[1:swapper/0][Power/clkmgr] [00][CG_INFRA]=[0x00000088] | |
[ 12.249441] (5)[1:swapper/0][Power/clkmgr] [01][CG_PERI ]=[0x77fd9ffc] | |
[ 12.249448] (5)[1:swapper/0][Power/clkmgr] [02][CG_DISP0]=[0xfff96bfc][0xfff06bfc] | |
[ 12.249453] (5)[1:swapper/0][Power/clkmgr] [03][CG_DISP1]=[0xfffffff3] | |
[ 12.249458] (5)[1:swapper/0][Power/clkmgr] [04][CG_IMAGE]=[0x00000000] | |
[ 12.249463] (5)[1:swapper/0][Power/clkmgr] [05][CG_MFG ]=[0x00000000] | |
[ 12.249468] (5)[1:swapper/0][Power/clkmgr] [06][CG_AUDIO]=[0x0f0c4344] | |
[ 12.249474] (5)[1:swapper/0][Power/clkmgr] [07][CG_VDEC0]=[0x00000000][0x00000000] | |
[ 12.249480] (5)[1:swapper/0][Power/clkmgr] [08][CG_VDEC1]=[0x00000000][0x00000000] | |
[ 12.249485] (5)[1:swapper/0][Power/clkmgr] [09][CG_VENC ]=[0x00000000] | |
[ 12.250150] (5)[1:swapper/0][Power/cpufreq] @_mt_cpufreq_init: num_possible_cpus: 8 | |
[ 12.250163] (5)[1:swapper/0][Power/cpufreq] CPU clock-frequency from DT = 1300 MHz | |
[ 12.250168] (5)[1:swapper/0][Power/cpufreq] @_mt_cpufreq_get_cpu_level: efuse cpu_spd_bond = 0x4 | |
[ 12.250172] (5)[1:swapper/0][Power/cpufreq] @_mt_cpufreq_get_cpu_level: efuse_spare2 = 0x3 | |
[ 12.250177] (5)[1:swapper/0][Power/cpufreq] @_mt_cpufreq_init: PMIC 5A throttle enabled! | |
[ 12.250182] (5)[1:swapper/0][Power/cpufreq] @_mt_cpufreq_init: No ExtBuck! | |
[ 12.250292] (5)[1:swapper/0][Power/cpufreq] [0] = { .cpufreq_khz = 1300000, .cpufreq_ncpu = 8, .cpufreq_power = 2886 } | |
[ 12.250298] (5)[1:swapper/0][Power/cpufreq] [1] = { .cpufreq_khz = 1235000, .cpufreq_ncpu = 8, .cpufreq_power = 2663 } | |
[ 12.250303] (5)[1:swapper/0][Power/cpufreq] [2] = { .cpufreq_khz = 1300000, .cpufreq_ncpu = 7, .cpufreq_power = 2525 } | |
[ 12.250309] (5)[1:swapper/0][Power/cpufreq] [3] = { .cpufreq_khz = 1144000, .cpufreq_ncpu = 8, .cpufreq_power = 2343 } | |
[ 12.250315] (5)[1:swapper/0][Power/cpufreq] [4] = { .cpufreq_khz = 1235000, .cpufreq_ncpu = 7, .cpufreq_power = 2330 } | |
[ 12.250320] (5)[1:swapper/0][Power/cpufreq] [5] = { .cpufreq_khz = 1300000, .cpufreq_ncpu = 6, .cpufreq_power = 2164 } | |
[ 12.250326] (5)[1:swapper/0][Power/cpufreq] [6] = { .cpufreq_khz = 1144000, .cpufreq_ncpu = 7, .cpufreq_power = 2050 } | |
[ 12.250331] (5)[1:swapper/0][Power/cpufreq] [7] = { .cpufreq_khz = 1235000, .cpufreq_ncpu = 6, .cpufreq_power = 1997 } | |
[ 12.250337] (5)[1:swapper/0][Power/cpufreq] [8] = { .cpufreq_khz = 1040000, .cpufreq_ncpu = 8, .cpufreq_power = 1949 } | |
[ 12.250342] (5)[1:swapper/0][Power/cpufreq] [9] = { .cpufreq_khz = 1300000, .cpufreq_ncpu = 5, .cpufreq_power = 1803 } | |
[ 12.250348] (5)[1:swapper/0][Power/cpufreq] [10] = { .cpufreq_khz = 1144000, .cpufreq_ncpu = 6, .cpufreq_power = 1757 } | |
[ 12.250353] (5)[1:swapper/0][Power/cpufreq] [11] = { .cpufreq_khz = 1040000, .cpufreq_ncpu = 7, .cpufreq_power = 1705 } | |
[ 12.250359] (5)[1:swapper/0][Power/cpufreq] [12] = { .cpufreq_khz = 1235000, .cpufreq_ncpu = 5, .cpufreq_power = 1664 } | |
[ 12.250365] (5)[1:swapper/0][Power/cpufreq] [13] = { .cpufreq_khz = 1144000, .cpufreq_ncpu = 5, .cpufreq_power = 1464 } | |
[ 12.250370] (5)[1:swapper/0][Power/cpufreq] [14] = { .cpufreq_khz = 1040000, .cpufreq_ncpu = 6, .cpufreq_power = 1461 } | |
[ 12.250376] (5)[1:swapper/0][Power/cpufreq] [15] = { .cpufreq_khz = 1300000, .cpufreq_ncpu = 4, .cpufreq_power = 1443 } | |
[ 12.250382] (5)[1:swapper/0][Power/cpufreq] [16] = { .cpufreq_khz = 819000, .cpufreq_ncpu = 8, .cpufreq_power = 1432 } | |
[ 12.250387] (5)[1:swapper/0][Power/cpufreq] [17] = { .cpufreq_khz = 1235000, .cpufreq_ncpu = 4, .cpufreq_power = 1331 } | |
[ 12.250393] (5)[1:swapper/0][Power/cpufreq] [18] = { .cpufreq_khz = 819000, .cpufreq_ncpu = 7, .cpufreq_power = 1253 } | |
[ 12.250399] (5)[1:swapper/0][Power/cpufreq] [19] = { .cpufreq_khz = 1040000, .cpufreq_ncpu = 5, .cpufreq_power = 1218 } | |
[ 12.250405] (5)[1:swapper/0][Power/cpufreq] [20] = { .cpufreq_khz = 1144000, .cpufreq_ncpu = 4, .cpufreq_power = 1171 } | |
[ 12.250410] (5)[1:swapper/0][Power/cpufreq] [21] = { .cpufreq_khz = 1300000, .cpufreq_ncpu = 3, .cpufreq_power = 1082 } | |
[ 12.250416] (5)[1:swapper/0][Power/cpufreq] [22] = { .cpufreq_khz = 819000, .cpufreq_ncpu = 6, .cpufreq_power = 1074 } | |
[ 12.250422] (5)[1:swapper/0][Power/cpufreq] [23] = { .cpufreq_khz = 1235000, .cpufreq_ncpu = 3, .cpufreq_power = 998 } | |
[ 12.250427] (5)[1:swapper/0][Power/cpufreq] [24] = { .cpufreq_khz = 598000, .cpufreq_ncpu = 8, .cpufreq_power = 988 } | |
[ 12.250433] (5)[1:swapper/0][Power/cpufreq] [25] = { .cpufreq_khz = 1040000, .cpufreq_ncpu = 4, .cpufreq_power = 974 } | |
[ 12.250439] (5)[1:swapper/0][Power/cpufreq] [26] = { .cpufreq_khz = 819000, .cpufreq_ncpu = 5, .cpufreq_power = 895 } | |
[ 12.250444] (5)[1:swapper/0][Power/cpufreq] [27] = { .cpufreq_khz = 1144000, .cpufreq_ncpu = 3, .cpufreq_power = 878 } | |
[ 12.250450] (5)[1:swapper/0][Power/cpufreq] [28] = { .cpufreq_khz = 598000, .cpufreq_ncpu = 7, .cpufreq_power = 864 } | |
[ 12.250456] (5)[1:swapper/0][Power/cpufreq] [29] = { .cpufreq_khz = 598000, .cpufreq_ncpu = 6, .cpufreq_power = 741 } | |
[ 12.250461] (5)[1:swapper/0][Power/cpufreq] [30] = { .cpufreq_khz = 1040000, .cpufreq_ncpu = 3, .cpufreq_power = 730 } | |
[ 12.250467] (5)[1:swapper/0][Power/cpufreq] [31] = { .cpufreq_khz = 1300000, .cpufreq_ncpu = 2, .cpufreq_power = 721 } | |
[ 12.250472] (5)[1:swapper/0][Power/cpufreq] [32] = { .cpufreq_khz = 819000, .cpufreq_ncpu = 4, .cpufreq_power = 716 } | |
[ 12.250478] (5)[1:swapper/0][Power/cpufreq] [33] = { .cpufreq_khz = 442000, .cpufreq_ncpu = 8, .cpufreq_power = 690 } | |
[ 12.250484] (5)[1:swapper/0][Power/cpufreq] [34] = { .cpufreq_khz = 1235000, .cpufreq_ncpu = 2, .cpufreq_power = 665 } | |
[ 12.250489] (5)[1:swapper/0][Power/cpufreq] [35] = { .cpufreq_khz = 598000, .cpufreq_ncpu = 5, .cpufreq_power = 617 } | |
[ 12.250495] (5)[1:swapper/0][Power/cpufreq] [36] = { .cpufreq_khz = 442000, .cpufreq_ncpu = 7, .cpufreq_power = 603 } | |
[ 12.250501] (5)[1:swapper/0][Power/cpufreq] [37] = { .cpufreq_khz = 1144000, .cpufreq_ncpu = 2, .cpufreq_power = 585 } | |
[ 12.250506] (5)[1:swapper/0][Power/cpufreq] [38] = { .cpufreq_khz = 819000, .cpufreq_ncpu = 3, .cpufreq_power = 537 } | |
[ 12.250512] (5)[1:swapper/0][Power/cpufreq] [39] = { .cpufreq_khz = 442000, .cpufreq_ncpu = 6, .cpufreq_power = 517 } | |
[ 12.250517] (5)[1:swapper/0][Power/cpufreq] [40] = { .cpufreq_khz = 598000, .cpufreq_ncpu = 4, .cpufreq_power = 494 } | |
[ 12.250523] (5)[1:swapper/0][Power/cpufreq] [41] = { .cpufreq_khz = 1040000, .cpufreq_ncpu = 2, .cpufreq_power = 487 } | |
[ 12.250528] (5)[1:swapper/0][Power/cpufreq] [42] = { .cpufreq_khz = 299000, .cpufreq_ncpu = 8, .cpufreq_power = 452 } | |
[ 12.250534] (5)[1:swapper/0][Power/cpufreq] [43] = { .cpufreq_khz = 442000, .cpufreq_ncpu = 5, .cpufreq_power = 431 } | |
[ 12.250539] (5)[1:swapper/0][Power/cpufreq] [44] = { .cpufreq_khz = 299000, .cpufreq_ncpu = 7, .cpufreq_power = 395 } | |
[ 12.250545] (5)[1:swapper/0][Power/cpufreq] [45] = { .cpufreq_khz = 598000, .cpufreq_ncpu = 3, .cpufreq_power = 370 } | |
[ 12.250551] (5)[1:swapper/0][Power/cpufreq] [46] = { .cpufreq_khz = 1300000, .cpufreq_ncpu = 1, .cpufreq_power = 360 } | |
[ 12.250556] (5)[1:swapper/0][Power/cpufreq] [47] = { .cpufreq_khz = 819000, .cpufreq_ncpu = 2, .cpufreq_power = 358 } | |
[ 12.250562] (5)[1:swapper/0][Power/cpufreq] [48] = { .cpufreq_khz = 442000, .cpufreq_ncpu = 4, .cpufreq_power = 345 } | |
[ 12.250567] (5)[1:swapper/0][Power/cpufreq] [49] = { .cpufreq_khz = 299000, .cpufreq_ncpu = 6, .cpufreq_power = 339 } | |
[ 12.250573] (5)[1:swapper/0][Power/cpufreq] [50] = { .cpufreq_khz = 1235000, .cpufreq_ncpu = 1, .cpufreq_power = 332 } | |
[ 12.250579] (5)[1:swapper/0][Power/cpufreq] [51] = { .cpufreq_khz = 1144000, .cpufreq_ncpu = 1, .cpufreq_power = 292 } | |
[ 12.250584] (5)[1:swapper/0][Power/cpufreq] [52] = { .cpufreq_khz = 299000, .cpufreq_ncpu = 5, .cpufreq_power = 282 } | |
[ 12.250590] (5)[1:swapper/0][Power/cpufreq] [53] = { .cpufreq_khz = 442000, .cpufreq_ncpu = 3, .cpufreq_power = 258 } | |
[ 12.250595] (5)[1:swapper/0][Power/cpufreq] [54] = { .cpufreq_khz = 598000, .cpufreq_ncpu = 2, .cpufreq_power = 247 } | |
[ 12.250601] (5)[1:swapper/0][Power/cpufreq] [55] = { .cpufreq_khz = 1040000, .cpufreq_ncpu = 1, .cpufreq_power = 243 } | |
[ 12.250606] (5)[1:swapper/0][Power/cpufreq] [56] = { .cpufreq_khz = 299000, .cpufreq_ncpu = 4, .cpufreq_power = 226 } | |
[ 12.250612] (5)[1:swapper/0][Power/cpufreq] [57] = { .cpufreq_khz = 819000, .cpufreq_ncpu = 1, .cpufreq_power = 179 } | |
[ 12.250618] (5)[1:swapper/0][Power/cpufreq] [58] = { .cpufreq_khz = 442000, .cpufreq_ncpu = 2, .cpufreq_power = 172 } | |
[ 12.250623] (5)[1:swapper/0][Power/cpufreq] [59] = { .cpufreq_khz = 299000, .cpufreq_ncpu = 3, .cpufreq_power = 169 } | |
[ 12.250629] (5)[1:swapper/0][Power/cpufreq] [60] = { .cpufreq_khz = 598000, .cpufreq_ncpu = 1, .cpufreq_power = 123 } | |
[ 12.250635] (5)[1:swapper/0][Power/cpufreq] [61] = { .cpufreq_khz = 299000, .cpufreq_ncpu = 2, .cpufreq_power = 113 } | |
[ 12.250640] (5)[1:swapper/0][Power/cpufreq] [62] = { .cpufreq_khz = 442000, .cpufreq_ncpu = 1, .cpufreq_power = 86 } | |
[ 12.250646] (5)[1:swapper/0][Power/cpufreq] [63] = { .cpufreq_khz = 299000, .cpufreq_ncpu = 1, .cpufreq_power = 56 } | |
[ 12.250654] (5)[1:swapper/0][Power/cpufreq] MT_CPU_DVFS_LITTLE freq = 819000 | |
[ 12.250679] (5)[1:swapper/0][Power/cpufreq] @_mt_cpufreq_init: limited_power_idx = 0 | |
[ 12.250683] (5)[1:swapper/0][PMIC] [register_battery_percent_notify] start | |
[ 12.250687] (5)[1:swapper/0][register_battery_percent_notify] prio_val=1 | |
[ 12.250691] (5)[1:swapper/0][PMIC] [register_battery_oc_notify] start | |
[ 12.250695] (5)[1:swapper/0][register_battery_oc_notify] prio_val=1 | |
[ 12.250699] (5)[1:swapper/0][PMIC] [register_low_battery_notify] start | |
[ 12.250703] (5)[1:swapper/0][register_low_battery_notify] prio_val=1 | |
[ 12.250718] (5)[1:swapper/0][Power/cpufreq] CPU DVFS init done! | |
[ 12.251106] (5)[1:swapper/0][cpu_ntf] <00>ffffffc0008681c4 (cpufreq_cpu_callback) | |
[ 12.251119] (5)[1:swapper/0][cpu_ntf] <00>ffffffc0003e8e70 (_mt_cpufreq_cpu_CB) | |
[ 12.251123] (5)[1:swapper/0][Power/cpufreq] CPU DVFS driver probe done | |
[ 12.251178] (5)[1:swapper/0][Power/cpufreq] CPU DVFS pdrv init done. | |
[ 12.251350] (5)[1:swapper/0][PTP] val[0]=0x11c96301 | |
[ 12.251354] (5)[1:swapper/0][PTP] val[1]=0x56003c | |
[ 12.251358] (5)[1:swapper/0][PTP] val[2]=0x11c61a70 | |
[ 12.251362] (5)[1:swapper/0][PTP] val[3]=0x5dceac | |
[ 12.251366] (5)[1:swapper/0][PTP] val[4]=0x50162 | |
[ 12.251369] (5)[1:swapper/0][PTP] val[5]=0x3 | |
[ 12.251373] (5)[1:swapper/0][PTP] val[6]=0x0 | |
[ 12.251377] (5)[1:swapper/0][PTP] val[7]=0x54000000 | |
[ 12.251381] (5)[1:swapper/0][PTP] p->PTPINITEN=0x1 | |
[ 12.251384] (5)[1:swapper/0][PTP] p->PTPMONEN=0x1 | |
[ 12.251696] (5)[1:swapper/0][PTP] Set PTP IRQ OK. | |
[ 12.251851] (5)[1:swapper/0][Power/cpufreq] _mt_cpufreq_calc_new_opp_idx(): for ptpod init, idx = 2 | |
[ 12.252138] (5)[1:swapper/0][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1200mv, freq = 1144000 KHz | |
[ 12.252160] (5)[1:swapper/0][PTP] det name=PTP_DET_CPU,det_id=0 | |
[ 12.252175] (5)[1:swapper/0][PTP] @ptp_init_det(), det->VBOOT = 80 | |
[ 12.252202] (5)[1:swapper/0][PTP] @ptp_init01(),vboot = 80 | |
[ 12.252207] -(5)[1:swapper/0][PTP] base_ops_init01(PTP_DET_CPU) start (ptp_level = 0x00000000). | |
[ 12.252341] -(5)[1:swapper/0][PTP] base_ops_init02(PTP_DET_CPU) start (ptp_level = 0x00000000). | |
[ 12.252345] -(5)[1:swapper/0][PTP] DCVOFFSETIN = 0xFFFFFE09 | |
[ 12.252349] -(5)[1:swapper/0][PTP] AGEVOFFSETIN = 0x00000000 | |
[ 12.252382] -(5)[1:swapper/0][PTP] ptp_set_ptp_volt cur_temp = 29900 | |
[ 12.252394] -(5)[1:swapper/0][PTP] base_ops_mon_mode(PTP_DET_CPU) start (ptp_level = 0x00000000). | |
[ 12.252592] (5)[1:swapper/0][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1100mv, freq = 819000 KHz | |
[ 12.253095] (5)[1:swapper/0][cpu_ntf] <00>ffffffc000401fcc (cpu_hotplug_handler) | |
[ 12.253125] (5)[1:swapper/0]<HWMSEN> hwmsen_init | |
[ 12.253128] (5)[1:swapper/0]<HWMSEN> hwmsen_probe | |
[ 12.253135] (5)[1:swapper/0]<HWMSEN> hwmsen_alloc_object | |
[ 12.253705] (5)[1:swapper/0]input: hwmdata as /devices/virtual/input/input2 | |
[ 12.253863] (5)[1:swapper/0]<HWMSEN> hwmsen_create_attr | |
[ 12.253924] (5)[1:swapper/0]<BATCHDEV> batch_probe 1039 : batch real driver init fail | |
[ 12.253930] (5)[1:swapper/0]<BATCHDEV> batch_init 1118 : failed to register batch driver | |
[ 12.253941] (5)[1:swapper/0]<ALS/PS> alsps_init | |
[ 12.253945] (5)[1:swapper/0]<ALS/PS> +++++++++++++alsps_probe!! | |
[ 12.253950] (5)[1:swapper/0]<ALS/PS> alsps_context_alloc_object++++ | |
[ 12.253955] (5)[1:swapper/0]<ALS/PS> alsps_context_alloc_object---- | |
[ 12.253959] (5)[1:swapper/0]<ALS/PS> alsps_real_driver_init + | |
[ 12.253962] (5)[1:swapper/0]<ALS/PS> alsps_real_driver_init i=0 | |
[ 12.253967] (5)[1:swapper/0]<ALS/PS> alsps try to init driver cm36686 | |
[ 12.254265] (5)[1:swapper/0][ALS/PS] cm36686_i2c_probe | |
[ 12.254387] (5)[1:swapper/0][ALS/PS] cm36686_init_client | |
[ 12.254870] (0)[1:swapper/0][ALS/PS] cm36686 ps CM36686_REG_ALS_CONF command! | |
[ 12.255338] (0)[1:swapper/0][ALS/PS] cm36686 ps CM36686_REG_PS_CONF1_2 command! | |
[ 12.255799] (1)[1:swapper/0][ALS/PS] cm36686 ps CM36686_REG_PS_CONF3_MS command! | |
[ 12.256267] (1)[1:swapper/0][ALS/PS] cm36686 ps CM36686_REG_PS_CANC command! | |
[ 12.256472] (1)[1:swapper/0][ALS/PS] cm36686_setup_eint 1087 : Cannot find alsps pinctrl default! | |
[ 12.256498] (1)[1:swapper/0][ALS/PS] ints[0] = 65, ints[1] = 0!! | |
[ 12.256523] (1)[1:swapper/0][ALS/PS] cm36686_obj->irq = 353 | |
[ 12.256661] -(1)[1:swapper/0]------------[ cut here ]------------ | |
[ 12.256676] -(1)[1:swapper/0]WARNING: CPU: 1 PID: 1 at ../kernel/irq/manage.c:454 enable_irq+0xac/0xf8() | |
[ 12.256680] -(1)[1:swapper/0]Unbalanced enable for IRQ 353 | |
[ 12.256690] -(1)[1:swapper/0]CPU: 1 PID: 1 Comm: swapper/0 Tainted: G W 3.18.99-MiSU #6 | |
[ 12.256694] -(1)[1:swapper/0]Hardware name: MT6753 (DT) | |
[ 12.256699] -(1)[1:swapper/0]Call trace: | |
[ 12.256709] -(1)[1:swapper/0][<ffffffc00008a830>] dump_backtrace+0x0/0x178 | |
[ 12.256717] -(1)[1:swapper/0][<ffffffc00008a9bc>] show_stack+0x14/0x1c | |
[ 12.256725] -(1)[1:swapper/0][<ffffffc000b34168>] dump_stack+0x88/0xac | |
[ 12.256735] -(1)[1:swapper/0][<ffffffc0000a5894>] warn_slowpath_fmt+0xcc/0x134 | |
[ 12.256742] -(1)[1:swapper/0][<ffffffc0000f6e70>] enable_irq+0xac/0xf8 | |
[ 12.256752] -(1)[1:swapper/0][<ffffffc000431434>] cm36686_setup_eint+0x224/0x274 | |
[ 12.256759] -(1)[1:swapper/0][<ffffffc0004317e4>] cm36686_i2c_probe+0x360/0x89c | |
[ 12.256769] -(1)[1:swapper/0][<ffffffc0008351bc>] i2c_device_probe+0xe8/0x144 | |
[ 12.256778] -(1)[1:swapper/0][<ffffffc0003bae90>] really_probe+0x94/0x37c | |
[ 12.256786] -(1)[1:swapper/0][<ffffffc0003bb448>] driver_probe_device+0x38/0x8c | |
[ 12.256794] -(1)[1:swapper/0][<ffffffc0003bb538>] __driver_attach+0x9c/0xa0 | |
[ 12.256801] -(1)[1:swapper/0][<ffffffc0003b9390>] bus_for_each_dev+0x64/0xb4 | |
[ 12.256809] -(1)[1:swapper/0][<ffffffc0003bb60c>] driver_attach+0x20/0x28 | |
[ 12.256816] -(1)[1:swapper/0][<ffffffc0003b9c28>] bus_add_driver+0x150/0x228 | |
[ 12.256824] -(1)[1:swapper/0][<ffffffc0003bbd28>] driver_register+0x74/0x134 | |
[ 12.256832] -(1)[1:swapper/0][<ffffffc0008369f0>] i2c_register_driver+0x38/0x110 | |
[ 12.256839] -(1)[1:swapper/0][<ffffffc00042f714>] cm36686_local_init+0x20/0x60 | |
[ 12.256847] -(1)[1:swapper/0][<ffffffc000f16ed4>] alsps_init+0x20c/0x3e8 | |
[ 12.256856] -(1)[1:swapper/0][<ffffffc000ef7d04>] do_one_initcall+0x1f8/0x214 | |
[ 12.256865] -(1)[1:swapper/0][<ffffffc000ef7e68>] kernel_init_freeable+0x148/0x1e8 | |
[ 12.256873] -(1)[1:swapper/0][<ffffffc000b2f4ec>] kernel_init+0x18/0x140 | |
[ 12.256878] -(1)[1:swapper/0]---[ end trace 9ddbe3f2e878ff38 ]--- | |
[ 12.256883] (1)[1:swapper/0][ALS/PS] cm36686_init_client() OK! | |
[ 12.256980] (1)[1:swapper/0][ALS/PS] cm36686_device misc_register OK! | |
[ 12.257161] (1)[1:swapper/0]<ALS/PS> alsps register data path vender_div: 100 | |
[ 12.257166] (1)[1:swapper/0]<ALS/PS> alsps register data path vender_div: 100 | |
[ 12.257171] (1)[1:swapper/0][ALS/PS] cm36686_i2c_probe: OK | |
[ 12.257256] (1)[1:swapper/0]<ALS/PS> alsps real driver cm36686 probe ok | |
[ 12.257260] (1)[1:swapper/0]<ALS/PS> Node of '/dev/als_ps' has already existed! | |
[ 12.257265] (1)[1:swapper/0]<ALS/PS> alsps_probe 1020 : alsps factory device already registed | |
[ 12.257470] (1)[1:swapper/0]input: m_alsps_input as /devices/virtual/input/input3 | |
[ 12.257570] (1)[1:swapper/0]<ALS/PS> ----alsps_probe OK !! | |
[ 12.257887] (5)[1:swapper/0][Gsensor] bma250_local_init | |
[ 12.257996] (5)[1:swapper/0][Gsensor] bma250_i2c_probe | |
[ 12.258185] (5)[1:swapper/0]BMA250E direction is 5 | |
[ 12.258190] (5)[1:swapper/0]bma250_init_client | |
[ 12.259122] (2)[1:swapper/0]BMA250_SetBWRate OK! | |
[ 12.260017] (2)[1:swapper/0]BMA250_SetDataFormat OK! | |
[ 12.260746] (2)[1:swapper/0]BMA250 disable interrupt ... | |
[ 12.260750] (2)[1:swapper/0]BMA250 disable interrupt function! | |
[ 12.270369] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1193mv, freq = 1300000 KHz | |
[ 12.270824] -(2)[1:swapper/0][PTP] ptp_set_ptp_volt cur_temp = 29900 | |
[ 12.281650] (2)[1:swapper/0]BMA250_SetPowerMode OK! | |
[ 12.281653] (2)[1:swapper/0]bma250_init_client OK! | |
[ 12.301282] (5)[146:kworker/u16:2][sd]msdc1 Set<50000K> src:<200000K> sclk:<50000K> timing<2> mode:0 div:1 | |
[ 12.301306] (5)[146:kworker/u16:2]mmc1: new high speed SDHC card at address 0001 | |
[ 12.301657] (1)[1:swapper/0]bma250_init_client | |
[ 12.301740] (0)[146:kworker/u16:2]mmcblk1: mmc1:0001 SD8GB 7.28 GiB | |
[ 12.302551] (1)[1:swapper/0]BMA250_SetBWRate OK! | |
[ 12.303442] (1)[1:swapper/0]BMA250_SetDataFormat OK! | |
[ 12.304189] (1)[1:swapper/0]BMA250 disable interrupt ... | |
[ 12.304192] (1)[1:swapper/0]BMA250 disable interrupt function! | |
[ 12.304194] (1)[1:swapper/0][Gsensor] Sensor power status is newest! | |
[ 12.304197] (1)[1:swapper/0]BMA250_SetPowerMode OK! | |
[ 12.304199] (1)[1:swapper/0]bma250_init_client OK! | |
[ 12.304610] (0)[146:kworker/u16:2] mmcblk1: p1 | |
[ 12.324351] (1)[1:swapper/0]<HWMSEN> hwmsen_attach | |
[ 12.324355] (1)[1:swapper/0]<HWMSEN> hwmsen_attach | |
[ 12.324358] (1)[1:swapper/0][Gsensor] bma250_i2c_probe: OK | |
[ 12.324398] (1)[1:swapper/0]i2c-core: driver [BMA250] using legacy suspend method | |
[ 12.324402] (1)[1:swapper/0]i2c-core: driver [BMA250] using legacy resume method | |
[ 12.324415] (1)[1:swapper/0]<ACCELEROMETER> acc factory device already registed | |
[ 12.324554] (1)[1:swapper/0]input: m_acc_input as /devices/virtual/input/input4 | |
[ 12.324629] (1)[1:swapper/0]BOOTPROF: 12324.625259:acc_init 66963461 ns | |
[ 12.324648] -(1)[1:swapper/0]mtk_rtc_hal_common: RTC_IRQ_EN = 0xd, RTC_PDN1 = 0x0 | |
[ 12.324653] -(1)[1:swapper/0]mtk_rtc_hal_common: rtc_spare_reg[12] = {16432, 1, 6} | |
[ 12.324660] (1)[1:swapper/0]mtk_rtc_common: There is Crystal | |
[ 12.324937] (1)[1:swapper/0][DEVAPC] module init. | |
[ 12.325356] (1)[1:swapper/0][DEVAPC] module probe. | |
[ 12.325478] (1)[1:swapper/0][DEVAPC] AO_ADDRESS ffffff8003d3c000 | |
[ 12.325581] (1)[1:swapper/0][DEVAPC] PD_ADDRESS ffffff8003d3e000, IRD: 166 | |
[ 12.325602] (1)[1:swapper/0][DEVAPC] Making SMC call to ATF. | |
[ 12.326981] (0)[1:swapper/0][MUSB]musb_gadget_pullup 2129: is_on=0, softconnect=0 ++ | |
[ 12.326986] (0)[1:swapper/0][MUSB]musb_gadget_pullup 2139: is_on=0, softconnect=0 ++ | |
[ 12.327001] (0)[1:swapper/0][MUSB]usb_cable_connected 689: usb_cable_connected vbus_exist=1 type=0 | |
[ 12.327005] (0)[1:swapper/0][MUSB]usb_cable_connected 711: usb_cable_connected, connected:0, cable_mode:1 | |
[ 12.327056] (0)[1:swapper/0]file system registered | |
[ 12.327617] (1)[1:swapper/0]Number of LUNs=8 | |
[ 12.327643] (1)[1:swapper/0]Mass Storage Function, version: 2009/09/11 | |
[ 12.327651] (1)[1:swapper/0]LUN: removable file: (no medium) | |
[ 12.327789] (1)[1:swapper/0]android_usb gadget: android_usb ready | |
[ 12.327793] (1)[1:swapper/0][MUSB]musb_gadget_start 2338: musb_gadget_start | |
[ 12.327801] (1)[1:swapper/0]musb-hdrc musb-hdrc.0.auto: MUSB HDRC host driver | |
[ 12.327819] (1)[1:swapper/0]musb-hdrc musb-hdrc.0.auto: new USB bus registered, assigned bus number 1 | |
[ 12.328292] (1)[1:swapper/0]hub 1-0:1.0: USB hub found | |
[ 12.328315] (1)[1:swapper/0]hub 1-0:1.0: 1 port detected | |
[ 12.328390] -(1)[1:swapper/0][MUSB]musb_hub_control 365: try to call musb_start in virthub | |
[ 12.329414] (1)[1:swapper/0]mtk-tpd bus:touch@: fwq Cannot find touch pinctrl default -19! | |
[ 12.329428] (1)[1:swapper/0]mtk_tpd: TPD_RES_X = 720, TPD_RES_Y = 1280 | |
[ 12.329432] (1)[1:swapper/0][HXTP] [Himax] Himax_ts I2C Touchscreen Driver local init | |
[ 12.329497] (1)[1:swapper/0][PMIC] [PMIC]regulator_is_enabled(name=VGP1 id=0 en_reg=5a2 vol_reg=65e en=1) | |
[ 12.329515] (1)[1:swapper/0][PMIC] regulator_get_voltage_sel(name=VGP1 id=0 en_reg=5a2 vol_reg=65e reg/sel:3 voltage:1800000 [0xa2c]=0xc102) | |
[ 12.329522] (1)[1:swapper/0][PMIC] regulator_set_voltage_sel(name=VGP1 id=0 en_reg=5a2 vol_reg=65e selector=5) | |
[ 12.329579] (1)[1:swapper/0]frank_zhonghua:Himax_probe_start | |
[ 12.329583] (1)[1:swapper/0]frank_zhonghua1:himax852xes_probe,5d | |
[ 12.329681] (1)[1:swapper/0]junpiao: dma_alloc_coherent | |
[ 12.329684] (1)[1:swapper/0]frank_zhonghua1_himax_client-addr = 5d | |
[ 12.329687] (1)[1:swapper/0]frank_zhonghua2_himax_client-addr = 48 | |
[ 12.329690] (1)[1:swapper/0]junpiao: i2c_set_clientdata | |
[ 12.329699] (1)[1:swapper/0][HXTP] DT-himax_parse_dt:display-coords = (0, 0)[HXTP] DT:gpio_3v3_en value is not valid | |
[ 12.329706] (1)[1:swapper/0][HXTP] DT:gpio_irq=1, gpio_rst=0, gpio_3v3_en=-2[HXTP] DT-No vk info in DT[HXTP] himax852xes_probe:panel-coords = 0, 720, 0, 1280 | |
[ 12.329813] (1)[1:swapper/0][HXTP] himax852xes_probe:display-coords = (720, 1280) | |
[ 12.329815] (1)[1:swapper/0][PMIC] [PMIC]regulator_is_enabled(name=VGP1 id=0 en_reg=5a2 vol_reg=65e en=1) | |
[ 12.425786] -(1)[137:kworker/1:1][MUSB]musb_hub_control 347: port status 00000100,devctl=0x99 | |
[ 12.544895] (0)[130:hps_main]MobiCore mcd: Cpu 7 is going to die | |
[ 12.786817] (0)[130:hps_main]CPU7: shutdown | |
[ 12.786848] (6)[187:hang_detect][Hang_Detect] hang_detect disabled. | |
[ 12.787059] (1)[1:swapper/0][HXTP] Himax IC package 852x ES | |
[ 12.789163] (0)[130:hps_main]MobiCore mcd: Cpu 7 is dead | |
[ 12.790023] (0)[130:hps_main][HPS] (0200)(8)action end(100)(300)(0)(0) (8)(8)(8)(8)(1) (0)(0)(0) (4222)(112)(0) (0)(300)(112)(0)(300) wifi_base(0) | |
[ 12.809096] (2)[1:swapper/0][HXTP] sensor_id=22. | |
[ 12.809703] (2)[1:swapper/0][HXTP] fw_ver=e3,3. | |
[ 12.810310] (2)[1:swapper/0][HXTP] config_ver=1. | |
[ 13.029484] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1012mv, freq = 299000 KHz | |
[ 13.136208] (2)[1:swapper/0][HXTP] himax_calculateChecksum 0xAD[0,1,2,3] = 0,0,0,0 | |
[ 13.137401] (2)[1:swapper/0][HXTP] himax_loadSensorConfig: TOUCH DEBUG 1 | |
[ 13.138614] (2)[1:swapper/0][HXTP] himax_power_on_initCMD: | |
[ 13.332495] (2)[1:swapper/0][HXTP] himax_touch_information:IC_TYPE =6 | |
[ 13.439651] (2)[1:swapper/0][HXTP] himax_touch_information:Touch Panel Type=0 | |
[ 13.492489] (2)[1:swapper/0][HXTP] himax_touch_information:HX_RX_NUM =13,HX_TX_NUM =23,HX_MAX_PT=10 | |
[ 13.493980] (2)[1:swapper/0][HXTP] config_ver=1. | |
[ 13.579160] (2)[1:swapper/0][HXTP] himax_loadSensorConfig: initialization complete | |
[ 13.580167] (2)[1:swapper/0][HXTP] calcDataSize: coord_data_size: 40, area_data_size:12, raw_data_frame_size:67, raw_data_nframes:1[HXTP] himax852xes_probe: calcDataSize complete | |
[ 13.581981] (2)[1:swapper/0][HXTP] himax852xes_probe: Use Protocol Type A | |
[ 13.582978] (2)[1:swapper/0][HXTP] input_set_abs_params: min_x 0, max_x 720, min_y 0, max_y 1280 | |
[ 13.584674] (2)[1:swapper/0]input: himax-touchscreen as /devices/virtual/input/input6 | |
[ 13.586198] (2)[1:swapper/0]himax_sys_self_test_init | |
[ 13.586929] (2)[1:swapper/0][HXTP] himax_sys_self_test_init success | |
[ 13.587763] (2)[1:swapper/0]Himax_interrupt = himax_ts_register_interrupt | |
[ 13.591212] (2)[1:swapper/0]hxtp:himax_touch_irq=298d | |
[ 13.591906] (0)[130:hps_main][HXTP] himax_ts_register_interrupt edge triiger falling | |
[ 13.591906] | |
[ 13.592528] (0)[130:hps_main]MobiCore mcd: Cpu 6 is going to die | |
[ 13.594455] (4)[1:swapper/0][HXTP][ERROR] deng, read_FW_version(): succeed! | |
[ 13.595968] (0)[130:hps_main]CPU6: shutdown | |
[ 13.595999] (4)[1:swapper/0]frank_zhonghua:Himax_probe_end | |
[ 13.596212] (4)[1:swapper/0][HXTP] end himax852xes_local_init, 7330 | |
[ 13.597510] (1)[219:mtk-tpd][HXTP] himax_cable_detect_func: Cable status change: 0x01 | |
[ 13.599710] (0)[130:hps_main]MobiCore mcd: Cpu 6 is dead | |
[ 13.600879] (0)[130:hps_main]MobiCore mcd: Cpu 5 is going to die | |
[ 13.601559] (4)[1:swapper/0]input: mtk-tpd as /devices/virtual/input/input5 | |
[ 13.602409] (4)[1:swapper/0]BOOTPROF: 13602.392339:tpd_device_init 1273845234 ns | |
[ 13.603673] (4)[1:swapper/0]mt-rtc mt-rtc: setting system clock to 2019-05-03 13:32:44 UTC (1556890364) | |
[ 13.603822] -(0)[0:swapper/0][Power/swap]DP: No enter --- SODI: No enter --- | |
[ 13.603872] -(0)[0:swapper/0][Power/swap]CNT(dpidle,rgidle): [0] = (0,539), [1] = (0,454), [2] = (0,479), [3] = (0,517), [4] = (0,291), [5] = (0,447), [6] = (0,384), [7] = (0,161), | |
[ 13.603897] -(0)[0:swapper/0][Power/swap]dpidle_block_cnt: [by_cpu] = 3224, [by_clk] = 0, [by_tmr] = 0, [by_oth] = 0, [by_vtg] = 0, | |
[ 13.603928] -(0)[0:swapper/0][Power/swap]dpidle_block_mask: 0x00000000, 0x00000000, 0x00000000, 0x00000000, 0x00000000, 0x00000000, 0x00000000, 0x00000000, 0x00000000, 0x00000000, | |
[ 13.612072] (0)[130:hps_main]CPU5: shutdown | |
[ 13.613374] (0)[130:hps_main]MobiCore mcd: Cpu 5 is dead | |
[ 13.613727] (4)[1:swapper/0]******** battery_dts_probe!! ******** | |
[ 13.614481] (4)[1:swapper/0]******** battery driver probe!! ******** | |
[ 13.614812] (4)[1:swapper/0][BAT_probe] adc_cali prepare : done !! | |
[ 13.614812] | |
[ 13.615274] (4)[1:swapper/0][BAT_probe] g_platform_boot_mode = 0 | |
[ 13.615274] | |
[ 13.615280] (4)[1:swapper/0][BAT_probe] power_supply_register AC Success !! | |
[ 13.615900] (4)[1:swapper/0][BAT_probe] power_supply_register USB Success !! | |
[ 13.616391] (4)[1:swapper/0][BAT_probe] power_supply_register WIRELESS Success !! | |
[ 13.617385] (4)[1:swapper/0][BAT_probe] power_supply_register Battery Success !! | |
[ 13.618196] (4)[1:swapper/0]battery_kthread_hrtimer_init : done | |
[ 13.618545] (4)[1:swapper/0][battery_probe] bat_thread_kthread Done | |
[ 13.618621] (1)[222:bat_thread_kthr][fgauge_get_profile_id]id_volt = 588 | |
[ 13.618633] (1)[222:bat_thread_kthr][fgauge_get_profile_id]Battery id (1) | |
[ 13.618659] (1)[222:bat_thread_kthr][Chip_Trim] Reg[0xCB8]=0x0, chip_diff_trim_value_4_0=0 | |
[ 13.618670] (1)[222:bat_thread_kthr][Chip_Trim] chip_diff_trim_value=1000 | |
[ 13.618733] (1)[222:bat_thread_kthr]******** [fgauge_initialization] reset HW FG! | |
[ 13.618762] (1)[222:bat_thread_kthr][fgauge_initialization] Reg[0xcba]=0x8 | |
[ 13.619037] (1)[222:bat_thread_kthr]******** [fgauge_initialization] Done! | |
[ 13.619067] (1)[222:bat_thread_kthr][oam] get_hw_ocv (pchr) : adc_result_reg=26534, adc_result=4372 | |
[ 13.619445] (4)[1:swapper/0]charger_hv_detect_sw_workaround_init : done | |
[ 13.619525] (4)[1:swapper/0]proc_create bat_proc_fops | |
[ 13.619562] (1)[222:bat_thread_kthr][dump_nter] mt6328_upmu_get_fg_nter_29_16 = 0x0 | |
[ 13.619581] (1)[222:bat_thread_kthr][dump_nter] mt6328_upmu_get_fg_nter_15_00 = 0x0 | |
[ 13.619599] (1)[222:bat_thread_kthr][dump_car] upmu_get_fg_car_31_16 = 0x0 | |
[ 13.619617] (1)[222:bat_thread_kthr][dump_car] upmu_get_fg_car_15_00 = 0x0 | |
[ 13.619639] (1)[222:bat_thread_kthr]new battery_profile[0,0] <0,4388> | |
[ 13.619653] (1)[222:bat_thread_kthr]new battery_profile[0,1] <2,4371> | |
[ 13.619666] (1)[222:bat_thread_kthr]new battery_profile[0,2] <4,4355> | |
[ 13.619680] (1)[222:bat_thread_kthr]new battery_profile[0,3] <6,4347> | |
[ 13.619705] (1)[222:bat_thread_kthr]new battery_profile[0,4] <8,4318> | |
[ 13.619718] (1)[222:bat_thread_kthr]new battery_profile[0,5] <10,4328> | |
[ 13.619732] (1)[222:bat_thread_kthr]new battery_profile[0,6] <12,4301> | |
[ 13.619745] (1)[222:bat_thread_kthr]new battery_profile[0,7] <14,4296> | |
[ 13.619759] (1)[222:bat_thread_kthr]new battery_profile[0,8] <16,4287> | |
[ 13.619772] (1)[222:bat_thread_kthr]new battery_profile[0,9] <18,4279> | |
[ 13.619786] (1)[222:bat_thread_kthr]new battery_profile[0,10] <20,4273> | |
[ 13.619800] (1)[222:bat_thread_kthr]new battery_profile[0,11] <22,4250> | |
[ 13.619814] (1)[222:bat_thread_kthr]new battery_profile[0,12] <24,4258> | |
[ 13.619828] (1)[222:bat_thread_kthr]new battery_profile[0,13] <26,4237> | |
[ 13.619842] (1)[222:bat_thread_kthr]new battery_profile[0,14] <28,4232> | |
[ 13.619855] (1)[222:bat_thread_kthr]new battery_profile[0,15] <30,4224> | |
[ 13.619869] (1)[222:bat_thread_kthr]new battery_profile[0,16] <32,4216> | |
[ 13.619883] (1)[222:bat_thread_kthr]new battery_profile[0,17] <34,4211> | |
[ 13.619896] (1)[222:bat_thread_kthr]new battery_profile[0,18] <36,4189> | |
[ 13.619910] (1)[222:bat_thread_kthr]new battery_profile[0,19] <38,4197> | |
[ 13.619924] (1)[222:bat_thread_kthr]new battery_profile[0,20] <40,4176> | |
[ 13.619938] (1)[222:bat_thread_kthr]new battery_profile[0,21] <42,4171> | |
[ 13.619951] (1)[222:bat_thread_kthr]new battery_profile[0,22] <44,4164> | |
[ 13.619965] (1)[222:bat_thread_kthr]new battery_profile[0,23] <46,4157> | |
[ 13.619979] (1)[222:bat_thread_kthr]new battery_profile[0,24] <48,4152> | |
[ 13.619993] (1)[222:bat_thread_kthr]new battery_profile[0,25] <50,4132> | |
[ 13.620007] (1)[222:bat_thread_kthr]new battery_profile[0,26] <52,4139> | |
[ 13.620021] (1)[222:bat_thread_kthr]new battery_profile[0,27] <54,4119> | |
[ 13.620035] (1)[222:bat_thread_kthr]new battery_profile[0,28] <56,4114> | |
[ 13.620048] (1)[222:bat_thread_kthr]new battery_profile[0,29] <58,4107> | |
[ 13.620062] (1)[222:bat_thread_kthr]new battery_profile[0,30] <60,4100> | |
[ 13.620076] (1)[222:bat_thread_kthr]new battery_profile[0,31] <62,4093> | |
[ 13.620089] (1)[222:bat_thread_kthr]new battery_profile[0,32] <64,4087> | |
[ 13.620103] (1)[222:bat_thread_kthr]new battery_profile[0,33] <66,4083> | |
[ 13.620117] (1)[222:bat_thread_kthr]new battery_profile[0,34] <68,4065> | |
[ 13.620131] (1)[222:bat_thread_kthr]new battery_profile[0,35] <70,4071> | |
[ 13.620145] (1)[222:bat_thread_kthr]new battery_profile[0,36] <72,4052> | |
[ 13.620158] (1)[222:bat_thread_kthr]new battery_profile[0,37] <74,4047> | |
[ 13.620172] (1)[222:bat_thread_kthr]new battery_profile[0,38] <76,4037> | |
[ 13.620186] (1)[222:bat_thread_kthr]new battery_profile[0,39] <78,4028> | |
[ 13.620200] (1)[222:bat_thread_kthr]new battery_profile[0,40] <80,4021> | |
[ 13.620214] (1)[222:bat_thread_kthr]new battery_profile[0,41] <82,3992> | |
[ 13.620227] (1)[222:bat_thread_kthr]new battery_profile[0,42] <84,4002> | |
[ 13.620241] (1)[222:bat_thread_kthr]new battery_profile[0,43] <86,3978> | |
[ 13.620255] (1)[222:bat_thread_kthr]new battery_profile[0,44] <88,3973> | |
[ 13.620269] (1)[222:bat_thread_kthr]new battery_profile[0,45] <90,3966> | |
[ 13.620282] (1)[222:bat_thread_kthr]new battery_profile[0,46] <92,3960> | |
[ 13.620296] (1)[222:bat_thread_kthr]new battery_profile[0,47] <94,3956> | |
[ 13.620310] (1)[222:bat_thread_kthr]new battery_profile[0,48] <96,3941> | |
[ 13.620324] (1)[222:bat_thread_kthr]new battery_profile[0,49] <98,3946> | |
[ 13.620337] (1)[222:bat_thread_kthr]new battery_profile[0,50] <100,3928> | |
[ 13.620352] (1)[222:bat_thread_kthr]new battery_profile[1,0] <0,4371> | |
[ 13.620365] (1)[222:bat_thread_kthr]new battery_profile[1,1] <2,4347> | |
[ 13.620379] (1)[222:bat_thread_kthr]new battery_profile[1,2] <4,4328> | |
[ 13.620392] (1)[222:bat_thread_kthr]new battery_profile[1,3] <6,4322> | |
[ 13.620405] (1)[222:bat_thread_kthr]new battery_profile[1,4] <8,4301> | |
[ 13.620419] (1)[222:bat_thread_kthr]new battery_profile[1,5] <10,4285> | |
[ 13.620433] (1)[222:bat_thread_kthr]new battery_profile[1,6] <12,4269> | |
[ 13.620447] (1)[222:bat_thread_kthr]new battery_profile[1,7] <14,4253> | |
[ 13.620460] (1)[222:bat_thread_kthr]new battery_profile[1,8] <16,4238> | |
[ 13.620474] (1)[222:bat_thread_kthr]new battery_profile[1,9] <18,4220> | |
[ 13.620487] (1)[222:bat_thread_kthr]new battery_profile[1,10] <20,4215> | |
[ 13.620501] (1)[222:bat_thread_kthr]new battery_profile[1,11] <22,4200> | |
[ 13.620515] (1)[222:bat_thread_kthr]new battery_profile[1,12] <24,4185> | |
[ 13.620529] (1)[222:bat_thread_kthr]new battery_profile[1,13] <26,4171> | |
[ 13.620543] (1)[222:bat_thread_kthr]new battery_profile[1,14] <28,4156> | |
[ 13.620557] (1)[222:bat_thread_kthr]new battery_profile[1,15] <30,4151> | |
[ 13.620570] (1)[222:bat_thread_kthr]new battery_profile[1,16] <32,4134> | |
[ 13.620584] (1)[222:bat_thread_kthr]new battery_profile[1,17] <34,4120> | |
[ 13.620598] (1)[222:bat_thread_kthr]new battery_profile[1,18] <36,4106> | |
[ 13.620611] (1)[222:bat_thread_kthr]new battery_profile[1,19] <38,4092> | |
[ 13.620625] (1)[222:bat_thread_kthr]new battery_profile[1,20] <40,4079> | |
[ 13.620639] (1)[222:bat_thread_kthr]new battery_profile[1,21] <42,4065> | |
[ 13.620653] (1)[222:bat_thread_kthr]new battery_profile[1,22] <44,4062> | |
[ 13.620677] (1)[222:bat_thread_kthr]new battery_profile[1,23] <46,4048> | |
[ 13.620691] (1)[222:bat_thread_kthr]new battery_profile[1,24] <48,4030> | |
[ 13.620705] (1)[222:bat_thread_kthr]new battery_profile[1,25] <50,4011> | |
[ 13.620718] (1)[222:bat_thread_kthr]new battery_profile[1,26] <52,3994> | |
[ 13.620732] (1)[222:bat_thread_kthr]new battery_profile[1,27] <54,3989> | |
[ 13.620746] (1)[222:bat_thread_kthr]new battery_profile[1,28] <56,3975> | |
[ 13.620760] (1)[222:bat_thread_kthr]new battery_profile[1,29] <58,3965> | |
[ 13.620774] (1)[222:bat_thread_kthr]new battery_profile[1,30] <60,3956> | |
[ 13.620786] (4)[1:swapper/0]******** mt_batteryNotify_dts_probe!! ******** | |
[ 13.620800] (1)[222:bat_thread_kthr]new battery_profile[1,31] <62,3946> | |
[ 13.620814] (1)[222:bat_thread_kthr]new battery_profile[1,32] <64,3934> | |
[ 13.620828] (1)[222:bat_thread_kthr]new battery_profile[1,33] <66,3920> | |
[ 13.620842] (1)[222:bat_thread_kthr]new battery_profile[1,34] <68,3916> | |
[ 13.620855] (1)[222:bat_thread_kthr]new battery_profile[1,35] <70,3902> | |
[ 13.620869] (1)[222:bat_thread_kthr]new battery_profile[1,36] <72,3890> | |
[ 13.620882] (1)[222:bat_thread_kthr]new battery_profile[1,37] <74,3878> | |
[ 13.620896] (1)[222:bat_thread_kthr]new battery_profile[1,38] <76,3867> | |
[ 13.620910] (1)[222:bat_thread_kthr]new battery_profile[1,39] <78,3864> | |
[ 13.620924] (1)[222:bat_thread_kthr]new battery_profile[1,40] <80,3854> | |
[ 13.620938] (1)[222:bat_thread_kthr]new battery_profile[1,41] <82,3846> | |
[ 13.620951] (1)[222:bat_thread_kthr]new battery_profile[1,42] <84,3838> | |
[ 13.620965] (1)[222:bat_thread_kthr]new battery_profile[1,43] <86,3832> | |
[ 13.620979] (1)[222:bat_thread_kthr]new battery_profile[1,44] <88,3826> | |
[ 13.620992] (1)[222:bat_thread_kthr]new battery_profile[1,45] <90,3819> | |
[ 13.621006] (1)[222:bat_thread_kthr]new battery_profile[1,46] <92,3817> | |
[ 13.621020] (1)[222:bat_thread_kthr]new battery_profile[1,47] <94,3813> | |
[ 13.621034] (1)[222:bat_thread_kthr]new battery_profile[1,48] <96,3808> | |
[ 13.621047] (1)[222:bat_thread_kthr]new battery_profile[1,49] <98,3803> | |
[ 13.621061] (1)[222:bat_thread_kthr]new battery_profile[1,50] <100,3798> | |
[ 13.621075] (1)[222:bat_thread_kthr]new battery_profile[2,0] <0,4369> | |
[ 13.621089] (1)[222:bat_thread_kthr]new battery_profile[2,1] <2,4340> | |
[ 13.621102] (1)[222:bat_thread_kthr]new battery_profile[2,2] <4,4314> | |
[ 13.621115] (1)[222:bat_thread_kthr]new battery_profile[2,3] <6,4288> | |
[ 13.621128] (1)[222:bat_thread_kthr]new battery_profile[2,4] <8,4264> | |
[ 13.621142] (1)[222:bat_thread_kthr]new battery_profile[2,5] <10,4249> | |
[ 13.621156] (1)[222:bat_thread_kthr]new battery_profile[2,6] <12,4217> | |
[ 13.621169] (1)[222:bat_thread_kthr]new battery_profile[2,7] <14,4202> | |
[ 13.621183] (1)[222:bat_thread_kthr]new battery_profile[2,8] <16,4172> | |
[ 13.621196] (1)[222:bat_thread_kthr]new battery_profile[2,9] <18,4157> | |
[ 13.621210] (1)[222:bat_thread_kthr]new battery_profile[2,10] <20,4135> | |
[ 13.621224] (1)[222:bat_thread_kthr]new battery_profile[2,11] <22,4113> | |
[ 13.621238] (1)[222:bat_thread_kthr]new battery_profile[2,12] <24,4092> | |
[ 13.621251] (1)[222:bat_thread_kthr]new battery_profile[2,13] <26,4071> | |
[ 13.621265] (1)[222:bat_thread_kthr]new battery_profile[2,14] <28,4053> | |
[ 13.621279] (1)[222:bat_thread_kthr]new battery_profile[2,15] <30,4032> | |
[ 13.621292] (1)[222:bat_thread_kthr]new battery_profile[2,16] <32,4009> | |
[ 13.621306] (1)[222:bat_thread_kthr]new battery_profile[2,17] <34,3993> | |
[ 13.621320] (1)[222:bat_thread_kthr]new battery_profile[2,18] <36,3984> | |
[ 13.621333] (1)[222:bat_thread_kthr]new battery_profile[2,19] <38,3963> | |
[ 13.621347] (1)[222:bat_thread_kthr]new battery_profile[2,20] <40,3953> | |
[ 13.621360] (1)[222:bat_thread_kthr]new battery_profile[2,21] <42,3931> | |
[ 13.621374] (1)[222:bat_thread_kthr]new battery_profile[2,22] <44,3919> | |
[ 13.621387] (1)[222:bat_thread_kthr]new battery_profile[2,23] <46,3891> | |
[ 13.621401] (1)[222:bat_thread_kthr]new battery_profile[2,24] <48,3877> | |
[ 13.621415] (1)[222:bat_thread_kthr]new battery_profile[2,25] <50,3859> | |
[ 13.621429] (1)[222:bat_thread_kthr]new battery_profile[2,26] <52,3846> | |
[ 13.621442] (1)[222:bat_thread_kthr]new battery_profile[2,27] <54,3835> | |
[ 13.621456] (1)[222:bat_thread_kthr]new battery_profile[2,28] <56,3826> | |
[ 13.621470] (1)[222:bat_thread_kthr]new battery_profile[2,29] <58,3818> | |
[ 13.621484] (1)[222:bat_thread_kthr]new battery_profile[2,30] <60,3810> | |
[ 13.621497] (1)[222:bat_thread_kthr]new battery_profile[2,31] <62,3805> | |
[ 13.621511] (1)[222:bat_thread_kthr]new battery_profile[2,32] <64,3797> | |
[ 13.621525] (1)[222:bat_thread_kthr]new battery_profile[2,33] <66,3793> | |
[ 13.621539] (1)[222:bat_thread_kthr]new battery_profile[2,34] <68,3786> | |
[ 13.621552] (1)[222:bat_thread_kthr]new battery_profile[2,35] <70,3782> | |
[ 13.621566] (1)[222:bat_thread_kthr]new battery_profile[2,36] <72,3776> | |
[ 13.621580] (4)[1:swapper/0]******** mt_batteryNotify_probe!! ******** | |
[ 13.621593] (1)[222:bat_thread_kthr]new battery_profile[2,37] <74,3773> | |
[ 13.621607] (1)[222:bat_thread_kthr]new battery_profile[2,38] <76,3768> | |
[ 13.621621] (1)[222:bat_thread_kthr]new battery_profile[2,39] <78,3763> | |
[ 13.621645] (1)[222:bat_thread_kthr]new battery_profile[2,40] <80,3754> | |
[ 13.621659] (1)[222:bat_thread_kthr]new battery_profile[2,41] <82,3746> | |
[ 13.621672] (1)[222:bat_thread_kthr]new battery_profile[2,42] <84,3738> | |
[ 13.621686] (1)[222:bat_thread_kthr]new battery_profile[2,43] <86,3724> | |
[ 13.621700] (1)[222:bat_thread_kthr]new battery_profile[2,44] <88,3715> | |
[ 13.621710] (4)[1:swapper/0]proc_create battery_cmd_proc_fops | |
[ 13.621723] (1)[222:bat_thread_kthr]new battery_profile[2,45] <90,3693> | |
[ 13.621737] (1)[222:bat_thread_kthr]new battery_profile[2,46] <92,3690> | |
[ 13.621746] (4)[1:swapper/0]proc_create current_cmd_proc_fops | |
[ 13.621759] (1)[222:bat_thread_kthr]new battery_profile[2,47] <94,3688> | |
[ 13.621774] (1)[222:bat_thread_kthr]new battery_profile[2,48] <96,3686> | |
[ 13.621783] (4)[1:swapper/0]proc_create discharging_cmd_proc_fops | |
[ 13.621796] (1)[222:bat_thread_kthr]new battery_profile[2,49] <98,3639> | |
[ 13.621805] (4)[1:swapper/0]******** mtk_battery_cmd!! ******** | |
[ 13.621818] (1)[222:bat_thread_kthr]new battery_profile[2,50] <100,3563> | |
[ 13.621833] (1)[222:bat_thread_kthr]new battery_profile[3,0] <0,4377> | |
[ 13.621846] (1)[222:bat_thread_kthr]new battery_profile[3,1] <2,4333> | |
[ 13.621859] (1)[222:bat_thread_kthr]new battery_profile[3,2] <4,4306> | |
[ 13.621873] (1)[222:bat_thread_kthr]new battery_profile[3,3] <6,4281> | |
[ 13.621886] (1)[222:bat_thread_kthr]new battery_profile[3,4] <8,4257> | |
[ 13.621899] (1)[222:bat_thread_kthr]new battery_profile[3,5] <10,4241> | |
[ 13.621913] (1)[222:bat_thread_kthr]new battery_profile[3,6] <12,4210> | |
[ 13.621926] (1)[222:bat_thread_kthr]new battery_profile[3,7] <14,4194> | |
[ 13.621940] (1)[222:bat_thread_kthr]new battery_profile[3,8] <16,4164> | |
[ 13.621953] (1)[222:bat_thread_kthr]new battery_profile[3,9] <18,4149> | |
[ 13.621967] (1)[222:bat_thread_kthr]new battery_profile[3,10] <20,4127> | |
[ 13.621981] (1)[222:bat_thread_kthr]new battery_profile[3,11] <22,4106> | |
[ 13.621995] (1)[222:bat_thread_kthr]new battery_profile[3,12] <24,4084> | |
[ 13.622008] (1)[222:bat_thread_kthr]new battery_profile[3,13] <26,4064> | |
[ 13.622022] (1)[222:bat_thread_kthr]new battery_profile[3,14] <28,4044> | |
[ 13.622036] (1)[222:bat_thread_kthr]new battery_profile[3,15] <30,4025> | |
[ 13.622049] (1)[222:bat_thread_kthr]new battery_profile[3,16] <32,4007> | |
[ 13.622063] (1)[222:bat_thread_kthr]new battery_profile[3,17] <34,3990> | |
[ 13.622076] (1)[222:bat_thread_kthr]new battery_profile[3,18] <36,3978> | |
[ 13.622090] (1)[222:bat_thread_kthr]new battery_profile[3,19] <38,3957> | |
[ 13.622104] (1)[222:bat_thread_kthr]new battery_profile[3,20] <40,3947> | |
[ 13.622118] (1)[222:bat_thread_kthr]new battery_profile[3,21] <42,3927> | |
[ 13.622132] (1)[222:bat_thread_kthr]new battery_profile[3,22] <44,3916> | |
[ 13.622145] (1)[222:bat_thread_kthr]new battery_profile[3,23] <46,3888> | |
[ 13.622159] (1)[222:bat_thread_kthr]new battery_profile[3,24] <48,3872> | |
[ 13.622172] (1)[222:bat_thread_kthr]new battery_profile[3,25] <50,3855> | |
[ 13.622186] (1)[222:bat_thread_kthr]new battery_profile[3,26] <52,3843> | |
[ 13.622200] (1)[222:bat_thread_kthr]new battery_profile[3,27] <54,3832> | |
[ 13.622214] (1)[222:bat_thread_kthr]new battery_profile[3,28] <56,3823> | |
[ 13.622228] (1)[222:bat_thread_kthr]new battery_profile[3,29] <58,3814> | |
[ 13.622241] (1)[222:bat_thread_kthr]new battery_profile[3,30] <60,3807> | |
[ 13.622255] (1)[222:bat_thread_kthr]new battery_profile[3,31] <62,3802> | |
[ 13.622269] (1)[222:bat_thread_kthr]new battery_profile[3,32] <64,3793> | |
[ 13.622282] (1)[222:bat_thread_kthr]new battery_profile[3,33] <66,3789> | |
[ 13.622296] (1)[222:bat_thread_kthr]new battery_profile[3,34] <68,3781> | |
[ 13.622309] (1)[222:bat_thread_kthr]new battery_profile[3,35] <70,3778> | |
[ 13.622323] (1)[222:bat_thread_kthr]new battery_profile[3,36] <72,3769> | |
[ 13.622337] (1)[222:bat_thread_kthr]new battery_profile[3,37] <74,3760> | |
[ 13.622350] (1)[222:bat_thread_kthr]new battery_profile[3,38] <76,3750> | |
[ 13.622364] (1)[222:bat_thread_kthr]new battery_profile[3,39] <78,3743> | |
[ 13.622377] (1)[222:bat_thread_kthr]new battery_profile[3,40] <80,3734> | |
[ 13.622391] (1)[222:bat_thread_kthr]new battery_profile[3,41] <82,3726> | |
[ 13.622405] (1)[222:bat_thread_kthr]new battery_profile[3,42] <84,3717> | |
[ 13.622484] (1)[222:bat_thread_kthr]new battery_profile[3,43] <86,3703> | |
[ 13.622495] (4)[1:swapper/0]****[battery_driver] Initialization : DONE !! | |
[ 13.622509] (1)[222:bat_thread_kthr]new battery_profile[3,44] <88,3694> | |
[ 13.622524] (1)[222:bat_thread_kthr]new battery_profile[3,45] <90,3675> | |
[ 13.622537] (1)[222:bat_thread_kthr]new battery_profile[3,46] <92,3674> | |
[ 13.622551] (1)[222:bat_thread_kthr]new battery_profile[3,47] <94,3672> | |
[ 13.622565] (1)[222:bat_thread_kthr]new battery_profile[3,48] <96,3670> | |
[ 13.622579] (1)[222:bat_thread_kthr]new battery_profile[3,49] <98,3585> | |
[ 13.622593] (1)[222:bat_thread_kthr]new battery_profile[3,50] <100,3498> | |
[ 13.624995] (1)[222:bat_thread_kthr][force_get_tbat] 808,807,1,195,10,29 | |
[ 13.629260] (1)[222:bat_thread_kthr][FGADC] compensate_battery_voltage, voltage=4382 | |
[ 13.629273] (1)[222:bat_thread_kthr][fgauge_initialization] gFG_DOD0 =0 100 | |
[ 13.629295] (1)[222:bat_thread_kthr][fgauge_initialization] Done HW_OCV:4372 FG_Current:1122 FG_CAR:0 tmp=29 capacity=100 Qmax=2194 | |
[ 13.824382] (0)[130:hps_main]MobiCore mcd: Cpu 4 is going to die | |
[ 13.827121] (0)[130:hps_main]CPU4: shutdown | |
[ 13.828394] (0)[130:hps_main]MobiCore mcd: Cpu 4 is dead | |
[ 13.829594] (0)[130:hps_main]MobiCore mcd: Cpu 3 is going to die | |
[ 13.832003] (0)[130:hps_main]CPU3: shutdown | |
[ 13.833204] (0)[130:hps_main]MobiCore mcd: Cpu 3 is dead | |
[ 13.834316] (0)[130:hps_main]MobiCore mcd: Cpu 2 is going to die | |
[ 13.836758] (1)[130:hps_main]CPU2: shutdown | |
[ 13.838106] (1)[130:hps_main]MobiCore mcd: Cpu 2 is dead | |
[ 13.839255] (1)[130:hps_main]MobiCore mcd: Cpu 1 is going to die | |
[ 13.841548] (0)[130:hps_main]CPU1: shutdown | |
[ 13.842956] (0)[130:hps_main]MobiCore mcd: Cpu 1 is dead | |
[ 13.843963] (0)[130:hps_main][HPS] (0200)(7)action end(15)(15)(0)(0) (8)(8)(8)(8)(1) (17)(8)(0) (509)(8)(0) (0)(15)(8)(0)(15) wifi_base(0) | |
[ 13.845593] (0)[130:hps_main][HPS] (0200)(7)DBG_HRT(15)(15)(0)(0) (8)(8)(8)(8)(1) (0)(0)(0) (0)(0)(0) (0)(0)(0)(0)(15) wifi_base(0) | |
[ 13.851276] (0)[228:wdtk-0][WDK], local_bit:0x0, cpu:0,RT[13851257339] | |
[ 13.851299] (0)[228:wdtk-0][WDK], local_bit:0x1, cpu:0, check bit0x:ff, lasthpg_cpu:0, lasthpg_act:1, lasthpg_t:13847342647, RT[13851280109] | |
[ 13.851337] (0)[228:wdtk-0][thread:228][RT:13851305955] 2019-05-03 13:32:44.747957 UTC;android time 2019-05-03 13:32:44.747957 | |
[ 13.878670] (0)[1:swapper/0][WDK] WDT start kicker done CPU_NR=8 | |
[ 13.879627] (0)[1:swapper/0][cpu_ntf] <00>ffffffc00084bdf8 (wk_cpu_callback) | |
[ 13.880769] (0)[1:swapper/0][WDK]init_wk done late_initcall cpus_kick_bit=0x1 ----- | |
[ 13.881798] (0)[1:swapper/0]BOOTPROF: 13881.784724:init_wk 259242770 ns | |
[ 13.884119] (0)[1:swapper/0][PMIC] [PMIC]regulator_is_enabled(name=VAUD28 id=0 en_reg=4f9 vol_reg=0 en=1) | |
[ 13.885369] (0)[1:swapper/0]vaud28: disabling | |
[ 13.886006] (0)[1:swapper/0][PMIC] regulator name=VAUD28 should not disable( use_count=0) | |
[ 13.887080] (0)[1:swapper/0]vaud28: couldn't disable: -1 | |
[ 13.887807] (0)[1:swapper/0][PMIC] [PMIC]regulator_is_enabled(name=VCN28 id=0 en_reg=527 vol_reg=0 en=0) | |
[ 13.889056] (0)[1:swapper/0][PMIC] [PMIC]regulator_is_enabled(name=VCAMA id=0 en_reg=520 vol_reg=63a en=0) | |
[ 13.890390] (0)[1:swapper/0][PMIC] [PMIC]regulator_is_enabled(name=VCN33_BT id=0 en_reg=53e vol_reg=63d en=0) | |
[ 13.891836] (0)[1:swapper/0][PMIC] [PMIC]regulator_is_enabled(name=VCN33_WIFI id=0 en_reg=53b vol_reg=63d en=0) | |
[ 13.893202] (0)[1:swapper/0][PMIC] [PMIC]regulator_is_enabled(name=VCAMAF id=0 en_reg=598 vol_reg=656 en=0) | |
[ 13.894486] (0)[1:swapper/0][PMIC] [PMIC]regulator_is_enabled(name=VIBR id=0 en_reg=5df vol_reg=659 en=0) | |
[ 13.895744] (0)[1:swapper/0][PMIC] [PMIC]regulator_is_enabled(name=VCAMD id=0 en_reg=5f6 vol_reg=666 en=0) | |
[ 13.897046] (0)[1:swapper/0][PMIC] [PMIC]regulator_is_enabled(name=VCN18 id=0 en_reg=5ea vol_reg=0 en=0) | |
[ 13.898293] (0)[1:swapper/0][PMIC] [PMIC]regulator_is_enabled(name=VCAMIO id=0 en_reg=600 vol_reg=672 en=0) | |
[ 13.899602] (0)[1:swapper/0][PMIC] [PMIC]regulator_is_enabled(name=VSRAM id=0 en_reg=60a vol_reg=677 en=1) | |
[ 13.900873] (0)[1:swapper/0]vsram: disabling | |
[ 13.901456] (0)[1:swapper/0][PMIC] regulator name=VSRAM should not disable( use_count=0) | |
[ 13.902785] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1162mv, freq = 1300000 KHz | |
[ 13.902841] (0)[1:swapper/0]vsram: couldn't disable: -1 | |
[ 13.903530] (0)[1:swapper/0][PMIC] [PMIC]regulator_is_enabled(name=VM id=0 en_reg=61f vol_reg=663 en=1) | |
[ 13.904738] (0)[1:swapper/0]vm: disabling | |
[ 13.905280] (0)[1:swapper/0][PMIC] regulator name=VM should not disable( use_count=0) | |
[ 13.906310] (0)[1:swapper/0]vm: couldn't disable: -1 | |
[ 13.906968] (0)[1:swapper/0]BOOTPROF: 13906.964570:regulator_init_complete 22877769 ns | |
[ 13.908727] -(0)[1:swapper/0][DFS]dfs_dummy_buffer va: 0xffffffc0013cc000, dst_pa: 0x413cc000, size: 256 | |
[ 13.910006] (0)[1:swapper/0][VcoreFS] [late_init_to_lowpwr_opp] feature_en: 1, late_init_opp: 1 | |
[ 13.911152] (0)[1:swapper/0]ALSA device list: | |
[ 13.911725] (0)[1:swapper/0] #0: mt-snd-card | |
[ 13.912737] (0)[1:swapper/0]Freeing unused kernel memory: 356K | |
[ 13.913523] (0)[1:swapper/0]Freeing alternatives memory: 52K | |
[ 13.914285] (0)[1:swapper/0]BOOTPROF: 13914.281955:Kernel_init_done | |
[ 13.917976] (0)[1:init]init: init first stage started! | |
[ 13.918942] (0)[1:init]init: Using Android DT directory /proc/device-tree/firmware/android/ | |
[ 13.947578] -(1)[0:swapper/1]CPU1: Booted secondary processor | |
[ 13.947597] -(1)[0:swapper/1]Detected VIPT I-cache on CPU1 | |
[ 13.947707] -(1)[0:swapper/1]CPU1: update cpu_capacity 1024 | |
[ 13.948455] -(2)[0:swapper/2]CPU2: Booted secondary processor | |
[ 13.948468] -(2)[0:swapper/2]Detected VIPT I-cache on CPU2 | |
[ 13.948574] -(2)[0:swapper/2]CPU2: update cpu_capacity 1024 | |
[ 13.948999] (0)[130:hps_main][HPS] (0020)(1)action end(116)(204)(0)(0) (8)(8)(8)(8)(1) (0)(0)(0) (0)(0)(0) (1)(204)(1)(0)(204) wifi_base(0) | |
[ 14.016715] (1)[1:init]EXT4-fs (mmcblk0p45): barriers disabled | |
[ 14.018361] (1)[1:init]EXT4-fs (mmcblk0p45): mounted filesystem with ordered data mode. Opts: lazytime,barrier=0 | |
[ 14.019796] (1)[1:init]init: [libfs_mgr]__mount(source=/dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/system,target=/system,type=ext4)=0: Success | |
[ 14.032509] (1)[1:init]init: Skipped setting INIT_AVB_VERSION (not in recovery mode) | |
[ 14.033523] (1)[1:init]init: Loading SELinux policy | |
[ 14.042114] (1)[1:init]SELinux: 2048 avtab hash slots, 13009 rules. | |
[ 14.048858] (1)[1:init]SELinux: 2048 avtab hash slots, 13009 rules. | |
[ 14.048884] (1)[1:init]SELinux: 1 users, 4 roles, 1197 types, 0 bools, 1 sens, 1024 cats | |
[ 14.048894] (1)[1:init]SELinux: 92 classes, 13009 rules | |
[ 14.051648] (1)[1:init]SELinux: Permission transition in class filesystem not defined in policy. | |
[ 14.052848] (1)[1:init]SELinux: Permission swapon in class file not defined in policy. | |
[ 14.053887] (1)[1:init]SELinux: Permission swapon in class dir not defined in policy. | |
[ 14.054919] (1)[1:init]SELinux: Permission swapon in class lnk_file not defined in policy. | |
[ 14.056020] (1)[1:init]SELinux: Permission swapon in class chr_file not defined in policy. | |
[ 14.057099] (1)[1:init]SELinux: Permission swapon in class blk_file not defined in policy. | |
[ 14.058185] (1)[1:init]SELinux: Permission swapon in class sock_file not defined in policy. | |
[ 14.059290] (1)[1:init]SELinux: Permission swapon in class fifo_file not defined in policy. | |
[ 14.060387] (1)[1:init]SELinux: Permission recv_msg in class socket not defined in policy. | |
[ 14.061460] (1)[1:init]SELinux: Permission send_msg in class socket not defined in policy. | |
[ 14.062558] (1)[1:init]SELinux: Permission recv_msg in class tcp_socket not defined in policy. | |
[ 14.063675] (1)[1:init]SELinux: Permission send_msg in class tcp_socket not defined in policy. | |
[ 14.064803] (1)[1:init]SELinux: Permission connectto in class tcp_socket not defined in policy. | |
[ 14.065948] (1)[1:init]SELinux: Permission newconn in class tcp_socket not defined in policy. | |
[ 14.067059] (1)[1:init]SELinux: Permission acceptfrom in class tcp_socket not defined in policy. | |
[ 14.068216] (1)[1:init]SELinux: Permission recv_msg in class udp_socket not defined in policy. | |
[ 14.069345] (1)[1:init]SELinux: Permission send_msg in class udp_socket not defined in policy. | |
[ 14.070471] (1)[1:init]SELinux: Permission recv_msg in class rawip_socket not defined in policy. | |
[ 14.071614] (1)[1:init]SELinux: Permission send_msg in class rawip_socket not defined in policy. | |
[ 14.072774] (1)[1:init]SELinux: Permission tcp_recv in class node not defined in policy. | |
[ 14.073827] (1)[1:init]SELinux: Permission tcp_send in class node not defined in policy. | |
[ 14.074889] (1)[1:init]SELinux: Permission udp_recv in class node not defined in policy. | |
[ 14.075965] (1)[1:init]SELinux: Permission udp_send in class node not defined in policy. | |
[ 14.077016] (1)[1:init]SELinux: Permission rawip_recv in class node not defined in policy. | |
[ 14.078101] (1)[1:init]SELinux: Permission rawip_send in class node not defined in policy. | |
[ 14.079192] (1)[1:init]SELinux: Permission enforce_dest in class node not defined in policy. | |
[ 14.080292] (1)[1:init]SELinux: Permission dccp_recv in class node not defined in policy. | |
[ 14.081365] (1)[1:init]SELinux: Permission dccp_send in class node not defined in policy. | |
[ 14.082450] (1)[1:init]SELinux: Permission tcp_recv in class netif not defined in policy. | |
[ 14.083513] (1)[1:init]SELinux: Permission tcp_send in class netif not defined in policy. | |
[ 14.084586] (1)[1:init]SELinux: Permission udp_recv in class netif not defined in policy. | |
[ 14.085660] (1)[1:init]SELinux: Permission udp_send in class netif not defined in policy. | |
[ 14.086742] (1)[1:init]SELinux: Permission rawip_recv in class netif not defined in policy. | |
[ 14.087829] (1)[1:init]SELinux: Permission rawip_send in class netif not defined in policy. | |
[ 14.088925] (1)[1:init]SELinux: Permission dccp_recv in class netif not defined in policy. | |
[ 14.090018] (1)[1:init]SELinux: Permission dccp_send in class netif not defined in policy. | |
[ 14.091101] (1)[1:init]SELinux: Permission recv_msg in class netlink_socket not defined in policy. | |
[ 14.092266] (1)[1:init]SELinux: Permission send_msg in class netlink_socket not defined in policy. | |
[ 14.093451] (1)[1:init]SELinux: Permission recv_msg in class packet_socket not defined in policy. | |
[ 14.094600] (1)[1:init]SELinux: Permission send_msg in class packet_socket not defined in policy. | |
[ 14.095777] (1)[1:init]SELinux: Permission recv_msg in class key_socket not defined in policy. | |
[ 14.096894] (1)[1:init]SELinux: Permission send_msg in class key_socket not defined in policy. | |
[ 14.098028] (1)[1:init]SELinux: Permission recv_msg in class unix_stream_socket not defined in policy. | |
[ 14.099245] (1)[1:init]SELinux: Permission send_msg in class unix_stream_socket not defined in policy. | |
[ 14.100452] (1)[1:init]SELinux: Permission newconn in class unix_stream_socket not defined in policy. | |
[ 14.101655] (1)[1:init]SELinux: Permission acceptfrom in class unix_stream_socket not defined in policy. | |
[ 14.102905] (1)[1:init]SELinux: Permission recv_msg in class unix_dgram_socket not defined in policy. | |
[ 14.104097] (1)[1:init]SELinux: Permission send_msg in class unix_dgram_socket not defined in policy. | |
[ 14.105324] (1)[1:init]SELinux: Permission recv_msg in class netlink_route_socket not defined in policy. | |
[ 14.106556] (1)[1:init]SELinux: Permission send_msg in class netlink_route_socket not defined in policy. | |
[ 14.107786] (1)[1:init]SELinux: Class netlink_firewall_socket not defined in policy. | |
[ 14.108809] (1)[1:init]SELinux: Permission recv_msg in class netlink_tcpdiag_socket not defined in policy. | |
[ 14.110070] (1)[1:init]SELinux: Permission send_msg in class netlink_tcpdiag_socket not defined in policy. | |
[ 14.111328] (1)[1:init]SELinux: Permission recv_msg in class netlink_nflog_socket not defined in policy. | |
[ 14.112566] (1)[1:init]SELinux: Permission send_msg in class netlink_nflog_socket not defined in policy. | |
[ 14.113799] (1)[1:init]SELinux: Permission recv_msg in class netlink_xfrm_socket not defined in policy. | |
[ 14.115019] (1)[1:init]SELinux: Permission send_msg in class netlink_xfrm_socket not defined in policy. | |
[ 14.116265] (1)[1:init]SELinux: Permission recv_msg in class netlink_selinux_socket not defined in policy. | |
[ 14.117511] (1)[1:init]SELinux: Permission send_msg in class netlink_selinux_socket not defined in policy. | |
[ 14.118774] (1)[1:init]SELinux: Permission recv_msg in class netlink_audit_socket not defined in policy. | |
[ 14.120014] (1)[1:init]SELinux: Permission send_msg in class netlink_audit_socket not defined in policy. | |
[ 14.121246] (1)[1:init]SELinux: Class netlink_ip6fw_socket not defined in policy. | |
[ 14.122234] (1)[1:init]SELinux: Permission recv_msg in class netlink_dnrt_socket not defined in policy. | |
[ 14.123463] (1)[1:init]SELinux: Permission send_msg in class netlink_dnrt_socket not defined in policy. | |
[ 14.124689] (1)[1:init]SELinux: Permission recv_msg in class netlink_kobject_uevent_socket not defined in policy. | |
[ 14.126022] (1)[1:init]SELinux: Permission send_msg in class netlink_kobject_uevent_socket not defined in policy. | |
[ 14.127354] (1)[1:init]SELinux: Permission recv_msg in class appletalk_socket not defined in policy. | |
[ 14.128542] (1)[1:init]SELinux: Permission send_msg in class appletalk_socket not defined in policy. | |
[ 14.129756] (1)[1:init]SELinux: Permission recv_msg in class dccp_socket not defined in policy. | |
[ 14.130883] (1)[1:init]SELinux: Permission send_msg in class dccp_socket not defined in policy. | |
[ 14.132037] (1)[1:init]SELinux: Permission recv_msg in class tun_socket not defined in policy. | |
[ 14.133160] (1)[1:init]SELinux: Permission send_msg in class tun_socket not defined in policy. | |
[ 14.134286] (1)[1:init]SELinux: the above unknown classes and permissions will be denied | |
[ 14.134745] (0)[222:bat_thread_kthr][FGADC] SWOCV : 4362,4325,1968,1,177,-37 | |
[ 14.136299] (1)[1:init]SELinux: Completing initialization. | |
[ 14.136305] (1)[1:init]SELinux: Setting up existing superblocks. | |
[ 14.136329] (1)[1:init]SELinux: initialized (dev rootfs, type rootfs), uses genfs_contexts | |
[ 14.136398] (1)[1:init]SELinux: initialized (dev bdev, type bdev), not configured for labeling | |
[ 14.136428] (1)[1:init]SELinux: initialized (dev proc, type proc), uses genfs_contexts | |
[ 14.136465] (1)[1:init]SELinux: initialized (dev tmpfs, type tmpfs), uses transition SIDs | |
[ 14.136498] (1)[1:init]SELinux: initialized (dev debugfs, type debugfs), uses genfs_contexts | |
[ 14.137430] (0)[222:bat_thread_kthr][dump_nter] mt6328_upmu_get_fg_nter_29_16 = 0x0 | |
[ 14.138434] (0)[222:bat_thread_kthr][dump_nter] mt6328_upmu_get_fg_nter_15_00 = 0x9 | |
[ 14.139454] (0)[222:bat_thread_kthr][dump_car] upmu_get_fg_car_31_16 = 0x0 | |
[ 14.139762] (1)[1:init]SELinux: initialized (dev sockfs, type sockfs), uses task SIDs | |
[ 14.139773] (1)[1:init]SELinux: initialized (dev pipefs, type pipefs), uses task SIDs | |
[ 14.139779] (1)[1:init]SELinux: initialized (dev anon_inodefs, type anon_inodefs), not configured for labeling | |
[ 14.139794] (1)[1:init]SELinux: initialized (dev devpts, type devpts), uses transition SIDs | |
[ 14.139811] (1)[1:init]SELinux: initialized (dev configfs, type configfs), uses genfs_contexts | |
[ 14.139826] (1)[1:init]SELinux: initialized (dev selinuxfs, type selinuxfs), uses genfs_contexts | |
[ 14.139879] (1)[1:init]SELinux: initialized (dev tmpfs, type tmpfs), uses transition SIDs | |
[ 14.139934] (1)[1:init]SELinux: initialized (dev sysfs, type sysfs), uses genfs_contexts | |
[ 14.140378] (0)[222:bat_thread_kthr][dump_car] upmu_get_fg_car_15_00 = 0x13a5 | |
[ 14.141313] (0)[222:bat_thread_kthr][fgauge_update_dod] gFG_BATT_CAPACITY=2194, gFG_BATT_CAPACITY_aging=2194, gFG_BATT_CAPACITY_init_high_current=2194 | |
[ 14.143073] (0)[222:bat_thread_kthr][oam] get_hw_ocv (pchr) : adc_result_reg=26534, adc_result=4372 | |
[ 14.144235] (0)[222:bat_thread_kthr][FGADC] get_hw_ocv=4372, HW_SOC=100, SW_SOC = 97 | |
[ 14.145244] -(0)[222:bat_thread_kthr]mtk_rtc_hal_common: rtc_spare_reg[0] = {16412, 127, 8} | |
[ 14.146332] (0)[222:bat_thread_kthr][FGADC] g_rtc_fg_soc=100, gFG_capacity_by_v=100 | |
[ 14.147319] (0)[222:bat_thread_kthr][FGADC] gFG_15_vlot = 3700mV | |
[ 14.149943] (0)[222:bat_thread_kthr][FGADC] 1,1930,0,4372,100,100,100,2194,2194,-37,0,0,1000,4362,1000,0,0,99,103 | |
[ 14.151282] (0)[222:bat_thread_kthr][battery_meter_initial] SOC_BY_HW_FG done | |
[ 14.154521] (0)[222:bat_thread_kthr][force_get_tbat] 807,806,1,193,10,29 | |
[ 14.155650] (1)[1:init]SELinux: initialized (dev mmcblk0p45, type ext4), uses xattr | |
[ 14.155789] (0)[222:bat_thread_kthr][dump_nter] mt6328_upmu_get_fg_nter_29_16 = 0x0 | |
[ 14.156791] (0)[222:bat_thread_kthr][dump_nter] mt6328_upmu_get_fg_nter_15_00 = 0x9 | |
[ 14.157799] (0)[222:bat_thread_kthr][dump_car] upmu_get_fg_car_31_16 = 0x0 | |
[ 14.158710] (0)[222:bat_thread_kthr][dump_car] upmu_get_fg_car_15_00 = 0x13a5 | |
[ 14.159666] (0)[222:bat_thread_kthr][FGADC] 1,1936,0,4326,98,100,100,2194,2194,-36,0,0,1000,4362,1000,0,0,99,103 | |
[ 14.167520] (0)[222:bat_thread_kthr][force_get_tbat] 808,807,1,198,10,29 | |
[ 14.168389] (0)[222:bat_thread_kthr]UI_SOC=(100), resetBatteryMeter=(0) | |
[ 14.169271] -(0)[222:bat_thread_kthr]mtk_rtc_hal_common: rtc_spare_reg[0] = {16412, 127, 8} | |
[ 14.185627] (1)[1:init]audit: type=1403 audit(1556890365.076:2): policy loaded auid=4294967295 ses=4294967295 | |
[ 14.187188] (1)[1:init]selinux: SELinux: Loaded policy from /sepolicy | |
[ 14.187188] | |
[ 14.191383] (1)[1:init]selinux: SELinux: Loaded file_contexts | |
[ 14.191383] | |
[ 14.193737] (0)[1:init]random: init urandom read with 20 bits of entropy available | |
[ 14.195799] (0)[1:init]init: init second stage started! | |
[ 14.200829] (0)[1:init]init: Using Android DT directory /proc/device-tree/firmware/android/ | |
[ 14.205170] (0)[1:init]selinux: SELinux: Loaded file_contexts | |
[ 14.205170] | |
[ 14.206891] (0)[1:init]selinux: SELinux: Loaded property_contexts from /plat_property_contexts & /nonplat_property_contexts. | |
[ 14.206891] | |
[ 14.208561] (0)[1:init]init: Running restorecon... | |
[ 14.215895] (0)[1:init]init: waitid failed: No child processes | |
[ 14.216743] (0)[1:init]init: Couldn't load property file: Unable to open '/system/etc/prop.default': No such file or directory: No such file or directory | |
[ 14.218519] (0)[1:init]init: Couldn't load property file: Unable to open '/prop.default': No such file or directory: No such file or directory | |
[ 14.220476] (0)[1:init]init: Couldn't load property file: Unable to open '/odm/default.prop': No such file or directory: No such file or directory | |
[ 14.223855] (0)[1:init]init: Couldn't load property file: Unable to open '/vendor/default.prop': No such file or directory: No such file or directory | |
[ 14.226069] (0)[1:init]init: Created socket '/dev/socket/property_service', mode 666, user 0, group 0 | |
[ 14.227382] (0)[1:init]init: Parsing file /init.rc... | |
[ 14.228363] (0)[1:init]init: Added '/init.environ.rc' to import list | |
[ 14.229217] (0)[1:init]init: Added '/init.usb.rc' to import list | |
[ 14.230015] (0)[1:init]init: Added '/init.mt6735.rc' to import list | |
[ 14.230844] (0)[1:init]init: Added '/vendor/etc/init/hw/init.mt6735.rc' to import list | |
[ 14.231872] (0)[1:init]init: Added '/init.usb.configfs.rc' to import list | |
[ 14.232780] (0)[1:init]init: Added '/init.zygote64_32.rc' to import list | |
[ 14.233757] (0)[1:init]init: /init.rc: 23: invalid keyword 'setcon' | |
[ 14.234585] (0)[1:init]init: /init.rc: 24: invalid keyword 'setenforce' | |
[ 14.236801] (0)[1:init]init: Parsing file /init.environ.rc... | |
[ 14.237674] (0)[1:init]init: Parsing file /init.usb.rc... | |
[ 14.238822] (0)[1:init]init: Parsing file /init.mt6735.rc... | |
[ 14.239660] (0)[1:init]init: Added 'init.mt6735.usb.rc' to import list | |
[ 14.240517] (0)[1:init]init: Added 'init.modem.rc' to import list | |
[ 14.241495] (0)[1:init]init: Parsing file init.mt6735.usb.rc... | |
[ 14.242509] (0)[67:kworker/0:1]get expdb info | |
[ 14.242710] (1)[1:init]init: Parsing file init.modem.rc... | |
[ 14.244529] (1)[1:init]init: Parsing file /vendor/etc/init/hw/init.mt6735.rc... | |
[ 14.245519] (1)[1:init]init: Unable to open '/vendor/etc/init/hw/init.mt6735.rc': No such file or directory | |
[ 14.246800] (1)[1:init]init: /init.rc: 10: Could not import file '/vendor/etc/init/hw/init.mt6735.rc': No such file or directory | |
[ 14.248293] (1)[1:init]init: Parsing file /init.usb.configfs.rc... | |
[ 14.249730] (1)[1:init]init: Parsing file /init.zygote64_32.rc... | |
[ 14.250759] (1)[1:init]init: Parsing directory /system/etc/init... | |
[ 14.251986] (1)[1:init]init: Parsing file /system/etc/init/[email protected]... | |
[ 14.253533] (1)[1:init]init: Parsing file /system/etc/init/atrace.rc... | |
[ 14.255229] (1)[1:init]init: Parsing file /system/etc/init/audioserver.rc... | |
[ 14.256557] (1)[1:init]init: Parsing file /system/etc/init/bootanim.rc... | |
[ 14.257785] (1)[1:init]init: Parsing file /system/etc/init/bootstat.rc... | |
[ 14.259032] (1)[1:init]init: Parsing file /system/etc/init/cameraserver.rc... | |
[ 14.260316] (1)[1:init]init: Parsing file /system/etc/init/drmserver.rc... | |
[ 14.261488] (1)[1:init]init: Parsing file /system/etc/init/dumpstate.rc... | |
[ 14.262767] (1)[1:init]init: Parsing file /system/etc/init/gatekeeperd.rc... | |
[ 14.263980] (1)[1:init]init: Parsing file /system/etc/init/hwservicemanager.rc... | |
[ 14.265278] (1)[1:init]init: Parsing file /system/etc/init/installd.rc... | |
[ 14.266824] (0)[1:init]init: Parsing file /system/etc/init/keystore.rc... | |
[ 14.268030] (0)[1:init]init: Parsing file /system/etc/init/lmkd.rc... | |
[ 14.269131] (0)[1:init]init: Parsing file /system/etc/init/logd.rc... | |
[ 14.270256] (0)[1:init]init: Parsing file /system/etc/init/mdnsd.rc... | |
[ 14.271325] (0)[1:init]init: Parsing file /system/etc/init/mediadrmserver.rc... | |
[ 14.272581] (0)[1:init]init: Parsing file /system/etc/init/mediaextractor.rc... | |
[ 14.273840] (0)[1:init]init: Parsing file /system/etc/init/mediametrics.rc... | |
[ 14.274966] (0)[1:init]init: Parsing file /system/etc/init/mediaserver.rc... | |
[ 14.276256] (0)[1:init]init: Parsing file /system/etc/init/mtpd.rc... | |
[ 14.277326] (0)[1:init]init: Parsing file /system/etc/init/netd.rc... | |
[ 14.278403] (0)[1:init]init: Parsing file /system/etc/init/racoon.rc... | |
[ 14.279500] (0)[1:init]init: Parsing file /system/etc/init/servicemanager.rc... | |
[ 14.280795] (0)[1:init]init: Parsing file /system/etc/init/storaged.rc... | |
[ 14.281894] (0)[1:init]init: Parsing file /system/etc/init/surfaceflinger.rc... | |
[ 14.283222] (0)[1:init]init: Parsing file /system/etc/init/thermalservice.rc... | |
[ 14.284456] (0)[1:init]init: Parsing file /system/etc/init/tombstoned.rc... | |
[ 14.285608] (0)[1:init]init: Parsing file /system/etc/init/uncrypt.rc... | |
[ 14.286787] (0)[1:init]init: Parsing file /system/etc/init/vdc.rc... | |
[ 14.287848] (0)[1:init]init: Parsing file /system/etc/init/vold.rc... | |
[ 14.288925] (0)[1:init]init: Parsing file /system/etc/init/webview_zygote32.rc... | |
[ 14.290263] (0)[1:init]init: Parsing file /system/etc/init/webview_zygote64.rc... | |
[ 14.291558] (0)[1:init]init: Parsing file /system/etc/init/wifi-events.rc... | |
[ 14.292940] (0)[1:init]init: Parsing file /system/etc/init/wificond.rc... | |
[ 14.294196] (0)[1:init]init: Parsing directory /vendor/etc/init... | |
[ 14.295140] (0)[1:init]init: Parsing file /vendor/etc/init/[email protected]... | |
[ 14.296726] (0)[1:init]init: Parsing file /vendor/etc/init/[email protected]... | |
[ 14.298402] (0)[1:init]init: Parsing file /vendor/etc/init/[email protected]... | |
[ 14.299992] (0)[1:init]init: Parsing file /vendor/etc/init/[email protected]... | |
[ 14.301602] (0)[1:init]init: Parsing file /vendor/etc/init/[email protected]... | |
[ 14.303076] (0)[1:init]init: Parsing file /vendor/etc/init/[email protected]... | |
[ 14.304624] (0)[1:init]init: Parsing file /vendor/etc/init/[email protected]... | |
[ 14.306097] (0)[1:init]init: Parsing file /vendor/etc/init/[email protected]... | |
[ 14.307567] (0)[1:init]init: Parsing file /vendor/etc/init/[email protected]... | |
[ 14.309199] (0)[1:init]init: Parsing file /vendor/etc/init/[email protected]... | |
[ 14.310825] (0)[1:init]init: Parsing file /vendor/etc/init/[email protected]... | |
[ 14.312341] (0)[1:init]init: Parsing file /vendor/etc/init/[email protected]... | |
[ 14.313849] (0)[1:init]init: Parsing file /vendor/etc/init/[email protected]... | |
[ 14.315383] (0)[1:init]init: Parsing file /vendor/etc/init/[email protected]... | |
[ 14.316914] (0)[1:init]init: Parsing file /vendor/etc/init/[email protected]... | |
[ 14.318415] (0)[1:init]init: Parsing file /vendor/etc/init/[email protected]... | |
[ 14.319897] (0)[1:init]init: Parsing file /vendor/etc/init/[email protected]... | |
[ 14.321395] (0)[1:init]init: Parsing file /vendor/etc/init/[email protected]... | |
[ 14.322886] (0)[1:init]init: Parsing file /vendor/etc/init/ccci_fsd.rc... | |
[ 14.323970] (0)[1:init]init: Parsing file /vendor/etc/init/ccci_mdinit.rc... | |
[ 14.325096] (0)[1:init]init: Parsing file /vendor/etc/init/conn.rc... | |
[ 14.326203] (0)[1:init]init: Parsing file /vendor/etc/init/emsvr.rc... | |
[ 14.327269] (0)[1:init]init: Parsing file /vendor/etc/init/etsd.rc... | |
[ 14.328310] (0)[1:init]init: Parsing file /vendor/etc/init/fuelgauged.rc... | |
[ 14.329447] (0)[1:init]init: Parsing file /vendor/etc/init/gsm0710muxd.rc... | |
[ 14.330570] (0)[1:init]init: Parsing file /vendor/etc/init/hostapd.android.rc... | |
[ 14.331871] (0)[1:init]init: Parsing file /vendor/etc/init/md_ctrl.rc... | |
[ 14.333022] (0)[1:init]init: Parsing file /vendor/etc/init/mnld.rc... | |
[ 14.334100] (0)[1:init]init: Parsing file /vendor/etc/init/muxreport.rc... | |
[ 14.335217] (0)[1:init]init: Parsing file /vendor/etc/init/nvram_daemon.rc... | |
[ 14.336514] (0)[1:init]init: Parsing file /vendor/etc/init/pq.rc... | |
[ 14.337535] (0)[1:init]init: Parsing file /vendor/etc/init/rild.rc... | |
[ 14.339822] (0)[1:init]init: Parsing file /vendor/etc/init/rild.rc_... | |
[ 14.341035] (0)[1:init]init: /vendor/etc/init/rild.rc_: 1: ignored duplicate definition of service 'ril-daemon-mtk' | |
[ 14.342431] (0)[1:init]init: Parsing file /vendor/etc/init/rilproxy.rc_... | |
[ 14.343787] (0)[1:init]init: Parsing file /vendor/etc/init/sensor.rc... | |
[ 14.344978] (0)[1:init]init: Parsing file /vendor/etc/init/thermal_manager.rc... | |
[ 14.346275] (0)[1:init]init: Parsing file /vendor/etc/init/vndservicemanager.rc... | |
[ 14.347587] (0)[1:init]init: Parsing file /vendor/etc/init/wpa_supplicant.rc... | |
[ 14.348947] (0)[1:init]init: Parsing file /odm/etc/init... | |
[ 14.349710] (0)[1:init]init: Unable to open '/odm/etc/init': No such file or directory | |
[ 14.350820] (0)[1:init]init: processing action (early-init) from (/init.rc:14) | |
[ 14.352693] (0)[1:init]SELinux: initialized (dev cgroup, type cgroup), uses genfs_contexts | |
[ 14.354165] (0)[1:init]init: starting service 'ueventd'... | |
[ 14.356052] (2)[1:init]init: processing action (wait_for_coldboot_done) from (<Builtin Action>:0) | |
[ 14.357924] (1)[239:ueventd]ueventd: ueventd started! | |
[ 14.358647] (1)[239:ueventd]ueventd: Parsing file /ueventd.rc... | |
[ 14.360295] (1)[239:ueventd]ueventd: Parsing file /vendor/ueventd.rc... | |
[ 14.361181] (1)[239:ueventd]ueventd: Unable to open '/vendor/ueventd.rc': No such file or directory | |
[ 14.362361] (1)[239:ueventd]ueventd: Parsing file /odm/ueventd.rc... | |
[ 14.363222] (1)[239:ueventd]ueventd: Unable to open '/odm/ueventd.rc': No such file or directory | |
[ 14.364429] (1)[239:ueventd]ueventd: Parsing file /ueventd.mt6735.rc... | |
[ 14.368501] (1)[239:ueventd]selinux: SELinux: Loaded file_contexts | |
[ 14.368501] | |
[ 14.372451] (0)[222:bat_thread_kthr]CDP, block | |
[ 14.451359] (0)[239:ueventd]selinux: SELinux: Loaded file_contexts | |
[ 14.451359] | |
[ 14.579168] (0)[239:ueventd]ueventd: Coldboot took 0.209 seconds | |
[ 14.580090] (1)[1:init]init: Command 'wait_for_coldboot_done' action=wait_for_coldboot_done (<Builtin Action>:0) returned 0 took 222ms. | |
[ 14.581695] (1)[1:init]init: processing action (mix_hwrng_into_linux_rng) from (<Builtin Action>:0) | |
[ 14.582938] (0)[1:init]init: /dev/hw_random not found | |
[ 14.583641] (0)[1:init]init: processing action (set_mmap_rnd_bits) from (<Builtin Action>:0) | |
[ 14.585363] (0)[1:init]init: processing action (set_kptr_restrict) from (<Builtin Action>:0) | |
[ 14.586655] (0)[1:init]init: processing action (keychord_init) from (<Builtin Action>:0) | |
[ 14.587737] (0)[1:init]init: processing action (console_init) from (<Builtin Action>:0) | |
[ 14.588817] (0)[1:init]init: processing action (init) from (/init.rc:49) | |
[ 14.592002] (0)[1:init]SELinux: initialized (dev tmpfs, type tmpfs), uses transition SIDs | |
[ 14.595197] (0)[1:init]audit: type=1400 audit(1556890365.486:3): avc: denied { create } for pid=1 comm="init" name="sdcard" scontext=u:r:init:s0 tcontext=u:object_r:tmpfs:s0 tclass=lnk_file permissive=1 | |
[ 14.597753] (0)[1:init]init: Unable to open '/proc/sys/kernel/hung_task_timeout_secs': No such file or directory | |
[ 14.599123] (0)[1:init]init: Unable to open '/proc/cpu/alignment': No such file or directory | |
[ 14.601964] (0)[1:init]SELinux: initialized (dev cgroup, type cgroup), uses genfs_contexts | |
[ 14.602980] (0)[1:init]init: Unable to open '/dev/cpuset/cpus': No such file or directory | |
[ 14.604070] (0)[1:init]init: Unable to open '/dev/cpuset/mems': No such file or directory | |
[ 14.605417] (0)[1:init]init: Unable to open '/dev/cpuset/cpus': No such file or directory | |
[ 14.606549] (0)[1:init]init: Unable to open '/dev/cpuset/mems': No such file or directory | |
[ 14.607893] (0)[1:init]init: Unable to open '/dev/cpuset/cpus': No such file or directory | |
[ 14.608977] (0)[1:init]init: Unable to open '/dev/cpuset/mems': No such file or directory | |
[ 14.610335] (0)[1:init]init: Unable to open '/dev/cpuset/cpus': No such file or directory | |
[ 14.611419] (0)[1:init]init: Unable to open '/dev/cpuset/mems': No such file or directory | |
[ 14.612823] (0)[1:init]init: Unable to open '/dev/cpuset/cpus': No such file or directory | |
[ 14.613907] (0)[1:init]init: Unable to open '/dev/cpuset/mems': No such file or directory | |
[ 14.616394] (0)[1:init]pstore: decompression failed;returned -5 | |
[ 14.617568] (0)[1:init]SELinux: initialized (dev pstore, type pstore), uses genfs_contexts | |
[ 14.617965] (0)[1:init]Registered swp emulation handler | |
[ 14.618861] (0)[1:init]init: Unable to open '/sys/class/leds/vibrator/trigger': No such file or directory | |
[ 14.620180] (0)[1:init]init: processing action (init) from (/init.environ.rc:2) | |
[ 14.621227] (0)[1:init]init: processing action (init) from (/init.mt6735.rc:4) | |
[ 14.622775] (0)[1:init]init: processing action (init) from (init.mt6735.usb.rc:1) | |
[ 14.624015] (0)[1:init]init: processing action (mix_hwrng_into_linux_rng) from (<Builtin Action>:0) | |
[ 14.625206] (0)[1:init]init: /dev/hw_random not found | |
[ 14.625964] (0)[1:init]init: processing action (late-init) from (/init.rc:275) | |
[ 14.626966] (0)[1:init]init: processing action (queue_property_triggers) from (<Builtin Action>:0) | |
[ 14.628163] (0)[1:init]init: processing action (fs) from (/init.mt6735.rc:10) | |
[ 14.630205] (1)[243:init]init: [libfs_mgr]Running /system/bin/fsck.f2fs -a /dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/userdata | |
[ 14.674613] (2)[243:init]fsck.f2fs: Info: Fix the reported corruption. | |
[ 14.674613] | |
[ 14.675708] (2)[243:init]fsck.f2fs: Info: Segments per section = 1 | |
[ 14.675708] | |
[ 14.676761] (2)[243:init]fsck.f2fs: Info: Sections per zone = 1 | |
[ 14.676761] | |
[ 14.677755] (2)[243:init]fsck.f2fs: Info: sector size = 512 | |
[ 14.677755] | |
[ 14.678710] (2)[243:init]fsck.f2fs: Info: total sectors = 52422656 (25597 MB) | |
[ 14.678710] | |
[ 14.679870] (2)[243:init]fsck.f2fs: Can't find a valid F2FS superblock at 0x0 | |
[ 14.679870] | |
[ 14.681026] (2)[243:init]fsck.f2fs: Can't find a valid F2FS superblock at 0x1 | |
[ 14.681026] | |
[ 14.682189] (2)[243:init]fsck.f2fs: fsck.f2fs terminated by exit(255) | |
[ 14.682189] | |
[ 14.683907] (2)[243:init]F2FS-fs (mmcblk0p46): Magic Mismatch, valid(0xf2f52010) - read(0xc183e6f2) | |
[ 14.685070] (2)[243:init]F2FS-fs (mmcblk0p46): Can't find valid F2FS filesystem in 1th superblock | |
[ 14.686456] (2)[243:init]F2FS-fs (mmcblk0p46): Magic Mismatch, valid(0xf2f52010) - read(0x16d301b4) | |
[ 14.687617] (2)[243:init]F2FS-fs (mmcblk0p46): Can't find valid F2FS filesystem in 2th superblock | |
[ 14.688783] (2)[243:init]F2FS-fs (mmcblk0p46): Magic Mismatch, valid(0xf2f52010) - read(0xc183e6f2) | |
[ 14.690005] (2)[243:init]F2FS-fs (mmcblk0p46): Can't find valid F2FS filesystem in 1th superblock | |
[ 14.691144] (2)[243:init]F2FS-fs (mmcblk0p46): Magic Mismatch, valid(0xf2f52010) - read(0x16d301b4) | |
[ 14.692315] (2)[243:init]F2FS-fs (mmcblk0p46): Can't find valid F2FS filesystem in 2th superblock | |
[ 14.693656] (2)[243:init]init: [libfs_mgr]__mount(source=/dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/userdata,target=/data,type=f2fs)=-1: Invalid argument | |
[ 14.695541] (2)[243:init]init: [libfs_mgr]Running /system/bin/fsck.f2fs -a /dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/userdata | |
[ 14.705911] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1112mv, freq = 1144000 KHz | |
[ 14.711913] (1)[243:init]fsck.f2fs: Info: Fix the reported corruption. | |
[ 14.711913] | |
[ 14.713040] (1)[243:init]fsck.f2fs: Info: Segments per section = 1 | |
[ 14.713040] | |
[ 14.714069] (1)[243:init]fsck.f2fs: Info: Sections per zone = 1 | |
[ 14.714069] | |
[ 14.715066] (1)[243:init]fsck.f2fs: Info: sector size = 512 | |
[ 14.715066] | |
[ 14.716053] (1)[243:init]fsck.f2fs: Info: total sectors = 52422656 (25597 MB) | |
[ 14.716053] | |
[ 14.716187] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1143mv, freq = 1235000 KHz | |
[ 14.717202] (1)[243:init]fsck.f2fs: Can't find a valid F2FS superblock at 0x0 | |
[ 14.717202] | |
[ 14.718359] (1)[243:init]fsck.f2fs: Can't find a valid F2FS superblock at 0x1 | |
[ 14.718359] | |
[ 14.719535] (1)[243:init]fsck.f2fs: fsck.f2fs terminated by exit(255) | |
[ 14.719535] | |
[ 14.721196] (1)[243:init]F2FS-fs (mmcblk0p46): Magic Mismatch, valid(0xf2f52010) - read(0xc183e6f2) | |
[ 14.722360] (1)[243:init]F2FS-fs (mmcblk0p46): Can't find valid F2FS filesystem in 1th superblock | |
[ 14.723888] (1)[243:init]init: [libfs_mgr]__mount(source=/dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/userdata,target=/data,type=f2fs)=-1: Invalid argument | |
[ 14.726265] (1)[243:init]init: [libfs_mgr]Invalid ext4 magic:0x7243 on '/dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/userdata' | |
[ 14.727854] (1)[243:init]init: [libfs_mgr]mount_with_alternatives(): skipping mount, invalid ext4, mountpoint=/data rec[2].fs_type=ext4 | |
[ 14.729929] (1)[243:init]init: [libfs_mgr]fs_mgr_mount_all(): possibly an encryptable blkdev /dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/userdata for mount /data type f2fs | |
[ 14.732087] (1)[243:init]SELinux: initialized (dev tmpfs, type tmpfs), uses transition SIDs | |
[ 14.732183] (1)[243:init]init: [libfs_mgr]Running /system/bin/fsck.f2fs -a /dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/cache | |
[ 14.735953] (2)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1162mv, freq = 1300000 KHz | |
[ 14.750645] (0)[243:init]fsck.f2fs: Info: Fix the reported corruption. | |
[ 14.750645] | |
[ 14.751737] (0)[243:init]fsck.f2fs: Info: Segments per section = 1 | |
[ 14.751737] | |
[ 14.752673] (1)[130:hps_main]MobiCore mcd: Cpu 2 is going to die | |
[ 14.753799] (0)[243:init]fsck.f2fs: Info: Sections per zone = 1 | |
[ 14.753799] | |
[ 14.753808] (1)[130:hps_main]CPU2: shutdown | |
[ 14.754378] (1)[130:hps_main]MobiCore mcd: Cpu 2 is dead | |
[ 14.754537] (1)[130:hps_main][HPS] (0200)(3)action end(106)(93)(0)(0) (8)(8)(8)(8)(1) (218)(8)(0) (1021)(8)(0) (0)(93)(8)(0)(93) wifi_base(0) | |
[ 14.757695] (0)[243:init]fsck.f2fs: Info: sector size = 512 | |
[ 14.757695] | |
[ 14.758645] (0)[243:init]fsck.f2fs: Info: total sectors = 524288 (256 MB) | |
[ 14.758645] | |
[ 14.759762] (0)[243:init]fsck.f2fs: Can't find a valid F2FS superblock at 0x0 | |
[ 14.759762] | |
[ 14.760918] (0)[243:init]fsck.f2fs: Can't find a valid F2FS superblock at 0x1 | |
[ 14.760918] | |
[ 14.762083] (0)[243:init]fsck.f2fs: fsck.f2fs terminated by exit(255) | |
[ 14.762083] | |
[ 14.764047] (0)[243:init]init: [libfs_mgr]__mount(source=/dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/cache,target=/cache,type=f2fs)=-1: Invalid argument | |
[ 14.765929] (0)[243:init]init: [libfs_mgr]Running /system/bin/fsck.f2fs -a /dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/cache | |
[ 14.772488] (0)[67:kworker/0:1][MUSB]do_low_power_timer_monitor_work 77: state:IDLE_STAGE, last:0, balanced<0,0>, usb_state:NO-CDEV | |
[ 14.783277] (0)[243:init]fsck.f2fs: Info: Fix the reported corruption. | |
[ 14.783277] | |
[ 14.784371] (0)[243:init]fsck.f2fs: Info: Segments per section = 1 | |
[ 14.784371] | |
[ 14.785408] (0)[243:init]fsck.f2fs: Info: Sections per zone = 1 | |
[ 14.785408] | |
[ 14.786429] (0)[243:init]fsck.f2fs: Info: sector size = 512 | |
[ 14.786429] | |
[ 14.787379] (0)[243:init]fsck.f2fs: Info: total sectors = 524288 (256 MB) | |
[ 14.787379] | |
[ 14.788485] (0)[243:init]fsck.f2fs: Can't find a valid F2FS superblock at 0x0 | |
[ 14.788485] | |
[ 14.789656] (0)[243:init]fsck.f2fs: Can't find a valid F2FS superblock at 0x1 | |
[ 14.789656] | |
[ 14.790817] (0)[243:init]fsck.f2fs: fsck.f2fs terminated by exit(255) | |
[ 14.790817] | |
[ 14.792733] (0)[243:init]init: [libfs_mgr]__mount(source=/dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/cache,target=/cache,type=f2fs)=-1: Invalid argument | |
[ 14.794992] (0)[243:init]init: [libfs_mgr]superblock s_max_mnt_count:10,/dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/cache | |
[ 14.796881] (0)[243:init]EXT4-fs (mmcblk0p42): Ignoring removed nomblk_io_submit option | |
[ 14.799295] (1)[243:init]EXT4-fs (mmcblk0p42): mounted filesystem with ordered data mode. Opts: errors=remount-ro,nomblk_io_submit | |
[ 14.800809] (1)[243:init]SELinux: initialized (dev mmcblk0p42, type ext4), uses xattr | |
[ 14.800967] (1)[243:init]init: [libfs_mgr]check_fs(): mount(/dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/cache,/cache,ext4)=0: Success | |
[ 14.819696] (1)[243:init]init: [libfs_mgr]check_fs(): unmount(/cache) succeeded | |
[ 14.820792] (1)[243:init]init: [libfs_mgr]Running /system/bin/e2fsck on /dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/cache | |
[ 14.864044] (1)[243:init]e2fsck: e2fsck 1.43.3 (04-Sep-2016) | |
[ 14.864044] | |
[ 14.865033] (1)[243:init]e2fsck: /dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/cache: clean, 19/16384 files, 2115/65536 blocks (check in 4 mounts) | |
[ 14.865033] | |
[ 14.868190] (1)[243:init]EXT4-fs (mmcblk0p42): barriers disabled | |
[ 14.869655] (0)[243:init]EXT4-fs (mmcblk0p42): mounted filesystem with ordered data mode. Opts: lazytime,noauto_da_alloc,discard,barrier=0 | |
[ 14.871255] (0)[243:init]SELinux: initialized (dev mmcblk0p42, type ext4), uses xattr | |
[ 14.871397] (0)[243:init]init: [libfs_mgr]__mount(source=/dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/cache,target=/cache,type=ext4)=0: Success | |
[ 14.873220] (0)[243:init]init: [libfs_mgr]mount_with_alternatives(): Mounted /dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/cache on /cache with fs_type=ext4 instead of f2fs | |
[ 14.873290] (1)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1112mv, freq = 1144000 KHz | |
[ 14.875886] (0)[243:init]init: [libfs_mgr]superblock s_max_mnt_count:10,/dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/protect1 | |
[ 14.877983] (0)[243:init]EXT4-fs (mmcblk0p3): Ignoring removed nomblk_io_submit option | |
[ 14.880521] (1)[243:init]EXT4-fs (mmcblk0p3): mounted filesystem with ordered data mode. Opts: errors=remount-ro,nomblk_io_submit | |
[ 14.882027] (1)[243:init]SELinux: initialized (dev mmcblk0p3, type ext4), uses xattr | |
[ 14.882160] (1)[243:init]init: [libfs_mgr]check_fs(): mount(/dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/protect1,/protect_f,ext4)=0: Success | |
[ 14.913179] (1)[243:init]init: [libfs_mgr]check_fs(): unmount(/protect_f) succeeded | |
[ 14.914210] (1)[243:init]init: [libfs_mgr]Running /system/bin/e2fsck on /dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/protect1 | |
[ 14.935950] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1162mv, freq = 1300000 KHz | |
[ 14.942644] (1)[243:init]e2fsck: e2fsck 1.43.3 (04-Sep-2016) | |
[ 14.942644] | |
[ 14.943633] (1)[243:init]e2fsck: /dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/protect1 has been mounted 10 times without being checked, check forced. | |
[ 14.943633] | |
[ 14.945668] (1)[243:init]e2fsck: Pass 1: Checking inodes, blocks, and sizes | |
[ 14.945668] | |
[ 14.946835] (1)[243:init]e2fsck: Pass 2: Checking directory structure | |
[ 14.946835] | |
[ 14.947893] (1)[243:init]e2fsck: Pass 3: Checking directory connectivity | |
[ 14.947893] | |
[ 14.948988] (1)[243:init]e2fsck: Pass 4: Checking reference counts | |
[ 14.948988] | |
[ 14.950037] (1)[243:init]e2fsck: Pass 5: Checking group summary information | |
[ 14.950037] | |
[ 14.951161] (1)[243:init]e2fsck: /dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/protect1: 18/640 files (0.0% non-contiguous), 1086/2560 blocks | |
[ 14.951161] | |
[ 14.955214] (0)[243:init]EXT4-fs (mmcblk0p3): mounted filesystem with ordered data mode. Opts: noauto_da_alloc,commit=1,nodelalloc,barrier=1 | |
[ 14.956900] (0)[243:init]SELinux: initialized (dev mmcblk0p3, type ext4), uses xattr | |
[ 14.957012] (0)[243:init]init: [libfs_mgr]__mount(source=/dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/protect1,target=/protect_f,type=ext4)=0: Success | |
[ 14.959371] (0)[243:init]init: [libfs_mgr]superblock s_max_mnt_count:10,/dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/protect2 | |
[ 14.961319] (0)[243:init]EXT4-fs (mmcblk0p4): Ignoring removed nomblk_io_submit option | |
[ 14.963881] (1)[243:init]EXT4-fs (mmcblk0p4): mounted filesystem with ordered data mode. Opts: errors=remount-ro,nomblk_io_submit | |
[ 14.965386] (1)[243:init]SELinux: initialized (dev mmcblk0p4, type ext4), uses xattr | |
[ 14.965514] (1)[243:init]init: [libfs_mgr]check_fs(): mount(/dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/protect2,/protect_s,ext4)=0: Success | |
[ 14.979800] (1)[243:init]init: [libfs_mgr]check_fs(): unmount(/protect_s) succeeded | |
[ 14.980847] (1)[243:init]init: [libfs_mgr]Running /system/bin/e2fsck on /dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/protect2 | |
[ 15.007315] (0)[243:init]e2fsck: e2fsck 1.43.3 (04-Sep-2016) | |
[ 15.007315] | |
[ 15.008304] (0)[243:init]e2fsck: /dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/protect2 has been mounted 10 times without being checked, check forced. | |
[ 15.008304] | |
[ 15.010358] (0)[243:init]e2fsck: Pass 1: Checking inodes, blocks, and sizes | |
[ 15.010358] | |
[ 15.011482] (0)[243:init]e2fsck: Pass 2: Checking directory structure | |
[ 15.011482] | |
[ 15.012554] (0)[243:init]e2fsck: Pass 3: Checking directory connectivity | |
[ 15.012554] | |
[ 15.013645] (0)[243:init]e2fsck: Pass 4: Checking reference counts | |
[ 15.013645] | |
[ 15.014675] (0)[243:init]e2fsck: Pass 5: Checking group summary information | |
[ 15.014675] | |
[ 15.015837] (0)[243:init]e2fsck: /dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/protect2: 17/640 files (0.0% non-contiguous), 1085/2560 blocks | |
[ 15.015837] | |
[ 15.019845] (1)[243:init]EXT4-fs (mmcblk0p4): mounted filesystem with ordered data mode. Opts: noauto_da_alloc,commit=1,nodelalloc,barrier=1 | |
[ 15.021474] (1)[243:init]SELinux: initialized (dev mmcblk0p4, type ext4), uses xattr | |
[ 15.021587] (1)[243:init]init: [libfs_mgr]__mount(source=/dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/protect2,target=/protect_s,type=ext4)=0: Success | |
[ 15.024002] (1)[243:init]init: [libfs_mgr]superblock s_max_mnt_count:10,/dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/nvdata | |
[ 15.025922] (1)[243:init]EXT4-fs (mmcblk0p40): Ignoring removed nomblk_io_submit option | |
[ 15.029880] (0)[243:init]EXT4-fs (mmcblk0p40): mounted filesystem with ordered data mode. Opts: errors=remount-ro,nomblk_io_submit | |
[ 15.031397] (0)[243:init]SELinux: initialized (dev mmcblk0p40, type ext4), uses xattr | |
[ 15.031523] (0)[243:init]init: [libfs_mgr]check_fs(): mount(/dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/nvdata,/nvdata,ext4)=0: Success | |
[ 15.046598] (0)[243:init]init: [libfs_mgr]check_fs(): unmount(/nvdata) succeeded | |
[ 15.047594] (0)[243:init]init: [libfs_mgr]Running /system/bin/e2fsck on /dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/nvdata | |
[ 15.059286] (1)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1012mv, freq = 819000 KHz | |
[ 15.076024] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1162mv, freq = 1300000 KHz | |
[ 15.086551] (0)[243:init]e2fsck: e2fsck 1.43.3 (04-Sep-2016) | |
[ 15.086551] | |
[ 15.087541] (0)[243:init]e2fsck: /dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/nvdata has been mounted 10 times without being checked, check forced. | |
[ 15.087541] | |
[ 15.089581] (0)[243:init]e2fsck: Pass 1: Checking inodes, blocks, and sizes | |
[ 15.089581] | |
[ 15.090705] (0)[243:init]e2fsck: Pass 2: Checking directory structure | |
[ 15.090705] | |
[ 15.091767] (0)[243:init]e2fsck: Pass 3: Checking directory connectivity | |
[ 15.091767] | |
[ 15.092875] (0)[243:init]e2fsck: Pass 4: Checking reference counts | |
[ 15.092875] | |
[ 15.093900] (0)[243:init]e2fsck: Pass 5: Checking group summary information | |
[ 15.093900] | |
[ 15.095029] (0)[243:init]e2fsck: /dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/nvdata: 564/2048 files (0.0% non-contiguous), 1833/8192 blocks | |
[ 15.095029] | |
[ 15.100222] (1)[243:init]EXT4-fs (mmcblk0p40): mounted filesystem with ordered data mode. Opts: noauto_da_alloc,discard,barrier=1 | |
[ 15.101731] (1)[243:init]SELinux: initialized (dev mmcblk0p40, type ext4), uses xattr | |
[ 15.101851] (1)[243:init]init: [libfs_mgr]__mount(source=/dev/block/platform/mtk-msdc.0/11230000.msdc0/by-name/nvdata,target=/nvdata,type=ext4)=0: Success | |
[ 15.104363] (0)[1:init]init: Parsing file /odm/etc/init... | |
[ 15.105119] (0)[1:init]init: Unable to open '/odm/etc/init': No such file or directory | |
[ 15.106230] (0)[1:init]init: Command 'mount_all /fstab.mt6735' action=fs (/init.mt6735.rc:11) returned 2 took 477ms. | |
[ 15.107675] (0)[1:init]init: processing action (fs) from (init.mt6735.usb.rc:15) | |
[ 15.109761] (0)[1:init]SELinux: initialized (dev functionfs, type functionfs), uses genfs_contexts | |
[ 15.109982] (0)[1:init]init: processing action (fs) from (/system/etc/init/logd.rc:18) | |
[ 15.111350] (0)[1:init]init: processing action (fs) from (/system/etc/init/wifi-events.rc:17) | |
[ 15.112636] (0)[1:init]init: processing action (post-fs) from (/init.rc:308) | |
[ 15.114977] (0)[1:init]init: Couldn't load property file: Unable to open '/odm/build.prop': No such file or directory: No such file or directory | |
[ 15.116755] (0)[1:init]init: Couldn't load property file: Unable to open '/vendor/build.prop': No such file or directory: No such file or directory | |
[ 15.118462] (0)[1:init]init: Couldn't load property file: Unable to open '/factory/factory.prop': No such file or directory: No such file or directory | |
[ 15.122870] (0)[1:init]init: starting service 'logd'... | |
[ 15.124892] (0)[1:init]init: starting service 'servicemanager'... | |
[ 15.124987] (1)[269:init]init: Created socket '/dev/socket/logd', mode 666, user 1036, group 1036 | |
[ 15.125379] (1)[269:init]init: Created socket '/dev/socket/logdr', mode 666, user 1036, group 1036 | |
[ 15.125717] (1)[269:init]init: Created socket '/dev/socket/logdw', mode 222, user 1036, group 1036 | |
[ 15.125867] (1)[269:init]init: Opened file '/proc/kmsg', flags 0 | |
[ 15.125903] (1)[269:init]init: Opened file '/dev/kmsg', flags 1 | |
[ 15.132142] (0)[1:init]init: starting service 'hwservicemanager'... | |
[ 15.134705] (0)[1:init]init: starting service 'vndservicemanager'... | |
[ 15.138817] (0)[1:init]selinux: SELinux: Skipping restorecon_recursive(/cache) | |
[ 15.138817] | |
[ 15.145297] (0)[1:init]init: processing action (post-fs) from (/init.mt6735.rc:13) | |
[ 15.152152] (0)[1:init]init: starting service 'exec 1 (/system/bin/chown -R nvram:nvram /nvdata)'... | |
[ 15.154272] (0)[1:init]init: SVC_EXEC pid 273 (uid 0 gid 0+0 context u:r:nvram_perms:s0) started; waiting... | |
[ 15.176618] (1)[269:logd]logd.auditd: start | |
[ 15.223013] (1)[271:hwservicemanage]binder: 271:271 ioctl 620a 0 returned -22 | |
[ 15.233449] (1)[1:init]init: Service 'exec 1 (/system/bin/chown -R nvram:nvram /nvdata)' (pid 273) exited with status 0 waiting took 0.081000 seconds | |
[ 15.235454] (1)[1:init]init: starting service 'exec 2 (/system/bin/chmod -R 0770 /nvdata)'... | |
[ 15.237470] (1)[1:init]init: SVC_EXEC pid 280 (uid 0 gid 0+0 context u:r:nvram_perms:s0) started; waiting... | |
[ 15.265315] (1)[1:init]init: Service 'exec 2 (/system/bin/chmod -R 0770 /nvdata)' (pid 280) exited with status 0 waiting took 0.029000 seconds | |
[ 15.268946] (1)[1:init]selinux: SELinux: Skipping restorecon_recursive(/nvdata) | |
[ 15.268946] | |
[ 15.270174] (1)[1:init]init: processing action (post-fs) from (/system/etc/init/atrace.rc:3) | |
[ 15.273904] (1)[1:init]init: Unable to open '/sys/kernel/debug/tracing/tracing_on': No such file or directory | |
[ 15.275206] (1)[1:init]init: Unable to open '/sys/kernel/tracing/tracing_on': No such file or directory | |
[ 15.276553] (1)[1:init]init: processing action (late-fs) from (/init.rc:368) | |
[ 15.278257] (1)[1:init]init: starting service 'keymaster-3-0'... | |
[ 15.279989] (1)[1:init]init: processing action (late-fs) from (/init.mt6735.rc:43) | |
[ 15.281457] (1)[1:init]init: processing action (post-fs-data) from (/init.rc:376) | |
[ 15.283438] (1)[1:init]init: starting service 'vold'... | |
[ 15.286641] (1)[1:init]init: Unable to open '/data/system/entropy.dat': No such file or directory | |
[ 15.288862] (1)[1:init]init: Unable to open '/data/misc/recovery/ro.build.fingerprint': No such file or directory | |
[ 15.291083] (1)[1:init]init: Unable to open '/data/misc/recovery/proc/version': No such file or directory | |
[ 15.292701] (0)[282:init]init: Created socket '/dev/socket/vold', mode 660, user 0, group 1009 | |
[ 15.294248] (0)[282:init]init: Created socket '/dev/socket/cryptd', mode 660, user 0, group 1009 | |
[ 15.318002] (0)[1:init]init: starting service 'exec 3 (/system/bin/vdc --wait cryptfs init_user0)'... | |
[ 15.320700] (1)[1:init]init: SVC_EXEC pid 283 (uid 0 gid 0+0 context default) started; waiting... | |
[ 15.355725] (1)[130:hps_main][HPS] (0000)(2)DBG_HRT(172)(226)(0)(0) (8)(8)(8)(8)(1) (345)(6)(0) (725)(6)(6) (0)(226)(6)(0)(226) wifi_base(0) | |
[ 15.395179] (0)[1:init]init: Service 'exec 3 (/system/bin/vdc --wait cryptfs init_user0)' (pid 283) exited with status 0 waiting took 0.077000 seconds | |
[ 15.419199] (1)[1:init]init: starting service 'exec 4 (/system/bin/tzdatacheck /system/usr/share/zoneinfo /data/misc/zoneinfo)'... | |
[ 15.421630] (1)[1:init]init: SVC_EXEC pid 288 (uid 1000 gid 1000+0 context default) started; waiting... | |
[ 15.452032] (1)[1:init]init: Service 'exec 4 (/system/bin/tzdatacheck /system/usr/share/zoneinfo /data/misc/zoneinfo)' (pid 288) exited with status 0 waiting took 0.036000 seconds | |
[ 15.454292] (1)[1:init]init: processing action (post-fs-data) from (/init.usb.rc:6) | |
[ 15.456490] (1)[1:init]init: processing action (post-fs-data) from (/init.mt6735.rc:50) | |
[ 15.458900] (1)[1:init]init: processing action (post-fs-data) from (init.modem.rc:1) | |
[ 15.463243] (0)[1:init]selinux: SELinux: Skipping restorecon_recursive(/protect_f) | |
[ 15.463243] | |
[ 15.464864] (0)[1:init]selinux: SELinux: Skipping restorecon_recursive(/protect_s) | |
[ 15.464864] | |
[ 15.466396] (0)[1:init]init: processing action (post-fs-data) from (/system/etc/init/bootstat.rc:3) | |
[ 15.468663] (0)[1:init]init: processing action (post-fs-data) from (/vendor/etc/init/hostapd.android.rc:9) | |
[ 15.470457] (0)[1:init]init: processing action (load_persist_props_action) from (/init.rc:265) | |
[ 15.471850] (0)[1:init]init: starting service 'logd-reinit'... | |
[ 15.473680] (0)[1:init]init: processing action (firmware_mounts_complete) from (/init.rc:271) | |
[ 15.474909] (0)[1:init]init: processing action (early-boot) from (/system/etc/init/installd.rc:5) | |
[ 15.488145] (0)[1:init]init: processing action (boot) from (/init.rc:559) | |
[ 15.493755] (0)[1:init]init: starting service 'hidl_memory'... | |
[ 15.495943] (0)[1:init]init: starting service 'audio-hal-2-0'... | |
[ 15.498122] (0)[1:init]init: starting service 'bluetooth-1-0'... | |
[ 15.507861] (0)[1:init]init: starting service 'camera-provider-2-4'... | |
[ 15.512326] (0)[1:init]init: starting service 'cas-hal-1-0'... | |
[ 15.515312] (0)[293:init]init: couldn't write 293 to /dev/cpuset/camera-daemon/tasks: No such file or directory | |
[ 15.516217] (0)[1:init]init: starting service 'configstore-hal-1-0'... | |
[ 15.519150] (1)[274:logd.daemon]logd.daemon: reinit | |
[ 15.522878] (0)[1:init]init: starting service 'drm-hal-1-0'... | |
[ 15.524926] (0)[1:init]init: starting service 'gnss_service'... | |
[ 15.542060] (0)[1:init]init: starting service 'gralloc-2-0'... | |
[ 15.546718] (0)[1:init]init: starting service 'hwcomposer-2-1'... | |
[ 15.553390] (0)[1:init]init: starting service 'light-hal-2-0'... | |
[ 15.558016] -(2)[0:swapper/2]CPU2: Booted secondary processor | |
[ 15.558037] -(2)[0:swapper/2]Detected VIPT I-cache on CPU2 | |
[ 15.558160] -(2)[0:swapper/2]CPU2: update cpu_capacity 1024 | |
[ 15.559018] -(3)[0:swapper/3]CPU3: Booted secondary processor | |
[ 15.559037] -(3)[0:swapper/3]Detected VIPT I-cache on CPU3 | |
[ 15.559163] -(3)[0:swapper/3]CPU3: update cpu_capacity 1024 | |
[ 15.560180] -(4)[0:swapper/4]CPU4: Booted secondary processor | |
[ 15.560204] -(4)[0:swapper/4]Detected VIPT I-cache on CPU4 | |
[ 15.560343] -(4)[0:swapper/4]CPU4: update cpu_capacity 1024 | |
[ 15.561567] -(5)[0:swapper/5]CPU5: Booted secondary processor | |
[ 15.561597] -(5)[0:swapper/5]Detected VIPT I-cache on CPU5 | |
[ 15.561799] -(5)[0:swapper/5]CPU5: update cpu_capacity 1024 | |
[ 15.562831] (0)[130:hps_main][HPS] (0020)(2)action end(199)(563)(0)(0) (8)(8)(8)(8)(1) (345)(7)(1) (898)(7)(7) (1)(563)(8)(0)(563) wifi_base(0) | |
[ 15.566273] (0)[1:init]init: starting service 'memtrack-hal-1-0'... | |
[ 15.571702] (0)[1:init]init: starting service 'sensors-hal-1-0'... | |
[ 15.576999] (0)[1:init]init: starting service 'usb-hal-1-0'... | |
[ 15.580244] (0)[1:init]init: starting service 'vibrator-1-0'... | |
[ 15.584396] (0)[1:init]init: starting service 'wifi_hal_legacy'... | |
[ 15.588588] (0)[1:init]init: Command 'class_start hal' action=boot (/init.rc:651) returned 0 took 95ms. | |
[ 15.590652] (0)[1:init]init: Service 'logd-reinit' (pid 289) exited with status 0 | |
[ 15.593697] (0)[1:init]init: starting service 'healthd'... | |
[ 15.598249] (0)[1:init]init: starting service 'lmkd'... | |
[ 15.602917] (0)[1:init]init: starting service 'surfaceflinger'... | |
[ 15.606089] (0)[1:init]init: starting service 'thermalservice'... | |
[ 15.608613] (0)[1:init]init: starting service 'ccci_fsd'... | |
[ 15.611686] (0)[1:init]init: starting service 'ccci_mdinit'... | |
[ 15.614467] (0)[1:init]init: starting service 'wmt_loader'... | |
[ 15.617446] (0)[1:init]init: starting service 'wmt_launcher'... | |
[ 15.617457] (5)[307:init]init: Created socket '/dev/socket/lmkd', mode 660, user 1000, group 1000 | |
[ 15.619392] (5)[308:init]init: Failed to bind socket 'pdx/system/vr/display/client': No such file or directory | |
[ 15.620213] (5)[308:init]init: Failed to bind socket 'pdx/system/vr/display/manager': No such file or directory | |
[ 15.621049] (5)[308:init]init: Failed to bind socket 'pdx/system/vr/display/vsync': No such file or directory | |
[ 15.625832] (0)[1:init]init: processing action (boot) from (/init.usb.rc:25) | |
[ 15.627586] (0)[1:init]init: processing action (persist.sys.usb.config=* && boot) from (/init.usb.rc:106) | |
[ 15.629430] (0)[1:init]init: processing action (boot) from (/init.mt6735.rc:67) | |
[ 15.633735] (0)[1:init]init: processing action (boot) from (init.mt6735.usb.rc:6) | |
[ 15.635334] (0)[1:init]init: processing action (boot) from (/system/etc/init/bootstat.rc:57) | |
[ 15.636740] (0)[1:init]init: processing action (boot) from (/system/etc/init/dumpstate.rc:1) | |
[ 15.638404] (0)[1:init]init: processing action (enable_property_trigger) from (<Builtin Action>:0) | |
[ 15.640424] (0)[1:init]init: processing action (security.perf_harden=1) from (/init.rc:707) | |
[ 15.641930] (0)[1:init]init: processing action (sys.usb.config=none && sys.usb.configfs=0) from (/init.usb.rc:29) | |
[ 15.643686] (0)[1:init]android_usb: already disabled | |
[ 15.644812] (0)[1:init]init: processing action (defaultcrypto) from (/system/etc/init/vdc.rc:2) | |
[ 15.646763] (0)[1:init]init: starting service 'exec 5 (/system/bin/vdc --wait cryptfs mountdefaultencrypted)'... | |
[ 15.649633] (0)[1:init]init: SVC_EXEC pid 314 (uid 0 gid 0+0 context default) started; waiting... | |
[ 15.665018] -(6)[0:swapper/6]CPU6: Booted secondary processor | |
[ 15.665043] -(6)[0:swapper/6]Detected VIPT I-cache on CPU6 | |
[ 15.665193] -(6)[0:swapper/6]CPU6: update cpu_capacity 1024 | |
[ 15.666776] -(7)[0:swapper/7]CPU7: Booted secondary processor | |
[ 15.666804] -(7)[0:swapper/7]Detected VIPT I-cache on CPU7 | |
[ 15.666975] -(7)[0:swapper/7]CPU7: update cpu_capacity 1024 | |
[ 15.668092] (0)[130:hps_main][HPS] (0020)(6)action end(596)(1736)(0)(0) (8)(8)(8)(8)(1) (0)(0)(0) (0)(0)(0) (1)(1736)(1)(0)(1736) wifi_base(0) | |
[ 15.680263] (4)[312:wmt_loader][WMT-DETECT][I]wmt_detect_open:open major 154 minor 0 (pid 312) | |
[ 15.683269] (4)[312:wmt_loader][WMT-DETECT][I]wmt_detect_unlocked_ioctl:cmd (-2147191034),arg(92) | |
[ 15.692483] (4)[312:wmt_loader][WMT-DETECT][I]wmt_detect_ext_chip_pwr_on:combo chip is not supported | |
[ 15.693908] (4)[312:wmt_loader][WMT-DETECT][I]wmt_detect_unlocked_ioctl:cmd (-2147191037),arg(0) | |
[ 15.699120] (3)[302:android.hardwar]<ALS/PS> ps vender_div value: 100 | |
[ 15.700401] (3)[302:android.hardwar]<ALS/PS> als vender_div value: 100 | |
[ 15.702692] (4)[312:wmt_loader][WMT-DETECT][I]wmt_detect_unlocked_ioctl:cmd (1074034433),arg(823) | |
[ 15.703857] (4)[312:wmt_loader]set current consys chipid (0x337) | |
[ 15.704670] (4)[312:wmt_loader][WMT-DETECT][I]wmt_detect_unlocked_ioctl:cmd (-2147191035),arg(26421) | |
[ 15.706027] (4)[312:wmt_loader][SDIO-DETECT][I]sdio_detect_exit:sdio_unregister_driver | |
[ 15.707087] (4)[312:wmt_loader][WMT-DETECT][I]wmt_detect_unlocked_ioctl:cmd (-2147191036),arg(26421) | |
[ 15.708278] (4)[312:wmt_loader][WMT-MOD-INIT][I]do_common_drv_init:start to do common driver init, chipid:0x00006735 | |
[ 15.712233] (4)[312:wmt_loader][HIF-SDIO][I]hif_sdio_init:start! | |
[ 15.713257] (4)[312:wmt_loader][HIF-SDIO][I]hif_sdio_deep_sleep_info_dmp:p_ds_info: 0x00fcb400, chipid:0x6630, reg_offset:0xf1, value:0x1 | |
[ 15.714866] (4)[312:wmt_loader][HIF-SDIO][I]hif_sdio_deep_sleep_info_dmp:ctl_info[0]--ctx:0x00000000, func_num:0, act_flag:0, en_flag:0 | |
[ 15.715065] (0)[1:init]init: Service 'exec 5 (/system/bin/vdc --wait cryptfs mountdefaultencrypted)' (pid 314) exited with status 0 waiting took 0.068000 seconds | |
[ 15.716021] (0)[1:init]init: processing action (init.svc.adbd=stopped) from (/init.usb.configfs.rc:15) | |
[ 15.720033] (4)[312:wmt_loader][HIF-SDIO][I]hif_sdio_deep_sleep_info_dmp:ctl_info[1]--ctx:0x00000000, func_num:0, act_flag:0, en_flag:0 | |
[ 15.724519] (4)[310:ccci_fsd][md1]port ccci_fs open with flag 20002 by ccci_fsd | |
[ 15.726115] (4)[312:wmt_loader][HIF-SDIO][I]hif_sdio_deep_sleep_info_dmp:p_ds_info: 0x00fcb448, chipid:0x6632, reg_offset:0xf1, value:0x1 | |
[ 15.727724] (4)[312:wmt_loader][HIF-SDIO][I]hif_sdio_deep_sleep_info_dmp:ctl_info[0]--ctx:0x00000000, func_num:0, act_flag:0, en_flag:0 | |
[ 15.729320] (4)[312:wmt_loader][HIF-SDIO][I]hif_sdio_deep_sleep_info_dmp:ctl_info[1]--ctx:0x00000000, func_num:0, act_flag:0, en_flag:0 | |
[ 15.730898] (4)[312:wmt_loader][HIF-SDIO][I]hif_sdio_deep_sleep_info_dmp:p_ds_info: 0x00fcb490, chipid:0x0, reg_offset:0x0, value:0x0 | |
[ 15.732475] (4)[312:wmt_loader][HIF-SDIO][I]hif_sdio_deep_sleep_info_dmp:ctl_info[0]--ctx:0x00000000, func_num:0, act_flag:0, en_flag:0 | |
[ 15.734058] (4)[312:wmt_loader][HIF-SDIO][I]hif_sdio_deep_sleep_info_dmp:ctl_info[1]--ctx:0x00000000, func_num:0, act_flag:0, en_flag:0 | |
[ 15.735555] (7)[306:healthd]healthd: unable to get HAL interface, using defaults | |
[ 15.736657] (4)[312:wmt_loader][HIF-SDIO][I]WMT_init:WMT Version= Consys WMT Driver - v1.0 DATE=2013/01/20 | |
[ 15.742777] (7)[306:healthd]healthd: BatteryFullChargePath not found | |
[ 15.743661] (7)[306:healthd]healthd: BatteryCycleCountPath not found | |
[ 15.745649] (7)[306:healthd]healthd: battery l=100 v=0 t=29.0 h=2 st=4 c=0 chg= | |
[ 15.753962] (4)[312:wmt_loader][STP] mtk_wcn_stp_dbg_enable:[I] STP dbg mode is turned on | |
[ 15.755059] (4)[312:wmt_loader][HIF-SDIO][I]WMT_init:driver(major 190) installed | |
[ 15.756556] (4)[312:wmt_loader](NULL device *): Direct firmware load for WMT_SOC.cfg failed with error -2 | |
[ 15.757814] (4)[312:wmt_loader](NULL device *): Falling back to user helper | |
[ 15.780989] (0)[320:ueventd]ueventd: firmware: loading 'WMT_SOC.cfg' for '/devices/virtual/firmware/WMT_SOC.cfg' | |
[ 15.782251] (4)[311:ccci_mdinit]Dump cpuinfo | |
[ 15.785407] (3)[311:ccci_mdinit][ccci0/util]cfg_info_buffer size:87 | |
[ 15.786694] (6)[296:android.hardwar]Dump cpuinfo | |
[ 15.786710] (3)[311:ccci_mdinit][ccci0/util]cfg_info_buffer size:87 | |
[ 15.787338] (2)[320:ueventd]ueventd: loading /devices/virtual/firmware/WMT_SOC.cfg took 6ms | |
[ 15.787402] (4)[312:wmt_loader][HIF-SDIO][I]wmt_dev_patch_get:loader firmware WMT_SOC.cfg ok!! | |
[ 15.787411] (4)[312:wmt_loader][WMT-CONF][I]wmt_conf_read_file:get full file name(WMT_SOC.cfg) buf(0xffffff8003e2e000) size(80) | |
[ 15.788109] (4)[312:wmt_loader][HIF-SDIO][I]wmt_lib_init:set pwr on seq par to hw conf | |
[ 15.788116] (4)[312:wmt_loader][HIF-SDIO][I]wmt_lib_init:ldo(0)rst(0)on(0)off(0)rtc(0) | |
[ 15.791384] (4)[312:wmt_loader][CONN-MD-DFT][W]conn_md_add_user:uid (0x80000003) is added to user list successfully | |
[ 15.791451] (4)[312:wmt_loader][HIF-SDIO][I]WMT_init:wmt_dev register thermal cb | |
[ 15.791462] (3)[321:mtk_wmtd][HIF-SDIO][I]wmtd_thread:wmtd thread starts | |
[ 15.791539] (4)[312:wmt_loader][HIF-SDIO][I]WMT_init:wmt register fb_notifier OK! | |
[ 15.791544] (4)[312:wmt_loader][HIF-SDIO][I]WMT_init:success | |
[ 15.791708] (4)[312:wmt_loader][UART] stp_uart_fifo_init: stp_uart_fifo_init() success. | |
[ 15.791793] (4)[312:wmt_loader][STP SDIO][I]stp_sdio_host_info_op:memory allocate for g_stp_sdio_host_info.pkt_buf.tx_buf succeed! | |
[ 15.791802] (4)[312:wmt_loader][STP SDIO][I]stp_sdio_host_info_op:memory allocate for g_stp_sdio_host_info.pkt_buf.rx_buf succeed! | |
[ 15.791808] (4)[312:wmt_loader][STP SDIO][I]stp_sdio_init:cltinfo func table size:8 | |
[ 15.791813] (4)[312:wmt_loader][STP SDIO][I]stp_sdio_init:manf_id:0x37a, card_id:0x18b, func_num:1, blk_size:512 | |
[ 15.791817] (4)[312:wmt_loader][STP SDIO][I]stp_sdio_init:manf_id:0x37a, card_id:0x18c, func_num:1, blk_size:512 | |
[ 15.791821] (4)[312:wmt_loader][STP SDIO][I]stp_sdio_init:manf_id:0x37a, card_id:0x6619, func_num:1, blk_size:512 | |
[ 15.791825] (4)[312:wmt_loader][STP SDIO][I]stp_sdio_init:manf_id:0x37a, card_id:0x20b, func_num:1, blk_size:512 | |
[ 15.791829] (4)[312:wmt_loader][STP SDIO][I]stp_sdio_init:manf_id:0x37a, card_id:0x20c, func_num:1, blk_size:512 | |
[ 15.791833] (4)[312:wmt_loader][STP SDIO][I]stp_sdio_init:manf_id:0x37a, card_id:0x6628, func_num:2, blk_size:512 | |
[ 15.791837] (4)[312:wmt_loader][STP SDIO][I]stp_sdio_init:manf_id:0x37a, card_id:0x6630, func_num:2, blk_size:512 | |
[ 15.791841] (4)[312:wmt_loader][STP SDIO][I]stp_sdio_init:manf_id:0x37a, card_id:0x6632, func_num:2, blk_size:512 | |
[ 15.791938] (4)[312:wmt_loader][STP SDIO][I]stp_sdio_init:blk_size(512), tx_buf_cnt(16), fifo tx(2080) rx(2304), buf tx(2560) rx(2560) | |
[ 15.791943] (4)[312:wmt_loader][WMT-MOD-INIT][I]do_common_drv_init:common driver init finish:0 | |
[ 15.791948] (4)[312:wmt_loader][BT-MOD-INIT][I]do_bluetooth_drv_init:start to do bluetooth driver init | |
[ 15.792240] (4)[312:wmt_loader][BT-MOD-INIT][I]do_bluetooth_drv_init:finish bluetooth driver init, i_ret:0 | |
[ 15.792245] (4)[312:wmt_loader][GPS-MOD-INIT][I]do_gps_drv_init:start to do gps driver init | |
[ 15.792465] (4)[312:wmt_loader]mtk_stp_GPS_chrdev driver(major 191) installed. | |
[ 15.792474] (4)[312:wmt_loader][GPS-MOD-INIT][I]do_gps_drv_init:finish gps driver init, i_ret:0 | |
[ 15.792477] (4)[312:wmt_loader][FM-MOD-INIT][I]do_fm_drv_init:start to do fm module init | |
[ 15.792482] (4)[312:wmt_loader][FM_NTC | MAIN]fm_env_setup | |
[ 15.792492] (4)[312:wmt_loader][FM_NTC | MAIN]fm ops registered | |
[ 15.792500] (4)[312:wmt_loader][FM_NTC | MAIN]fm locks created | |
[ 15.792504] (4)[312:wmt_loader][FM_NTC | MAIN]fm timer created | |
[ 15.792519] (4)[312:wmt_loader][FM_NTC | LINK]fm link setup | |
[ 15.792552] (4)[312:wmt_loader][FM_NTC | LINK]cmd_fifo created | |
[ 15.792578] (4)[312:wmt_loader][FM_NTC | LINK]evt_fifo created | |
[ 15.793191] (4)[312:wmt_loader][FM_NTC | MAIN]mt_fm_probe | |
[ 15.793686] (5)[312:wmt_loader][FM_NTC | MAIN]chipid:0x6627, chip type:1 | |
[ 15.793692] (5)[312:wmt_loader][FM_NTC | MAIN]FM default config | |
[ 15.793696] (5)[312:wmt_loader][FM_NTC | MAIN]0x6627 configs: | |
[ 15.793700] (5)[312:wmt_loader][FM_NTC | MAIN]RX->rssi_l: -296 | |
[ 15.793703] (5)[312:wmt_loader][FM_NTC | MAIN]RX->rssi_s: -296 | |
[ 15.793706] (5)[312:wmt_loader][FM_NTC | MAIN]RX->pamd_th: -12 | |
[ 15.793709] (5)[312:wmt_loader][FM_NTC | MAIN]RX->mr_th: -67 | |
[ 15.793712] (5)[312:wmt_loader][FM_NTC | MAIN]RX->atdc_th: 3496 | |
[ 15.793715] (5)[312:wmt_loader][FM_NTC | MAIN]RX->prx_th: 64 | |
[ 15.793718] (5)[312:wmt_loader][FM_NTC | MAIN]RX->smg_th: 16421 | |
[ 15.793721] (5)[312:wmt_loader][FM_NTC | MAIN]RX->de_emphasis: 0 | |
[ 15.793724] (5)[312:wmt_loader][FM_NTC | MAIN]RX->osc_freq: 0 | |
[ 15.793726] (5)[312:wmt_loader][FM_NTC | MAIN]RX->desense_rssi_th: -240 | |
[ 15.793729] (5)[312:wmt_loader][FM_NTC | MAIN]TX->scan_hole_low: 0 | |
[ 15.793732] (5)[312:wmt_loader][FM_NTC | MAIN]TX->scan_hole_high: 0 | |
[ 15.793734] (5)[312:wmt_loader][FM_NTC | MAIN]TX->power_level: 0 | |
[ 15.793738] (5)[312:wmt_loader][FM_NTC | MAIN]aud path[1]I2S state[1]mode[0]rate[0]pad[0] | |
[ 15.793828] (5)[312:wmt_loader](NULL device *): Direct firmware load for fm_cust.cfg failed with error -2 | |
[ 15.793832] (5)[312:wmt_loader](NULL device *): Falling back to user helper | |
[ 15.797395] (4)[325:ueventd]ueventd: firmware: loading 'fm_cust.cfg' for '/devices/virtual/firmware/fm_cust.cfg' | |
[ 15.797929] (4)[325:ueventd]ueventd: firmware: could not find firmware for fm_cust.cfg | |
[ 15.798152] (4)[325:ueventd]ueventd: loading /devices/virtual/firmware/fm_cust.cfg took 0ms | |
[ 15.798203] (5)[312:wmt_loader][FM_ERR | CHIP]Failed to load firmware "fm_cust.cfg" | |
[ 15.798208] (5)[312:wmt_loader][FM_ALT | MAIN]fail to read config file = fm_cust.cfg | |
[ 15.798216] (5)[312:wmt_loader][FM_NTC | MAIN]FM cust config | |
[ 15.798220] (5)[312:wmt_loader][FM_NTC | MAIN]0x6627 configs: | |
[ 15.798223] (5)[312:wmt_loader][FM_NTC | MAIN]RX->rssi_l: -296 | |
[ 15.798226] (5)[312:wmt_loader][FM_NTC | MAIN]RX->rssi_s: -296 | |
[ 15.798229] (5)[312:wmt_loader][FM_NTC | MAIN]RX->pamd_th: -12 | |
[ 15.798232] (5)[312:wmt_loader][FM_NTC | MAIN]RX->mr_th: -67 | |
[ 15.798235] (5)[312:wmt_loader][FM_NTC | MAIN]RX->atdc_th: 3496 | |
[ 15.798238] (5)[312:wmt_loader][FM_NTC | MAIN]RX->prx_th: 64 | |
[ 15.798241] (5)[312:wmt_loader][FM_NTC | MAIN]RX->smg_th: 16421 | |
[ 15.798244] (5)[312:wmt_loader][FM_NTC | MAIN]RX->de_emphasis: 0 | |
[ 15.798246] (5)[312:wmt_loader][FM_NTC | MAIN]RX->osc_freq: 0 | |
[ 15.798250] (5)[312:wmt_loader][FM_NTC | MAIN]RX->desense_rssi_th: -240 | |
[ 15.798252] (5)[312:wmt_loader][FM_NTC | MAIN]TX->scan_hole_low: 0 | |
[ 15.798255] (5)[312:wmt_loader][FM_NTC | MAIN]TX->scan_hole_high: 0 | |
[ 15.798258] (5)[312:wmt_loader][FM_NTC | MAIN]TX->power_level: 0 | |
[ 15.798261] (5)[312:wmt_loader][FM_NTC | MAIN]aud path[1]I2S state[1]mode[0]rate[0]pad[0] | |
[ 15.798272] (5)[312:wmt_loader][FM_NTC | MAIN]alloc fm:231:0 | |
[ 15.798632] (5)[312:wmt_loader][FM_NTC | MAIN]create_proc_entry success | |
[ 15.798748] (5)[312:wmt_loader][FM_NTC | MAIN]6. fm platform driver registered | |
[ 15.798753] (5)[312:wmt_loader][FM-MOD-INIT][I]do_fm_drv_init:finish fm module init | |
[ 15.798758] (5)[312:wmt_loader][WLAN-MOD-INIT][I]do_wlan_drv_init:start to do wlan module init 0x6735 | |
[ 15.799019] (5)[312:wmt_loader][WLAN-MOD-INIT][I]do_wlan_drv_init:WMT-WIFI char dev init, ret:0 | |
[ 15.800646] (5)[312:wmt_loader][HIF-SDIO][I]mtk_wcn_wmt_wlan_reg:wmt wlan cb register | |
[ 15.800999] (5)[312:wmt_loader][WLAN-MOD-INIT][I]do_wlan_drv_init:WLAN-GEN2 driver init, ret:0 | |
[ 15.801004] (5)[312:wmt_loader][WLAN-MOD-INIT][I]do_wlan_drv_init:finish wlan module init | |
[ 15.801170] (5)[312:wmt_loader][WMT-DETECT][I]wmt_detect_close:close major 154 minor 0 (pid 312) | |
[ 15.801794] (0)[279:logd.auditd]type=1400 audit(1556890366.693:4): avc: denied { setattr } for pid=312 comm="wmt_loader" name="wmt_dbg" dev="proc" ino=4026534396 scontext=u:r:wmt_loader:s0 tcontext=u:object_r:proc_wmt:s0 tclass=file permissive=1 | |
[ 15.803596] (1)[1:init]init: Service 'wmt_loader' (pid 312) exited with status 0 | |
[ 15.868372] (1)[1:init]selinux: avc: denied { set } for property=debug.sf.hwc_pid pid=299 uid=1000 gid=1003 scontext=u:r:hal_graphics_composer_default:s0 tcontext=u:object_r:debug_prop:s0 tclass=property_service permissive=1 | |
[ 15.868372] | |
[ 15.892489] (0)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, mc_open_device failed: 15 | |
[ 15.936227] (5)[296:android.hardwar]Dump cpuinfo | |
[ 16.043482] (0)[313:wmt_launcher][HIF-SDIO][I]WMT_open:major 190 minor 0 (pid 313) | |
[ 16.044470] (0)[313:wmt_launcher][HIF-SDIO][I]WMT_open:1st call | |
[ 16.045415] (0)[313:wmt_launcher][HIF-SDIO][I]wmt_lib_set_hif:new hifType:2, fcCtrl:0, baud:0, fm:2 | |
[ 16.046689] (1)[321:mtk_wmtd][WMT-CORE][E]opfunc_hif_conf(1017):WMT-CORE: WMT HIF info added | |
[ 16.047680] (3)[313:wmt_launcher][STP] mtk_wcn_stp_coredump_flag_ctrl:[I] disable coredump function. | |
[ 16.047687] (3)[313:wmt_launcher][STP] mtk_wcn_stp_set_wmt_last_close:[I] set wmt_last_close flag (0) | |
[ 16.048085] (7)[339:pwr_on_conn][HIF-SDIO][I]mtk_wcn_wmt_func_ctrl:wmt-exp: OPID(3) type(9) start | |
[ 16.048101] (7)[339:pwr_on_conn][STP] mtk_wcn_stp_psm_disable:[W] STP Not Ready, Dont do Sleep/Wakeup | |
[ 16.052552] (1)[321:mtk_wmtd][WMT-CONSYS-HW][W]mtk_wcn_consys_hw_reg_ctrl:CONSYS-HW-REG-CTRL(0x00000001),start | |
[ 16.053865] (1)[321:mtk_wmtd][PMIC] regulator_get_voltage_sel bugl(name=VCN18 id=0 en_reg=5ea vol_reg=0) | |
[ 16.055100] (1)[321:mtk_wmtd][PMIC] regulator_get_voltage_sel(name=VCN18 id=0 en_reg=5ea vol_reg=0 reg/sel:0 voltage:0 [0x0]=0x9) | |
[ 16.056643] (1)[321:mtk_wmtd]vcn18: operation not allowed | |
[ 16.057365] (1)[321:mtk_wmtd][PMIC] [PMIC]regulator_is_enabled(name=VCN18 id=0 en_reg=5ea vol_reg=0 en=0) | |
[ 16.058618] (1)[321:mtk_wmtd][PMIC] regulator_enable(name=VCN18 id=0 en_reg=5ea vol_reg=0) [a3a]=0x8102 | |
[ 16.060209] (1)[321:mtk_wmtd][PMIC] regulator_get_voltage_sel bugl(name=VCN28 id=0 en_reg=527 vol_reg=0) | |
[ 16.061435] (1)[321:mtk_wmtd][PMIC] regulator_get_voltage_sel(name=VCN28 id=0 en_reg=527 vol_reg=0 reg/sel:0 voltage:0 [0x0]=0x9) | |
[ 16.062953] (1)[321:mtk_wmtd]vcn28: operation not allowed | |
[ 16.063671] (1)[321:mtk_wmtd][PMIC] [PMIC]regulator_is_enabled(name=VCN28 id=0 en_reg=527 vol_reg=0 en=0) | |
[ 16.064917] (1)[321:mtk_wmtd][PMIC] regulator_enable(name=VCN28 id=0 en_reg=527 vol_reg=0) [a0e]=0xc10a | |
[ 16.066544] (1)[321:mtk_wmtd][Power/clkmgr] [conn_power_on] | |
[ 16.067289] (6)[1:init][WMT-CONSYS-HW][E]polling_consys_chipid(601):Read CONSYS chipId(0x00000000) | |
[ 16.068110] (6)[1:init]selinux: avc: denied { set } for property=debug.sf.hwc_pid pid=308 uid=1000 gid=1003 scontext=u:r:surfaceflinger:s0 tcontext=u:object_r:debug_prop:s0 tclass=property_service permissive=1 | |
[ 16.068110] | |
[ 16.075452] (0)[1:init]selinux: avc: denied { set } for property=ro.sf.lcd_density pid=308 uid=1000 gid=1003 scontext=u:r:surfaceflinger:s0 tcontext=u:object_r:default_prop:s0 tclass=property_service permissive=1 | |
[ 16.075452] | |
[ 16.078171] (0)[1:init]init: property_set("ro.sf.lcd_density", "320") failed: property already set | |
[ 16.115824] (1)[321:mtk_wmtd][WMT-CONSYS-HW][W]mtk_wcn_consys_hw_reg_ctrl:CONSYS-HW-REG-CTRL(0x00000001),finish | |
[ 16.117140] (1)[321:mtk_wmtd][WMT-PLAT][W]wmt_plat_soc_gps_sync_ctrl:host gps sync pin not defined!!! | |
[ 16.118350] (1)[321:mtk_wmtd][WMT-PLAT][W]wmt_plat_soc_i2s_ctrl:host i2s pin not defined!!! | |
[ 16.119658] (1)[321:mtk_wmtd]MTK-BTIF-EXP[I]mtk_wcn_btif_open:p_btif(0xffffffc000fcf3e8) | |
[ 16.120735] (1)[321:mtk_wmtd]MTK-BTIF-EXP[I]mtk_wcn_btif_open:owner name:CONSYS_STP, recorded name:CONSYS_STP | |
[ 16.122031] (1)[321:mtk_wmtd]MTK-BTIF[I]_btif_lpbk_ctrl:loopback function disabled | |
[ 16.123067] (1)[321:mtk_wmtd]MTK-BTIF[I]_btif_controller_setup:succeed | |
[ 16.123961] (1)[321:mtk_wmtd]MTK-BTIF[I]_btif_tx_dma_setup:succeed | |
[ 16.124786] (1)[321:mtk_wmtd]MTK-BTIF[I]_btif_rx_dma_setup:succeed | |
[ 16.125592] (1)[321:mtk_wmtd]MTK-BTIF[I]btif_log_buf_reset:reset Tx log buffer | |
[ 16.126592] (1)[321:mtk_wmtd]MTK-BTIF[I]btif_log_buf_reset:reset Rx log buffer | |
[ 16.127539] (1)[321:mtk_wmtd]MTK-BTIF[I]btif_open:BTIF's Tx Mode:1, Rx Mode(1) | |
[ 16.128474] (1)[321:mtk_wmtd]MTK-BTIF-EXP[I]mtk_wcn_btif_open:btif_open succeed | |
[ 16.129475] (1)[321:mtk_wmtd][STP] mtk_wcn_stp_enable:[I] mtk_wcn_stp_enable: set the current enable = (0) | |
[ 16.130743] (1)[321:mtk_wmtd][STP] mtk_wcn_stp_ready:[I] set ready (0) | |
[ 16.131598] (1)[321:mtk_wmtd][STP] mtk_wcn_stp_enable:[I] mtk_wcn_stp_enable: set the current enable = (1) | |
[ 16.132887] (1)[321:mtk_wmtd][STP] mtk_wcn_stp_set_wmt_evt_err_trg_assert:[I] set evt err tigger assert flag to 0 | |
[ 16.134809] (1)[321:mtk_wmtd][WMT-CORE][I]wmt_core_hw_check:get hwcode (chip id) (0x337) | |
[ 16.137387] (1)[321:mtk_wmtd][WMT-IC][W]mtk_wcn_soc_ver_check:0x337: ic info: SOC_CONSYS.E1 (0x8a00/0x8a00, WMTHWVER:0, patch_ext:_e1) | |
[ 16.138947] (1)[321:mtk_wmtd][WMT-CORE][I]wmt_core_hw_check:chip id(0x337) ver_check ok | |
[ 16.141345] (1)[321:mtk_wmtd][STP] mtk_wcn_stp_enable:[I] mtk_wcn_stp_enable: set the current enable = (1) | |
[ 16.142604] (1)[321:mtk_wmtd][STP] mtk_wcn_stp_set_wmt_evt_err_trg_assert:[I] set evt err tigger assert flag to 0 | |
[ 16.163089] (3)[321:mtk_wmtd][HIF-SDIO][I]wmt_ctrl_ul_cmd:str(srh_patch) result(0) | |
[ 16.166007] (3)[321:mtk_wmtd](NULL device *): Direct firmware load for ROMv2_lm_patch_1_1_hdr.bin failed with error -2 | |
[ 16.167383] (3)[321:mtk_wmtd](NULL device *): Falling back to user helper | |
[ 16.169329] (0)[362:ueventd]ueventd: firmware: loading 'ROMv2_lm_patch_1_1_hdr.bin' for '/devices/virtual/firmware/ROMv2_lm_patch_1_1_hdr.bin' | |
[ 16.174829] (2)[362:ueventd]ueventd: loading /devices/virtual/firmware/ROMv2_lm_patch_1_1_hdr.bin took 5ms | |
[ 16.174869] (3)[321:mtk_wmtd][HIF-SDIO][I]wmt_dev_patch_get:loader firmware ROMv2_lm_patch_1_1_hdr.bin ok!! | |
[ 16.175495] (3)[321:mtk_wmtd][WMT-IC][I]mtk_wcn_soc_patch_dwn:[Patch]BuiltTime = 20180222194438a, HVer = 0x8a00, SVer = 0x8a00, PhVer = 0x00fa,Platform = 1746 | |
[ 16.268842] (2)[308:surfaceflinger]DISP/MTKFB [FB Driver] enter late_resume | |
[ 16.268890] (1)[1:init]init: starting service 'bootanim'... | |
[ 16.268916] (2)[308:surfaceflinger]DISP/MTKFB [FB Driver] leave late_resume | |
[ 16.268924] (2)[308:surfaceflinger][Power/cpufreq] @_mt_cpufreq_lcm_status_switch: LCM is on | |
[ 16.269298] (2)[308:surfaceflinger][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1012mv, freq = 819000 KHz | |
[ 16.269333] (2)[308:surfaceflinger] | |
[ 16.269333] <<SOC DVFS FLIPER>> Late Resume | |
[ 16.269337] (2)[308:surfaceflinger]fliper enable +++ | |
[ 16.269347] (2)[308:surfaceflinger][HIF-SDIO][W]wmt_fb_notifier_callback:@@@@@@@@@@wmt enter UNBLANK @@@@@@@@@@@@@@ | |
[ 16.276110] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1162mv, freq = 1300000 KHz | |
[ 16.276282] (2)[195:kworker/2:1][HIF-SDIO][I]mtk_wcn_wmt_func_ctrl:wmt-exp: OPID(3) type(9) start | |
[ 16.277429] (2)[195:kworker/2:1][WMT-PLAT][W]wmt_plat_wake_lock_ctrl:WMT-PLAT: wakelock status(1), counter(2) | |
[ 16.285268] (5)[293:android.hardwar]Dump cpuinfo | |
[ 16.326108] (0)[293:android.hardwar][camdebug] g_invokeSensorNameStr ov13850v36mipiraw CAMERA_HW_DRVNAME1 kd_camera_hw | |
[ 16.327498] (0)[293:android.hardwar][DUAL_CAMERA_MAIN_SENSOR] on = 1 | |
[ 16.328323] (0)[293:android.hardwar][camdebug] ov13850 poweron | |
[ 16.329117] (0)[293:android.hardwar]PinIdx(1) PwrType(1) val(0) | |
[ 16.329907] (0)[293:android.hardwar][kd_camera_hw]PinIdx(1) PwrType(1) val(0) | |
[ 16.330828] (0)[293:android.hardwar]PinIdx(0) PwrType(1) val(0) | |
[ 16.331616] (0)[293:android.hardwar][kd_camera_hw]PinIdx(0) PwrType(1) val(0) | |
[ 16.332588] (0)[293:android.hardwar][PMIC] [PMIC]regulator_is_enabled(name=VCAMIO id=0 en_reg=600 vol_reg=672 en=0) | |
[ 16.333936] (0)[293:android.hardwar][PMIC] regulator_get_voltage_sel(name=VCAMIO id=0 en_reg=600 vol_reg=672 reg/sel:3 voltage:1800000 [0xa3e]=0x100) | |
[ 16.335639] (0)[293:android.hardwar][PMIC] regulator_set_voltage_sel(name=VCAMIO id=0 en_reg=600 vol_reg=672 selector=3) | |
[ 16.337060] (0)[293:android.hardwar][PMIC] [PMIC]regulator_is_enabled(name=VCAMIO id=0 en_reg=600 vol_reg=672 en=0) | |
[ 16.338406] (0)[293:android.hardwar][PMIC] regulator_enable(name=VCAMIO id=0 en_reg=600 vol_reg=672) [a3e]=0x8102 | |
[ 16.341078] (0)[293:android.hardwar][PMIC] [PMIC]regulator_is_enabled(name=VCAMA id=0 en_reg=520 vol_reg=63a en=0) | |
[ 16.342434] (0)[293:android.hardwar][PMIC] regulator_get_voltage_sel(name=VCAMA id=0 en_reg=520 vol_reg=63a reg/sel:3 voltage:2800000 [0xa0c]=0x100) | |
[ 16.344127] (0)[293:android.hardwar][PMIC] regulator_set_voltage_sel(name=VCAMA id=0 en_reg=520 vol_reg=63a selector=3) | |
[ 16.345527] (0)[293:android.hardwar][PMIC] [PMIC]regulator_is_enabled(name=VCAMA id=0 en_reg=520 vol_reg=63a en=0) | |
[ 16.346875] (0)[293:android.hardwar][PMIC] regulator_enable(name=VCAMA id=0 en_reg=520 vol_reg=63a) [a0c]=0x8102 | |
[ 16.349574] (0)[293:android.hardwar][PMIC] [PMIC]regulator_is_enabled(name=VCAMD id=0 en_reg=5f6 vol_reg=666 en=0) | |
[ 16.350909] (0)[293:android.hardwar][PMIC] regulator_get_voltage_sel(name=VCAMD id=0 en_reg=5f6 vol_reg=666 reg/sel:4 voltage:1300000 [0xa3c]=0x100) | |
[ 16.352615] (0)[293:android.hardwar][PMIC] regulator_set_voltage_sel(name=VCAMD id=0 en_reg=5f6 vol_reg=666 selector=3) | |
[ 16.353992] (0)[293:android.hardwar][PMIC] [upmu_set_rg_vcamd] old cal=0 new cal=1. | |
[ 16.355007] (0)[293:android.hardwar][PMIC] [upmu_set_rg_vcamd]:1 old cal=0 new cal=1. | |
[ 16.356058] (0)[293:android.hardwar][PMIC] [PMIC]regulator_is_enabled(name=VCAMD id=0 en_reg=5f6 vol_reg=666 en=0) | |
[ 16.357394] (0)[293:android.hardwar][PMIC] regulator_enable(name=VCAMD id=0 en_reg=5f6 vol_reg=666) [a3c]=0x8102 | |
[ 16.361087] (0)[293:android.hardwar][PMIC] [PMIC]regulator_is_enabled(name=VCAMAF id=0 en_reg=598 vol_reg=656 en=0) | |
[ 16.362445] (0)[293:android.hardwar][PMIC] regulator_get_voltage_sel(name=VCAMAF id=0 en_reg=598 vol_reg=656 reg/sel:5 voltage:2800000 [0xa2a]=0x120) | |
[ 16.364149] (0)[293:android.hardwar][PMIC] regulator_set_voltage_sel(name=VCAMAF id=0 en_reg=598 vol_reg=656 selector=5) | |
[ 16.365561] (0)[293:android.hardwar][PMIC] [PMIC]regulator_is_enabled(name=VCAMAF id=0 en_reg=598 vol_reg=656 en=0) | |
[ 16.366918] (0)[293:android.hardwar][PMIC] regulator_enable(name=VCAMAF id=0 en_reg=598 vol_reg=656) [a2a]=0x8122 | |
[ 16.373617] (0)[293:android.hardwar]PinIdx(0) PwrType(1) val(1) | |
[ 16.374430] (0)[293:android.hardwar][kd_camera_hw]PinIdx(0) PwrType(1) val(1) | |
[ 16.395371] (3)[293:android.hardwar][camdebug] g_invokeSensorNameStr[0] ov13850v36mipiraw mtk_ccm_name | |
[ 16.396611] (3)[293:android.hardwar][OV13850_camera_sensor] feature_control feature_id = 3040 | |
[ 16.400222] (4)[293:android.hardwar][OV13850_camera_sensor] ov13850main_sysfs_init kobject creat and add | |
[ 16.401472] (4)[293:android.hardwar][OV13850_camera_sensor] ov13850main_sysfs_init sysfs_create_file | |
[ 16.402695] (4)[293:android.hardwar][OV13850_camera_sensor] get_imgsensor_id [ryf]i2c write id: 0x20, sensor id: 0xd850 | |
[ 16.404084] (4)[293:android.hardwar][camdebug] g_invokeSensorNameStr[1] non_sensor mtk_ccm_name CAM[1]:ov13850v36mipiraw; | |
[ 16.405510] (4)[293:android.hardwar][DUAL_CAMERA_MAIN_SENSOR] on = 0 | |
[ 16.406377] (4)[293:android.hardwar][camdebug] ov13850 poweroff | |
[ 16.407152] (4)[293:android.hardwar]PinIdx(0) PwrType(1) val(0) | |
[ 16.407951] (4)[293:android.hardwar][kd_camera_hw]PinIdx(0) PwrType(1) val(0) | |
[ 16.408889] (4)[293:android.hardwar][PMIC] [PMIC]regulator_is_enabled(name=VCAMAF id=0 en_reg=598 vol_reg=656 en=1) | |
[ 16.410268] (4)[293:android.hardwar][PMIC] regulator_disable(name=VCAMAF id=0 en_reg=598 vol_reg=656 use_count=1) [a2a]=0x120 | |
[ 16.411723] (4)[293:android.hardwar][PMIC] [PMIC]regulator_is_enabled(name=VCAMD id=0 en_reg=5f6 vol_reg=666 en=1) | |
[ 16.413088] (4)[293:android.hardwar][PMIC] regulator_disable(name=VCAMD id=0 en_reg=5f6 vol_reg=666 use_count=1) [a3c]=0x100 | |
[ 16.414535] (4)[293:android.hardwar][PMIC] [PMIC]regulator_is_enabled(name=VCAMA id=0 en_reg=520 vol_reg=63a en=1) | |
[ 16.415921] (4)[293:android.hardwar][PMIC] regulator_disable(name=VCAMA id=0 en_reg=520 vol_reg=63a use_count=1) [a0c]=0x100 | |
[ 16.417365] (4)[293:android.hardwar][PMIC] [PMIC]regulator_is_enabled(name=VCAMIO id=0 en_reg=600 vol_reg=672 en=1) | |
[ 16.418721] (4)[293:android.hardwar][PMIC] regulator_disable(name=VCAMIO id=0 en_reg=600 vol_reg=672 use_count=1) [a3e]=0x100 | |
[ 16.420371] (4)[293:android.hardwar][OV13850_camera_sensor] get_info scenario_id = 0 | |
[ 16.421580] (4)[293:android.hardwar][camdebug] g_invokeSensorNameStr ov5670v36mipiraw CAMERA_HW_DRVNAME1 kd_camera_hw | |
[ 16.422970] (4)[293:android.hardwar][DUAL_CAMERA_MAIN_SENSOR] on = 1 | |
[ 16.423797] (4)[293:android.hardwar][kdModulePowerOn] | |
[ 16.424144] (4)[293:android.hardwar][adopt_CAMERA_HW_CheckIsAlive] ERROR_SENSOR_POWER_ON_FAIL (4)[293:android.hardwar][DUAL_CAMERA_MAIN_SENSOR] on = 0 | |
[ 16.425903] (4)[293:android.hardwar][kdModulePowerOn] | |
[ 16.426244] (4)[293:android.hardwar][adopt_CAMERA_HW_CheckIsAlive] ERROR_SENSOR_POWER_ON_FAIL (4)[293:android.hardwar][ov5670_camera_sensor] get_info scenario_id = 0 | |
[ 16.428416] (4)[293:android.hardwar][camdebug] g_invokeSensorNameStr s5k5e8yxv36mipiraw CAMERA_HW_DRVNAME1 kd_camera_hw | |
[ 16.429835] (4)[293:android.hardwar][DUAL_CAMERA_MAIN_SENSOR] on = 1 | |
[ 16.430666] (4)[293:android.hardwar][kdModulePowerOn] | |
[ 16.431012] (4)[293:android.hardwar][adopt_CAMERA_HW_CheckIsAlive] ERROR_SENSOR_POWER_ON_FAIL (4)[293:android.hardwar][DUAL_CAMERA_MAIN_SENSOR] on = 0 | |
[ 16.432774] (4)[293:android.hardwar][kdModulePowerOn] | |
[ 16.433115] (4)[293:android.hardwar][adopt_CAMERA_HW_CheckIsAlive] ERROR_SENSOR_POWER_ON_FAIL (4)[293:android.hardwar][S5K5E8YX_camera_sensor] get_info scenario_id = 0 | |
[ 16.435299] (4)[293:android.hardwar]ERROR:kdSetDriver() | |
[ 16.436107] (4)[293:android.hardwar][camdebug] g_invokeSensorNameStr s5k5e8yxv36mipiraw CAMERA_HW_DRVNAME1 kd_camera_hw | |
[ 16.447517] (3)[293:android.hardwar][camdebug] g_invokeSensorNameStr[0] s5k5e8yxv36mipiraw mtk_ccm_name CAM[1]:ov13850v36mipiraw; | |
[ 16.449035] (3)[293:android.hardwar][camdebug] g_invokeSensorNameStr[1] non_sensor mtk_ccm_name CAM[1]:ov13850v36mipiraw; | |
[ 16.450750] (3)[293:android.hardwar][camdebug] g_invokeSensorNameStr ov13850v36mipiraw CAMERA_HW_DRVNAME1 kd_camera_hw | |
[ 16.452123] (3)[293:android.hardwar][DUAL_CAMERA_SUB_SENSOR] on = 1 | |
[ 16.452959] (3)[293:android.hardwar][kdModulePowerOn] | |
[ 16.453297] (3)[293:android.hardwar][adopt_CAMERA_HW_CheckIsAlive] ERROR_SENSOR_POWER_ON_FAIL (3)[293:android.hardwar][DUAL_CAMERA_SUB_SENSOR] on = 0 | |
[ 16.455028] (3)[293:android.hardwar][kdModulePowerOn] | |
[ 16.455377] (3)[293:android.hardwar][adopt_CAMERA_HW_CheckIsAlive] ERROR_SENSOR_POWER_ON_FAIL (3)[293:android.hardwar][OV13850_camera_sensor] get_info scenario_id = 0 | |
[ 16.457509] (3)[293:android.hardwar][camdebug] g_invokeSensorNameStr ov5670v36mipiraw CAMERA_HW_DRVNAME1 kd_camera_hw | |
[ 16.458865] (3)[293:android.hardwar][DUAL_CAMERA_SUB_SENSOR] on = 1 | |
[ 16.459730] (3)[293:android.hardwar][kdModulePowerOn] | |
[ 16.460068] (3)[293:android.hardwar][adopt_CAMERA_HW_CheckIsAlive] ERROR_SENSOR_POWER_ON_FAIL (3)[293:android.hardwar][DUAL_CAMERA_SUB_SENSOR] on = 0 | |
[ 16.461799] (3)[293:android.hardwar][kdModulePowerOn] | |
[ 16.462151] (3)[293:android.hardwar][adopt_CAMERA_HW_CheckIsAlive] ERROR_SENSOR_POWER_ON_FAIL (3)[293:android.hardwar][ov5670_camera_sensor] get_info scenario_id = 0 | |
[ 16.464269] (3)[293:android.hardwar][camdebug] g_invokeSensorNameStr s5k5e8yxv36mipiraw CAMERA_HW_DRVNAME1 kd_camera_hw | |
[ 16.465650] (3)[293:android.hardwar][DUAL_CAMERA_SUB_SENSOR] on = 1 | |
[ 16.466494] (3)[293:android.hardwar][kdModulePowerOn] | |
[ 16.466831] (3)[293:android.hardwar][adopt_CAMERA_HW_CheckIsAlive] ERROR_SENSOR_POWER_ON_FAIL (3)[293:android.hardwar][DUAL_CAMERA_SUB_SENSOR] on = 0 | |
[ 16.468562] (3)[293:android.hardwar][kdModulePowerOn] | |
[ 16.468913] (3)[293:android.hardwar][adopt_CAMERA_HW_CheckIsAlive] ERROR_SENSOR_POWER_ON_FAIL (3)[293:android.hardwar][S5K5E8YX_camera_sensor] get_info scenario_id = 0 | |
[ 16.470309] (2)[366:kworker/2:2] | |
[ 16.470309] <<SOC DVFS FLIPER>> flip to S(0), 1504 | |
[ 16.471272] (0)[130:hps_main]MobiCore mcd: Cpu 7 is going to die | |
[ 16.473192] (2)[130:hps_main]CPU7: shutdown | |
[ 16.473267] (3)[293:android.hardwar]ERROR:kdSetDriver() | |
[ 16.473304] (3)[293:android.hardwar][camdebug] g_invokeSensorNameStr s5k5e8yxv36mipiraw CAMERA_HW_DRVNAME1 kd_camera_hw | |
[ 16.476333] (2)[130:hps_main]MobiCore mcd: Cpu 7 is dead | |
[ 16.477291] (2)[130:hps_main]MobiCore mcd: Cpu 6 is going to die | |
[ 16.478895] (2)[130:hps_main]CPU6: shutdown | |
[ 16.479908] (2)[130:hps_main]MobiCore mcd: Cpu 6 is dead | |
[ 16.480804] (2)[130:hps_main][HPS] (0200)(8)action end(330)(273)(4)(0) (8)(8)(8)(8)(1) (0)(0)(0) (3538)(8)(0) (0)(273)(8)(0)(273) wifi_base(0) | |
[ 16.483314] (3)[293:android.hardwar][camdebug] g_invokeSensorNameStr[0] s5k5e8yxv36mipiraw mtk_ccm_name CAM[1]:ov13850v36mipiraw; | |
[ 16.484826] (3)[293:android.hardwar][camdebug] g_invokeSensorNameStr[1] non_sensor mtk_ccm_name CAM[1]:ov13850v36mipiraw; | |
[ 16.486660] (3)[293:android.hardwar][OV13850_camera_sensor] feature_control feature_id = 3003 | |
[ 16.487763] (3)[293:android.hardwar][OV13850_camera_sensor] feature_control feature_Control imgsensor.pclk = 0,imgsensor.current_fps = 0 | |
[ 16.489369] (3)[293:android.hardwar][OV13850_camera_sensor] feature_control feature_id = 3002 | |
[ 16.490567] (3)[293:android.hardwar][OV13850_camera_sensor] get_info scenario_id = 0 | |
[ 16.491572] (3)[293:android.hardwar][OV13850_camera_sensor] get_info scenario_id = 1 | |
[ 16.492598] (3)[293:android.hardwar][OV13850_camera_sensor] get_info scenario_id = 2 | |
[ 16.493598] (3)[293:android.hardwar][OV13850_camera_sensor] get_info scenario_id = 3 | |
[ 16.494606] (3)[293:android.hardwar][OV13850_camera_sensor] get_info scenario_id = 9 | |
[ 16.495617] (3)[293:android.hardwar][OV13850_camera_sensor] get_info scenario_id = 10 | |
[ 16.496648] (3)[293:android.hardwar][OV13850_camera_sensor] get_info scenario_id = 11 | |
[ 16.497657] (3)[293:android.hardwar][OV13850_camera_sensor] get_info scenario_id = 12 | |
[ 16.498676] (3)[293:android.hardwar][OV13850_camera_sensor] get_info scenario_id = 13 | |
[ 16.499720] (3)[293:android.hardwar][OV13850_camera_sensor] get_info scenario_id = 14 | |
[ 16.500731] (3)[293:android.hardwar][OV13850_camera_sensor] get_resolution E | |
[ 16.502303] (3)[293:android.hardwar][OV13850_camera_sensor] feature_control feature_id = 3003 | |
[ 16.503434] (3)[293:android.hardwar][OV13850_camera_sensor] feature_control feature_Control imgsensor.pclk = 0,imgsensor.current_fps = 0 | |
[ 16.505010] (3)[293:android.hardwar][OV13850_camera_sensor] feature_control feature_id = 3002 | |
[ 16.506255] (3)[293:android.hardwar][CAMERA_HW] ffffffc0aeb3d480 ffffffc0aeb3db80 ffffffc0aeb3d480 | |
[ 16.507415] (3)[293:android.hardwar][OV13850_camera_sensor] feature_control feature_id = 3058 | |
[ 16.508516] (3)[293:android.hardwar][OV13850_camera_sensor] get_default_framerate_by_scenario scenario_id = 0 | |
[ 16.509840] (3)[293:android.hardwar][CAMERA_HW] ffffffc0aeb3d480 ffffffc0aeb3db80 ffffffc0aeb3d480 | |
[ 16.510993] (3)[293:android.hardwar][OV13850_camera_sensor] feature_control feature_id = 3058 | |
[ 16.512097] (3)[293:android.hardwar][OV13850_camera_sensor] get_default_framerate_by_scenario scenario_id = 1 | |
[ 16.513411] (3)[293:android.hardwar][CAMERA_HW] ffffffc0aeb3d480 ffffffc0aeb3db80 ffffffc0aeb3d480 | |
[ 16.514563] (3)[293:android.hardwar][OV13850_camera_sensor] feature_control feature_id = 3058 | |
[ 16.515668] (3)[293:android.hardwar][OV13850_camera_sensor] get_default_framerate_by_scenario scenario_id = 2 | |
[ 16.516980] (3)[293:android.hardwar][CAMERA_HW] ffffffc0aeb3d480 ffffffc0aeb3db80 ffffffc0aeb3d480 | |
[ 16.518133] (3)[293:android.hardwar][OV13850_camera_sensor] feature_control feature_id = 3058 | |
[ 16.519267] (3)[293:android.hardwar][OV13850_camera_sensor] get_default_framerate_by_scenario scenario_id = 3 | |
[ 16.520557] (3)[293:android.hardwar][CAMERA_HW] ffffffc0aeb3d480 ffffffc0aeb3db80 ffffffc0aeb3d480 | |
[ 16.521706] (3)[293:android.hardwar][OV13850_camera_sensor] feature_control feature_id = 3058 | |
[ 16.522824] (3)[293:android.hardwar][OV13850_camera_sensor] get_default_framerate_by_scenario scenario_id = 9 | |
[ 16.524110] (3)[293:android.hardwar][CAMERA_HW] ffffffc0aeb3d480 ffffffc0aeb3db80 ffffffc0aeb3d480 | |
[ 16.525259] (3)[293:android.hardwar][OV13850_camera_sensor] feature_control feature_id = 3058 | |
[ 16.526382] (3)[293:android.hardwar][OV13850_camera_sensor] get_default_framerate_by_scenario scenario_id = 10 | |
[ 16.527678] (3)[293:android.hardwar][CAMERA_HW] ffffffc0aeb3d480 ffffffc0aeb3db80 ffffffc0aeb3d480 | |
[ 16.528827] (3)[293:android.hardwar][OV13850_camera_sensor] feature_control feature_id = 3058 | |
[ 16.529944] (3)[293:android.hardwar][OV13850_camera_sensor] get_default_framerate_by_scenario scenario_id = 11 | |
[ 16.531248] (3)[293:android.hardwar][CAMERA_HW] ffffffc0aeb3d480 ffffffc0aeb3db80 ffffffc0aeb3d480 | |
[ 16.532400] (3)[293:android.hardwar][OV13850_camera_sensor] feature_control feature_id = 3058 | |
[ 16.533514] (3)[293:android.hardwar][OV13850_camera_sensor] get_default_framerate_by_scenario scenario_id = 12 | |
[ 16.534820] (3)[293:android.hardwar][CAMERA_HW] ffffffc0aeb3d480 ffffffc0aeb3db80 ffffffc0aeb3d480 | |
[ 16.535986] (3)[293:android.hardwar][OV13850_camera_sensor] feature_control feature_id = 3058 | |
[ 16.537081] (3)[293:android.hardwar][OV13850_camera_sensor] get_default_framerate_by_scenario scenario_id = 13 | |
[ 16.538386] (3)[293:android.hardwar][CAMERA_HW] ffffffc0aeb3d480 ffffffc0aeb3db80 ffffffc0aeb3d480 | |
[ 16.539562] (3)[293:android.hardwar][OV13850_camera_sensor] feature_control feature_id = 3058 | |
[ 16.540657] (3)[293:android.hardwar][OV13850_camera_sensor] get_default_framerate_by_scenario scenario_id = 14 | |
[ 16.542255] (3)[293:android.hardwar][CAMERA_HW] ffffffc0aeb3d480 ffffffc0aeb3db80 ffffffc0aeb3d480 | |
[ 16.543433] (3)[293:android.hardwar][CAMERA_HW] ffffffc0aeb3d480 ffffffc0aeb3db80 ffffffc0aeb3d480 | |
[ 16.544587] (3)[293:android.hardwar][CAMERA_HW] ffffffc0aeb3d480 ffffffc0aeb3db80 ffffffc0aeb3d480 | |
[ 16.545769] (3)[293:android.hardwar][CAMERA_HW] ffffffc0aeb3d480 ffffffc0aeb3db80 ffffffc0aeb3d480 | |
[ 16.546923] (3)[293:android.hardwar][CAMERA_HW] ffffffc0aeb3d480 ffffffc0aeb3db80 ffffffc0aeb3d480 | |
[ 16.548083] (3)[293:android.hardwar][CAMERA_HW] ffffffc0aeb3d480 ffffffc0aeb3db80 ffffffc0aeb3d480 | |
[ 16.549269] (3)[293:android.hardwar][CAMERA_HW] ffffffc0aeb3d480 ffffffc0aeb3db80 ffffffc0aeb3d480 | |
[ 16.550425] (3)[293:android.hardwar][CAMERA_HW] ffffffc0aeb3d480 ffffffc0aeb3db80 ffffffc0aeb3d480 | |
[ 16.551585] (3)[293:android.hardwar][CAMERA_HW] ffffffc0aeb3d480 ffffffc0aeb3db80 ffffffc0aeb3d480 | |
[ 16.552770] (3)[293:android.hardwar][CAMERA_HW] ffffffc0aeb3d480 ffffffc0aeb3db80 ffffffc0aeb3d480 | |
[ 16.612302] (2)[321:mtk_wmtd][WMT-IC][W]mtk_wcn_soc_patch_dwn:wmt_core: patch dwn:0 frag(319, 872) ok | |
[ 16.613991] (2)[321:mtk_wmtd](NULL device *): Direct firmware load for ROMv2_lm_patch_1_0_hdr.bin failed with error -2 | |
[ 16.615362] (2)[321:mtk_wmtd](NULL device *): Falling back to user helper | |
[ 16.617172] (1)[376:ueventd]ueventd: firmware: loading 'ROMv2_lm_patch_1_0_hdr.bin' for '/devices/virtual/firmware/ROMv2_lm_patch_1_0_hdr.bin' | |
[ 16.621069] (2)[376:ueventd]ueventd: loading /devices/virtual/firmware/ROMv2_lm_patch_1_0_hdr.bin took 4ms | |
[ 16.621150] (0)[321:mtk_wmtd][HIF-SDIO][I]wmt_dev_patch_get:loader firmware ROMv2_lm_patch_1_0_hdr.bin ok!! | |
[ 16.818862] (3)[321:mtk_wmtd][WMT-IC][W]mtk_wcn_soc_patch_dwn:wmt_core: patch dwn:0 frag(180, 959) ok | |
[ 16.847839] (1)[321:mtk_wmtd]vcn33_bt: unsupportable voltage range: 3300000-3300uV | |
[ 16.848834] (1)[321:mtk_wmtd][PMIC] [PMIC]regulator_is_enabled(name=VCN33_BT id=0 en_reg=53e vol_reg=63d en=0) | |
[ 16.850162] (1)[321:mtk_wmtd][PMIC] regulator_enable(name=VCN33_BT id=0 en_reg=53e vol_reg=63d) [a14]=0x2 | |
[ 16.851788] (1)[321:mtk_wmtd]vcn33_wifi: unsupportable voltage range: 3300000-3300uV | |
[ 16.852807] (1)[321:mtk_wmtd][PMIC] [PMIC]regulator_is_enabled(name=VCN33_WIFI id=0 en_reg=53b vol_reg=63d en=0) | |
[ 16.854123] (1)[321:mtk_wmtd][PMIC] regulator_enable(name=VCN33_WIFI id=0 en_reg=53b vol_reg=63d) [a12]=0x2 | |
[ 16.882673] (2)[130:hps_main][HPS] (0000)(6)DBG_HRT(211)(212)(0)(0) (8)(8)(8)(8)(1) (418)(4)(0) (972)(4)(4) (0)(212)(4)(0)(212) wifi_base(0) | |
[ 17.036080] (2)[315:vold]fsck.f2fs: Info: Fix the reported corruption. | |
[ 17.036080] | |
[ 17.037180] (2)[315:vold]fsck.f2fs: Info: Segments per section = 1 | |
[ 17.037180] | |
[ 17.038209] (2)[315:vold]fsck.f2fs: Info: Sections per zone = 1 | |
[ 17.038209] | |
[ 17.039220] (2)[315:vold]fsck.f2fs: Info: sector size = 512 | |
[ 17.039220] | |
[ 17.040172] (2)[315:vold]fsck.f2fs: Info: total sectors = 52422656 (25597 MB) | |
[ 17.040172] | |
[ 17.041322] (2)[315:vold]fsck.f2fs: Can't find a valid F2FS superblock at 0x0 | |
[ 17.041322] | |
[ 17.042491] (2)[315:vold]fsck.f2fs: Can't find a valid F2FS superblock at 0x1 | |
[ 17.042491] | |
[ 17.043651] (2)[315:vold]fsck.f2fs: fsck.f2fs terminated by exit(255) | |
[ 17.043651] | |
[ 17.061295] (2)[315:vold]fsck.f2fs: Info: Fix the reported corruption. | |
[ 17.061295] | |
[ 17.062389] (2)[315:vold]fsck.f2fs: Info: Segments per section = 1 | |
[ 17.062389] | |
[ 17.063448] (2)[315:vold]fsck.f2fs: Info: Sections per zone = 1 | |
[ 17.063448] | |
[ 17.064443] (2)[315:vold]fsck.f2fs: Info: sector size = 512 | |
[ 17.064443] | |
[ 17.065397] (2)[315:vold]fsck.f2fs: Info: total sectors = 52422656 (25597 MB) | |
[ 17.065397] | |
[ 17.066570] (2)[315:vold]fsck.f2fs: Can't find a valid F2FS superblock at 0x0 | |
[ 17.066570] | |
[ 17.067729] (2)[315:vold]fsck.f2fs: Can't find a valid F2FS superblock at 0x1 | |
[ 17.067729] | |
[ 17.068893] (2)[315:vold]fsck.f2fs: fsck.f2fs terminated by exit(255) | |
[ 17.068893] | |
[ 17.071799] (0)[315:vold]EXT4-fs (dm-0): Ignoring removed nomblk_io_submit option | |
[ 17.077255] (3)[315:vold]EXT4-fs (dm-0): mounted filesystem with ordered data mode. Opts: errors=remount-ro,nomblk_io_submit | |
[ 17.078710] (3)[315:vold]SELinux: initialized (dev dm-0, type ext4), uses xattr | |
[ 17.152473] (3)[315:vold]e2fsck: e2fsck 1.43.3 (04-Sep-2016) | |
[ 17.152473] | |
[ 17.153460] (3)[315:vold]e2fsck: /dev/block/dm-0: clean, 1859/1638400 files, 154178/6552832 blocks | |
[ 17.153460] | |
[ 17.157737] (3)[315:vold]EXT4-fs (dm-0): barriers disabled | |
[ 17.160550] (3)[315:vold]EXT4-fs (dm-0): mounted filesystem with ordered data mode. Opts: lazytime,noauto_da_alloc,discard,barrier=0 | |
[ 17.162092] (3)[315:vold]SELinux: initialized (dev dm-0, type ext4), uses xattr | |
[ 17.163346] (1)[1:init]init: processing action (vold.decrypt=trigger_post_fs_data) from (/init.rc:673) | |
[ 17.164599] (1)[1:init]init: processing action (post-fs-data) from (/init.rc:376) | |
[ 17.180182] (1)[321:mtk_wmtd][PMIC] regulator_disable(name=VCN33_BT id=0 en_reg=53e vol_reg=63d use_count=1) [a14]=0x0 | |
[ 17.181583] (1)[321:mtk_wmtd][PMIC] regulator_disable(name=VCN33_WIFI id=0 en_reg=53b vol_reg=63d use_count=1) [a12]=0x0 | |
[ 17.183004] (1)[321:mtk_wmtd][WMT-IC][I]wmt_stp_init_coex:ctrl GET_WMT_CONF ok(0xffffffc00140f760) | |
[ 17.184975] (0)[321:mtk_wmtd][WMT-IC][W]mtk_wcn_soc_sw_init:co-clock disabled. | |
[ 17.186754] (0)[321:mtk_wmtd][STP] mtk_wcn_stp_psm_enable:[W] STP Not Ready, Dont do Sleep/Wakeup | |
[ 17.187901] (0)[321:mtk_wmtd][STP] mtk_wcn_stp_ready:[I] set ready (1) | |
[ 17.188760] (0)[321:mtk_wmtd][WMT-CORE][I]wmt_core_dump_func_state:[AF FUNC ON]status(b:0 f:0 g:0 w:0 lpbk:2 coredump:0 wmt:2 ant:0 sd1:0 sd2:0 stp:0) | |
[ 17.190569] (0)[339:pwr_on_conn][WMT-PLAT][W]wmt_plat_wake_lock_ctrl:WMT-PLAT: wakelock status(1), counter(1) | |
[ 17.190612] (2)[321:mtk_wmtd][WMT-CORE][W]opfunc_func_on:func(9) already on | |
[ 17.190639] (2)[195:kworker/2:1][HIF-SDIO][I]mtk_wcn_wmt_func_ctrl:OPID(3) type(9) ok | |
[ 17.190644] (2)[195:kworker/2:1][HIF-SDIO][I]wmt_pwr_on_off_handler:WMT turn on LPBK suceed | |
[ 17.194947] (3)[339:pwr_on_conn][HIF-SDIO][I]mtk_wcn_wmt_func_ctrl:OPID(3) type(9) ok | |
[ 17.216731] (3)[1:init]init: starting service 'exec 6 (/system/bin/vdc --wait cryptfs init_user0)'... | |
[ 17.218809] (3)[1:init]init: SVC_EXEC pid 391 (uid 0 gid 0+0 context default) started; waiting... | |
[ 17.233452] (1)[1:init]init: Service 'exec 6 (/system/bin/vdc --wait cryptfs init_user0)' (pid 391) exited with status 0 waiting took 0.016000 seconds | |
[ 17.235884] (2)[1:init]selinux: SELinux: Skipping restorecon_recursive(/data) | |
[ 17.235884] | |
[ 17.237420] (2)[1:init]init: starting service 'exec 7 (/system/bin/tzdatacheck /system/usr/share/zoneinfo /data/misc/zoneinfo)'... | |
[ 17.239827] (2)[1:init]init: SVC_EXEC pid 392 (uid 1000 gid 1000+0 context default) started; waiting... | |
[ 17.252501] (2)[1:init]init: Service 'exec 7 (/system/bin/tzdatacheck /system/usr/share/zoneinfo /data/misc/zoneinfo)' (pid 392) exited with status 0 waiting took 0.015000 seconds | |
[ 17.254689] (2)[1:init]init: processing action (post-fs-data) from (/init.usb.rc:6) | |
[ 17.257267] (2)[1:init]init: processing action (post-fs-data) from (/init.mt6735.rc:50) | |
[ 17.262175] (0)[1:init]init: processing action (post-fs-data) from (init.modem.rc:1) | |
[ 17.264497] (0)[1:init]selinux: SELinux: Skipping restorecon_recursive(/protect_f) | |
[ 17.264497] | |
[ 17.265861] (0)[1:init]selinux: SELinux: Skipping restorecon_recursive(/protect_s) | |
[ 17.265861] | |
[ 17.268183] (2)[1:init]init: processing action (post-fs-data) from (/system/etc/init/bootstat.rc:3) | |
[ 17.272161] (0)[1:init]init: processing action (init.svc.bootanim=running && ro.crypto.type=block && post-fs-data) from (/system/etc/init/bootstat.rc:44) | |
[ 17.274506] (0)[1:init]init: starting service 'exec 8 (/system/bin/bootstat -r post_decrypt_time_elapsed)'... | |
[ 17.276817] (2)[1:init]init: SVC_EXEC pid 405 (uid 1000 gid 1007+0 context default) started; waiting... | |
[ 17.284598] (1)[130:hps_main]MobiCore mcd: Cpu 5 is going to die | |
[ 17.286202] (1)[130:hps_main]CPU5: shutdown | |
[ 17.287233] (1)[130:hps_main]MobiCore mcd: Cpu 5 is dead | |
[ 17.288195] (1)[130:hps_main]MobiCore mcd: Cpu 4 is going to die | |
[ 17.289804] (1)[130:hps_main]CPU4: shutdown | |
[ 17.290864] (1)[130:hps_main]MobiCore mcd: Cpu 4 is dead | |
[ 17.291815] (1)[130:hps_main]MobiCore mcd: Cpu 3 is going to die | |
[ 17.293284] (1)[130:hps_main]CPU3: shutdown | |
[ 17.293803] (0)[1:init]init: Service 'exec 8 (/system/bin/bootstat -r post_decrypt_time_elapsed)' (pid 405) exited with status 0 waiting took 0.019000 seconds | |
[ 17.293973] (0)[1:init]init: processing action (post-fs-data) from (/vendor/etc/init/hostapd.android.rc:9) | |
[ 17.294811] (0)[1:init]init: processing action (vold.decrypt=trigger_load_persist_props) from (/init.rc:668) | |
[ 17.294863] (0)[1:init]init: Couldn't load property file: Unable to open '/data/local.prop': No such file or directory: No such file or directory | |
[ 17.300434] (1)[130:hps_main]MobiCore mcd: Cpu 3 is dead | |
[ 17.301315] (1)[130:hps_main][HPS] (0200)(6)action end(234)(207)(0)(0) (8)(8)(8)(8)(1) (434)(8)(0) (1785)(8)(0) (0)(207)(8)(0)(207) wifi_base(0) | |
[ 17.343133] (0)[1:init]init: starting service 'logd-reinit'... | |
[ 17.344742] (0)[1:init]init: property_set("ro.boottime.logd-reinit", "17278566471") failed: property already set | |
[ 17.346365] (0)[1:init]init: processing action (vold.decrypt=trigger_restart_framework) from (/init.rc:681) | |
[ 17.347662] (0)[1:init]init: ExecStart(update_verifier): Service not found | |
[ 17.349234] (0)[1:init]init: starting service 'flash_recovery'... | |
[ 17.351692] (0)[1:init]init: starting service 'zygote'... | |
[ 17.353928] (0)[1:init]init: starting service 'zygote_secondary'... | |
[ 17.356433] (0)[1:init]init: starting service 'audioserver'... | |
[ 17.357307] (2)[411:init]init: Created socket '/dev/socket/zygote_secondary', mode 660, user 0, group 1000 | |
[ 17.358543] (0)[1:init]init: starting service 'cameraserver'... | |
[ 17.360012] (1)[274:logd.daemon]logd.daemon: reinit | |
[ 17.360041] (0)[410:init]init: Created socket '/dev/socket/zygote', mode 660, user 0, group 1000 | |
[ 17.361112] (0)[1:init]init: starting service 'drm'... | |
[ 17.362548] (0)[1:init]init: starting service 'installd'... | |
[ 17.365104] (1)[413:init]init: couldn't write 413 to /dev/cpuset/camera-daemon/tasks: No such file or directory | |
[ 17.369724] (0)[1:init]init: starting service 'keystore'... | |
[ 17.372084] (0)[1:init]init: starting service 'mediadrm'... | |
[ 17.378616] (0)[1:init]init: starting service 'mediaextractor'... | |
[ 17.382004] (0)[1:init]init: starting service 'mediametrics'... | |
[ 17.419924] (0)[1:init]init: starting service 'media'... | |
[ 17.422879] (0)[1:init]init: starting service 'netd'... | |
[ 17.429978] (0)[1:init]init: starting service 'storaged'... | |
[ 17.441394] (0)[1:init]init: starting service 'wificond'... | |
[ 17.453651] (0)[421:init]init: Created socket '/dev/socket/netd', mode 660, user 0, group 1000 | |
[ 17.464474] (0)[1:init]init: starting service 'mediacodec'... | |
[ 17.466547] (0)[421:init]init: Created socket '/dev/socket/dnsproxyd', mode 660, user 0, group 3003 | |
[ 17.469323] (0)[1:init]init: starting service 'emsvr'... | |
[ 17.471469] (1)[422:init]init: Failed to open file '/d/mmc0/mmc0:0001/ext_csd': No such file or directory | |
[ 17.477474] (0)[421:init]init: Created socket '/dev/socket/mdns', mode 660, user 0, group 1000 | |
[ 17.503442] -(3)[0:swapper/3]CPU3: Booted secondary processor | |
[ 17.503462] -(3)[0:swapper/3]Detected VIPT I-cache on CPU3 | |
[ 17.503579] -(3)[0:swapper/3]CPU3: update cpu_capacity 1024 | |
[ 17.504469] -(4)[0:swapper/4]CPU4: Booted secondary processor | |
[ 17.504490] -(4)[0:swapper/4]Detected VIPT I-cache on CPU4 | |
[ 17.504620] -(4)[0:swapper/4]CPU4: update cpu_capacity 1024 | |
[ 17.505805] -(5)[0:swapper/5]CPU5: Booted secondary processor | |
[ 17.505831] -(5)[0:swapper/5]Detected VIPT I-cache on CPU5 | |
[ 17.505984] -(5)[0:swapper/5]CPU5: update cpu_capacity 1024 | |
[ 17.507523] -(6)[0:swapper/6]CPU6: Booted secondary processor | |
[ 17.507550] -(6)[0:swapper/6]Detected VIPT I-cache on CPU6 | |
[ 17.507726] -(6)[0:swapper/6]CPU6: update cpu_capacity 1024 | |
[ 17.509416] -(7)[0:swapper/7]CPU7: Booted secondary processor | |
[ 17.509440] -(7)[0:swapper/7]Detected VIPT I-cache on CPU7 | |
[ 17.509602] -(7)[0:swapper/7]CPU7: update cpu_capacity 1024 | |
[ 17.510289] (0)[1:init]init: starting service 'fuelgauged'... | |
[ 17.510801] (4)[130:hps_main][HPS] (0020)(3)action end(300)(1231)(0)(0) (8)(8)(8)(8)(1) (254)(1)(1) (254)(1)(1) (1)(1231)(2)(0)(1231) wifi_base(0) | |
[ 17.514100] (0)[421:init]init: Created socket '/dev/socket/fwmarkd', mode 660, user 0, group 3003 | |
[ 17.518443] (0)[1:init]init: starting service 'mnld'... | |
[ 17.521872] (0)[1:init]init: starting service 'nvram_daemon'... | |
[ 17.527739] (0)[1:init]init: starting service 'pq'... | |
[ 17.528015] -(2)[410:app_process64][PTP] ptp_set_ptp_volt cur_temp = 37500 | |
[ 17.537202] (0)[1:init]init: starting service 'mxg2320d'... | |
[ 17.540590] (6)[427:init]init: Created socket '/dev/socket/mnld', mode 660, user 1021, group 1021 | |
[ 17.547956] (0)[1:init]init: starting service 'thermal_manager'... | |
[ 17.551193] (0)[1:init]init: Command 'class_start main' action=vold.decrypt=trigger_restart_framework (/init.rc:684) returned 0 took 202ms. | |
[ 17.554567] (0)[1:init]init: Service 'logd-reinit' (pid 408) exited with status 0 | |
[ 17.555985] (0)[1:init]init: Service 'flash_recovery' (pid 409) exited with status 0 | |
[ 17.558905] (0)[1:init]init: starting service 'gatekeeperd'... | |
[ 17.599968] (7)[426:fuelgauged]MTK_FG: get control socket error, reason:Protocol not supported | |
[ 17.601156] (7)[426:fuelgauged]MTK_FG: [fg_res] FG_DAEMON_CMD_SET_DAEMON_PID, input 426 | |
[ 17.634840] (0)[279:logd.auditd]type=1400 audit(1556890366.693:4): avc: denied { setattr } for pid=312 comm="wmt_loader" name="wmt_dbg" dev="proc" ino=4026534396 scontext=u:r:wmt_loader:s0 tcontext=u:object_r:proc_wmt:s0 tclass=file permissive=1 | |
[ 17.642020] (4)[433:thermal_manager][name:mtk_ts_cpu&][Power/CPU_Thermal]tscpu_unbind unbinding OK | |
[ 17.642052] (4)[433:thermal_manager][name:mtk_ts_cpu&][Power/CPU_Thermal]tscpu_unbind unbinding OK | |
[ 17.642073] (4)[433:thermal_manager][name:mtk_ts_cpu&][Power/CPU_Thermal]tscpu_unbind unbinding OK | |
[ 17.642094] (4)[433:thermal_manager][name:mtk_ts_cpu&][Power/CPU_Thermal]tscpu_unbind unbinding OK | |
[ 17.642122] (4)[433:thermal_manager][name:mtk_ts_cpu&][Power/CPU_Thermal]tscpu_unbind unbinding OK | |
[ 17.645896] (1)[279:logd.auditd]type=1400 audit(1556890368.526:5): avc: denied { read open } for pid=435 comm="nvram_daemon" path="/system/bin/sh" dev="mmcblk0p45" ino=465 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:shell_exec:s0 tclass=file permissive=1 | |
[ 17.648830] -(0)[411:app_process32][PTP] ptp_set_ptp_volt cur_temp = 37500 | |
[ 17.652364] (1)[1:init]init: starting service 'tombstoned'... | |
[ 17.653055] (4)[433:thermal_manager][name:mtk_ts_cpu&][Power/CPU_Thermal]tscpu_bind binding OK, 0 | |
[ 17.653114] (4)[433:thermal_manager][name:mtk_ts_cpu&][Power/CPU_Thermal]tscpu_bind binding OK, 2 | |
[ 17.653174] (4)[433:thermal_manager][name:mtk_ts_cpu&][Power/CPU_Thermal]tscpu_bind binding OK, 1 | |
[ 17.661007] (1)[1:init]init: starting service 'fps_hal'... | |
[ 17.664478] (7)[436:init]init: Created socket '/dev/socket/tombstoned_crash', mode 666, user 1000, group 1000 | |
[ 17.669482] (4)[427:mnld]Dump cpuinfo | |
[ 17.678954] (1)[1:init]init: starting service 'etsd'... | |
[ 17.680900] (1)[1:init]init: Command 'class_start late_start' action=vold.decrypt=trigger_restart_framework (/init.rc:685) returned 0 took 123ms. | |
[ 17.682854] (7)[436:init]init: Created socket '/dev/socket/tombstoned_intercept', mode 666, user 1000, group 1000 | |
[ 17.685401] (7)[436:init]init: Created socket '/dev/socket/tombstoned_java_trace', mode 666, user 1000, group 1000 | |
[ 17.708948] (1)[1:init]init: processing action (vold.decrypt=trigger_restart_framework) from (/vendor/etc/init/md_ctrl.rc:7) | |
[ 17.719200] (3)[321:mtk_wmtd][WMT-CORE][I]opfunc_therm_ctrl:Send WMT_THERM_CTRL_CMD command OK! | |
[ 17.719380] (1)[1:init]init: starting service 'start_modem'... | |
[ 17.721072] (1)[1:init]init: processing action (vold.decrypt=trigger_restart_framework) from (/vendor/etc/init/nvram_daemon.rc:1) | |
[ 17.731649] (3)[321:mtk_wmtd][WMT-CORE][I]opfunc_therm_ctrl:Send WMT_THERM_READ_CMD command OK! | |
[ 17.742604] (3)[321:mtk_wmtd][WMT-CORE][I]opfunc_therm_ctrl:Send WMT_THERM_CTRL_CMD command OK! | |
[ 17.743930] (4)[433:thermal_manager][HIF-SDIO][I]wmt_dev_tm_temp_query:[Thermal] current_temp = 0x1d | |
[ 17.746117] (4)[433:thermal_manager][BATTERY] set_bat_charging_current_limit (650) | |
[ 17.750966] (4)[433:thermal_manager][BATTERY] Default CC mode charging : 65000, input current = 50000 | |
[ 17.779151] (0)[67:kworker/0:1][MUSB]do_low_power_timer_monitor_work 77: state:IDLE_STAGE, last:0, balanced<0,0>, usb_state:NO-CDEV | |
[ 17.787177] (3)[1:init]init: Service 'thermal_manager' (pid 433) exited with status 0 | |
[ 17.810164] (3)[279:logd.auditd]type=1400 audit(1556890368.526:5): avc: denied { read open } for pid=435 comm="nvram_daemon" path="/system/bin/sh" dev="mmcblk0p45" ino=465 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:shell_exec:s0 tclass=file permissive=1 | |
[ 17.815996] (3)[1:init]selinux: avc: denied { set } for property=debug.pq.shp.en pid=429 uid=1003 gid=1003 scontext=u:r:pq:s0 tcontext=u:object_r:debug_prop:s0 tclass=property_service permissive=1 | |
[ 17.815996] | |
[ 17.829371] (3)[1:init]selinux: avc: denied { set } for property=vold.encryption.type pid=441 uid=1001 gid=1001 scontext=u:r:md_ctrl:s0 tcontext=u:object_r:vold_encryption_type_prop:s0 tclass=property_service permissive=1 | |
[ 17.829371] | |
[ 17.832971] (3)[279:logd.auditd]type=1400 audit(1556890368.526:6): avc: denied { execute_no_trans } for pid=435 comm="nvram_daemon" path="/system/bin/sh" dev="mmcblk0p45" ino=465 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:shell_exec:s0 tclass=file permissive=1 | |
[ 17.895913] (5)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, mc_open_device failed: 15 | |
[ 17.908653] (7)[414:drmserver]Dump cpuinfo | |
[ 17.922251] (3)[279:logd.auditd]type=1400 audit(1556890368.526:6): avc: denied { execute_no_trans } for pid=435 comm="nvram_daemon" path="/system/bin/sh" dev="mmcblk0p45" ino=465 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:shell_exec:s0 tclass=file permissive=1 | |
[ 17.925303] (3)[279:logd.auditd]type=1400 audit(1556890368.533:7): avc: denied { getattr } for pid=435 comm="sh" path="/system/bin/sh" dev="mmcblk0p45" ino=465 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:shell_exec:s0 tclass=file permissive=1 | |
[ 17.928356] (3)[279:logd.auditd]type=1400 audit(1556890368.533:7): avc: denied { getattr } for pid=435 comm="sh" path="/system/bin/sh" dev="mmcblk0p45" ino=465 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:shell_exec:s0 tclass=file permissive=1 | |
[ 17.931192] (3)[279:logd.auditd]type=1400 audit(1556890368.559:8): avc: denied { read } for pid=435 comm="sh" name="/" dev="rootfs" ino=1 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:rootfs:s0 tclass=dir permissive=1 | |
[ 17.933960] (3)[279:logd.auditd]type=1400 audit(1556890368.559:8): avc: denied { read } for pid=435 comm="sh" name="/" dev="rootfs" ino=1 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:rootfs:s0 tclass=dir permissive=1 | |
[ 17.936550] (3)[279:logd.auditd]type=1400 audit(1556890368.559:9): avc: denied { open } for pid=435 comm="sh" path="/" dev="rootfs" ino=1 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:rootfs:s0 tclass=dir permissive=1 | |
[ 17.939497] (3)[279:logd.auditd]type=1400 audit(1556890368.559:9): avc: denied { open } for pid=435 comm="sh" path="/" dev="rootfs" ino=1 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:rootfs:s0 tclass=dir permissive=1 | |
[ 17.942087] (3)[279:logd.auditd]type=1400 audit(1556890368.559:10): avc: denied { getattr } for pid=435 comm="sh" path="/system/bin/toybox" dev="mmcblk0p45" ino=500 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:toolbox_exec:s0 tclass=file permissive=1 | |
[ 17.945438] (3)[279:logd.auditd]type=1400 audit(1556890368.559:10): avc: denied { getattr } for pid=435 comm="sh" path="/system/bin/toybox" dev="mmcblk0p45" ino=500 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:toolbox_exec:s0 tclass=file permissive=1 | |
[ 17.948420] (3)[279:logd.auditd]type=1400 audit(1556890368.559:11): avc: denied { execute } for pid=435 comm="sh" name="toybox" dev="mmcblk0p45" ino=500 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:toolbox_exec:s0 tclass=file permissive=1 | |
[ 17.951652] (3)[279:logd.auditd]type=1400 audit(1556890368.559:11): avc: denied { execute } for pid=435 comm="sh" name="toybox" dev="mmcblk0p45" ino=500 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:toolbox_exec:s0 tclass=file permissive=1 | |
[ 17.954600] (3)[279:logd.auditd]type=1400 audit(1556890368.566:12): avc: denied { read open } for pid=438 comm="sh" path="/system/bin/toybox" dev="mmcblk0p45" ino=500 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:toolbox_exec:s0 tclass=file permissive=1 | |
[ 17.957861] (3)[279:logd.auditd]type=1400 audit(1556890368.566:12): avc: denied { read open } for pid=438 comm="sh" path="/system/bin/toybox" dev="mmcblk0p45" ino=500 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:toolbox_exec:s0 tclass=file permissive=1 | |
[ 17.961009] (3)[279:logd.auditd]type=1400 audit(1556890368.566:13): avc: denied { execute_no_trans } for pid=438 comm="sh" path="/system/bin/toybox" dev="mmcblk0p45" ino=500 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:toolbox_exec:s0 tclass=file permissive=1 | |
[ 17.964484] (3)[279:logd.auditd]type=1400 audit(1556890368.566:13): avc: denied { execute_no_trans } for pid=438 comm="sh" path="/system/bin/toybox" dev="mmcblk0p45" ino=500 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:toolbox_exec:s0 tclass=file permissive=1 | |
[ 17.967759] (3)[279:logd.auditd]type=1400 audit(1556890368.619:14): avc: denied { getattr } for pid=438 comm="cp" path="/fstab.mt6735" dev="rootfs" ino=4203 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:rootfs:s0 tclass=file permissive=1 | |
[ 17.971075] (3)[279:logd.auditd]type=1400 audit(1556890368.619:14): avc: denied { getattr } for pid=438 comm="cp" path="/fstab.mt6735" dev="rootfs" ino=4203 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:rootfs:s0 tclass=file permissive=1 | |
[ 17.974064] (3)[279:logd.auditd]type=1400 audit(1556890368.629:15): avc: denied { read open } for pid=442 comm="nvram_daemon" path="/system/bin/sh" dev="mmcblk0p45" ino=465 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:shell_exec:s0 tclass=file permissive=1 | |
[ 17.977251] (3)[279:logd.auditd]type=1400 audit(1556890368.629:15): avc: denied { read open } for pid=442 comm="nvram_daemon" path="/system/bin/sh" dev="mmcblk0p45" ino=465 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:shell_exec:s0 tclass=file permissive=1 | |
[ 17.980518] (3)[279:logd.auditd]type=1400 audit(1556890368.633:16): avc: denied { execute_no_trans } for pid=442 comm="nvram_daemon" path="/system/bin/sh" dev="mmcblk0p45" ino=465 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:shell_exec:s0 tclass=file permissive=1 | |
[ 17.983845] (3)[279:logd.auditd]type=1400 audit(1556890368.633:16): avc: denied { execute_no_trans } for pid=442 comm="nvram_daemon" path="/system/bin/sh" dev="mmcblk0p45" ino=465 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:shell_exec:s0 tclass=file permissive=1 | |
[ 17.986964] (3)[279:logd.auditd]type=1400 audit(1556890368.633:17): avc: denied { getattr } for pid=442 comm="sh" path="/system/bin/sh" dev="mmcblk0p45" ino=465 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:shell_exec:s0 tclass=file permissive=1 | |
[ 18.002791] (3)[279:logd.auditd]type=1400 audit(1556890368.633:17): avc: denied { getattr } for pid=442 comm="sh" path="/system/bin/sh" dev="mmcblk0p45" ino=465 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:shell_exec:s0 tclass=file permissive=1 | |
[ 18.007427] (3)[279:logd.auditd]type=1400 audit(1556890368.653:18): avc: denied { write } for pid=441 comm="md_ctrl" name="property_service" dev="tmpfs" ino=458 scontext=u:r:md_ctrl:s0 tcontext=u:object_r:property_socket:s0 tclass=sock_file permissive=1 | |
[ 18.011555] (3)[279:logd.auditd]type=1400 audit(1556890368.653:18): avc: denied { write } for pid=441 comm="md_ctrl" name="property_service" dev="tmpfs" ino=458 scontext=u:r:md_ctrl:s0 tcontext=u:object_r:property_socket:s0 tclass=sock_file permissive=1 | |
[ 18.014933] (3)[279:logd.auditd]type=1400 audit(1556890368.653:19): avc: denied { connectto } for pid=441 comm="md_ctrl" path="/dev/socket/property_service" scontext=u:r:md_ctrl:s0 tcontext=u:r:init:s0 tclass=unix_stream_socket permissive=1 | |
[ 18.018176] (3)[279:logd.auditd]type=1400 audit(1556890368.653:19): avc: denied { connectto } for pid=441 comm="md_ctrl" path="/dev/socket/property_service" scontext=u:r:md_ctrl:s0 tcontext=u:r:init:s0 tclass=unix_stream_socket permissive=1 | |
[ 18.021016] (3)[279:logd.auditd]type=1400 audit(1556890368.669:20): avc: denied { execute_no_trans } for pid=444 comm="sh" path="/system/bin/toybox" dev="mmcblk0p45" ino=500 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:toolbox_exec:s0 tclass=file permissive=1 | |
[ 18.025042] (3)[279:logd.auditd]type=1400 audit(1556890368.669:20): avc: denied { execute_no_trans } for pid=444 comm="sh" path="/system/bin/toybox" dev="mmcblk0p45" ino=500 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:toolbox_exec:s0 tclass=file permissive=1 | |
[ 18.028284] (3)[279:logd.auditd]type=1400 audit(1556890368.669:21): avc: denied { read } for pid=444 comm="chmod" name="toybox" dev="mmcblk0p45" ino=500 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:toolbox_exec:s0 tclass=file permissive=1 | |
[ 18.032677] (3)[279:logd.auditd]type=1400 audit(1556890368.669:21): avc: denied { read } for pid=444 comm="chmod" name="toybox" dev="mmcblk0p45" ino=500 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:toolbox_exec:s0 tclass=file permissive=1 | |
[ 18.035453] (3)[279:logd.auditd]type=1400 audit(1556890368.669:22): avc: denied { execute } for pid=444 comm="chmod" path="/system/bin/toybox" dev="mmcblk0p45" ino=500 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:toolbox_exec:s0 tclass=file permissive=1 | |
[ 18.038600] (3)[279:logd.auditd]type=1400 audit(1556890368.669:22): avc: denied { execute } for pid=444 comm="chmod" path="/system/bin/toybox" dev="mmcblk0p45" ino=500 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:toolbox_exec:s0 tclass=file permissive=1 | |
[ 18.041812] (3)[279:logd.auditd]type=1400 audit(1556890368.669:23): avc: denied { getattr } for pid=444 comm="chmod" path="/system/bin/toybox" dev="mmcblk0p45" ino=500 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:toolbox_exec:s0 tclass=file permissive=1 | |
[ 18.045212] (3)[279:logd.auditd]type=1400 audit(1556890368.669:23): avc: denied { getattr } for pid=444 comm="chmod" path="/system/bin/toybox" dev="mmcblk0p45" ino=500 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:toolbox_exec:s0 tclass=file permissive=1 | |
[ 18.048177] (3)[279:logd.auditd]type=1400 audit(1556890368.739:24): avc: denied { open } for pid=450 comm="sh" path="/system/bin/toybox" dev="mmcblk0p45" ino=500 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:toolbox_exec:s0 tclass=file permissive=1 | |
[ 18.051322] (3)[279:logd.auditd]type=1400 audit(1556890368.739:24): avc: denied { open } for pid=450 comm="sh" path="/system/bin/toybox" dev="mmcblk0p45" ino=500 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:toolbox_exec:s0 tclass=file permissive=1 | |
[ 18.054492] (3)[279:logd.auditd]type=1400 audit(1556890368.786:25): avc: denied { setattr } for pid=450 comm="chown" name="nvram" dev="dm-0" ino=53 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:nvdata_file:s0 tclass=lnk_file permissive=1 | |
[ 18.057435] (3)[279:logd.auditd]type=1400 audit(1556890368.786:25): avc: denied { setattr } for pid=450 comm="chown" name="nvram" dev="dm-0" ino=53 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:nvdata_file:s0 tclass=lnk_file permissive=1 | |
[ 18.060209] (3)[279:logd.auditd]type=1400 audit(1556890368.826:26): avc: denied { read open } for pid=461 comm="nvram_daemon" path="/system/bin/sh" dev="mmcblk0p45" ino=465 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:shell_exec:s0 tclass=file permissive=1 | |
[ 18.063448] (3)[279:logd.auditd]type=1400 audit(1556890368.826:26): avc: denied { read open } for pid=461 comm="nvram_daemon" path="/system/bin/sh" dev="mmcblk0p45" ino=465 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:shell_exec:s0 tclass=file permissive=1 | |
[ 18.066412] (3)[279:logd.auditd]type=1400 audit(1556890368.826:27): avc: denied { execute_no_trans } for pid=461 comm="nvram_daemon" path="/system/bin/sh" dev="mmcblk0p45" ino=465 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:shell_exec:s0 tclass=file permissive=1 | |
[ 18.069742] (3)[279:logd.auditd]type=1400 audit(1556890368.826:27): avc: denied { execute_no_trans } for pid=461 comm="nvram_daemon" path="/system/bin/sh" dev="mmcblk0p45" ino=465 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:shell_exec:s0 tclass=file permissive=1 | |
[ 18.072812] (3)[279:logd.auditd]type=1400 audit(1556890368.829:28): avc: denied { getattr } for pid=461 comm="sh" path="/system/bin/sh" dev="mmcblk0p45" ino=465 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:shell_exec:s0 tclass=file permissive=1 | |
[ 18.075892] (3)[279:logd.auditd]type=1400 audit(1556890368.829:28): avc: denied { getattr } for pid=461 comm="sh" path="/system/bin/sh" dev="mmcblk0p45" ino=465 scontext=u:r:nvram_daemon:s0 tcontext=u:object_r:shell_exec:s0 tclass=file permissive=1 | |
[ 18.078708] (3)[279:logd.auditd]type=1400 audit(1556890368.939:29): avc: denied { sys_module } for pid=421 comm="netd" capability=16 scontext=u:r:netd:s0 tcontext=u:r:netd:s0 tclass=capability permissive=1 | |
[ 18.100611] (2)[490:nvram_daemon][ALS/PS] compat_cm36686_unlocked_ioctl | |
[ 18.101481] (2)[490:nvram_daemon][ALS/PS] ALSPS cm36686 ALSPS_IOCTL_SET_CALI | |
[ 18.102124] (2)[490:nvram_daemon][ALS/PS] compat_cm36686_unlocked_ioctl | |
[ 18.103112] (2)[490:nvram_daemon][ALS/PS] ALSPS cm36686 ALSPS_SET_PS_THRESHOLD | |
[ 18.103774] (2)[490:nvram_daemon][ALS/PS] cm36686_unlocked_ioctl 1362 : cm36686_unlocked_ioctl set threshold high: 0x50530306, low: 0x4d0006 | |
[ 18.105402] (2)[490:nvram_daemon][ALS/PS] set_psensor_threshold 1159 : set_psensor_threshold function high: 0x50530312, low:0x4d0012 | |
[ 18.133877] (7)[420:mediaserver]Dump cpuinfo | |
[ 18.178875] (2)[279:logd.auditd]type=1400 audit(1556890368.939:29): avc: denied { sys_module } for pid=421 comm="netd" capability=16 scontext=u:r:netd:s0 tcontext=u:r:netd:s0 tclass=capability permissive=1 | |
[ 18.181266] (2)[279:logd.auditd]type=1400 audit(1556890369.069:30): avc: denied { read write } for pid=427 comm="mnld" name="mmcblk0p2" dev="tmpfs" ino=2161 scontext=u:r:mnld:s0 tcontext=u:object_r:nvram_device:s0 tclass=blk_file permissive=1 | |
[ 18.184401] (2)[279:logd.auditd]type=1400 audit(1556890369.069:30): avc: denied { read write } for pid=427 comm="mnld" name="mmcblk0p2" dev="tmpfs" ino=2161 scontext=u:r:mnld:s0 tcontext=u:object_r:nvram_device:s0 tclass=blk_file permissive=1 | |
[ 18.187183] (2)[279:logd.auditd]type=1400 audit(1556890369.069:31): avc: denied { open } for pid=427 comm="mnld" path="/dev/block/mmcblk0p2" dev="tmpfs" ino=2161 scontext=u:r:mnld:s0 tcontext=u:object_r:nvram_device:s0 tclass=blk_file permissive=1 | |
[ 18.227688] (4)[411:app_process32]Dump cpuinfo | |
[ 18.290661] (2)[311:ccci_mdinit][md1]port ccci_monitor open with flag 20002 by ccci_mdinit | |
[ 18.301508] (2)[311:ccci_mdinit][md1]CCCI_IOC_SIM_SWITCH_TYPE:sim type(0x0) | |
[ 18.302196] (2)[311:ccci_mdinit][md1]CCCI_IOC_UPDATE_SIM_SLOT_CFG get s0:0 s1:1 s2:0 s3:0 | |
[ 18.303473] (2)[279:logd.auditd]type=1400 audit(1556890369.069:31): avc: denied { open } for pid=427 comm="mnld" path="/dev/block/mmcblk0p2" dev="tmpfs" ino=2161 scontext=u:r:mnld:s0 tcontext=u:object_r:nvram_device:s0 tclass=blk_file permissive=1 | |
[ 18.306870] (2)[311:ccci_mdinit][md1]port ccci_ipc_5 open with flag 20002 by ccci_mdinit | |
[ 18.308052] (2)[311:ccci_mdinit][md1]CCCI_IPC_UPDATE_TIMEZONE keep 0x0 | |
[ 18.309358] (2)[311:ccci_mdinit][ccci0/util]md1 get boot store | |
[ 18.310123] (2)[311:ccci_mdinit][md1]ccci core boot md1, md_state=1 | |
[ 18.310945] (2)[311:ccci_mdinit][ccci0/util]security is on! | |
[ 18.311681] (2)[311:ccci_mdinit][md1/ntc]CLDMA modem is starting | |
[ 18.312490] (2)[311:ccci_mdinit][md1]Clear MPU protect MD ROM region<5> | |
[ 18.313351] (2)[311:ccci_mdinit][md1]Clear MPU protect MD R/W region<14> | |
[ 18.314234] (2)[311:ccci_mdinit][md1]Clear MPU protect DSP ROM region<6> | |
[ 18.315113] (2)[311:ccci_mdinit][ccci1/util]MD1 image postfix=1_lwg_n | |
[ 18.316066] (2)[311:ccci_mdinit][ccci1/util]MD1 image postfix=1_lwg_n_E1 | |
[ 18.316940] (2)[311:ccci_mdinit][ccci1/util]Find img @CIP | |
[ 18.317652] (2)[311:ccci_mdinit][ccci1/util]try to open modem_1_lwg_n.img | |
[ 18.318562] (2)[311:ccci_mdinit][ccci1/util]try to open modem_1_lwg_n_E1.img | |
[ 18.319532] (2)[311:ccci_mdinit][ccci1/util]try to open modem.img | |
[ 18.320348] (2)[311:ccci_mdinit][ccci1/util]Find img @default | |
[ 18.321099] (2)[311:ccci_mdinit][ccci1/util]try to open modem_1_lwg_n.img | |
[ 18.322062] (2)[311:ccci_mdinit][ccci0/util]sec_open fd = (1)! | |
[ 18.322881] (2)[311:ccci_mdinit][ccci0/util]sec_open file ptr = (ffffffc0a0bb9280)! | |
[ 18.323879] (2)[311:ccci_mdinit][ccci1/util]open /vendor/firmware/modem_1_lwg_n.img OK | |
[ 18.324906] (2)[311:ccci_mdinit][ccci1/util]sign check ret value 0x0, 0x0! | |
[ 18.325818] (2)[311:ccci_mdinit][ccci1/util]sign check success(0x0, 0x0)! | |
[ 18.326697] (2)[311:ccci_mdinit][ccci1/util]signature_check offset:0, tail:0 | |
[ 18.327621] (2)[311:ccci_mdinit][ccci1/util]masp_ccci_is_cipherfmt pre check | |
[ 18.328261] (2)[311:ccci_mdinit][ccci1/util]masp_ccci_is_cipherfmt check (2)[279:logd.auditd]type=1400 audit(1556890369.193:32): avc: denied { read } for pid=311 comm="ccci_mdinit" name="mode" dev="sysfs" ino=11516 scontext=u:r:ccci_mdinit:s0 tcontext=u:object_r:sysfs:s0 tclass=file permissive=1 | |
[ 18.331745] (2)[311:ccci_mdinit][ccci1/util]masp_ccci_is_cipherfmt ret=0! | |
[ 18.332642] (2)[311:ccci_mdinit][ccci1/util]Not cipher image | |
[ 18.333820] (5)[311:ccci_mdinit][ccci0/util]This image does not find header, no need bypass | |
[ 18.333948] (2)[279:logd.auditd]type=1400 audit(1556890369.193:32): avc: denied { read } for pid=311 comm="ccci_mdinit" name="mode" dev="sysfs" ino=11516 scontext=u:r:ccci_mdinit:s0 tcontext=u:object_r:sysfs:s0 tclass=file permissive=1 | |
[ 18.333959] (2)[279:logd.auditd]type=1400 audit(1556890369.193:33): avc: denied { open } for pid=311 comm="ccci_mdinit" path="/sys/mtk_ssw/mode" dev="sysfs" ino=11516 scontext=u:r:ccci_mdinit:s0 tcontext=u:object_r:sysfs:s0 tclass=file permissive=1 | |
[ 18.340373] (5)[311:ccci_mdinit][ccci0/util]legacy load | |
[ 18.361010] (5)[311:ccci_mdinit][ccci1/util]DEBUG ret == size_per_read size=1048576 | |
[ 18.365658] (5)[311:ccci_mdinit][ccci1/util]DEBUG ret == size_per_read size=1048576 | |
[ 18.368313] (5)[311:ccci_mdinit][ccci1/util]DEBUG ret == size_per_read size=1048576 | |
[ 18.373120] (5)[311:ccci_mdinit][ccci1/util]DEBUG ret == size_per_read size=1048576 | |
[ 18.376270] (5)[311:ccci_mdinit][ccci1/util]DEBUG ret == size_per_read size=1048576 | |
[ 18.396087] (5)[311:ccci_mdinit][ccci1/util]DEBUG ret == size_per_read size=1048576 | |
[ 18.399682] (4)[311:ccci_mdinit][ccci1/util]DEBUG ret == size_per_read size=1048576 | |
[ 18.403785] (4)[311:ccci_mdinit][ccci1/util]DEBUG ret == size_per_read size=1048576 | |
[ 18.406808] (4)[311:ccci_mdinit][ccci1/util]DEBUG ret == size_per_read size=1048576 | |
[ 18.408064] (4)[311:ccci_mdinit][ccci1/util]/vendor/firmware/modem_1_lwg_n.img, image size=0x919034, read size:9539636, tail:0 | |
[ 18.409743] (4)[311:ccci_mdinit][ccci1/util]MD image header size = -1 | |
[ 18.410609] (4)[311:ccci_mdinit][ccci1/util]**********************MD image check 188*************************** | |
[ 18.411901] (4)[311:ccci_mdinit][ccci1/util]md check header not exist! -1 | |
[ 18.412819] (4)[311:ccci_mdinit][ccci1/util]**********************MD image check*************************** | |
[ 18.413489] (0)[130:hps_main][HPS] (0000)(8)DBG_HRT(486)(388)(0)(0) (8)(8)(8)(8)(1) (0)(0)(0) (5519)(9)(1) (0)(388)(9)(0)(388) wifi_base(0) | |
[ 18.415686] (4)[311:ccci_mdinit][ccci1/util]load_firmware failed: ret=-408! | |
[ 18.416615] (4)[311:ccci_mdinit][ccci1/util]V36BML_LEGACY firmware check offset: 64 data_sec_length: 300 sec_tail_length: 236 | |
[ 18.418072] (4)[311:ccci_mdinit][ccci0/util]legacy load | |
[ 18.420910] (4)[311:ccci_mdinit][ccci1/util]DEBUG ret == size_per_read size=1048576 | |
[ 18.424018] (4)[311:ccci_mdinit][ccci1/util]DEBUG ret == size_per_read size=1048576 | |
[ 18.426926] (4)[311:ccci_mdinit][ccci1/util]DEBUG ret == size_per_read size=1048576 | |
[ 18.429957] (4)[311:ccci_mdinit][ccci1/util]DEBUG ret == size_per_read size=1048576 | |
[ 18.432662] (4)[311:ccci_mdinit][ccci1/util]DEBUG ret == size_per_read size=1048576 | |
[ 18.435307] (4)[311:ccci_mdinit][ccci1/util]DEBUG ret == size_per_read size=1048576 | |
[ 18.438074] (4)[311:ccci_mdinit][ccci1/util]DEBUG ret == size_per_read size=1048576 | |
[ 18.441086] (4)[311:ccci_mdinit][ccci1/util]DEBUG ret == size_per_read size=1048576 | |
[ 18.443963] (4)[311:ccci_mdinit][ccci1/util]DEBUG ret == size_per_read size=1048576 | |
[ 18.445187] (4)[311:ccci_mdinit][ccci1/util]/vendor/firmware/modem_1_lwg_n.img, image size=0x918f08, read size:9539572, tail:236 | |
[ 18.446910] (4)[311:ccci_mdinit][ccci1/util]MD image header size = 284 | |
[ 18.447409] (2)[485:HwBinder:291_1]Dump cpuinfo | |
[ 18.448410] (4)[311:ccci_mdinit][ccci1/util]**********************MD image check V3 284*************************** | |
[ 18.449781] (4)[311:ccci_mdinit][ccci1/util]Modem header check OK! | |
[ 18.450599] (4)[311:ccci_mdinit][ccci1/util](MD)[type]=lwg, (AP)[type]=lwg | |
[ 18.451503] (4)[311:ccci_mdinit][ccci1/util](MD)[plat]=MT6735_S00, (AP)[plat]=MT6735E1 | |
[ 18.452556] (4)[311:ccci_mdinit][ccci1/util](MD)[size]=7000000, (AP)[size]=7000000 | |
[ 18.453547] (4)[311:ccci_mdinit][ccci1/util](MD)[img_size]=918d08, (AP)[img_size]=918d08 | |
[ 18.454606] (4)[311:ccci_mdinit][ccci1/util]DSP image offset=a20000 size=219d1c | |
[ 18.455564] (4)[311:ccci_mdinit][ccci1/util](MD)[build_ver]=, [build_time]=2016/04/22 15:26 | |
[ 18.456674] (4)[311:ccci_mdinit][ccci1/util](MD)[product_ver]=Release | |
[ 18.457522] (4)[311:ccci_mdinit][ccci1/util]**********************MD image check V3*************************** | |
[ 18.458821] (4)[311:ccci_mdinit][ccci1/util]Load /vendor/firmware/modem_1_lwg_n.img (size=0x918ff4) to 0x0x00000000f6000000 | |
[ 18.460136] (1)[485:HwBinder:291_1]Audio_AmpR_Set() | |
[ 18.460156] (1)[485:HwBinder:291_1]Audio_AmpL_Set() gain = 0 | |
[ 18.460156] | |
[ 18.460158] (1)[485:HwBinder:291_1]Voice_Amp_Set() | |
[ 18.460176] (1)[485:HwBinder:291_1]Speaker_Amp_Set() value = 0 | |
[ 18.460176] | |
[ 18.460714] (1)[485:HwBinder:291_1]Headset_Speaker_Amp_Set() gain = 0 | |
[ 18.460714] | |
[ 18.460716] (1)[485:HwBinder:291_1]Audio_ADC1_Set() | |
[ 18.460720] (1)[485:HwBinder:291_1]TurnOnADcPowerACC ADCType = 13 enable = 0, refmic_using_ADC_L=0 | |
[ 18.460889] (1)[485:HwBinder:291_1]TopCkCount <0 =-1 | |
[ 18.460889] | |
[ 18.460891] (1)[485:HwBinder:291_1]ClsqEnable count <0 | |
[ 18.460925] (1)[485:HwBinder:291_1]NvRegCount <0 =-1 | |
[ 18.460925] | |
[ 18.460927] (1)[485:HwBinder:291_1]audck_buf_Count count <0 | |
[ 18.460937] (1)[485:HwBinder:291_1]Audio_ADC2_Set() | |
[ 18.460941] (1)[485:HwBinder:291_1]TurnOnADcPowerACC ADCType = 14 enable = 0, refmic_using_ADC_L=0 | |
[ 18.461108] (1)[485:HwBinder:291_1]TopCkCount <0 =-1 | |
[ 18.461108] | |
[ 18.461110] (1)[485:HwBinder:291_1]ClsqEnable count <0 | |
[ 18.461135] (1)[485:HwBinder:291_1]NvRegCount <0 =-1 | |
[ 18.461135] | |
[ 18.461137] (1)[485:HwBinder:291_1]audck_buf_Count count <0 | |
[ 18.462510] (2)[279:logd.auditd]type=1400 audit(1556890369.193:33): avc: denied { open } for pid=311 comm="ccci_mdinit" path="/sys/mtk_ssw/mode" dev="sysfs" ino=11516 scontext=u:r:ccci_mdinit:s0 tcontext=u:object_r:sysfs:s0 tclass=file permissive=1 | |
[ 18.462521] (2)[279:logd.auditd]type=1400 audit(1556890369.356:34): avc: denied { read write } for pid=291 comm="HwBinder:291_1" name="mmcblk0p2" dev="tmpfs" ino=2161 scontext=u:r:hal_audio_default:s0 tcontext=u:object_r:nvram_device:s0 tclass=blk_file permissive=1 | |
[ 18.462921] (2)[279:logd.auditd]type=1400 audit(1556890369.356:34): avc: denied { read write } for pid=291 comm="HwBinder:291_1" name="mmcblk0p2" dev="tmpfs" ino=2161 scontext=u:r:hal_audio_default:s0 tcontext=u:object_r:nvram_device:s0 tclass=blk_file permissive=1 | |
[ 18.462931] (2)[279:logd.auditd]type=1400 audit(1556890369.356:35): avc: denied { open } for pid=291 comm="HwBinder:291_1" path="/dev/block/mmcblk0p2" dev="tmpfs" ino=2161 scontext=u:r:hal_audio_default:s0 tcontext=u:object_r:nvram_device:s0 tclass=blk_file permissive=1 | |
[ 18.466693] (3)[485:HwBinder:291_1]Audio_Hpl_Offset_Get | |
[ 18.466714] (3)[485:HwBinder:291_1]GetAudioTrimOffset channels = 1 | |
[ 18.485791] (3)[485:HwBinder:291_1]SetI2SDacOut SampleRate 44100, lowjitter 0, I2SWLen 0 | |
[ 18.485829] (3)[485:HwBinder:291_1]SetI2SDacEnable bEnable = 1 | |
[ 18.485831] (3)[485:HwBinder:291_1]OpenTrimBufferHardware true | |
[ 18.486506] (3)[485:HwBinder:291_1]ApplyDLNewIFFrequency with frequency = 48000 | |
[ 18.491612] (4)[311:ccci_mdinit]ApplyDLNewIFFrequency with frequency = 48000 | |
[ 18.491614] (4)[311:ccci_mdinit][ccci1/util]V36BML_LEGACY firmware check OK | |
[ 18.493447] (4)[311:ccci_mdinit][ccci0/util]sec_close (1)! | |
[ 18.494182] (4)[311:ccci_mdinit][ccci1/util]MD1 image postfix=1_lwg_n | |
[ 18.495018] (4)[311:ccci_mdinit][ccci1/util]MD1 image postfix=1_lwg_n_E1 | |
[ 18.495929] (4)[311:ccci_mdinit][ccci1/util]Find img @CIP | |
[ 18.496638] (4)[311:ccci_mdinit][ccci1/util]try to open dsp_1_lwg_n.bin | |
[ 18.497549] (4)[311:ccci_mdinit][ccci1/util]try to open dsp_1_lwg_n_E1.bin | |
[ 18.498454] (4)[311:ccci_mdinit][ccci1/util]try to open DSP_ROM | |
[ 18.499273] (4)[311:ccci_mdinit][ccci1/util]Find img @default | |
[ 18.500030] (4)[311:ccci_mdinit][ccci1/util]try to open dsp_1_lwg_n.bin | |
[ 18.501217] (4)[311:ccci_mdinit][ccci0/util]sec_open fd = (1)! | |
[ 18.501984] (4)[311:ccci_mdinit][ccci0/util]sec_open file ptr = (ffffffc0a0967140)! | |
[ 18.503014] (4)[311:ccci_mdinit][ccci1/util]open /vendor/firmware/dsp_1_lwg_n.bin OK | |
[ 18.505681] (4)[311:ccci_mdinit][ccci0/util]This image does not find header, no need bypass | |
[ 18.506804] (4)[311:ccci_mdinit][ccci0/util]legacy load | |
[ 18.506962] (3)[485:HwBinder:291_1]setOffsetTrimMux Mux = 1 | |
[ 18.527915] (0)[485:HwBinder:291_1]Buffer_offl_value = 1489 | |
[ 18.528684] (0)[485:HwBinder:291_1]setOffsetTrimMux Mux = 2 | |
[ 18.540306] (4)[311:ccci_mdinit][ccci1/util]DEBUG ret == size_per_read size=1048576 | |
[ 18.541939] (4)[311:ccci_mdinit][ccci1/util]/vendor/firmware/dsp_1_lwg_n.bin, image size=0x154208, read size:1393160, tail:0 | |
[ 18.543607] (4)[311:ccci_mdinit][ccci1/util]Load /vendor/firmware/dsp_1_lwg_n.bin (size=0x154208) to 0x0x00000000f6a20000 | |
[ 18.545011] (4)[311:ccci_mdinit][ccci0/util]sec_close (1)! | |
[ 18.545774] (4)[311:ccci_mdinit][md1/err]load ARMV7 firmware begin[0x0]<0x0> | |
[ 18.547088] (0)[485:HwBinder:291_1]Buffer_offr_value = 1489 | |
[ 18.547256] (4)[311:ccci_mdinit][md1]MPU Start protect MD ROM region<5:f6000000:f691ffff> b6d0b64, invalid_map=0xbe000000 | |
[ 18.547264] (4)[311:ccci_mdinit][md1]MPU Start protect MD R/W region<14:f6920000:fcffffff> b6d0b45 | |
[ 18.547272] (4)[311:ccci_mdinit][md1]MPU Start protect MD Share region<9:fd000000:fd00ffff> b6d0b40 | |
[ 18.547278] (4)[311:ccci_mdinit][md1]MPU Start protect AP region<15:40000000:ffffffff> 20 | |
[ 18.547285] (4)[311:ccci_mdinit][md1]MPU Start protect DSP region<6:f6a20000:f6b7ffff> b6d0b64 | |
[ 18.547296] (4)[311:ccci_mdinit][md1]md_cd_power_on:set VLTE on,bit0,1 | |
[ 18.547509] (4)[311:ccci_mdinit][md1]md_cd_power_on: set md1_srcclkena bit(0x1000_0338)=0x54 | |
[ 18.547512] (4)[311:ccci_mdinit][md1]clock buffer, BSI ignore mode | |
[ 18.547537] (4)[311:ccci_mdinit][md1]Call start md_power_on() | |
[ 18.547551] (4)[311:ccci_mdinit][Power/clkmgr] [md_power_on]: id = 0 | |
[ 18.547555] (4)[311:ccci_mdinit][md1]Call end md_power_on() ret=0 | |
[ 18.547559] (4)[311:ccci_mdinit][md1]Call end kicker_pbm_by_md(0,true) | |
[ 18.547567] (4)[311:ccci_mdinit][md1]set MD boot slave | |
[ 18.547573] (4)[311:ccci_mdinit][md1]CLDMA AP side clock is always on | |
[ 18.547586] (4)[311:ccci_mdinit][md1]cldma_reset from boot_md_store | |
[ 18.547607] (4)[311:ccci_mdinit][md1]cldma_start from boot_md_store | |
[ 18.547628] (4)[311:ccci_mdinit][md1/ntc]CLDMA modem started 0 | |
[ 18.563789] (2)[485:HwBinder:291_1]OpenTrimBufferHardware false | |
[ 18.564979] (2)[485:HwBinder:291_1]TopCkCount <0 =0 | |
[ 18.564979] | |
[ 18.565627] (2)[485:HwBinder:291_1]setOffsetTrimMux Mux = 1 | |
[ 18.566414] (2)[485:HwBinder:291_1]OpenAnalogHeadphone bEnable = 1 | |
[ 18.566901] (2)[485:HwBinder:291_1]SetHplTrimOffset Offset = 2048 | |
[ 18.567723] (2)[485:HwBinder:291_1]SetHprTrimOffset Offset = 2048 | |
[ 18.569136] (2)[485:HwBinder:291_1]Audio_Amp_Change | |
[ 18.570358] (2)[485:HwBinder:291_1]HeadsetVoloumeSet index = 8 oldindex = 8 | |
[ 18.578580] -(7)[293:[email protected]]random: nonblocking pool is initialized | |
[ 18.593491] (0)[485:HwBinder:291_1]Buffer_on_value = 1499 Buffer_offl_value = 1489 mHplOffset = 2058 | |
[ 18.594696] (0)[485:HwBinder:291_1]setOffsetTrimMux Mux = 2 | |
[ 18.615851] (4)[485:HwBinder:291_1]Buffer_on_value = 1497 Buffer_offr_value = 1489 mHprOffset = 2056 | |
[ 18.617044] (4)[485:HwBinder:291_1]OpenAnalogHeadphone bEnable = 0 | |
[ 18.617554] (4)[485:HwBinder:291_1]Audio_Amp_Change off amp | |
[ 18.618306] (4)[485:HwBinder:291_1]HeadsetVoloumeRestore | |
[ 18.619033] (4)[485:HwBinder:291_1]index = 8 oldindex = 8 | |
[ 18.620236] (4)[485:HwBinder:291_1]TopCkCount <0 =0 | |
[ 18.620236] | |
[ 18.621144] (4)[485:HwBinder:291_1]setOffsetTrimMux Mux = 9 | |
[ 18.621929] (4)[485:HwBinder:291_1]SetI2SDacEnable bEnable = 0 | |
[ 18.622520] (4)[485:HwBinder:291_1]SetHprTrimOffset Offset = 2056 | |
[ 18.623343] (4)[485:HwBinder:291_1]SetHplTrimOffset Offset = 2058 | |
[ 18.624202] (4)[485:HwBinder:291_1]Audio_Hpl_Offset_Set() | |
[ 18.624917] (4)[485:HwBinder:291_1]SetHplTrimOffset Offset = 2045 | |
[ 18.625813] (4)[485:HwBinder:291_1]Audio_Hpr_Offset_Get | |
[ 18.626549] (4)[485:HwBinder:291_1]Audio_Hpr_Offset_Set() | |
[ 18.627259] (4)[485:HwBinder:291_1]SetHprTrimOffset Offset = 2051 | |
[ 18.651887] (4)[485:HwBinder:291_1]Audio_Mic1_Mode_Select_Set() | |
[ 18.652796] (4)[485:HwBinder:291_1]Audio_Mic1_Mode_Select_Set() mAudio_Analog_Mic1_mode = 0 | |
[ 18.654185] (4)[485:HwBinder:291_1]Audio_Mic2_Mode_Select_Set() | |
[ 18.654974] (4)[485:HwBinder:291_1]Audio_Mic2_Mode_Select_Set() mAudio_Analog_Mic2_mode = 0 | |
[ 18.656444] (4)[485:HwBinder:291_1]Audio_Mic3_Mode_Select_Set() | |
[ 18.657233] (4)[485:HwBinder:291_1]Audio_Mic3_Mode_Select_Set() mAudio_Analog_Mic3_mode = 0 | |
[ 18.658584] (4)[485:HwBinder:291_1]Audio_Mic4_Mode_Select_Set() | |
[ 18.659407] (4)[485:HwBinder:291_1]Audio_Mic4_Mode_Select_Set() mAudio_Analog_Mic4_mode = 0 | |
[ 18.679406] (0)[182:ccci_ctrl][md1]control message 0x0,0x5555FFFF | |
[ 18.680207] (0)[182:ccci_ctrl][md1]get old handshake message | |
[ 18.681712] (4)[311:ccci_mdinit][md1]MPU Start protect AP region<15:40000000:ffffffff> a280b68 | |
[ 18.682874] -(4)[311:ccci_mdinit][md1/err]open /data/mdlog/mdlog1_config fail | |
[ 18.683510] -(4)[311:ccci_mdinit]mtk_rtc_hal_common: rtc_spare_reg[12] = {16432, 1, 6} | |
[ 18.684577] (4)[311:ccci_mdinit][md1]********************************************** | |
[ 18.685586] (4)[311:ccci_mdinit][md1]Prefix CCIF | |
[ 18.686311] (4)[311:ccci_mdinit][md1]Platform_L MT67 | |
[ 18.687019] (4)[311:ccci_mdinit][md1]Platform_H 35E1 | |
[ 18.687735] (4)[311:ccci_mdinit][md1]DriverVersion 0x20110118 | |
[ 18.688548] (4)[311:ccci_mdinit][md1]BootChannel 0 | |
[ 18.689259] (4)[311:ccci_mdinit][md1]BootingStartID(Mode) 0x0 | |
[ 18.690023] (4)[311:ccci_mdinit][md1]BootAttributes 0 | |
[ 18.690737] (4)[311:ccci_mdinit][md1]BootReadyID 0 | |
[ 18.691419] (4)[311:ccci_mdinit][md1]ExceShareMemBase 0x41000000 | |
[ 18.692234] (4)[311:ccci_mdinit][md1]ExceShareMemSize 0x10000 | |
[ 18.693040] (4)[311:ccci_mdinit][md1]TotalShareMemBase 0x41000000 | |
[ 18.693877] (4)[311:ccci_mdinit][md1]TotalShareMemSize 0x10000 | |
[ 18.694690] (4)[311:ccci_mdinit][md1]CheckSum 0 | |
[ 18.695340] (4)[311:ccci_mdinit][md1]Postfix CCIF | |
[ 18.696058] (4)[311:ccci_mdinit][md1]********************************************** | |
[ 18.697048] (4)[311:ccci_mdinit][md1]Prefix MISC | |
[ 18.697731] (4)[311:ccci_mdinit][md1]SupportMask 0xaa24 | |
[ 18.698468] (4)[311:ccci_mdinit][md1]Index 0x0 | |
[ 18.699162] (4)[311:ccci_mdinit][md1]Next 0x0 | |
[ 18.699795] (4)[311:ccci_mdinit][md1]Feature0 0x0 0x0 0x0 0x0 | |
[ 18.700596] (4)[311:ccci_mdinit][md1]Feature1 0x0 0x0 0x0 0x0 | |
[ 18.701399] (4)[311:ccci_mdinit][md1]Feature2 0x714bf145 0x0 0x0 0x0 | |
[ 18.702278] (4)[311:ccci_mdinit][md1]Feature3 0x0 0x0 0x0 0x0 | |
[ 18.703106] (4)[311:ccci_mdinit][md1]Feature4 0x0 0x0 0x0 0x0 | |
[ 18.703903] (4)[311:ccci_mdinit][md1]Feature5 0x3 0x0 0x0 0x0 | |
[ 18.704703] (4)[311:ccci_mdinit][md1]Feature6 0x5ccc4301 0x0 0x0 0x0 | |
[ 18.705582] (4)[311:ccci_mdinit][md1]Feature7 0x0 0x0 0x0 0x0 | |
[ 18.706411] (4)[311:ccci_mdinit][md1]Postfix MISC | |
[ 18.707100] (4)[311:ccci_mdinit][md1]---------------------------------------------- | |
[ 18.709127] (4)[0:swapper/4][md1]traffic(2/0):Tx(7f)1-0,0-0,0-0,0-0,0-0,0-0,0-0,0-0:Rx(7f)1,0,0,0,0,0,0,0 | |
[ 18.710377] (4)[0:swapper/4][md1]traffic(net): tx: [22]0 0, [26]0 0, [30]0 0, rx:[20]0, [24]0, [28]0 | |
[ 18.711899] (6)[485:HwBinder:291_1][md1]port ccci_aud open with flag 20002 by HwBinder:291_1 | |
[ 18.713341] (6)[485:HwBinder:291_1][md1]MD state 1, 2 | |
[ 18.713744] (1)[130:hps_main]MobiCore mcd: Cpu 7 is going to die | |
[ 18.715159] (1)[130:hps_main]CPU7: shutdown | |
[ 18.716284] (1)[130:hps_main]MobiCore mcd: Cpu 7 is dead | |
[ 18.717237] (1)[130:hps_main][HPS] (0200)(8)action end(461)(364)(17)(0) (8)(8)(8)(8)(1) (0)(0)(0) (4442)(12)(4) (0)(364)(12)(0)(364) wifi_base(0) | |
[ 18.732820] (1)[179:ccci_rpc_k][md1][0x00004005] fail: name:MD1_SIM3_HOT_PLUG_EINT, len:23, type:6, ret:-11 | |
[ 18.734185] (5)[179:ccci_rpc_k][md1][0x00004005] fail: name:MD1_SIM3_HOT_PLUG_EINT, len:23, type:5, ret:-11 | |
[ 18.735529] (1)[179:ccci_rpc_k][md1][0x00004005] fail: name:MD1_SIM4_HOT_PLUG_EINT, len:23, type:6, ret:-11 | |
[ 18.736924] (1)[179:ccci_rpc_k][md1][0x00004005] fail: name:MD1_SIM4_HOT_PLUG_EINT, len:23, type:5, ret:-11 | |
[ 18.752314] (0)[310:ccci_fsd][md1]ch=15 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 18.755163] (4)[310:ccci_fsd][md1]ch=15 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 18.764411] (1)[310:ccci_fsd][md1]ch=15 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 18.774351] (4)[310:ccci_fsd][md1]ch=15 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 18.784613] (6)[310:ccci_fsd][md1]ch=15 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 18.794323] (2)[310:ccci_fsd][md1]ch=15 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 18.805570] (4)[310:ccci_fsd][md1]ch=15 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 18.815088] (1)[310:ccci_fsd][md1]ch=15 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 18.824305] (1)[310:ccci_fsd][md1]ch=15 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 18.834241] (1)[310:ccci_fsd][md1]ch=15 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 18.844997] (0)[310:ccci_fsd][md1]ch=15 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 18.854368] (1)[310:ccci_fsd][md1]ch=15 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 18.864568] (5)[310:ccci_fsd][md1]ch=15 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 18.874200] (1)[310:ccci_fsd][md1]ch=15 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 18.885132] (1)[310:ccci_fsd][md1]ch=15 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 18.894570] (5)[310:ccci_fsd][md1]ch=15 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 18.905530] (4)[310:ccci_fsd][md1]ch=15 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 18.914250] (0)[310:ccci_fsd][md1]ch=15 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 18.924602] (4)[310:ccci_fsd][md1]ch=15 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 18.934355] (1)[310:ccci_fsd][md1]ch=15 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 18.944148] (1)[310:ccci_fsd][md1]ch=15 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 18.954432] (5)[310:ccci_fsd][md1]ch=15 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 18.964975] (4)[310:ccci_fsd][md1]ch=15 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 18.974791] (0)[310:ccci_fsd][md1]ch=15 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 18.984233] (2)[310:ccci_fsd][md1]ch=15 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 18.994353] (2)[310:ccci_fsd][md1]ch=15 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 19.005076] (5)[310:ccci_fsd][md1]ch=15 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 19.022592] (6)[293:[email protected]]M4Uconfig_port:CAM_IMGO,v1,s0 | |
[ 19.022838] (4)[520:initCamdevice][OV13850_camera_sensor] feature_control feature_id = 3003 | |
[ 19.022844] (4)[520:initCamdevice][OV13850_camera_sensor] feature_control feature_Control imgsensor.pclk = 0,imgsensor.current_fps = 0 | |
[ 19.022852] (4)[520:initCamdevice][OV13850_camera_sensor] feature_control feature_id = 3002 | |
[ 19.023354] (4)[520:initCamdevice][DUAL_CAMERA_MAIN_SENSOR] on = 1 | |
[ 19.023359] (4)[520:initCamdevice][camdebug] ov13850 poweron | |
[ 19.023364] (4)[520:initCamdevice]PinIdx(1) PwrType(1) val(0) | |
[ 19.023383] (4)[520:initCamdevice][kd_camera_hw]PinIdx(1) PwrType(1) val(0) | |
[ 19.023386] (4)[520:initCamdevice]PinIdx(0) PwrType(1) val(0) | |
[ 19.023397] (4)[520:initCamdevice][kd_camera_hw]PinIdx(0) PwrType(1) val(0) | |
[ 19.023410] (4)[520:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMIO id=0 en_reg=600 vol_reg=672 en=0) | |
[ 19.023427] (4)[520:initCamdevice][PMIC] regulator_enable(name=VCAMIO id=0 en_reg=600 vol_reg=672) [a3e]=0x8102 | |
[ 19.024778] (4)[520:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMA id=0 en_reg=520 vol_reg=63a en=0) | |
[ 19.024794] (4)[520:initCamdevice][PMIC] regulator_enable(name=VCAMA id=0 en_reg=520 vol_reg=63a) [a0c]=0x8102 | |
[ 19.026184] (4)[520:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMD id=0 en_reg=5f6 vol_reg=666 en=0) | |
[ 19.026201] (4)[520:initCamdevice][PMIC] regulator_enable(name=VCAMD id=0 en_reg=5f6 vol_reg=666) [a3c]=0x8102 | |
[ 19.028590] (4)[520:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMAF id=0 en_reg=598 vol_reg=656 en=0) | |
[ 19.028606] (4)[520:initCamdevice][PMIC] regulator_enable(name=VCAMAF id=0 en_reg=598 vol_reg=656) [a2a]=0x8122 | |
[ 19.033988] (4)[520:initCamdevice]PinIdx(0) PwrType(1) val(1) | |
[ 19.034004] (4)[520:initCamdevice][kd_camera_hw]PinIdx(0) PwrType(1) val(1) | |
[ 19.044229] (6)[293:[email protected]]M4Uconfig_port:CAM_RRZO,v1,s0 | |
[ 19.044423] (5)[179:ccci_rpc_k][md1]ch=33 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 19.046124] (6)[293:[email protected]]M4Uconfig_port:CAM_AAO,v1,s0 | |
[ 19.046913] (6)[293:[email protected]]M4Uconfig_port:CAM_ESFKO,v1,s0 | |
[ 19.047725] (6)[293:[email protected]]M4Uconfig_port:CAM_IMGO_S,v1,s0 | |
[ 19.048550] (6)[293:[email protected]]M4Uconfig_port:CAM_LSCI,v1,s0 | |
[ 19.049400] (5)[293:[email protected]]M4Uconfig_port:CAM_LSCI_D,v1,s0 | |
[ 19.050229] (5)[293:[email protected]]M4Uconfig_port:CAM_BPCI,v1,s0 | |
[ 19.051027] (5)[293:[email protected]]M4Uconfig_port:CAM_BPCI_D,v1,s0 | |
[ 19.051851] (5)[293:[email protected]]M4Uconfig_port:CAM_UFDI,v1,s0 | |
[ 19.052695] (5)[293:[email protected]]M4Uconfig_port:CAM_IMGI,v1,s0 | |
[ 19.053495] (5)[293:[email protected]]M4Uconfig_port:CAM_IMG2O,v1,s0 | |
[ 19.054012] (4)[520:initCamdevice][OV13850_camera_sensor] open OV13850,MIPI 4LANE | |
[ 19.054016] (4)[520:initCamdevice][OV13850_camera_sensor] open preview 2096*1552@30fps,640Mbps/lane; video 4192*3104@30fps,1.2Gbps/lane; capture 13M@30fps,1.2Gbps/lane | |
[ 19.054184] (4)[520:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 19.054187] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.054190] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.054198] (4)[520:initCamdevice]I2C structure: | |
[ 19.054198] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.054198] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.054198] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.054201] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.054213] (4)[520:initCamdevice]I2C register: | |
[ 19.054213] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.054213] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.054213] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.054221] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.054221] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.054221] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.054221] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.054239] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.054239] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.054239] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.054239] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.054241] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.054249] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.054408] (4)[520:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 19.054411] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.054415] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.054422] (4)[520:initCamdevice]I2C structure: | |
[ 19.054422] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.054422] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.054422] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.054425] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.054437] (4)[520:initCamdevice]I2C register: | |
[ 19.054437] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.054437] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.054437] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.054443] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.054443] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.054443] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.054443] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.054453] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.054453] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.054453] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.054453] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.054456] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.054463] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.054619] (4)[520:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 19.054622] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.054625] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.054632] (4)[520:initCamdevice]I2C structure: | |
[ 19.054632] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.054632] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.054632] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.054635] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.054646] (4)[520:initCamdevice]I2C register: | |
[ 19.054646] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.054646] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.054646] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.054653] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.054653] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.054653] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.054653] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.054665] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.054665] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.054665] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.054665] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.054667] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.054672] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.054825] (4)[520:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 19.054828] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.054831] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.054838] (4)[520:initCamdevice]I2C structure: | |
[ 19.054838] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.054838] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.054838] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.054841] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.054852] (4)[520:initCamdevice]I2C register: | |
[ 19.054852] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.054852] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.054852] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.054858] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.054858] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.054858] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.054858] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.054868] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.054868] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.054868] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.054868] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.054871] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.054875] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.054879] (4)[520:initCamdevice][OV13850_camera_sensor] open Read sensor id fail, write id: 0x20, id: 0x0 | |
[ 19.055030] (4)[520:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 19.055033] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.055036] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.055043] (4)[520:initCamdevice]I2C structure: | |
[ 19.055043] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.055043] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.055043] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.055046] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.055058] (4)[520:initCamdevice]I2C register: | |
[ 19.055058] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.055058] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.055058] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.055064] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.055064] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.055064] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.055064] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.055074] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.055074] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.055074] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.055074] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.055077] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.055081] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.055231] (4)[520:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 19.055234] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.055237] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.055244] (4)[520:initCamdevice]I2C structure: | |
[ 19.055244] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.055244] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.055244] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.055246] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.055258] (4)[520:initCamdevice]I2C register: | |
[ 19.055258] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.055258] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.055258] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.055264] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.055264] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.055264] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.055264] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.055274] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.055274] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.055274] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.055274] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.055280] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.055285] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.055437] (4)[520:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 19.055440] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.055443] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.055450] (4)[520:initCamdevice]I2C structure: | |
[ 19.055450] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.055450] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.055450] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.055453] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.055464] (4)[520:initCamdevice]I2C register: | |
[ 19.055464] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.055464] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.055464] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.055470] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.055470] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.055470] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.055470] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.055480] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.055480] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.055480] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.055480] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.055483] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.055487] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.055639] (4)[520:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 19.055642] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.055644] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.055652] (4)[520:initCamdevice]I2C structure: | |
[ 19.055652] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.055652] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.055652] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.055654] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.055666] (4)[520:initCamdevice]I2C register: | |
[ 19.055666] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.055666] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.055666] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.055672] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.055672] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.055672] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.055672] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.055682] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.055682] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.055682] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.055682] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.055685] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.055689] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.055693] (4)[520:initCamdevice][OV13850_camera_sensor] open Read sensor id fail, write id: 0x20, id: 0x0 | |
[ 19.055849] (4)[520:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 19.055852] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.055855] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.055862] (4)[520:initCamdevice]I2C structure: | |
[ 19.055862] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.055862] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.055862] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.055865] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.055876] (4)[520:initCamdevice]I2C register: | |
[ 19.055876] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.055876] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.055876] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.055883] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.055883] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.055883] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.055883] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.055893] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.055893] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.055893] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.055893] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.055895] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.055900] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.056052] (4)[520:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 19.056054] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.056057] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.056064] (4)[520:initCamdevice]I2C structure: | |
[ 19.056064] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.056064] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.056064] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.056067] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.056078] (4)[520:initCamdevice]I2C register: | |
[ 19.056078] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.056078] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.056078] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.056085] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.056085] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.056085] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.056085] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.056094] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.056094] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.056094] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.056094] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.056097] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.056102] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.056254] (4)[520:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 19.056257] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.056259] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.056267] (4)[520:initCamdevice]I2C structure: | |
[ 19.056267] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.056267] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.056267] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.056269] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.056281] (4)[520:initCamdevice]I2C register: | |
[ 19.056281] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.056281] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.056281] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.056287] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.056287] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.056287] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.056287] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.056297] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.056297] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.056297] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.056297] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.056300] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.056305] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.056452] (4)[520:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 19.056455] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.056457] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.056465] (4)[520:initCamdevice]I2C structure: | |
[ 19.056465] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.056465] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.056465] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.056468] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.056479] (4)[520:initCamdevice]I2C register: | |
[ 19.056479] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.056479] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.056479] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.056485] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.056485] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.056485] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.056485] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.056496] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.056496] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.056496] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.056496] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.056499] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.056504] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.056508] (4)[520:initCamdevice][OV13850_camera_sensor] open Read sensor id fail, write id: 0x6c, id: 0x0 | |
[ 19.056664] (4)[520:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 19.056667] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.056670] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.056677] (4)[520:initCamdevice]I2C structure: | |
[ 19.056677] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.056677] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.056677] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.056680] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.056691] (4)[520:initCamdevice]I2C register: | |
[ 19.056691] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.056691] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.056691] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.056698] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.056698] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.056698] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.056698] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.056708] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.056708] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.056708] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.056708] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.056710] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.056716] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.056868] (4)[520:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 19.056870] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.056873] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.056880] (4)[520:initCamdevice]I2C structure: | |
[ 19.056880] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.056880] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.056880] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.056883] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.056894] (4)[520:initCamdevice]I2C register: | |
[ 19.056894] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.056894] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.056894] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.056901] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.056901] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.056901] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.056901] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.056910] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.056910] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.056910] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.056910] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.056913] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.056918] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.057069] (4)[520:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 19.057071] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.057074] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.057082] (4)[520:initCamdevice]I2C structure: | |
[ 19.057082] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.057082] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.057082] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.057084] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.057096] (4)[520:initCamdevice]I2C register: | |
[ 19.057096] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.057096] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.057096] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.057102] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.057102] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.057102] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.057102] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.057112] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.057112] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.057112] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.057112] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.057115] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.057119] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.057270] (4)[520:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 19.057273] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.057276] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.057283] (4)[520:initCamdevice]I2C structure: | |
[ 19.057283] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.057283] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.057283] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.057286] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.057298] (4)[520:initCamdevice]I2C register: | |
[ 19.057298] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.057298] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.057298] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.057304] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.057304] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.057304] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.057304] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.057314] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.057314] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.057314] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.057314] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.057316] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.057321] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.057325] (4)[520:initCamdevice][OV13850_camera_sensor] open Read sensor id fail, write id: 0x6c, id: 0x0 | |
[ 19.057328] (4)[520:initCamdevice][DUAL_CAMERA_MAIN_SENSOR] on = 0 | |
[ 19.057333] (4)[520:initCamdevice][camdebug] ov13850 poweroff | |
[ 19.057336] (4)[520:initCamdevice]PinIdx(0) PwrType(1) val(0) | |
[ 19.057356] (4)[520:initCamdevice][kd_camera_hw]PinIdx(0) PwrType(1) val(0) | |
[ 19.057369] (4)[520:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMAF id=0 en_reg=598 vol_reg=656 en=1) | |
[ 19.057387] (4)[520:initCamdevice][PMIC] regulator_disable(name=VCAMAF id=0 en_reg=598 vol_reg=656 use_count=1) [a2a]=0x120 | |
[ 19.057397] (4)[520:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMD id=0 en_reg=5f6 vol_reg=666 en=1) | |
[ 19.057413] (4)[520:initCamdevice][PMIC] regulator_disable(name=VCAMD id=0 en_reg=5f6 vol_reg=666 use_count=1) [a3c]=0x100 | |
[ 19.057423] (4)[520:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMA id=0 en_reg=520 vol_reg=63a en=1) | |
[ 19.057439] (4)[520:initCamdevice][PMIC] regulator_disable(name=VCAMA id=0 en_reg=520 vol_reg=63a use_count=1) [a0c]=0x100 | |
[ 19.057450] (4)[520:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMIO id=0 en_reg=600 vol_reg=672 en=1) | |
[ 19.057466] (4)[520:initCamdevice][PMIC] regulator_disable(name=VCAMIO id=0 en_reg=600 vol_reg=672 use_count=1) [a3e]=0x100 | |
[ 19.057472] (4)[520:initCamdevice]SensorOpen | |
[ 19.057474] (4)[520:initCamdevice]ERROR:SensorOpen(), turn off power | |
[ 19.057626] (4)[520:initCamdevice][DUAL_CAMERA_MAIN_SENSOR] on = 1 | |
[ 19.057631] (4)[520:initCamdevice][camdebug] ov13850 poweron | |
[ 19.057634] (4)[520:initCamdevice]PinIdx(1) PwrType(1) val(0) | |
[ 19.057649] (4)[520:initCamdevice][kd_camera_hw]PinIdx(1) PwrType(1) val(0) | |
[ 19.057652] (4)[520:initCamdevice]PinIdx(0) PwrType(1) val(0) | |
[ 19.057660] (4)[520:initCamdevice][kd_camera_hw]PinIdx(0) PwrType(1) val(0) | |
[ 19.057673] (4)[520:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMIO id=0 en_reg=600 vol_reg=672 en=0) | |
[ 19.057689] (4)[520:initCamdevice][PMIC] regulator_enable(name=VCAMIO id=0 en_reg=600 vol_reg=672) [a3e]=0x8102 | |
[ 19.059050] (4)[520:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMA id=0 en_reg=520 vol_reg=63a en=0) | |
[ 19.059069] (4)[520:initCamdevice][PMIC] regulator_enable(name=VCAMA id=0 en_reg=520 vol_reg=63a) [a0c]=0x8102 | |
[ 19.060504] (4)[520:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMD id=0 en_reg=5f6 vol_reg=666 en=0) | |
[ 19.060522] (4)[520:initCamdevice][PMIC] regulator_enable(name=VCAMD id=0 en_reg=5f6 vol_reg=666) [a3c]=0x8102 | |
[ 19.062922] (4)[520:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMAF id=0 en_reg=598 vol_reg=656 en=0) | |
[ 19.062939] (4)[520:initCamdevice][PMIC] regulator_enable(name=VCAMAF id=0 en_reg=598 vol_reg=656) [a2a]=0x122 | |
[ 19.068329] (4)[520:initCamdevice]PinIdx(0) PwrType(1) val(1) | |
[ 19.068349] (4)[520:initCamdevice][kd_camera_hw]PinIdx(0) PwrType(1) val(1) | |
[ 19.088362] (4)[520:initCamdevice][OV13850_camera_sensor] open OV13850,MIPI 4LANE | |
[ 19.088367] (4)[520:initCamdevice][OV13850_camera_sensor] open preview 2096*1552@30fps,640Mbps/lane; video 4192*3104@30fps,1.2Gbps/lane; capture 13M@30fps,1.2Gbps/lane | |
[ 19.088542] (4)[520:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 19.088546] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.088549] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.088556] (4)[520:initCamdevice]I2C structure: | |
[ 19.088556] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.088556] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.088556] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.088560] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.088571] (4)[520:initCamdevice]I2C register: | |
[ 19.088571] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.088571] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.088571] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.088578] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.088578] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.088578] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.088578] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.088588] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.088588] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.088588] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.088588] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.088591] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.088597] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.088778] (4)[520:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 19.088781] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.088784] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.088791] (4)[520:initCamdevice]I2C structure: | |
[ 19.088791] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.088791] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.088791] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.088794] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.088805] (4)[520:initCamdevice]I2C register: | |
[ 19.088805] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.088805] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.088805] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.088812] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.088812] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.088812] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.088812] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.088822] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.088822] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.088822] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.088822] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.088825] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.088830] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.088984] (4)[520:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 19.088987] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.088990] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.088997] (4)[520:initCamdevice]I2C structure: | |
[ 19.088997] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.088997] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.088997] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.089000] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.089011] (4)[520:initCamdevice]I2C register: | |
[ 19.089011] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.089011] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.089011] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.089018] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.089018] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.089018] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.089018] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.089027] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.089027] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.089027] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.089027] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.089030] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.089035] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.089189] (4)[520:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 19.089192] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.089195] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.089202] (4)[520:initCamdevice]I2C structure: | |
[ 19.089202] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.089202] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.089202] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.089205] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.089216] (4)[520:initCamdevice]I2C register: | |
[ 19.089216] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.089216] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.089216] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.089223] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.089223] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.089223] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.089223] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.089232] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.089232] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.089232] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.089232] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.089235] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.089240] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.089244] (4)[520:initCamdevice][OV13850_camera_sensor] open Read sensor id fail, write id: 0x20, id: 0x0 | |
[ 19.089399] (4)[520:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 19.089402] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.089404] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.089412] (4)[520:initCamdevice]I2C structure: | |
[ 19.089412] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.089412] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.089412] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.089415] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.089426] (4)[520:initCamdevice]I2C register: | |
[ 19.089426] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.089426] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.089426] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.089432] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.089432] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.089432] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.089432] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.089442] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.089442] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.089442] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.089442] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.089445] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.089450] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.089601] (4)[520:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 19.089604] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.089607] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.089614] (4)[520:initCamdevice]I2C structure: | |
[ 19.089614] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.089614] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.089614] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.089617] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.089629] (4)[520:initCamdevice]I2C register: | |
[ 19.089629] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.089629] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.089629] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.089635] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.089635] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.089635] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.089635] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.089645] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.089645] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.089645] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.089645] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.089648] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.089652] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.089804] (4)[520:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 19.089808] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.089810] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.089818] (4)[520:initCamdevice]I2C structure: | |
[ 19.089818] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.089818] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.089818] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.089821] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.089833] (4)[520:initCamdevice]I2C register: | |
[ 19.089833] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.089833] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.089833] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.089841] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.089841] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.089841] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.089841] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.089850] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.089850] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.089850] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.089850] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.089855] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.089860] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.090014] (4)[520:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 19.090017] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.090020] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.090027] (4)[520:initCamdevice]I2C structure: | |
[ 19.090027] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.090027] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.090027] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.090030] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.090042] (4)[520:initCamdevice]I2C register: | |
[ 19.090042] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.090042] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.090042] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.090048] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.090048] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.090048] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.090048] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.090058] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.090058] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.090058] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.090058] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.090060] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.090065] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.090069] (4)[520:initCamdevice][OV13850_camera_sensor] open Read sensor id fail, write id: 0x20, id: 0x0 | |
[ 19.090221] (4)[520:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 19.090224] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.090227] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.090234] (4)[520:initCamdevice]I2C structure: | |
[ 19.090234] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.090234] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.090234] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.090237] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.090249] (4)[520:initCamdevice]I2C register: | |
[ 19.090249] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.090249] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.090249] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.090255] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.090255] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.090255] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.090255] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.090265] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.090265] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.090265] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.090265] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.090267] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.090272] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.090423] (4)[520:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 19.090427] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.090429] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.090437] (4)[520:initCamdevice]I2C structure: | |
[ 19.090437] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.090437] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.090437] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.090440] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.090451] (4)[520:initCamdevice]I2C register: | |
[ 19.090451] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.090451] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.090451] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.090457] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.090457] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.090457] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.090457] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.090467] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.090467] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.090467] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.090467] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.090470] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.090474] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.090626] (4)[520:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 19.090629] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.090632] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.090639] (4)[520:initCamdevice]I2C structure: | |
[ 19.090639] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.090639] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.090639] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.090642] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.090653] (4)[520:initCamdevice]I2C register: | |
[ 19.090653] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.090653] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.090653] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.090661] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.090661] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.090661] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.090661] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.090671] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.090671] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.090671] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.090671] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.090674] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.090679] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.090831] (4)[520:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 19.090833] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.090836] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.090843] (4)[520:initCamdevice]I2C structure: | |
[ 19.090843] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.090843] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.090843] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.090846] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.090858] (4)[520:initCamdevice]I2C register: | |
[ 19.090858] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.090858] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.090858] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.090864] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.090864] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.090864] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.090864] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.090874] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.090874] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.090874] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.090874] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.090877] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.090881] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.090885] (4)[520:initCamdevice][OV13850_camera_sensor] open Read sensor id fail, write id: 0x6c, id: 0x0 | |
[ 19.091036] (4)[520:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 19.091039] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.091042] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.091049] (4)[520:initCamdevice]I2C structure: | |
[ 19.091049] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.091049] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.091049] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.091051] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.091063] (4)[520:initCamdevice]I2C register: | |
[ 19.091063] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.091063] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.091063] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.091069] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.091069] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.091069] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.091069] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.091079] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.091079] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.091079] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.091079] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.091082] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.091086] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.091236] (4)[520:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 19.091239] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.091241] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.091248] (4)[520:initCamdevice]I2C structure: | |
[ 19.091248] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.091248] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.091248] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.091251] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.091262] (4)[520:initCamdevice]I2C register: | |
[ 19.091262] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.091262] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.091262] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.091269] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.091269] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.091269] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.091269] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.091280] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.091280] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.091280] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.091280] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.091283] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.091288] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.091440] (4)[520:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 19.091443] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.091446] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.091453] (4)[520:initCamdevice]I2C structure: | |
[ 19.091453] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.091453] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.091453] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.091456] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.091467] (4)[520:initCamdevice]I2C register: | |
[ 19.091467] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.091467] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.091467] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.091474] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.091474] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.091474] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.091474] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.091482] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.091482] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.091482] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.091482] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.091485] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.091490] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.091646] (4)[520:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 19.091650] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.091653] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.091660] (4)[520:initCamdevice]I2C structure: | |
[ 19.091660] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.091660] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.091660] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.091663] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.091676] (4)[520:initCamdevice]I2C register: | |
[ 19.091676] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.091676] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.091676] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.091683] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.091683] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.091683] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.091683] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.091693] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.091693] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.091693] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.091693] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.091697] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.091702] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.091706] (4)[520:initCamdevice][OV13850_camera_sensor] open Read sensor id fail, write id: 0x6c, id: 0x0 | |
[ 19.091711] (4)[520:initCamdevice][DUAL_CAMERA_MAIN_SENSOR] on = 0 | |
[ 19.091717] (4)[520:initCamdevice][camdebug] ov13850 poweroff | |
[ 19.091722] (4)[520:initCamdevice]PinIdx(0) PwrType(1) val(0) | |
[ 19.091749] (4)[520:initCamdevice][kd_camera_hw]PinIdx(0) PwrType(1) val(0) | |
[ 19.091770] (4)[520:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMAF id=0 en_reg=598 vol_reg=656 en=1) | |
[ 19.091797] (4)[520:initCamdevice][PMIC] regulator_disable(name=VCAMAF id=0 en_reg=598 vol_reg=656 use_count=1) [a2a]=0x120 | |
[ 19.091810] (4)[520:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMD id=0 en_reg=5f6 vol_reg=666 en=1) | |
[ 19.091827] (4)[520:initCamdevice][PMIC] regulator_disable(name=VCAMD id=0 en_reg=5f6 vol_reg=666 use_count=1) [a3c]=0x100 | |
[ 19.091839] (4)[520:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMA id=0 en_reg=520 vol_reg=63a en=1) | |
[ 19.091855] (4)[520:initCamdevice][PMIC] regulator_disable(name=VCAMA id=0 en_reg=520 vol_reg=63a use_count=1) [a0c]=0x100 | |
[ 19.091870] (4)[520:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMIO id=0 en_reg=600 vol_reg=672 en=1) | |
[ 19.091886] (4)[520:initCamdevice][PMIC] regulator_disable(name=VCAMIO id=0 en_reg=600 vol_reg=672 use_count=1) [a3e]=0x100 | |
[ 19.091894] (4)[520:initCamdevice]SensorOpen | |
[ 19.091896] (4)[520:initCamdevice]ERROR:SensorOpen(), turn off power | |
[ 19.092110] (4)[520:initCamdevice][DUAL_CAMERA_MAIN_SENSOR] on = 1 | |
[ 19.092115] (4)[520:initCamdevice][camdebug] ov13850 poweron | |
[ 19.092119] (4)[520:initCamdevice]PinIdx(1) PwrType(1) val(0) | |
[ 19.092136] (4)[520:initCamdevice][kd_camera_hw]PinIdx(1) PwrType(1) val(0) | |
[ 19.092140] (4)[520:initCamdevice]PinIdx(0) PwrType(1) val(0) | |
[ 19.092148] (4)[520:initCamdevice][kd_camera_hw]PinIdx(0) PwrType(1) val(0) | |
[ 19.092162] (4)[520:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMIO id=0 en_reg=600 vol_reg=672 en=0) | |
[ 19.092180] (4)[520:initCamdevice][PMIC] regulator_enable(name=VCAMIO id=0 en_reg=600 vol_reg=672) [a3e]=0x8102 | |
[ 19.093547] (4)[520:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMA id=0 en_reg=520 vol_reg=63a en=0) | |
[ 19.093564] (4)[520:initCamdevice][PMIC] regulator_enable(name=VCAMA id=0 en_reg=520 vol_reg=63a) [a0c]=0x8102 | |
[ 19.094961] (4)[520:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMD id=0 en_reg=5f6 vol_reg=666 en=0) | |
[ 19.094978] (4)[520:initCamdevice][PMIC] regulator_enable(name=VCAMD id=0 en_reg=5f6 vol_reg=666) [a3c]=0x8102 | |
[ 19.095889] (3)[182:ccci_ctrl][md1]control message 0x0,0x0 | |
[ 19.095960] (2)[514:ccci_mdinit][md0]Update time(R): [sec=0x5ccc4301][timezone=0x00000000][des=0x00000000] | |
[ 19.095966] (2)[514:ccci_mdinit][md0]Update time(A): [L:0x5ccc4301][H:0x00000000][0x00000000][0x00000000] | |
[ 19.095987] (2)[514:ccci_mdinit][md0]Update success | |
[ 19.097393] (4)[520:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMAF id=0 en_reg=598 vol_reg=656 en=0) | |
[ 19.097412] (4)[520:initCamdevice][PMIC] regulator_enable(name=VCAMAF id=0 en_reg=598 vol_reg=656) [a2a]=0x8122 | |
[ 19.101026] (1)[1:init]selinux: avc: denied { set } for property=ctl.emdlogger1 pid=311 uid=1001 gid=1001 scontext=u:r:ccci_mdinit:s0 tcontext=u:object_r:ctl_default_prop:s0 tclass=property_service permissive=1 | |
[ 19.101026] | |
[ 19.101096] (1)[1:init]init: no such service 'emdlogger1' | |
[ 19.102828] (4)[520:initCamdevice]PinIdx(0) PwrType(1) val(1) | |
[ 19.102851] (4)[520:initCamdevice][kd_camera_hw]PinIdx(0) PwrType(1) val(1) | |
[ 19.103257] (1)[1:init]init: starting service 'gsm0710muxd'... | |
[ 19.115952] (0)[485:HwBinder:291_1][md1]MD state 2, 3 | |
[ 19.120603] (3)[485:HwBinder:291_1]Audio_Vow_Cfg4_Get() = 110 | |
[ 19.120794] (3)[485:HwBinder:291_1]Audio_Vow_Cfg2_Get() = 8738 | |
[ 19.120805] (3)[485:HwBinder:291_1]Audio_Vow_Cfg2_Set() = 8738 | |
[ 19.120818] (3)[485:HwBinder:291_1]Audio_Vow_Cfg3_Get() = 34663 | |
[ 19.120828] (3)[485:HwBinder:291_1]Audio_Vow_Cfg3_Set() = 34663 | |
[ 19.120840] (3)[485:HwBinder:291_1]Audio_Vow_Cfg4_Get() = 110 | |
[ 19.120849] (3)[485:HwBinder:291_1]Audio_Vow_Cfg4_Set() = 110 | |
[ 19.122871] (4)[520:initCamdevice][OV13850_camera_sensor] open OV13850,MIPI 4LANE | |
[ 19.122876] (4)[520:initCamdevice][OV13850_camera_sensor] open preview 2096*1552@30fps,640Mbps/lane; video 4192*3104@30fps,1.2Gbps/lane; capture 13M@30fps,1.2Gbps/lane | |
[ 19.123054] (4)[520:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 19.123058] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.123062] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.123070] (4)[520:initCamdevice]I2C structure: | |
[ 19.123070] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.123070] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.123070] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.123074] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.123086] (4)[520:initCamdevice]I2C register: | |
[ 19.123086] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.123086] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.123086] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.123092] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.123092] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.123092] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.123092] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.123103] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.123103] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.123103] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.123103] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.123106] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.123115] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.123133] (3)[525:gsm0710muxd][md1]port ttyC0 open with flag 20902 by gsm0710muxd | |
[ 19.123280] (4)[520:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 19.123284] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.123287] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.123294] (4)[520:initCamdevice]I2C structure: | |
[ 19.123294] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.123294] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.123294] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.123297] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.123310] (4)[520:initCamdevice]I2C register: | |
[ 19.123310] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.123310] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.123310] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.123317] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.123317] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.123317] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.123317] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.123327] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.123327] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.123327] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.123327] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.123330] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.123338] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.123506] (4)[520:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 19.123510] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.123513] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.123520] (4)[520:initCamdevice]I2C structure: | |
[ 19.123520] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.123520] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.123520] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.123523] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.123535] (4)[520:initCamdevice]I2C register: | |
[ 19.123535] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.123535] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.123535] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.123541] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.123541] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.123541] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.123541] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.123551] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.123551] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.123551] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.123551] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.123554] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.123561] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.123724] (4)[520:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 19.123727] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.123730] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.123738] (4)[520:initCamdevice]I2C structure: | |
[ 19.123738] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.123738] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.123738] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.123742] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.123753] (4)[520:initCamdevice]I2C register: | |
[ 19.123753] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.123753] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.123753] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.123760] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.123760] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.123760] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.123760] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.123772] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.123772] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.123772] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.123772] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.123775] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.123781] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.123785] (4)[520:initCamdevice][OV13850_camera_sensor] open Read sensor id fail, write id: 0x20, id: 0x0 | |
[ 19.123948] (4)[520:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 19.123951] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.123954] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.123961] (4)[520:initCamdevice]I2C structure: | |
[ 19.123961] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.123961] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.123961] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.123965] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.123980] (4)[520:initCamdevice]I2C register: | |
[ 19.123980] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.123980] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.123980] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.123986] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.123986] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.123986] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.123986] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.123996] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.123996] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.123996] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.123996] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.123999] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.124006] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.124162] (4)[520:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 19.124165] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.124168] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.124176] (4)[520:initCamdevice]I2C structure: | |
[ 19.124176] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.124176] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.124176] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.124179] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.124191] (4)[520:initCamdevice]I2C register: | |
[ 19.124191] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.124191] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.124191] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.124197] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.124197] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.124197] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.124197] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.124207] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.124207] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.124207] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.124207] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.124209] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.124215] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.124369] (4)[520:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 19.124372] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.124375] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.124383] (4)[520:initCamdevice]I2C structure: | |
[ 19.124383] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.124383] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.124383] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.124388] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.124404] (4)[520:initCamdevice]I2C register: | |
[ 19.124404] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.124404] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.124404] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.124411] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.124411] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.124411] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.124411] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.124426] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.124426] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.124426] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.124426] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.124429] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.124436] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.124587] (4)[520:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 19.124590] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.124593] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.124601] (4)[520:initCamdevice]I2C structure: | |
[ 19.124601] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.124601] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.124601] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.124605] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.124621] (4)[520:initCamdevice]I2C register: | |
[ 19.124621] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.124621] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.124621] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.124628] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.124628] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.124628] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.124628] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.124637] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.124637] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.124637] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.124637] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.124640] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.124647] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.124651] (4)[520:initCamdevice][OV13850_camera_sensor] open Read sensor id fail, write id: 0x20, id: 0x0 | |
[ 19.124809] (4)[520:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 19.124813] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.124815] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.124822] (4)[520:initCamdevice]I2C structure: | |
[ 19.124822] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.124822] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.124822] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.124826] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.124837] (4)[520:initCamdevice]I2C register: | |
[ 19.124837] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.124837] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.124837] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.124843] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.124843] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.124843] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.124843] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.124853] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.124853] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.124853] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.124853] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.124856] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.124861] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.125015] (4)[520:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 19.125019] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.125022] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.125029] (4)[520:initCamdevice]I2C structure: | |
[ 19.125029] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.125029] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.125029] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.125033] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.125047] (4)[520:initCamdevice]I2C register: | |
[ 19.125047] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.125047] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.125047] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.125053] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.125053] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.125053] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.125053] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.125063] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.125063] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.125063] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.125063] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.125066] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.125073] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.125230] (4)[520:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 19.125233] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.125236] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.125244] (4)[520:initCamdevice]I2C structure: | |
[ 19.125244] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.125244] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.125244] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.125247] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.125259] (4)[520:initCamdevice]I2C register: | |
[ 19.125259] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.125259] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.125259] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.125265] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.125265] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.125265] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.125265] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.125275] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.125275] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.125275] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.125275] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.125278] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.125284] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.125449] (4)[520:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 19.125453] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.125456] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.125463] (4)[520:initCamdevice]I2C structure: | |
[ 19.125463] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.125463] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.125463] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.125467] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.125479] (4)[520:initCamdevice]I2C register: | |
[ 19.125479] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.125479] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.125479] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.125485] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.125485] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.125485] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.125485] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.125497] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.125497] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.125497] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.125497] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.125500] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.125508] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.125513] (4)[520:initCamdevice][OV13850_camera_sensor] open Read sensor id fail, write id: 0x6c, id: 0x0 | |
[ 19.125679] (4)[520:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 19.125683] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.125686] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.125693] (4)[520:initCamdevice]I2C structure: | |
[ 19.125693] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.125693] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.125693] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.125697] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.125708] (4)[520:initCamdevice]I2C register: | |
[ 19.125708] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.125708] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.125708] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.125714] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.125714] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.125714] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.125714] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.125724] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.125724] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.125724] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.125724] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.125727] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.125763] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.125925] (4)[520:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 19.125929] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.125932] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.125939] (4)[520:initCamdevice]I2C structure: | |
[ 19.125939] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.125939] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.125939] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.125942] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.125954] (4)[520:initCamdevice]I2C register: | |
[ 19.125954] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.125954] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.125954] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.125960] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.125960] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.125960] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.125960] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.125972] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.125972] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.125972] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.125972] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.125975] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.125981] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.126137] (4)[520:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 19.126140] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.126143] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.126150] (4)[520:initCamdevice]I2C structure: | |
[ 19.126150] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.126150] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.126150] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.126153] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.126165] (4)[520:initCamdevice]I2C register: | |
[ 19.126165] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.126165] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.126165] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.126171] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.126171] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.126171] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.126171] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.126181] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.126181] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.126181] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.126181] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.126184] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.126190] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.126341] (4)[520:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 19.126345] (4)[520:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 19.126348] (4)[520:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 19.126355] (4)[520:initCamdevice]I2C structure: | |
[ 19.126355] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 19.126355] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 19.126355] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 19.126358] (4)[520:initCamdevice]base address 0xffffff8001fd2000 | |
[ 19.126370] (4)[520:initCamdevice]I2C register: | |
[ 19.126370] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 19.126370] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 19.126370] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 19.126376] (4)[520:initCamdevice]before enable DMA register(0x0): | |
[ 19.126376] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.126376] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.126376] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.126386] (4)[520:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 19.126386] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 19.126386] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 19.126386] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 19.126389] (4)[520:initCamdevice]I2C(0) dump info------------------------------ | |
[ 19.126395] (4)[520:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 19.126399] (4)[520:initCamdevice][OV13850_camera_sensor] open Read sensor id fail, write id: 0x6c, id: 0x0 | |
[ 19.126403] (4)[520:initCamdevice][DUAL_CAMERA_MAIN_SENSOR] on = 0 | |
[ 19.126408] (4)[520:initCamdevice][camdebug] ov13850 poweroff | |
[ 19.126411] (4)[520:initCamdevice]PinIdx(0) PwrType(1) val(0) | |
[ 19.126430] (4)[520:initCamdevice][kd_camera_hw]PinIdx(0) PwrType(1) val(0) | |
[ 19.126443] (4)[520:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMAF id=0 en_reg=598 vol_reg=656 en=1) | |
[ 19.126464] (4)[520:initCamdevice][PMIC] regulator_disable(name=VCAMAF id=0 en_reg=598 vol_reg=656 use_count=1) [a2a]=0x120 | |
[ 19.126476] (4)[520:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMD id=0 en_reg=5f6 vol_reg=666 en=1) | |
[ 19.126492] (4)[520:initCamdevice][PMIC] regulator_disable(name=VCAMD id=0 en_reg=5f6 vol_reg=666 use_count=1) [a3c]=0x100 | |
[ 19.126502] (4)[520:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMA id=0 en_reg=520 vol_reg=63a en=1) | |
[ 19.126520] (4)[520:initCamdevice][PMIC] regulator_disable(name=VCAMA id=0 en_reg=520 vol_reg=63a use_count=1) [a0c]=0x100 | |
[ 19.126532] (4)[520:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMIO id=0 en_reg=600 vol_reg=672 en=1) | |
[ 19.126548] (4)[520:initCamdevice][PMIC] regulator_disable(name=VCAMIO id=0 en_reg=600 vol_reg=672 use_count=1) [a3e]=0x100 | |
[ 19.126555] (4)[520:initCamdevice]SensorOpen | |
[ 19.126557] (4)[520:initCamdevice]ERROR:SensorOpen(), turn off power | |
[ 19.519439] (1)[130:hps_main]MobiCore mcd: Cpu 6 is going to die | |
[ 20.044318] (2)[130:hps_main]CPU6: shutdown | |
[ 20.044527] (5)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, mc_open_device failed: 15 | |
[ 20.045507] (4)[293:[email protected]]M4Uconfig_port:CAM_IMG3O,v1,s0 | |
[ 20.045519] (4)[293:[email protected]]M4Uconfig_port:CAM_VIPI,v1,s0 | |
[ 20.045528] (4)[293:[email protected]]M4Uconfig_port:CAM_VIP2I,v1,s0 | |
[ 20.045538] (4)[293:[email protected]]M4Uconfig_port:CAM_VIP3I,v1,s0 | |
[ 20.045548] (4)[293:[email protected]]M4Uconfig_port:CAM_LCEI,v1,s0 | |
[ 20.045558] (4)[293:[email protected]]M4Uconfig_port:CAM_RB,v1,s0 | |
[ 20.045567] (4)[293:[email protected]]M4Uconfig_port:CAM_RP,v1,s0 | |
[ 20.045577] (4)[293:[email protected]]M4Uconfig_port:CAM_WR,v1,s0 | |
[ 20.046169] (4)[293:[email protected]][ION] error: cache_map_vm_struct is NULL, retry | |
[ 20.054443] (2)[130:hps_main]MobiCore mcd: Cpu 6 is dead | |
[ 20.055638] (2)[130:hps_main]MobiCore mcd: Cpu 5 is going to die | |
[ 20.057359] (1)[130:hps_main]CPU5: shutdown | |
[ 20.058650] (1)[130:hps_main]MobiCore mcd: Cpu 5 is dead | |
[ 20.059661] (1)[130:hps_main][HPS] (0200)(7)action end(283)(345)(0)(0) (8)(8)(8)(8)(1) (583)(8)(0) (2990)(8)(0) (0)(345)(8)(0)(345) wifi_base(0) | |
[ 20.105642] (2)[279:logd.auditd]type=1400 audit(1556890369.356:35): avc: denied { open } for pid=291 comm="HwBinder:291_1" path="/dev/block/mmcblk0p2" dev="tmpfs" ino=2161 scontext=u:r:hal_audio_default:s0 tcontext=u:object_r:nvram_device:s0 tclass=blk_file permissive=1 | |
[ 20.108744] (2)[279:logd.auditd]type=1400 audit(1556890370.996:36): avc: denied { read write } for pid=293 comm="[email protected]" name="mmcblk0p2" dev="tmpfs" ino=2161 scontext=u:r:hal_camera_default:s0 tcontext=u:object_r:nvram_device:s0 tclass=blk_file permissive=1 | |
[ 20.112793] (2)[279:logd.auditd]type=1400 audit(1556890370.996:36): avc: denied { read write } for pid=293 comm="[email protected]" name="mmcblk0p2" dev="tmpfs" ino=2161 scontext=u:r:hal_camera_default:s0 tcontext=u:object_r:nvram_device:s0 tclass=blk_file permissive=1 | |
[ 20.115829] (2)[279:logd.auditd]type=1400 audit(1556890370.996:37): avc: denied { open } for pid=293 comm="[email protected]" path="/dev/block/mmcblk0p2" dev="tmpfs" ino=2161 scontext=u:r:hal_camera_default:s0 tcontext=u:object_r:nvram_device:s0 tclass=blk_file permissive=1 | |
[ 20.120428] (1)[293:[email protected]][OV13850_camera_sensor] feature_control feature_id = 3080 | |
[ 20.121534] (1)[293:[email protected]][OV13850_camera_sensor] feature_control SENSOR_FEATURE_GET_CROP_INFO scenarioId:0 | |
[ 20.122922] (1)[293:[email protected]][OV13850_camera_sensor] feature_control SENSOR_SET_SENSOR_IHDR LE=0, SE=18176, Gain=0 | |
[ 20.124323] (1)[293:[email protected]][OV13850_camera_sensor] ihdr_write_shutter_gain le:0x0, se:0x4700, gain:0x0 | |
[ 20.125823] (1)[293:[email protected]][OV13850_camera_sensor] feature_control feature_id = 3080 | |
[ 20.126930] (1)[293:[email protected]][OV13850_camera_sensor] feature_control SENSOR_FEATURE_GET_CROP_INFO scenarioId:1 | |
[ 20.128298] (1)[293:[email protected]][OV13850_camera_sensor] feature_control SENSOR_SET_SENSOR_IHDR LE=1, SE=18176, Gain=0 | |
[ 20.129723] (1)[293:[email protected]][OV13850_camera_sensor] ihdr_write_shutter_gain le:0x1, se:0x4700, gain:0x0 | |
[ 20.131164] (1)[293:[email protected]][OV13850_camera_sensor] feature_control feature_id = 3080 | |
[ 20.132262] (1)[293:[email protected]][OV13850_camera_sensor] feature_control SENSOR_FEATURE_GET_CROP_INFO scenarioId:2 | |
[ 20.133639] (1)[293:[email protected]][OV13850_camera_sensor] feature_control SENSOR_SET_SENSOR_IHDR LE=2, SE=18176, Gain=0 | |
[ 20.135052] (1)[293:[email protected]][OV13850_camera_sensor] ihdr_write_shutter_gain le:0x2, se:0x4700, gain:0x0 | |
[ 20.136546] (1)[293:[email protected]][OV13850_camera_sensor] feature_control feature_id = 3080 | |
[ 20.137645] (1)[293:[email protected]][OV13850_camera_sensor] feature_control SENSOR_FEATURE_GET_CROP_INFO scenarioId:3 | |
[ 20.139013] (1)[293:[email protected]][OV13850_camera_sensor] feature_control SENSOR_SET_SENSOR_IHDR LE=3, SE=18176, Gain=0 | |
[ 20.140442] (1)[293:[email protected]][OV13850_camera_sensor] ihdr_write_shutter_gain le:0x3, se:0x4700, gain:0x0 | |
[ 20.141856] (1)[293:[email protected]][OV13850_camera_sensor] feature_control feature_id = 3080 | |
[ 20.142961] (1)[293:[email protected]][OV13850_camera_sensor] feature_control SENSOR_FEATURE_GET_CROP_INFO scenarioId:9 | |
[ 20.144319] (1)[293:[email protected]][OV13850_camera_sensor] feature_control SENSOR_SET_SENSOR_IHDR LE=9, SE=18176, Gain=0 | |
[ 20.145783] (1)[293:[email protected]][OV13850_camera_sensor] ihdr_write_shutter_gain le:0x9, se:0x4700, gain:0x0 | |
[ 20.161373] -(5)[0:swapper/5]__sched_setscheduler 532:F858THREAD sched_priority=-3 | |
[ 20.161714] -(5)[0:swapper/5]CPU5: Booted secondary processor | |
[ 20.161724] -(5)[0:swapper/5]Detected VIPT I-cache on CPU5 | |
[ 20.161859] -(5)[0:swapper/5]CPU5: update cpu_capacity 1024 | |
[ 20.162986] -(6)[0:swapper/6]CPU6: Booted secondary processor | |
[ 20.162994] -(6)[0:swapper/6]Detected VIPT I-cache on CPU6 | |
[ 20.163111] -(6)[0:swapper/6]CPU6: update cpu_capacity 1024 | |
[ 20.164152] -(7)[0:swapper/7]CPU7: Booted secondary processor | |
[ 20.164160] -(7)[0:swapper/7]Detected VIPT I-cache on CPU7 | |
[ 20.164269] -(7)[0:swapper/7]CPU7: update cpu_capacity 1024 | |
[ 20.165011] (2)[130:hps_main][HPS] (0020)(5)action end(543)(2313)(0)(0) (8)(8)(8)(8)(1) (0)(0)(0) (0)(0)(0) (1)(2313)(1)(0)(2313) wifi_base(0) | |
[ 20.232097] (1)[179:ccci_rpc_k][md1]IPC_RPC_DSP_EMI_MPU_SETTING request=1 | |
[ 20.233013] (1)[179:ccci_rpc_k][md1]MPU Start protect DSP region<6:f6a20000:f6b7ffff> b6d0b45 | |
[ 20.363669] (0)[537:main][name:capability&]capability: warning: `main' uses 32-bit capabilities (legacy support in use) | |
[ 20.465161] (2)[130:hps_main][HPS] (0000)(8)DBG_HRT(132)(115)(0)(0) (8)(8)(8)(8)(1) (0)(0)(0) (463)(3)(3) (0)(115)(3)(0)(115) wifi_base(0) | |
[ 20.502781] (3)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 442000 KHz | |
[ 20.566102] (3)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1106mv, freq = 1300000 KHz | |
[ 20.737269] -(0)[0:swapper/0][PMIC] bat_percent_notify_task is called | |
[ 20.738119] (0)[70:bat_percent_not][PMIC] [upmu_get_rgs_chrdet] CHRDET status = 1 | |
[ 20.739103] (0)[70:bat_percent_not][PMIC] bat_per_level=0,bat_per_val=100 | |
[ 20.785787] (0)[67:kworker/0:1][MUSB]do_low_power_timer_monitor_work 77: state:IDLE_STAGE, last:0, balanced<0,0>, usb_state:NO-CDEV | |
[ 20.942673] (4)[279:logd.auditd]type=1400 audit(1556890370.996:37): avc: denied { open } for pid=293 comm="[email protected]" path="/dev/block/mmcblk0p2" dev="tmpfs" ino=2161 scontext=u:r:hal_camera_default:s0 tcontext=u:object_r:nvram_device:s0 tclass=blk_file permissive=1 | |
[ 20.945790] (4)[279:logd.auditd]type=1400 audit(1556890371.836:38): avc: denied { create } for pid=410 comm="main" name="tasks" scontext=u:r:zygote:s0 tcontext=u:object_r:cgroup:s0 tclass=file permissive=1 | |
[ 20.967067] (2)[130:hps_main]MobiCore mcd: Cpu 7 is going to die | |
[ 20.968766] (2)[130:hps_main]CPU7: shutdown | |
[ 20.969788] (2)[130:hps_main]MobiCore mcd: Cpu 7 is dead | |
[ 20.970747] (2)[130:hps_main]MobiCore mcd: Cpu 6 is going to die | |
[ 20.972331] (0)[130:hps_main]CPU6: shutdown | |
[ 20.973356] (0)[130:hps_main]MobiCore mcd: Cpu 6 is dead | |
[ 20.974405] (0)[130:hps_main]MobiCore mcd: Cpu 5 is going to die | |
[ 20.975986] (0)[130:hps_main]CPU5: shutdown | |
[ 20.977002] (0)[130:hps_main]MobiCore mcd: Cpu 5 is dead | |
[ 20.977947] (0)[130:hps_main]MobiCore mcd: Cpu 4 is going to die | |
[ 20.979407] (1)[130:hps_main]CPU4: shutdown | |
[ 20.980629] (1)[130:hps_main]MobiCore mcd: Cpu 4 is dead | |
[ 20.981622] (1)[130:hps_main]MobiCore mcd: Cpu 3 is going to die | |
[ 20.983062] (0)[130:hps_main]CPU3: shutdown | |
[ 20.984208] (0)[130:hps_main]MobiCore mcd: Cpu 3 is dead | |
[ 20.985128] (0)[130:hps_main]MobiCore mcd: Cpu 2 is going to die | |
[ 20.986502] (1)[130:hps_main]CPU2: shutdown | |
[ 20.987658] (1)[130:hps_main]MobiCore mcd: Cpu 2 is dead | |
[ 20.988557] (1)[130:hps_main][HPS] (0200)(8)action end(117)(111)(0)(0) (8)(8)(8)(8)(1) (0)(0)(0) (1084)(8)(0) (0)(111)(8)(0)(111) wifi_base(0) | |
[ 21.045902] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1081mv, freq = 1235000 KHz | |
[ 21.105961] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 819000 KHz | |
[ 21.139333] (1)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1106mv, freq = 1300000 KHz | |
[ 21.225924] (1)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1018mv, freq = 1040000 KHz | |
[ 21.289296] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1081mv, freq = 1235000 KHz | |
[ 21.302593] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1106mv, freq = 1300000 KHz | |
[ 21.484443] (0)[300:[email protected]][LED]Set Backlight directly 102 at time 4294883721, mapping level is 102 | |
[ 21.485711] (0)[300:[email protected]][LED]get_cust_led_dtsi: get the leds info from device tree | |
[ 21.486870] (0)[300:[email protected]][PWM] disp_pwm_set_backlight_cmdq(id = 0x1, level_1024 = 409), old = -1 | |
[ 21.488166] (0)[300:[email protected]][PWM] backlight is on (409), ddp_pwm power:(1) | |
[ 21.990709] (0)[130:hps_main][HPS] (0000)(2)DBG_HRT(127)(132)(0)(0) (8)(8)(8)(8)(1) (310)(10)(0) (1261)(10)(2) (0)(132)(10)(0)(132) wifi_base(0) | |
[ 22.045841] (0)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, mc_open_device failed: 15 | |
[ 22.049458] (0)[306:healthd]healthd: battery l=100 v=0 t=29.0 h=2 st=4 c=0 chg= | |
[ 22.169914] (1)[137:kworker/1:1] | |
[ 22.169914] <<SOC DVFS FLIPER>> flip to E(0), 1059 | |
[ 22.208637] (0)[302:[email protected]]WANGYUFEI IN YULONG ACC_READ_CALIBRATION! | |
[ 22.209800] (0)[302:[email protected]]Use yulong CALI ,tempbuf is 0,0,0,0,0,0,0 Use yulong CALI , offset[BMA250_AXIS_X] = 0 , offset[BMA250_AXIS_Y] = 0, offset[BMA250_AXIS_Z] = 0 | |
[ 22.211686] (0)[302:[email protected]][Gsensor] enable value=0, sensor_power =0 | |
[ 22.212795] (0)[302:[email protected]][Gsensor] Gsensor device have updated! | |
[ 22.215010] (0)[306:healthd]healthd: battery l=100 v=0 t=29.0 h=2 st=4 c=0 chg= | |
[ 22.219350] (0)[302:[email protected]][Gsensor] bma250_enable_nodata OK! | |
[ 22.232471] (0)[302:[email protected]]<ALS/PS> als_store_active buf=0 | |
[ 22.233294] (0)[302:[email protected]]<ALS/PS> ALSPS disable | |
[ 22.234018] (0)[302:[email protected]]<ALS/PS> AAL status is 0 | |
[ 22.234767] (0)[302:[email protected]][ALS/PS] cm36686_obj als enable value = 0 | |
[ 22.235701] (0)[302:[email protected]][ALS/PS] cm36686_enable_als disable_als | |
[ 22.243091] (1)[302:[email protected]][ALS/PS] CM36686_REG_ALS_CONF value value_low = 41, value_high = 0 | |
[ 22.246030] (1)[302:[email protected]]<ALS/PS> alsps real disable | |
[ 22.246807] (1)[302:[email protected]]<ALS/PS> alsps_store_active done | |
[ 22.248073] (1)[302:[email protected]]<ALS/PS> ps_store_active buf=0 | |
[ 22.248882] (1)[302:[email protected]]<ALS/PS> PS disable | |
[ 22.249592] (1)[302:[email protected]][ALS/PS] cm36686_obj als enable value = 0 | |
[ 22.251735] (1)[302:[email protected]][ALS/PS] cm36686_enable_ps disable_ps | |
[ 22.255399] (1)[302:[email protected]][ALS/PS] CM36686_REG_PS_CONF1_2 value value_low = 63, value_high = 8 | |
[ 22.257101] (1)[302:[email protected]]<ALS/PS> ps real disable | |
[ 22.257840] (1)[302:[email protected]]<ALS/PS> ps_store_active done | |
[ 22.292888] -(2)[0:swapper/2]CPU2: Booted secondary processor | |
[ 22.292909] -(2)[0:swapper/2]Detected VIPT I-cache on CPU2 | |
[ 22.293029] -(2)[0:swapper/2]CPU2: update cpu_capacity 1024 | |
[ 22.293613] (1)[130:hps_main][HPS] (0080)(2)action end(195)(706)(0)(0) (8)(8)(8)(8)(1) (391)(13)(1) (1334)(12)(4) (0)(706)(13)(0)(706) wifi_base(0) | |
[ 22.395755] -(3)[0:swapper/3]CPU3: Booted secondary processor | |
[ 22.395779] -(3)[0:swapper/3]Detected VIPT I-cache on CPU3 | |
[ 22.395908] -(3)[0:swapper/3]CPU3: update cpu_capacity 1024 | |
[ 22.396854] -(4)[0:swapper/4]CPU4: Booted secondary processor | |
[ 22.396876] -(4)[0:swapper/4]Detected VIPT I-cache on CPU4 | |
[ 22.397006] -(4)[0:swapper/4]CPU4: update cpu_capacity 1024 | |
[ 22.397799] (3)[130:hps_main][HPS] (0020)(3)action end(296)(416)(0)(0) (8)(8)(8)(8)(1) (0)(0)(0) (0)(0)(0) (1)(416)(1)(0)(416) wifi_base(0) | |
[ 22.470281] (1)[137:kworker/1:1] | |
[ 22.470281] <<SOC DVFS FLIPER>> flip to S(0), 1592 | |
[ 22.510512] (3)[1:init]init: processing action (sys.sysctl.extra_free_kbytes=*) from (/init.rc:697) | |
[ 23.000948] (2)[538:system_server]acc_open | |
[ 23.001518] (2)[538:system_server]acc_release | |
[ 23.231379] (2)[525:gsm0710muxd][md1]ch=12 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 23.236140] (2)[525:gsm0710muxd][md1]ch=12 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 23.237723] (4)[310:ccci_fsd][md1]ch=15 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 23.250347] (0)[1:init]init: no such service 'ril-daemon' | |
[ 23.251847] (3)[1:init]init: service ril-daemon-mtk does not have a SELinux domain defined | |
[ 23.252983] (3)[1:init]init: starting service 'ril-daemon-mtk'... | |
[ 23.264655] (4)[279:logd.auditd]type=1400 audit(1556890371.836:38): avc: denied { create } for pid=410 comm="main" name="tasks" scontext=u:r:zygote:s0 tcontext=u:object_r:cgroup:s0 tclass=file permissive=1 | |
[ 23.267210] (4)[279:logd.auditd]type=1400 audit(1556890374.146:39): avc: denied { execute } for pid=657 comm="init" name="rild" dev="mmcblk0p45" ino=3150 scontext=u:r:init:s0 tcontext=u:object_r:unlabeled:s0 tclass=file permissive=1 | |
[ 23.270485] (4)[279:logd.auditd]type=1400 audit(1556890374.146:39): avc: denied { execute } for pid=657 comm="init" name="rild" dev="mmcblk0p45" ino=3150 scontext=u:r:init:s0 tcontext=u:object_r:unlabeled:s0 tclass=file permissive=1 | |
[ 23.273144] (4)[279:logd.auditd]type=1400 audit(1556890374.146:40): avc: denied { execute_no_trans } for pid=657 comm="init" path="/system/vendor/bin/hw/rild" dev="mmcblk0p45" ino=3150 scontext=u:r:init:s0 tcontext=u:object_r:unlabeled:s0 tclass=file permissive=1 | |
[ 23.341679] (2)[279:logd.auditd]type=1400 audit(1556890374.146:40): avc: denied { execute_no_trans } for pid=657 comm="init" path="/system/vendor/bin/hw/rild" dev="mmcblk0p45" ino=3150 scontext=u:r:init:s0 tcontext=u:object_r:unlabeled:s0 tclass=file permissive=1 | |
[ 23.344703] (2)[279:logd.auditd]type=1400 audit(1556890374.233:41): avc: granted { open } for pid=657 comm="rild" path="/dev/pmsg0" dev="tmpfs" ino=2119 scontext=u:r:init:s0 tcontext=u:object_r:pmsg_device:s0 tclass=chr_file | |
[ 23.347400] (2)[279:logd.auditd]type=1400 audit(1556890374.233:41): avc: granted { open } for pid=657 comm="rild" path="/dev/pmsg0" dev="tmpfs" ino=2119 scontext=u:r:init:s0 tcontext=u:object_r:pmsg_device:s0 tclass=chr_file | |
[ 23.349974] (2)[279:logd.auditd]type=1400 audit(1556890374.236:42): avc: denied { write } for pid=657 comm="rild" name="property_service" dev="tmpfs" ino=458 scontext=u:r:init:s0 tcontext=u:object_r:property_socket:s0 tclass=sock_file permissive=1 | |
[ 23.352927] (2)[279:logd.auditd]type=1400 audit(1556890374.236:42): avc: denied { write } for pid=657 comm="rild" name="property_service" dev="tmpfs" ino=458 scontext=u:r:init:s0 tcontext=u:object_r:property_socket:s0 tclass=sock_file permissive=1 | |
[ 23.355769] (2)[279:logd.auditd]type=1400 audit(1556890374.239:43): avc: denied { call } for pid=657 comm="rild" scontext=u:r:init:s0 tcontext=u:r:hwservicemanager:s0 tclass=binder permissive=1 | |
[ 23.358150] (2)[279:logd.auditd]type=1400 audit(1556890374.239:43): avc: denied { call } for pid=657 comm="rild" scontext=u:r:init:s0 tcontext=u:r:hwservicemanager:s0 tclass=binder permissive=1 | |
[ 23.360553] (2)[279:logd.auditd]type=1400 audit(1556890374.243:44): avc: denied { transfer } for pid=657 comm="rild" scontext=u:r:init:s0 tcontext=u:r:hwservicemanager:s0 tclass=binder permissive=1 | |
[ 23.363035] (2)[279:logd.auditd]type=1400 audit(1556890374.243:44): avc: denied { transfer } for pid=657 comm="rild" scontext=u:r:init:s0 tcontext=u:r:hwservicemanager:s0 tclass=binder permissive=1 | |
[ 23.365287] (2)[279:logd.auditd]type=1400 audit(1556890374.243:45): avc: denied { search } for pid=271 comm="hwservicemanage" name="657" dev="proc" ino=1366 scontext=u:r:hwservicemanager:s0 tcontext=u:r:init:s0 tclass=dir permissive=1 | |
[ 23.369048] (2)[279:logd.auditd]type=1400 audit(1556890374.243:45): avc: denied { search } for pid=271 comm="hwservicemanage" name="657" dev="proc" ino=1366 scontext=u:r:hwservicemanager:s0 tcontext=u:r:init:s0 tclass=dir permissive=1 | |
[ 23.371727] (2)[279:logd.auditd]type=1400 audit(1556890374.243:46): avc: denied { read } for pid=271 comm="hwservicemanage" name="current" dev="proc" ino=11049 scontext=u:r:hwservicemanager:s0 tcontext=u:r:init:s0 tclass=file permissive=1 | |
[ 23.374555] (2)[279:logd.auditd]type=1400 audit(1556890374.243:46): avc: denied { read } for pid=271 comm="hwservicemanage" name="current" dev="proc" ino=11049 scontext=u:r:hwservicemanager:s0 tcontext=u:r:init:s0 tclass=file permissive=1 | |
[ 23.377314] (2)[279:logd.auditd]type=1400 audit(1556890374.243:47): avc: denied { open } for pid=271 comm="hwservicemanage" path="/proc/657/attr/current" dev="proc" ino=11049 scontext=u:r:hwservicemanager:s0 tcontext=u:r:init:s0 tclass=file permissive=1 | |
[ 23.380319] (2)[279:logd.auditd]type=1400 audit(1556890374.243:47): avc: denied { open } for pid=271 comm="hwservicemanage" path="/proc/657/attr/current" dev="proc" ino=11049 scontext=u:r:hwservicemanager:s0 tcontext=u:r:init:s0 tclass=file permissive=1 | |
[ 23.383211] (2)[279:logd.auditd]type=1400 audit(1556890374.243:48): avc: denied { getattr } for pid=271 comm="hwservicemanage" scontext=u:r:hwservicemanager:s0 tcontext=u:r:init:s0 tclass=process permissive=1 | |
[ 23.385840] (2)[279:logd.auditd]type=1400 audit(1556890374.243:48): avc: denied { getattr } for pid=271 comm="hwservicemanage" scontext=u:r:hwservicemanager:s0 tcontext=u:r:init:s0 tclass=process permissive=1 | |
[ 23.388200] (2)[279:logd.auditd]type=1400 audit(1556890374.243:49): avc: denied { call } for pid=271 comm="hwservicemanage" scontext=u:r:hwservicemanager:s0 tcontext=u:r:init:s0 tclass=binder permissive=1 | |
[ 23.390695] (2)[279:logd.auditd]type=1400 audit(1556890374.243:49): avc: denied { call } for pid=271 comm="hwservicemanage" scontext=u:r:hwservicemanager:s0 tcontext=u:r:init:s0 tclass=binder permissive=1 | |
[ 23.393102] (2)[279:logd.auditd]type=1400 audit(1556890374.249:50): avc: denied { write } for pid=657 comm="rild" name="property_service" dev="tmpfs" ino=458 scontext=u:r:init:s0 tcontext=u:object_r:property_socket:s0 tclass=sock_file permissive=1 | |
[ 23.396061] (2)[279:logd.auditd]type=1400 audit(1556890374.249:50): avc: denied { write } for pid=657 comm="rild" name="property_service" dev="tmpfs" ino=458 scontext=u:r:init:s0 tcontext=u:object_r:property_socket:s0 tclass=sock_file permissive=1 | |
[ 23.398847] (2)[279:logd.auditd]type=1400 audit(1556890374.253:51): avc: denied { block_suspend } for pid=657 comm="rild" capability=36 scontext=u:r:init:s0 tcontext=u:r:init:s0 tclass=capability2 permissive=1 | |
[ 23.500201] (1)[130:hps_main]MobiCore mcd: Cpu 4 is going to die | |
[ 23.501712] (1)[130:hps_main]CPU4: shutdown | |
[ 23.502832] (1)[130:hps_main]MobiCore mcd: Cpu 4 is dead | |
[ 23.503759] (1)[130:hps_main][HPS] (0200)(5)action end(125)(124)(0)(0) (8)(8)(8)(8)(1) (442)(11)(1) (2509)(11)(3) (0)(124)(11)(0)(124) wifi_base(0) | |
[ 23.505446] (1)[130:hps_main][HPS] (0200)(5)DBG_HRT(125)(124)(0)(0) (8)(8)(8)(8)(1) (0)(0)(0) (0)(0)(0) (0)(0)(0)(0)(124) wifi_base(0) | |
[ 23.604850] -(0)[0:swapper/0][Power/swap]DP: No enter --- SODI: No enter --- | |
[ 23.650931] (0)[310:ccci_fsd][md1]ch=15 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 23.652358] (0)[652:gsm0710muxd][md1]ch=12 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 23.678509] (3)[652:gsm0710muxd][md1]ch=12 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 23.697133] (2)[681:rild][md1]port ccci_ioctl1 open with flag 20802 by rild | |
[ 23.697175] (1)[279:logd.auditd]type=1400 audit(1556890374.253:51): avc: denied { block_suspend } for pid=657 comm="rild" capability=36 scontext=u:r:init:s0 tcontext=u:r:init:s0 tclass=capability2 permissive=1 | |
[ 23.697186] (1)[279:logd.auditd]type=1400 audit(1556890374.589:52): avc: granted { read } for pid=657 comm="rild" name="ccci_ioctl1" dev="tmpfs" ino=511 scontext=u:r:init:s0 tcontext=u:object_r:ccci_device:s0 tclass=chr_file | |
[ 23.697293] (1)[279:logd.auditd]type=1400 audit(1556890374.589:52): avc: granted { read } for pid=657 comm="rild" name="ccci_ioctl1" dev="tmpfs" ino=511 scontext=u:r:init:s0 tcontext=u:object_r:ccci_device:s0 tclass=chr_file | |
[ 23.697301] (1)[279:logd.auditd]type=1400 audit(1556890374.589:53): avc: granted { read open } for pid=657 comm="rild" path="/dev/ccci_ioctl1" dev="tmpfs" ino=511 scontext=u:r:init:s0 tcontext=u:object_r:ccci_device:s0 tclass=chr_file | |
[ 23.708392] (2)[681:rild][md1]port ccci_ioctl1 close rx_len=0 empty=1 | |
[ 23.709247] (2)[681:rild][md1]dev close check: 1 1 0 0 | |
[ 23.729229] (3)[652:gsm0710muxd][md1]ch=12 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 23.792465] (0)[67:kworker/0:1][MUSB]do_low_power_timer_monitor_work 77: state:IDLE_STAGE, last:0, balanced<0,0>, usb_state:NO-CDEV | |
[ 24.049142] (0)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, mc_open_device failed: 15 | |
[ 24.307452] (1)[130:hps_main]MobiCore mcd: Cpu 3 is going to die | |
[ 24.308889] (1)[130:hps_main]CPU3: shutdown | |
[ 24.310043] (1)[130:hps_main]MobiCore mcd: Cpu 3 is dead | |
[ 24.310993] (1)[130:hps_main]MobiCore mcd: Cpu 2 is going to die | |
[ 24.312366] (0)[130:hps_main]CPU2: shutdown | |
[ 24.313460] (0)[130:hps_main]MobiCore mcd: Cpu 2 is dead | |
[ 24.314359] (0)[130:hps_main][HPS] (0200)(4)action end(124)(125)(0)(0) (8)(8)(8)(8)(1) (264)(8)(0) (1087)(8)(0) (0)(125)(8)(0)(125) wifi_base(0) | |
[ 24.447468] (1)[646:gsm0710muxd][md1]ch=12 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 24.448619] (1)[310:ccci_fsd][md1]ch=15 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 24.457011] (1)[646:gsm0710muxd][md1]ch=12 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 24.488536] (1)[646:gsm0710muxd][md1]ch=12 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 24.496946] (0)[681:rild][md1]port ccci_ioctl1 open with flag 20802 by rild | |
[ 24.497897] (0)[681:rild][md1]port ccci_ioctl1 close rx_len=0 empty=1 | |
[ 24.498733] (0)[681:rild][md1]dev close check: 1 1 0 0 | |
[ 24.500568] (0)[279:logd.auditd]type=1400 audit(1556890374.589:53): avc: granted { read open } for pid=657 comm="rild" path="/dev/ccci_ioctl1" dev="tmpfs" ino=511 scontext=u:r:init:s0 tcontext=u:object_r:ccci_device:s0 tclass=chr_file | |
[ 24.503265] (0)[279:logd.auditd]type=1400 audit(1556890375.389:54): avc: granted { read } for pid=657 comm="rild" name="ccci_ioctl1" dev="tmpfs" ino=511 scontext=u:r:init:s0 tcontext=u:object_r:ccci_device:s0 tclass=chr_file | |
[ 24.505975] (0)[279:logd.auditd]type=1400 audit(1556890375.389:54): avc: granted { read } for pid=657 comm="rild" name="ccci_ioctl1" dev="tmpfs" ino=511 scontext=u:r:init:s0 tcontext=u:object_r:ccci_device:s0 tclass=chr_file | |
[ 24.508584] (0)[279:logd.auditd]type=1400 audit(1556890375.389:55): avc: granted { read open } for pid=657 comm="rild" path="/dev/ccci_ioctl1" dev="tmpfs" ino=511 scontext=u:r:init:s0 tcontext=u:object_r:ccci_device:s0 tclass=chr_file | |
[ 24.530919] (0)[646:gsm0710muxd][md1]ch=12 qno=1 free slot 0, CLDMA_AP_L2TIMR0=0xff00ff02 | |
[ 25.016406] (1)[130:hps_main][HPS] (0000)(2)DBG_HRT(119)(123)(0)(0) (8)(8)(8)(8)(1) (242)(7)(1) (910)(7)(7) (0)(123)(7)(0)(123) wifi_base(0) | |
[ 25.055914] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1018mv, freq = 1040000 KHz | |
[ 25.065980] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1106mv, freq = 1300000 KHz | |
[ 25.273427] (1)[137:kworker/1:1] | |
[ 25.273427] <<SOC DVFS FLIPER>> flip to E(0), 1192 | |
[ 25.318549] -(2)[0:swapper/2]CPU2: Booted secondary processor | |
[ 25.318570] -(2)[0:swapper/2]Detected VIPT I-cache on CPU2 | |
[ 25.318691] -(2)[0:swapper/2]CPU2: update cpu_capacity 1024 | |
[ 25.319319] (0)[130:hps_main][HPS] (0080)(2)action end(194)(387)(0)(0) (8)(8)(8)(8)(1) (385)(10)(0) (1096)(9)(1) (0)(387)(10)(0)(387) wifi_base(0) | |
[ 25.421402] -(3)[0:swapper/3]CPU3: Booted secondary processor | |
[ 25.421426] -(3)[0:swapper/3]Detected VIPT I-cache on CPU3 | |
[ 25.421578] -(3)[0:swapper/3]CPU3: update cpu_capacity 1024 | |
[ 25.422536] -(4)[0:swapper/4]CPU4: Booted secondary processor | |
[ 25.422559] -(4)[0:swapper/4]Detected VIPT I-cache on CPU4 | |
[ 25.422694] -(4)[0:swapper/4]CPU4: update cpu_capacity 1024 | |
[ 25.423922] -(5)[0:swapper/5]CPU5: Booted secondary processor | |
[ 25.423950] -(5)[0:swapper/5]Detected VIPT I-cache on CPU5 | |
[ 25.424111] -(5)[0:swapper/5]CPU5: update cpu_capacity 1024 | |
[ 25.425667] -(6)[0:swapper/6]CPU6: Booted secondary processor | |
[ 25.425694] -(6)[0:swapper/6]Detected VIPT I-cache on CPU6 | |
[ 25.425871] -(6)[0:swapper/6]CPU6: update cpu_capacity 1024 | |
[ 25.427399] -(7)[0:swapper/7]CPU7: Booted secondary processor | |
[ 25.427431] -(7)[0:swapper/7]Detected VIPT I-cache on CPU7 | |
[ 25.427595] -(7)[0:swapper/7]CPU7: update cpu_capacity 1024 | |
[ 25.428625] (0)[130:hps_main][HPS] (0020)(3)action end(298)(999)(0)(0) (8)(8)(8)(8)(1) (0)(0)(0) (0)(0)(0) (1)(999)(1)(0)(999) wifi_base(0) | |
[ 25.473602] (1)[137:kworker/1:1] | |
[ 25.473602] <<SOC DVFS FLIPER>> flip to S(0), 2424 | |
[ 25.508706] (2)[1:init]init: starting service 'webview_zygote32'... | |
[ 25.515984] (4)[798:init]init: Created socket '/dev/socket/webview_zygote', mode 660, user 1053, group 1000 | |
[ 25.521367] (3)[782:sdcard]sdcardfs version 2.0 | |
[ 25.521989] (3)[782:sdcard]sdcardfs: dev_name -> /data/media | |
[ 25.522798] (3)[782:sdcard]sdcardfs: options -> fsuid=1023,fsgid=1023,multiuser,derive_gid,mask=6,userid=0,gid=1015 | |
[ 25.524152] (3)[782:sdcard]sdcardfs: mnt -> ffffffc082a83020 | |
[ 25.524968] (3)[782:sdcard]sdcardfs: mounted on top of /data/media type ext4 | |
[ 25.526467] (3)[782:sdcard]SELinux: initialized (dev sdcardfs, type sdcardfs), uses genfs_contexts | |
[ 25.526840] (3)[782:sdcard]Remount options were mask=23,gid=9997 for vfsmnt ffffffc082a83ca0. | |
[ 25.527985] (3)[782:sdcard]sdcardfs : options - debug:1 | |
[ 25.528672] (3)[782:sdcard]sdcardfs : options - gid:9997 | |
[ 25.529406] (3)[782:sdcard]sdcardfs : options - mask:23 | |
[ 25.530294] (3)[782:sdcard]Remount options were mask=7,gid=9997 for vfsmnt ffffffc082a82520. | |
[ 25.531923] (0)[782:sdcard]sdcardfs : options - debug:1 | |
[ 25.532657] (0)[782:sdcard]sdcardfs : options - gid:9997 | |
[ 25.533627] (0)[782:sdcard]sdcardfs : options - mask:7 | |
[ 25.596253] (0)[279:logd.auditd]type=1400 audit(1556890375.389:55): avc: granted { read open } for pid=657 comm="rild" path="/dev/ccci_ioctl1" dev="tmpfs" ino=511 scontext=u:r:init:s0 tcontext=u:object_r:ccci_device:s0 tclass=chr_file | |
[ 25.599206] (0)[279:logd.auditd]type=1400 audit(1556890376.489:56): avc: denied { write } for pid=657 comm="rild" name="property_service" dev="tmpfs" ino=458 scontext=u:r:init:s0 tcontext=u:object_r:property_socket:s0 tclass=sock_file permissive=1 | |
[ 25.602897] (0)[279:logd.auditd]type=1400 audit(1556890376.489:56): avc: denied { write } for pid=657 comm="rild" name="property_service" dev="tmpfs" ino=458 scontext=u:r:init:s0 tcontext=u:object_r:property_socket:s0 tclass=sock_file permissive=1 | |
[ 25.606291] (0)[279:logd.auditd]type=1400 audit(1556890376.489:57): avc: denied { block_suspend } for pid=657 comm="rild" capability=36 scontext=u:r:init:s0 tcontext=u:r:init:s0 tclass=capability2 permissive=1 | |
[ 25.690661] (1)[305:android.hardwar][HIF-SDIO][I]mtk_wcn_wmt_func_ctrl:wmt-exp: OPID(3) type(3) start | |
[ 25.712537] (3)[321:mtk_wmtd][WMT-CORE][E]opfunc_func_on(1213):not implemented yet hifType: 0x2, unspecified wifi_hif | |
[ 25.713916] (3)[321:mtk_wmtd][WMT-FUNC][W]wmt_func_wifi_on:WMT-FUNC: wmt wlan func on before wlan probe | |
[ 25.715150] (3)[321:mtk_wmtd]vcn33_wifi: unsupportable voltage range: 3300000-3300uV | |
[ 25.716205] (3)[321:mtk_wmtd][PMIC] [PMIC]regulator_is_enabled(name=VCN33_WIFI id=0 en_reg=53b vol_reg=63d en=0) | |
[ 25.717532] (3)[321:mtk_wmtd][PMIC] regulator_enable(name=VCN33_WIFI id=0 en_reg=53b vol_reg=63d) [a12]=0x2 | |
[ 26.052487] (2)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, mc_open_device failed: 15 | |
[ 26.100356] (3)[798:webview_zygote3]Dump cpuinfo | |
[ 26.171385] (1)[313:wmt_launcher][WMT-PLAT][E]wmt_plat_set_dbg_mode(1764):fw dbg mode register value(0x00000000) | |
[ 26.195910] (6)[528:HwBinder:291_3]Handset_PGA_Set(), index = 8 | |
[ 26.205111] (0)[931:writer]Audio_I2S0dl1_hdoutput_Set() | |
[ 26.207536] (0)[931:writer]mtk_pcm_I2S0dl1_prepare format = 10 SNDRV_PCM_FORMAT_S32_LE = 10 SNDRV_PCM_FORMAT_U32_LE = 12 | |
[ 26.208960] (0)[931:writer]mtk_pcm_I2S0dl1_prepare mI2S0dl1_hdoutput_control == 1 | |
[ 26.209982] (0)[931:writer]EnableApll2 bEnable = 1 | |
[ 26.210704] (0)[931:writer]SetI2SDacOut SampleRate 48000, lowjitter 1, I2SWLen 1 | |
[ 26.211679] (0)[931:writer]SetI2SDacEnable bEnable = 1 | |
[ 26.212746] (0)[931:writer]Voice_Amp_Set() | |
[ 26.213312] (0)[931:writer]Voice_Amp_Change | |
[ 26.214268] (0)[931:writer]ApplyDLNewIFFrequency with frequency = 48000 | |
[ 26.214918] (0)[931:writer]ApplyDLNewIFFrequency with frequency = 48000<4>[ 26.215849] (0)[931:writer]Voice_Amp_Change on amp | |
[ 26.217615] (0)[931:writer]Handset_PGA_Set(), index = 8 | |
[ 26.218494] (0)[931:writer]Audio_Irqcnt1_Get | |
[ 26.219130] (0)[931:writer]Audio_Irqcnt1_Set() | |
[ 26.220706] -(0)[931:writer]mtk_pcm_I2S0dl1_start | |
[ 26.531162] (0)[130:hps_main][HPS] (0000)(8)DBG_HRT(786)(1149)(0)(0) (8)(8)(8)(8)(1) (0)(0)(0) (5438)(11)(3) (1)(1149)(11)(0)(1149) wifi_base(0) | |
[ 26.533116] (0)[279:logd.auditd]type=1400 audit(1556890376.489:57): avc: denied { block_suspend } for pid=657 comm="rild" capability=36 scontext=u:r:init:s0 tcontext=u:r:init:s0 tclass=capability2 permissive=1 | |
[ 26.535638] (0)[279:logd.auditd]type=1400 audit(1556890377.423:58): avc: denied { call } for pid=908 comm="m.android.phone" scontext=u:r:radio:s0 tcontext=u:r:init:s0 tclass=binder permissive=1 | |
[ 26.538617] (0)[279:logd.auditd]type=1400 audit(1556890377.423:58): avc: denied { call } for pid=908 comm="m.android.phone" scontext=u:r:radio:s0 tcontext=u:r:init:s0 tclass=binder permissive=1 | |
[ 26.540983] (0)[279:logd.auditd]type=1400 audit(1556890377.426:59): avc: denied { transfer } for pid=908 comm="m.android.phone" scontext=u:r:radio:s0 tcontext=u:r:init:s0 tclass=binder permissive=1 | |
[ 26.799114] (0)[67:kworker/0:1][MUSB]do_low_power_timer_monitor_work 77: state:IDLE_STAGE, last:0, balanced<0,0>, usb_state:NO-CDEV | |
[ 26.847896] (4)[1033:initCamdevice][OV13850_camera_sensor] feature_control feature_id = 3003 | |
[ 26.847997] (5)[293:[email protected]]M4Uconfig_port:CAM_IMGO,v1,s0 | |
[ 26.848010] (5)[293:[email protected]]M4Uconfig_port:CAM_RRZO,v1,s0 | |
[ 26.848020] (5)[293:[email protected]]M4Uconfig_port:CAM_AAO,v1,s0 | |
[ 26.848030] (5)[293:[email protected]]M4Uconfig_port:CAM_ESFKO,v1,s0 | |
[ 26.848040] (5)[293:[email protected]]M4Uconfig_port:CAM_IMGO_S,v1,s0 | |
[ 26.848049] (5)[293:[email protected]]M4Uconfig_port:CAM_LSCI,v1,s0 | |
[ 26.848060] (5)[293:[email protected]]M4Uconfig_port:CAM_LSCI_D,v1,s0 | |
[ 26.848069] (5)[293:[email protected]]M4Uconfig_port:CAM_BPCI,v1,s0 | |
[ 26.848079] (5)[293:[email protected]]M4Uconfig_port:CAM_BPCI_D,v1,s0 | |
[ 26.848089] (5)[293:[email protected]]M4Uconfig_port:CAM_UFDI,v1,s0 | |
[ 26.848098] (5)[293:[email protected]]M4Uconfig_port:CAM_IMGI,v1,s0 | |
[ 26.848108] (5)[293:[email protected]]M4Uconfig_port:CAM_IMG2O,v1,s0 | |
[ 26.848118] (5)[293:[email protected]]M4Uconfig_port:CAM_IMG3O,v1,s0 | |
[ 26.848127] (5)[293:[email protected]]M4Uconfig_port:CAM_VIPI,v1,s0 | |
[ 26.848137] (5)[293:[email protected]]M4Uconfig_port:CAM_VIP2I,v1,s0 | |
[ 26.848147] (5)[293:[email protected]]M4Uconfig_port:CAM_VIP3I,v1,s0 | |
[ 26.848156] (5)[293:[email protected]]M4Uconfig_port:CAM_LCEI,v1,s0 | |
[ 26.848166] (5)[293:[email protected]]M4Uconfig_port:CAM_RB,v1,s0 | |
[ 26.848175] (5)[293:[email protected]]M4Uconfig_port:CAM_RP,v1,s0 | |
[ 26.848184] (5)[293:[email protected]]M4Uconfig_port:CAM_WR,v1,s0 | |
[ 26.865133] (4)[1033:initCamdevice][OV13850_camera_sensor] feature_control feature_Control imgsensor.pclk = 0,imgsensor.current_fps = 0 | |
[ 26.866756] (4)[1033:initCamdevice][OV13850_camera_sensor] feature_control feature_id = 3002 | |
[ 26.868508] (4)[1033:initCamdevice][DUAL_CAMERA_MAIN_SENSOR] on = 1 | |
[ 26.869411] (4)[1033:initCamdevice][camdebug] ov13850 poweron | |
[ 26.870168] (4)[1033:initCamdevice]PinIdx(1) PwrType(1) val(0) | |
[ 26.870972] (4)[1033:initCamdevice][kd_camera_hw]PinIdx(1) PwrType(1) val(0) | |
[ 26.871887] (4)[1033:initCamdevice]PinIdx(0) PwrType(1) val(0) | |
[ 26.872691] (4)[1033:initCamdevice][kd_camera_hw]PinIdx(0) PwrType(1) val(0) | |
[ 26.873616] (4)[1033:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMIO id=0 en_reg=600 vol_reg=672 en=0) | |
[ 26.874960] (4)[1033:initCamdevice][PMIC] regulator_enable(name=VCAMIO id=0 en_reg=600 vol_reg=672) [a3e]=0x8102 | |
[ 26.877645] (4)[1033:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMA id=0 en_reg=520 vol_reg=63a en=0) | |
[ 26.878978] (4)[1033:initCamdevice][PMIC] regulator_enable(name=VCAMA id=0 en_reg=520 vol_reg=63a) [a0c]=0x8102 | |
[ 26.881721] (7)[1033:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMD id=0 en_reg=5f6 vol_reg=666 en=0) | |
[ 26.883135] (7)[1033:initCamdevice][PMIC] regulator_enable(name=VCAMD id=0 en_reg=5f6 vol_reg=666) [a3c]=0x8102 | |
[ 26.886861] (7)[1033:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMAF id=0 en_reg=598 vol_reg=656 en=0) | |
[ 26.888229] (7)[1033:initCamdevice][PMIC] regulator_enable(name=VCAMAF id=0 en_reg=598 vol_reg=656) [a2a]=0x8122 | |
[ 26.894975] (7)[1033:initCamdevice]PinIdx(0) PwrType(1) val(1) | |
[ 26.895779] (7)[1033:initCamdevice][kd_camera_hw]PinIdx(0) PwrType(1) val(1) | |
[ 26.898749] (0)[285:vold]FAT-fs (mmcblk1p1): Volume was not properly unmounted. Some data may be corrupt. Please run fsck. | |
[ 26.900422] (0)[285:vold]SELinux: initialized (dev mmcblk1p1, type vfat), uses genfs_contexts | |
[ 26.903596] (6)[1033:initCamdevice]__sched_setscheduler 1035:F858THREAD sched_priority=-3 | |
[ 26.916707] (6)[1033:initCamdevice][OV13850_camera_sensor] open OV13850,MIPI 4LANE | |
[ 26.917704] (6)[1033:initCamdevice][OV13850_camera_sensor] open preview 2096*1552@30fps,640Mbps/lane; video 4192*3104@30fps,1.2Gbps/lane; capture 13M@30fps,1.2Gbps/lane | |
[ 26.920012] (6)[1033:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 26.920267] (2)[1037:sdcard]sdcardfs version 2.0 | |
[ 26.920270] (2)[1037:sdcard]sdcardfs: dev_name -> /mnt/media_rw/0403-0201 | |
[ 26.920273] (2)[1037:sdcard]sdcardfs: options -> fsuid=1023,fsgid=1023,mask=6,userid=0,gid=1015 | |
[ 26.920277] (2)[1037:sdcard]sdcardfs: mnt -> ffffffc0845fbb60 | |
[ 26.920333] (2)[1037:sdcard]sdcardfs: mounted on top of /mnt/media_rw/0403-0201 type vfat | |
[ 26.920348] (2)[1037:sdcard]SELinux: initialized (dev sdcardfs, type sdcardfs), uses genfs_contexts | |
[ 26.920592] (2)[1037:sdcard]Remount options were mask=18,gid=9997 for vfsmnt ffffffc08296fca0. | |
[ 26.920599] (2)[1037:sdcard]sdcardfs : options - debug:1 | |
[ 26.920602] (2)[1037:sdcard]sdcardfs : options - gid:9997 | |
[ 26.920604] (2)[1037:sdcard]sdcardfs : options - mask:18 | |
[ 26.920732] (2)[1037:sdcard]Remount options were mask=18,gid=9997 for vfsmnt ffffffc07d0427a0. | |
[ 26.920737] (2)[1037:sdcard]sdcardfs : options - debug:1 | |
[ 26.920740] (2)[1037:sdcard]sdcardfs : options - gid:9997 | |
[ 26.920743] (2)[1037:sdcard]sdcardfs : options - mask:18 | |
[ 26.931881] (6)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 26.932591] (6)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 26.933476] (6)[1033:initCamdevice]I2C structure: | |
[ 26.933476] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 26.933476] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 26.933476] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 26.936793] (6)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 26.937606] (6)[1033:initCamdevice]I2C register: | |
[ 26.937606] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 26.937606] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 26.937606] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 26.941186] (6)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 26.941186] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 26.941186] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 26.941186] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 26.944222] (6)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 26.944222] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 26.944222] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 26.944222] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 26.947260] (6)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 26.948231] (6)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 26.949373] (6)[1033:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 26.950274] (6)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 26.950978] (6)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 26.951873] (6)[1033:initCamdevice]I2C structure: | |
[ 26.951873] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 26.951873] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 26.951873] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 26.955211] (4)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 26.956043] (4)[1033:initCamdevice]I2C register: | |
[ 26.956043] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 26.956043] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 26.956043] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 26.959642] (4)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 26.959642] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 26.959642] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 26.959642] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 26.962680] (4)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 26.962680] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 26.962680] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 26.962680] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 26.965707] (4)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 26.966724] (4)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 26.967859] (4)[1033:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 26.968782] (4)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 26.969509] (4)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 26.970397] (4)[1033:initCamdevice]I2C structure: | |
[ 26.970397] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 26.970397] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 26.970397] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 26.973716] (4)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 26.974528] (4)[1033:initCamdevice]I2C register: | |
[ 26.974528] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 26.974528] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 26.974528] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 26.978148] (4)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 26.978148] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 26.978148] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 26.978148] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 26.981182] (4)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 26.981182] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 26.981182] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 26.981182] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 26.984212] (4)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 26.985186] (4)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 26.986325] (4)[1033:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 26.987227] (4)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 26.987931] (4)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 26.988825] (4)[1033:initCamdevice]I2C structure: | |
[ 26.988825] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 26.988825] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 26.988825] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 26.992148] (4)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 26.992968] (4)[1033:initCamdevice]I2C register: | |
[ 26.992968] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 26.992968] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 26.992968] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 26.996554] (4)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 26.996554] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 26.996554] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 26.996554] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 26.999580] (4)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 26.999580] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 26.999580] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 26.999580] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.002610] (4)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.003583] (4)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.004555] (4)[1033:initCamdevice][OV13850_camera_sensor] open Read sensor id fail, write id: 0x20, id: 0x0 | |
[ 27.005991] (4)[1033:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 27.006892] (4)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.007597] (4)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.008491] (4)[1033:initCamdevice]I2C structure: | |
[ 27.008491] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.008491] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.008491] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.011816] (4)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.012635] (4)[1033:initCamdevice]I2C register: | |
[ 27.012635] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.012635] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.012635] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.016216] (4)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.016216] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.016216] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.016216] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.019240] (4)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.019240] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.019240] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.019240] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.022261] (4)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.023249] (4)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.024376] (4)[1033:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 27.025275] (4)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.025991] (4)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.026874] (4)[1033:initCamdevice]I2C structure: | |
[ 27.026874] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.026874] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.026874] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.030186] (4)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.030998] (4)[1033:initCamdevice]I2C register: | |
[ 27.030998] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.030998] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.030998] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.033194] (1)[130:hps_main]MobiCore mcd: Cpu 7 is going to die | |
[ 27.035685] (4)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.035685] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.035685] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.035685] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.035707] (1)[130:hps_main]CPU7: shutdown | |
[ 27.036283] (1)[130:hps_main]MobiCore mcd: Cpu 7 is dead | |
[ 27.036536] (1)[130:hps_main][HPS] (0200)(8)action end(226)(230)(0)(0) (8)(8)(8)(8)(1) (0)(0)(0) (4528)(16)(0) (0)(230)(16)(0)(230) wifi_base(0) | |
[ 27.041633] (4)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.041633] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.041633] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.041633] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.044663] (4)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.045634] (4)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.046773] (4)[1033:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 27.047673] (4)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.048378] (4)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.049283] (4)[1033:initCamdevice]I2C structure: | |
[ 27.049283] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.049283] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.049283] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.052594] (4)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.053408] (4)[1033:initCamdevice]I2C register: | |
[ 27.053408] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.053408] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.053408] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.057010] (4)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.057010] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.057010] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.057010] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.060038] (4)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.060038] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.060038] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.060038] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.063067] (4)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.064042] (4)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.065176] (5)[1033:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 27.066097] (5)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.066790] (5)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.067684] (5)[1033:initCamdevice]I2C structure: | |
[ 27.067684] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.067684] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.067684] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.071021] (5)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.071835] (5)[1033:initCamdevice]I2C register: | |
[ 27.071835] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.071835] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.071835] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.075419] (5)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.075419] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.075419] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.075419] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.078450] (5)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.078450] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.078450] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.078450] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.081485] (5)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.082501] (6)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.083478] (6)[1033:initCamdevice][OV13850_camera_sensor] open Read sensor id fail, write id: 0x20, id: 0x0 | |
[ 27.084907] (6)[1033:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 27.085826] (6)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.086519] (6)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.087413] (6)[1033:initCamdevice]I2C structure: | |
[ 27.087413] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.087413] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.087413] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.090727] (6)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.091538] (6)[1033:initCamdevice]I2C register: | |
[ 27.091538] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.091538] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.091538] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.095135] (6)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.095135] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.095135] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.095135] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.098166] (6)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.098166] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.098166] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.098166] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.101198] (6)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.102170] (6)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.103301] (6)[1033:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 27.104202] (6)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.104906] (6)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.105821] (6)[1033:initCamdevice]I2C structure: | |
[ 27.105821] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.105821] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.105821] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.109139] (6)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.109950] (6)[1033:initCamdevice]I2C register: | |
[ 27.109950] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.109950] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.109950] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.113535] (6)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.113535] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.113535] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.113535] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.116560] (6)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.116560] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.116560] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.116560] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.119595] (6)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.120566] (6)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.121696] (6)[1033:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 27.122609] (6)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.123302] (6)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.124196] (6)[1033:initCamdevice]I2C structure: | |
[ 27.124196] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.124196] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.124196] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.127508] (6)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.128321] (6)[1033:initCamdevice]I2C register: | |
[ 27.128321] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.128321] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.128321] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.131895] (6)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.131895] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.131895] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.131895] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.134924] (6)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.134924] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.134924] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.134924] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.137952] (6)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.138924] (6)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.140066] (6)[1033:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 27.140969] (6)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.141674] (6)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.142578] (6)[1033:initCamdevice]I2C structure: | |
[ 27.142578] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.142578] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.142578] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.145889] (6)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.146702] (6)[1033:initCamdevice]I2C register: | |
[ 27.146702] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.146702] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.146702] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.150277] (6)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.150277] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.150277] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.150277] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.153304] (6)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.153304] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.153304] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.153304] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.156332] (6)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.157304] (6)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.158278] (6)[1033:initCamdevice][OV13850_camera_sensor] open Read sensor id fail, write id: 0x6c, id: 0x0 | |
[ 27.159704] (6)[1033:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 27.160605] (6)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.161309] (6)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.162203] (6)[1033:initCamdevice]I2C structure: | |
[ 27.162203] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.162203] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.162203] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.165532] (6)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.166389] (4)[1033:initCamdevice]I2C register: | |
[ 27.166389] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.166389] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.166389] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.170017] (4)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.170017] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.170017] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.170017] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.173064] (4)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.173064] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.173064] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.173064] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.176124] (4)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.177098] (4)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.178231] (4)[1033:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 27.179142] (4)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.179836] (4)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.180730] (4)[1033:initCamdevice]I2C structure: | |
[ 27.180730] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.180730] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.180730] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.184048] (4)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.184859] (4)[1033:initCamdevice]I2C register: | |
[ 27.184859] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.184859] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.184859] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.188439] (4)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.188439] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.188439] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.188439] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.191474] (4)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.191474] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.191474] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.191474] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.194504] (4)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.195477] (4)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.196616] (4)[1033:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 27.197516] (4)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.198221] (4)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.199126] (4)[1033:initCamdevice]I2C structure: | |
[ 27.199126] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.199126] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.199126] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.202437] (4)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.203251] (4)[1033:initCamdevice]I2C register: | |
[ 27.203251] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.203251] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.203251] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.206827] (4)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.206827] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.206827] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.206827] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.209857] (4)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.209857] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.209857] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.209857] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.212886] (4)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.213859] (4)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.214992] (4)[1033:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 27.215907] (4)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.216600] (4)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.217494] (4)[1033:initCamdevice]I2C structure: | |
[ 27.217494] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.217494] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.217494] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.220806] (4)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.221619] (4)[1033:initCamdevice]I2C register: | |
[ 27.221619] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.221619] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.221619] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.225196] (4)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.225196] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.225196] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.225196] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.228220] (4)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.228220] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.228220] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.228220] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.231255] (4)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.232224] (4)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.233206] (4)[1033:initCamdevice][OV13850_camera_sensor] open Read sensor id fail, write id: 0x6c, id: 0x0 | |
[ 27.234466] (4)[1033:initCamdevice][DUAL_CAMERA_MAIN_SENSOR] on = 0 | |
[ 27.235291] (4)[1033:initCamdevice][camdebug] ov13850 poweroff | |
[ 27.236067] (4)[1033:initCamdevice]PinIdx(0) PwrType(1) val(0) | |
[ 27.236844] (4)[1033:initCamdevice][kd_camera_hw]PinIdx(0) PwrType(1) val(0) | |
[ 27.237764] (4)[1033:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMAF id=0 en_reg=598 vol_reg=656 en=1) | |
[ 27.239112] (4)[1033:initCamdevice][PMIC] regulator_disable(name=VCAMAF id=0 en_reg=598 vol_reg=656 use_count=1) [a2a]=0x120 | |
[ 27.240551] (4)[1033:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMD id=0 en_reg=5f6 vol_reg=666 en=1) | |
[ 27.241879] (4)[1033:initCamdevice][PMIC] regulator_disable(name=VCAMD id=0 en_reg=5f6 vol_reg=666 use_count=1) [a3c]=0x100 | |
[ 27.243314] (4)[1033:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMA id=0 en_reg=520 vol_reg=63a en=1) | |
[ 27.244638] (4)[1033:initCamdevice][PMIC] regulator_disable(name=VCAMA id=0 en_reg=520 vol_reg=63a use_count=1) [a0c]=0x100 | |
[ 27.246077] (4)[1033:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMIO id=0 en_reg=600 vol_reg=672 en=1) | |
[ 27.247416] (4)[1033:initCamdevice][PMIC] regulator_disable(name=VCAMIO id=0 en_reg=600 vol_reg=672 use_count=1) [a3e]=0x100 | |
[ 27.248845] (4)[1033:initCamdevice]SensorOpen | |
[ 27.249132] (4)[1033:initCamdevice]ERROR:SensorOpen(), turn off power | |
[ 27.250157] (4)[1033:initCamdevice][DUAL_CAMERA_MAIN_SENSOR] on = 1 | |
[ 27.250975] (4)[1033:initCamdevice][camdebug] ov13850 poweron | |
[ 27.251732] (4)[1033:initCamdevice]PinIdx(1) PwrType(1) val(0) | |
[ 27.252557] (6)[1033:initCamdevice][kd_camera_hw]PinIdx(1) PwrType(1) val(0) | |
[ 27.253472] (6)[1033:initCamdevice]PinIdx(0) PwrType(1) val(0) | |
[ 27.254246] (6)[1033:initCamdevice][kd_camera_hw]PinIdx(0) PwrType(1) val(0) | |
[ 27.255173] (6)[1033:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMIO id=0 en_reg=600 vol_reg=672 en=0) | |
[ 27.256522] (6)[1033:initCamdevice][PMIC] regulator_enable(name=VCAMIO id=0 en_reg=600 vol_reg=672) [a3e]=0x8102 | |
[ 27.259168] (6)[1033:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMA id=0 en_reg=520 vol_reg=63a en=0) | |
[ 27.260493] (6)[1033:initCamdevice][PMIC] regulator_enable(name=VCAMA id=0 en_reg=520 vol_reg=63a) [a0c]=0x8102 | |
[ 27.263172] (5)[1033:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMD id=0 en_reg=5f6 vol_reg=666 en=0) | |
[ 27.264499] (5)[1033:initCamdevice][PMIC] regulator_enable(name=VCAMD id=0 en_reg=5f6 vol_reg=666) [a3c]=0x8102 | |
[ 27.268273] (4)[1033:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMAF id=0 en_reg=598 vol_reg=656 en=0) | |
[ 27.269664] (4)[1033:initCamdevice][PMIC] regulator_enable(name=VCAMAF id=0 en_reg=598 vol_reg=656) [a2a]=0x8122 | |
[ 27.276354] (4)[1033:initCamdevice]PinIdx(0) PwrType(1) val(1) | |
[ 27.277131] (4)[1033:initCamdevice][kd_camera_hw]PinIdx(0) PwrType(1) val(1) | |
[ 27.298047] (6)[1033:initCamdevice][OV13850_camera_sensor] open OV13850,MIPI 4LANE | |
[ 27.299030] (6)[1033:initCamdevice][OV13850_camera_sensor] open preview 2096*1552@30fps,640Mbps/lane; video 4192*3104@30fps,1.2Gbps/lane; capture 13M@30fps,1.2Gbps/lane | |
[ 27.301119] (6)[1033:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 27.302019] (6)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.302742] (6)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.303624] (6)[1033:initCamdevice]I2C structure: | |
[ 27.303624] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.303624] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.303624] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.306939] (6)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.307748] (6)[1033:initCamdevice]I2C register: | |
[ 27.307748] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.307748] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.307748] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.311328] (6)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.311328] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.311328] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.311328] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.314357] (6)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.314357] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.314357] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.314357] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.317389] (6)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.318360] (6)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.319496] (6)[1033:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 27.320397] (6)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.321101] (6)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.321995] (6)[1033:initCamdevice]I2C structure: | |
[ 27.321995] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.321995] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.321995] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.325317] (6)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.326133] (6)[1033:initCamdevice]I2C register: | |
[ 27.326133] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.326133] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.326133] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.329707] (6)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.329707] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.329707] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.329707] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.332733] (6)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.332733] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.332733] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.332733] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.335762] (6)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.336735] (6)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.337864] (6)[1033:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 27.338764] (6)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.339481] (6)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.340364] (6)[1033:initCamdevice]I2C structure: | |
[ 27.340364] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.340364] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.340364] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.343681] (6)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.344490] (6)[1033:initCamdevice]I2C register: | |
[ 27.344490] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.344490] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.344490] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.348064] (6)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.348064] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.348064] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.348064] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.351086] (6)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.351086] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.351086] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.351086] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.354117] (6)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.355088] (6)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.356226] (6)[1033:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 27.357129] (6)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.357831] (6)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.358726] (6)[1033:initCamdevice]I2C structure: | |
[ 27.358726] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.358726] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.358726] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.362042] (6)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.362864] (6)[1033:initCamdevice]I2C register: | |
[ 27.362864] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.362864] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.362864] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.366439] (6)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.366439] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.366439] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.366439] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.369462] (6)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.369462] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.369462] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.369462] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.372495] (6)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.373518] (6)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.374488] (6)[1033:initCamdevice][OV13850_camera_sensor] open Read sensor id fail, write id: 0x20, id: 0x0 | |
[ 27.375927] (6)[1033:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 27.376829] (6)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.377534] (6)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.378428] (6)[1033:initCamdevice]I2C structure: | |
[ 27.378428] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.378428] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.378428] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.381745] (6)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.382568] (6)[1033:initCamdevice]I2C register: | |
[ 27.382568] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.382568] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.382568] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.386143] (6)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.386143] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.386143] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.386143] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.389178] (6)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.389178] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.389178] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.389178] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.392202] (6)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.393198] (6)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.394324] (6)[1033:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 27.395236] (6)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.395952] (6)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.396836] (6)[1033:initCamdevice]I2C structure: | |
[ 27.396836] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.396836] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.396836] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.400154] (6)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.400963] (6)[1033:initCamdevice]I2C register: | |
[ 27.400963] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.400963] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.400963] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.404545] (6)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.404545] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.404545] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.404545] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.407571] (6)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.407571] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.407571] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.407571] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.410604] (6)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.411573] (6)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.412712] (6)[1033:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 27.413612] (6)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.414317] (6)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.415210] (6)[1033:initCamdevice]I2C structure: | |
[ 27.415210] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.415210] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.415210] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.418543] (6)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.419366] (6)[1033:initCamdevice]I2C register: | |
[ 27.419366] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.419366] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.419366] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.422980] (5)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.422980] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.422980] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.422980] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.426023] (5)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.426023] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.426023] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.426023] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.429045] (5)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.430034] (5)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.431151] (5)[1033:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 27.432050] (5)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.432767] (5)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.433649] (5)[1033:initCamdevice]I2C structure: | |
[ 27.433649] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.433649] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.433649] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.436960] (5)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.437775] (5)[1033:initCamdevice]I2C register: | |
[ 27.437775] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.437775] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.437775] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.441361] (5)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.441361] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.441361] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.441361] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.444400] (5)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.444400] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.444400] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.444400] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.447444] (5)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.448414] (5)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.449396] (5)[1033:initCamdevice][OV13850_camera_sensor] open Read sensor id fail, write id: 0x20, id: 0x0 | |
[ 27.450815] (5)[1033:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 27.451715] (5)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.452433] (5)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.453315] (5)[1033:initCamdevice]I2C structure: | |
[ 27.453315] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.453315] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.453315] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.456626] (5)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.457441] (5)[1033:initCamdevice]I2C register: | |
[ 27.457441] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.457441] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.457441] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.461018] (5)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.461018] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.461018] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.461018] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.464042] (5)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.464042] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.464042] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.464042] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.467076] (5)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.468047] (5)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.469166] (5)[1033:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 27.470073] (5)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.470771] (5)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.471665] (5)[1033:initCamdevice]I2C structure: | |
[ 27.471665] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.471665] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.471665] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.474989] (5)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.475827] (5)[1033:initCamdevice]I2C register: | |
[ 27.475827] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.475827] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.475827] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.479425] (5)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.479425] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.479425] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.479425] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.482458] (5)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.482458] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.482458] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.482458] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.485480] (5)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.486484] (5)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.487609] (5)[1033:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 27.488510] (5)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.489227] (5)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.490109] (5)[1033:initCamdevice]I2C structure: | |
[ 27.490109] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.490109] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.490109] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.493421] (5)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.494234] (5)[1033:initCamdevice]I2C register: | |
[ 27.494234] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.494234] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.494234] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.497810] (5)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.497810] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.497810] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.497810] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.500833] (5)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.500833] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.500833] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.500833] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.503864] (5)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.504835] (5)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.505980] (5)[1033:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 27.506881] (5)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.507586] (5)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.508480] (5)[1033:initCamdevice]I2C structure: | |
[ 27.508480] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.508480] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.508480] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.511796] (5)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.512613] (5)[1033:initCamdevice]I2C register: | |
[ 27.512613] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.512613] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.512613] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.516188] (5)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.516188] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.516188] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.516188] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.519210] (5)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.519210] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.519210] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.519210] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.522230] (5)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.523279] (5)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.524250] (5)[1033:initCamdevice][OV13850_camera_sensor] open Read sensor id fail, write id: 0x6c, id: 0x0 | |
[ 27.525676] (5)[1033:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 27.526597] (5)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.527291] (5)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.528185] (5)[1033:initCamdevice]I2C structure: | |
[ 27.528185] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.528185] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.528185] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.531497] (5)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.532310] (5)[1033:initCamdevice]I2C register: | |
[ 27.532310] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.532310] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.532310] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.534023] (2)[279:logd.auditd]type=1400 audit(1556890377.426:59): avc: denied { transfer } for pid=908 comm="m.android.phone" scontext=u:r:radio:s0 tcontext=u:r:init:s0 tclass=binder permissive=1 | |
[ 27.534034] (2)[279:logd.auditd]type=1400 audit(1556890378.426:60): avc: denied { block_suspend } for pid=657 comm="rild" capability=36 scontext=u:r:init:s0 tcontext=u:r:init:s0 tclass=capability2 permissive=1 | |
[ 27.534161] (2)[279:logd.auditd]type=1400 audit(1556890378.426:60): avc: denied { block_suspend } for pid=657 comm="rild" capability=36 scontext=u:r:init:s0 tcontext=u:r:init:s0 tclass=capability2 permissive=1 | |
[ 27.534169] (2)[279:logd.auditd]type=1400 audit(1556890378.426:61): avc: denied { call } for pid=657 comm="rild" scontext=u:r:init:s0 tcontext=u:r:radio:s0 tclass=binder permissive=1 | |
[ 27.534584] (2)[279:logd.auditd]type=1400 audit(1556890378.426:61): avc: denied { call } for pid=657 comm="rild" scontext=u:r:init:s0 tcontext=u:r:radio:s0 tclass=binder permissive=1 | |
[ 27.534595] (2)[279:logd.auditd]type=1400 audit(1556890378.426:62): avc: denied { write } for pid=657 comm="rild" name="property_service" dev="tmpfs" ino=458 scontext=u:r:init:s0 tcontext=u:object_r:property_socket:s0 tclass=sock_file permissive=1 | |
[ 27.544334] (4)[1:init]init: processing action (ril.muxreport=1) from (/vendor/etc/init/muxreport.rc:8) | |
[ 27.545583] (4)[1:init]init: starting service 'muxreport-daemon'... | |
[ 27.551843] (5)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.551843] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.551843] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.551843] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.554869] (5)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.554869] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.554869] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.554869] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.557919] (5)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.558894] (5)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.559047] (4)[1:init]init: Service 'muxreport-daemon' (pid 1040) exited with status 0 | |
[ 27.561067] (5)[1033:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 27.561970] (5)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.562687] (5)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.563570] (5)[1033:initCamdevice]I2C structure: | |
[ 27.563570] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.563570] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.563570] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.566906] (5)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.567720] (5)[1033:initCamdevice]I2C register: | |
[ 27.567720] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.567720] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.567720] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.571304] (5)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.571304] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.571304] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.571304] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.574331] (5)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.574331] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.574331] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.574331] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.577360] (5)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.578333] (5)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.579473] (5)[1033:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 27.580373] (5)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.581078] (5)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.581972] (5)[1033:initCamdevice]I2C structure: | |
[ 27.581972] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.581972] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.581972] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.585354] (6)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.586205] (6)[1033:initCamdevice]I2C register: | |
[ 27.586205] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.586205] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.586205] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.589787] (6)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.589787] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.589787] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.589787] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.592817] (6)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.592817] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.592817] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.592817] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.595847] (6)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.596822] (6)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.597951] (6)[1033:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 27.598851] (6)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.599568] (6)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.600450] (6)[1033:initCamdevice]I2C structure: | |
[ 27.600450] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.600450] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.600450] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.603767] (6)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.604576] (6)[1033:initCamdevice]I2C register: | |
[ 27.604576] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.604576] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.604576] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.608161] (6)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.608161] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.608161] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.608161] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.611192] (6)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.611192] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.611192] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.611192] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.614223] (6)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.615195] (6)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.616180] (6)[1033:initCamdevice][OV13850_camera_sensor] open Read sensor id fail, write id: 0x6c, id: 0x0 | |
[ 27.617438] (6)[1033:initCamdevice][DUAL_CAMERA_MAIN_SENSOR] on = 0 | |
[ 27.618262] (6)[1033:initCamdevice][camdebug] ov13850 poweroff | |
[ 27.619032] (6)[1033:initCamdevice]PinIdx(0) PwrType(1) val(0) | |
[ 27.619826] (6)[1033:initCamdevice][kd_camera_hw]PinIdx(0) PwrType(1) val(0) | |
[ 27.620746] (6)[1033:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMAF id=0 en_reg=598 vol_reg=656 en=1) | |
[ 27.622086] (6)[1033:initCamdevice][PMIC] regulator_disable(name=VCAMAF id=0 en_reg=598 vol_reg=656 use_count=1) [a2a]=0x120 | |
[ 27.623534] (6)[1033:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMD id=0 en_reg=5f6 vol_reg=666 en=1) | |
[ 27.624860] (6)[1033:initCamdevice][PMIC] regulator_disable(name=VCAMD id=0 en_reg=5f6 vol_reg=666 use_count=1) [a3c]=0x100 | |
[ 27.626302] (6)[1033:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMA id=0 en_reg=520 vol_reg=63a en=1) | |
[ 27.627628] (6)[1033:initCamdevice][PMIC] regulator_disable(name=VCAMA id=0 en_reg=520 vol_reg=63a use_count=1) [a0c]=0x100 | |
[ 27.629058] (6)[1033:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMIO id=0 en_reg=600 vol_reg=672 en=1) | |
[ 27.630422] (6)[1033:initCamdevice][PMIC] regulator_disable(name=VCAMIO id=0 en_reg=600 vol_reg=672 use_count=1) [a3e]=0x100 | |
[ 27.631855] (6)[1033:initCamdevice]SensorOpen | |
[ 27.632128] (6)[1033:initCamdevice]ERROR:SensorOpen(), turn off power | |
[ 27.633248] (6)[1033:initCamdevice][DUAL_CAMERA_MAIN_SENSOR] on = 1 | |
[ 27.633935] (2)[321:mtk_wmtd][WMT-FUNC][W]wmt_func_wifi_on:WMT-FUNC: wmt call wlan probe ok | |
[ 27.633945] (2)[321:mtk_wmtd][WMT-CORE][I]wmt_core_dump_func_state:[AF FUNC ON]status(b:0 f:0 g:0 w:2 lpbk:2 coredump:0 wmt:2 ant:0 sd1:0 sd2:0 stp:0) | |
[ 27.634021] (3)[305:android.hardwar][HIF-SDIO][I]mtk_wcn_wmt_func_ctrl:OPID(3) type(3) ok | |
[ 27.637754] (2)[305:android.hardwar]IPv6: ADDRCONF(NETDEV_UP): wlan0: link is not ready | |
[ 27.639024] (6)[1033:initCamdevice][camdebug] ov13850 poweron | |
[ 27.639844] (6)[1033:initCamdevice]PinIdx(1) PwrType(1) val(0) | |
[ 27.640644] (6)[1033:initCamdevice][kd_camera_hw]PinIdx(1) PwrType(1) val(0) | |
[ 27.641570] (6)[1033:initCamdevice]PinIdx(0) PwrType(1) val(0) | |
[ 27.642361] (6)[1033:initCamdevice][kd_camera_hw]PinIdx(0) PwrType(1) val(0) | |
[ 27.643321] (6)[1033:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMIO id=0 en_reg=600 vol_reg=672 en=0) | |
[ 27.644672] (6)[1033:initCamdevice][PMIC] regulator_enable(name=VCAMIO id=0 en_reg=600 vol_reg=672) [a3e]=0x8102 | |
[ 27.647357] (6)[1033:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMA id=0 en_reg=520 vol_reg=63a en=0) | |
[ 27.648684] (6)[1033:initCamdevice][PMIC] regulator_enable(name=VCAMA id=0 en_reg=520 vol_reg=63a) [a0c]=0x8102 | |
[ 27.651427] (4)[1033:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMD id=0 en_reg=5f6 vol_reg=666 en=0) | |
[ 27.652826] (4)[1033:initCamdevice][PMIC] regulator_enable(name=VCAMD id=0 en_reg=5f6 vol_reg=666) [a3c]=0x8102 | |
[ 27.656514] (4)[1033:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMAF id=0 en_reg=598 vol_reg=656 en=0) | |
[ 27.657851] (4)[1033:initCamdevice][PMIC] regulator_enable(name=VCAMAF id=0 en_reg=598 vol_reg=656) [a2a]=0x8122 | |
[ 27.661133] (0)[1:init]init: starting service 'wpa_supplicant'... | |
[ 27.663916] (1)[1044:init]init: Created socket '/dev/socket/wpa_wlan0', mode 660, user 1010, group 1010 | |
[ 27.664549] (4)[1033:initCamdevice]PinIdx(0) PwrType(1) val(1) | |
[ 27.664570] (4)[1033:initCamdevice][kd_camera_hw]PinIdx(0) PwrType(1) val(1) | |
[ 27.684598] (4)[1033:initCamdevice][OV13850_camera_sensor] open OV13850,MIPI 4LANE | |
[ 27.685581] (4)[1033:initCamdevice][OV13850_camera_sensor] open preview 2096*1552@30fps,640Mbps/lane; video 4192*3104@30fps,1.2Gbps/lane; capture 13M@30fps,1.2Gbps/lane | |
[ 27.687671] (4)[1033:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 27.688571] (4)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.689287] (4)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.690175] (4)[1033:initCamdevice]I2C structure: | |
[ 27.690175] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.690175] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.690175] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.693528] (4)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.694342] (4)[1033:initCamdevice]I2C register: | |
[ 27.694342] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.694342] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.694342] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.697933] (4)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.697933] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.697933] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.697933] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.700962] (4)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.700962] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.700962] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.700962] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.703993] (4)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.704967] (4)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.706104] (4)[1033:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 27.707005] (4)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.707710] (4)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.708604] (4)[1033:initCamdevice]I2C structure: | |
[ 27.708604] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.708604] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.708604] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.711926] (4)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.712793] (4)[1033:initCamdevice]I2C register: | |
[ 27.712793] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.712793] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.712793] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.716427] (4)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.716427] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.716427] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.716427] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.719491] (4)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.719491] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.719491] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.719491] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.722541] (4)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.723512] (4)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.724641] (4)[1033:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 27.725541] (4)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.726258] (4)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.727142] (4)[1033:initCamdevice]I2C structure: | |
[ 27.727142] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.727142] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.727142] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.730457] (4)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.731269] (4)[1033:initCamdevice]I2C register: | |
[ 27.731269] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.731269] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.731269] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.734874] (4)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.734874] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.734874] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.734874] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.735072] (2)[279:logd.auditd]type=1400 audit(1556890378.426:62): avc: denied { write } for pid=657 comm="rild" name="property_service" dev="tmpfs" ino=458 scontext=u:r:init:s0 tcontext=u:object_r:property_socket:s0 tclass=sock_file permissive=1 | |
[ 27.735085] (2)[279:logd.auditd]type=1400 audit(1556890378.626:63): avc: denied { block_suspend } for pid=657 comm="rild" capability=36 scontext=u:r:init:s0 tcontext=u:r:init:s0 tclass=capability2 permissive=1 | |
[ 27.743062] (4)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.743062] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.743062] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.743062] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.746095] (4)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.747066] (4)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.748199] (4)[1033:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 27.749109] (4)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.749803] (4)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.750697] (4)[1033:initCamdevice]I2C structure: | |
[ 27.750697] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.750697] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.750697] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.754017] (4)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.754827] (4)[1033:initCamdevice]I2C register: | |
[ 27.754827] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.754827] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.754827] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.758421] (4)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.758421] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.758421] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.758421] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.761447] (4)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.761447] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.761447] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.761447] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.764475] (4)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.765451] (4)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.766429] (4)[1033:initCamdevice][OV13850_camera_sensor] open Read sensor id fail, write id: 0x20, id: 0x0 | |
[ 27.767851] (4)[1033:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 27.768754] (4)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.769423] (5)[321:mtk_wmtd][WMT-CORE][I]opfunc_therm_ctrl:Send WMT_THERM_CTRL_CMD command OK! | |
[ 27.769828] (5)[321:mtk_wmtd][WMT-CORE][I]opfunc_therm_ctrl:Send WMT_THERM_READ_CMD command OK! | |
[ 27.770282] (6)[321:mtk_wmtd][WMT-CORE][I]opfunc_therm_ctrl:Send WMT_THERM_CTRL_CMD command OK! | |
[ 27.770337] (1)[137:kworker/1:1][HIF-SDIO][I]wmt_dev_tm_temp_query:[Thermal] current_temp = 0x1d | |
[ 27.773983] (4)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.774875] (4)[1033:initCamdevice]I2C structure: | |
[ 27.774875] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.774875] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.774875] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.778196] (4)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.779011] (4)[1033:initCamdevice]I2C register: | |
[ 27.779011] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.779011] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.779011] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.782664] (6)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.782664] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.782664] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.782664] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.785691] (6)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.785691] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.785691] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.785691] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.788743] (6)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.789725] (6)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.790847] (6)[1033:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 27.791747] (6)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.792482] (6)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.793378] (6)[1033:initCamdevice]I2C structure: | |
[ 27.793378] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.793378] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.793378] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.796724] (6)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.797550] (6)[1033:initCamdevice]I2C register: | |
[ 27.797550] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.797550] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.797550] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.801152] (6)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.801152] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.801152] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.801152] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.804183] (6)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.804183] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.804183] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.804183] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.807213] (6)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.808185] (6)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.809325] (6)[1033:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 27.810226] (6)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.810931] (6)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.811825] (6)[1033:initCamdevice]I2C structure: | |
[ 27.811825] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.811825] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.811825] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.815146] (6)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.815964] (6)[1033:initCamdevice]I2C register: | |
[ 27.815964] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.815964] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.815964] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.819540] (6)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.819540] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.819540] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.819540] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.822569] (6)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.822569] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.822569] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.822569] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.825593] (6)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.826586] (6)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.827710] (6)[1033:initCamdevice]ERROR,495: id=0,addr: 10, transfer error | |
[ 27.828611] (6)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.829329] (6)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.830210] (6)[1033:initCamdevice]I2C structure: | |
[ 27.830210] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.830210] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.830210] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.833530] (6)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.834340] (6)[1033:initCamdevice]I2C register: | |
[ 27.834340] [I2C]SLAVE_ADDR=20,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.834340] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.834340] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.837919] (6)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.837919] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.837919] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.837919] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.840944] (6)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.840944] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.840944] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.840944] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.840978] (2)[130:hps_main]MobiCore mcd: Cpu 6 is going to die | |
[ 27.844786] (5)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.846104] (5)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.846121] (2)[130:hps_main]CPU6: shutdown | |
[ 27.846771] (2)[130:hps_main]MobiCore mcd: Cpu 6 is dead | |
[ 27.848346] (5)[1033:initCamdevice][OV13850_camera_sensor] open Read sensor id fail, write id: 0x20, id: 0x0 | |
[ 27.848375] (2)[130:hps_main]MobiCore mcd: Cpu 5 is going to die | |
[ 27.850613] (5)[1033:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 27.851530] (5)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.852593] (3)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.852609] (2)[130:hps_main]CPU5: shutdown | |
[ 27.853089] (2)[130:hps_main]MobiCore mcd: Cpu 5 is dead | |
[ 27.853367] (2)[130:hps_main]MobiCore mcd: Cpu 4 is going to die | |
[ 27.855855] (3)[1033:initCamdevice]I2C structure: | |
[ 27.855855] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.855855] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.855855] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.855859] (2)[130:hps_main]CPU4: shutdown | |
[ 27.856392] (2)[130:hps_main]MobiCore mcd: Cpu 4 is dead | |
[ 27.859214] (2)[130:hps_main]MobiCore mcd: Cpu 3 is going to die | |
[ 27.861285] (3)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.862115] (3)[1033:initCamdevice]I2C register: | |
[ 27.862115] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.862115] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.862115] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.866048] (2)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.866048] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.866048] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.866048] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.866056] (2)[130:hps_main]CPU3: shutdown | |
[ 27.866758] (0)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.866758] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.866758] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.866758] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.866761] (0)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.866771] (0)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.866926] (0)[1033:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 27.866929] (0)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.866933] (0)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.866940] (0)[1033:initCamdevice]I2C structure: | |
[ 27.866940] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.866940] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.866940] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.866943] (0)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.866955] (0)[1033:initCamdevice]I2C register: | |
[ 27.866955] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.866955] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.866955] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.866962] (0)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.866962] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.866962] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.866962] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.866972] (0)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.866972] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.866972] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.866972] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.866974] (0)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.866979] (0)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.867128] (0)[1033:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 27.867131] (0)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.867133] (0)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.867140] (0)[1033:initCamdevice]I2C structure: | |
[ 27.867140] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.867140] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.867140] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.867143] (0)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.867155] (0)[1033:initCamdevice]I2C register: | |
[ 27.867155] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.867155] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.867155] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.867161] (0)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.867161] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.867161] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.867161] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.867172] (0)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.867172] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.867172] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.867172] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.867174] (0)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.867179] (0)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.867319] (0)[1033:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 27.867322] (0)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.867325] (0)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.867332] (0)[1033:initCamdevice]I2C structure: | |
[ 27.867332] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.867332] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.867332] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.867335] (0)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.867347] (0)[1033:initCamdevice]I2C register: | |
[ 27.867347] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.867347] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.867347] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.867354] (0)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.867354] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.867354] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.867354] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.867364] (0)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.867364] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.867364] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.867364] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.867366] (0)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.867371] (0)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.867375] (0)[1033:initCamdevice][OV13850_camera_sensor] open Read sensor id fail, write id: 0x6c, id: 0x0 | |
[ 27.867516] (0)[1033:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 27.867519] (0)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.867522] (0)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.867529] (0)[1033:initCamdevice]I2C structure: | |
[ 27.867529] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.867529] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.867529] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.867532] (0)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.867544] (0)[1033:initCamdevice]I2C register: | |
[ 27.867544] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.867544] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.867544] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.867550] (0)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.867550] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.867550] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.867550] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.867560] (0)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.867560] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.867560] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.867560] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.867563] (0)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.867567] (0)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.867709] (0)[1033:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 27.867712] (0)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.867715] (0)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.867722] (0)[1033:initCamdevice]I2C structure: | |
[ 27.867722] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.867722] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.867722] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.867725] (0)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.867736] (0)[1033:initCamdevice]I2C register: | |
[ 27.867736] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.867736] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.867736] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.867742] (0)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.867742] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.867742] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.867742] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.867753] (0)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.867753] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.867753] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.867753] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.867755] (0)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.867760] (0)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.867901] (0)[1033:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 27.867904] (0)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.867907] (0)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.867914] (0)[1033:initCamdevice]I2C structure: | |
[ 27.867914] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.867914] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.867914] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.867917] (0)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.867928] (0)[1033:initCamdevice]I2C register: | |
[ 27.867928] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.867928] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.867928] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.867935] (0)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.867935] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.867935] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.867935] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.867944] (0)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.867944] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.867944] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.867944] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.867947] (0)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.867952] (0)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.868092] (0)[1033:initCamdevice]ERROR,495: id=0,addr: 36, transfer error | |
[ 27.868095] (0)[1033:initCamdevice]ERROR,501: I2C_ACKERR | |
[ 27.868098] (0)[1033:initCamdevice]I2C(0) dump info++++++++++++++++++++++ | |
[ 27.868105] (0)[1033:initCamdevice]I2C structure: | |
[ 27.868105] [I2C]Clk=17062,Id=0,Speed mode=1,St_rs=0,Dma_en=0,Op=1,Poll_en=0,Irq_stat=2 | |
[ 27.868105] [I2C]Trans_len=2,Trans_num=1,Trans_auxlen=0,Data_size=ffff,speed=100 | |
[ 27.868105] [I2C]Trans_stop=1,Trans_comp=0,Trans_error=2 | |
[ 27.868108] (0)[1033:initCamdevice]base address 0xffffff8001fd2000 | |
[ 27.868120] (0)[1033:initCamdevice]I2C register: | |
[ 27.868120] [I2C]SLAVE_ADDR=6c,INTR_MASK=f8,INTR_STAT=1,CONTROL=28,TRANSFER_LEN=2 | |
[ 27.868120] [I2C]TRANSAC_LEN=1,DELAY_LEN=2,TIMING=1410,START=0,FIFO_STAT=1210 | |
[ 27.868120] [I2C]IO_CONFIG=3,HS=102,DCM_EN=0,DEBUGSTAT=40,EXT_CONF=8001,TRANSFER_LEN_AUX=0 | |
[ 27.868126] (0)[1033:initCamdevice]before enable DMA register(0x0): | |
[ 27.868126] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.868126] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.868126] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.868136] (0)[1033:initCamdevice]DMA register(0xffffff8001fd0180): | |
[ 27.868136] [I2C]INT_FLAG=0,INT_EN=0,EN=0,RST=0, | |
[ 27.868136] [I2C]STOP=0,FLUSH=0,CON=0,TX_MEM_ADDR=0, RX_MEM_ADDR=0 | |
[ 27.868136] [I2C]TX_LEN=0,RX_LEN=0,INT_BUF_SIZE=0,DEBUG_STATUS=0 | |
[ 27.868139] (0)[1033:initCamdevice]I2C(0) dump info------------------------------ | |
[ 27.868144] (0)[1033:initCamdevice][CAMERA SENSOR] I2C send failed!!, Addr = 0x30 | |
[ 27.868147] (0)[1033:initCamdevice][OV13850_camera_sensor] open Read sensor id fail, write id: 0x6c, id: 0x0 | |
[ 27.868151] (0)[1033:initCamdevice][DUAL_CAMERA_MAIN_SENSOR] on = 0 | |
[ 27.868155] (0)[1033:initCamdevice][camdebug] ov13850 poweroff | |
[ 27.868159] (0)[1033:initCamdevice]PinIdx(0) PwrType(1) val(0) | |
[ 27.868178] (0)[1033:initCamdevice][kd_camera_hw]PinIdx(0) PwrType(1) val(0) | |
[ 27.868190] (0)[1033:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMAF id=0 en_reg=598 vol_reg=656 en=1) | |
[ 27.868208] (0)[1033:initCamdevice][PMIC] regulator_disable(name=VCAMAF id=0 en_reg=598 vol_reg=656 use_count=1) [a2a]=0x120 | |
[ 27.868218] (0)[1033:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMD id=0 en_reg=5f6 vol_reg=666 en=1) | |
[ 27.868234] (0)[1033:initCamdevice][PMIC] regulator_disable(name=VCAMD id=0 en_reg=5f6 vol_reg=666 use_count=1) [a3c]=0x100 | |
[ 27.868244] (0)[1033:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMA id=0 en_reg=520 vol_reg=63a en=1) | |
[ 27.868262] (0)[1033:initCamdevice][PMIC] regulator_disable(name=VCAMA id=0 en_reg=520 vol_reg=63a use_count=1) [a0c]=0x100 | |
[ 27.868272] (0)[1033:initCamdevice][PMIC] [PMIC]regulator_is_enabled(name=VCAMIO id=0 en_reg=600 vol_reg=672 en=1) | |
[ 27.868289] (0)[1033:initCamdevice][PMIC] regulator_disable(name=VCAMIO id=0 en_reg=600 vol_reg=672 use_count=1) [a3e]=0x100 | |
[ 27.868294] (0)[1033:initCamdevice]SensorOpen | |
[ 27.868296] (0)[1033:initCamdevice]ERROR:SensorOpen(), turn off power | |
[ 28.021247] (2)[130:hps_main]MobiCore mcd: Cpu 3 is dead | |
[ 28.022250] (2)[130:hps_main][HPS] (0200)(7)action end(172)(171)(0)(0) (8)(8)(8)(8)(1) (429)(8)(0) (1843)(8)(0) (0)(171)(8)(0)(171) wifi_base(0) | |
[ 28.055912] (2)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, mc_open_device failed: 15 | |
[ 28.176363] (2)[1:init]init: Service 'nvram_daemon' (pid 428) exited with status 0 | |
[ 28.224094] (2)[130:hps_main][HPS] (0000)(3)DBG_HRT(184)(164)(0)(0) (8)(8)(8)(8)(1) (354)(2)(0) (354)(2)(2) (0)(164)(2)(0)(164) wifi_base(0) | |
[ 28.279253] (1)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1018mv, freq = 1040000 KHz | |
[ 28.365954] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1056mv, freq = 1144000 KHz | |
[ 28.369287] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1106mv, freq = 1300000 KHz | |
[ 28.548944] (2)[279:logd.auditd]type=1400 audit(1556890378.626:63): avc: denied { block_suspend } for pid=657 comm="rild" capability=36 scontext=u:r:init:s0 tcontext=u:r:init:s0 tclass=capability2 permissive=1 | |
[ 28.553594] (2)[279:logd.auditd]type=1400 audit(1556890379.439:64): avc: denied { call } for pid=657 comm="rild" scontext=u:r:init:s0 tcontext=u:r:radio:s0 tclass=binder permissive=1 | |
[ 28.560124] (2)[279:logd.auditd]type=1400 audit(1556890379.439:64): avc: denied { call } for pid=657 comm="rild" scontext=u:r:init:s0 tcontext=u:r:radio:s0 tclass=binder permissive=1 | |
[ 28.562363] (2)[279:logd.auditd]type=1400 audit(1556890379.439:65): avc: denied { call } for pid=908 comm="HwBinder:908_1" scontext=u:r:radio:s0 tcontext=u:r:init:s0 tclass=binder permissive=1 | |
[ 28.565517] (2)[279:logd.auditd]type=1400 audit(1556890379.439:65): avc: denied { call } for pid=908 comm="HwBinder:908_1" scontext=u:r:radio:s0 tcontext=u:r:init:s0 tclass=binder permissive=1 | |
[ 28.569012] (2)[279:logd.auditd]type=1400 audit(1556890379.449:66): avc: denied { transfer } for pid=908 comm="m.android.phone" scontext=u:r:radio:s0 tcontext=u:r:init:s0 tclass=binder permissive=1 | |
[ 28.726318] -(3)[0:swapper/3]CPU3: Booted secondary processor | |
[ 28.726336] -(3)[0:swapper/3]Detected VIPT I-cache on CPU3 | |
[ 28.726456] -(3)[0:swapper/3]CPU3: update cpu_capacity 1024 | |
[ 28.727067] (0)[130:hps_main][HPS] (0080)(3)action end(285)(391)(0)(0) (8)(8)(8)(8)(1) (571)(7)(1) (1139)(6)(6) (0)(391)(7)(0)(391) wifi_base(0) | |
[ 28.919128] (3)[742:Jit thread pool][md1]traffic(3/0):Tx(7f)5-5,1495-1492,0-0,0-0,0-0,0-0,0-0,0-0:Rx(7f)6,1291,0,0,0,0,0,0 | |
[ 28.920591] (3)[742:Jit thread pool][md1]traffic(net): tx: [22]0 0, [26]0 0, [30]0 0, rx:[20]0, [24]0, [28]0 | |
[ 29.210719] (2)[1:init]init: property_set("ro.ril.ecclist", "112,911") failed: property already set | |
[ 29.273711] (0)[528:HwBinder:291_3]Voice_Amp_Set() | |
[ 29.274353] (0)[528:HwBinder:291_3]turn off ampL | |
[ 29.275404] -(0)[528:HwBinder:291_3]TopCkCount <0 =0 | |
[ 29.275404] | |
[ 29.275947] -(0)[528:HwBinder:291_3]mtk_pcm_I2S0dl1_stop | |
[ 29.277999] (0)[528:HwBinder:291_3]SetI2SDacEnable bEnable = 0 | |
[ 29.280162] (0)[528:HwBinder:291_3]mtk_pcm_I2S0dl1_close mI2S0dl1_hdoutput_control == 1 | |
[ 29.281263] (0)[528:HwBinder:291_3]EnableApll2 bEnable = 0 | |
[ 29.282212] (0)[528:HwBinder:291_3]Audio_I2S0dl1_hdoutput_Set() | |
[ 29.387760] (1)[589:HwBinder:302_1][Gsensor] bma250_set_delay (66), chip only use 1024HZ | |
[ 29.390051] (1)[589:HwBinder:302_1][Gsensor] enable value=1, sensor_power =0 | |
[ 29.413588] (2)[589:HwBinder:302_1][Gsensor] bma250_enable_nodata OK! | |
[ 29.614779] (1)[1:init]init: Service 'bootanim' (pid 365) exited with status 0 | |
[ 29.642877] (0)[302:[email protected]]<ALS/PS> als_delay 250000000 ns | |
[ 29.643887] (0)[302:[email protected]]<ALS/PS> als_store_batch buf=0 | |
[ 29.644701] (0)[302:[email protected]]<ALS/PS> als_store_batch not supported | |
[ 29.645606] (0)[302:[email protected]]<ALS/PS> als_store_batch done: 0 | |
[ 29.647605] (0)[302:[email protected]]<ALS/PS> als_store_active buf=1 | |
[ 29.648429] (0)[302:[email protected]]<ALS/PS> ALSPS enable data | |
[ 29.649013] (1)[1:init]init: processing action (sys.usb.config=none && sys.usb.configfs=0) from (/init.usb.rc:29) | |
[ 29.649374] (1)[1:init]android_usb: already disabled | |
[ 29.649774] (1)[1:init]init: processing action (init.svc.adbd=stopped) from (/init.usb.configfs.rc:15) | |
[ 29.649954] (1)[1:init]init: processing action (sys.usb.config=adb && sys.usb.configfs=0) from (/init.usb.rc:38) | |
[ 29.650008] (1)[1:init]android_usb: already disabled | |
[ 29.650452] (1)[1:init]init: starting service 'adbd'... | |
[ 29.651717] (1)[1:init]init: processing action (sys.usb.config=adb) from (init.mt6735.usb.rc:21) | |
[ 29.652503] (3)[1096:init]init: Created socket '/dev/socket/adbd', mode 660, user 1000, group 1000 | |
[ 29.653277] (1)[279:logd.auditd]type=1400 audit(1556890379.449:66): avc: denied { transfer } for pid=908 comm="m.android.phone" scontext=u:r:radio:s0 tcontext=u:r:init:s0 tclass=binder permissive=1 | |
[ 29.653292] (1)[279:logd.auditd]type=1400 audit(1556890380.546:67): avc: denied { execute } for pid=1096 comm="init" name="adbd" dev="mmcblk0p45" ino=3160 scontext=u:r:init:s0 tcontext=u:object_r:unlabeled:s0 tclass=file permissive=1 | |
[ 29.653709] (1)[279:logd.auditd]type=1400 audit(1556890380.546:67): avc: denied { execute } for pid=1096 comm="init" name="adbd" dev="mmcblk0p45" ino=3160 scontext=u:r:init:s0 tcontext=u:object_r:unlabeled:s0 tclass=file permissive=1 | |
[ 29.653721] (1)[279:logd.auditd]type=1400 audit(1556890380.546:68): avc: denied { entrypoint } for pid=1096 comm="init" path="/system/bin/adbd" dev="mmcblk0p45" ino=3160 scontext=u:r:adbd:s0 tcontext=u:object_r:unlabeled:s0 tclass=file permissive=1 | |
[ 29.667107] (1)[1:init]init: processing action (sys.boot_completed=1) from (/init.rc:691) | |
[ 29.667398] (1)[279:logd.auditd]type=1400 audit(1556890380.546:68): avc: denied { entrypoint } for pid=1096 comm="init" path="/system/bin/adbd" dev="mmcblk0p45" ino=3160 scontext=u:r:adbd:s0 tcontext=u:object_r:unlabeled:s0 tclass=file permissive=1 | |
[ 29.667411] (1)[279:logd.auditd]type=1400 audit(1556890380.559:69): avc: denied { read } for pid=1096 comm="adbd" path="/system/bin/adbd" dev="mmcblk0p45" ino=3160 scontext=u:r:adbd:s0 tcontext=u:object_r:unlabeled:s0 tclass=file permissive=1 | |
[ 29.669311] (3)[1097:usb ffs open]read descriptors | |
[ 29.669323] (3)[1097:usb ffs open]read descriptors | |
[ 29.669329] (3)[1097:usb ffs open]read strings | |
[ 29.669380] (3)[1097:usb ffs open][MUSB]musb_gadget_pullup 2129: is_on=1, softconnect=0 ++ | |
[ 29.669384] (3)[1097:usb ffs open][MUSB]musb_gadget_pullup 2139: is_on=1, softconnect=0 ++ | |
[ 29.669398] (3)[1097:usb ffs open][MUSB]usb_cable_connected 689: usb_cable_connected vbus_exist=1 type=0 | |
[ 29.669402] (3)[1097:usb ffs open][MUSB]set_usb_rdy 57: set usb_rdy, wake up bat | |
[ 29.669405] (3)[1097:usb ffs open][BATTERY] wake_up_bat. | |
[ 29.669410] (3)[1097:usb ffs open][MUSB]usb_cable_connected 705: issue connect_rescue_work on is_ready begin, delay_time:2000 ms | |
[ 29.669416] (3)[1097:usb ffs open][MUSB]usb_cable_connected 707: issue connect_rescue_work on is_ready end, delay_time:2000 ms | |
[ 29.669420] (3)[1097:usb ffs open][MUSB]usb_cable_connected 711: usb_cable_connected, connected:0, cable_mode:1 | |
[ 29.669425] -(3)[1097:usb ffs open][MUSB]musb_pullup 2072: MUSB: gadget pull up 1 start, musb->power:0 | |
[ 29.669429] -(3)[1097:usb ffs open][MUSB]musb_pullup 2092: MUSB: gadget pull up 1 end | |
[ 29.669679] (3)[222:bat_thread_kthr]CDP, free | |
[ 29.669743] (3)[222:bat_thread_kthr][MUSB]Charger_Detect_Init 693: Charger_Detect_Init | |
[ 29.669954] (1)[1:init]init: processing action (sys.boot_completed=1) from (/init.mt6735.rc:92) | |
[ 29.670747] (1)[1:init]init: processing action (sys.boot_completed=1 && sys.logbootcomplete=1) from (/system/etc/init/bootstat.rc:66) | |
[ 29.671203] (1)[1:init]init: starting service 'exec 9 (/system/bin/bootstat --record_boot_complete)'... | |
[ 29.672490] (1)[1:init]init: SVC_EXEC pid 1098 (uid 1000 gid 1007+0 context default) started; waiting... | |
[ 29.687620] (2)[1:init]init: Service 'exec 9 (/system/bin/bootstat --record_boot_complete)' (pid 1098) exited with status 0 waiting took 0.016000 seconds | |
[ 29.688238] (2)[1:init]init: starting service 'exec 10 (/system/bin/bootstat --record_boot_reason)'... | |
[ 29.689424] (2)[1:init]init: SVC_EXEC pid 1099 (uid 1000 gid 1007+0 context default) started; waiting... | |
[ 29.698865] (2)[302:[email protected]][ALS/PS] cm36686_obj als enable value = 1 | |
[ 29.699979] (2)[302:[email protected]][ALS/PS] cm36686_enable_als enable_als | |
[ 29.701519] (1)[302:[email protected]][ALS/PS] CM36686_REG_ALS_CONF value value_low = 41, value_high = 0 | |
[ 29.703249] (1)[302:[email protected]]<ALS/PS> alsps real enable | |
[ 29.704018] (1)[302:[email protected]]<ALS/PS> alsps_store_active done | |
[ 29.706907] (0)[1:init]init: Service 'exec 10 (/system/bin/bootstat --record_boot_reason)' (pid 1099) exited with status 0 waiting took 0.018000 seconds | |
[ 29.709453] (0)[1:init]init: starting service 'exec 11 (/system/bin/bootstat --record_time_since_factory_reset)'... | |
[ 29.711915] (0)[1:init]init: SVC_EXEC pid 1101 (uid 1000 gid 1007+0 context default) started; waiting... | |
[ 29.728098] (0)[1:init]init: Service 'exec 11 (/system/bin/bootstat --record_time_since_factory_reset)' (pid 1101) exited with status 0 waiting took 0.018000 seconds | |
[ 29.730053] (1)[130:hps_main][HPS] (0000)(4)DBG_HRT(324)(593)(0)(0) (8)(8)(8)(8)(1) (671)(10)(0) (2629)(10)(2) (0)(593)(10)(0)(593) wifi_base(0) | |
[ 29.730656] (0)[1:init]init: starting service 'exec 12 (/system/bin/bootstat -l)'... | |
[ 29.731685] (0)[1:init]init: SVC_EXEC pid 1102 (uid 1000 gid 1007+0 context default) started; waiting... | |
[ 29.748437] (1)[1:init]init: Service 'exec 12 (/system/bin/bootstat -l)' (pid 1102) exited with status 0 waiting took 0.018000 seconds | |
[ 29.750335] (1)[1:init]init: processing action (sys.boot_completed=1 && sys.wifitracing.started=0) from (/system/etc/init/wifi-events.rc:20) | |
[ 29.752332] (1)[1:init]selinux: SELinux: Could not get canonical path for /sys/kernel/debug/tracing/instances/wifi restorecon: No such file or directory. | |
[ 29.752332] | |
[ 29.754500] (1)[1:init]init: Unable to open '/sys/kernel/debug/tracing/instances/wifi/tracing_on': No such file or directory | |
[ 29.756048] (1)[1:init]init: Unable to open '/sys/kernel/debug/tracing/instances/wifi/buffer_size_kb': No such file or directory | |
[ 29.757603] (1)[1:init]init: Unable to open '/sys/kernel/debug/tracing/instances/wifi/trace_options': No such file or directory | |
[ 29.759197] (1)[1:init]init: Unable to open '/sys/kernel/debug/tracing/instances/wifi/events/cfg80211/cfg80211_gtk_rekey_notify/enable': No such file or directory | |
[ 29.761165] (1)[1:init]init: Unable to open '/sys/kernel/debug/tracing/instances/wifi/events/cfg80211/rdev_add_key/enable': No such file or directory | |
[ 29.762997] (1)[1:init]init: Unable to open '/sys/kernel/debug/tracing/instances/wifi/events/cfg80211/rdev_assoc/enable': No such file or directory | |
[ 29.764777] (1)[1:init]init: Unable to open '/sys/kernel/debug/tracing/instances/wifi/events/cfg80211/rdev_auth/enable': No such file or directory | |
[ 29.766568] (1)[1:init]init: Unable to open '/sys/kernel/debug/tracing/instances/wifi/events/cfg80211/rdev_connect/enable': No such file or directory | |
[ 29.768350] (1)[1:init]init: Unable to open '/sys/kernel/debug/tracing/instances/wifi/events/cfg80211/rdev_set_default_key/enable': No such file or directory | |
[ 29.770370] (3)[1:init]init: Unable to open '/sys/kernel/debug/tracing/instances/wifi/events/cfg80211/rdev_set_default_mgmt_key/enable': No such file or directory | |
[ 29.772324] (3)[1:init]init: Unable to open '/sys/kernel/debug/tracing/instances/wifi/events/cfg80211/rdev_set_rekey_data/enable': No such file or directory | |
[ 29.774440] (3)[1:init]init: Unable to open '/sys/kernel/debug/tracing/instances/wifi/events/net/filter': No such file or directory | |
[ 29.776084] (3)[1:init]init: Unable to open '/sys/kernel/debug/tracing/instances/wifi/events/net/net_dev_queue/enable': No such file or directory | |
[ 29.777839] (3)[1:init]init: Unable to open '/sys/kernel/debug/tracing/instances/wifi/events/net/net_dev_xmit/enable': No such file or directory | |
[ 29.779629] (3)[1:init]init: Unable to open '/sys/kernel/debug/tracing/instances/wifi/events/net/netif_rx/enable': No such file or directory | |
[ 29.781317] (3)[1:init]init: Unable to open '/sys/kernel/debug/tracing/instances/wifi/events/net/netif_receive_skb/enable': No such file or directory | |
[ 29.805802] (0)[67:kworker/0:1][MUSB]do_low_power_timer_monitor_work 77: state:IDLE_STAGE, last:0, balanced<0,0>, usb_state:DISCONNECTED | |
[ 29.880333] (1)[279:logd.auditd]type=1400 audit(1556890380.559:69): avc: denied { read } for pid=1096 comm="adbd" path="/system/bin/adbd" dev="mmcblk0p45" ino=3160 scontext=u:r:adbd:s0 tcontext=u:object_r:unlabeled:s0 tclass=file permissive=1 | |
[ 29.883656] (1)[279:logd.auditd]type=1400 audit(1556890380.773:70): avc: denied { call } for pid=908 comm="m.android.phone" scontext=u:r:radio:s0 tcontext=u:r:init:s0 tclass=binder permissive=1 | |
[ 29.972528] (3)[222:bat_thread_kthr]step B2 : Charging Host! | |
[ 29.973354] (3)[222:bat_thread_kthr][MUSB]Charger_Detect_Release 717: Charger_Detect_Release | |
[ 29.974453] (3)[222:bat_thread_kthr][MUSB]mt_usb_connect 547: issue work | |
[ 29.975895] (3)[222:bat_thread_kthr][MUSB]mt_usb_connect 549: [MUSB] USB connect | |
[ 29.976389] (2)[6:kworker/u16:0][MUSB]do_connection_work 475: is ready 1 is_host 0 power 0 | |
[ 29.976404] (2)[6:kworker/u16:0][MUSB]usb_cable_connected 689: usb_cable_connected vbus_exist=1 type=2 | |
[ 29.976409] (2)[6:kworker/u16:0][MUSB]usb_cable_connected 711: usb_cable_connected, connected:1, cable_mode:1 | |
[ 29.976416] -(2)[6:kworker/u16:0][MUSB]do_connection_work 514: lock | |
[ 29.976421] -(2)[6:kworker/u16:0][MUSB]musb_start 1277: start, is_host=0 is_active=1 | |
[ 29.976427] -(2)[6:kworker/u16:0][MUSB]mt_usb_enable 345: begin <0,0>,<2,2,1,1> | |
[ 29.979945] (1)[137:kworker/1:1]<ALS/PS> als data[3] | |
[ 29.986258] (3)[222:bat_thread_kthr][BAT_thread]Cable in, CHR_Type_num=2 | |
[ 29.987320] -(2)[6:kworker/u16:0][MUSB]HQA_special 35: HQA, 0x18, before:86 | |
[ 29.988220] -(2)[6:kworker/u16:0][MUSB]HQA_special 39: HQA, 0x18, after:86 | |
[ 29.989116] -(2)[6:kworker/u16:0][MUSB]hs_slew_rate_cal 319: [USBPHY]slew calibration:FM_OUT =330,x=4170,value=4 | |
[ 29.990412] -(2)[6:kworker/u16:0][MUSB]usb_phy_recover 667: usb recovery success | |
[ 29.991363] -(2)[6:kworker/u16:0][MUSB]mt_usb_enable 369: end, <2,2,2,1> | |
[ 29.992235] -(2)[6:kworker/u16:0][MUSB]musb_start 1329: set ignore babble MUSB_ULPI_REG_DATA=81 | |
[ 29.993347] -(2)[6:kworker/u16:0][MUSB]musb_start 1349: add softconn | |
[ 30.001310] (3)[222:bat_thread_kthr][force_get_tbat] 786,787,0,164,10,30 | |
[ 30.007140] (3)[222:bat_thread_kthr][force_get_tbat] 775,777,0,232,10,30 | |
[ 30.008383] (3)[222:bat_thread_kthr][dump_nter] mt6328_upmu_get_fg_nter_29_16 = 0x0 | |
[ 30.010001] (3)[222:bat_thread_kthr][dump_nter] mt6328_upmu_get_fg_nter_15_00 = 0x106 | |
[ 30.012058] (3)[222:bat_thread_kthr][dump_car] upmu_get_fg_car_31_16 = 0xfffe | |
[ 30.012588] (1)[300:[email protected]][LED]Set Backlight directly 96 at time 4294886280, mapping level is 96 | |
[ 30.012597] (1)[300:[email protected]][LED]get_cust_led_dtsi: get the leds info from device tree | |
[ 30.015398] (3)[222:bat_thread_kthr][dump_car] upmu_get_fg_car_15_00 = 0xcd19 | |
[ 30.016771] (3)[222:bat_thread_kthr][FGADC] 0,2322,0,4287,95,100,100,2194,2194,43,0,0,1000,4244,1000,0,0,99,103 | |
[ 30.019239] (3)[222:bat_thread_kthr]AvgVbat=(4244,4244),AvgI=(585,0),VChr=4901,AvgT=(30,30),SOC=(100,100),UI_SOC=100,ZCV=4287 bcct:1:0 I:65000 | |
[ 30.025888] (1)[279:logd.auditd]type=1400 audit(1556890380.773:70): avc: denied { call } for pid=908 comm="m.android.phone" scontext=u:r:radio:s0 tcontext=u:r:init:s0 tclass=binder permissive=1 | |
[ 30.030590] (1)[300:[email protected]][LED]Set Backlight directly 90 at time 4294886285, mapping level is 90 | |
[ 30.032043] (1)[300:[email protected]][LED]get_cust_led_dtsi: get the leds info from device tree | |
[ 30.033235] (1)[279:logd.auditd][BATTERY] Pre-CC mode charge, timer=0 on 0 !! | |
[ 30.033235] | |
[ 30.034216] (1)[279:logd.auditd]type=1400 audit(1556890380.916:71): avc: denied { call } for pid=657 comm="rild" scontext=u:r:init:s0 tcontext=u:r:radio:s0 tclass=binder permissive=1 | |
[ 30.043015] (3)[222:bat_thread_kthr][BATTERY] Default CC mode charging : 65000, input current = 320001 | |
[ 30.047589] (1)[300:[email protected]][LED]Set Backlight directly 83 at time 4294886290, mapping level is 83 | |
[ 30.049247] (1)[300:[email protected]][LED]get_cust_led_dtsi: get the leds info from device tree | |
[ 30.052990] (3)[222:bat_thread_kthr][bq24158] [0x0]=0xd0 [0x1]=0xd8 [0x2]=0xaa [0x3]=0x51 [0x4]=0x1a [0x5]=0x3 [0x6]=0x7c | |
[ 30.057899] (3)[222:bat_thread_kthr][100percent], UI_SOC(100), reset(1) bat_full(1) ever100(1) | |
[ 30.059136] (0)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, mc_open_device failed: 15 | |
[ 30.059224] (3)[222:bat_thread_kthr][dump_nter] mt6328_upmu_get_fg_nter_29_16 = 0x0 | |
[ 30.059232] (3)[222:bat_thread_kthr][dump_nter] mt6328_upmu_get_fg_nter_15_00 = 0x0 | |
[ 30.059240] (3)[222:bat_thread_kthr][dump_car] upmu_get_fg_car_31_16 = 0x0 | |
[ 30.059247] (3)[222:bat_thread_kthr][dump_car] upmu_get_fg_car_15_00 = 0x0 | |
[ 30.059251] (3)[222:bat_thread_kthr][battery_meter_reset]1 DOD0=0,DOD1=0,ui=100 | |
[ 30.059255] (3)[222:bat_thread_kthr][battery_meter_reset]2 DOD0=0,DOD1=0,ui=100 | |
[ 30.059258] (3)[222:bat_thread_kthr]UI_SOC=(100), resetBatteryMeter=(1) | |
[ 30.059268] -(3)[222:bat_thread_kthr]mtk_rtc_hal_common: rtc_spare_reg[0] = {16412, 127, 8} | |
[ 30.059332] (3)[222:bat_thread_kthr]current_now=(0) | |
[ 30.059335] (3)[222:bat_thread_kthr]voltage_now=(4244000) | |
[ 30.059559] (3)[222:bat_thread_kthr][dump_nter] mt6328_upmu_get_fg_nter_29_16 = 0x0 | |
[ 30.059567] (3)[222:bat_thread_kthr][dump_nter] mt6328_upmu_get_fg_nter_15_00 = 0x0 | |
[ 30.059574] (3)[222:bat_thread_kthr][dump_car] upmu_get_fg_car_31_16 = 0x0 | |
[ 30.059583] (3)[222:bat_thread_kthr][dump_car] upmu_get_fg_car_15_00 = 0x0 | |
[ 30.059587] (3)[222:bat_thread_kthr][battery_meter_reset]1 DOD0=0,DOD1=0,ui=100 | |
[ 30.059592] (3)[222:bat_thread_kthr][battery_meter_reset]2 DOD0=0,DOD1=0,ui=100 | |
[ 30.059595] (3)[222:bat_thread_kthr][BATTERY] Charger plug in/out, Call battery_meter_reset. (100) | |
[ 30.059607] (3)[222:bat_thread_kthr][BAT_thread]Cable in, CHR_Type_num=2 | |
[ 30.062856] (1)[306:healthd]healthd: battery l=100 v=4244 t=30.0 h=2 st=5 c=0 chg=u | |
[ 30.063927] (1)[306:healthd]healthd: battery l=100 v=4244 t=30.0 h=2 st=5 c=0 chg=u | |
[ 30.065498] (1)[306:healthd]healthd: battery l=100 v=4244 t=30.0 h=2 st=5 c=0 chg=u | |
[ 30.066376] (1)[306:healthd]healthd: battery l=100 v=4244 t=30.0 h=2 st=5 c=0 chg=u | |
[ 30.070829] (3)[222:bat_thread_kthr][force_get_tbat] 801,800,1,183,10,29 | |
[ 30.073279] (3)[222:bat_thread_kthr]AvgVbat=(4251,4321),AvgI=(520,0),VChr=4768,AvgT=(29,29),SOC=(100,100),UI_SOC=100,ZCV=4287 bcct:1:0 I:85000 | |
[ 30.075483] (1)[222:bat_thread_kthr][BATTERY] Battery full !! | |
[ 30.075483] | |
[ 30.078948] (1)[222:bat_thread_kthr][BATTERY] Battery Re-charging !! | |
[ 30.078948] | |
[ 30.078951] (1)[222:bat_thread_kthr][dump_nter] mt6328_upmu_get_fg_nter_29_16 = 0x0 | |
[ 30.078959] (1)[222:bat_thread_kthr][dump_nter] mt6328_upmu_get_fg_nter_15_00 = 0x0 | |
[ 30.078966] (1)[222:bat_thread_kthr][dump_car] upmu_get_fg_car_31_16 = 0x0 | |
[ 30.078974] (1)[222:bat_thread_kthr][dump_car] upmu_get_fg_car_15_00 = 0x0 | |
[ 30.078978] (1)[222:bat_thread_kthr][battery_meter_reset]1 DOD0=0,DOD1=0,ui=100 | |
[ 30.078982] (1)[222:bat_thread_kthr][battery_meter_reset]2 DOD0=0,DOD1=0,ui=100 | |
[ 30.083093] (3)[222:bat_thread_kthr][bq24158] [0x0]=0xd0 [0x1]=0xd8 [0x2]=0xaa [0x3]=0x51 [0x4]=0x1a [0x5]=0x3 [0x6]=0x7c | |
[ 30.083122] (3)[222:bat_thread_kthr][100percent], UI_SOC(100), reset(0) bat_full(1) ever100(1) | |
[ 30.083125] (3)[222:bat_thread_kthr][recharging] UI_SOC=100, SOC=100 | |
[ 30.083129] (3)[222:bat_thread_kthr]UI_SOC=(100), resetBatteryMeter=(0) | |
[ 30.083140] -(3)[222:bat_thread_kthr]mtk_rtc_hal_common: rtc_spare_reg[0] = {16412, 127, 8} | |
[ 30.083199] (3)[222:bat_thread_kthr]current_now=(0) | |
[ 30.083202] (3)[222:bat_thread_kthr]voltage_now=(4321000) | |
[ 30.084407] (1)[306:healthd]healthd: battery l=100 v=4321 t=29.0 h=2 st=5 c=0 chg=u | |
[ 30.085306] (1)[306:healthd]healthd: battery l=100 v=4321 t=29.0 h=2 st=5 c=0 chg=u | |
[ 30.087149] (1)[306:healthd]healthd: battery l=100 v=4321 t=29.0 h=2 st=5 c=0 chg=u | |
[ 30.091288] (1)[306:healthd]healthd: battery l=100 v=4321 t=29.0 h=2 st=5 c=0 chg=u | |
[ 30.106022] (1)[300:[email protected]][LED]Set Backlight directly 64 at time 4294886308, mapping level is 64 | |
[ 30.111201] (1)[300:[email protected]][LED]get_cust_led_dtsi: get the leds info from device tree | |
[ 30.112350] (1)[300:[email protected]][PWM] disp_pwm_set_backlight_cmdq(id = 0x1, level_1024 = 257), old = 333 | |
[ 30.120232] (1)[300:[email protected]][LED]Set Backlight directly 58 at time 4294886312, mapping level is 58 | |
[ 30.122037] (3)[300:[email protected]][LED]get_cust_led_dtsi: get the leds info from device tree | |
[ 30.134614] -(4)[0:swapper/4]CPU4: Booted secondary processor | |
[ 30.134636] -(4)[0:swapper/4]Detected VIPT I-cache on CPU4 | |
[ 30.134772] -(4)[0:swapper/4]CPU4: update cpu_capacity 1024 | |
[ 30.135866] -(5)[0:swapper/5]CPU5: Booted secondary processor | |
[ 30.135888] -(5)[0:swapper/5]Detected VIPT I-cache on CPU5 | |
[ 30.136031] -(5)[0:swapper/5]CPU5: update cpu_capacity 1024 | |
[ 30.137314] -(6)[0:swapper/6]CPU6: Booted secondary processor | |
[ 30.137342] -(6)[0:swapper/6]Detected VIPT I-cache on CPU6 | |
[ 30.137514] -(6)[0:swapper/6]CPU6: update cpu_capacity 1024 | |
[ 30.138350] (6)[300:[email protected]][LED]Set Backlight directly 51 at time 4294886317, mapping level is 51 | |
[ 30.138933] -(7)[0:swapper/7]CPU7: Booted secondary processor | |
[ 30.138943] -(7)[0:swapper/7]Detected VIPT I-cache on CPU7 | |
[ 30.139107] -(7)[0:swapper/7]CPU7: update cpu_capacity 1024 | |
[ 30.140089] (0)[130:hps_main][HPS] (0020)(4)action end(395)(1452)(0)(0) (8)(8)(8)(8)(1) (692)(13)(1) (2565)(13)(5) (1)(1452)(14)(0)(1452) wifi_base(0) | |
[ 30.143648] (6)[300:[email protected]][LED]get_cust_led_dtsi: get the leds info from device tree | |
[ 30.152820] (4)[279:logd.auditd]type=1400 audit(1556890380.916:71): avc: denied { call } for pid=657 comm="rild" scontext=u:r:init:s0 tcontext=u:r:radio:s0 tclass=binder permissive=1 | |
[ 30.154148] (6)[300:[email protected]][LED]Set Backlight directly 45 at time 4294886322, mapping level is 45 | |
[ 30.154157] (6)[300:[email protected]][LED]get_cust_led_dtsi: get the leds info from device tree | |
[ 30.157309] (4)[279:logd.auditd]type=1400 audit(1556890381.046:72): avc: denied { write } for pid=657 comm="rild" name="property_service" dev="tmpfs" ino=458 scontext=u:r:init:s0 tcontext=u:object_r:property_socket:s0 tclass=sock_file permissive=1 | |
[ 30.172106] (0)[300:[email protected]][LED]Set Backlight directly 38 at time 4294886327, mapping level is 38 | |
[ 30.173458] (0)[300:[email protected]][LED]get_cust_led_dtsi: get the leds info from device tree | |
[ 30.190203] (4)[300:[email protected]][LED]Set Backlight directly 32 at time 4294886333, mapping level is 32 | |
[ 30.191460] (4)[300:[email protected]][LED]get_cust_led_dtsi: get the leds info from device tree | |
[ 30.192100] -(6)[1176:ndroid.keychain][MUSB]musb_stage0_irq 1156: MUSB_INTR_RESET (b_idle) | |
[ 30.192106] -(6)[1176:ndroid.keychain]QMU_WARN,<musb_disable_q_all 318>, disable_q_all | |
[ 30.192117] -(6)[1176:ndroid.keychain][MUSB]musb_sync_with_bat 760: BATTERY_SetUSBState, state=1 | |
[ 30.192121] -(6)[1176:ndroid.keychain][BATTERY] BAT_SetUSBState Success! Set 1 | |
[ 30.192124] -(6)[1176:ndroid.keychain][BATTERY] wake_up_bat. | |
[ 30.192386] (5)[222:bat_thread_kthr][dump_nter] mt6328_upmu_get_fg_nter_29_16 = 0x0 | |
[ 30.192396] (5)[222:bat_thread_kthr][dump_nter] mt6328_upmu_get_fg_nter_15_00 = 0x0 | |
[ 30.192438] (5)[222:bat_thread_kthr][dump_car] upmu_get_fg_car_31_16 = 0x0 | |
[ 30.192448] (5)[222:bat_thread_kthr][dump_car] upmu_get_fg_car_15_00 = 0x0 | |
[ 30.192454] (5)[222:bat_thread_kthr][battery_meter_reset]1 DOD0=0,DOD1=0,ui=100 | |
[ 30.192458] (5)[222:bat_thread_kthr][battery_meter_reset]2 DOD0=0,DOD1=0,ui=100 | |
[ 30.192462] (5)[222:bat_thread_kthr][BATTERY] Charger plug in/out, Call battery_meter_reset. (100) | |
[ 30.192477] (5)[222:bat_thread_kthr][BAT_thread]Cable in, CHR_Type_num=2 | |
[ 30.201509] (5)[222:bat_thread_kthr][force_get_tbat] 795,795,1,53,10,29 | |
[ 30.204212] (2)[222:bat_thread_kthr]AvgVbat=(4255,4286),AvgI=(585,0),VChr=4778,AvgT=(29,29),SOC=(100,100),UI_SOC=100,ZCV=4287 bcct:1:0 I:85000 | |
[ 30.207107] (7)[222:bat_thread_kthr][BATTERY] Default CC mode charging : 65000, input current = 320001 | |
[ 30.214639] (0)[222:bat_thread_kthr][bq24158] [0x0]=0xd0 [0x1]=0xd8 [0x2]=0xaa [0x3]=0x51 [0x4]=0x1a [0x5]=0x3 [0x6]=0x7c | |
[ 30.219638] (0)[222:bat_thread_kthr][100percent], UI_SOC(100), reset(0) bat_full(1) ever100(1) | |
[ 30.220904] (0)[222:bat_thread_kthr][recharging] UI_SOC=100, SOC=100 | |
[ 30.221017] (7)[306:healthd]healthd: battery l=100 v=4321 t=29.0 h=2 st=5 c=0 chg=u | |
[ 30.222291] (7)[306:healthd]healthd: battery l=100 v=4321 t=29.0 h=2 st=2 c=0 chg=u | |
[ 30.223435] (7)[306:healthd]healthd: battery l=100 v=4321 t=29.0 h=2 st=2 c=0 chg=u | |
[ 30.224757] (0)[222:bat_thread_kthr]UI_SOC=(100), resetBatteryMeter=(0) | |
[ 30.225626] -(0)[222:bat_thread_kthr]mtk_rtc_hal_common: rtc_spare_reg[0] = {16412, 127, 8} | |
[ 30.226798] (0)[222:bat_thread_kthr]current_now=(0) | |
[ 30.227453] (0)[222:bat_thread_kthr]voltage_now=(4286000) | |
[ 30.229912] (7)[306:healthd]healthd: battery l=100 v=4286 t=29.0 h=2 st=5 c=0 chg=u | |
[ 30.268355] (1)[137:kworker/1:1]<ALS/PS> als data[3] | |
[ 30.318563] (4)[25:kworker/4:0]android_work: sent uevent USB_STATE=CONNECTED | |
[ 30.322945] -(3)[551:android.bg][MUSB]musb_stage0_irq 1156: MUSB_INTR_RESET (b_peripheral) | |
[ 30.324018] -(3)[551:android.bg]QMU_WARN,<musb_disable_q_all 318>, disable_q_all | |
[ 30.324993] -(3)[551:android.bg][MUSB]musb_sync_with_bat 760: BATTERY_SetUSBState, state=1 | |
[ 30.326073] -(3)[551:android.bg][BATTERY] BAT_SetUSBState Success! Set 1 | |
[ 30.326968] -(3)[551:android.bg][BATTERY] wake_up_bat. | |
[ 30.327911] (0)[222:bat_thread_kthr][dump_nter] mt6328_upmu_get_fg_nter_29_16 = 0x0 | |
[ 30.327924] (3)[322:kworker/3:1]android_work: sent uevent USB_STATE=DISCONNECTED | |
[ 30.330774] (6)[222:bat_thread_kthr][dump_nter] mt6328_upmu_get_fg_nter_15_00 = 0x0 | |
[ 30.331375] (5)[279:logd.auditd]type=1400 audit(1556890381.046:72): avc: denied { write } for pid=657 comm="rild" name="property_service" dev="tmpfs" ino=458 scontext=u:r:init:s0 tcontext=u:object_r:property_socket:s0 tclass=sock_file permissive=1 | |
[ 30.331394] (5)[279:logd.auditd]type=1400 audit(1556890381.223:73): avc: denied { block_suspend } for pid=657 comm="rild" capability=36 scontext=u:r:init:s0 tcontext=u:r:init:s0 tclass=capability2 permissive=1 | |
[ 30.334000] (5)[279:logd.auditd]type=1400 audit(1556890381.223:73): avc: denied { block_suspend } for pid=657 comm="rild" capability=36 scontext=u:r:init:s0 tcontext=u:r:init:s0 tclass=capability2 permissive=1 | |
[ 30.334012] (5)[279:logd.auditd]type=1400 audit(1556890381.226:74): avc: denied { call } for pid=908 comm="m.android.phone" scontext=u:r:radio:s0 tcontext=u:r:init:s0 tclass=binder permissive=1 | |
[ 30.341597] (6)[222:bat_thread_kthr][dump_car] upmu_get_fg_car_31_16 = 0x0 | |
[ 30.342522] (6)[222:bat_thread_kthr][dump_car] upmu_get_fg_car_15_00 = 0x0 | |
[ 30.343431] (6)[222:bat_thread_kthr][battery_meter_reset]1 DOD0=0,DOD1=0,ui=100 | |
[ 30.344379] (6)[222:bat_thread_kthr][battery_meter_reset]2 DOD0=0,DOD1=0,ui=100 | |
[ 30.345334] (6)[222:bat_thread_kthr][BATTERY] Charger plug in/out, Call battery_meter_reset. (100) | |
[ 30.346568] (6)[222:bat_thread_kthr][BAT_thread]Cable in, CHR_Type_num=2 | |
[ 30.354832] (5)[222:bat_thread_kthr][force_get_tbat] 792,792,1,90,10,29 | |
[ 30.359322] (7)[222:bat_thread_kthr]AvgVbat=(4261,4302),AvgI=(520,0),VChr=4768,AvgT=(29,29),SOC=(100,100),UI_SOC=100,ZCV=4287 bcct:1:0 I:85000 | |
[ 30.363988] (5)[222:bat_thread_kthr][BATTERY] Default CC mode charging : 65000, input current = 320001 | |
[ 30.373513] (6)[222:bat_thread_kthr][bq24158] [0x0]=0xd0 [0x1]=0xd8 [0x2]=0xaa [0x3]=0x51 [0x4]=0x1a [0x5]=0x3 [0x6]=0x7c | |
[ 30.378385] (6)[222:bat_thread_kthr][100percent], UI_SOC(100), reset(0) bat_full(1) ever100(1) | |
[ 30.379561] (6)[222:bat_thread_kthr][recharging] UI_SOC=100, SOC=100 | |
[ 30.380396] (6)[222:bat_thread_kthr]UI_SOC=(100), resetBatteryMeter=(0) | |
[ 30.381271] -(6)[222:bat_thread_kthr]mtk_rtc_hal_common: rtc_spare_reg[0] = {16412, 127, 8} | |
[ 30.382406] (6)[222:bat_thread_kthr]current_now=(0) | |
[ 30.383082] (6)[222:bat_thread_kthr]voltage_now=(4302000) | |
[ 30.387521] (7)[306:healthd]healthd: battery l=100 v=4302 t=29.0 h=2 st=5 c=0 chg=u | |
[ 30.390931] (7)[306:healthd]healthd: battery l=100 v=4302 t=29.0 h=2 st=5 c=0 chg=u | |
[ 30.394497] (7)[306:healthd]healthd: battery l=100 v=4302 t=29.0 h=2 st=5 c=0 chg=u | |
[ 30.397692] (7)[306:healthd]healthd: battery l=100 v=4302 t=29.0 h=2 st=5 c=0 chg=u | |
[ 30.466656] (0)[67:kworker/0:1]android_work: sent uevent USB_STATE=CONNECTED | |
[ 30.467527] -(5)[742:Jit thread pool]android_usb gadget: high-speed config #1: android | |
[ 30.467560] -(5)[742:Jit thread pool][MUSB]fifo_setup 1237: musb type=BULK | |
[ 30.467569] -(5)[742:Jit thread pool][MUSB]fifo_setup 1278: fifo size is 6 after 512, fifo address is 512, epnum 1,hwepnum 1 | |
[ 30.467574] -(5)[742:Jit thread pool]QMU_WARN,<mtk_qmu_enable 402>, enable RQ(1) | |
[ 30.467592] -(5)[742:Jit thread pool][MUSB]musb_gadget_enable 1475: musb-hdrc periph: enabled ep1out for bulk OUT, maxpacket 512 | |
[ 30.467599] -(5)[742:Jit thread pool][MUSB]fifo_setup 1237: musb type=BULK | |
[ 30.467604] -(5)[742:Jit thread pool][MUSB]fifo_setup 1278: fifo size is 6 after 512, fifo address is 1024, epnum 1,hwepnum 1 | |
[ 30.467609] -(5)[742:Jit thread pool]QMU_WARN,<mtk_qmu_enable 470>, enable TQ(1) | |
[ 30.467618] -(5)[742:Jit thread pool][MUSB]musb_gadget_enable 1475: musb-hdrc periph: enabled ep1in for bulk IN, maxpacket 512 | |
[ 30.467633] -(5)[742:Jit thread pool][MUSB]musb_sync_with_bat 760: BATTERY_SetUSBState, state=2 | |
[ 30.467636] -(5)[742:Jit thread pool][BATTERY] BAT_SetUSBState Success! Set 2 | |
[ 30.467640] -(5)[742:Jit thread pool][BATTERY] wake_up_bat. | |
[ 30.468014] (6)[222:bat_thread_kthr][dump_nter] mt6328_upmu_get_fg_nter_29_16 = 0x0 | |
[ 30.468023] (6)[222:bat_thread_kthr][dump_nter] mt6328_upmu_get_fg_nter_15_00 = 0x0 | |
[ 30.468031] (6)[222:bat_thread_kthr][dump_car] upmu_get_fg_car_31_16 = 0x0 | |
[ 30.468039] (6)[222:bat_thread_kthr][dump_car] upmu_get_fg_car_15_00 = 0x0 | |
[ 30.468043] (6)[222:bat_thread_kthr][battery_meter_reset]1 DOD0=0,DOD1=0,ui=100 | |
[ 30.468047] (6)[222:bat_thread_kthr][battery_meter_reset]2 DOD0=0,DOD1=0,ui=100 | |
[ 30.468051] (6)[222:bat_thread_kthr][BATTERY] Charger plug in/out, Call battery_meter_reset. (100) | |
[ 30.468063] (6)[222:bat_thread_kthr][BAT_thread]Cable in, CHR_Type_num=2 | |
[ 30.478148] (2)[222:bat_thread_kthr][force_get_tbat] 790,790,0,7,10,30 | |
[ 30.480865] (2)[222:bat_thread_kthr]AvgVbat=(4263,4265),AvgI=(455,0),VChr=4749,AvgT=(29,30),SOC=(100,100),UI_SOC=100,ZCV=4287 bcct:1:0 I:85000 | |
[ 30.483689] (2)[222:bat_thread_kthr][BATTERY] Default CC mode charging : 65000, input current = 320001 | |
[ 30.490290] (0)[67:kworker/0:1][bq24158] [0x0]=0xd0 [0x1]=0xd8 [0x2]=0xaa [0x3]=0x51 | |
[ 30.493062] (0)[67:kworker/0:1]android_work: sent uevent USB_STATE=CONFIGURED | |
[ 30.495622] (5)[222:bat_thread_kthr][0x4]=0x1a (1)[222:bat_thread_kthr][0x5]=0x3 [0x6]=0x7c | |
[ 30.498620] (5)[222:bat_thread_kthr][100percent], UI_SOC(100), reset(0) bat_full(1) ever100(1) | |
[ 30.499603] (7)[306:healthd]healthd: battery l=100 v=4302 t=29.0 h=2 st=5 c=0 chg=u | |
[ 30.500990] (7)[306:healthd]healthd: battery l=100 v=4302 t=29.0 h=2 st=5 c=0 chg=u | |
[ 30.501839] (5)[222:bat_thread_kthr][recharging] UI_SOC=100, SOC=100 | |
[ 30.501844] (5)[222:bat_thread_kthr]UI_SOC=(100), resetBatteryMeter=(0) | |
[ 30.501856] -(5)[222:bat_thread_kthr]mtk_rtc_hal_common: rtc_spare_reg[0] = {16412, 127, 8} | |
[ 30.501932] (5)[222:bat_thread_kthr]current_now=(0) | |
[ 30.501935] (5)[222:bat_thread_kthr]voltage_now=(4265000) | |
[ 30.506905] (2)[1:init]init: property_set("ro.ril.ecclist", "112,911") failed: property already set | |
[ 30.507724] (7)[306:healthd]healthd: battery l=100 v=4265 t=29.0 h=2 st=5 c=0 chg=u | |
[ 30.509990] (7)[306:healthd]healthd: battery l=100 v=4265 t=29.0 h=2 st=5 c=0 chg=u | |
[ 30.543103] (1)[137:kworker/1:1]<ALS/PS> als data[2] | |
[ 30.573253] (4)[1:init]init: property_set("ro.ril.ecclist", "112,911") failed: property already set | |
[ 30.634631] (4)[1041:tx_thread][HIF-SDIO][I]wmt_lib_get_fwinfor_from_emi:vir addr(0xffffff8005b80421) | |
[ 30.635906] (4)[1041:tx_thread][HIF-SDIO][I]wmt_lib_get_fwinfor_from_emi:vir addr(0xffffff8005b80621) | |
[ 30.637125] (4)[1041:tx_thread][HIF-SDIO][I]wmt_lib_get_fwinfor_from_emi:vir addr(0xffffff8005b80600) | |
[ 30.650607] (5)[1:init]init: property_set("ro.ril.ecclist", "112,911") failed: property already set | |
[ 30.667197] (5)[279:logd.auditd]type=1400 audit(1556890381.226:74): avc: denied { call } for pid=908 comm="m.android.phone" scontext=u:r:radio:s0 tcontext=u:r:init:s0 tclass=binder permissive=1 | |
[ 30.672292] (5)[279:logd.auditd]type=1400 audit(1556890381.559:75): avc: denied { block_suspend } for pid=657 comm="rild" capability=36 scontext=u:r:init:s0 tcontext=u:r:init:s0 tclass=capability2 permissive=1 | |
[ 30.680403] (6)[1:init]init: property_set("ro.ril.ecclist", "112,911") failed: property already set | |
[ 30.716514] (5)[279:logd.auditd]type=1400 audit(1556890381.559:75): avc: denied { block_suspend } for pid=657 comm="rild" capability=36 scontext=u:r:init:s0 tcontext=u:r:init:s0 tclass=capability2 permissive=1 | |
[ 30.719236] (4)[279:logd.auditd]type=1400 audit(1556890381.609:76): avc: denied { call } for pid=657 comm="rild" scontext=u:r:init:s0 tcontext=u:r:radio:s0 tclass=binder permissive=1 | |
[ 30.738268] -(0)[381:kworker/u17:4][PMIC] dlpt_notify_task is called | |
[ 30.738413] (6)[71:dlpt_notify_thr][PMIC] [dlpt_notify_handler] 0 100 0 0 60 | |
[ 30.738417] (6)[71:dlpt_notify_thr][PMIC] [DLPT] is running | |
[ 30.738429] (6)[71:dlpt_notify_thr][PMIC] [upmu_get_rgs_chrdet] CHRDET status = 1 | |
[ 30.741788] -(0)[381:kworker/u17:4][PMIC] bat_percent_notify_task is called | |
[ 30.741834] (6)[70:bat_percent_not][PMIC] [upmu_get_rgs_chrdet] CHRDET status = 1 | |
[ 30.741839] (6)[70:bat_percent_not][PMIC] bat_per_level=0,bat_per_val=100 | |
[ 30.744420] (6)[71:dlpt_notify_thr][PBM] [ma_to_mw] 4248(mV) * 5500(mA) = 23364(mW) | |
[ 30.819754] (1)[137:kworker/1:1]<ALS/PS> als data[3] | |
[ 31.096742] (1)[137:kworker/1:1]<ALS/PS> als data[3] | |
[ 31.240807] (2)[130:hps_main][HPS] (0000)(8)DBG_HRT(610)(573)(6)(0) (8)(8)(8)(8)(1) (0)(0)(0) (5405)(11)(3) (0)(573)(11)(0)(573) wifi_base(0) | |
[ 31.373117] (1)[137:kworker/1:1]<ALS/PS> als data[3] | |
[ 31.649700] (1)[137:kworker/1:1]<ALS/PS> als data[3] | |
[ 31.672517] (3)[322:kworker/3:1][MUSB]do_connect_rescue_work 567: do_connect_rescue_work, issue connection work | |
[ 31.673869] (4)[146:kworker/u16:2][MUSB]do_connection_work 475: is ready 1 is_host 0 power 1 | |
[ 31.674980] (4)[146:kworker/u16:2][MUSB]usb_cable_connected 689: usb_cable_connected vbus_exist=1 type=2 | |
[ 31.676283] (4)[146:kworker/u16:2][MUSB]usb_cable_connected 711: usb_cable_connected, connected:1, cable_mode:1 | |
[ 31.677581] -(4)[146:kworker/u16:2][MUSB]do_connection_work 534: do nothing, usb_in:1, power:1 | |
[ 31.742930] (3)[130:hps_main]MobiCore mcd: Cpu 7 is going to die | |
[ 31.745134] (4)[130:hps_main]CPU7: shutdown | |
[ 31.746584] (4)[130:hps_main]MobiCore mcd: Cpu 7 is dead | |
[ 31.747748] (4)[130:hps_main][HPS] (0200)(8)action end(624)(635)(26)(0) (8)(8)(8)(8)(1) (0)(0)(0) (4693)(16)(0) (0)(635)(16)(0)(635) wifi_base(0) | |
[ 31.877764] (5)[279:logd.auditd]type=1400 audit(1556890381.609:76): avc: denied { call } for pid=657 comm="rild" scontext=u:r:init:s0 tcontext=u:r:radio:s0 tclass=binder permissive=1 | |
[ 31.880878] (4)[279:logd.auditd]type=1400 audit(1556890382.769:77): avc: denied { call } for pid=908 comm="m.android.phone" scontext=u:r:radio:s0 tcontext=u:r:init:s0 tclass=binder permissive=1 | |
[ 31.903881] -(2)[1406:IntentService[A][PTP] ptp_set_ptp_volt cur_temp = 42700 | |
[ 31.926398] (1)[137:kworker/1:1]<ALS/PS> als data[3] | |
[ 31.950141] -(7)[0:swapper/7]CPU7: Booted secondary processor | |
[ 31.950166] -(7)[0:swapper/7]Detected VIPT I-cache on CPU7 | |
[ 31.950328] -(7)[0:swapper/7]CPU7: update cpu_capacity 1024 | |
[ 31.951441] (2)[130:hps_main][HPS] (0080)(7)action end(668)(924)(0)(0) (8)(8)(8)(8)(1) (1352)(2)(0) (684)(1)(1) (0)(924)(2)(0)(924) wifi_base(0) | |
[ 32.105833] (0)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, mc_open_device failed: 15 | |
[ 32.127314] (6)[279:logd.auditd]type=1400 audit(1556890382.769:77): avc: denied { call } for pid=908 comm="m.android.phone" scontext=u:r:radio:s0 tcontext=u:r:init:s0 tclass=binder permissive=1 | |
[ 32.129783] (6)[279:logd.auditd]type=1400 audit(1556890383.019:78): avc: denied { write } for pid=657 comm="rild" name="property_service" dev="tmpfs" ino=458 scontext=u:r:init:s0 tcontext=u:object_r:property_socket:s0 tclass=sock_file permissive=1 | |
[ 32.203018] (1)[137:kworker/1:1]<ALS/PS> als data[3] | |
[ 32.479722] (1)[137:kworker/1:1]<ALS/PS> als data[3] | |
[ 32.616032] (2)[985:Binder:538_7]mtk_rtc_common: set al time = 1970/01/01 00:00:00 (4) | |
[ 32.617712] -(2)[985:Binder:538_7]mtk_rtc_hal_common: read tc time = 1902/02/01 (4) 00:00:00 | |
[ 32.618798] -(2)[985:Binder:538_7]mtk_rtc_hal_common: a = 1 | |
[ 32.619522] -(2)[985:Binder:538_7]mtk_rtc_hal_common: b = 1 | |
[ 32.620248] -(2)[985:Binder:538_7]mtk_rtc_hal_common: c = 25600 | |
[ 32.621307] -(2)[985:Binder:538_7]mtk_rtc_hal_common: read tc time = 1902/02/01 (4) 00:00:00 | |
[ 32.622386] -(2)[985:Binder:538_7]mtk_rtc_hal_common: a = 1 | |
[ 32.623113] -(2)[985:Binder:538_7]mtk_rtc_hal_common: b = 1 | |
[ 32.623839] -(2)[985:Binder:538_7]mtk_rtc_hal_common: c = 25600 | |
[ 32.753784] (3)[130:hps_main]MobiCore mcd: Cpu 7 is going to die | |
[ 32.755585] (3)[130:hps_main]CPU7: shutdown | |
[ 32.756352] (1)[137:kworker/1:1]<ALS/PS> als data[3] | |
[ 32.756754] (3)[130:hps_main]MobiCore mcd: Cpu 7 is dead | |
[ 32.757119] (3)[130:hps_main][HPS] (0200)(8)action end(540)(545)(0)(0) (8)(8)(8)(8)(1) (0)(0)(0) (4623)(8)(0) (0)(545)(8)(0)(545) wifi_base(0) | |
[ 32.757129] (3)[130:hps_main][HPS] (0200)(8)DBG_HRT(540)(545)(0)(0) (8)(8)(8)(8)(1) (0)(0)(0) (0)(0)(0) (0)(0)(0)(0)(545) wifi_base(0) | |
[ 32.812561] (0)[67:kworker/0:1][MUSB]do_low_power_timer_monitor_work 77: state:IDLE_STAGE, last:0, balanced<0,0>, usb_state:CONFIGURED | |
[ 33.036377] (1)[137:kworker/1:1]<ALS/PS> als data[3] | |
[ 33.313034] (1)[137:kworker/1:1]<ALS/PS> als data[3] | |
[ 33.557647] (2)[130:hps_main]MobiCore mcd: Cpu 6 is going to die | |
[ 33.559372] (2)[130:hps_main]CPU6: shutdown | |
[ 33.560534] (2)[130:hps_main]MobiCore mcd: Cpu 6 is dead | |
[ 33.561601] (2)[130:hps_main]MobiCore mcd: Cpu 5 is going to die | |
[ 33.563236] (1)[130:hps_main]CPU5: shutdown | |
[ 33.564502] (1)[130:hps_main]MobiCore mcd: Cpu 5 is dead | |
[ 33.565604] (1)[130:hps_main]MobiCore mcd: Cpu 4 is going to die | |
[ 33.567221] (1)[130:hps_main]CPU4: shutdown | |
[ 33.568542] (1)[130:hps_main]MobiCore mcd: Cpu 4 is dead | |
[ 33.569641] (1)[130:hps_main][HPS] (0200)(7)action end(188)(185)(0)(0) (8)(8)(8)(8)(1) (378)(8)(0) (2503)(8)(0) (0)(185)(8)(0)(185) wifi_base(0) | |
[ 33.589693] (1)[137:kworker/1:1]<ALS/PS> als data[3] | |
[ 33.605514] -(0)[0:swapper/0][Power/swap]DP: No enter --- SODI: No enter --- | |
[ 33.852451] (0)[228:wdtk-0][WDK], local_bit:0x0, cpu:0,RT[33852440464] | |
[ 33.852458] (0)[228:wdtk-0][WDK], local_bit:0x1, cpu:0, check bit0x:f, lasthpg_cpu:4, lasthpg_act:0, lasthpg_t:33567908463, RT[33852453233] | |
[ 33.852468] (0)[228:wdtk-0][thread:228][RT:33852461079] 2019-05-03 13:33:04.749116 UTC;android time 2019-05-03 15:33:04.749116 | |
[ 33.859110] (1)[229:wdtk-1][WDK], local_bit:0x1, cpu:1,RT[33859101926] | |
[ 33.859118] (1)[229:wdtk-1][WDK], local_bit:0x3, cpu:1, check bit0x:f, lasthpg_cpu:4, lasthpg_act:0, lasthpg_t:33567908463, RT[33859113003] | |
[ 33.859129] (1)[229:wdtk-1][thread:229][RT:33859120926] 2019-05-03 13:33:04.755775 UTC;android time 2019-05-03 15:33:04.755775 | |
[ 33.862469] (2)[230:wdtk-2][WDK], local_bit:0x3, cpu:2,RT[33862455156] | |
[ 33.862476] (2)[230:wdtk-2][WDK], local_bit:0x7, cpu:2, check bit0x:f, lasthpg_cpu:4, lasthpg_act:0, lasthpg_t:33567908463, RT[33862471541] | |
[ 33.862487] (2)[230:wdtk-2][thread:230][RT:33862479849] 2019-05-03 13:33:04.759134 UTC;android time 2019-05-03 15:33:04.759134 | |
[ 33.865789] (3)[231:wdtk-3][WDK], local_bit:0x7, cpu:3,RT[33865776387] | |
[ 33.865796] (3)[231:wdtk-3][WDK], local_bit:0xf, cpu:3, check bit0x:f, lasthpg_cpu:4, lasthpg_act:0, lasthpg_t:33567908463, RT[33865791464] | |
[ 33.865800] (3)[231:wdtk-3][WDK]: kick Ex WDT,RT[33865797618] | |
[ 33.865895] (3)[231:wdtk-3][thread:231][RT:33865887772] 2019-05-03 13:33:04.762542 UTC;android time 2019-05-03 15:33:04.762542 | |
[ 33.866339] (1)[137:kworker/1:1]<ALS/PS> als data[3] | |
[ 34.109133] (0)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, mc_open_device failed: 15 | |
[ 34.143029] (1)[137:kworker/1:1]<ALS/PS> als data[3] | |
[ 34.273183] (0)[130:hps_main][HPS] (0000)(4)DBG_HRT(155)(160)(0)(0) (8)(8)(8)(8)(1) (340)(7)(1) (1242)(7)(7) (0)(160)(7)(0)(160) wifi_base(0) | |
[ 34.362683] (1)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 299000 KHz | |
[ 34.375095] (0)[130:hps_main]MobiCore mcd: Cpu 3 is going to die | |
[ 34.377955] (1)[130:hps_main]CPU3: shutdown | |
[ 34.380668] (1)[130:hps_main]MobiCore mcd: Cpu 3 is dead | |
[ 34.382198] (1)[130:hps_main]MobiCore mcd: Cpu 2 is going to die | |
[ 34.384669] (1)[130:hps_main]CPU2: shutdown | |
[ 34.387206] (1)[130:hps_main]MobiCore mcd: Cpu 2 is dead | |
[ 34.388461] (1)[130:hps_main][HPS] (0200)(4)action end(69)(69)(0)(0) (8)(8)(8)(8)(1) (224)(8)(0) (1311)(8)(0) (0)(69)(8)(0)(69) wifi_base(0) | |
[ 34.406138] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 442000 KHz | |
[ 34.419770] (1)[137:kworker/1:1]<ALS/PS> als data[3] | |
[ 34.426196] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 598000 KHz | |
[ 34.552710] (1)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 442000 KHz | |
[ 34.696505] (1)[137:kworker/1:1]<ALS/PS> als data[3] | |
[ 34.919370] (1)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1106mv, freq = 1300000 KHz | |
[ 34.972980] (1)[137:kworker/1:1]<ALS/PS> als data[3] | |
[ 35.027233] (0)[279:logd.auditd]type=1400 audit(1556890383.019:78): avc: denied { write } for pid=657 comm="rild" name="property_service" dev="tmpfs" ino=458 scontext=u:r:init:s0 tcontext=u:object_r:property_socket:s0 tclass=sock_file permissive=1 | |
[ 35.032580] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1018mv, freq = 1040000 KHz | |
[ 35.035133] (0)[279:logd.auditd]type=1400 audit(1556890385.919:79): avc: denied { block_suspend } for pid=657 comm="rild" capability=36 scontext=u:r:init:s0 tcontext=u:r:init:s0 tclass=capability2 permissive=1 | |
[ 35.039259] (1)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1056mv, freq = 1144000 KHz | |
[ 35.052625] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1106mv, freq = 1300000 KHz | |
[ 35.193885] (0)[279:logd.auditd]type=1400 audit(1556890385.919:79): avc: denied { block_suspend } for pid=657 comm="rild" capability=36 scontext=u:r:init:s0 tcontext=u:r:init:s0 tclass=capability2 permissive=1 | |
[ 35.196941] (0)[279:logd.auditd]type=1400 audit(1556890386.086:80): avc: denied { call } for pid=657 comm="rild" scontext=u:r:init:s0 tcontext=u:r:radio:s0 tclass=binder permissive=1 | |
[ 35.249965] (1)[137:kworker/1:1]<ALS/PS> als data[3] | |
[ 35.291153] -(2)[0:swapper/2]CPU2: Booted secondary processor | |
[ 35.291173] -(2)[0:swapper/2]Detected VIPT I-cache on CPU2 | |
[ 35.291295] -(2)[0:swapper/2]CPU2: update cpu_capacity 1024 | |
[ 35.292158] -(3)[0:swapper/3]CPU3: Booted secondary processor | |
[ 35.292178] -(3)[0:swapper/3]Detected VIPT I-cache on CPU3 | |
[ 35.292295] -(3)[0:swapper/3]CPU3: update cpu_capacity 1024 | |
[ 35.293258] -(4)[0:swapper/4]CPU4: Booted secondary processor | |
[ 35.293279] -(4)[0:swapper/4]Detected VIPT I-cache on CPU4 | |
[ 35.293414] -(4)[0:swapper/4]CPU4: update cpu_capacity 1024 | |
[ 35.294411] -(5)[0:swapper/5]CPU5: Booted secondary processor | |
[ 35.294432] -(5)[0:swapper/5]Detected VIPT I-cache on CPU5 | |
[ 35.294563] -(5)[0:swapper/5]CPU5: update cpu_capacity 1024 | |
[ 35.295627] -(6)[0:swapper/6]CPU6: Booted secondary processor | |
[ 35.295644] -(6)[0:swapper/6]Detected VIPT I-cache on CPU6 | |
[ 35.295772] -(6)[0:swapper/6]CPU6: update cpu_capacity 1024 | |
[ 35.296856] -(7)[0:swapper/7]CPU7: Booted secondary processor | |
[ 35.296876] -(7)[0:swapper/7]Detected VIPT I-cache on CPU7 | |
[ 35.297006] -(7)[0:swapper/7]CPU7: update cpu_capacity 1024 | |
[ 35.297872] (1)[130:hps_main][HPS] (0020)(2)action end(200)(766)(0)(0) (8)(8)(8)(8)(1) (337)(8)(0) (1066)(8)(0) (1)(766)(9)(0)(766) wifi_base(0) | |
[ 35.409456] (1)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 598000 KHz | |
[ 35.412707] (1)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1106mv, freq = 1300000 KHz | |
[ 35.472746] (1)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 598000 KHz | |
[ 35.508842] (2)[1143:Binder:538_8]mtk_rtc_common: set tc time = 2019/05/03 13:33:06 | |
[ 35.526733] (1)[137:kworker/1:1]<ALS/PS> als data[3] | |
[ 35.562786] (3)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1106mv, freq = 1300000 KHz | |
[ 35.652876] (3)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 299000 KHz | |
[ 35.800064] (1)[130:hps_main][HPS] (0000)(8)DBG_HRT(201)(190)(0)(0) (8)(8)(8)(8)(1) (0)(0)(0) (1057)(5)(5) (0)(190)(5)(0)(190) wifi_base(0) | |
[ 35.803174] (1)[137:kworker/1:1]<ALS/PS> als data[3] | |
[ 35.819219] (0)[67:kworker/0:1][MUSB]do_low_power_timer_monitor_work 77: state:IDLE_STAGE, last:0, balanced<0,0>, usb_state:CONFIGURED | |
[ 36.019560] (3)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1106mv, freq = 1300000 KHz | |
[ 36.079669] (1)[137:kworker/1:1]<ALS/PS> als data[2] | |
[ 36.092869] (3)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 299000 KHz | |
[ 36.102191] (2)[130:hps_main]MobiCore mcd: Cpu 7 is going to die | |
[ 36.105737] (2)[130:hps_main]CPU7: shutdown | |
[ 36.107223] (2)[130:hps_main]MobiCore mcd: Cpu 7 is dead | |
[ 36.108809] (0)[130:hps_main]MobiCore mcd: Cpu 6 is going to die | |
[ 36.112329] (0)[130:hps_main]CPU6: shutdown | |
[ 36.113024] (1)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, mc_open_device failed: 15 | |
[ 36.113933] (0)[130:hps_main]MobiCore mcd: Cpu 6 is dead | |
[ 36.115186] (0)[130:hps_main]MobiCore mcd: Cpu 5 is going to die | |
[ 36.118280] (1)[130:hps_main]CPU5: shutdown | |
[ 36.120022] (1)[130:hps_main]MobiCore mcd: Cpu 5 is dead | |
[ 36.121451] (1)[130:hps_main]MobiCore mcd: Cpu 4 is going to die | |
[ 36.124202] (1)[130:hps_main]CPU4: shutdown | |
[ 36.125958] (1)[130:hps_main]MobiCore mcd: Cpu 4 is dead | |
[ 36.127400] (1)[130:hps_main]MobiCore mcd: Cpu 3 is going to die | |
[ 36.130107] (1)[130:hps_main]CPU3: shutdown | |
[ 36.131774] (1)[130:hps_main]MobiCore mcd: Cpu 3 is dead | |
[ 36.133082] (1)[130:hps_main][HPS] (0200)(8)action end(141)(137)(0)(0) (8)(8)(8)(8)(1) (0)(0)(0) (1665)(8)(0) (0)(137)(8)(0)(137) wifi_base(0) | |
[ 36.252772] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1106mv, freq = 1300000 KHz | |
[ 36.302671] (1)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 442000 KHz | |
[ 36.356464] (1)[137:kworker/1:1]<ALS/PS> als data[0] | |
[ 36.369407] (1)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1106mv, freq = 1300000 KHz | |
[ 36.415966] (1)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 598000 KHz | |
[ 36.486020] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 819000 KHz | |
[ 36.532693] (1)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 442000 KHz | |
[ 36.539365] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1106mv, freq = 1300000 KHz | |
[ 36.585996] (2)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 598000 KHz | |
[ 36.633006] (1)[1502:kworker/1:2]<ALS/PS> als data[0] | |
[ 36.656081] (1)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 299000 KHz | |
[ 36.676108] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 442000 KHz | |
[ 36.706021] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1106mv, freq = 1300000 KHz | |
[ 36.779340] (2)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 299000 KHz | |
[ 36.896095] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 442000 KHz | |
[ 36.909791] (1)[1502:kworker/1:2]<ALS/PS> als data[0] | |
[ 36.916040] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1106mv, freq = 1300000 KHz | |
[ 36.935413] (0)[130:hps_main]MobiCore mcd: Cpu 2 is going to die | |
[ 36.936865] (0)[130:hps_main]CPU2: shutdown | |
[ 36.937935] (0)[130:hps_main]MobiCore mcd: Cpu 2 is dead | |
[ 36.938919] (0)[130:hps_main][HPS] (0200)(3)action end(181)(216)(0)(0) (8)(8)(8)(8)(1) (303)(8)(0) (1204)(8)(0) (0)(216)(8)(0)(216) wifi_base(0) | |
[ 37.059317] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 598000 KHz | |
[ 37.159378] (1)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 442000 KHz | |
[ 37.186652] (1)[1502:kworker/1:2]<ALS/PS> als data[0] | |
[ 37.192716] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 598000 KHz | |
[ 37.292672] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 442000 KHz | |
[ 37.340908] (1)[130:hps_main][HPS] (0000)(2)DBG_HRT(110)(167)(0)(0) (8)(8)(8)(8)(1) (225)(4)(0) (387)(4)(4) (0)(167)(4)(0)(167) wifi_base(0) | |
[ 37.463080] (1)[1502:kworker/1:2]<ALS/PS> als data[0] | |
[ 37.609408] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 598000 KHz | |
[ 37.632663] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 819000 KHz | |
[ 37.680222] (1)[1502:kworker/1:2] | |
[ 37.680222] <<SOC DVFS FLIPER>> flip to E(0), 862 | |
[ 37.739698] (1)[1502:kworker/1:2]<ALS/PS> als data[0] | |
[ 37.796715] (0)[321:mtk_wmtd][WMT-CORE][I]opfunc_therm_ctrl:Send WMT_THERM_CTRL_CMD command OK! | |
[ 37.801682] (0)[321:mtk_wmtd][WMT-CORE][I]opfunc_therm_ctrl:Send WMT_THERM_READ_CMD command OK! | |
[ 37.803072] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1106mv, freq = 1300000 KHz | |
[ 37.804643] (0)[321:mtk_wmtd][WMT-CORE][I]opfunc_therm_ctrl:Send WMT_THERM_CTRL_CMD command OK! | |
[ 37.805821] (1)[1502:kworker/1:2][HIF-SDIO][I]wmt_dev_tm_temp_query:[Thermal] current_temp = 0x1d | |
[ 37.862638] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 598000 KHz | |
[ 37.962713] (1)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 442000 KHz | |
[ 38.016513] (1)[1502:kworker/1:2]<ALS/PS> als data[0] | |
[ 38.115858] (1)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, mc_open_device failed: 15 | |
[ 38.293062] (1)[1502:kworker/1:2]<ALS/PS> als data[0] | |
[ 38.536060] (1)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 598000 KHz | |
[ 38.572747] (1)[1502:kworker/1:2]<ALS/PS> als data[0] | |
[ 38.652683] (1)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 442000 KHz | |
[ 38.825825] (0)[67:kworker/0:1][MUSB]do_low_power_timer_monitor_work 77: state:IDLE_STAGE, last:0, balanced<0,0>, usb_state:CONFIGURED | |
[ 38.844044] (1)[130:hps_main][HPS] (0000)(2)DBG_HRT(129)(190)(0)(0) (8)(8)(8)(8)(1) (258)(19)(1) (1008)(19)(3) (0)(190)(19)(0)(190) wifi_base(0) | |
[ 38.849719] (1)[1502:kworker/1:2]<ALS/PS> als data[0] | |
[ 38.919163] (1)[64:kworker/u17:0][md1]traffic(3/0):Tx(7f)5-5,2535-2529,0-0,0-0,0-0,0-0,0-0,0-0:Rx(7f)6,2019,0,0,0,0,0,0 | |
[ 38.920580] (1)[64:kworker/u17:0][md1]traffic(net): tx: [22]0 0, [26]0 0, [30]0 0, rx:[20]0, [24]0, [28]0 | |
[ 38.932717] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1106mv, freq = 1300000 KHz | |
[ 38.940490] (1)[937:Binder:538_6]mtk_rtc_common: set tc time = 2019/05/03 13:33:10 | |
[ 39.076980] (1)[1502:kworker/1:2] | |
[ 39.076980] <<SOC DVFS FLIPER>> flip to S(0), 1509 | |
[ 39.126341] (1)[1502:kworker/1:2]<ALS/PS> als data[0] | |
[ 39.146259] -(2)[0:swapper/2]CPU2: Booted secondary processor | |
[ 39.146278] -(2)[0:swapper/2]Detected VIPT I-cache on CPU2 | |
[ 39.146397] -(2)[0:swapper/2]CPU2: update cpu_capacity 1024 | |
[ 39.146951] (1)[130:hps_main][HPS] (0080)(2)action end(195)(539)(0)(0) (8)(8)(8)(8)(1) (391)(22)(0) (1091)(21)(5) (0)(539)(22)(0)(539) wifi_base(0) | |
[ 39.316810] (1)[300:[email protected]][LED]Set Backlight directly 25 at time 4294889071, mapping level is 25 | |
[ 39.318057] (1)[300:[email protected]][LED]get_cust_led_dtsi: get the leds info from device tree | |
[ 39.334574] (0)[300:[email protected]][LED]Set Backlight directly 20 at time 4294889076, mapping level is 20 | |
[ 39.335878] (0)[300:[email protected]][LED]get_cust_led_dtsi: get the leds info from device tree | |
[ 39.362607] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1018mv, freq = 1040000 KHz | |
[ 39.402999] (1)[1502:kworker/1:2]<ALS/PS> als data[0] | |
[ 39.476027] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 299000 KHz | |
[ 39.679734] (1)[1502:kworker/1:2]<ALS/PS> als data[0] | |
[ 39.949530] (0)[130:hps_main]MobiCore mcd: Cpu 2 is going to die | |
[ 39.951997] (0)[130:hps_main]CPU2: shutdown | |
[ 39.953871] (0)[130:hps_main]MobiCore mcd: Cpu 2 is dead | |
[ 39.955194] (0)[130:hps_main]MobiCore mcd: Cpu 1 is going to die | |
[ 39.957476] (0)[130:hps_main]CPU1: shutdown | |
[ 39.960307] (0)[130:hps_main]MobiCore mcd: Cpu 1 is dead | |
[ 39.961523] (0)[130:hps_main][HPS] (0200)(3)action end(4)(3)(0)(0) (8)(8)(8)(8)(1) (7)(8)(0) (269)(8)(0) (0)(3)(8)(0)(3) wifi_base(0) | |
[ 39.963864] (0)[67:kworker/0:1]<ALS/PS> als data[0] | |
[ 40.119217] (0)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, mc_open_device failed: 15 | |
[ 40.156036] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1106mv, freq = 1300000 KHz | |
[ 40.239315] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 299000 KHz | |
[ 40.241517] (0)[67:kworker/0:1]<ALS/PS> als data[0] | |
[ 40.363621] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(6)(13)(0)(0) (8)(5)(8)(8)(1) (13)(4)(0) (0)(0)(0) (0)(13)(4)(0)(13) wifi_base(0) | |
[ 40.467895] (0)[222:bat_thread_kthr][BAT_thread]Cable in, CHR_Type_num=2 | |
[ 40.477719] (0)[222:bat_thread_kthr][force_get_tbat] 796,796,1,84,10,29 | |
[ 40.483178] (0)[222:bat_thread_kthr][force_get_tbat] 797,797,1,83,10,29 | |
[ 40.484518] (0)[222:bat_thread_kthr][dump_nter] mt6328_upmu_get_fg_nter_29_16 = 0x0 | |
[ 40.485665] (0)[222:bat_thread_kthr][dump_nter] mt6328_upmu_get_fg_nter_15_00 = 0xa0 | |
[ 40.486741] (0)[222:bat_thread_kthr][dump_car] upmu_get_fg_car_31_16 = 0x0 | |
[ 40.487763] (0)[222:bat_thread_kthr][dump_car] upmu_get_fg_car_15_00 = 0x4ac7 | |
[ 40.488745] (0)[222:bat_thread_kthr][FGADC] 1,837,0,4327,98,100,100,2194,2194,-16,0,0,1000,4343,1000,0,0,99,103 | |
[ 40.490678] (0)[222:bat_thread_kthr]AvgVbat=(4273,4343),AvgI=(390,0),VChr=5033,AvgT=(29,29),SOC=(100,100),UI_SOC=100,ZCV=4327 bcct:1:0 I:85000 | |
[ 40.495400] (0)[222:bat_thread_kthr][BATTERY] Default CC mode charging : 65000, input current = 320001 | |
[ 40.504534] (0)[222:bat_thread_kthr][bq24158] [0x0]=0xd0 [0x1]=0xd8 [0x2]=0xaa [0x3]=0x51 [0x4]=0x1a [0x5]=0x3 [0x6]=0x7c | |
[ 40.515312] (0)[306:healthd]healthd: battery l=100 v=4265 t=29.0 h=2 st=5 c=0 chg=u | |
[ 40.517783] (0)[67:kworker/0:1]<ALS/PS> als data[0] | |
[ 40.524127] (0)[306:healthd]healthd: battery l=100 v=4265 t=29.0 h=2 st=5 c=0 chg=u | |
[ 40.526169] (0)[222:bat_thread_kthr][100percent], UI_SOC(100), reset(0) bat_full(1) ever100(1) | |
[ 40.529393] (0)[222:bat_thread_kthr][recharging] UI_SOC=100, SOC=100 | |
[ 40.530275] (0)[222:bat_thread_kthr]UI_SOC=(100), resetBatteryMeter=(0) | |
[ 40.531166] -(0)[222:bat_thread_kthr]mtk_rtc_hal_common: rtc_spare_reg[0] = {16412, 127, 8} | |
[ 40.532319] (0)[222:bat_thread_kthr]current_now=(0) | |
[ 40.533078] (0)[222:bat_thread_kthr]voltage_now=(4343000) | |
[ 40.536094] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1106mv, freq = 1300000 KHz | |
[ 40.537065] (0)[306:healthd]healthd: battery l=100 v=4343 t=29.0 h=2 st=5 c=0 chg=u | |
[ 40.550013] (0)[306:healthd]healthd: battery l=100 v=4343 t=29.0 h=2 st=5 c=0 chg=u | |
[ 40.635973] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 299000 KHz | |
[ 40.686059] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1106mv, freq = 1300000 KHz | |
[ 40.709737] (0)[279:logd.auditd]type=1400 audit(1556890386.086:80): avc: denied { call } for pid=657 comm="rild" scontext=u:r:init:s0 tcontext=u:r:radio:s0 tclass=binder permissive=1 | |
[ 40.711813] (0)[279:logd.auditd]type=1400 audit(1556890391.777:81): avc: denied { syslog_read } for pid=1508 comm="dmesg" scontext=u:r:shell:s0 tcontext=u:r:kernel:s0 tclass=system permissive=1 | |
[ 40.741861] -(0)[1226:<-transport][PMIC] bat_percent_notify_task is called | |
[ 40.742853] (0)[70:bat_percent_not][PMIC] [upmu_get_rgs_chrdet] CHRDET status = 1 | |
[ 40.743819] (0)[70:bat_percent_not][PMIC] bat_per_level=0,bat_per_val=100 | |
[ 40.744718] -(0)[70:bat_percent_not][PMIC] dlpt_notify_task is called | |
[ 40.745594] (0)[71:dlpt_notify_thr][PMIC] [dlpt_notify_handler] 100 100 5500 0 60 | |
[ 40.746581] (0)[71:dlpt_notify_thr][PMIC] [DLPT] is running | |
[ 40.747311] (0)[71:dlpt_notify_thr][PMIC] [upmu_get_rgs_chrdet] CHRDET status = 1 | |
[ 40.752500] (0)[71:dlpt_notify_thr][PBM] [ma_to_mw] 4345(mV) * 5500(mA) = 23897(mW) | |
[ 40.765783] -(1)[0:swapper/1]CPU1: Booted secondary processor | |
[ 40.765799] -(1)[0:swapper/1]Detected VIPT I-cache on CPU1 | |
[ 40.765911] -(1)[0:swapper/1]CPU1: update cpu_capacity 1024 | |
[ 40.766620] -(2)[0:swapper/2]CPU2: Booted secondary processor | |
[ 40.766636] -(2)[0:swapper/2]Detected VIPT I-cache on CPU2 | |
[ 40.766741] -(2)[0:swapper/2]CPU2: update cpu_capacity 1024 | |
[ 40.767242] (1)[130:hps_main][HPS] (0020)(1)action end(100)(205)(0)(0) (8)(8)(8)(8)(1) (96)(7)(1) (0)(0)(0) (1)(205)(8)(0)(205) wifi_base(0) | |
[ 40.792983] (0)[67:kworker/0:1]<ALS/PS> als data[0] | |
[ 40.922573] (1)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1018mv, freq = 1040000 KHz | |
[ 41.069647] (0)[67:kworker/0:1]<ALS/PS> als data[0] | |
[ 41.169359] (1)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 299000 KHz | |
[ 41.176639] (0)[67:kworker/0:1] | |
[ 41.176639] <<SOC DVFS FLIPER>> flip to E(0), 161 | |
[ 41.336118] (1)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1106mv, freq = 1300000 KHz | |
[ 41.346456] (0)[67:kworker/0:1]<ALS/PS> als data[0] | |
[ 41.526016] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 299000 KHz | |
[ 41.569595] (0)[130:hps_main]MobiCore mcd: Cpu 2 is going to die | |
[ 41.572622] (0)[130:hps_main]CPU2: shutdown | |
[ 41.574310] (0)[130:hps_main]MobiCore mcd: Cpu 2 is dead | |
[ 41.576122] (0)[130:hps_main]MobiCore mcd: Cpu 1 is going to die | |
[ 41.578550] (0)[130:hps_main]CPU1: shutdown | |
[ 41.580263] (0)[130:hps_main]MobiCore mcd: Cpu 1 is dead | |
[ 41.581506] (0)[130:hps_main][HPS] (0200)(3)action end(40)(39)(0)(0) (8)(8)(8)(8)(1) (80)(8)(0) (547)(8)(0) (0)(39)(8)(0)(39) wifi_base(0) | |
[ 41.627075] (0)[67:kworker/0:1]<ALS/PS> als data[0] | |
[ 41.633929] (0)[300:[email protected]][LED]Set Backlight directly 0 at time 4294889766, mapping level is 0 | |
[ 41.635194] (0)[300:[email protected]][LED]get_cust_led_dtsi: get the leds info from device tree | |
[ 41.639413] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1106mv, freq = 1300000 KHz | |
[ 41.642281] (0)[300:[email protected]][PWM] disp_pwm_set_backlight_cmdq(id = 0x1, level_1024 = 0), old = 80 | |
[ 41.646421] (0)[589:HwBinder:302_1][Gsensor] enable value=0, sensor_power =1 | |
[ 41.668196] (0)[589:HwBinder:302_1][Gsensor] bma250_enable_nodata OK! | |
[ 41.686167] (0)[589:HwBinder:302_1]<ALS/PS> als_store_active buf=0 | |
[ 41.686977] (0)[589:HwBinder:302_1]<ALS/PS> ALSPS disable | |
[ 41.688052] (0)[589:HwBinder:302_1]<ALS/PS> AAL status is 0 | |
[ 41.688779] (0)[589:HwBinder:302_1][ALS/PS] cm36686_obj als enable value = 0 | |
[ 41.689801] (0)[589:HwBinder:302_1][ALS/PS] cm36686_enable_als disable_als | |
[ 41.691253] (0)[589:HwBinder:302_1][ALS/PS] CM36686_REG_ALS_CONF value value_low = 40, value_high = 0 | |
[ 41.704087] (0)[589:HwBinder:302_1]<ALS/PS> alsps real disable | |
[ 41.704857] (0)[589:HwBinder:302_1]<ALS/PS> alsps_store_active done | |
[ 41.771189] (0)[308:surfaceflinger][HX8394F] lcm_suspend 1139 | |
[ 41.771193] (0)[308:surfaceflinger][HX8394F] push_table 796 | |
[ 41.822653] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 950mv, freq = 299000 KHz | |
[ 41.832499] (0)[1506:kworker/0:2][MUSB]do_low_power_timer_monitor_work 77: state:IDLE_STAGE, last:0, balanced<0,0>, usb_state:CONFIGURED | |
[ 41.883479] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(1)(1)(0)(0) (8)(5)(8)(8)(1) (91)(3)(1) (0)(0)(0) (0)(1)(3)(0)(1) wifi_base(0) | |
[ 42.009860] (0)[308:surfaceflinger][HX8394F] lcm_suspend_power 1104 | |
[ 42.009874] (0)[308:surfaceflinger][HX8394F] lcm_suspend_power, begin | |
[ 42.009898] (0)[308:surfaceflinger][HX8394F] lcm_suspend_power, end | |
[ 42.010108] (0)[308:surfaceflinger][PWM] backlight is off, ddp_pwm power:(0) | |
[ 42.016021] (0)[72:cfinteractive][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1106mv, freq = 1300000 KHz | |
[ 42.016142] (0)[308:surfaceflinger][ION]ion_fb_event: + screen-off + | |
[ 42.016148] (0)[308:surfaceflinger][ION]ion_fb_event: - screen-off - | |
[ 42.032194] (0)[308:surfaceflinger]dyn_fsync_flush: flushing work finished. | |
[ 42.032205] (0)[308:surfaceflinger][Power/cpufreq] @_mt_cpufreq_lcm_status_switch: LCM is off | |
[ 42.032327] (0)[308:surfaceflinger][name:mt_cpufreq&][Power/cpufreq] @_mt_cpufreq_set_locked(): Vproc = 1018mv, freq = 1040000 KHz | |
[ 42.032422] (0)[308:surfaceflinger] | |
[ 42.032422] <<SOC DVFS FLIPER>> Early Suspend and flip to E(0) | |
[ 42.032425] (0)[308:surfaceflinger]fliper disable --- | |
[ 42.032433] (0)[308:surfaceflinger][HXTP] himax852xes_suspend: Enter suspended. | |
[ 42.032436] (0)[308:surfaceflinger][HXTP] himax852xes_suspend: enter | |
[ 42.032442] (0)[308:surfaceflinger][HXTP] irq_enable_count = 0 | |
[ 42.075885] (0)[308:surfaceflinger][HIF-SDIO][W]wmt_fb_notifier_callback:@@@@@@@@@@wmt enter early POWERDOWN @@@@@@@@@@@@@@ | |
[ 42.075909] (0)[1506:kworker/0:2][HIF-SDIO][I]mtk_wcn_wmt_func_ctrl:wmt-exp: OPID(4) type(9) start | |
[ 42.100155] (0)[321:mtk_wmtd][WMT-CORE][I]wmt_core_dump_func_state:[AF FUNC OFF]status(b:0 f:0 g:0 w:2 lpbk:0 coredump:0 wmt:2 ant:0 sd1:0 sd2:0 stp:0) | |
[ 42.102012] (0)[1506:kworker/0:2][HIF-SDIO][I]mtk_wcn_wmt_func_ctrl:OPID(4) type(9) ok | |
[ 42.122486] (0)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, mc_open_device failed: 15 | |
[ 42.184540] -(1)[0:swapper/1]CPU1: Booted secondary processor | |
[ 42.184561] -(1)[0:swapper/1]Detected VIPT I-cache on CPU1 | |
[ 42.184682] -(1)[0:swapper/1]CPU1: update cpu_capacity 1024 | |
[ 42.185527] -(2)[0:swapper/2]CPU2: Booted secondary processor | |
[ 42.185543] -(2)[0:swapper/2]Detected VIPT I-cache on CPU2 | |
[ 42.185661] -(2)[0:swapper/2]CPU2: update cpu_capacity 1024 | |
[ 42.186626] -(3)[0:swapper/3]CPU3: Booted secondary processor | |
[ 42.186647] -(3)[0:swapper/3]Detected VIPT I-cache on CPU3 | |
[ 42.186778] -(3)[0:swapper/3]CPU3: update cpu_capacity 1024 | |
[ 42.187826] -(4)[0:swapper/4]CPU4: Booted secondary processor | |
[ 42.187851] -(4)[0:swapper/4]Detected VIPT I-cache on CPU4 | |
[ 42.187991] -(4)[0:swapper/4]CPU4: update cpu_capacity 1024 | |
[ 42.189069] -(5)[0:swapper/5]CPU5: Booted secondary processor | |
[ 42.189097] -(5)[0:swapper/5]Detected VIPT I-cache on CPU5 | |
[ 42.189229] -(5)[0:swapper/5]CPU5: update cpu_capacity 1024 | |
[ 42.190023] (2)[130:hps_main][HPS] (0020)(1)action end(100)(537)(0)(0) (8)(8)(8)(8)(1) (55)(5)(1) (0)(0)(0) (1)(537)(6)(0)(537) wifi_base(0) | |
[ 42.789107] (0)[187:hang_detect][Hang_Detect] hang_detect disabled. | |
[ 42.992064] (2)[130:hps_main]MobiCore mcd: Cpu 5 is going to die | |
[ 42.993836] (2)[130:hps_main]CPU5: shutdown | |
[ 42.994757] (2)[130:hps_main]MobiCore mcd: Cpu 5 is dead | |
[ 42.995863] (2)[130:hps_main]MobiCore mcd: Cpu 4 is going to die | |
[ 42.997418] (2)[130:hps_main]CPU4: shutdown | |
[ 42.998309] (2)[130:hps_main]MobiCore mcd: Cpu 4 is dead | |
[ 42.999369] (2)[130:hps_main]MobiCore mcd: Cpu 3 is going to die | |
[ 43.000846] (2)[130:hps_main]CPU3: shutdown | |
[ 43.001698] (2)[130:hps_main]MobiCore mcd: Cpu 3 is dead | |
[ 43.002749] (2)[130:hps_main]MobiCore mcd: Cpu 2 is going to die | |
[ 43.004226] (0)[130:hps_main]CPU2: shutdown | |
[ 43.005149] (0)[130:hps_main]MobiCore mcd: Cpu 2 is dead | |
[ 43.006211] (0)[130:hps_main]MobiCore mcd: Cpu 1 is going to die | |
[ 43.007634] (0)[130:hps_main]CPU1: shutdown | |
[ 43.008575] (0)[130:hps_main]MobiCore mcd: Cpu 1 is dead | |
[ 43.009605] (0)[130:hps_main][HPS] (0200)(6)action end(0)(0)(0)(0) (8)(8)(8)(8)(1) (0)(8)(0) (187)(8)(0) (0)(0)(8)(0)(0) wifi_base(0) | |
[ 43.199098] (0)[214:read_poweroff_l]ram_console: open expdb partition error [-2]! | |
[ 43.411318] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(0)(0)(0)(0) (8)(8)(8)(8)(1) (0)(4)(0) (0)(0)(0) (0)(0)(4)(0)(0) wifi_base(0) | |
[ 43.494702] -(0)[0:swapper/0][Power/swap]DP: No enter --- SODI: No enter --- | |
[ 43.495633] -(0)[0:swapper/0][Power/swap]CNT(dpidle,rgidle): [0] = (0,31717), [1] = (0,31302), [2] = (0,25417), [3] = (0,19323), [4] = (0,14139), [5] = (0,13300), [6] = (0,11741), [7] = (0,7554), | |
[ 43.497841] -(0)[0:swapper/0][Power/swap]dpidle_block_cnt: [by_cpu] = 155606, [by_clk] = 334, [by_tmr] = 0, [by_oth] = 0, [by_vtg] = 0, | |
[ 43.499403] -(0)[0:swapper/0][Power/swap]dpidle_block_mask: 0x00000000, 0x00000400, 0x00000001, 0x00000000, 0x000003e1, 0x00000000, 0x00000000, 0x00000000, 0x00000000, 0x00000000, | |
[ 44.125772] (0)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, mc_open_device failed: 15 | |
[ 44.839110] (0)[1506:kworker/0:2][MUSB]do_low_power_timer_monitor_work 77: state:IDLE_STAGE, last:0, balanced<0,0>, usb_state:CONFIGURED | |
[ 44.913471] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(1)(1)(0)(0) (8)(8)(8)(8)(1) (1)(19)(1) (0)(0)(0) (0)(1)(19)(0)(1) wifi_base(0) | |
[ 46.129115] (0)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, mc_open_device failed: 15 | |
[ 46.415635] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(0)(0)(0)(0) (8)(8)(8)(8)(1) (0)(34)(0) (0)(0)(0) (0)(0)(34)(0)(0) wifi_base(0) | |
[ 47.825777] (0)[1506:kworker/0:2][HIF-SDIO][I]wmt_dev_tra_poll:**poll_during_time = 1431403525 > 3000, during_count = 876 > 200, query | |
[ 47.827322] (0)[1506:kworker/0:2][HIF-SDIO][I]wmt_dev_tm_temp_query:traffic , we must query temperature.. | |
[ 47.845761] (0)[67:kworker/0:1][MUSB]do_low_power_timer_monitor_work 77: state:IDLE_STAGE, last:0, balanced<0,0>, usb_state:CONFIGURED | |
[ 47.849906] (0)[321:mtk_wmtd][WMT-CORE][I]opfunc_therm_ctrl:Send WMT_THERM_CTRL_CMD command OK! | |
[ 47.851878] (0)[321:mtk_wmtd][WMT-CORE][I]opfunc_therm_ctrl:Send WMT_THERM_READ_CMD command OK! | |
[ 47.853869] (0)[321:mtk_wmtd][WMT-CORE][I]opfunc_therm_ctrl:Send WMT_THERM_CTRL_CMD command OK! | |
[ 47.855018] (0)[1506:kworker/0:2][HIF-SDIO][I]wmt_dev_tm_temp_query:[Thermal] current_temp = 0x1d | |
[ 47.917780] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(10)(10)(0)(0) (8)(8)(8)(8)(1) (10)(49)(1) (0)(0)(0) (0)(10)(49)(0)(10) wifi_base(0) | |
[ 48.132449] (0)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, mc_open_device failed: 15 | |
[ 49.259135] (0)[908:m.android.phone][md1]traffic(3/0):Tx(7f)5-5,2560-2557,0-0,0-0,0-0,0-0,0-0,0-0:Rx(7f)6,2040,0,0,0,0,0,0 | |
[ 49.260560] (0)[908:m.android.phone][md1]traffic(net): tx: [22]0 0, [26]0 0, [30]0 0, rx:[20]0, [24]0, [28]0 | |
[ 49.420013] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(0)(0)(0)(0) (8)(8)(8)(8)(1) (9)(64)(0) (0)(0)(0) (0)(0)(64)(0)(0) wifi_base(0) | |
[ 50.135785] (0)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, mc_open_device failed: 15 | |
[ 50.467886] (0)[222:bat_thread_kthr][BAT_thread]Cable in, CHR_Type_num=2 | |
[ 50.477463] (0)[222:bat_thread_kthr][force_get_tbat] 786,786,0,95,10,30 | |
[ 50.482775] (0)[222:bat_thread_kthr][force_get_tbat] 786,787,0,103,10,30 | |
[ 50.484027] (0)[222:bat_thread_kthr][dump_nter] mt6328_upmu_get_fg_nter_29_16 = 0x0 | |
[ 50.485029] (0)[222:bat_thread_kthr][dump_nter] mt6328_upmu_get_fg_nter_15_00 = 0x140 | |
[ 50.486081] (0)[222:bat_thread_kthr][dump_car] upmu_get_fg_car_31_16 = 0xffff | |
[ 50.487019] (0)[222:bat_thread_kthr][dump_car] upmu_get_fg_car_15_00 = 0xd400 | |
[ 50.487967] (0)[222:bat_thread_kthr][FGADC] 0,1180,0,4287,95,100,100,2194,2194,22,0,0,1000,4265,1000,0,0,99,103 | |
[ 50.489777] (0)[222:bat_thread_kthr]AvgVbat=(4275,4265),AvgI=(325,0),VChr=5156,AvgT=(29,30),SOC=(100,100),UI_SOC=100,ZCV=4287 bcct:1:0 I:85000 | |
[ 50.494059] (0)[222:bat_thread_kthr][BATTERY] Default CC mode charging : 65000, input current = 320001 | |
[ 50.501561] (0)[222:bat_thread_kthr][bq24158] [0x0]=0xe0 [0x1]=0xd8 [0x2]=0xaa [0x3]=0x51 [0x4]=0x1a [0x5]=0x3 [0x6]=0x7c | |
[ 50.507305] (0)[306:healthd]healthd: battery l=100 v=4343 t=29.0 h=2 st=5 c=0 chg=u | |
[ 50.511135] (0)[306:healthd]healthd: battery l=100 v=4343 t=29.0 h=2 st=5 c=0 chg=u | |
[ 50.512608] (0)[222:bat_thread_kthr][100percent], UI_SOC(100), reset(0) bat_full(1) ever100(1) | |
[ 50.515365] (0)[306:healthd]healthd: battery l=100 v=4343 t=29.0 h=2 st=5 c=0 chg=u | |
[ 50.516426] (0)[222:bat_thread_kthr][recharging] UI_SOC=100, SOC=100 | |
[ 50.517252] (0)[222:bat_thread_kthr]UI_SOC=(100), resetBatteryMeter=(0) | |
[ 50.518127] -(0)[222:bat_thread_kthr]mtk_rtc_hal_common: rtc_spare_reg[0] = {16412, 127, 8} | |
[ 50.519300] (0)[222:bat_thread_kthr]current_now=(0) | |
[ 50.519940] (0)[222:bat_thread_kthr]voltage_now=(4265000) | |
[ 50.522951] (0)[306:healthd]healthd: battery l=100 v=4265 t=29.0 h=2 st=5 c=0 chg=u | |
[ 50.745577] -(0)[0:swapper/0][PMIC] bat_percent_notify_task is called | |
[ 50.746431] (0)[70:bat_percent_not][PMIC] [upmu_get_rgs_chrdet] CHRDET status = 1 | |
[ 50.747398] (0)[70:bat_percent_not][PMIC] bat_per_level=0,bat_per_val=100 | |
[ 50.753646] -(0)[0:swapper/0][PMIC] dlpt_notify_task is called | |
[ 50.754408] (0)[71:dlpt_notify_thr][PMIC] [dlpt_notify_handler] 100 100 5500 0 60 | |
[ 50.755373] (0)[71:dlpt_notify_thr][PMIC] [DLPT] is running | |
[ 50.756136] (0)[71:dlpt_notify_thr][PMIC] [upmu_get_rgs_chrdet] CHRDET status = 1 | |
[ 50.761347] (0)[71:dlpt_notify_thr][PBM] [ma_to_mw] 4266(mV) * 5500(mA) = 23463(mW) | |
[ 50.852432] (0)[1506:kworker/0:2][MUSB]do_low_power_timer_monitor_work 77: state:IDLE_STAGE, last:0, balanced<0,0>, usb_state:CONFIGURED | |
[ 50.922194] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(1)(1)(0)(0) (8)(8)(8)(8)(1) (8)(79)(1) (0)(0)(0) (0)(1)(79)(0)(1) wifi_base(0) | |
[ 52.139117] (0)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, mc_open_device failed: 15 | |
[ 52.424348] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(0)(0)(0)(0) (8)(8)(8)(8)(1) (0)(94)(0) (0)(0)(0) (0)(0)(94)(0)(0) wifi_base(0) | |
[ 52.726360] -(1)[0:swapper/1]CPU1: Booted secondary processor | |
[ 52.726381] -(1)[0:swapper/1]Detected VIPT I-cache on CPU1 | |
[ 52.726497] -(1)[0:swapper/1]CPU1: update cpu_capacity 1024 | |
[ 52.727324] -(2)[0:swapper/2]CPU2: Booted secondary processor | |
[ 52.727338] -(2)[0:swapper/2]Detected VIPT I-cache on CPU2 | |
[ 52.727443] -(2)[0:swapper/2]CPU2: update cpu_capacity 1024 | |
[ 52.728180] -(3)[0:swapper/3]CPU3: Booted secondary processor | |
[ 52.728194] -(3)[0:swapper/3]Detected VIPT I-cache on CPU3 | |
[ 52.728298] -(3)[0:swapper/3]CPU3: update cpu_capacity 1024 | |
[ 52.728791] (0)[130:hps_main][HPS] (0020)(1)action end(100)(306)(0)(0) (8)(8)(8)(8)(1) (41)(96)(0) (0)(0)(0) (1)(306)(97)(0)(306) wifi_base(0) | |
[ 53.504565] -(0)[0:swapper/0][Power/swap]DP: No enter --- SODI: No enter --- | |
[ 53.530878] (1)[130:hps_main]MobiCore mcd: Cpu 3 is going to die | |
[ 53.532480] (1)[130:hps_main]CPU3: shutdown | |
[ 53.533369] (1)[130:hps_main]MobiCore mcd: Cpu 3 is dead | |
[ 53.534419] (1)[130:hps_main]MobiCore mcd: Cpu 2 is going to die | |
[ 53.535915] (0)[130:hps_main]CPU2: shutdown | |
[ 53.536789] (0)[130:hps_main]MobiCore mcd: Cpu 2 is dead | |
[ 53.537829] (0)[130:hps_main]MobiCore mcd: Cpu 1 is going to die | |
[ 53.539269] (0)[130:hps_main]CPU1: shutdown | |
[ 53.540104] (0)[130:hps_main]MobiCore mcd: Cpu 1 is dead | |
[ 53.541100] (0)[130:hps_main][HPS] (0200)(4)action end(0)(0)(0)(0) (8)(8)(8)(8)(1) (0)(8)(0) (116)(8)(0) (0)(0)(8)(0)(0) wifi_base(0) | |
[ 53.855766] (0)[228:wdtk-0][WDK], local_bit:0x0, cpu:0,RT[53855759743] | |
[ 53.855773] (0)[228:wdtk-0][WDK], local_bit:0x1, cpu:0, check bit0x:1, lasthpg_cpu:1, lasthpg_act:0, lasthpg_t:53539911665, RT[53855767666] | |
[ 53.855777] (0)[228:wdtk-0][WDK]: kick Ex WDT,RT[53855774743] | |
[ 53.855844] (0)[228:wdtk-0][thread:228][RT:53855834281] 2019-05-03 13:33:24.926378 UTC;android time 2019-05-03 15:33:24.926378 | |
[ 53.863781] (0)[1506:kworker/0:2][MUSB]do_low_power_timer_monitor_work 77: state:IDLE_STAGE, last:0, balanced<0,0>, usb_state:CONFIGURED | |
[ 53.942845] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(6)(2)(0)(0) (8)(8)(8)(8)(1) (6)(4)(0) (0)(0)(0) (0)(2)(4)(0)(2) wifi_base(0) | |
[ 54.142444] (0)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, mc_open_device failed: 15 | |
[ 55.444929] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(0)(0)(0)(0) (8)(8)(8)(8)(1) (0)(19)(1) (0)(0)(0) (0)(0)(19)(0)(0) wifi_base(0) | |
[ 56.145782] (0)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, mc_open_device failed: 15 | |
[ 56.865772] (0)[1506:kworker/0:2][MUSB]do_low_power_timer_monitor_work 77: state:IDLE_STAGE, last:0, balanced<0,0>, usb_state:CONFIGURED | |
[ 56.947273] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(1)(1)(0)(0) (8)(8)(8)(8)(1) (42)(34)(0) (0)(0)(0) (0)(1)(34)(0)(1) wifi_base(0) | |
[ 58.149116] (0)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, mc_open_device failed: 15 | |
[ 58.450365] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(2)(5)(0)(0) (8)(8)(8)(8)(1) (2)(49)(1) (0)(0)(0) (0)(5)(49)(0)(5) wifi_base(0) | |
[ 59.872434] (0)[1506:kworker/0:2][MUSB]do_low_power_timer_monitor_work 77: state:IDLE_STAGE, last:0, balanced<0,0>, usb_state:CONFIGURED | |
[ 59.952510] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(2)(2)(0)(0) (8)(8)(8)(8)(1) (2)(64)(0) (0)(0)(0) (0)(2)(64)(0)(2) wifi_base(0) | |
[ 60.152441] (0)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, mc_open_device failed: 15 | |
[ 60.467913] (0)[222:bat_thread_kthr][BAT_thread]Cable in, CHR_Type_num=2 | |
[ 60.477466] (0)[222:bat_thread_kthr][force_get_tbat] 785,785,0,82,10,30 | |
[ 60.482772] (0)[222:bat_thread_kthr][force_get_tbat] 785,785,0,89,10,30 | |
[ 60.483998] (0)[222:bat_thread_kthr][dump_nter] mt6328_upmu_get_fg_nter_29_16 = 0x0 | |
[ 60.485000] (0)[222:bat_thread_kthr][dump_nter] mt6328_upmu_get_fg_nter_15_00 = 0x1e0 | |
[ 60.486070] (0)[222:bat_thread_kthr][dump_car] upmu_get_fg_car_31_16 = 0xffff | |
[ 60.487008] (0)[222:bat_thread_kthr][dump_car] upmu_get_fg_car_15_00 = 0x2967 | |
[ 60.487956] (0)[222:bat_thread_kthr][FGADC] 0,896,0,4282,94,100,100,2194,2194,17,0,0,1000,4265,1000,0,0,99,103 | |
[ 60.489766] (0)[222:bat_thread_kthr]AvgVbat=(4277,4265),AvgI=(260,0),VChr=5156,AvgT=(29,30),SOC=(100,100),UI_SOC=100,ZCV=4282 bcct:1:0 I:85000 | |
[ 60.494044] (0)[222:bat_thread_kthr][BATTERY] Default CC mode charging : 65000, input current = 320001 | |
[ 60.501832] (0)[222:bat_thread_kthr][bq24158] [0x0]=0xe0 [0x1]=0xd8 [0x2]=0xaa [0x3]=0x51 [0x4]=0x1a [0x5]=0x3 [0x6]=0x7c | |
[ 60.507592] (0)[306:healthd]healthd: battery l=100 v=4265 t=29.0 h=2 st=5 c=0 chg=u | |
[ 60.511842] (0)[306:healthd]healthd: battery l=100 v=4265 t=29.0 h=2 st=5 c=0 chg=u | |
[ 60.513404] (0)[222:bat_thread_kthr][100percent], UI_SOC(100), reset(0) bat_full(1) ever100(1) | |
[ 60.516309] (0)[306:healthd]healthd: battery l=100 v=4265 t=29.0 h=2 st=5 c=0 chg=u | |
[ 60.517687] (0)[222:bat_thread_kthr][recharging] UI_SOC=100, SOC=100 | |
[ 60.518514] (0)[222:bat_thread_kthr]UI_SOC=(100), resetBatteryMeter=(0) | |
[ 60.519555] -(0)[222:bat_thread_kthr]mtk_rtc_hal_common: rtc_spare_reg[0] = {16412, 127, 8} | |
[ 60.520698] (0)[222:bat_thread_kthr]current_now=(0) | |
[ 60.521337] (0)[222:bat_thread_kthr]voltage_now=(4265000) | |
[ 60.523899] (0)[306:healthd]healthd: battery l=100 v=4265 t=29.0 h=2 st=5 c=0 chg=u | |
[ 60.748308] -(0)[0:swapper/0][PMIC] bat_percent_notify_task is called | |
[ 60.749154] (0)[70:bat_percent_not][PMIC] [upmu_get_rgs_chrdet] CHRDET status = 1 | |
[ 60.750121] (0)[70:bat_percent_not][PMIC] bat_per_level=0,bat_per_val=100 | |
[ 60.762400] -(0)[0:swapper/0][PMIC] dlpt_notify_task is called | |
[ 60.763162] (0)[71:dlpt_notify_thr][PMIC] [dlpt_notify_handler] 100 100 5500 0 60 | |
[ 60.764127] (0)[71:dlpt_notify_thr][PMIC] [DLPT] is running | |
[ 60.764870] (0)[71:dlpt_notify_thr][PMIC] [upmu_get_rgs_chrdet] CHRDET status = 1 | |
[ 60.772150] (0)[71:dlpt_notify_thr][PBM] [ma_to_mw] 4263(mV) * 5500(mA) = 23446(mW) | |
[ 61.454711] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(61)(66)(0)(0) (8)(8)(8)(8)(1) (103)(79)(1) (0)(0)(0) (0)(66)(79)(0)(66) wifi_base(0) | |
[ 62.155783] (0)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, mc_open_device failed: 15 | |
[ 62.879142] (0)[1506:kworker/0:2][MUSB]do_low_power_timer_monitor_work 77: state:IDLE_STAGE, last:0, balanced<0,0>, usb_state:CONFIGURED | |
[ 62.957230] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(2)(2)(0)(0) (8)(8)(8)(8)(1) (2)(94)(0) (0)(0)(0) (0)(2)(94)(0)(2) wifi_base(0) | |
[ 63.517244] -(0)[0:swapper/0][Power/swap]DP: No enter --- SODI: No enter --- | |
[ 64.159106] (0)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, mc_open_device failed: 15 | |
[ 64.460359] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(0)(0)(0)(0) (8)(8)(8)(8)(1) (0)(109)(1) (0)(0)(0) (0)(0)(109)(0)(0) wifi_base(0) | |
[ 65.885780] (0)[1506:kworker/0:2][MUSB]do_low_power_timer_monitor_work 77: state:IDLE_STAGE, last:0, balanced<0,0>, usb_state:CONFIGURED | |
[ 65.962551] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(1)(1)(0)(0) (8)(8)(8)(8)(1) (1)(124)(0) (0)(0)(0) (0)(1)(124)(0)(1) wifi_base(0) | |
[ 66.162443] (0)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, mc_open_device failed: 15 | |
[ 66.464665] -(1)[0:swapper/1]CPU1: Booted secondary processor | |
[ 66.464685] -(1)[0:swapper/1]Detected VIPT I-cache on CPU1 | |
[ 66.464801] -(1)[0:swapper/1]CPU1: update cpu_capacity 1024 | |
[ 66.465352] (0)[130:hps_main][HPS] (0020)(1)action end(100)(110)(0)(0) (8)(8)(8)(8)(1) (38)(128)(0) (0)(0)(0) (1)(110)(129)(0)(110) wifi_base(0) | |
[ 67.267462] (1)[130:hps_main]MobiCore mcd: Cpu 1 is going to die | |
[ 67.269004] (0)[130:hps_main]CPU1: shutdown | |
[ 67.269995] (0)[130:hps_main]MobiCore mcd: Cpu 1 is dead | |
[ 67.271001] (0)[130:hps_main][HPS] (0200)(2)action end(0)(0)(0)(0) (8)(8)(8)(8)(1) (0)(8)(0) (283)(8)(0) (0)(0)(8)(0)(0) wifi_base(0) | |
[ 67.472642] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(0)(0)(0)(0) (8)(8)(8)(8)(1) (4)(2)(0) (0)(0)(0) (0)(0)(2)(0)(0) wifi_base(0) | |
[ 68.165775] (0)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, mc_open_device failed: 15 | |
[ 68.892438] (0)[1506:kworker/0:2][MUSB]do_low_power_timer_monitor_work 77: state:IDLE_STAGE, last:0, balanced<0,0>, usb_state:CONFIGURED | |
[ 68.974760] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(1)(1)(0)(0) (8)(8)(8)(8)(1) (1)(17)(1) (0)(0)(0) (0)(1)(17)(0)(1) wifi_base(0) | |
[ 70.169115] (0)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, mc_open_device failed: 15 | |
[ 70.467947] (0)[222:bat_thread_kthr][BAT_thread]Cable in, CHR_Type_num=2 | |
[ 70.476006] (0)[222:bat_thread_kthr][force_get_tbat] 781,782,0,148,10,30 | |
[ 70.476960] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(26)(29)(0)(0) (8)(8)(8)(8)(1) (26)(32)(0) (0)(0)(0) (0)(29)(32)(0)(29) wifi_base(0) | |
[ 70.482658] (0)[222:bat_thread_kthr][force_get_tbat] 783,784,0,148,10,30 | |
[ 70.483904] (0)[222:bat_thread_kthr][dump_nter] mt6328_upmu_get_fg_nter_29_16 = 0x0 | |
[ 70.484907] (0)[222:bat_thread_kthr][dump_nter] mt6328_upmu_get_fg_nter_15_00 = 0x280 | |
[ 70.485979] (0)[222:bat_thread_kthr][dump_car] upmu_get_fg_car_31_16 = 0xfffe | |
[ 70.486917] (0)[222:bat_thread_kthr][dump_car] upmu_get_fg_car_15_00 = 0x7d53 | |
[ 70.487865] (0)[222:bat_thread_kthr][FGADC] 0,1483,0,4267,93,100,100,2194,2194,27,0,0,1000,4240,1000,0,0,99,103 | |
[ 70.492506] (0)[222:bat_thread_kthr]AvgVbat=(4277,4240),AvgI=(195,0),VChr=5156,AvgT=(29,30),SOC=(100,100),UI_SOC=100,ZCV=4267 bcct:1:0 I:85000 | |
[ 70.496786] (0)[222:bat_thread_kthr][BATTERY] Default CC mode charging : 65000, input current = 320001 | |
[ 70.504269] (0)[222:bat_thread_kthr][bq24158] [0x0]=0xe0 [0x1]=0xd8 [0x2]=0xaa [0x3]=0x51 [0x4]=0x1a [0x5]=0x3 [0x6]=0x7c | |
[ 70.508671] (0)[222:bat_thread_kthr][100percent], UI_SOC(100), reset(0) bat_full(1) ever100(1) | |
[ 70.511268] (0)[306:healthd]healthd: battery l=100 v=4265 t=29.0 h=2 st=5 c=0 chg=u | |
[ 70.514880] (0)[306:healthd]healthd: battery l=100 v=4265 t=29.0 h=2 st=5 c=0 chg=u | |
[ 70.515950] (0)[222:bat_thread_kthr][recharging] UI_SOC=100, SOC=100 | |
[ 70.516776] (0)[222:bat_thread_kthr]UI_SOC=(100), resetBatteryMeter=(0) | |
[ 70.517651] -(0)[222:bat_thread_kthr]mtk_rtc_hal_common: rtc_spare_reg[0] = {16412, 127, 8} | |
[ 70.518772] (0)[222:bat_thread_kthr]current_now=(0) | |
[ 70.519429] (0)[222:bat_thread_kthr]voltage_now=(4240000) | |
[ 70.522356] (0)[306:healthd]healthd: battery l=100 v=4240 t=29.0 h=2 st=5 c=0 chg=u | |
[ 70.530326] (0)[306:healthd]healthd: battery l=100 v=4240 t=29.0 h=2 st=5 c=0 chg=u | |
[ 70.751034] -(0)[0:swapper/0][PMIC] bat_percent_notify_task is called | |
[ 70.751887] (0)[70:bat_percent_not][PMIC] [upmu_get_rgs_chrdet] CHRDET status = 1 | |
[ 70.752873] (0)[70:bat_percent_not][PMIC] bat_per_level=0,bat_per_val=100 | |
[ 70.773212] -(0)[0:swapper/0][PMIC] dlpt_notify_task is called | |
[ 70.773974] (0)[71:dlpt_notify_thr][PMIC] [dlpt_notify_handler] 100 100 5500 0 60 | |
[ 70.774939] (0)[71:dlpt_notify_thr][PMIC] [DLPT] is running | |
[ 70.775682] (0)[71:dlpt_notify_thr][PMIC] [upmu_get_rgs_chrdet] CHRDET status = 1 | |
[ 70.780803] (0)[71:dlpt_notify_thr][PBM] [ma_to_mw] 4261(mV) * 5500(mA) = 23435(mW) | |
[ 71.899105] (0)[1506:kworker/0:2][MUSB]do_low_power_timer_monitor_work 77: state:IDLE_STAGE, last:0, balanced<0,0>, usb_state:CONFIGURED | |
[ 71.979243] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(1)(1)(0)(0) (8)(8)(8)(8)(1) (1)(47)(1) (0)(0)(0) (0)(1)(47)(0)(1) wifi_base(0) | |
[ 72.172446] (0)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, mc_open_device failed: 15 | |
[ 72.792422] (0)[187:hang_detect][Hang_Detect] hang_detect disabled. | |
[ 73.481358] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(0)(0)(0)(0) (8)(8)(8)(8)(1) (0)(62)(0) (0)(0)(0) (0)(0)(62)(0)(0) wifi_base(0) | |
[ 73.528523] -(0)[0:swapper/0][Power/swap]DP: No enter --- SODI: No enter --- | |
[ 73.529454] -(0)[0:swapper/0][Power/swap]CNT(dpidle,rgidle): [0] = (0,32018), [1] = (0,31417), [2] = (0,25459), [3] = (0,19345), [4] = (0,14139), [5] = (0,13300), [6] = (0,11741), [7] = (0,7554), | |
[ 73.531662] -(0)[0:swapper/0][Power/swap]dpidle_block_cnt: [by_cpu] = 325, [by_clk] = 1205, [by_tmr] = 0, [by_oth] = 0, [by_vtg] = 0, | |
[ 73.533203] -(0)[0:swapper/0][Power/swap]dpidle_block_mask: 0x00000000, 0x00000400, 0x00000001, 0x00000000, 0x000003e1, 0x00000000, 0x00000000, 0x00000000, 0x00000000, 0x00000000, | |
[ 73.859091] (0)[228:wdtk-0][WDK], local_bit:0x0, cpu:0,RT[73859085406] | |
[ 73.859099] (0)[228:wdtk-0][WDK], local_bit:0x1, cpu:0, check bit0x:1, lasthpg_cpu:1, lasthpg_act:0, lasthpg_t:67269714467, RT[73859093790] | |
[ 73.859103] (0)[228:wdtk-0][WDK]: kick Ex WDT,RT[73859100713] | |
[ 73.859219] (0)[228:wdtk-0][thread:228][RT:73859209713] 2019-05-03 13:33:44.929756 UTC;android time 2019-05-03 15:33:44.929756 | |
[ 74.175762] (0)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, mc_open_device failed: 15 | |
[ 74.176826] (0)[236:rpmb_open][emmcrpmb] emmc_rpmb_open_session, open session failed!!! | |
[ 74.905759] (0)[1506:kworker/0:2][MUSB]do_low_power_timer_monitor_work 77: state:IDLE_STAGE, last:0, balanced<0,0>, usb_state:CONFIGURED | |
[ 74.983485] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(1)(1)(0)(0) (8)(8)(8)(8)(1) (1)(77)(1) (0)(0)(0) (0)(1)(77)(0)(1) wifi_base(0) | |
[ 76.485592] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(0)(0)(0)(0) (8)(8)(8)(8)(1) (0)(92)(0) (0)(0)(0) (0)(0)(92)(0)(0) wifi_base(0) | |
[ 77.912426] (0)[1506:kworker/0:2][MUSB]do_low_power_timer_monitor_work 77: state:IDLE_STAGE, last:0, balanced<0,0>, usb_state:CONFIGURED | |
[ 77.987766] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(2)(1)(0)(0) (8)(8)(8)(8)(1) (2)(107)(1) (0)(0)(0) (0)(1)(107)(0)(1) wifi_base(0) | |
[ 79.489927] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(0)(0)(0)(0) (8)(8)(8)(8)(1) (0)(122)(0) (0)(0)(0) (0)(0)(122)(0)(0) wifi_base(0) | |
[ 80.467963] (0)[222:bat_thread_kthr][BAT_thread]Cable in, CHR_Type_num=2 | |
[ 80.477519] (0)[222:bat_thread_kthr][force_get_tbat] 789,789,0,81,10,30 | |
[ 80.482826] (0)[222:bat_thread_kthr][force_get_tbat] 790,790,0,90,10,30 | |
[ 80.484051] (0)[222:bat_thread_kthr][dump_nter] mt6328_upmu_get_fg_nter_29_16 = 0x0 | |
[ 80.485054] (0)[222:bat_thread_kthr][dump_nter] mt6328_upmu_get_fg_nter_15_00 = 0x320 | |
[ 80.486109] (0)[222:bat_thread_kthr][dump_car] upmu_get_fg_car_31_16 = 0xfffd | |
[ 80.487048] (0)[222:bat_thread_kthr][dump_car] upmu_get_fg_car_15_00 = 0xd8e0 | |
[ 80.488000] (0)[222:bat_thread_kthr][FGADC] 0,902,0,4279,94,100,100,2194,2194,17,0,0,1000,4262,1000,0,0,99,103 | |
[ 80.489800] (0)[222:bat_thread_kthr]AvgVbat=(4279,4262),AvgI=(130,0),VChr=5147,AvgT=(29,30),SOC=(100,100),UI_SOC=100,ZCV=4279 bcct:1:0 I:85000 | |
[ 80.494084] (0)[222:bat_thread_kthr][BATTERY] Default CC mode charging : 65000, input current = 320001 | |
[ 80.501587] (0)[222:bat_thread_kthr][bq24158] [0x0]=0xe0 [0x1]=0xd8 [0x2]=0xaa [0x3]=0x51 [0x4]=0x1a [0x5]=0x3 [0x6]=0x7c | |
[ 80.507300] (0)[306:healthd]healthd: battery l=100 v=4240 t=29.0 h=2 st=5 c=0 chg=u | |
[ 80.511150] (0)[306:healthd]healthd: battery l=100 v=4240 t=29.0 h=2 st=5 c=0 chg=u | |
[ 80.512623] (0)[222:bat_thread_kthr][100percent], UI_SOC(100), reset(0) bat_full(1) ever100(1) | |
[ 80.515391] (0)[306:healthd]healthd: battery l=100 v=4240 t=29.0 h=2 st=5 c=0 chg=u | |
[ 80.516453] (0)[222:bat_thread_kthr][recharging] UI_SOC=100, SOC=100 | |
[ 80.517279] (0)[222:bat_thread_kthr]UI_SOC=(100), resetBatteryMeter=(0) | |
[ 80.518153] -(0)[222:bat_thread_kthr]mtk_rtc_hal_common: rtc_spare_reg[0] = {16412, 127, 8} | |
[ 80.519324] (0)[222:bat_thread_kthr]current_now=(0) | |
[ 80.519964] (0)[222:bat_thread_kthr]voltage_now=(4262000) | |
[ 80.522904] (0)[306:healthd]healthd: battery l=100 v=4262 t=29.0 h=2 st=5 c=0 chg=u | |
[ 80.753779] -(0)[0:swapper/0][PMIC] bat_percent_notify_task is called | |
[ 80.754632] (0)[70:bat_percent_not][PMIC] [upmu_get_rgs_chrdet] CHRDET status = 1 | |
[ 80.755599] (0)[70:bat_percent_not][PMIC] bat_per_level=0,bat_per_val=100 | |
[ 80.781855] -(0)[0:swapper/0][PMIC] dlpt_notify_task is called | |
[ 80.782618] (0)[71:dlpt_notify_thr][PMIC] [dlpt_notify_handler] 100 100 5500 0 60 | |
[ 80.783583] (0)[71:dlpt_notify_thr][PMIC] [DLPT] is running | |
[ 80.784326] (0)[71:dlpt_notify_thr][PMIC] [upmu_get_rgs_chrdet] CHRDET status = 1 | |
[ 80.791565] (0)[71:dlpt_notify_thr][PBM] [ma_to_mw] 4261(mV) * 5500(mA) = 23435(mW) | |
[ 80.919094] (0)[1506:kworker/0:2][MUSB]do_low_power_timer_monitor_work 77: state:IDLE_STAGE, last:0, balanced<0,0>, usb_state:CONFIGURED | |
[ 80.992685] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(1)(1)(0)(0) (8)(8)(8)(8)(1) (1)(137)(1) (0)(0)(0) (0)(1)(137)(0)(1) wifi_base(0) | |
[ 82.494827] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(0)(0)(0)(0) (8)(8)(8)(8)(1) (0)(152)(0) (0)(0)(0) (0)(0)(152)(0)(0) wifi_base(0) | |
[ 83.297107] -(1)[0:swapper/1]CPU1: Booted secondary processor | |
[ 83.297129] -(1)[0:swapper/1]Detected VIPT I-cache on CPU1 | |
[ 83.297249] -(1)[0:swapper/1]CPU1: update cpu_capacity 1024 | |
[ 83.298116] -(2)[0:swapper/2]CPU2: Booted secondary processor | |
[ 83.298134] -(2)[0:swapper/2]Detected VIPT I-cache on CPU2 | |
[ 83.298252] -(2)[0:swapper/2]CPU2: update cpu_capacity 1024 | |
[ 83.298844] (0)[130:hps_main][HPS] (0020)(1)action end(100)(300)(0)(0) (8)(8)(8)(8)(1) (82)(159)(1) (0)(0)(0) (1)(300)(160)(0)(300) wifi_base(0) | |
[ 83.600760] -(0)[0:swapper/0][Power/swap]DP: No enter --- SODI: No enter --- | |
[ 83.925762] (0)[1506:kworker/0:2][MUSB]do_low_power_timer_monitor_work 77: state:IDLE_STAGE, last:0, balanced<0,0>, usb_state:CONFIGURED | |
[ 84.000902] (0)[130:hps_main][HPS] (0000)(3)DBG_HRT(1)(1)(0)(0) (8)(8)(8)(8)(1) (1)(7)(1) (213)(7)(7) (0)(1)(7)(0)(1) wifi_base(0) | |
[ 84.102534] (0)[130:hps_main]MobiCore mcd: Cpu 2 is going to die | |
[ 84.104067] (0)[130:hps_main]CPU2: shutdown | |
[ 84.105131] (0)[130:hps_main]MobiCore mcd: Cpu 2 is dead | |
[ 84.106237] (0)[130:hps_main]MobiCore mcd: Cpu 1 is going to die | |
[ 84.107675] (0)[130:hps_main]CPU1: shutdown | |
[ 84.108675] (0)[130:hps_main]MobiCore mcd: Cpu 1 is dead | |
[ 84.109691] (0)[130:hps_main][HPS] (0200)(3)action end(1)(1)(0)(0) (8)(8)(8)(8)(1) (2)(8)(0) (214)(8)(0) (0)(1)(8)(0)(1) wifi_base(0) | |
[ 85.511796] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(0)(0)(0)(0) (8)(8)(8)(8)(1) (0)(14)(0) (0)(0)(0) (0)(0)(14)(0)(0) wifi_base(0) | |
[ 86.932440] (0)[1506:kworker/0:2][MUSB]do_low_power_timer_monitor_work 77: state:IDLE_STAGE, last:0, balanced<0,0>, usb_state:CONFIGURED | |
[ 87.013968] (0)[130:hps_main][HPS] (0000)(1)DBG_HRT(1)(1)(0)(0) (8)(8)(8)(8)(1) (4)(29)(1) (0)(0)(0) (0)(1)(29)(0)(1) wifi_base(0) | |
m4h0n3y@troislitresdevodka:~/Desktop/bml/CIK$ |
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment