Testing api client

index.js

!function(){"use strict";try{if("undefined"!=typeof document){var a=document.createElement("style");a.appendChild(document.createTextNode('.scalar-icon[data-v-a4126bd9],.scalar-icon[data-v-a4126bd9] *{stroke-width:var(--3c7f90fa)}.scalar-modal-layout[data-v-e37b0bd8]{animation:fadein-layout-e37b0bd8 ease-in-out .3s forwards}.scalar-modal[data-v-e37b0bd8]{animation:fadein-modal-e37b0bd8 ease-in-out .3s forwards;animation-delay:.1s;position:fixed;left:0;top:0;right:0;box-shadow:var(--scalar-shadow-2);transform:translate3d(0,10px,0)}.dark-mode .scalar-modal[data-v-e37b0bd8]{background-color:color-mix(in srgb,var(--scalar-background-1),black)}.scalar-modal.scalar-modal-search[data-v-e37b0bd8]{max-width:540px;max-height:440px;background-color:transparent}.modal-content-search .modal-body[data-v-e37b0bd8]{padding:0;overflow:hidden;display:flex;flex-direction:column;max-height:440px}@media (max-width: 1280px){.scalar-modal[data-v-e37b0bd8]{max-height:calc(100% - 56px);top:28px}}@keyframes fadein-layout-e37b0bd8{0%{opacity:0}to{opacity:1}}@keyframes fadein-modal-e37b0bd8{0%{opacity:0;transform:translate3d(0,10px,0)}to{opacity:1;transform:translateZ(0)}}.full-size-styles[data-v-e37b0bd8]{transform:translateZ(0);animation:fadein-layout-e37b0bd8 ease-in-out .3s forwards;max-height:100%!important;top:0!important;width:100%!important;border-radius:0!important;background-color:color-mix(in srgb,var(--scalar-background-1),transparent 6%)!important}@layer scalar-base,scalar-theme;@layer scalar-base{body{margin:0;line-height:inherit}}:where(.scalar-app){font-family:var(--scalar-font);line-height:1.15;-webkit-text-size-adjust:100%;-moz-tab-size:4;-o-tab-size:4;tab-size:4}:where(.scalar-app) *,:where(.scalar-app) *:before,:where(.scalar-app) *:after{box-sizing:border-box;border-width:0;border-style:solid;border-color:var(--scalar-border-color);outline-width:1px;outline-style:none;outline-color:var(--scalar-color-accent);font-family:inherit;font-feature-settings:inherit;font-variation-settings:inherit;font-size:inherit;font-weight:inherit;line-height:inherit;color:inherit;margin:unset;padding:unset;text-rendering:optimizeLegibility;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}:where(.scalar-app) :before,:where(.scalar-app) :after{--tw-content: ""}:where(.scalar-app) button,:where(.scalar-app) input,:where(.scalar-app) optgroup,:where(.scalar-app) select,:where(.scalar-app) textarea,:where(.scalar-app) ::file-selector-button{background:transparent}:where(.scalar-app) ol,:where(.scalar-app) ul,:where(.scalar-app) menu{list-style:none}:where(.scalar-app) input:where(:not([type=button],[type=reset],[type=submit])),:where(.scalar-app) select,:where(.scalar-app) textarea{border-radius:var(--scalar-radius);border-width:1px}:where(.scalar-app) input::-moz-placeholder{color:var(--scalar-color-3);font-family:var(--scalar-font)}:where(.scalar-app) input::placeholder{color:var(--scalar-color-3);font-family:var(--scalar-font)}:where(.scalar-app) input[type=search]::-webkit-search-cancel-button,:where(.scalar-app) input[type=search]::-webkit-search-decoration{-webkit-appearance:none;-moz-appearance:none;appearance:none}:where(.scalar-app) input:-webkit-autofill{-webkit-background-clip:text!important;background-clip:text!important}:where(.scalar-app) :focus-visible{outline-style:solid}:where(.scalar-app) button,:where(.scalar-app) [role=button]{cursor:pointer}:where(.scalar-app) :disabled{cursor:default}:where(.scalar-app) img,:where(.scalar-app) svg,:where(.scalar-app) video,:where(.scalar-app) canvas,:where(.scalar-app) audio,:where(.scalar-app) iframe,:where(.scalar-app) embed,:where(.scalar-app) object{display:block;vertical-align:middle}:where(.scalar-app) [hidden]{display:none}.scalar-app .cm-scroller,.scalar-app .custom-scroll{overflow-y:auto;scrollbar-color:transparent transparent;scrollbar-width:thin;-webkit-overflow-scrolling:touch}.scalar-app .custom-scroll-self-contain-overflow{overscroll-behavior:contain}.scalar-app .cm-scroller:hover,.scalar-app .custom-scroll:hover,.scalar-app.scalar-scrollbars-obtrusive .cm-scroller,.scalar-app.scalar-scrollbars-obtrusive .custom-scroll{scrollbar-color:var(--scalar-scrollbar-color, transparent) transparent}.scalar-app .cm-scroller:hover::-webkit-scrollbar-thumb,.scalar-app .custom-scroll:hover::-webkit-scrollbar-thumb{background:var(--scalar-scrollbar-color);background-clip:content-box;border:3px solid transparent}.scalar-app .cm-scroller::-webkit-scrollbar-thumb:active,.scalar-app .custom-scroll::-webkit-scrollbar-thumb:active{background:var(--scalar-scrollbar-color-active);background-clip:content-box;border:3px solid transparent}.scalar-app .cm-scroller::-webkit-scrollbar-corner,.scalar-app .custom-scroll::-webkit-scrollbar-corner{background:transparent}.scalar-app .cm-scroller::-webkit-scrollbar,.scalar-app .custom-scroll::-webkit-scrollbar{height:12px;width:12px}.scalar-app .cm-scroller::-webkit-scrollbar-track,.scalar-app .custom-scroll::-webkit-scrollbar-track{background:transparent}.scalar-app .cm-scroller::-webkit-scrollbar-thumb,.scalar-app .custom-scroll::-webkit-scrollbar-thumb{border-radius:20px;background:transparent;background-clip:content-box;border:3px solid transparent}@media (pointer: coarse){.scalar-app .cm-scroller,.scalar-app .custom-scroll{padding-right:12px}}@layer scalar-base{:root{--scalar-border-width: .5px;--scalar-radius: 3px;--scalar-radius-lg: 6px;--scalar-radius-xl: 8px;--scalar-font: "Inter", -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, Oxygen, Ubuntu, Cantarell, "Open Sans", "Helvetica Neue", sans-serif;--scalar-font-code: "JetBrains Mono", ui-monospace, Menlo, Monaco, "Cascadia Mono", "Segoe UI Mono", "Roboto Mono", "Oxygen Mono", "Ubuntu Monospace", "Source Code Pro", "Fira Mono", "Droid Sans Mono", "Courier New", monospace;--scalar-heading-1: 40px;--scalar-page-description: 24px;--scalar-heading-2: 24px;--scalar-heading-3: 20px;--scalar-heading-4: 16px;--scalar-heading-5: 16px;--scalar-heading-6: 16px;--scalar-paragraph: 16px;--scalar-small: 14px;--scalar-mini: 13px;--scalar-micro: 12px;--scalar-bold: 600;--scalar-semibold: 500;--scalar-regular: 400;--scalar-font-size-1: 24px;--scalar-font-size-2: 16px;--scalar-font-size-3: 14px;--scalar-font-size-4: 13px;--scalar-font-size-5: 12px;--scalar-font-size-6: 12px;--scalar-font-size-7: 10px;--scalar-line-height-1: 32px;--scalar-line-height-2: 24px;--scalar-line-height-3: 20px;--scalar-line-height-4: 18px;--scalar-line-height-5: 16px;--scalar-font-medium: 500;--scalar-font-bold: 700;--scalar-text-decoration: none;--scalar-text-decoration-hover: underline}.dark-mode{color-scheme:dark;--scalar-scrollbar-color: rgba(255, 255, 255, .18);--scalar-scrollbar-color-active: rgba(255, 255, 255, .36);--scalar-button-1: rgba(255, 255, 255, 1);--scalar-button-1-hover: rgba(255, 255, 255, .9);--scalar-button-1-color: black;--scalar-shadow-1: 0 1px 3px 0 rgb(0, 0, 0, .1);--scalar-shadow-2: rgba(15, 15, 15, .2) 0px 3px 6px, rgba(15, 15, 15, .4) 0px 9px 24px, 0 0 0 1px var(--scalar-border-color);--scalar-lifted-brightness: 1.45;--scalar-backdrop-brightness: .5;--scalar-sidebar-indent-border: transparent;--scalar-sidebar-indent-border-hover: transparent;--scalar-sidebar-indent-border-active: transparent}.light-mode{color-scheme:light;--scalar-scrollbar-color-active: rgba(0, 0, 0, .36);--scalar-scrollbar-color: rgba(0, 0, 0, .18);--scalar-button-1: rgba(0, 0, 0, 1);--scalar-button-1-hover: rgba(0, 0, 0, .8);--scalar-button-1-color: rgba(255, 255, 255, .9);--scalar-shadow-1: 0 1px 3px 0 rgba(0, 0, 0, .11);--scalar-shadow-2: rgba(0, 0, 0, .08) 0px 13px 20px 0px, rgba(0, 0, 0, .08) 0px 3px 8px 0px, #eeeeed 0px 0 0 .5px;--scalar-lifted-brightness: 1;--scalar-backdrop-brightness: 1;--scalar-sidebar-indent-border: transparent;--scalar-sidebar-indent-border-hover: transparent;--scalar-sidebar-indent-border-active: transparent}.light-mode .dark-mode{color-scheme:dark!important}@media (max-width: 460px){:root{--scalar-font-size-1: 22px;--scalar-font-size-2: 14px;--scalar-font-size-3: 12px}}@media (max-width: 720px){:root{--scalar-heading-1: 24px;--scalar-page-description: 20px}}*::-moz-selection{background:var(--scalar-selection-background);color:var(--scalar-selection-color)}*::selection{background:var(--scalar-selection-background);color:var(--scalar-selection-color)}.light-mode{--scalar-background-1: #fff;--scalar-background-2: #f6f6f6;--scalar-background-3: #e7e7e7;--scalar-background-accent: #8ab4f81f;--scalar-color-1: #2a2f45;--scalar-color-2: #757575;--scalar-color-3: #8e8e8e;--scalar-color-accent: #0099ff;--scalar-border-color: #dfdfdf}.dark-mode{--scalar-background-1: #0f0f0f;--scalar-background-2: #1a1a1a;--scalar-background-3: #272727;--scalar-color-1: #e7e7e7;--scalar-color-2: #a4a4a4;--scalar-color-3: #797979;--scalar-color-accent: #3ea6ff;--scalar-background-accent: #3ea6ff1f;--scalar-border-color: #2d2d2d}.light-mode .t-doc__sidebar,.dark-mode .t-doc__sidebar{--scalar-sidebar-background-1: var(--scalar-background-1);--scalar-sidebar-color-1: var(--scalar-color-1);--scalar-sidebar-color-2: var(--scalar-color-2);--scalar-sidebar-border-color: var(--scalar-border-color);--scalar-sidebar-item-hover-background: var(--scalar-background-2);--scalar-sidebar-item-hover-color: currentColor;--scalar-sidebar-item-active-background: var(--scalar-background-2);--scalar-sidebar-color-active: var(--scalar-color-1);--scalar-sidebar-search-background: transparent;--scalar-sidebar-search-color: var(--scalar-color-3);--scalar-sidebar-search-border-color: var(--scalar-border-color)}.light-mode,.dark-mode{--scalar-selection-background: color-mix( in sRGB, var(--scalar-color-1) 80%, transparent );--scalar-selection-color: var(--scalar-background-1)}.light-mode{--scalar-color-green: #069061;--scalar-color-red: #ef0006;--scalar-color-yellow: #edbe20;--scalar-color-blue: #0082d0;--scalar-color-orange: #fb892c;--scalar-color-purple: #5203d1;--scalar-button-1: rgba(0, 0, 0, 1);--scalar-button-1-hover: rgba(0, 0, 0, .8);--scalar-button-1-color: rgba(255, 255, 255, .9)}.dark-mode{--scalar-color-green: #00b648;--scalar-color-red: #dc1b19;--scalar-color-yellow: #ffc90d;--scalar-color-blue: #4eb3ec;--scalar-color-orange: #ff8d4d;--scalar-color-purple: #b191f9;--scalar-button-1: rgba(255, 255, 255, 1);--scalar-button-1-hover: rgba(255, 255, 255, .9);--scalar-button-1-color: black}*,:before,:after{--tw-border-spacing-x: 0;--tw-border-spacing-y: 0;--tw-translate-x: 0;--tw-translate-y: 0;--tw-rotate: 0;--tw-skew-x: 0;--tw-skew-y: 0;--tw-scale-x: 1;--tw-scale-y: 1;--tw-pan-x: ;--tw-pan-y: ;--tw-pinch-zoom: ;--tw-scroll-snap-strictness: proximity;--tw-gradient-from-position: ;--tw-gradient-via-position: ;--tw-gradient-to-position: ;--tw-ordinal: ;--tw-slashed-zero: ;--tw-numeric-figure: ;--tw-numeric-spacing: ;--tw-numeric-fraction: ;--tw-ring-inset: ;--tw-ring-offset-width: 0px;--tw-ring-offset-color: #fff;--tw-ring-color: rgb(59 130 246 / .5);--tw-ring-offset-shadow: 0 0 #0000;--tw-ring-shadow: 0 0 #0000;--tw-shadow: 0 0 #0000;--tw-shadow-colored: 0 0 #0000;--tw-blur: ;--tw-brightness: ;--tw-contrast: ;--tw-grayscale: ;--tw-hue-rotate: ;--tw-invert: ;--tw-saturate: ;--tw-sepia: ;--tw-drop-shadow: ;--tw-backdrop-blur: ;--tw-backdrop-brightness: ;--tw-backdrop-contrast: ;--tw-backdrop-grayscale: ;--tw-backdrop-hue-rotate: ;--tw-backdrop-invert: ;--tw-backdrop-opacity: ;--tw-backdrop-saturate: ;--tw-backdrop-sepia: ;--tw-contain-size: ;--tw-contain-layout: ;--tw-contain-paint: ;--tw-contain-style: }::backdrop{--tw-border-spacing-x: 0;--tw-border-spacing-y: 0;--tw-translate-x: 0;--tw-translate-y: 0;--tw-rotate: 0;--tw-skew-x: 0;--tw-skew-y: 0;--tw-scale-x: 1;--tw-scale-y: 1;--tw-pan-x: ;--tw-pan-y: ;--tw-pinch-zoom: ;--tw-scroll-snap-strictness: proximity;--tw-gradient-from-position: ;--tw-gradient-via-position: ;--tw-gradient-to-position: ;--tw-ordinal: ;--tw-slashed-zero: ;--tw-numeric-figure: ;--tw-numeric-spacing: ;--tw-numeric-fraction: ;--tw-ring-inset: ;--tw-ring-offset-width: 0px;--tw-ring-offset-color: #fff;--tw-ring-color: rgb(59 130 246 / .5);--tw-ring-offset-shadow: 0 0 #0000;--tw-ring-shadow: 0 0 #0000;--tw-shadow: 0 0 #0000;--tw-shadow-colored: 0 0 #0000;--tw-blur: ;--tw-brightness: ;--tw-contrast: ;--tw-grayscale: ;--tw-hue-rotate: ;--tw-invert: ;--tw-saturate: ;--tw-sepia: ;--tw-drop-shadow: ;--tw-backdrop-blur: ;--tw-backdrop-brightness: ;--tw-backdrop-contrast: ;--tw-backdrop-grayscale: ;--tw-backdrop-hue-rotate: ;--tw-backdrop-invert: ;--tw-backdrop-opacity: ;--tw-backdrop-saturate: ;--tw-backdrop-sepia: ;--tw-contain-size: ;--tw-contain-layout: ;--tw-contain-paint: ;--tw-contain-style: }}:where(.scalar-app) .container{width:100%}@media (min-width: 400px){:where(.scalar-app) .container{max-width:400px}}@media (min-width: 600px){:where(.scalar-app) .container{max-width:600px}}@media (min-width: 800px){:where(.scalar-app) .container{max-width:800px}}@media (min-width: 1000px){:where(.scalar-app) .container{max-width:1000px}}@media (min-width: 1200px){:where(.scalar-app) .container{max-width:1200px}}:where(.scalar-app) .sr-only{position:absolute;width:1px;height:1px;padding:0;margin:-1px;overflow:hidden;clip:rect(0,0,0,0);white-space:nowrap;border-width:0}:where(.scalar-app) .pointer-events-none{pointer-events:none}:where(.scalar-app) .visible{visibility:visible}:where(.scalar-app) .invisible{visibility:hidden}:where(.scalar-app) .\\!static{position:static!important}:where(.scalar-app) .static{position:static}:where(.scalar-app) .fixed{position:fixed}:where(.scalar-app) .absolute{position:absolute}:where(.scalar-app) .relative{position:relative}:where(.scalar-app) .sticky{position:sticky}:where(.scalar-app) .inset-0{top:0;right:0;bottom:0;left:0}:where(.scalar-app) .left-0{left:0}:where(.scalar-app) .left-3{left:12px}:where(.scalar-app) .left-px{left:1px}:where(.scalar-app) .right-2{right:8px}:where(.scalar-app) .top-0{top:0}:where(.scalar-app) .top-1\\/2{top:50%}:where(.scalar-app) .top-2{top:8px}:where(.scalar-app) .top-\\[0\\.5px\\]{top:.5px}:where(.scalar-app) .top-px{top:1px}:where(.scalar-app) .-z-1{z-index:-1}:where(.scalar-app) .z-\\[1001\\]{z-index:1001}:where(.scalar-app) .z-overlay{z-index:10000}:where(.scalar-app) .\\!m-0{margin:0!important}:where(.scalar-app) .m-0{margin:0}:where(.scalar-app) .m-1{margin:4px}:where(.scalar-app) .m-auto{margin:auto}:where(.scalar-app) .-mx-0{margin-left:-0px;margin-right:-0px}:where(.scalar-app) .-mx-0\\.75{margin-left:-3px;margin-right:-3px}:where(.scalar-app) .mx-2{margin-left:8px;margin-right:8px}:where(.scalar-app) .mx-auto{margin-left:auto;margin-right:auto}:where(.scalar-app) .my-0{margin-top:0;margin-bottom:0}:where(.scalar-app) .my-0\\.75{margin-top:3px;margin-bottom:3px}:where(.scalar-app) .my-3{margin-top:12px;margin-bottom:12px}:where(.scalar-app) .-mb-1{margin-bottom:-4px}:where(.scalar-app) .mb-0{margin-bottom:0}:where(.scalar-app) .ml-1{margin-left:4px}:where(.scalar-app) .mr-2{margin-right:8px}:where(.scalar-app) .mr-3{margin-right:12px}:where(.scalar-app) .mt-0{margin-top:0}:where(.scalar-app) .mt-1{margin-top:4px}:where(.scalar-app) .mt-1\\.5{margin-top:6px}:where(.scalar-app) .mt-20{margin-top:80px}:where(.scalar-app) .line-clamp-4{overflow:hidden;display:-webkit-box;-webkit-box-orient:vertical;-webkit-line-clamp:4}:where(.scalar-app) .block{display:block}:where(.scalar-app) .inline-block{display:inline-block}:where(.scalar-app) .flex{display:flex}:where(.scalar-app) .grid{display:grid}:where(.scalar-app) .contents{display:contents}:where(.scalar-app) .hidden{display:none}:where(.scalar-app) .aspect-square{aspect-ratio:1 / 1}:where(.scalar-app) .size-10{width:40px;height:40px}:where(.scalar-app) .size-2{width:8px;height:8px}:where(.scalar-app) .size-2\\.5{width:10px;height:10px}:where(.scalar-app) .size-3{width:12px;height:12px}:where(.scalar-app) .size-3\\.5{width:14px;height:14px}:where(.scalar-app) .size-4{width:16px;height:16px}:where(.scalar-app) .size-5{width:20px;height:20px}:where(.scalar-app) .size-6{width:24px;height:24px}:where(.scalar-app) .size-8{width:32px;height:32px}:where(.scalar-app) .size-full{width:100%;height:100%}:where(.scalar-app) .h-10{height:40px}:where(.scalar-app) .h-3{height:12px}:where(.scalar-app) .h-3\\.5{height:14px}:where(.scalar-app) .h-4{height:16px}:where(.scalar-app) .h-5{height:20px}:where(.scalar-app) .h-72{height:288px}:where(.scalar-app) .h-8{height:32px}:where(.scalar-app) .h-\\[100dvh\\]{height:100dvh}:where(.scalar-app) .h-fit{height:-moz-fit-content;height:fit-content}:where(.scalar-app) .h-full{height:100%}:where(.scalar-app) .h-px{height:1px}:where(.scalar-app) .h-screen{height:100vh}:where(.scalar-app) .max-h-\\[440px\\]{max-height:440px}:where(.scalar-app) .max-h-\\[calc\\(100dvh-120px\\)\\]{max-height:calc(100dvh - 120px)}:where(.scalar-app) .max-h-\\[calc\\(100dvh-180px\\)\\]{max-height:calc(100dvh - 180px)}:where(.scalar-app) .max-h-\\[calc\\(100dvh-240px\\)\\]{max-height:calc(100dvh - 240px)}:where(.scalar-app) .max-h-dvh{max-height:100dvh}:where(.scalar-app) .min-h-\\[77px\\]{min-height:77px}:where(.scalar-app) .w-3{width:12px}:where(.scalar-app) .w-4{width:16px}:where(.scalar-app) .w-40{width:160px}:where(.scalar-app) .w-48{width:192px}:where(.scalar-app) .w-5{width:20px}:where(.scalar-app) .w-56{width:224px}:where(.scalar-app) .w-6{width:24px}:where(.scalar-app) .w-\\[100dvw\\]{width:100dvw}:where(.scalar-app) .w-\\[calc\\(100vw-16px\\)\\]{width:calc(100vw - 16px)}:where(.scalar-app) .w-full{width:100%}:where(.scalar-app) .min-w-0{min-width:0px}:where(.scalar-app) .max-w-screen-lg{max-width:800px}:where(.scalar-app) .max-w-screen-md{max-width:640px}:where(.scalar-app) .max-w-screen-sm{max-width:540px}:where(.scalar-app) .max-w-screen-xl{max-width:1000px}:where(.scalar-app) .max-w-screen-xs{max-width:480px}:where(.scalar-app) .max-w-screen-xxs{max-width:360px}:where(.scalar-app) .flex-1{flex:1 1 0%}:where(.scalar-app) .origin-top-left{transform-origin:top left}:where(.scalar-app) .-translate-y-1\\/2{--tw-translate-y: -50%;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}:where(.scalar-app) .translate-x-2{--tw-translate-x: 8px;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}:where(.scalar-app) .translate-x-2\\.5{--tw-translate-x: 10px;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}:where(.scalar-app) .rotate-90{--tw-rotate: 90deg;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}:where(.scalar-app) .transform{transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}:where(.scalar-app) .cursor-not-allowed{cursor:not-allowed}:where(.scalar-app) .cursor-pointer{cursor:pointer}:where(.scalar-app) .resize-none{resize:none}:where(.scalar-app) .resize{resize:both}:where(.scalar-app) .appearance-none{-webkit-appearance:none;-moz-appearance:none;appearance:none}:where(.scalar-app) .flex-col{flex-direction:column}:where(.scalar-app) .flex-wrap{flex-wrap:wrap}:where(.scalar-app) .items-start{align-items:flex-start}:where(.scalar-app) .items-center{align-items:center}:where(.scalar-app) .justify-start{justify-content:flex-start}:where(.scalar-app) .justify-center{justify-content:center}:where(.scalar-app) .justify-between{justify-content:space-between}:where(.scalar-app) .gap-0{gap:0px}:where(.scalar-app) .gap-0\\.75{gap:3px}:where(.scalar-app) .gap-1{gap:4px}:where(.scalar-app) .gap-1\\.5{gap:6px}:where(.scalar-app) .gap-16{gap:64px}:where(.scalar-app) .gap-2{gap:8px}:where(.scalar-app) .gap-2\\.5{gap:10px}:where(.scalar-app) .gap-4{gap:16px}:where(.scalar-app) .divide-y>:not([hidden])~:not([hidden]){--tw-divide-y-reverse: 0;border-top-width:calc(var(--scalar-border-width) * calc(1 - var(--tw-divide-y-reverse)));border-bottom-width:calc(var(--scalar-border-width) * var(--tw-divide-y-reverse))}:where(.scalar-app) .self-center{align-self:center}:where(.scalar-app) .overflow-auto{overflow:auto}:where(.scalar-app) .overflow-hidden{overflow:hidden}:where(.scalar-app) .overflow-visible{overflow:visible}:where(.scalar-app) .truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}:where(.scalar-app) .text-ellipsis{text-overflow:ellipsis}:where(.scalar-app) .text-wrap{text-wrap:wrap}:where(.scalar-app) .rounded{border-radius:var(--scalar-radius)}:where(.scalar-app) .rounded-full{border-radius:9999px}:where(.scalar-app) .rounded-lg{border-radius:var(--scalar-radius-lg)}:where(.scalar-app) .rounded-none{border-radius:0}:where(.scalar-app) .border{border-width:var(--scalar-border-width)}:where(.scalar-app) .border-0{border-width:0}:where(.scalar-app) .border-t{border-top-width:var(--scalar-border-width)}:where(.scalar-app) .border-solid{border-style:solid}:where(.scalar-app) .border-dashed{border-style:dashed}:where(.scalar-app) .border-none{border-style:none}:where(.scalar-app) .border-border{border-color:var(--scalar-border-color)}:where(.scalar-app) .border-c-3{border-color:var(--scalar-color-3)}:where(.scalar-app) .border-red{border-color:var(--scalar-color-red)}:where(.scalar-app) .bg-b-1{background-color:var(--scalar-background-1)}:where(.scalar-app) .bg-b-2{background-color:var(--scalar-background-2)}:where(.scalar-app) .bg-b-3{background-color:var(--scalar-background-3)}:where(.scalar-app) .bg-b-btn{background-color:var(--scalar-button-1)}:where(.scalar-app) .bg-backdrop{background-color:#00000038}:where(.scalar-app) .bg-border{background-color:var(--scalar-border-color)}:where(.scalar-app) .bg-c-accent{background-color:var(--scalar-color-accent)}:where(.scalar-app) .bg-red{background-color:var(--scalar-color-red)}:where(.scalar-app) .bg-transparent{background-color:transparent}:where(.scalar-app) .bg-white{--tw-bg-opacity: 1;background-color:rgb(255 255 255 / var(--tw-bg-opacity))}:where(.scalar-app) .p-0{padding:0}:where(.scalar-app) .p-0\\.5{padding:2px}:where(.scalar-app) .p-0\\.75{padding:3px}:where(.scalar-app) .p-1{padding:4px}:where(.scalar-app) .p-2{padding:8px}:where(.scalar-app) .p-3{padding:12px}:where(.scalar-app) .p-6{padding:24px}:where(.scalar-app) .p-\\[3px\\]{padding:3px}:where(.scalar-app) .px-1{padding-left:4px;padding-right:4px}:where(.scalar-app) .px-1\\.5{padding-left:6px;padding-right:6px}:where(.scalar-app) .px-2{padding-left:8px;padding-right:8px}:where(.scalar-app) .px-2\\.5{padding-left:10px;padding-right:10px}:where(.scalar-app) .px-3{padding-left:12px;padding-right:12px}:where(.scalar-app) .px-6{padding-left:24px;padding-right:24px}:where(.scalar-app) .px-9{padding-left:36px;padding-right:36px}:where(.scalar-app) .py-1{padding-top:4px;padding-bottom:4px}:where(.scalar-app) .py-1\\.5{padding-top:6px;padding-bottom:6px}:where(.scalar-app) .py-2{padding-top:8px;padding-bottom:8px}:where(.scalar-app) .py-2\\.5{padding-top:10px;padding-bottom:10px}:where(.scalar-app) .py-4{padding-top:16px;padding-bottom:16px}:where(.scalar-app) .pb-0{padding-bottom:0}:where(.scalar-app) .pl-8{padding-left:32px}:where(.scalar-app) .pr-3{padding-right:12px}:where(.scalar-app) .pt-3{padding-top:12px}:where(.scalar-app) .pt-6{padding-top:24px}:where(.scalar-app) .text-left{text-align:left}:where(.scalar-app) .font-code{font-family:var(--scalar-font-code)}:where(.scalar-app) .text-lg{font-size:var(--scalar-font-size-2)}:where(.scalar-app) .text-sm{font-size:var(--scalar-font-size-4)}:where(.scalar-app) .text-xs{font-size:var(--scalar-font-size-5)}:where(.scalar-app) .text-xxs{font-size:var(--scalar-font-size-6)}:where(.scalar-app) .font-bold{font-weight:var(--scalar-bold)}:where(.scalar-app) .font-medium{font-weight:var(--scalar-semibold)}:where(.scalar-app) .font-normal{font-weight:var(--scalar-regular)}:where(.scalar-app) .leading-none{line-height:1}:where(.scalar-app) .leading-snug{line-height:1.375}:where(.scalar-app) .text-b-1{color:var(--scalar-background-1)}:where(.scalar-app) .text-c-1{color:var(--scalar-color-1)}:where(.scalar-app) .text-c-2{color:var(--scalar-color-2)}:where(.scalar-app) .text-c-3{color:var(--scalar-color-3)}:where(.scalar-app) .text-c-accent{color:var(--scalar-color-accent)}:where(.scalar-app) .text-c-btn{color:var(--scalar-button-1-color)}:where(.scalar-app) .text-c-ghost{color:var(--scalar-color-ghost)}:where(.scalar-app) .text-red{color:var(--scalar-color-red)}:where(.scalar-app) .text-transparent{color:transparent}:where(.scalar-app) .text-white{--tw-text-opacity: 1;color:rgb(255 255 255 / var(--tw-text-opacity))}:where(.scalar-app) .no-underline{text-decoration-line:none}:where(.scalar-app) .opacity-0{opacity:0}:where(.scalar-app) .opacity-40{opacity:.4}:where(.scalar-app) .opacity-50{opacity:.5}:where(.scalar-app) .shadow{--tw-shadow: var(--scalar-shadow-1);--tw-shadow-colored: var(--scalar-shadow-1);box-shadow:var(--tw-ring-offset-shadow, 0 0 #0000),var(--tw-ring-shadow, 0 0 #0000),var(--tw-shadow)}:where(.scalar-app) .shadow-lg{--tw-shadow: var(--scalar-shadow-2);--tw-shadow-colored: var(--scalar-shadow-2);box-shadow:var(--tw-ring-offset-shadow, 0 0 #0000),var(--tw-ring-shadow, 0 0 #0000),var(--tw-shadow)}:where(.scalar-app) .shadow-md{--tw-shadow: var(--scalar-shadow-1);--tw-shadow-colored: var(--scalar-shadow-1);box-shadow:var(--tw-ring-offset-shadow, 0 0 #0000),var(--tw-ring-shadow, 0 0 #0000),var(--tw-shadow)}:where(.scalar-app) .shadow-none{--tw-shadow: 0 0 #0000;--tw-shadow-colored: 0 0 var(--tw-shadow-color);box-shadow:var(--tw-ring-offset-shadow, 0 0 #0000),var(--tw-ring-shadow, 0 0 #0000),var(--tw-shadow)}:where(.scalar-app) .shadow-sm{--tw-shadow: rgba(0, 0, 0, .09) 0px 1px 4px;--tw-shadow-colored: 0px 1px 4px var(--tw-shadow-color);box-shadow:var(--tw-ring-offset-shadow, 0 0 #0000),var(--tw-ring-shadow, 0 0 #0000),var(--tw-shadow)}:where(.scalar-app) .shadow-current{--tw-shadow-color: currentColor;--tw-shadow: var(--tw-shadow-colored)}:where(.scalar-app) .outline-none{outline:2px solid transparent;outline-offset:2px}:where(.scalar-app) .outline{outline-style:solid}:where(.scalar-app) .blur{--tw-blur: blur(8px);filter:var(--tw-blur) var(--tw-brightness) var(--tw-contrast) var(--tw-grayscale) var(--tw-hue-rotate) var(--tw-invert) var(--tw-saturate) var(--tw-sepia) var(--tw-drop-shadow)}:where(.scalar-app) .brightness-lifted{--tw-brightness: brightness(var(--scalar-lifted-brightness));filter:var(--tw-blur) var(--tw-brightness) var(--tw-contrast) var(--tw-grayscale) var(--tw-hue-rotate) var(--tw-invert) var(--tw-saturate) var(--tw-sepia) var(--tw-drop-shadow)}:where(.scalar-app) .filter{filter:var(--tw-blur) var(--tw-brightness) var(--tw-contrast) var(--tw-grayscale) var(--tw-hue-rotate) var(--tw-invert) var(--tw-saturate) var(--tw-sepia) var(--tw-drop-shadow)}:where(.scalar-app) .transition{transition-property:color,background-color,border-color,text-decoration-color,fill,stroke,opacity,box-shadow,transform,filter,-webkit-backdrop-filter;transition-property:color,background-color,border-color,text-decoration-color,fill,stroke,opacity,box-shadow,transform,filter,backdrop-filter;transition-property:color,background-color,border-color,text-decoration-color,fill,stroke,opacity,box-shadow,transform,filter,backdrop-filter,-webkit-backdrop-filter;transition-timing-function:cubic-bezier(.4,0,.2,1);transition-duration:.15s}:where(.scalar-app) .transition-colors{transition-property:color,background-color,border-color,text-decoration-color,fill,stroke;transition-timing-function:cubic-bezier(.4,0,.2,1);transition-duration:.15s}:where(.scalar-app) .transition-opacity{transition-property:opacity;transition-timing-function:cubic-bezier(.4,0,.2,1);transition-duration:.15s}:where(.scalar-app) .transition-transform{transition-property:transform;transition-timing-function:cubic-bezier(.4,0,.2,1);transition-duration:.15s}:where(.scalar-app) .duration-300{transition-duration:.3s}:where(.scalar-app) .ease-in-out{transition-timing-function:cubic-bezier(.4,0,.2,1)}:where(.scalar-app) .bg-b-1{--tw-bg-base: var(--scalar-background-1)}:where(.scalar-app) .bg-b-2{--tw-bg-base: var(--scalar-background-2)}:where(.scalar-app) .bg-b-3{--tw-bg-base: var(--scalar-background-3)}:where(.scalar-app) .bg-b-btn{--tw-bg-base: var(--scalar-button-1)}:where(.scalar-app) .bg-backdrop{--tw-bg-base: rgba(0, 0, 0, .22)}:where(.scalar-app) .bg-border{--tw-bg-base: var(--scalar-border-color)}:where(.scalar-app) .bg-c-accent{--tw-bg-base: var(--scalar-color-accent)}:where(.scalar-app) .bg-red{--tw-bg-base: var(--scalar-color-red)}:where(.scalar-app) .bg-transparent{--tw-bg-base: transparent}:where(.scalar-app) .bg-white{--tw-bg-opacity: 1;--tw-bg-base: rgb(255 255 255 / var(--tw-bg-opacity))}:where(.scalar-app) .row,:where(.scalar-app) .scalar-row{display:flex;flex-direction:row}:where(.scalar-app) .col{display:flex;flex-direction:column}:where(.scalar-app) .centered-x{left:50%;--tw-translate-x: -50%;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}:where(.scalar-app) .centered{left:50%;--tw-translate-x: -50%;top:50%;--tw-translate-y: -50%;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}:where(.scalar-app) .first-of-type\\:mt-0:first-of-type{margin-top:0}:where(.scalar-app) .first-of-type\\:mt-0\\.75:first-of-type{margin-top:3px}:where(.scalar-app) .last-of-type\\:mb-0:last-of-type{margin-bottom:0}:where(.scalar-app) .last-of-type\\:mb-0\\.75:last-of-type{margin-bottom:3px}:where(.scalar-app) .hover\\:bg-b-2:hover{background-color:var(--scalar-background-2)}:where(.scalar-app) .hover\\:text-c-1:hover{color:var(--scalar-color-1)}:where(.scalar-app) .hover\\:bg-b-2:hover{--tw-bg-base: var(--scalar-background-2)}:where(.scalar-app) .focus\\:outline-none:focus{outline:2px solid transparent;outline-offset:2px}:where(.scalar-app) .focus-visible\\:ring-1:focus-visible{--tw-ring-offset-shadow: var(--tw-ring-inset) 0 0 0 var(--tw-ring-offset-width) var(--tw-ring-offset-color);--tw-ring-shadow: var(--tw-ring-inset) 0 0 0 calc(1px + var(--tw-ring-offset-width)) var(--tw-ring-color);box-shadow:var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow, 0 0 #0000)}:where(.scalar-app) .focus-visible\\:ring-c-accent:focus-visible{--tw-ring-color: var(--scalar-color-accent)}:where(.scalar-app) .active\\:bg-b-btn:active{background-color:var(--scalar-button-1)}:where(.scalar-app) .active\\:text-c-1:active{color:var(--scalar-color-1)}:where(.scalar-app) .active\\:shadow-none:active{--tw-shadow: 0 0 #0000;--tw-shadow-colored: 0 0 var(--tw-shadow-color);box-shadow:var(--tw-ring-offset-shadow, 0 0 #0000),var(--tw-ring-shadow, 0 0 #0000),var(--tw-shadow)}:where(.scalar-app) .active\\:brightness-90:active{--tw-brightness: brightness(.9);filter:var(--tw-blur) var(--tw-brightness) var(--tw-contrast) var(--tw-grayscale) var(--tw-hue-rotate) var(--tw-invert) var(--tw-saturate) var(--tw-sepia) var(--tw-drop-shadow)}:where(.scalar-app) .active\\:bg-b-btn:active{--tw-bg-base: var(--scalar-button-1)}:where(.scalar-app) .group:hover .group-hover\\:text-c-1{color:var(--scalar-color-1)}:where(.scalar-app) .group:hover .group-hover\\:opacity-100{opacity:1}:where(.scalar-app) .group\\/listbox:hover .group-hover\\/listbox\\:shadow-border,:where(.scalar-app) .group:hover .group-hover\\:shadow-border{--tw-shadow: inset 0 0 0 1px var(--scalar-border-color);--tw-shadow-colored: inset 0 0 0 1px var(--tw-shadow-color);box-shadow:var(--tw-ring-offset-shadow, 0 0 #0000),var(--tw-ring-shadow, 0 0 #0000),var(--tw-shadow);--tw-shadow-color: var(--scalar-border-color);--tw-shadow: var(--tw-shadow-colored)}:where(.scalar-app) .has-\\[\\:focus-visible\\]\\:outline:has(:focus-visible){outline-style:solid}:where(.scalar-app) .ui-open\\:rotate-180[data-headlessui-state~=open]{--tw-rotate: 180deg;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}:where(.scalar-app) :where([data-headlessui-state~=open]) .ui-open\\:rotate-180{--tw-rotate: 180deg;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}:where(.scalar-app) .has-actv-btn\\:border:has(button:active){border-width:var(--scalar-border-width)}:where(.scalar-app) .has-actv-btn\\:border-border:has(button:active){border-color:var(--scalar-border-color)}:where(.scalar-app) .\\!empty\\:flex:not(:empty){display:flex}:where(.scalar-app) .\\!empty\\:w-7:not(:empty){width:28px}:where(.scalar-app) .\\!empty\\:items-center:not(:empty){align-items:center}:where(.scalar-app) .\\!empty\\:pr-3:not(:empty){padding-right:12px}:where(.scalar-app) .hocus\\:bg-h-btn:hover{background-color:var(--scalar-button-1-hover)}:where(.scalar-app) .hocus\\:text-c-1:hover{color:var(--scalar-color-1)}:where(.scalar-app) .hocus\\:brightness-90:hover{--tw-brightness: brightness(.9);filter:var(--tw-blur) var(--tw-brightness) var(--tw-contrast) var(--tw-grayscale) var(--tw-hue-rotate) var(--tw-invert) var(--tw-saturate) var(--tw-sepia) var(--tw-drop-shadow)}:where(.scalar-app) .hocus\\:bg-h-btn:hover{--tw-bg-base: var(--scalar-button-1-hover)}:where(.scalar-app) .hocus\\:bg-h-btn:focus-visible{background-color:var(--scalar-button-1-hover)}:where(.scalar-app) .hocus\\:text-c-1:focus-visible{color:var(--scalar-color-1)}:where(.scalar-app) .hocus\\:brightness-90:focus-visible{--tw-brightness: brightness(.9);filter:var(--tw-blur) var(--tw-brightness) var(--tw-contrast) var(--tw-grayscale) var(--tw-hue-rotate) var(--tw-invert) var(--tw-saturate) var(--tw-sepia) var(--tw-drop-shadow)}:where(.scalar-app) .hocus\\:bg-h-btn:focus-visible{--tw-bg-base: var(--scalar-button-1-hover)}@media (min-width: 800px){:where(.scalar-app) .md\\:row{display:flex;flex-direction:row}}@media (min-width: 1000px){:where(.scalar-app) .lg\\:w-\\[calc\\(100vw-32px\\)\\]{width:calc(100vw - 32px)}:where(.scalar-app) .lg\\:w-full{width:100%}}:where(.scalar-app) .dark\\:bg-backdropdark:where(.dark-mode,.dark-mode *){background-color:#00000073;--tw-bg-base: rgba(0, 0, 0, .45)}.loader-wrapper[data-v-5a129980]{position:relative;display:flex;align-items:center;justify-content:center;--loader-size: 50%}.svg-loader[data-v-5a129980]{width:var(--loader-size);height:var(--loader-size);top:1rem;right:.9rem;overflow:visible;fill:none;background-color:transparent;stroke:currentColor}.svg-path[data-v-5a129980]{stroke-width:14;fill:none;transition:.3s}.svg-x-mark[data-v-5a129980]{stroke-dasharray:57;stroke-dashoffset:57;transition-delay:0s}.svg-check-mark[data-v-5a129980]{stroke-dasharray:149;stroke-dashoffset:149;transition-delay:0s}.icon-is-invalid .svg-x-mark[data-v-5a129980],.icon-is-valid .svg-check-mark[data-v-5a129980]{stroke-dashoffset:0;transition-delay:.3s}.circular-loader[data-v-5a129980]{animation:rotate-5a129980 .7s linear infinite,fade-in-5a129980 .4s;transform-origin:center center;transform:scale(5);background:transparent}.loader-path[data-v-5a129980]{stroke-dasharray:50,200;stroke-dashoffset:-100;stroke-linecap:round}.loader-path-off[data-v-5a129980]{stroke-dasharray:50,200;stroke-dashoffset:-100;transition:opacity .3s;opacity:0}@keyframes fade-in-5a129980{0%{opacity:0}70%{opacity:0}to{opacity:1}}@keyframes rotate-5a129980{0%{transform:scale(5) rotate(0)}to{transform:scale(5) rotate(360deg)}}.scalar-code-block{background:inherit;position:relative;overflow:auto;padding:.5rem .5rem .5rem .75rem}.scalar-code-block:hover .copy-button{opacity:100;visibility:visible}.scalar-codeblock-pre{margin:0;background:transparent;text-wrap:nowrap;white-space-collapse:preserve;border-radius:0}.scalar-code-copy{display:flex;align-items:start;justify-content:flex-end;position:sticky;top:0;right:0;bottom:0;left:0}.copy-button{position:relative;top:0;right:0;display:flex;align-items:center;background-color:var(--scalar-background-2);border:1px solid var(--scalar-border-color);border-radius:3px;color:var(--scalar-color-3);cursor:pointer;height:30px;margin-bottom:-30px;opacity:0;padding:6px;transition:opacity .15s ease-in-out,color .15s ease-in-out;visibility:hidden}.scalar-code-copy,.copy-button{background:inherit}.copy-button:after{content:".";color:transparent;font-size:var(--scalar-mini);line-height:1.35;width:0px}.copy-button:hover{color:var(--scalar-color-1)}.copy-button svg{stroke-width:1.5}.scalar-app code.hljs *{font-size:var(--scalar-small);font-family:var(--scalar-font-code);text-align:left;white-space:pre;word-spacing:normal;word-break:normal;word-wrap:normal;line-height:1.4;-moz-tab-size:4;-o-tab-size:4;tab-size:4}.scalar-app code.hljs{font-size:var(--scalar-small);font-family:var(--scalar-font-code);display:inline-block;counter-reset:linenumber}.scalar-app .hljs{background:transparent;color:var(--scalar-color-2)}.scalar-app .hljs .line:before{color:var(--scalar-color-3);display:inline-block;counter-increment:linenumber;content:counter(linenumber);margin-right:.7em;min-width:calc(var(--line-digits) * 1ch);text-align:right}.scalar-app .hljs-comment,.scalar-app .hljs-quote{color:var(--scalar-color-3);font-style:italic}.scalar-app .hljs-number{color:var(--scalar-color-orange)}.scalar-app .hljs-regexp,.scalar-app .hljs-string,.scalar-app .hljs-built_in{color:var(--scalar-color-blue)}.scalar-app .hljs-title.class_{color:var(--scalar-color-1)}.scalar-app .hljs-keyword{color:var(--scalar-color-purple)}.scalar-app .hljs-title.function_{color:var(--scalar-color-orange)}.scalar-app .hljs-subst,.scalar-app .hljs-name{color:var(--scalar-color-blue)}.scalar-app .hljs-attr,.scalar-app .hljs-attribute{color:var(--scalar-color-1)}.scalar-app .hljs-addition,.scalar-app .hljs-literal,.scalar-app .hljs-selector-tag,.scalar-app .hljs-type{color:var(--scalar-color-green)}.scalar-app .hljs-selector-attr,.scalar-app .hljs-selector-pseudo{color:var(--scalar-color-orange)}.scalar-app .hljs-doctag,.scalar-app .hljs-section,.scalar-app .hljs-title{color:var(--scalar-color-blue)}.scalar-app .hljs-selector-id,.scalar-app .hljs-template-variable,.scalar-app .hljs-variable{color:var(--scalar-color-1)}.scalar-app .hljs-name,.scalar-app .hljs-section,.scalar-app .hljs-strong{font-weight:var(--scalar-semibold)}.scalar-app .hljs-bullet,.scalar-app .hljs-link,.scalar-app .hljs-meta,.scalar-app .hljs-symbol{color:var(--scalar-color-blue)}.scalar-app .hljs-deletion{color:var(--scalar-color-red)}.scalar-app .hljs-formula{background:var(--scalar-color-1)}.scalar-app .hljs-emphasis{font-style:italic}.scalar-app .credentials{font-size:0!important;color:transparent}.scalar-app .credentials:after{content:"·····";font-size:var(--scalar-small);color:var(--scalar-color-3);-webkit-user-select:none;-moz-user-select:none;user-select:none}.hljs.language-html{color:var(--scalar-color-1)}.hljs.language-html .hljs-attr{color:var(--scalar-color-2)}.hljs.language-curl .hljs-keyword{color:var(--scalar-color-orange)}.hljs.language-curl .hljs-string{color:var(--scalar-color-1)}.hljs.language-curl .hljs-literal,.hljs.language-php .hljs-variable{color:var(--scalar-color-blue)}.hljs.language-objectivec .hljs-meta{color:var(--scalar-color-1)}.hljs.language-objectivec .hljs-built_in,.hljs-built_in{color:var(--scalar-color-orange)}.scalar-app .markdown{font-family:var(--scalar-font);color:var(--scalar-color-1);word-break:break-word}.scalar-app .markdown h1,.scalar-app .markdown h2,.scalar-app .markdown h3,.scalar-app .markdown h4,.scalar-app .markdown h5,.scalar-app .markdown h6,.scalar-app .markdown p,.scalar-app .markdown div,.scalar-app .markdown img,.scalar-app .markdown details,.scalar-app .markdown summary,.scalar-app .markdown ul,.scalar-app .markdown ol,.scalar-app .markdown table,.scalar-app .markdown blockquote,.scalar-app .markdown code{margin:12px 0}.scalar-app .markdown details{margin:12px 0;color:var(--scalar-color-1)}.scalar-app .markdown summary{display:block;margin:1em 0;padding-left:20px;position:relative;font-weight:var(--scalar-semibold);cursor:pointer;-webkit-user-select:none;-moz-user-select:none;user-select:none}.scalar-app .markdown summary:after{display:block;content:"";position:absolute;top:1px;left:1px;width:16px;height:16px;background-color:var(--scalar-color-3);-webkit-mask-image:url(\'data:image/svg+xml,<svg viewBox="0 0 24 24" fill="none" xmlns="http://www.w3.org/2000/svg"><path d="M8.25 19.5L15.75 12L8.25 4.5" stroke="black" stroke-width="2" stroke-linecap="round" stroke-linejoin="round"/></svg>\');mask-image:url(\'data:image/svg+xml,<svg viewBox="0 0 24 24" fill="none" xmlns="http://www.w3.org/2000/svg"><path d="M8.25 19.5L15.75 12L8.25 4.5" stroke="black" stroke-width="2" stroke-linecap="round" stroke-linejoin="round"/></svg>\')}.scalar-app .markdown summary:hover:after{background-color:var(--scalar-color-1)}.scalar-app .markdown details[open] summary:after{transform:rotate(90deg)}.scalar-app .markdown summary::-webkit-details-marker{display:none}.scalar-app .markdown img{overflow:hidden;border-radius:var(--scalar-radius);max-width:100%}.scalar-app .markdown>:first-child{margin-top:0;margin-bottom:0}.scalar-app .markdown h1{--font-size: 1.4em}.scalar-app .markdown h2{--font-size: 1.25em}.scalar-app .markdown h3{--font-size: 1.1em}.scalar-app .markdown h4,.scalar-app .markdown h6{--font-size: 1em}.scalar-app .markdown h1,.scalar-app .markdown h2,.scalar-app .markdown h3,.scalar-app .markdown h4,.scalar-app .markdown h5,.scalar-app .markdown h6{font-size:var(--font-size);margin:18px 0 6px;font-weight:var(--scalar-bold);display:block;line-height:1.45}.scalar-app .markdown b,.scalar-app .markdown strong{font-weight:var(--scalar-bold)}.scalar-app .markdown p{color:inherit;font-weight:var(--font-weight, var(--scalar-regular));line-height:1.5;margin-bottom:0;display:block}.scalar-app .markdown ul,.scalar-app .markdown ol{padding-left:24px;line-height:1.5;margin:12px 0;display:block}.scalar-app .markdown ul{list-style:disc}.scalar-app .markdown ol{list-style:decimal}.scalar-app .markdown ul.contains-task-list{list-style:none;padding-left:0}.scalar-app .markdown li{margin:6px 0;display:list-item}.scalar-app .markdown ul:first-of-type li:first-of-type{margin-top:0}.scalar-app .markdown a{color:var(--scalar-color-accent);-webkit-text-decoration:var(--scalar-text-decoration);text-decoration:var(--scalar-text-decoration);cursor:pointer}.scalar-app .markdown a:hover{-webkit-text-decoration:var(--scalar-text-decoration-hover);text-decoration:var(--scalar-text-decoration-hover)}.scalar-app .markdown em{font-style:italic}.scalar-app .markdown sup{font-size:var(--scalar-micro);vertical-align:super;font-weight:450}.scalar-app .markdown sub{font-size:var(--scalar-micro);vertical-align:sub;font-weight:450}.scalar-app .markdown del{text-decoration:line-through}.scalar-app .markdown code{font-family:var(--scalar-font-code);background-color:var(--scalar-background-2);box-shadow:0 0 0 var(--scalar-border-width) var(--scalar-border-color);font-size:var(--scalar-micro);border-radius:2px;padding:0 3px}.scalar-app .markdown pre code{display:block;white-space:pre;padding:12px;line-height:1.5;margin:12px 0;-webkit-overflow-scrolling:touch;overflow-x:auto;max-width:100%;min-width:100px}.scalar-app .markdown hr{border:none;border-bottom:var(--scalar-border-width) solid var(--scalar-border-color)}.scalar-app .markdown blockquote{border-left:3px solid var(--scalar-border-color);padding-left:12px;margin:0;display:block}.scalar-app .markdown table{display:block;overflow-x:auto;position:relative;border-collapse:collapse;width:-moz-max-content;width:max-content;max-width:100%;margin:1em 0;box-shadow:0 0 0 var(--scalar-border-width) var(--scalar-border-color);border-radius:var(--scalar-radius-lg)}.scalar-app .markdown tbody{display:table-row-group;vertical-align:middle}.scalar-app .markdown thead{display:table-header-group;vertical-align:middle}.scalar-app .markdown tr{display:table-row;border-color:inherit;vertical-align:inherit}.scalar-app .markdown td,.scalar-app .markdown th{display:table-cell;vertical-align:inherit;min-width:1em;padding:6px 9px;vertical-align:top;line-height:1.5;position:relative;word-break:initial;font-size:var(--scalar-small);color:var(--scalar-color-1);font-weight:var(--font-weight, var(--scalar-regular));border-right:var(--scalar-border-width) solid var(--scalar-border-color);border-bottom:var(--scalar-border-width) solid var(--scalar-border-color)}.scalar-app .markdown td>*,.scalar-app .markdown th>*{margin-bottom:0}.scalar-app .markdown th:empty{display:none}.scalar-app .markdown td:first-of-type,.scalar-app .markdown th:first-of-type{border-left:none}.scalar-app .markdown td:last-of-type,.scalar-app .markdown th:last-of-type{border-right:none}.scalar-app .markdown tr:last-of-type td{border-bottom:none}.scalar-app .markdown th{font-weight:var(--scalar-semibold)!important;text-align:left;border-left-color:transparent;background:var(--scalar-background-2)}.scalar-app .markdown tr>[align=left]{text-align:left}.scalar-app .markdown tr>[align=right]{text-align:right}.scalar-app .markdown tr>[align=center]{text-align:center}.dark-mode .scalar-dropdown-item[data-v-a4980d5e]:hover{filter:brightness(1.1)}.scalar-input-wrapper-focus .scalar-input-label[data-v-4de7a24e]{color:var(--scalar-color-1)}.scalar-input-wrapper-error .scalar-input-label[data-v-4de7a24e]{color:var(--scalar-color-red)}.scalar-input[data-v-4de7a24e]::-moz-selection{color:var(--scalar-color-1);background:#ffa55859}.scalar-input[data-v-4de7a24e]::selection{color:var(--scalar-color-1);background:#ffa55859}.scalar-input[data-v-4de7a24e]:has(+.scalar-input-label){opacity:0}.scalar-input[data-v-4de7a24e]:not(:-moz-placeholder-shown){opacity:1;-moz-transition:opacity .2s ease-in-out .15s;transition:opacity .2s ease-in-out .15s}.scalar-input[data-v-4de7a24e]:not(:placeholder-shown),.scalar-input-wrapper-focus .scalar-input[data-v-4de7a24e]{opacity:1;transition:opacity .2s ease-in-out .15s}.scalar-input[data-v-4de7a24e]:-webkit-autofill,.scalar-input[data-v-4de7a24e]:-webkit-autofill:hover,.scalar-input[data-v-4de7a24e]:-webkit-autofill:focus,.scalar-input[data-v-4de7a24e]:-webkit-autofill:active,.scalar-input[data-v-4de7a24e]:focus-within:-webkit-autofill,.scalar-input[data-v-4de7a24e]:focus-within:-webkit-autofill:hover,.scalar-input[data-v-4de7a24e]:focus-within:-webkit-autofill:focus,.scalar-input[data-v-4de7a24e]:focus-within:-webkit-autofill:active{-webkit-box-shadow:0 0 0px 1000px var(--scalar-background-1) inset!important;-webkit-text-fill-color:var(--scalar-color-1);color:var(--scalar-color-1);border-radius:var(--scalar-radius)}.scalar-input:not(:-moz-placeholder-shown)+.scalar-input-label[data-v-4de7a24e]{transform:translate3d(0,-20px,0) scale(.8);transform-origin:top left}.scalar-input-wrapper-focus .scalar-input-label[data-v-4de7a24e],.scalar-input:not(:placeholder-shown)+.scalar-input-label[data-v-4de7a24e]{transform:translate3d(0,-20px,0) scale(.8);transform-origin:top left}.scalar-input-wrapper-focus:has(button:active) .scalar-input-label[data-v-4de7a24e]{color:var(--scalar-color-3)!important}@layer scalar-base{*,:before,:after{--tw-border-spacing-x:0;--tw-border-spacing-y:0;--tw-translate-x:0;--tw-translate-y:0;--tw-rotate:0;--tw-skew-x:0;--tw-skew-y:0;--tw-scale-x:1;--tw-scale-y:1;--tw-pan-x: ;--tw-pan-y: ;--tw-pinch-zoom: ;--tw-scroll-snap-strictness:proximity;--tw-gradient-from-position: ;--tw-gradient-via-position: ;--tw-gradient-to-position: ;--tw-ordinal: ;--tw-slashed-zero: ;--tw-numeric-figure: ;--tw-numeric-spacing: ;--tw-numeric-fraction: ;--tw-ring-inset: ;--tw-ring-offset-width:0px;--tw-ring-offset-color:#fff;--tw-ring-color:rgb(59 130 246 / .5);--tw-ring-offset-shadow:0 0 #0000;--tw-ring-shadow:0 0 #0000;--tw-shadow:0 0 #0000;--tw-shadow-colored:0 0 #0000;--tw-blur: ;--tw-brightness: ;--tw-contrast: ;--tw-grayscale: ;--tw-hue-rotate: ;--tw-invert: ;--tw-saturate: ;--tw-sepia: ;--tw-drop-shadow: ;--tw-backdrop-blur: ;--tw-backdrop-brightness: ;--tw-backdrop-contrast: ;--tw-backdrop-grayscale: ;--tw-backdrop-hue-rotate: ;--tw-backdrop-invert: ;--tw-backdrop-opacity: ;--tw-backdrop-saturate: ;--tw-backdrop-sepia: ;--tw-contain-size: ;--tw-contain-layout: ;--tw-contain-paint: ;--tw-contain-style: }::backdrop{--tw-border-spacing-x:0;--tw-border-spacing-y:0;--tw-translate-x:0;--tw-translate-y:0;--tw-rotate:0;--tw-skew-x:0;--tw-skew-y:0;--tw-scale-x:1;--tw-scale-y:1;--tw-pan-x: ;--tw-pan-y: ;--tw-pinch-zoom: ;--tw-scroll-snap-strictness:proximity;--tw-gradient-from-position: ;--tw-gradient-via-position: ;--tw-gradient-to-position: ;--tw-ordinal: ;--tw-slashed-zero: ;--tw-numeric-figure: ;--tw-numeric-spacing: ;--tw-numeric-fraction: ;--tw-ring-inset: ;--tw-ring-offset-width:0px;--tw-ring-offset-color:#fff;--tw-ring-color:rgb(59 130 246 / .5);--tw-ring-offset-shadow:0 0 #0000;--tw-ring-shadow:0 0 #0000;--tw-shadow:0 0 #0000;--tw-shadow-colored:0 0 #0000;--tw-blur: ;--tw-brightness: ;--tw-contrast: ;--tw-grayscale: ;--tw-hue-rotate: ;--tw-invert: ;--tw-saturate: ;--tw-sepia: ;--tw-drop-shadow: ;--tw-backdrop-blur: ;--tw-backdrop-brightness: ;--tw-backdrop-contrast: ;--tw-backdrop-grayscale: ;--tw-backdrop-hue-rotate: ;--tw-backdrop-invert: ;--tw-backdrop-opacity: ;--tw-backdrop-saturate: ;--tw-backdrop-sepia: ;--tw-contain-size: ;--tw-contain-layout: ;--tw-contain-paint: ;--tw-contain-style: }}.scalar-client{line-height:1.5;color:var(--scalar-color-1)}.scalar-client .row{display:flex;flex-direction:row}.scalar-client .row-1{display:flex;flex-direction:row;flex:1 1 0%}.scalar-client .col{display:flex;flex-direction:column}.scalar-client .col-1{display:flex;flex-direction:column;flex:1 1 0%}.scalar-client .flex-center{display:flex;justify-content:center;align-items:center}.scalar-client .centered-x{left:50%;--tw-translate-x: -50%;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.scalar-client .centered-y{top:50%;--tw-translate-y: -50%;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.scalar-client .centered{left:50%;--tw-translate-x: -50%;top:50%;--tw-translate-y: -50%;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.scalar-client .sr-only{position:absolute;width:1px;height:1px;padding:0;margin:-1px;overflow:hidden;clip:rect(0,0,0,0);white-space:nowrap;border-width:0}.scalar-client .pointer-events-none{pointer-events:none}.scalar-client .pointer-events-auto{pointer-events:auto}.scalar-client .visible{visibility:visible}.scalar-client .static{position:static}.scalar-client .fixed{position:fixed}.scalar-client .absolute{position:absolute}.scalar-client .relative{position:relative}.scalar-client .sticky{position:sticky}.scalar-client .inset-0{top:0;right:0;bottom:0;left:0}.scalar-client .inset-y-2\\/4{top:50%;bottom:50%}.scalar-client .-right-6{right:-24px}.scalar-client .bottom-0{bottom:0}.scalar-client .bottom-10{bottom:40px}.scalar-client .left-0{left:0}.scalar-client .right-0{right:0}.scalar-client .right-1{right:4px}.scalar-client .right-10{right:40px}.scalar-client .right-2{right:8px}.scalar-client .right-4{right:16px}.scalar-client .right-5{right:20px}.scalar-client .right-7{right:28px}.scalar-client .top-0{top:0}.scalar-client .top-1\\/2{top:50%}.scalar-client .top-8{top:32px}.scalar-client .top-\\[0\\.5px\\]{top:.5px}.scalar-client .-z-1{z-index:-1}.scalar-client .z-0{z-index:0}.scalar-client .z-1{z-index:1}.scalar-client .z-10{z-index:10}.scalar-client .z-50{z-index:50}.scalar-client .z-\\[10001\\]{z-index:10001}.scalar-client .z-context{z-index:1000}.scalar-client .z-overlay{z-index:10000}.scalar-client .order-last{order:9999}.scalar-client .col-span-full{grid-column:1 / -1}.scalar-client .\\!m-0{margin:0!important}.scalar-client .m-0{margin:0}.scalar-client .m-4{margin:16px}.scalar-client .m-auto{margin:auto}.scalar-client .-my-1{margin-top:-4px;margin-bottom:-4px}.scalar-client .mx-0{margin-left:0;margin-right:0}.scalar-client .mx-1{margin-left:4px;margin-right:4px}.scalar-client .my-1{margin-top:4px;margin-bottom:4px}.scalar-client .my-1\\.25{margin-top:5px;margin-bottom:5px}.scalar-client .my-12{margin-top:48px;margin-bottom:48px}.scalar-client .my-4{margin-top:16px;margin-bottom:16px}.scalar-client .\\!mb-0{margin-bottom:0!important}.scalar-client .\\!mr-0{margin-right:0!important}.scalar-client .-mr-1{margin-right:-4px}.scalar-client .-mr-1\\.5{margin-right:-6px}.scalar-client .-mr-3{margin-right:-12px}.scalar-client .mb-0{margin-bottom:0}.scalar-client .mb-0\\.5{margin-bottom:2px}.scalar-client .mb-1{margin-bottom:4px}.scalar-client .mb-1\\.5{margin-bottom:6px}.scalar-client .mb-2{margin-bottom:8px}.scalar-client .mb-4{margin-bottom:16px}.scalar-client .mb-5{margin-bottom:20px}.scalar-client .mb-8{margin-bottom:32px}.scalar-client .mb-\\[\\.5px\\]{margin-bottom:.5px}.scalar-client .ml-0{margin-left:0}.scalar-client .ml-0\\.5{margin-left:2px}.scalar-client .ml-1{margin-left:4px}.scalar-client .ml-8{margin-left:32px}.scalar-client .ml-auto{margin-left:auto}.scalar-client .mr-1{margin-right:4px}.scalar-client .mr-1\\.5{margin-right:6px}.scalar-client .mr-2{margin-right:8px}.scalar-client .mr-2\\.5{margin-right:10px}.scalar-client .mr-auto{margin-right:auto}.scalar-client .mt-1{margin-top:4px}.scalar-client .mt-10{margin-top:40px}.scalar-client .mt-2{margin-top:8px}.scalar-client .mt-3{margin-top:12px}.scalar-client .mt-4{margin-top:16px}.scalar-client .mt-8{margin-top:32px}.scalar-client .mt-auto{margin-top:auto}.scalar-client .line-clamp-1{overflow:hidden;display:-webkit-box;-webkit-box-orient:vertical;-webkit-line-clamp:1}.scalar-client .line-clamp-3{overflow:hidden;display:-webkit-box;-webkit-box-orient:vertical;-webkit-line-clamp:3}.scalar-client .block{display:block}.scalar-client .inline-block{display:inline-block}.scalar-client .flex{display:flex}.scalar-client .inline-flex{display:inline-flex}.scalar-client .table{display:table}.scalar-client .grid{display:grid}.scalar-client .contents{display:contents}.scalar-client .hidden{display:none}.scalar-client .aspect-\\[4\\/3\\]{aspect-ratio:4/3}.scalar-client .aspect-square{aspect-ratio:1 / 1}.scalar-client .size-2{width:8px;height:8px}.scalar-client .size-2\\.5{width:10px;height:10px}.scalar-client .size-3{width:12px;height:12px}.scalar-client .size-3\\.5{width:14px;height:14px}.scalar-client .size-4{width:16px;height:16px}.scalar-client .h-10{height:40px}.scalar-client .h-2{height:8px}.scalar-client .h-2\\.5{height:10px}.scalar-client .h-24{height:96px}.scalar-client .h-3{height:12px}.scalar-client .h-3\\.5{height:14px}.scalar-client .h-4{height:16px}.scalar-client .h-48{height:192px}.scalar-client .h-5{height:20px}.scalar-client .h-6{height:24px}.scalar-client .h-64{height:256px}.scalar-client .h-7{height:28px}.scalar-client .h-8{height:32px}.scalar-client .h-\\[68px\\]{height:68px}.scalar-client .h-\\[calc\\(100\\%_-_50px\\)\\]{height:calc(100% - 50px)}.scalar-client .h-auto{height:auto}.scalar-client .h-fit{height:-moz-fit-content;height:fit-content}.scalar-client .h-full{height:100%}.scalar-client .h-screen{height:100vh}.scalar-client .max-h-40{max-height:160px}.scalar-client .max-h-8{max-height:32px}.scalar-client .max-h-\\[300px\\]{max-height:300px}.scalar-client .max-h-\\[40dvh\\]{max-height:40dvh}.scalar-client .min-h-0{min-height:0px}.scalar-client .min-h-10{min-height:40px}.scalar-client .min-h-11{min-height:44px}.scalar-client .min-h-12{min-height:48px}.scalar-client .min-h-20{min-height:80px}.scalar-client .min-h-8{min-height:32px}.scalar-client .w-10{width:40px}.scalar-client .w-2{width:8px}.scalar-client .w-2\\.5{width:10px}.scalar-client .w-20{width:80px}.scalar-client .w-3{width:12px}.scalar-client .w-3\\.5{width:14px}.scalar-client .w-4{width:16px}.scalar-client .w-5{width:20px}.scalar-client .w-6{width:24px}.scalar-client .w-6\\/12{width:50%}.scalar-client .w-64{width:256px}.scalar-client .w-8{width:32px}.scalar-client .w-\\[60px\\]{width:60px}.scalar-client .w-\\[calc\\(100\\%-10px\\)\\]{width:calc(100% - 10px)}.scalar-client .w-\\[calc\\(100\\%_-_8px\\)\\]{width:calc(100% - 8px)}.scalar-client .w-\\[inherit\\]{width:inherit}.scalar-client .w-auto{width:auto}.scalar-client .w-dvw{width:100dvw}.scalar-client .w-fit{width:-moz-fit-content;width:fit-content}.scalar-client .w-full{width:100%}.scalar-client .w-max{width:-moz-max-content;width:max-content}.scalar-client .min-w-0{min-width:0px}.scalar-client .min-w-2{min-width:8px}.scalar-client .min-w-2\\.5{min-width:10px}.scalar-client .min-w-3{min-width:12px}.scalar-client .min-w-48{min-width:192px}.scalar-client .min-w-60{min-width:240px}.scalar-client .min-w-8{min-width:32px}.scalar-client .min-w-\\[120px\\]{min-width:120px}.scalar-client .min-w-\\[37px\\]{min-width:37px}.scalar-client .min-w-full{min-width:100%}.scalar-client .max-w-\\[100\\%\\]{max-width:100%}.scalar-client .max-w-\\[14px\\]{max-width:14px}.scalar-client .max-w-\\[150px\\]{max-width:150px}.scalar-client .max-w-\\[320px\\]{max-width:320px}.scalar-client .max-w-\\[37px\\]{max-width:37px}.scalar-client .max-w-\\[420px\\]{max-width:420px}.scalar-client .max-w-\\[720px\\]{max-width:720px}.scalar-client .max-w-full{max-width:100%}.scalar-client .flex-1{flex:1 1 0%}.scalar-client .flex-shrink-0,.scalar-client .shrink-0{flex-shrink:0}.scalar-client .flex-grow{flex-grow:1}.scalar-client .-translate-x-1\\/2{--tw-translate-x:-50%;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.scalar-client .-translate-y-1\\/2{--tw-translate-y:-50%;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.scalar-client .translate-x-0{--tw-translate-x:0px;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.scalar-client .rotate-90{--tw-rotate:90deg;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.scalar-client .transform{transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.scalar-client .cursor-default{cursor:default}.scalar-client .cursor-help{cursor:help}.scalar-client .cursor-pointer{cursor:pointer}.scalar-client .cursor-text{cursor:text}.scalar-client .select-none{-webkit-user-select:none;-moz-user-select:none;user-select:none}.scalar-client .resize-none{resize:none}.scalar-client .resize{resize:both}.scalar-client .auto-rows-\\[32px\\]{grid-auto-rows:32px}.scalar-client .auto-rows-auto{grid-auto-rows:auto}.scalar-client .grid-cols-2{grid-template-columns:repeat(2,minmax(0,1fr))}.scalar-client .grid-cols-\\[44px\\,1fr\\,repeat\\(3\\,auto\\)\\]{grid-template-columns:44px 1fr repeat(3,auto)}.scalar-client .grid-cols-\\[auto\\,1fr\\]{grid-template-columns:auto 1fr}.scalar-client .grid-cols-\\[repeat\\(auto-fill\\,minmax\\(32px\\,1fr\\)\\)\\]{grid-template-columns:repeat(auto-fill,minmax(32px,1fr))}.scalar-client .flex-row{flex-direction:row}.scalar-client .flex-col{flex-direction:column}.scalar-client .flex-wrap{flex-wrap:wrap}.scalar-client .content-between{align-content:space-between}.scalar-client .items-start{align-items:flex-start}.scalar-client .items-end{align-items:flex-end}.scalar-client .items-center{align-items:center}.scalar-client .items-stretch{align-items:stretch}.scalar-client .justify-start{justify-content:flex-start}.scalar-client .justify-end{justify-content:flex-end}.scalar-client .justify-center{justify-content:center}.scalar-client .justify-between{justify-content:space-between}.scalar-client .\\!gap-1{gap:4px!important}.scalar-client .\\!gap-1\\.5{gap:6px!important}.scalar-client .\\!gap-2{gap:8px!important}.scalar-client .gap-0{gap:0px}.scalar-client .gap-0\\.25{gap:1px}.scalar-client .gap-0\\.5{gap:2px}.scalar-client .gap-1{gap:4px}.scalar-client .gap-1\\.5{gap:6px}.scalar-client .gap-10{gap:40px}.scalar-client .gap-2{gap:8px}.scalar-client .gap-2\\.5{gap:10px}.scalar-client .gap-3{gap:12px}.scalar-client .gap-4{gap:16px}.scalar-client .gap-6{gap:24px}.scalar-client .gap-\\[\\.5px\\]{gap:.5px}.scalar-client .gap-\\[1\\.5px\\]{gap:1.5px}.scalar-client .gap-px{gap:1px}.scalar-client .space-x-1>:not([hidden])~:not([hidden]){--tw-space-x-reverse:0;margin-right:calc(4px * var(--tw-space-x-reverse));margin-left:calc(4px * calc(1 - var(--tw-space-x-reverse)))}.scalar-client .divide-y>:not([hidden])~:not([hidden]){--tw-divide-y-reverse:0;border-top-width:calc(var(--scalar-border-width) * calc(1 - var(--tw-divide-y-reverse)));border-bottom-width:calc(var(--scalar-border-width) * var(--tw-divide-y-reverse))}.scalar-client .self-center{align-self:center}.scalar-client .justify-self-end{justify-self:end}.scalar-client .overflow-auto{overflow:auto}.scalar-client .overflow-hidden{overflow:hidden}.scalar-client .overflow-visible{overflow:visible}.scalar-client .overflow-x-auto{overflow-x:auto}.scalar-client .truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.scalar-client .text-ellipsis{text-overflow:ellipsis}.scalar-client .whitespace-nowrap{white-space:nowrap}.scalar-client .whitespace-pre{white-space:pre}.scalar-client .text-balance{text-wrap:balance}.scalar-client .text-pretty{text-wrap:pretty}.scalar-client .break-words{overflow-wrap:break-word}.scalar-client .break-all{word-break:break-all}.scalar-client .rounded{border-radius:var(--scalar-radius)}.scalar-client .rounded-\\[10px\\]{border-radius:10px}.scalar-client .rounded-full{border-radius:9999px}.scalar-client .rounded-lg{border-radius:var(--scalar-radius-lg)}.scalar-client .rounded-md{border-radius:var(--scalar-radius)}.scalar-client .rounded-xl{border-radius:var(--scalar-radius-xl)}.scalar-client .rounded-b{border-bottom-right-radius:var(--scalar-radius);border-bottom-left-radius:var(--scalar-radius)}.scalar-client .rounded-b-lg{border-bottom-right-radius:var(--scalar-radius-lg);border-bottom-left-radius:var(--scalar-radius-lg)}.scalar-client .rounded-b-none{border-bottom-right-radius:0;border-bottom-left-radius:0}.scalar-client .rounded-t{border-top-left-radius:var(--scalar-radius);border-top-right-radius:var(--scalar-radius)}.scalar-client .rounded-t-none{border-top-left-radius:0;border-top-right-radius:0}.scalar-client .\\!border-0{border-width:0!important}.scalar-client .border{border-width:var(--scalar-border-width)}.scalar-client .border-0{border-width:0}.scalar-client .border-1\\/2{border-width:calc(var(--scalar-border-width) / 2)}.scalar-client .border-\\[1\\.5px\\]{border-width:1.5px}.scalar-client .border-b-0{border-bottom-width:0}.scalar-client .border-b-1\\/2{border-bottom-width:calc(var(--scalar-border-width) / 2)}.scalar-client .border-l-0{border-left-width:0}.scalar-client .border-l-1\\/2{border-left-width:calc(var(--scalar-border-width) / 2)}.scalar-client .border-r{border-right-width:var(--scalar-border-width)}.scalar-client .border-r-0{border-right-width:0}.scalar-client .border-r-1\\/2{border-right-width:calc(var(--scalar-border-width) / 2)}.scalar-client .border-t{border-top-width:var(--scalar-border-width)}.scalar-client .border-t-0{border-top-width:0}.scalar-client .border-t-1\\/2{border-top-width:calc(var(--scalar-border-width) / 2)}.scalar-client .border-solid{border-style:solid}.scalar-client .border-none{border-style:none}.scalar-client .border-b-3{border-color:var(--scalar-background-3)}.scalar-client .border-c-3{border-color:var(--scalar-color-3)}.scalar-client .border-transparent{border-color:transparent}.scalar-client .border-r-transparent{border-right-color:transparent}.scalar-client .bg-b-1{background-color:var(--scalar-background-1)}.scalar-client .bg-b-2{background-color:var(--scalar-background-2)}.scalar-client .bg-b-3{background-color:var(--scalar-background-3)}.scalar-client .bg-blue{background-color:var(--scalar-color-blue)}.scalar-client .bg-c-2{background-color:var(--scalar-color-2)}.scalar-client .bg-c-accent{background-color:var(--scalar-color-accent)}.scalar-client .bg-green{background-color:var(--scalar-color-green)}.scalar-client .bg-grey{background-color:var(--scalar-color-3)}.scalar-client .bg-orange{background-color:var(--scalar-color-orange)}.scalar-client .bg-pink{background-color:var(--scalar-color-pink)}.scalar-client .bg-purple{background-color:var(--scalar-color-purple)}.scalar-client .bg-red{background-color:var(--scalar-color-red)}.scalar-client .bg-sidebar-active-b{background-color:var(--scalar-sidebar-item-active-background, var(--scalar-background-2))}.scalar-client .bg-white{--tw-bg-opacity:1;background-color:rgb(255 255 255 / var(--tw-bg-opacity))}.scalar-client .bg-yellow{background-color:var(--scalar-color-yellow)}.scalar-client .bg-none{background-image:none}.scalar-client .fill-current{fill:currentColor}.scalar-client .stroke-2{stroke-width:2}.scalar-client .stroke-\\[2\\.25\\]{stroke-width:2.25}.scalar-client .\\!p-1{padding:4px!important}.scalar-client .p-0{padding:0}.scalar-client .p-0\\.5{padding:2px}.scalar-client .p-0\\.75{padding:3px}.scalar-client .p-1{padding:4px}.scalar-client .p-1\\.5{padding:6px}.scalar-client .p-2{padding:8px}.scalar-client .p-2\\.25{padding:9px}.scalar-client .p-3{padding:12px}.scalar-client .p-4{padding:16px}.scalar-client .p-\\[3px\\]{padding:3px}.scalar-client .p-\\[5px\\]{padding:5px}.scalar-client .p-\\[8px\\]{padding:8px}.scalar-client .px-0{padding-left:0;padding-right:0}.scalar-client .px-0\\.5{padding-left:2px;padding-right:2px}.scalar-client .px-1{padding-left:4px;padding-right:4px}.scalar-client .px-1\\.5{padding-left:6px;padding-right:6px}.scalar-client .px-2{padding-left:8px;padding-right:8px}.scalar-client .px-2\\.5{padding-left:10px;padding-right:10px}.scalar-client .px-3{padding-left:12px;padding-right:12px}.scalar-client .px-3\\.5{padding-left:14px;padding-right:14px}.scalar-client .px-4{padding-left:16px;padding-right:16px}.scalar-client .px-5{padding-left:20px;padding-right:20px}.scalar-client .px-6{padding-left:24px;padding-right:24px}.scalar-client .px-\\[0px\\]{padding-left:0;padding-right:0}.scalar-client .px-\\[2\\.25px\\]{padding-left:2.25px;padding-right:2.25px}.scalar-client .py-0{padding-top:0;padding-bottom:0}.scalar-client .py-0\\.5{padding-top:2px;padding-bottom:2px}.scalar-client .py-1{padding-top:4px;padding-bottom:4px}.scalar-client .py-1\\.5{padding-top:6px;padding-bottom:6px}.scalar-client .py-2{padding-top:8px;padding-bottom:8px}.scalar-client .py-2\\.5{padding-top:10px;padding-bottom:10px}.scalar-client .py-3{padding-top:12px;padding-bottom:12px}.scalar-client .py-5{padding-top:20px;padding-bottom:20px}.scalar-client .py-\\[0px\\]{padding-top:0;padding-bottom:0}.scalar-client .py-\\[2\\.25px\\]{padding-top:2.25px;padding-bottom:2.25px}.scalar-client .py-\\[9px\\]{padding-top:9px;padding-bottom:9px}.scalar-client .py-px{padding-top:1px;padding-bottom:1px}.scalar-client .pb-0{padding-bottom:0}.scalar-client .pb-14{padding-bottom:56px}.scalar-client .pb-3{padding-bottom:12px}.scalar-client .pb-4{padding-bottom:16px}.scalar-client .pb-\\[75px\\]{padding-bottom:75px}.scalar-client .pl-1{padding-left:4px}.scalar-client .pl-2{padding-left:8px}.scalar-client .pl-5{padding-left:20px}.scalar-client .pl-8{padding-left:32px}.scalar-client .pl-9{padding-left:36px}.scalar-client .pl-px{padding-left:1px}.scalar-client .pr-0{padding-right:0}.scalar-client .pr-1{padding-right:4px}.scalar-client .pr-1\\.5{padding-right:6px}.scalar-client .pr-2{padding-right:8px}.scalar-client .pr-2\\.5{padding-right:10px}.scalar-client .pr-6{padding-right:24px}.scalar-client .pr-\\[26px\\]{padding-right:26px}.scalar-client .pt-0{padding-top:0}.scalar-client .pt-1{padding-top:4px}.scalar-client .pt-3{padding-top:12px}.scalar-client .pt-px{padding-top:1px}.scalar-client .text-left{text-align:left}.scalar-client .text-center{text-align:center}.scalar-client .text-right{text-align:right}.scalar-client .font-code{font-family:var(--scalar-font-code)}.scalar-client .text-3xs{font-size:var(--scalar-font-size-7)}.scalar-client .text-\\[11px\\]{font-size:11px}.scalar-client .text-\\[21px\\]{font-size:21px}.scalar-client .text-\\[50px\\]{font-size:50px}.scalar-client .text-\\[6px\\]{font-size:6px}.scalar-client .text-base{font-size:var(--scalar-font-size-3)}.scalar-client .text-sm{font-size:var(--scalar-font-size-4)}.scalar-client .text-xl{font-size:var(--scalar-font-size-1)}.scalar-client .text-xs{font-size:var(--scalar-font-size-5)}.scalar-client .text-xxs{font-size:var(--scalar-font-size-6)}.scalar-client .font-bold{font-weight:var(--scalar-bold)}.scalar-client .font-medium{font-weight:var(--scalar-semibold)}.scalar-client .font-normal{font-weight:var(--scalar-regular)}.scalar-client .uppercase{text-transform:uppercase}.scalar-client .lowercase{text-transform:lowercase}.scalar-client .capitalize{text-transform:capitalize}.scalar-client .leading-3{line-height:var(--scalar-line-height-3)}.scalar-client .leading-5{line-height:var(--scalar-line-height-5)}.scalar-client .leading-\\[1\\.44\\]{line-height:1.44}.scalar-client .leading-\\[21px\\]{line-height:21px}.scalar-client .leading-\\[7px\\]{line-height:7px}.scalar-client .leading-none{line-height:1}.scalar-client .leading-normal{line-height:1.5}.scalar-client .leading-snug{line-height:1.375}.scalar-client .leading-tight{line-height:1.25}.scalar-client .tracking-\\[-3px\\]{letter-spacing:-3px}.scalar-client .\\!text-c-1{color:var(--scalar-color-1)!important}.scalar-client .text-b-1{color:var(--scalar-background-1)}.scalar-client .text-blue{color:var(--scalar-color-blue)}.scalar-client .text-border{color:var(--scalar-border-color)}.scalar-client .text-c-1{color:var(--scalar-color-1)}.scalar-client .text-c-2{color:var(--scalar-color-2)}.scalar-client .text-c-3{color:var(--scalar-color-3)}.scalar-client .text-green{color:var(--scalar-color-green)}.scalar-client .text-grey{color:var(--scalar-color-3)}.scalar-client .text-orange{color:var(--scalar-color-orange)}.scalar-client .text-purple{color:var(--scalar-color-purple)}.scalar-client .text-red{color:var(--scalar-color-red)}.scalar-client .text-sidebar-active-c{color:var(--scalar-sidebar-color-active, currentColor)}.scalar-client .text-sidebar-c-2{color:var(--scalar-sidebar-color-2, var(--scalar-color-2))}.scalar-client .text-transparent{color:transparent}.scalar-client .text-yellow{color:var(--scalar-color-yellow)}.scalar-client .underline{text-decoration-line:underline}.scalar-client .no-underline{text-decoration-line:none}.scalar-client .decoration-c-3{text-decoration-color:var(--scalar-color-3)}.scalar-client .underline-offset-2{text-underline-offset:2px}.scalar-client .opacity-0{opacity:0}.scalar-client .opacity-100{opacity:1}.scalar-client .shadow{--tw-shadow:var(--scalar-shadow-1);--tw-shadow-colored:var(--scalar-shadow-1);box-shadow:var(--tw-ring-offset-shadow, 0 0 #0000),var(--tw-ring-shadow, 0 0 #0000),var(--tw-shadow)}.scalar-client .shadow-\\[-8px_0_4px_var\\(--scalar-background-1\\)\\]{--tw-shadow:-8px 0 4px var(--scalar-background-1);--tw-shadow-colored:-8px 0 4px var(--tw-shadow-color);box-shadow:var(--tw-ring-offset-shadow, 0 0 #0000),var(--tw-ring-shadow, 0 0 #0000),var(--tw-shadow)}.scalar-client .shadow-\\[0_-8px_0_8px_var\\(--scalar-background-1\\)\\,0_0_8px_8px_var\\(--scalar-background-1\\)\\]{--tw-shadow:0 -8px 0 8px var(--scalar-background-1),0 0 8px 8px var(--scalar-background-1);--tw-shadow-colored:0 -8px 0 8px var(--tw-shadow-color), 0 0 8px 8px var(--tw-shadow-color);box-shadow:var(--tw-ring-offset-shadow, 0 0 #0000),var(--tw-ring-shadow, 0 0 #0000),var(--tw-shadow)}.scalar-client .shadow-lg{--tw-shadow:var(--scalar-shadow-2);--tw-shadow-colored:var(--scalar-shadow-2);box-shadow:var(--tw-ring-offset-shadow, 0 0 #0000),var(--tw-ring-shadow, 0 0 #0000),var(--tw-shadow)}.scalar-client .shadow-none{--tw-shadow:0 0 #0000;--tw-shadow-colored:0 0 var(--tw-shadow-color);box-shadow:var(--tw-ring-offset-shadow, 0 0 #0000),var(--tw-ring-shadow, 0 0 #0000),var(--tw-shadow)}.scalar-client .outline-none{outline:2px solid transparent;outline-offset:2px}.scalar-client .outline{outline-style:solid}.scalar-client .ring-1{--tw-ring-offset-shadow:var(--tw-ring-inset) 0 0 0 var(--tw-ring-offset-width) var(--tw-ring-offset-color);--tw-ring-shadow:var(--tw-ring-inset) 0 0 0 calc(1px + var(--tw-ring-offset-width)) var(--tw-ring-color);box-shadow:var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow, 0 0 #0000)}.scalar-client .ring-offset-4{--tw-ring-offset-width:4px}.scalar-client .blur{--tw-blur:blur(8px);filter:var(--tw-blur) var(--tw-brightness) var(--tw-contrast) var(--tw-grayscale) var(--tw-hue-rotate) var(--tw-invert) var(--tw-saturate) var(--tw-sepia) var(--tw-drop-shadow)}.scalar-client .brightness-lifted{--tw-brightness:brightness(var(--scalar-lifted-brightness));filter:var(--tw-blur) var(--tw-brightness) var(--tw-contrast) var(--tw-grayscale) var(--tw-hue-rotate) var(--tw-invert) var(--tw-saturate) var(--tw-sepia) var(--tw-drop-shadow)}.scalar-client .filter{filter:var(--tw-blur) var(--tw-brightness) var(--tw-contrast) var(--tw-grayscale) var(--tw-hue-rotate) var(--tw-invert) var(--tw-saturate) var(--tw-sepia) var(--tw-drop-shadow)}.scalar-client .backdrop-filter{-webkit-backdrop-filter:var(--tw-backdrop-blur) var(--tw-backdrop-brightness) var(--tw-backdrop-contrast) var(--tw-backdrop-grayscale) var(--tw-backdrop-hue-rotate) var(--tw-backdrop-invert) var(--tw-backdrop-opacity) var(--tw-backdrop-saturate) var(--tw-backdrop-sepia);backdrop-filter:var(--tw-backdrop-blur) var(--tw-backdrop-brightness) var(--tw-backdrop-contrast) var(--tw-backdrop-grayscale) var(--tw-backdrop-hue-rotate) var(--tw-backdrop-invert) var(--tw-backdrop-opacity) var(--tw-backdrop-saturate) var(--tw-backdrop-sepia)}.scalar-client .transition{transition-property:color,background-color,border-color,text-decoration-color,fill,stroke,opacity,box-shadow,transform,filter,-webkit-backdrop-filter;transition-property:color,background-color,border-color,text-decoration-color,fill,stroke,opacity,box-shadow,transform,filter,backdrop-filter;transition-property:color,background-color,border-color,text-decoration-color,fill,stroke,opacity,box-shadow,transform,filter,backdrop-filter,-webkit-backdrop-filter;transition-timing-function:cubic-bezier(.4,0,.2,1);transition-duration:.15s}.scalar-client .transition-colors{transition-property:color,background-color,border-color,text-decoration-color,fill,stroke;transition-timing-function:cubic-bezier(.4,0,.2,1);transition-duration:.15s}.scalar-client .transition-none{transition-property:none}.scalar-client .transition-opacity{transition-property:opacity;transition-timing-function:cubic-bezier(.4,0,.2,1);transition-duration:.15s}.scalar-client .transition-transform{transition-property:transform;transition-timing-function:cubic-bezier(.4,0,.2,1);transition-duration:.15s}.scalar-client .duration-150{transition-duration:.15s}.scalar-client .duration-200{transition-duration:.2s}.scalar-client .duration-300{transition-duration:.3s}.scalar-client .ease-in-out{transition-timing-function:cubic-bezier(.4,0,.2,1)}.scalar-client .bg-mix-transparent{background-color:color-mix(var(--tw-bg-mix-method, in srgb),transparent calc(var(--tw-bg-mix-amount, 0) * 1%),var(--tw-bg-base))}.scalar-client .bg-mix-amount-90{--tw-bg-mix-amount:90}.scalar-client .bg-b-1{--tw-bg-base:var(--scalar-background-1)}.scalar-client .bg-b-2{--tw-bg-base:var(--scalar-background-2)}.scalar-client .bg-b-3{--tw-bg-base:var(--scalar-background-3)}.scalar-client .bg-blue{--tw-bg-base:var(--scalar-color-blue)}.scalar-client .bg-c-2{--tw-bg-base:var(--scalar-color-2)}.scalar-client .bg-c-accent{--tw-bg-base:var(--scalar-color-accent)}.scalar-client .bg-green{--tw-bg-base:var(--scalar-color-green)}.scalar-client .bg-grey{--tw-bg-base:var(--scalar-color-3)}.scalar-client .bg-orange{--tw-bg-base:var(--scalar-color-orange)}.scalar-client .bg-pink{--tw-bg-base:var(--scalar-color-pink)}.scalar-client .bg-purple{--tw-bg-base:var(--scalar-color-purple)}.scalar-client .bg-red{--tw-bg-base:var(--scalar-color-red)}.scalar-client .bg-sidebar-active-b{--tw-bg-base:var(--scalar-sidebar-item-active-background, var(--scalar-background-2))}.scalar-client .bg-white{--tw-bg-opacity:1;--tw-bg-base:rgb(255 255 255 / var(--tw-bg-opacity))}.scalar-client .bg-yellow{--tw-bg-base:var(--scalar-color-yellow)}.scalar-client .\\[--scalar-small\\:--scalar-font-size-4\\]{--scalar-small:var(--scalar-font-size-4)}.scalar-client .\\*\\:flex>*{display:flex}.scalar-client .\\*\\:h-8>*{height:32px}.scalar-client .\\*\\:cursor-pointer>*{cursor:pointer}.scalar-client .\\*\\:items-center>*{align-items:center}.scalar-client .\\*\\:rounded-none>*{border-radius:0}.scalar-client .\\*\\:border-t-1\\/2>*{border-top-width:calc(var(--scalar-border-width) / 2)}.scalar-client .\\*\\:px-1>*{padding-left:4px;padding-right:4px}.scalar-client .\\*\\:px-1\\.5>*{padding-left:6px;padding-right:6px}.scalar-client .before\\:pointer-events-none:before{content:var(--tw-content);pointer-events:none}.scalar-client .before\\:absolute:before{content:var(--tw-content);position:absolute}.scalar-client .before\\:-top-8:before{content:var(--tw-content);top:-32px}.scalar-client .before\\:left-0:before{content:var(--tw-content);left:0}.scalar-client .before\\:left-1\\/2:before{content:var(--tw-content);left:50%}.scalar-client .before\\:left-\\[calc\\(\\.75rem_\\+_\\.5px\\)\\]:before{content:var(--tw-content);left:calc(.75rem + .5px)}.scalar-client .before\\:left-\\[calc\\(1\\.75rem_-_1\\.5px\\)\\]:before{content:var(--tw-content);left:calc(1.75rem - 1.5px)}.scalar-client .before\\:left-\\[calc\\(1rem_-_1\\.5px\\)\\]:before{content:var(--tw-content);left:calc(1rem - 1.5px)}.scalar-client .before\\:right-\\[23px\\]:before{content:var(--tw-content);right:23px}.scalar-client .before\\:top-0:before{content:var(--tw-content);top:0}.scalar-client .before\\:top-1\\/2:before{content:var(--tw-content);top:50%}.scalar-client .before\\:z-1:before{content:var(--tw-content);z-index:1}.scalar-client .before\\:mx-\\[0\\.5ch\\]:before{content:var(--tw-content);margin-left:.5ch;margin-right:.5ch}.scalar-client .before\\:block:before{content:var(--tw-content);display:block}.scalar-client .before\\:aspect-square:before{content:var(--tw-content);aspect-ratio:1 / 1}.scalar-client .before\\:h-\\[calc\\(100\\%\\+32px\\)\\]:before{content:var(--tw-content);height:calc(100% + 32px)}.scalar-client .before\\:h-\\[calc\\(100\\%_\\+_\\.5px\\)\\]:before{content:var(--tw-content);height:calc(100% + .5px)}.scalar-client .before\\:min-h-full:before{content:var(--tw-content);min-height:100%}.scalar-client .before\\:w-3:before{content:var(--tw-content);width:12px}.scalar-client .before\\:w-9\\/12:before{content:var(--tw-content);width:75%}.scalar-client .before\\:w-\\[\\.5px\\]:before{content:var(--tw-content);width:.5px}.scalar-client .before\\:w-full:before{content:var(--tw-content);width:100%}.scalar-client .before\\:-translate-x-1\\/2:before{content:var(--tw-content);--tw-translate-x:-50%;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.scalar-client .before\\:-translate-y-1\\/2:before{content:var(--tw-content);--tw-translate-y:-50%;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.scalar-client .before\\:transform:before{content:var(--tw-content);transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.scalar-client .before\\:rounded:before{content:var(--tw-content);border-radius:var(--scalar-radius)}.scalar-client .before\\:rounded-lg:before{content:var(--tw-content);border-radius:var(--scalar-radius-lg)}.scalar-client .before\\:border:before{content:var(--tw-content);border-width:var(--scalar-border-width)}.scalar-client .before\\:border-\\[1px\\]:before{content:var(--tw-content);border-width:1px}.scalar-client .before\\:bg-border:before{content:var(--tw-content);background-color:var(--scalar-border-color)}.scalar-client .before\\:bg-gradient-to-r:before{content:var(--tw-content);background-image:linear-gradient(to right,var(--tw-gradient-stops))}.scalar-client .before\\:from-transparent:before{content:var(--tw-content);--tw-gradient-from:transparent var(--tw-gradient-from-position);--tw-gradient-to:rgb(0 0 0 / 0) var(--tw-gradient-to-position);--tw-gradient-stops:var(--tw-gradient-from), var(--tw-gradient-to)}.scalar-client .before\\:to-b-1:before{content:var(--tw-content);--tw-gradient-to:var(--scalar-background-1) var(--tw-gradient-to-position)}.scalar-client .before\\:opacity-0:before{content:var(--tw-content);opacity:0}.scalar-client .before\\:shadow-lg:before{content:var(--tw-content);--tw-shadow:var(--scalar-shadow-2);--tw-shadow-colored:var(--scalar-shadow-2);box-shadow:var(--tw-ring-offset-shadow, 0 0 #0000),var(--tw-ring-shadow, 0 0 #0000),var(--tw-shadow)}.scalar-client .before\\:content-\\[\\\'\\\'\\]:before{--tw-content:"";content:var(--tw-content)}.scalar-client .before\\:content-\\[\\\'·\\\'\\]:before{--tw-content:"·";content:var(--tw-content)}.scalar-client .before\\:bg-border:before{content:var(--tw-content);--tw-bg-base:var(--scalar-border-color)}.scalar-client .first\\:\\*\\:rounded-l>*:first-child{border-top-left-radius:var(--scalar-radius);border-bottom-left-radius:var(--scalar-radius)}.scalar-client .first\\:\\*\\:border-t-0>*:first-child{border-top-width:0}.scalar-client .last\\:mb-0:last-child{margin-bottom:0}.scalar-client .last\\:border-r-0:last-child{border-right-width:0}.scalar-client .last\\:\\*\\:rounded-r>*:last-child{border-top-right-radius:var(--scalar-radius);border-bottom-right-radius:var(--scalar-radius)}.scalar-client .last\\:before\\:h-full:last-child:before{content:var(--tw-content);height:100%}.scalar-client .focus-within\\:border-b-3:focus-within{border-color:var(--scalar-background-3)}.scalar-client .focus-within\\:bg-b-1:focus-within{background-color:var(--scalar-background-1)}.scalar-client .focus-within\\:bg-b-2:focus-within{background-color:var(--scalar-background-2)}.scalar-client .focus-within\\:text-c-1:focus-within{color:var(--scalar-color-1)}.scalar-client .focus-within\\:bg-b-1:focus-within{--tw-bg-base:var(--scalar-background-1)}.scalar-client .focus-within\\:bg-b-2:focus-within{--tw-bg-base:var(--scalar-background-2)}.scalar-client .hover\\:bg-b-2:hover{background-color:var(--scalar-background-2)}.scalar-client .hover\\:bg-b-3:hover{background-color:var(--scalar-background-3)}.scalar-client .hover\\:bg-sidebar-active-b:hover{background-color:var(--scalar-sidebar-item-active-background, var(--scalar-background-2))}.scalar-client .hover\\:text-c-1:hover{color:var(--scalar-color-1)}.scalar-client .hover\\:text-c-2:hover{color:var(--scalar-color-2)}.scalar-client .hover\\:bg-b-2:hover{--tw-bg-base:var(--scalar-background-2)}.scalar-client .hover\\:bg-b-3:hover{--tw-bg-base:var(--scalar-background-3)}.scalar-client .hover\\:bg-sidebar-active-b:hover{--tw-bg-base:var(--scalar-sidebar-item-active-background, var(--scalar-background-2))}.scalar-client .\\*\\:hover\\:bg-b-2:hover>*{background-color:var(--scalar-background-2)}.scalar-client .\\*\\:hover\\:bg-b-2:hover>*{--tw-bg-base:var(--scalar-background-2)}.scalar-client .focus\\:text-c-1:focus{color:var(--scalar-color-1)}.scalar-client .focus\\:outline-none:focus{outline:2px solid transparent;outline-offset:2px}.scalar-client .active\\:text-c-1:active{color:var(--scalar-color-1)}.scalar-client .disabled\\:text-c-2:disabled{color:var(--scalar-color-2)}.scalar-client .group:last-child .group-last\\:border-b-transparent{border-bottom-color:transparent}.scalar-client .group\\/upload:hover .group-hover\\/upload\\:block,.scalar-client .group:hover .group-hover\\:block{display:block}.scalar-client .group\\/item:hover .group-hover\\/item\\:flex,.scalar-client .group:hover .group-hover\\:flex{display:flex}.scalar-client .group:hover .group-hover\\:hidden{display:none}.scalar-client .group:hover .group-hover\\:cursor-auto{cursor:auto}.scalar-client .group:hover .group-hover\\:bg-b-2{background-color:var(--scalar-background-2)}.scalar-client .group\\/info:hover .group-hover\\/info\\:text-c-1{color:var(--scalar-color-1)}.scalar-client .group\\/scopes-accordion:hover .group-hover\\/scopes-accordion\\:text-c-2{color:var(--scalar-color-2)}.scalar-client .group:hover .group-hover\\:text-c-1{color:var(--scalar-color-1)}.scalar-client .group\\/params:hover .group-hover\\/params\\:opacity-100,.scalar-client .group:hover .group-hover\\:opacity-100{opacity:1}.scalar-client .group:hover .group-hover\\:opacity-80{opacity:.8}.scalar-client .group\\/item:hover .group-hover\\/item\\:shadow-border,.scalar-client .group:hover .group-hover\\:shadow-border{--tw-shadow:inset 0 0 0 1px var(--scalar-border-color);--tw-shadow-colored:inset 0 0 0 1px var(--tw-shadow-color);box-shadow:var(--tw-ring-offset-shadow, 0 0 #0000),var(--tw-ring-shadow, 0 0 #0000),var(--tw-shadow)}.scalar-client .group\\/item:hover .group-hover\\/item\\:shadow-border,.scalar-client .group:hover .group-hover\\:shadow-border{--tw-shadow-color:var(--scalar-border-color);--tw-shadow:var(--tw-shadow-colored)}.scalar-client .group:hover .group-hover\\:bg-b-2{--tw-bg-base:var(--scalar-background-2)}.scalar-client .group\\/cell:hover .group-hover\\/cell\\:before\\:opacity-100:before{content:var(--tw-content);opacity:1}.scalar-client .peer:checked~.peer-checked\\:text-c-2{color:var(--scalar-color-2)}.scalar-client .peer:focus~.peer-focus\\:opacity-0{opacity:0}.scalar-client .has-\\[\\.empty-sidebar-item\\]\\:border-t-1\\/2:has(.empty-sidebar-item){border-top-width:calc(var(--scalar-border-width) / 2)}.scalar-client .peer:has(.cm-focused)~.peer-has-\\[\\.cm-focused\\]\\:opacity-0{opacity:0}.scalar-client .ui-open\\:mb-3[data-headlessui-state~=open]{margin-bottom:12px}.scalar-client .ui-open\\:rotate-90[data-headlessui-state~=open]{--tw-rotate:90deg;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.scalar-client .ui-open\\:pb-1[data-headlessui-state~=open]{padding-bottom:4px}.scalar-client :where([data-headlessui-state~=open]) .ui-open\\:mb-3{margin-bottom:12px}.scalar-client :where([data-headlessui-state~=open]) .ui-open\\:rotate-90{--tw-rotate:90deg;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.scalar-client :where([data-headlessui-state~=open]) .ui-open\\:pb-1{padding-bottom:4px}.scalar-client .ui-not-open\\:invisible[data-headlessui-state]:not([data-headlessui-state~=open]){visibility:hidden}.scalar-client .ui-not-open\\:mb-0[data-headlessui-state]:not([data-headlessui-state~=open]){margin-bottom:0}.scalar-client .ui-not-open\\:rotate-0[data-headlessui-state]:not([data-headlessui-state~=open]){--tw-rotate:0deg;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.scalar-client .ui-not-open\\:bg-transparent[data-headlessui-state]:not([data-headlessui-state~=open]){background-color:transparent}.scalar-client .ui-not-open\\:pb-0[data-headlessui-state]:not([data-headlessui-state~=open]){padding-bottom:0}.scalar-client .ui-not-open\\:bg-transparent[data-headlessui-state]:not([data-headlessui-state~=open]){--tw-bg-base:transparent}.scalar-client .ui-not-open\\:hover\\:bg-b-2:hover[data-headlessui-state]:not([data-headlessui-state~=open]){background-color:var(--scalar-background-2)}.scalar-client .ui-not-open\\:hover\\:bg-b-2:hover[data-headlessui-state]:not([data-headlessui-state~=open]){--tw-bg-base:var(--scalar-background-2)}.scalar-client :where([data-headlessui-state]:not([data-headlessui-state~=open])) .ui-not-open\\:invisible:not([data-headlessui-state]){visibility:hidden}.scalar-client :where([data-headlessui-state]:not([data-headlessui-state~=open])) .ui-not-open\\:mb-0:not([data-headlessui-state]){margin-bottom:0}.scalar-client :where([data-headlessui-state]:not([data-headlessui-state~=open])) .ui-not-open\\:rotate-0:not([data-headlessui-state]){--tw-rotate:0deg;transform:translate(var(--tw-translate-x),var(--tw-translate-y)) rotate(var(--tw-rotate)) skew(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y))}.scalar-client :where([data-headlessui-state]:not([data-headlessui-state~=open])) .ui-not-open\\:bg-transparent:not([data-headlessui-state]){background-color:transparent}.scalar-client :where([data-headlessui-state]:not([data-headlessui-state~=open])) .ui-not-open\\:pb-0:not([data-headlessui-state]){padding-bottom:0}.scalar-client :where([data-headlessui-state]:not([data-headlessui-state~=open])) .ui-not-open\\:bg-transparent:not([data-headlessui-state]){--tw-bg-base:transparent}.scalar-client :where([data-headlessui-state]:not([data-headlessui-state~=open])) .ui-not-open\\:hover\\:bg-b-2:hover:not([data-headlessui-state]){background-color:var(--scalar-background-2)}.scalar-client :where([data-headlessui-state]:not([data-headlessui-state~=open])) .ui-not-open\\:hover\\:bg-b-2:hover:not([data-headlessui-state]){--tw-bg-base:var(--scalar-background-2)}.scalar-client .ui-checked\\:bg-b-3[data-headlessui-state~=checked]{background-color:var(--scalar-background-3)}.scalar-client .ui-checked\\:bg-b-3[data-headlessui-state~=checked]{--tw-bg-base:var(--scalar-background-3)}.scalar-client :where([data-headlessui-state~=checked]) .ui-checked\\:bg-b-3{background-color:var(--scalar-background-3)}.scalar-client :where([data-headlessui-state~=checked]) .ui-checked\\:bg-b-3{--tw-bg-base:var(--scalar-background-3)}.scalar-client .ui-active\\:bg-b-2[data-headlessui-state~=active]{background-color:var(--scalar-background-2)}.scalar-client .ui-active\\:bg-b-2[data-headlessui-state~=active]{--tw-bg-base:var(--scalar-background-2)}.scalar-client :where([data-headlessui-state~=active]) .ui-active\\:bg-b-2{background-color:var(--scalar-background-2)}.scalar-client :where([data-headlessui-state~=active]) .ui-active\\:bg-b-2{--tw-bg-base:var(--scalar-background-2)}@media (min-width: 600px){.scalar-client .sm\\:order-none{order:0}}@media (min-width: 600px){.scalar-client .sm\\:flex-row{flex-direction:row}}@media (min-width: 600px){.scalar-client .sm\\:flex-col{flex-direction:column}}@media (min-width: 800px){.scalar-client .md\\:mx-1{margin-left:4px;margin-right:4px}}@media (min-width: 800px){.scalar-client .md\\:block{display:block}}@media (min-width: 800px){.scalar-client .md\\:flex{display:flex}}@media (min-width: 800px){.scalar-client .md\\:w-full{width:100%}}@media (min-width: 800px){.scalar-client .md\\:min-w-fit{min-width:-moz-fit-content;min-width:fit-content}}@media (min-width: 800px){.scalar-client .md\\:flex-none{flex:none}}@media (min-width: 800px){.scalar-client .md\\:flex-row{flex-direction:row}}@media (min-width: 800px){.scalar-client .md\\:border-b-0{border-bottom-width:0}}@media (min-width: 800px){.scalar-client .md\\:border-r-1\\/2{border-right-width:calc(var(--scalar-border-width) / 2)}}@media (min-width: 800px){.scalar-client .md\\:p-1{padding:4px}}@media (min-width: 800px){.scalar-client .md\\:p-1\\.5{padding:6px}}@media (min-width: 800px){.scalar-client .md\\:p-5{padding:20px}}@media (min-width: 800px){.scalar-client .md\\:px-2{padding-left:8px;padding-right:8px}}@media (min-width: 800px){.scalar-client .md\\:px-2\\.5{padding-left:10px;padding-right:10px}}@media (min-width: 800px){.scalar-client .md\\:px-4{padding-left:16px;padding-right:16px}}@media (min-width: 800px){.scalar-client .md\\:py-2{padding-top:8px;padding-bottom:8px}}@media (min-width: 800px){.scalar-client .md\\:py-2\\.5{padding-top:10px;padding-bottom:10px}}@media (min-width: 800px){.scalar-client .md\\:pb-2{padding-bottom:8px}}@media (min-width: 800px){.scalar-client .md\\:pb-2\\.5{padding-bottom:10px}}@media (min-width: 800px){.scalar-client .md\\:pb-\\[37px\\]{padding-bottom:37px}}@media (min-width: 800px){.scalar-client .md\\:pl-1{padding-left:4px}}@media (min-width: 800px){.scalar-client .md\\:\\*\\:border-t-0>*{border-top-width:0}}@media (min-width: 1000px){.scalar-client .lg\\:order-none{order:0}}@media (min-width: 1000px){.scalar-client .lg\\:mb-0{margin-bottom:0}}@media (min-width: 1000px){.scalar-client .lg\\:flex{display:flex}}@media (min-width: 1000px){.scalar-client .lg\\:min-h-header{min-height:var(--scalar-client-header-height)}}@media (min-width: 1000px){.scalar-client .lg\\:w-\\[120px\\]{width:120px}}@media (min-width: 1000px){.scalar-client .lg\\:w-auto{width:auto}}@media (min-width: 1000px){.scalar-client .lg\\:min-w-\\[720px\\]{min-width:720px}}@media (min-width: 1000px){.scalar-client .lg\\:max-w-\\[720px\\]{max-width:720px}}@media (min-width: 1000px){.scalar-client .lg\\:flex-1{flex:1 1 0%}}@media (min-width: 1000px){.scalar-client .lg\\:p-1{padding:4px}}@media (min-width: 1000px){.scalar-client .lg\\:px-1{padding-left:4px;padding-right:4px}}@media (min-width: 1000px){.scalar-client .lg\\:px-2{padding-left:8px;padding-right:8px}}@media (min-width: 1000px){.scalar-client .lg\\:px-2\\.5{padding-left:10px;padding-right:10px}}@media (min-width: 1000px){.scalar-client .lg\\:pr-24{padding-right:96px}}@media (min-width: 1000px){.scalar-client .lg\\:text-sm{font-size:var(--scalar-font-size-4)}}@media (min-width: 1200px){.scalar-client .xl\\:flex{display:flex}}@media (min-width: 1200px){.scalar-client .xl\\:min-h-header{min-height:var(--scalar-client-header-height)}}@media (min-width: 1200px){.scalar-client .xl\\:min-w-0{min-width:0px}}@media (min-width: 1200px){.scalar-client .xl\\:flex-1{flex:1 1 0%}}@media (min-width: 1200px){.scalar-client .xl\\:flex-row{flex-direction:row}}@media (min-width: 1200px){.scalar-client .xl\\:overflow-hidden{overflow:hidden}}@media (min-width: 1200px){.scalar-client .xl\\:rounded-none{border-radius:0}}@media (min-width: 1200px){.scalar-client .xl\\:px-4{padding-left:16px;padding-right:16px}}@media (min-width: 1200px){.scalar-client .xl\\:px-6{padding-left:24px;padding-right:24px}}@media (min-width: 1200px){.scalar-client .xl\\:pr-5{padding-right:20px}}@media (min-width: 1200px){.scalar-client .xl\\:\\*\\:border-l-1\\/2>*{border-left-width:calc(var(--scalar-border-width) / 2)}}@media (min-width: 1200px){.scalar-client .xl\\:\\*\\:border-t-0>*{border-top-width:0}}@media (min-width: 1200px){.scalar-client .xl\\:first\\:\\*\\:border-l-0>*:first-child{border-left-width:0}}.scalar-client .dark\\:hover\\:bg-b-2:hover:where(.dark-mode,.dark-mode *){background-color:var(--scalar-background-2)}.scalar-client .dark\\:hover\\:bg-b-2:hover:where(.dark-mode,.dark-mode *){--tw-bg-base:var(--scalar-background-2)}:root{--scalar-client-header-height: 50px;--scalar-sidebar-width: 280px;--scalar-toc-width: 280px}.scalar .scalar-api-client[data-v-900788ee]{max-height:calc(100% - calc(var(--scalar-app-header-height)));border-radius:8px}.scalar .scalar-app-layout[data-v-900788ee]{background:var(--scalar-background-1);height:calc(100% - 120px);max-width:1390px;width:100%;margin:auto;opacity:0;animation:scalarapiclientfadein-900788ee .35s forwards;position:relative;overflow:hidden;border-radius:8px}@keyframes scalarapiclientfadein-900788ee{0%{opacity:0}to{opacity:1}}.scalar .scalar-app-exit[data-v-900788ee]{position:fixed;top:0;left:0;width:100vw;height:100vh;background:#00000038;transition:all .3s ease-in-out;cursor:pointer;animation:scalardrawerexitfadein-900788ee .35s forwards}.dark-mode .scalar .scalar-app-exit[data-v-900788ee]{background:#00000073}.scalar .scalar-app-exit[data-v-900788ee]:before{font-family:sans-serif;position:absolute;top:0;font-size:30px;font-weight:100;line-height:50px;right:12px;text-align:center;color:#fff;opacity:.6}.scalar .scalar-app-exit[data-v-900788ee]:hover:before{opacity:1}@keyframes scalardrawerexitfadein-900788ee{0%{opacity:0}to{opacity:1}}.scalar-container[data-v-900788ee]{overflow:hidden;visibility:visible;position:fixed;bottom:0;top:0;left:0;width:100%;height:100%;display:flex;align-items:center;justify-content:center}.scalar .url-form-input[data-v-900788ee]{min-height:auto!important}.scalar .scalar-container[data-v-900788ee]{line-height:normal}.scalar .scalar-app-header span[data-v-900788ee]{color:var(--scalar-color-3)}.scalar .scalar-app-header a[data-v-900788ee]{color:var(--scalar-color-1)}.scalar .scalar-app-header a[data-v-900788ee]:hover{text-decoration:underline}.scalar-activate[data-v-900788ee]{width:-moz-fit-content;width:fit-content;margin:0px .75rem .75rem auto;line-height:24px;cursor:pointer;font-size:.875rem;font-weight:600;display:flex;align-items:center;gap:6px}.scalar-activate-button[data-v-900788ee]{display:flex;gap:6px;align-items:center;color:var(--scalar-color-blue);-webkit-appearance:none;-moz-appearance:none;appearance:none;outline:none;border:none;background:transparent;padding:0 .5rem}.scalar-activate:hover .scalar-activate-button[data-v-900788ee]{background:var(--scalar-background-3);border-radius:3px}.http-bg-gradient[data-v-a2902675]{background:linear-gradient(#ffffffbf,#00000009)}.http-bg-gradient[data-v-a2902675]:hover{background:linear-gradient(#00000009,#ffffffbf)}.dark-mode .http-bg-gradient[data-v-a2902675]{background:linear-gradient(#ffffff09,#00000026)}.dark-mode .http-bg-gradient[data-v-a2902675]:hover{background:linear-gradient(#00000026,#ffffff09)}.scroll-timeline-x[data-v-50c10cc9]{overflow:auto;scroll-timeline:--scroll-timeline x;scroll-timeline:--scroll-timeline horizontal;-ms-overflow-style:none;scrollbar-width:none}.fade-request-section-content[data-v-1bc6f599]{background:linear-gradient(to left,var(--scalar-background-1) 64%,transparent)}.filter-hover[data-v-1bc6f599]{height:100%;padding-right:42px;padding-left:24px;position:absolute;right:0;transition:width 0s ease-in-out .2s;overflow:hidden}.filter-hover[data-v-1bc6f599]:hover{width:100%}.filter-hover[data-v-1bc6f599]:before{content:"";position:absolute;top:0;left:0;width:100%;height:100%;background-color:var(--scalar-background-1);opacity:0;transition:all .3s ease-in-out;pointer-events:none}.filter-hover button[data-v-1bc6f599]{opacity:0}.filter-hover button[data-v-1bc6f599]:not(:last-of-type){transform:translate3d(0,3px,0)}.filter-hover:hover button[data-v-1bc6f599]{transition:opacity .2s ease-in-out,transform .2s ease-in-out}.filter-hover:hover button[data-v-1bc6f599]:nth-last-of-type(1){transition-delay:.05s}.filter-hover:hover button[data-v-1bc6f599]:nth-last-of-type(2){transition-delay:.1s}.filter-hover:hover button[data-v-1bc6f599]:nth-last-of-type(3){transition-delay:.15s}.filter-hover:hover button[data-v-1bc6f599]:nth-last-of-type(4){transition-delay:.2s}.filter-hover:hover button[data-v-1bc6f599]:nth-last-of-type(5){transition-delay:.25s}.filter-hover:hover button[data-v-1bc6f599]:nth-last-of-type(6){transition-delay:.3s}.filter-hover:hover button[data-v-1bc6f599]:nth-last-of-type(7){transition-delay:.4s}.filter-hover:hover button[data-v-1bc6f599]{opacity:1;transform:translateZ(0)}.filter-hover[data-v-1bc6f599]:hover:before{opacity:.9;-webkit-backdrop-filter:blur(10px);backdrop-filter:blur(10px)}[data-v-9121d6e5] .cm-editor{height:100%;outline:none;padding:0;background:transparent}[data-v-9121d6e5] .cm-placeholder{color:var(--scalar-color-3)}[data-v-9121d6e5] .cm-content{font-family:var(--scalar-font-code);font-size:var(--scalar-small);max-height:20px;padding:8px 0}[data-v-9121d6e5] .cm-tooltip{background:transparent!important;filter:brightness(var(--scalar-lifted-brightness));border-radius:var(--scalar-radius);box-shadow:var(--scalar-shadow-2);border:none!important;outline:none!important;overflow:hidden!important}[data-v-9121d6e5] .cm-tooltip-autocomplete ul li{padding:3px 6px!important}[data-v-9121d6e5] .cm-completionIcon-type:after{color:var(--scalar-color-3)!important}[data-v-9121d6e5] .cm-tooltip-autocomplete ul li[aria-selected]{background:var(--scalar-background-2)!important;color:var(--scalar-color-1)!important}[data-v-9121d6e5] .cm-tooltip-autocomplete ul{padding:6px!important;position:relative}[data-v-9121d6e5] .cm-tooltip-autocomplete ul li:hover{border-radius:3px;color:var(--scalar-color-1)!important;background:var(--scalar-background-3)!important}[data-v-9121d6e5] .cm-activeLine,[data-v-9121d6e5] .cm-activeLineGutter{background-color:transparent}[data-v-9121d6e5] .cm-selectionMatch,[data-v-9121d6e5] .cm-matchingBracket{border-radius:var(--scalar-radius);background:var(--scalar-background-4)!important}[data-v-9121d6e5] .cm-css-color-picker-wrapper{display:inline-flex;outline:1px solid var(--scalar-background-3);border-radius:3px;overflow:hidden}[data-v-9121d6e5] .cm-gutters{background-color:var(--scalar-background-1);border-right:none;color:var(--scalar-color-3);font-size:var(--scalar-small);line-height:1.44;border-radius:0 0 0 3px}[data-v-9121d6e5] .cm-gutterElement{font-family:var(--scalar-font-code)!important;padding:0 6px 0 8px!important;display:flex;align-items:center;justify-content:flex-end}[data-v-9121d6e5] .cm-gutter+.cm-gutter :not(.cm-foldGutter) .cm-gutterElement{padding-left:0!important}[data-v-9121d6e5] .cm-scroller{overflow:auto}.cm-pill{--tw-bg-base: var(--scalar-color-1);color:var(--tw-bg-base);padding:0 9px;display:inline-block;border-radius:30px;font-size:var(--scalar-mini);background:color-mix(in srgb,var(--tw-bg-base),transparent 94%)!important}.cm-pill.bg-grey{background:var(--scalar-background-3)!important}.dark-mode .cm-pill{background:color-mix(in srgb,var(--tw-bg-base),transparent 80%)!important}.cm-pill:first-of-type{margin-left:0}.cm-editor .cm-widgetBuffer{display:none}.cm-foldPlaceholder:hover{color:var(--scalar-color-1)}.cm-foldGutter .cm-gutterElement{font-size:var(--scalar-heading-4);padding:2px!important}.cm-foldGutter .cm-gutterElement:first-of-type{display:none}.cm-foldGutter .cm-gutterElement .cm-foldMarker{padding:2px}.cm-foldGutter .cm-gutterElement:hover .cm-foldMarker{background:var(--scalar-background-2);border-radius:var(--scalar-radius);color:var(--scalar-color-1)}.cm-focused .cm-content ::-moz-selection{background:var(--scalar-selection-background)!important;color:var(--scalar-selection-color)}.cm-focused .cm-content ::selection{background:var(--scalar-selection-background)!important;color:var(--scalar-selection-color)}[data-v-1f355550] .cm-editor{padding:0}[data-v-1f355550] .cm-content{align-items:center;background-color:transparent;display:flex;font-family:var(--scalar-font);font-size:var(--scalar-mini);padding:6px 8px}[data-v-1f355550] .cm-content:has(.cm-pill){padding:4px 3px}[data-v-1f355550] .cm-content .cm-pill:not(:last-of-type){margin-right:.5px}[data-v-1f355550] .cm-content .cm-pill:not(:first-of-type){margin-left:.5px}[data-v-1f355550] .cm-line{padding:0}.filemask[data-v-1f355550]{-webkit-mask-image:linear-gradient(to right,transparent 0,var(--scalar-background-2) 20px);mask-image:linear-gradient(to right,transparent 0,var(--scalar-background-2) 20px)}[data-v-33e11d9f] .cm-content{font-size:var(--scalar-mini)}[data-v-0417d80a] .cm-editor{padding:0}[data-v-0417d80a] .cm-content{align-items:center;background-color:transparent;display:flex;font-family:var(--scalar-font);font-size:var(--scalar-mini);padding:6px 8px}[data-v-0417d80a] .cm-content:has(.cm-pill){padding:4px 3px}[data-v-0417d80a] .cm-content .cm-pill:not(:last-of-type){margin-right:.5px}[data-v-0417d80a] .cm-content .cm-pill:not(:first-of-type){margin-left:.5px}[data-v-0417d80a] .cm-line{padding:0}.required[data-v-0417d80a]:after{content:"Required"}input[data-v-0417d80a]::-moz-placeholder{color:var(--scalar-color-3)}input[data-v-0417d80a]::placeholder{color:var(--scalar-color-3)}.auth-combobox-position[data-v-4a75f9a1]{margin-left:120px}.scroll-timeline-x[data-v-4a75f9a1]{overflow:auto;scroll-timeline:--scroll-timeline x;scroll-timeline:--scroll-timeline horizontal;scrollbar-width:none;-ms-overflow-style:none}.fade-left[data-v-4a75f9a1],.fade-right[data-v-4a75f9a1]{position:sticky;content:"";height:100%;animation-name:fadein-4a75f9a1;animation-duration:1ms;animation-direction:reverse;animation-timeline:--scroll-timeline;min-height:24px;pointer-events:none}.fade-left[data-v-4a75f9a1]{background:linear-gradient(-90deg,color-mix(in srgb,var(--scalar-background-1),transparent 100%) 0%,color-mix(in srgb,var(--scalar-background-1),transparent 20%) 60%,var(--scalar-background-1) 100%);min-width:3px;left:-1px;animation-direction:normal}.fade-right[data-v-4a75f9a1]{background:linear-gradient(90deg,color-mix(in srgb,var(--scalar-background-1),transparent 100%) 0%,color-mix(in srgb,var(--scalar-background-1),transparent 20%) 60%,var(--scalar-background-1) 100%);margin-left:-20px;min-width:24px;right:-1px;top:0}@keyframes fadein-4a75f9a1{0%{opacity:0}15%{opacity:1}}.request-section-content{--scalar-border-width: .5px}.request-section-content-filter{box-shadow:0 -10px 0 10px var(--scalar-background-1)}.request-item:focus-within .request-meta-buttons{opacity:1}.addressbar-history-button[data-v-0e166ebf]:hover{background:var(--scalar-background-3)}.addressbar-history-button[data-v-0e166ebf]:focus-within{background:var(--scalar-background-2)}[data-v-19d5c366] .cm-editor{background-color:var(--scalar-background-1);height:100%;outline:none;width:100%}[data-v-19d5c366] .cm-content{padding:0;display:flex;align-items:center;font-size:var(--scalar-mini)}.scroll-timeline-x[data-v-19d5c366]{scroll-timeline:--scroll-timeline x;scroll-timeline:--scroll-timeline horizontal;-ms-overflow-style:none}.scroll-timeline-x-hidden[data-v-19d5c366]{overflow:hidden}.scroll-timeline-x-hidden[data-v-19d5c366] .cm-scroller{scrollbar-width:none;-ms-overflow-style:none;padding-right:20px;overflow:auto}.scroll-timeline-x-hidden[data-v-19d5c366]::-webkit-scrollbar{width:0;height:0;display:none}.scroll-timeline-x-hidden[data-v-19d5c366] .cm-scroller::-webkit-scrollbar{width:0;height:0;display:none}.scroll-timeline-x-address[data-v-19d5c366]{line-height:27px;scrollbar-width:none}.scroll-timeline-x-address[data-v-19d5c366]:after{content:"";position:absolute;height:100%;width:24px;right:0;cursor:text}.scroll-timeline-x-address[data-v-19d5c366]:empty:before{content:"Enter URL or cURL request";color:var(--scalar-color-3);pointer-events:none}.fade-left[data-v-19d5c366],.fade-right[data-v-19d5c366]{content:"";position:sticky;height:100%;animation-name:fadein-19d5c366;animation-duration:1ms;animation-direction:reverse;animation-timeline:--scroll-timeline;pointer-events:none}.fade-left[data-v-19d5c366]{background:linear-gradient(-90deg,color-mix(in srgb,var(--scalar-background-1),transparent 100%) 0%,color-mix(in srgb,var(--scalar-background-1),transparent 20%) 30%,var(--scalar-background-1) 100%);left:0;min-width:3px;animation-direction:normal}.fade-right[data-v-19d5c366]{background:linear-gradient(90deg,color-mix(in srgb,var(--scalar-background-1),transparent 100%) 0%,color-mix(in srgb,var(--scalar-background-1),transparent 20%) 30%,var(--scalar-background-1) 100%);right:0;min-width:24px}@keyframes fadein-19d5c366{0%{opacity:0}1%{opacity:1}}.codemirror-bg-switcher[data-v-19d5c366]{--scalar-background-1: var(--scalar-background-2)}.addressbar-bg-states:focus-within .codemirror-bg-switcher[data-v-19d5c366]{--scalar-background-1: var(--scalar-background-1)}.addressbar-bg-states[data-v-19d5c366]{background:var(--scalar-background-2);border-color:transparent}.addressbar-bg-states[data-v-19d5c366]:focus-within{background:var(--scalar-background-1);border-color:var(--scalar-border-color)}.delete-warning-button[data-v-c3d3d457]{background:color-mix(in srgb,var(--scalar-color-red),transparent 95%);color:var(--scalar-color-red)}.delete-warning-button[data-v-c3d3d457]:hover,.delete-warning-button[data-v-c3d3d457]:focus{background:color-mix(in srgb,var(--scalar-color-red),transparent 90%)}.gitbook-show[data-v-89f09c6b]{display:none}.light-mode .bg-preview[data-v-7fbe3767]{background-image:url("data:image/svg+xml,%3Csvg xmlns=\'http://www.w3.org/2000/svg\' width=\'16\' height=\'16\' fill=\'%23000\' fill-opacity=\'10%25\'%3E%3Crect width=\'8\' height=\'8\' /%3E%3Crect x=\'8\' y=\'8\' width=\'8\' height=\'8\' /%3E%3C/svg%3E")}.dark-mode .bg-preview[data-v-7fbe3767]{background-image:url("data:image/svg+xml,%3Csvg xmlns=\'http://www.w3.org/2000/svg\' width=\'16\' height=\'16\' fill=\'%23FFF\' fill-opacity=\'10%25\'%3E%3Crect width=\'8\' height=\'8\' /%3E%3Crect x=\'8\' y=\'8\' width=\'8\' height=\'8\' /%3E%3C/svg%3E")}[data-v-b7d4ba6e] .cm-editor{background-color:transparent;font-size:var(--scalar-mini);outline:none}[data-v-b7d4ba6e] .cm-gutters{background-color:var(--scalar-background-1);border-radius:var(--scalar-radius) 0 0 var(--scalar-radius)}.ascii-art-animate .ascii-art-line[data-v-93347509]{border-right:1ch solid transparent;animation:typewriter-93347509 4s steps(1) 1s 1 normal both,blinkTextCursor-93347509 .5s steps(1) infinite normal}@keyframes typewriter-93347509{0%{width:0}to{width:100%}}@keyframes blinkTextCursor-93347509{0%{border-right-color:currentColor}50%{border-right-color:transparent}}.scalar-version-number[data-v-cf8761cd]{transform:skew(0,16deg);width:66px;height:66px;position:absolute;margin-left:-33px;font-size:8px;font-family:var(--scalar-font-code);line-height:11px;margin-top:-110px}.scalar-version-number b[data-v-cf8761cd]{font-weight:700}.v-enter-active[data-v-ef5f83d8]{transition:opacity .5s ease}.v-enter-from[data-v-ef5f83d8]{opacity:0}.response-body-virtual[data-headlessui-state=open],.response-body-virtual[data-headlessui-state=open] .diclosure-panel{display:flex;flex-direction:column;flex-grow:1}.sidebar-height[data-v-6d244398]{min-height:100%}@media (min-width: 800px){.sidebar-mask[data-v-6d244398]{-webkit-mask-image:linear-gradient(0,transparent 0,transparent 0,var(--scalar-background-2) 30px);mask-image:linear-gradient(0,transparent 0,transparent 0,var(--scalar-background-2) 30px)}}.resizer[data-v-6d244398]{width:5px;cursor:col-resize;position:absolute;top:0;right:0;bottom:0;border-right:2px solid transparent;transition:border-right-color .3s}.resizer[data-v-6d244398]:hover,.dragging .resizer[data-v-6d244398]{border-right-color:var(--scalar-background-3)}.dragging[data-v-6d244398]{cursor:col-resize}.dragging[data-v-6d244398]:before{content:"";display:block;position:absolute;width:100%;height:100%}.ellipsis-position[data-v-dd8b3a7e]{transform:translate3d(calc(-100% - 4.5px),0,0)}.dragover-asChild[data-v-1c55d212],.dragover-above[data-v-1c55d212],.dragover-below[data-v-1c55d212]{position:relative}.dragover-above[data-v-1c55d212]:after,.dragover-below[data-v-1c55d212]:after{content:"";position:absolute;top:-1.5px;height:3px;width:100%;display:block;background:color-mix(in srgb,var(--scalar-color-blue),transparent 85%);pointer-events:none;border-radius:var(--scalar-radius)}.dragover-below[data-v-1c55d212]:after{top:initial;bottom:-1.5px}.dragover-asChild[data-v-1c55d212]:after{content:"";position:absolute;top:0;left:0;width:100%;height:100%;display:block;background:color-mix(in srgb,var(--scalar-color-blue),transparent 85%);pointer-events:none;border-radius:var(--scalar-radius)}.indent-border-line-offset[data-v-0eb4db04]:before{left:var(--7aec5b39)}.indent-padding-left[data-v-0eb4db04]{padding-left:calc(var(--296ea3e5) + 6px)}.editable-sidebar-hover:hover .editable-sidebar-hover-item[data-v-0eb4db04]{-webkit-mask-image:linear-gradient(to left,transparent 10px,var(--scalar-background-2) 30px);mask-image:linear-gradient(to left,transparent 10px,var(--scalar-background-2) 30px)}.sidebar-folderitem[data-v-0eb4db04] .ellipsis-position{right:6px;transform:none}.word-break-break-word[data-v-0eb4db04]{word-break:break-word}.search-button-fade[data-v-beea081e]{background:linear-gradient(var(--scalar-background-1) 44px,color-mix(in srgb,var(--scalar-background-1),transparent) 50px,transparent)}.empty-sidebar-item[data-v-beea081e] .scalar-button{background:var(--scalar-button-1);color:var(--scalar-button-1-color)}.empty-sidebar-item[data-v-beea081e] .scalar-button:hover{background:var(--scalar-button-1-hover)}.empty-sidebar-item[data-v-beea081e] .add-item-hotkey{color:var(--scalar-button-1-color);background:color-mix(in srgb,var(--scalar-button-1),white 20%);border-color:transparent}.empty-sidebar-item-content[data-v-beea081e]{display:none}.empty-sidebar-item .empty-sidebar-item-content[data-v-beea081e]{display:block}.rabbitjump[data-v-beea081e]{opacity:0}.empty-sidebar-item:hover .rabbitjump[data-v-beea081e]{opacity:1;animation:rabbitAnimation-beea081e .5s steps(1) infinite}.empty-sidebar-item:hover .rabbitsit[data-v-beea081e]{opacity:0;animation:rabbitAnimation2-beea081e .5s steps(1) infinite}.empty-sidebar-item:hover .rabbit-ascii[data-v-beea081e]{animation:rabbitRun-beea081e 8s infinite linear}@keyframes rabbitRun-beea081e{0%{transform:translateZ(0)}25%{transform:translate3d(250px,0,0)}25.01%{transform:translate3d(-250px,0,0)}75%{transform:translate3d(250px,0,0)}75.01%{transform:translate3d(-250px,0,0)}to{transform:translateZ(0)}}@keyframes rabbitAnimation-beea081e{0%,to{opacity:1}50%{opacity:0}}@keyframes rabbitAnimation2-beea081e{0%,to{opacity:0}50%{opacity:1;transform:translate3d(0,-8px,0)}}.request-text-color-text[data-v-e56f92be]{color:var(--scalar-color-1);background:linear-gradient(var(--scalar-background-1),var(--scalar-background-3));box-shadow:0 0 0 1px var(--scalar-border-color)}@media screen and (max-width: 800px){.sidebar-active-hide-layout[data-v-e56f92be]{display:none}.sidebar-active-width[data-v-e56f92be]{width:100%}}.active-link[data-v-271914bc]{background-color:var(--scalar-background-2);color:var(--scalar-color-1);--tw-bg-base: var(--scalar-background-2)}.empty-variable-name[data-v-271914bc]:empty:before{content:"No Name";color:var(--scalar-color-3)}.cookie>a[data-v-271914bc]{padding-left:40px}')),document.head.appendChild(a)}}catch(r){console.error("vite-plugin-css-injected-by-js",r)}}();
var __defProp = Object.defineProperty;
var __defNormalProp = (obj, key2, value) => key2 in obj ? __defProp(obj, key2, { enumerable: true, configurable: true, writable: true, value }) : obj[key2] = value;
var __publicField = (obj, key2, value) => __defNormalProp(obj, typeof key2 !== "symbol" ? key2 + "" : key2, value);
/**
* @vue/shared v3.5.12
* (c) 2018-present Yuxi (Evan) You and Vue contributors
* @license MIT
**/
/*! #__NO_SIDE_EFFECTS__ */
// @__NO_SIDE_EFFECTS__
function makeMap(str) {
  const map2 = /* @__PURE__ */ Object.create(null);
  for (const key2 of str.split(",")) map2[key2] = 1;
  return (val) => val in map2;
}
const EMPTY_OBJ = {};
const EMPTY_ARR = [];
const NOOP = () => {
};
const NO = () => false;
const isOn = (key2) => key2.charCodeAt(0) === 111 && key2.charCodeAt(1) === 110 && // uppercase letter
(key2.charCodeAt(2) > 122 || key2.charCodeAt(2) < 97);
const isModelListener = (key2) => key2.startsWith("onUpdate:");
const extend$3 = Object.assign;
const remove$1 = (arr, el) => {
  const i2 = arr.indexOf(el);
  if (i2 > -1) {
    arr.splice(i2, 1);
  }
};
const hasOwnProperty$1 = Object.prototype.hasOwnProperty;
const hasOwn$2 = (val, key2) => hasOwnProperty$1.call(val, key2);
const isArray$3 = Array.isArray;
const isMap$1 = (val) => toTypeString(val) === "[object Map]";
const isSet = (val) => toTypeString(val) === "[object Set]";
const isFunction = (val) => typeof val === "function";
const isString$1 = (val) => typeof val === "string";
const isSymbol = (val) => typeof val === "symbol";
const isObject$2 = (val) => val !== null && typeof val === "object";
const isPromise = (val) => {
  return (isObject$2(val) || isFunction(val)) && isFunction(val.then) && isFunction(val.catch);
};
const objectToString = Object.prototype.toString;
const toTypeString = (value) => objectToString.call(value);
const toRawType = (value) => {
  return toTypeString(value).slice(8, -1);
};
const isPlainObject$2 = (val) => toTypeString(val) === "[object Object]";
const isIntegerKey = (key2) => isString$1(key2) && key2 !== "NaN" && key2[0] !== "-" && "" + parseInt(key2, 10) === key2;
const isReservedProp = /* @__PURE__ */ makeMap(
  // the leading comma is intentional so empty string "" is also included
  ",key,ref,ref_for,ref_key,onVnodeBeforeMount,onVnodeMounted,onVnodeBeforeUpdate,onVnodeUpdated,onVnodeBeforeUnmount,onVnodeUnmounted"
);
const cacheStringFunction = (fn) => {
  const cache2 = /* @__PURE__ */ Object.create(null);
  return (str) => {
    const hit = cache2[str];
    return hit || (cache2[str] = fn(str));
  };
};
const camelizeRE = /-(\w)/g;
const camelize = cacheStringFunction(
  (str) => {
    return str.replace(camelizeRE, (_2, c2) => c2 ? c2.toUpperCase() : "");
  }
);
const hyphenateRE = /\B([A-Z])/g;
const hyphenate = cacheStringFunction(
  (str) => str.replace(hyphenateRE, "-$1").toLowerCase()
);
const capitalize$1 = cacheStringFunction((str) => {
  return str.charAt(0).toUpperCase() + str.slice(1);
});
const toHandlerKey = cacheStringFunction(
  (str) => {
    const s3 = str ? `on${capitalize$1(str)}` : ``;
    return s3;
  }
);
const hasChanged = (value, oldValue) => !Object.is(value, oldValue);
const invokeArrayFns = (fns, ...arg) => {
  for (let i2 = 0; i2 < fns.length; i2++) {
    fns[i2](...arg);
  }
};
const def = (obj, key2, value, writable = false) => {
  Object.defineProperty(obj, key2, {
    configurable: true,
    enumerable: false,
    writable,
    value
  });
};
const looseToNumber = (val) => {
  const n2 = parseFloat(val);
  return isNaN(n2) ? val : n2;
};
const toNumber = (val) => {
  const n2 = isString$1(val) ? Number(val) : NaN;
  return isNaN(n2) ? val : n2;
};
let _globalThis;
const getGlobalThis = () => {
  return _globalThis || (_globalThis = typeof globalThis !== "undefined" ? globalThis : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : typeof global !== "undefined" ? global : {});
};
function normalizeStyle(value) {
  if (isArray$3(value)) {
    const res = {};
    for (let i2 = 0; i2 < value.length; i2++) {
      const item = value[i2];
      const normalized = isString$1(item) ? parseStringStyle(item) : normalizeStyle(item);
      if (normalized) {
        for (const key2 in normalized) {
          res[key2] = normalized[key2];
        }
      }
    }
    return res;
  } else if (isString$1(value) || isObject$2(value)) {
    return value;
  }
}
const listDelimiterRE = /;(?![^(]*\))/g;
const propertyDelimiterRE = /:([^]+)/;
const styleCommentRE = /\/\*[^]*?\*\//g;
function parseStringStyle(cssText) {
  const ret = {};
  cssText.replace(styleCommentRE, "").split(listDelimiterRE).forEach((item) => {
    if (item) {
      const tmp = item.split(propertyDelimiterRE);
      tmp.length > 1 && (ret[tmp[0].trim()] = tmp[1].trim());
    }
  });
  return ret;
}
function normalizeClass(value) {
  let res = "";
  if (isString$1(value)) {
    res = value;
  } else if (isArray$3(value)) {
    for (let i2 = 0; i2 < value.length; i2++) {
      const normalized = normalizeClass(value[i2]);
      if (normalized) {
        res += normalized + " ";
      }
    }
  } else if (isObject$2(value)) {
    for (const name2 in value) {
      if (value[name2]) {
        res += name2 + " ";
      }
    }
  }
  return res.trim();
}
function normalizeProps(props) {
  if (!props) return null;
  let { class: klass, style: style2 } = props;
  if (klass && !isString$1(klass)) {
    props.class = normalizeClass(klass);
  }
  if (style2) {
    props.style = normalizeStyle(style2);
  }
  return props;
}
const specialBooleanAttrs = `itemscope,allowfullscreen,formnovalidate,ismap,nomodule,novalidate,readonly`;
const isSpecialBooleanAttr = /* @__PURE__ */ makeMap(specialBooleanAttrs);
function includeBooleanAttr(value) {
  return !!value || value === "";
}
const isRef$1 = (val) => {
  return !!(val && val["__v_isRef"] === true);
};
const toDisplayString = (val) => {
  return isString$1(val) ? val : val == null ? "" : isArray$3(val) || isObject$2(val) && (val.toString === objectToString || !isFunction(val.toString)) ? isRef$1(val) ? toDisplayString(val.value) : JSON.stringify(val, replacer, 2) : String(val);
};
const replacer = (_key, val) => {
  if (isRef$1(val)) {
    return replacer(_key, val.value);
  } else if (isMap$1(val)) {
    return {
      [`Map(${val.size})`]: [...val.entries()].reduce(
        (entries2, [key2, val2], i2) => {
          entries2[stringifySymbol(key2, i2) + " =>"] = val2;
          return entries2;
        },
        {}
      )
    };
  } else if (isSet(val)) {
    return {
      [`Set(${val.size})`]: [...val.values()].map((v2) => stringifySymbol(v2))
    };
  } else if (isSymbol(val)) {
    return stringifySymbol(val);
  } else if (isObject$2(val) && !isArray$3(val) && !isPlainObject$2(val)) {
    return String(val);
  }
  return val;
};
const stringifySymbol = (v2, i2 = "") => {
  var _a2;
  return (
    // Symbol.description in es2019+ so we need to cast here to pass
    // the lib: es2016 check
    isSymbol(v2) ? `Symbol(${(_a2 = v2.description) != null ? _a2 : i2})` : v2
  );
};
/**
* @vue/reactivity v3.5.12
* (c) 2018-present Yuxi (Evan) You and Vue contributors
* @license MIT
**/
let activeEffectScope;
class EffectScope {
  constructor(detached = false) {
    this.detached = detached;
    this._active = true;
    this.effects = [];
    this.cleanups = [];
    this._isPaused = false;
    this.parent = activeEffectScope;
    if (!detached && activeEffectScope) {
      this.index = (activeEffectScope.scopes || (activeEffectScope.scopes = [])).push(
        this
      ) - 1;
    }
  }
  get active() {
    return this._active;
  }
  pause() {
    if (this._active) {
      this._isPaused = true;
      let i2, l2;
      if (this.scopes) {
        for (i2 = 0, l2 = this.scopes.length; i2 < l2; i2++) {
          this.scopes[i2].pause();
        }
      }
      for (i2 = 0, l2 = this.effects.length; i2 < l2; i2++) {
        this.effects[i2].pause();
      }
    }
  }
  /**
   * Resumes the effect scope, including all child scopes and effects.
   */
  resume() {
    if (this._active) {
      if (this._isPaused) {
        this._isPaused = false;
        let i2, l2;
        if (this.scopes) {
          for (i2 = 0, l2 = this.scopes.length; i2 < l2; i2++) {
            this.scopes[i2].resume();
          }
        }
        for (i2 = 0, l2 = this.effects.length; i2 < l2; i2++) {
          this.effects[i2].resume();
        }
      }
    }
  }
  run(fn) {
    if (this._active) {
      const currentEffectScope = activeEffectScope;
      try {
        activeEffectScope = this;
        return fn();
      } finally {
        activeEffectScope = currentEffectScope;
      }
    }
  }
  /**
   * This should only be called on non-detached scopes
   * @internal
   */
  on() {
    activeEffectScope = this;
  }
  /**
   * This should only be called on non-detached scopes
   * @internal
   */
  off() {
    activeEffectScope = this.parent;
  }
  stop(fromParent) {
    if (this._active) {
      let i2, l2;
      for (i2 = 0, l2 = this.effects.length; i2 < l2; i2++) {
        this.effects[i2].stop();
      }
      for (i2 = 0, l2 = this.cleanups.length; i2 < l2; i2++) {
        this.cleanups[i2]();
      }
      if (this.scopes) {
        for (i2 = 0, l2 = this.scopes.length; i2 < l2; i2++) {
          this.scopes[i2].stop(true);
        }
      }
      if (!this.detached && this.parent && !fromParent) {
        const last = this.parent.scopes.pop();
        if (last && last !== this) {
          this.parent.scopes[this.index] = last;
          last.index = this.index;
        }
      }
      this.parent = void 0;
      this._active = false;
    }
  }
}
function effectScope(detached) {
  return new EffectScope(detached);
}
function getCurrentScope() {
  return activeEffectScope;
}
function onScopeDispose(fn, failSilently = false) {
  if (activeEffectScope) {
    activeEffectScope.cleanups.push(fn);
  }
}
let activeSub;
const pausedQueueEffects = /* @__PURE__ */ new WeakSet();
class ReactiveEffect {
  constructor(fn) {
    this.fn = fn;
    this.deps = void 0;
    this.depsTail = void 0;
    this.flags = 1 | 4;
    this.next = void 0;
    this.cleanup = void 0;
    this.scheduler = void 0;
    if (activeEffectScope && activeEffectScope.active) {
      activeEffectScope.effects.push(this);
    }
  }
  pause() {
    this.flags |= 64;
  }
  resume() {
    if (this.flags & 64) {
      this.flags &= ~64;
      if (pausedQueueEffects.has(this)) {
        pausedQueueEffects.delete(this);
        this.trigger();
      }
    }
  }
  /**
   * @internal
   */
  notify() {
    if (this.flags & 2 && !(this.flags & 32)) {
      return;
    }
    if (!(this.flags & 8)) {
      batch(this);
    }
  }
  run() {
    if (!(this.flags & 1)) {
      return this.fn();
    }
    this.flags |= 2;
    cleanupEffect(this);
    prepareDeps(this);
    const prevEffect = activeSub;
    const prevShouldTrack = shouldTrack;
    activeSub = this;
    shouldTrack = true;
    try {
      return this.fn();
    } finally {
      cleanupDeps(this);
      activeSub = prevEffect;
      shouldTrack = prevShouldTrack;
      this.flags &= ~2;
    }
  }
  stop() {
    if (this.flags & 1) {
      for (let link = this.deps; link; link = link.nextDep) {
        removeSub(link);
      }
      this.deps = this.depsTail = void 0;
      cleanupEffect(this);
      this.onStop && this.onStop();
      this.flags &= ~1;
    }
  }
  trigger() {
    if (this.flags & 64) {
      pausedQueueEffects.add(this);
    } else if (this.scheduler) {
      this.scheduler();
    } else {
      this.runIfDirty();
    }
  }
  /**
   * @internal
   */
  runIfDirty() {
    if (isDirty$1(this)) {
      this.run();
    }
  }
  get dirty() {
    return isDirty$1(this);
  }
}
let batchDepth = 0;
let batchedSub;
let batchedComputed;
function batch(sub, isComputed = false) {
  sub.flags |= 8;
  if (isComputed) {
    sub.next = batchedComputed;
    batchedComputed = sub;
    return;
  }
  sub.next = batchedSub;
  batchedSub = sub;
}
function startBatch() {
  batchDepth++;
}
function endBatch() {
  if (--batchDepth > 0) {
    return;
  }
  if (batchedComputed) {
    let e2 = batchedComputed;
    batchedComputed = void 0;
    while (e2) {
      const next = e2.next;
      e2.next = void 0;
      e2.flags &= ~8;
      e2 = next;
    }
  }
  let error2;
  while (batchedSub) {
    let e2 = batchedSub;
    batchedSub = void 0;
    while (e2) {
      const next = e2.next;
      e2.next = void 0;
      e2.flags &= ~8;
      if (e2.flags & 1) {
        try {
          ;
          e2.trigger();
        } catch (err) {
          if (!error2) error2 = err;
        }
      }
      e2 = next;
    }
  }
  if (error2) throw error2;
}
function prepareDeps(sub) {
  for (let link = sub.deps; link; link = link.nextDep) {
    link.version = -1;
    link.prevActiveLink = link.dep.activeLink;
    link.dep.activeLink = link;
  }
}
function cleanupDeps(sub) {
  let head2;
  let tail = sub.depsTail;
  let link = tail;
  while (link) {
    const prev = link.prevDep;
    if (link.version === -1) {
      if (link === tail) tail = prev;
      removeSub(link);
      removeDep(link);
    } else {
      head2 = link;
    }
    link.dep.activeLink = link.prevActiveLink;
    link.prevActiveLink = void 0;
    link = prev;
  }
  sub.deps = head2;
  sub.depsTail = tail;
}
function isDirty$1(sub) {
  for (let link = sub.deps; link; link = link.nextDep) {
    if (link.dep.version !== link.version || link.dep.computed && (refreshComputed(link.dep.computed) || link.dep.version !== link.version)) {
      return true;
    }
  }
  if (sub._dirty) {
    return true;
  }
  return false;
}
function refreshComputed(computed2) {
  if (computed2.flags & 4 && !(computed2.flags & 16)) {
    return;
  }
  computed2.flags &= ~16;
  if (computed2.globalVersion === globalVersion) {
    return;
  }
  computed2.globalVersion = globalVersion;
  const dep = computed2.dep;
  computed2.flags |= 2;
  if (dep.version > 0 && !computed2.isSSR && computed2.deps && !isDirty$1(computed2)) {
    computed2.flags &= ~2;
    return;
  }
  const prevSub = activeSub;
  const prevShouldTrack = shouldTrack;
  activeSub = computed2;
  shouldTrack = true;
  try {
    prepareDeps(computed2);
    const value = computed2.fn(computed2._value);
    if (dep.version === 0 || hasChanged(value, computed2._value)) {
      computed2._value = value;
      dep.version++;
    }
  } catch (err) {
    dep.version++;
    throw err;
  } finally {
    activeSub = prevSub;
    shouldTrack = prevShouldTrack;
    cleanupDeps(computed2);
    computed2.flags &= ~2;
  }
}
function removeSub(link, soft = false) {
  const { dep, prevSub, nextSub } = link;
  if (prevSub) {
    prevSub.nextSub = nextSub;
    link.prevSub = void 0;
  }
  if (nextSub) {
    nextSub.prevSub = prevSub;
    link.nextSub = void 0;
  }
  if (dep.subs === link) {
    dep.subs = prevSub;
    if (!prevSub && dep.computed) {
      dep.computed.flags &= ~4;
      for (let l2 = dep.computed.deps; l2; l2 = l2.nextDep) {
        removeSub(l2, true);
      }
    }
  }
  if (!soft && !--dep.sc && dep.map) {
    dep.map.delete(dep.key);
  }
}
function removeDep(link) {
  const { prevDep, nextDep } = link;
  if (prevDep) {
    prevDep.nextDep = nextDep;
    link.prevDep = void 0;
  }
  if (nextDep) {
    nextDep.prevDep = prevDep;
    link.nextDep = void 0;
  }
}
let shouldTrack = true;
const trackStack = [];
function pauseTracking() {
  trackStack.push(shouldTrack);
  shouldTrack = false;
}
function resetTracking() {
  const last = trackStack.pop();
  shouldTrack = last === void 0 ? true : last;
}
function cleanupEffect(e2) {
  const { cleanup } = e2;
  e2.cleanup = void 0;
  if (cleanup) {
    const prevSub = activeSub;
    activeSub = void 0;
    try {
      cleanup();
    } finally {
      activeSub = prevSub;
    }
  }
}
let globalVersion = 0;
class Link {
  constructor(sub, dep) {
    this.sub = sub;
    this.dep = dep;
    this.version = dep.version;
    this.nextDep = this.prevDep = this.nextSub = this.prevSub = this.prevActiveLink = void 0;
  }
}
class Dep {
  constructor(computed2) {
    this.computed = computed2;
    this.version = 0;
    this.activeLink = void 0;
    this.subs = void 0;
    this.map = void 0;
    this.key = void 0;
    this.sc = 0;
  }
  track(debugInfo) {
    if (!activeSub || !shouldTrack || activeSub === this.computed) {
      return;
    }
    let link = this.activeLink;
    if (link === void 0 || link.sub !== activeSub) {
      link = this.activeLink = new Link(activeSub, this);
      if (!activeSub.deps) {
        activeSub.deps = activeSub.depsTail = link;
      } else {
        link.prevDep = activeSub.depsTail;
        activeSub.depsTail.nextDep = link;
        activeSub.depsTail = link;
      }
      addSub(link);
    } else if (link.version === -1) {
      link.version = this.version;
      if (link.nextDep) {
        const next = link.nextDep;
        next.prevDep = link.prevDep;
        if (link.prevDep) {
          link.prevDep.nextDep = next;
        }
        link.prevDep = activeSub.depsTail;
        link.nextDep = void 0;
        activeSub.depsTail.nextDep = link;
        activeSub.depsTail = link;
        if (activeSub.deps === link) {
          activeSub.deps = next;
        }
      }
    }
    return link;
  }
  trigger(debugInfo) {
    this.version++;
    globalVersion++;
    this.notify(debugInfo);
  }
  notify(debugInfo) {
    startBatch();
    try {
      if (false) ;
      for (let link = this.subs; link; link = link.prevSub) {
        if (link.sub.notify()) {
          ;
          link.sub.dep.notify();
        }
      }
    } finally {
      endBatch();
    }
  }
}
function addSub(link) {
  link.dep.sc++;
  if (link.sub.flags & 4) {
    const computed2 = link.dep.computed;
    if (computed2 && !link.dep.subs) {
      computed2.flags |= 4 | 16;
      for (let l2 = computed2.deps; l2; l2 = l2.nextDep) {
        addSub(l2);
      }
    }
    const currentTail = link.dep.subs;
    if (currentTail !== link) {
      link.prevSub = currentTail;
      if (currentTail) currentTail.nextSub = link;
    }
    link.dep.subs = link;
  }
}
const targetMap = /* @__PURE__ */ new WeakMap();
const ITERATE_KEY = Symbol(
  ""
);
const MAP_KEY_ITERATE_KEY = Symbol(
  ""
);
const ARRAY_ITERATE_KEY = Symbol(
  ""
);
function track(target, type2, key2) {
  if (shouldTrack && activeSub) {
    let depsMap = targetMap.get(target);
    if (!depsMap) {
      targetMap.set(target, depsMap = /* @__PURE__ */ new Map());
    }
    let dep = depsMap.get(key2);
    if (!dep) {
      depsMap.set(key2, dep = new Dep());
      dep.map = depsMap;
      dep.key = key2;
    }
    {
      dep.track();
    }
  }
}
function trigger(target, type2, key2, newValue, oldValue, oldTarget) {
  const depsMap = targetMap.get(target);
  if (!depsMap) {
    globalVersion++;
    return;
  }
  const run = (dep) => {
    if (dep) {
      {
        dep.trigger();
      }
    }
  };
  startBatch();
  if (type2 === "clear") {
    depsMap.forEach(run);
  } else {
    const targetIsArray = isArray$3(target);
    const isArrayIndex = targetIsArray && isIntegerKey(key2);
    if (targetIsArray && key2 === "length") {
      const newLength = Number(newValue);
      depsMap.forEach((dep, key22) => {
        if (key22 === "length" || key22 === ARRAY_ITERATE_KEY || !isSymbol(key22) && key22 >= newLength) {
          run(dep);
        }
      });
    } else {
      if (key2 !== void 0 || depsMap.has(void 0)) {
        run(depsMap.get(key2));
      }
      if (isArrayIndex) {
        run(depsMap.get(ARRAY_ITERATE_KEY));
      }
      switch (type2) {
        case "add":
          if (!targetIsArray) {
            run(depsMap.get(ITERATE_KEY));
            if (isMap$1(target)) {
              run(depsMap.get(MAP_KEY_ITERATE_KEY));
            }
          } else if (isArrayIndex) {
            run(depsMap.get("length"));
          }
          break;
        case "delete":
          if (!targetIsArray) {
            run(depsMap.get(ITERATE_KEY));
            if (isMap$1(target)) {
              run(depsMap.get(MAP_KEY_ITERATE_KEY));
            }
          }
          break;
        case "set":
          if (isMap$1(target)) {
            run(depsMap.get(ITERATE_KEY));
          }
          break;
      }
    }
  }
  endBatch();
}
function getDepFromReactive(object2, key2) {
  const depMap = targetMap.get(object2);
  return depMap && depMap.get(key2);
}
function reactiveReadArray(array) {
  const raw2 = toRaw(array);
  if (raw2 === array) return raw2;
  track(raw2, "iterate", ARRAY_ITERATE_KEY);
  return isShallow(array) ? raw2 : raw2.map(toReactive);
}
function shallowReadArray(arr) {
  track(arr = toRaw(arr), "iterate", ARRAY_ITERATE_KEY);
  return arr;
}
const arrayInstrumentations = {
  __proto__: null,
  [Symbol.iterator]() {
    return iterator(this, Symbol.iterator, toReactive);
  },
  concat(...args) {
    return reactiveReadArray(this).concat(
      ...args.map((x2) => isArray$3(x2) ? reactiveReadArray(x2) : x2)
    );
  },
  entries() {
    return iterator(this, "entries", (value) => {
      value[1] = toReactive(value[1]);
      return value;
    });
  },
  every(fn, thisArg) {
    return apply(this, "every", fn, thisArg, void 0, arguments);
  },
  filter(fn, thisArg) {
    return apply(this, "filter", fn, thisArg, (v2) => v2.map(toReactive), arguments);
  },
  find(fn, thisArg) {
    return apply(this, "find", fn, thisArg, toReactive, arguments);
  },
  findIndex(fn, thisArg) {
    return apply(this, "findIndex", fn, thisArg, void 0, arguments);
  },
  findLast(fn, thisArg) {
    return apply(this, "findLast", fn, thisArg, toReactive, arguments);
  },
  findLastIndex(fn, thisArg) {
    return apply(this, "findLastIndex", fn, thisArg, void 0, arguments);
  },
  // flat, flatMap could benefit from ARRAY_ITERATE but are not straight-forward to implement
  forEach(fn, thisArg) {
    return apply(this, "forEach", fn, thisArg, void 0, arguments);
  },
  includes(...args) {
    return searchProxy(this, "includes", args);
  },
  indexOf(...args) {
    return searchProxy(this, "indexOf", args);
  },
  join(separator) {
    return reactiveReadArray(this).join(separator);
  },
  // keys() iterator only reads `length`, no optimisation required
  lastIndexOf(...args) {
    return searchProxy(this, "lastIndexOf", args);
  },
  map(fn, thisArg) {
    return apply(this, "map", fn, thisArg, void 0, arguments);
  },
  pop() {
    return noTracking(this, "pop");
  },
  push(...args) {
    return noTracking(this, "push", args);
  },
  reduce(fn, ...args) {
    return reduce(this, "reduce", fn, args);
  },
  reduceRight(fn, ...args) {
    return reduce(this, "reduceRight", fn, args);
  },
  shift() {
    return noTracking(this, "shift");
  },
  // slice could use ARRAY_ITERATE but also seems to beg for range tracking
  some(fn, thisArg) {
    return apply(this, "some", fn, thisArg, void 0, arguments);
  },
  splice(...args) {
    return noTracking(this, "splice", args);
  },
  toReversed() {
    return reactiveReadArray(this).toReversed();
  },
  toSorted(comparer) {
    return reactiveReadArray(this).toSorted(comparer);
  },
  toSpliced(...args) {
    return reactiveReadArray(this).toSpliced(...args);
  },
  unshift(...args) {
    return noTracking(this, "unshift", args);
  },
  values() {
    return iterator(this, "values", toReactive);
  }
};
function iterator(self2, method, wrapValue) {
  const arr = shallowReadArray(self2);
  const iter = arr[method]();
  if (arr !== self2 && !isShallow(self2)) {
    iter._next = iter.next;
    iter.next = () => {
      const result = iter._next();
      if (result.value) {
        result.value = wrapValue(result.value);
      }
      return result;
    };
  }
  return iter;
}
const arrayProto = Array.prototype;
function apply(self2, method, fn, thisArg, wrappedRetFn, args) {
  const arr = shallowReadArray(self2);
  const needsWrap = arr !== self2 && !isShallow(self2);
  const methodFn = arr[method];
  if (methodFn !== arrayProto[method]) {
    const result2 = methodFn.apply(self2, args);
    return needsWrap ? toReactive(result2) : result2;
  }
  let wrappedFn = fn;
  if (arr !== self2) {
    if (needsWrap) {
      wrappedFn = function(item, index2) {
        return fn.call(this, toReactive(item), index2, self2);
      };
    } else if (fn.length > 2) {
      wrappedFn = function(item, index2) {
        return fn.call(this, item, index2, self2);
      };
    }
  }
  const result = methodFn.call(arr, wrappedFn, thisArg);
  return needsWrap && wrappedRetFn ? wrappedRetFn(result) : result;
}
function reduce(self2, method, fn, args) {
  const arr = shallowReadArray(self2);
  let wrappedFn = fn;
  if (arr !== self2) {
    if (!isShallow(self2)) {
      wrappedFn = function(acc, item, index2) {
        return fn.call(this, acc, toReactive(item), index2, self2);
      };
    } else if (fn.length > 3) {
      wrappedFn = function(acc, item, index2) {
        return fn.call(this, acc, item, index2, self2);
      };
    }
  }
  return arr[method](wrappedFn, ...args);
}
function searchProxy(self2, method, args) {
  const arr = toRaw(self2);
  track(arr, "iterate", ARRAY_ITERATE_KEY);
  const res = arr[method](...args);
  if ((res === -1 || res === false) && isProxy(args[0])) {
    args[0] = toRaw(args[0]);
    return arr[method](...args);
  }
  return res;
}
function noTracking(self2, method, args = []) {
  pauseTracking();
  startBatch();
  const res = toRaw(self2)[method].apply(self2, args);
  endBatch();
  resetTracking();
  return res;
}
const isNonTrackableKeys = /* @__PURE__ */ makeMap(`__proto__,__v_isRef,__isVue`);
const builtInSymbols = new Set(
  /* @__PURE__ */ Object.getOwnPropertyNames(Symbol).filter((key2) => key2 !== "arguments" && key2 !== "caller").map((key2) => Symbol[key2]).filter(isSymbol)
);
function hasOwnProperty(key2) {
  if (!isSymbol(key2)) key2 = String(key2);
  const obj = toRaw(this);
  track(obj, "has", key2);
  return obj.hasOwnProperty(key2);
}
class BaseReactiveHandler {
  constructor(_isReadonly = false, _isShallow = false) {
    this._isReadonly = _isReadonly;
    this._isShallow = _isShallow;
  }
  get(target, key2, receiver) {
    const isReadonly2 = this._isReadonly, isShallow2 = this._isShallow;
    if (key2 === "__v_isReactive") {
      return !isReadonly2;
    } else if (key2 === "__v_isReadonly") {
      return isReadonly2;
    } else if (key2 === "__v_isShallow") {
      return isShallow2;
    } else if (key2 === "__v_raw") {
      if (receiver === (isReadonly2 ? isShallow2 ? shallowReadonlyMap : readonlyMap : isShallow2 ? shallowReactiveMap : reactiveMap).get(target) || // receiver is not the reactive proxy, but has the same prototype
      // this means the receiver is a user proxy of the reactive proxy
      Object.getPrototypeOf(target) === Object.getPrototypeOf(receiver)) {
        return target;
      }
      return;
    }
    const targetIsArray = isArray$3(target);
    if (!isReadonly2) {
      let fn;
      if (targetIsArray && (fn = arrayInstrumentations[key2])) {
        return fn;
      }
      if (key2 === "hasOwnProperty") {
        return hasOwnProperty;
      }
    }
    const res = Reflect.get(
      target,
      key2,
      // if this is a proxy wrapping a ref, return methods using the raw ref
      // as receiver so that we don't have to call `toRaw` on the ref in all
      // its class methods
      isRef(target) ? target : receiver
    );
    if (isSymbol(key2) ? builtInSymbols.has(key2) : isNonTrackableKeys(key2)) {
      return res;
    }
    if (!isReadonly2) {
      track(target, "get", key2);
    }
    if (isShallow2) {
      return res;
    }
    if (isRef(res)) {
      return targetIsArray && isIntegerKey(key2) ? res : res.value;
    }
    if (isObject$2(res)) {
      return isReadonly2 ? readonly(res) : reactive(res);
    }
    return res;
  }
}
class MutableReactiveHandler extends BaseReactiveHandler {
  constructor(isShallow2 = false) {
    super(false, isShallow2);
  }
  set(target, key2, value, receiver) {
    let oldValue = target[key2];
    if (!this._isShallow) {
      const isOldValueReadonly = isReadonly(oldValue);
      if (!isShallow(value) && !isReadonly(value)) {
        oldValue = toRaw(oldValue);
        value = toRaw(value);
      }
      if (!isArray$3(target) && isRef(oldValue) && !isRef(value)) {
        if (isOldValueReadonly) {
          return false;
        } else {
          oldValue.value = value;
          return true;
        }
      }
    }
    const hadKey = isArray$3(target) && isIntegerKey(key2) ? Number(key2) < target.length : hasOwn$2(target, key2);
    const result = Reflect.set(
      target,
      key2,
      value,
      isRef(target) ? target : receiver
    );
    if (target === toRaw(receiver)) {
      if (!hadKey) {
        trigger(target, "add", key2, value);
      } else if (hasChanged(value, oldValue)) {
        trigger(target, "set", key2, value);
      }
    }
    return result;
  }
  deleteProperty(target, key2) {
    const hadKey = hasOwn$2(target, key2);
    target[key2];
    const result = Reflect.deleteProperty(target, key2);
    if (result && hadKey) {
      trigger(target, "delete", key2, void 0);
    }
    return result;
  }
  has(target, key2) {
    const result = Reflect.has(target, key2);
    if (!isSymbol(key2) || !builtInSymbols.has(key2)) {
      track(target, "has", key2);
    }
    return result;
  }
  ownKeys(target) {
    track(
      target,
      "iterate",
      isArray$3(target) ? "length" : ITERATE_KEY
    );
    return Reflect.ownKeys(target);
  }
}
class ReadonlyReactiveHandler extends BaseReactiveHandler {
  constructor(isShallow2 = false) {
    super(true, isShallow2);
  }
  set(target, key2) {
    return true;
  }
  deleteProperty(target, key2) {
    return true;
  }
}
const mutableHandlers = /* @__PURE__ */ new MutableReactiveHandler();
const readonlyHandlers = /* @__PURE__ */ new ReadonlyReactiveHandler();
const shallowReactiveHandlers = /* @__PURE__ */ new MutableReactiveHandler(true);
const shallowReadonlyHandlers = /* @__PURE__ */ new ReadonlyReactiveHandler(true);
const toShallow = (value) => value;
const getProto = (v2) => Reflect.getPrototypeOf(v2);
function createIterableMethod(method, isReadonly2, isShallow2) {
  return function(...args) {
    const target = this["__v_raw"];
    const rawTarget = toRaw(target);
    const targetIsMap = isMap$1(rawTarget);
    const isPair2 = method === "entries" || method === Symbol.iterator && targetIsMap;
    const isKeyOnly = method === "keys" && targetIsMap;
    const innerIterator = target[method](...args);
    const wrap2 = isShallow2 ? toShallow : isReadonly2 ? toReadonly : toReactive;
    !isReadonly2 && track(
      rawTarget,
      "iterate",
      isKeyOnly ? MAP_KEY_ITERATE_KEY : ITERATE_KEY
    );
    return {
      // iterator protocol
      next() {
        const { value, done } = innerIterator.next();
        return done ? { value, done } : {
          value: isPair2 ? [wrap2(value[0]), wrap2(value[1])] : wrap2(value),
          done
        };
      },
      // iterable protocol
      [Symbol.iterator]() {
        return this;
      }
    };
  };
}
function createReadonlyMethod(type2) {
  return function(...args) {
    return type2 === "delete" ? false : type2 === "clear" ? void 0 : this;
  };
}
function createInstrumentations(readonly2, shallow) {
  const instrumentations = {
    get(key2) {
      const target = this["__v_raw"];
      const rawTarget = toRaw(target);
      const rawKey = toRaw(key2);
      if (!readonly2) {
        if (hasChanged(key2, rawKey)) {
          track(rawTarget, "get", key2);
        }
        track(rawTarget, "get", rawKey);
      }
      const { has } = getProto(rawTarget);
      const wrap2 = shallow ? toShallow : readonly2 ? toReadonly : toReactive;
      if (has.call(rawTarget, key2)) {
        return wrap2(target.get(key2));
      } else if (has.call(rawTarget, rawKey)) {
        return wrap2(target.get(rawKey));
      } else if (target !== rawTarget) {
        target.get(key2);
      }
    },
    get size() {
      const target = this["__v_raw"];
      !readonly2 && track(toRaw(target), "iterate", ITERATE_KEY);
      return Reflect.get(target, "size", target);
    },
    has(key2) {
      const target = this["__v_raw"];
      const rawTarget = toRaw(target);
      const rawKey = toRaw(key2);
      if (!readonly2) {
        if (hasChanged(key2, rawKey)) {
          track(rawTarget, "has", key2);
        }
        track(rawTarget, "has", rawKey);
      }
      return key2 === rawKey ? target.has(key2) : target.has(key2) || target.has(rawKey);
    },
    forEach(callback, thisArg) {
      const observed = this;
      const target = observed["__v_raw"];
      const rawTarget = toRaw(target);
      const wrap2 = shallow ? toShallow : readonly2 ? toReadonly : toReactive;
      !readonly2 && track(rawTarget, "iterate", ITERATE_KEY);
      return target.forEach((value, key2) => {
        return callback.call(thisArg, wrap2(value), wrap2(key2), observed);
      });
    }
  };
  extend$3(
    instrumentations,
    readonly2 ? {
      add: createReadonlyMethod("add"),
      set: createReadonlyMethod("set"),
      delete: createReadonlyMethod("delete"),
      clear: createReadonlyMethod("clear")
    } : {
      add(value) {
        if (!shallow && !isShallow(value) && !isReadonly(value)) {
          value = toRaw(value);
        }
        const target = toRaw(this);
        const proto2 = getProto(target);
        const hadKey = proto2.has.call(target, value);
        if (!hadKey) {
          target.add(value);
          trigger(target, "add", value, value);
        }
        return this;
      },
      set(key2, value) {
        if (!shallow && !isShallow(value) && !isReadonly(value)) {
          value = toRaw(value);
        }
        const target = toRaw(this);
        const { has, get: get2 } = getProto(target);
        let hadKey = has.call(target, key2);
        if (!hadKey) {
          key2 = toRaw(key2);
          hadKey = has.call(target, key2);
        }
        const oldValue = get2.call(target, key2);
        target.set(key2, value);
        if (!hadKey) {
          trigger(target, "add", key2, value);
        } else if (hasChanged(value, oldValue)) {
          trigger(target, "set", key2, value);
        }
        return this;
      },
      delete(key2) {
        const target = toRaw(this);
        const { has, get: get2 } = getProto(target);
        let hadKey = has.call(target, key2);
        if (!hadKey) {
          key2 = toRaw(key2);
          hadKey = has.call(target, key2);
        }
        get2 ? get2.call(target, key2) : void 0;
        const result = target.delete(key2);
        if (hadKey) {
          trigger(target, "delete", key2, void 0);
        }
        return result;
      },
      clear() {
        const target = toRaw(this);
        const hadItems = target.size !== 0;
        const result = target.clear();
        if (hadItems) {
          trigger(
            target,
            "clear",
            void 0,
            void 0
          );
        }
        return result;
      }
    }
  );
  const iteratorMethods = [
    "keys",
    "values",
    "entries",
    Symbol.iterator
  ];
  iteratorMethods.forEach((method) => {
    instrumentations[method] = createIterableMethod(method, readonly2, shallow);
  });
  return instrumentations;
}
function createInstrumentationGetter(isReadonly2, shallow) {
  const instrumentations = createInstrumentations(isReadonly2, shallow);
  return (target, key2, receiver) => {
    if (key2 === "__v_isReactive") {
      return !isReadonly2;
    } else if (key2 === "__v_isReadonly") {
      return isReadonly2;
    } else if (key2 === "__v_raw") {
      return target;
    }
    return Reflect.get(
      hasOwn$2(instrumentations, key2) && key2 in target ? instrumentations : target,
      key2,
      receiver
    );
  };
}
const mutableCollectionHandlers = {
  get: /* @__PURE__ */ createInstrumentationGetter(false, false)
};
const shallowCollectionHandlers = {
  get: /* @__PURE__ */ createInstrumentationGetter(false, true)
};
const readonlyCollectionHandlers = {
  get: /* @__PURE__ */ createInstrumentationGetter(true, false)
};
const shallowReadonlyCollectionHandlers = {
  get: /* @__PURE__ */ createInstrumentationGetter(true, true)
};
const reactiveMap = /* @__PURE__ */ new WeakMap();
const shallowReactiveMap = /* @__PURE__ */ new WeakMap();
const readonlyMap = /* @__PURE__ */ new WeakMap();
const shallowReadonlyMap = /* @__PURE__ */ new WeakMap();
function targetTypeMap(rawType) {
  switch (rawType) {
    case "Object":
    case "Array":
      return 1;
    case "Map":
    case "Set":
    case "WeakMap":
    case "WeakSet":
      return 2;
    default:
      return 0;
  }
}
function getTargetType(value) {
  return value["__v_skip"] || !Object.isExtensible(value) ? 0 : targetTypeMap(toRawType(value));
}
function reactive(target) {
  if (isReadonly(target)) {
    return target;
  }
  return createReactiveObject(
    target,
    false,
    mutableHandlers,
    mutableCollectionHandlers,
    reactiveMap
  );
}
function shallowReactive(target) {
  return createReactiveObject(
    target,
    false,
    shallowReactiveHandlers,
    shallowCollectionHandlers,
    shallowReactiveMap
  );
}
function readonly(target) {
  return createReactiveObject(
    target,
    true,
    readonlyHandlers,
    readonlyCollectionHandlers,
    readonlyMap
  );
}
function shallowReadonly(target) {
  return createReactiveObject(
    target,
    true,
    shallowReadonlyHandlers,
    shallowReadonlyCollectionHandlers,
    shallowReadonlyMap
  );
}
function createReactiveObject(target, isReadonly2, baseHandlers, collectionHandlers, proxyMap) {
  if (!isObject$2(target)) {
    return target;
  }
  if (target["__v_raw"] && !(isReadonly2 && target["__v_isReactive"])) {
    return target;
  }
  const existingProxy = proxyMap.get(target);
  if (existingProxy) {
    return existingProxy;
  }
  const targetType = getTargetType(target);
  if (targetType === 0) {
    return target;
  }
  const proxy = new Proxy(
    target,
    targetType === 2 ? collectionHandlers : baseHandlers
  );
  proxyMap.set(target, proxy);
  return proxy;
}
function isReactive(value) {
  if (isReadonly(value)) {
    return isReactive(value["__v_raw"]);
  }
  return !!(value && value["__v_isReactive"]);
}
function isReadonly(value) {
  return !!(value && value["__v_isReadonly"]);
}
function isShallow(value) {
  return !!(value && value["__v_isShallow"]);
}
function isProxy(value) {
  return value ? !!value["__v_raw"] : false;
}
function toRaw(observed) {
  const raw2 = observed && observed["__v_raw"];
  return raw2 ? toRaw(raw2) : observed;
}
function markRaw(value) {
  if (!hasOwn$2(value, "__v_skip") && Object.isExtensible(value)) {
    def(value, "__v_skip", true);
  }
  return value;
}
const toReactive = (value) => isObject$2(value) ? reactive(value) : value;
const toReadonly = (value) => isObject$2(value) ? readonly(value) : value;
function isRef(r2) {
  return r2 ? r2["__v_isRef"] === true : false;
}
function ref(value) {
  return createRef(value, false);
}
function shallowRef(value) {
  return createRef(value, true);
}
function createRef(rawValue, shallow) {
  if (isRef(rawValue)) {
    return rawValue;
  }
  return new RefImpl(rawValue, shallow);
}
class RefImpl {
  constructor(value, isShallow2) {
    this.dep = new Dep();
    this["__v_isRef"] = true;
    this["__v_isShallow"] = false;
    this._rawValue = isShallow2 ? value : toRaw(value);
    this._value = isShallow2 ? value : toReactive(value);
    this["__v_isShallow"] = isShallow2;
  }
  get value() {
    {
      this.dep.track();
    }
    return this._value;
  }
  set value(newValue) {
    const oldValue = this._rawValue;
    const useDirectValue = this["__v_isShallow"] || isShallow(newValue) || isReadonly(newValue);
    newValue = useDirectValue ? newValue : toRaw(newValue);
    if (hasChanged(newValue, oldValue)) {
      this._rawValue = newValue;
      this._value = useDirectValue ? newValue : toReactive(newValue);
      {
        this.dep.trigger();
      }
    }
  }
}
function unref(ref2) {
  return isRef(ref2) ? ref2.value : ref2;
}
function toValue$3(source2) {
  return isFunction(source2) ? source2() : unref(source2);
}
const shallowUnwrapHandlers = {
  get: (target, key2, receiver) => key2 === "__v_raw" ? target : unref(Reflect.get(target, key2, receiver)),
  set: (target, key2, value, receiver) => {
    const oldValue = target[key2];
    if (isRef(oldValue) && !isRef(value)) {
      oldValue.value = value;
      return true;
    } else {
      return Reflect.set(target, key2, value, receiver);
    }
  }
};
function proxyRefs(objectWithRefs) {
  return isReactive(objectWithRefs) ? objectWithRefs : new Proxy(objectWithRefs, shallowUnwrapHandlers);
}
class CustomRefImpl {
  constructor(factory) {
    this["__v_isRef"] = true;
    this._value = void 0;
    const dep = this.dep = new Dep();
    const { get: get2, set: set2 } = factory(dep.track.bind(dep), dep.trigger.bind(dep));
    this._get = get2;
    this._set = set2;
  }
  get value() {
    return this._value = this._get();
  }
  set value(newVal) {
    this._set(newVal);
  }
}
function customRef(factory) {
  return new CustomRefImpl(factory);
}
function toRefs(object2) {
  const ret = isArray$3(object2) ? new Array(object2.length) : {};
  for (const key2 in object2) {
    ret[key2] = propertyToRef(object2, key2);
  }
  return ret;
}
class ObjectRefImpl {
  constructor(_object, _key, _defaultValue) {
    this._object = _object;
    this._key = _key;
    this._defaultValue = _defaultValue;
    this["__v_isRef"] = true;
    this._value = void 0;
  }
  get value() {
    const val = this._object[this._key];
    return this._value = val === void 0 ? this._defaultValue : val;
  }
  set value(newVal) {
    this._object[this._key] = newVal;
  }
  get dep() {
    return getDepFromReactive(toRaw(this._object), this._key);
  }
}
class GetterRefImpl {
  constructor(_getter) {
    this._getter = _getter;
    this["__v_isRef"] = true;
    this["__v_isReadonly"] = true;
    this._value = void 0;
  }
  get value() {
    return this._value = this._getter();
  }
}
function toRef(source2, key2, defaultValue) {
  if (isRef(source2)) {
    return source2;
  } else if (isFunction(source2)) {
    return new GetterRefImpl(source2);
  } else if (isObject$2(source2) && arguments.length > 1) {
    return propertyToRef(source2, key2, defaultValue);
  } else {
    return ref(source2);
  }
}
function propertyToRef(source2, key2, defaultValue) {
  const val = source2[key2];
  return isRef(val) ? val : new ObjectRefImpl(source2, key2, defaultValue);
}
class ComputedRefImpl {
  constructor(fn, setter, isSSR) {
    this.fn = fn;
    this.setter = setter;
    this._value = void 0;
    this.dep = new Dep(this);
    this.__v_isRef = true;
    this.deps = void 0;
    this.depsTail = void 0;
    this.flags = 16;
    this.globalVersion = globalVersion - 1;
    this.next = void 0;
    this.effect = this;
    this["__v_isReadonly"] = !setter;
    this.isSSR = isSSR;
  }
  /**
   * @internal
   */
  notify() {
    this.flags |= 16;
    if (!(this.flags & 8) && // avoid infinite self recursion
    activeSub !== this) {
      batch(this, true);
      return true;
    }
  }
  get value() {
    const link = this.dep.track();
    refreshComputed(this);
    if (link) {
      link.version = this.dep.version;
    }
    return this._value;
  }
  set value(newValue) {
    if (this.setter) {
      this.setter(newValue);
    }
  }
}
function computed$1(getterOrOptions, debugOptions, isSSR = false) {
  let getter;
  let setter;
  if (isFunction(getterOrOptions)) {
    getter = getterOrOptions;
  } else {
    getter = getterOrOptions.get;
    setter = getterOrOptions.set;
  }
  const cRef = new ComputedRefImpl(getter, setter, isSSR);
  return cRef;
}
const INITIAL_WATCHER_VALUE = {};
const cleanupMap = /* @__PURE__ */ new WeakMap();
let activeWatcher = void 0;
function onWatcherCleanup(cleanupFn, failSilently = false, owner = activeWatcher) {
  if (owner) {
    let cleanups = cleanupMap.get(owner);
    if (!cleanups) cleanupMap.set(owner, cleanups = []);
    cleanups.push(cleanupFn);
  }
}
function watch$1(source2, cb, options = EMPTY_OBJ) {
  const { immediate, deep, once, scheduler, augmentJob, call } = options;
  const reactiveGetter = (source22) => {
    if (deep) return source22;
    if (isShallow(source22) || deep === false || deep === 0)
      return traverse$1(source22, 1);
    return traverse$1(source22);
  };
  let effect2;
  let getter;
  let cleanup;
  let boundCleanup;
  let forceTrigger = false;
  let isMultiSource = false;
  if (isRef(source2)) {
    getter = () => source2.value;
    forceTrigger = isShallow(source2);
  } else if (isReactive(source2)) {
    getter = () => reactiveGetter(source2);
    forceTrigger = true;
  } else if (isArray$3(source2)) {
    isMultiSource = true;
    forceTrigger = source2.some((s3) => isReactive(s3) || isShallow(s3));
    getter = () => source2.map((s3) => {
      if (isRef(s3)) {
        return s3.value;
      } else if (isReactive(s3)) {
        return reactiveGetter(s3);
      } else if (isFunction(s3)) {
        return call ? call(s3, 2) : s3();
      } else ;
    });
  } else if (isFunction(source2)) {
    if (cb) {
      getter = call ? () => call(source2, 2) : source2;
    } else {
      getter = () => {
        if (cleanup) {
          pauseTracking();
          try {
            cleanup();
          } finally {
            resetTracking();
          }
        }
        const currentEffect = activeWatcher;
        activeWatcher = effect2;
        try {
          return call ? call(source2, 3, [boundCleanup]) : source2(boundCleanup);
        } finally {
          activeWatcher = currentEffect;
        }
      };
    }
  } else {
    getter = NOOP;
  }
  if (cb && deep) {
    const baseGetter = getter;
    const depth = deep === true ? Infinity : deep;
    getter = () => traverse$1(baseGetter(), depth);
  }
  const scope = getCurrentScope();
  const watchHandle = () => {
    effect2.stop();
    if (scope) {
      remove$1(scope.effects, effect2);
    }
  };
  if (once && cb) {
    const _cb = cb;
    cb = (...args) => {
      _cb(...args);
      watchHandle();
    };
  }
  let oldValue = isMultiSource ? new Array(source2.length).fill(INITIAL_WATCHER_VALUE) : INITIAL_WATCHER_VALUE;
  const job = (immediateFirstRun) => {
    if (!(effect2.flags & 1) || !effect2.dirty && !immediateFirstRun) {
      return;
    }
    if (cb) {
      const newValue = effect2.run();
      if (deep || forceTrigger || (isMultiSource ? newValue.some((v2, i2) => hasChanged(v2, oldValue[i2])) : hasChanged(newValue, oldValue))) {
        if (cleanup) {
          cleanup();
        }
        const currentWatcher = activeWatcher;
        activeWatcher = effect2;
        try {
          const args = [
            newValue,
            // pass undefined as the old value when it's changed for the first time
            oldValue === INITIAL_WATCHER_VALUE ? void 0 : isMultiSource && oldValue[0] === INITIAL_WATCHER_VALUE ? [] : oldValue,
            boundCleanup
          ];
          call ? call(cb, 3, args) : (
            // @ts-expect-error
            cb(...args)
          );
          oldValue = newValue;
        } finally {
          activeWatcher = currentWatcher;
        }
      }
    } else {
      effect2.run();
    }
  };
  if (augmentJob) {
    augmentJob(job);
  }
  effect2 = new ReactiveEffect(getter);
  effect2.scheduler = scheduler ? () => scheduler(job, false) : job;
  boundCleanup = (fn) => onWatcherCleanup(fn, false, effect2);
  cleanup = effect2.onStop = () => {
    const cleanups = cleanupMap.get(effect2);
    if (cleanups) {
      if (call) {
        call(cleanups, 4);
      } else {
        for (const cleanup2 of cleanups) cleanup2();
      }
      cleanupMap.delete(effect2);
    }
  };
  if (cb) {
    if (immediate) {
      job(true);
    } else {
      oldValue = effect2.run();
    }
  } else if (scheduler) {
    scheduler(job.bind(null, true), true);
  } else {
    effect2.run();
  }
  watchHandle.pause = effect2.pause.bind(effect2);
  watchHandle.resume = effect2.resume.bind(effect2);
  watchHandle.stop = watchHandle;
  return watchHandle;
}
function traverse$1(value, depth = Infinity, seen) {
  if (depth <= 0 || !isObject$2(value) || value["__v_skip"]) {
    return value;
  }
  seen = seen || /* @__PURE__ */ new Set();
  if (seen.has(value)) {
    return value;
  }
  seen.add(value);
  depth--;
  if (isRef(value)) {
    traverse$1(value.value, depth, seen);
  } else if (isArray$3(value)) {
    for (let i2 = 0; i2 < value.length; i2++) {
      traverse$1(value[i2], depth, seen);
    }
  } else if (isSet(value) || isMap$1(value)) {
    value.forEach((v2) => {
      traverse$1(v2, depth, seen);
    });
  } else if (isPlainObject$2(value)) {
    for (const key2 in value) {
      traverse$1(value[key2], depth, seen);
    }
    for (const key2 of Object.getOwnPropertySymbols(value)) {
      if (Object.prototype.propertyIsEnumerable.call(value, key2)) {
        traverse$1(value[key2], depth, seen);
      }
    }
  }
  return value;
}
/**
* @vue/runtime-core v3.5.12
* (c) 2018-present Yuxi (Evan) You and Vue contributors
* @license MIT
**/
const stack = [];
let isWarning = false;
function warn$1$1(msg, ...args) {
  if (isWarning) return;
  isWarning = true;
  pauseTracking();
  const instance = stack.length ? stack[stack.length - 1].component : null;
  const appWarnHandler = instance && instance.appContext.config.warnHandler;
  const trace = getComponentTrace();
  if (appWarnHandler) {
    callWithErrorHandling(
      appWarnHandler,
      instance,
      11,
      [
        // eslint-disable-next-line no-restricted-syntax
        msg + args.map((a2) => {
          var _a2, _b;
          return (_b = (_a2 = a2.toString) == null ? void 0 : _a2.call(a2)) != null ? _b : JSON.stringify(a2);
        }).join(""),
        instance && instance.proxy,
        trace.map(
          ({ vnode }) => `at <${formatComponentName(instance, vnode.type)}>`
        ).join("\n"),
        trace
      ]
    );
  } else {
    const warnArgs = [`[Vue warn]: ${msg}`, ...args];
    if (trace.length && // avoid spamming console during tests
    true) {
      warnArgs.push(`
`, ...formatTrace(trace));
    }
    console.warn(...warnArgs);
  }
  resetTracking();
  isWarning = false;
}
function getComponentTrace() {
  let currentVNode = stack[stack.length - 1];
  if (!currentVNode) {
    return [];
  }
  const normalizedStack = [];
  while (currentVNode) {
    const last = normalizedStack[0];
    if (last && last.vnode === currentVNode) {
      last.recurseCount++;
    } else {
      normalizedStack.push({
        vnode: currentVNode,
        recurseCount: 0
      });
    }
    const parentInstance = currentVNode.component && currentVNode.component.parent;
    currentVNode = parentInstance && parentInstance.vnode;
  }
  return normalizedStack;
}
function formatTrace(trace) {
  const logs = [];
  trace.forEach((entry, i2) => {
    logs.push(...i2 === 0 ? [] : [`
`], ...formatTraceEntry(entry));
  });
  return logs;
}
function formatTraceEntry({ vnode, recurseCount }) {
  const postfix = recurseCount > 0 ? `... (${recurseCount} recursive calls)` : ``;
  const isRoot = vnode.component ? vnode.component.parent == null : false;
  const open = ` at <${formatComponentName(
    vnode.component,
    vnode.type,
    isRoot
  )}`;
  const close = `>` + postfix;
  return vnode.props ? [open, ...formatProps(vnode.props), close] : [open + close];
}
function formatProps(props) {
  const res = [];
  const keys2 = Object.keys(props);
  keys2.slice(0, 3).forEach((key2) => {
    res.push(...formatProp(key2, props[key2]));
  });
  if (keys2.length > 3) {
    res.push(` ...`);
  }
  return res;
}
function formatProp(key2, value, raw2) {
  if (isString$1(value)) {
    value = JSON.stringify(value);
    return raw2 ? value : [`${key2}=${value}`];
  } else if (typeof value === "number" || typeof value === "boolean" || value == null) {
    return raw2 ? value : [`${key2}=${value}`];
  } else if (isRef(value)) {
    value = formatProp(key2, toRaw(value.value), true);
    return raw2 ? value : [`${key2}=Ref<`, value, `>`];
  } else if (isFunction(value)) {
    return [`${key2}=fn${value.name ? `<${value.name}>` : ``}`];
  } else {
    value = toRaw(value);
    return raw2 ? value : [`${key2}=`, value];
  }
}
function callWithErrorHandling(fn, instance, type2, args) {
  try {
    return args ? fn(...args) : fn();
  } catch (err) {
    handleError(err, instance, type2);
  }
}
function callWithAsyncErrorHandling(fn, instance, type2, args) {
  if (isFunction(fn)) {
    const res = callWithErrorHandling(fn, instance, type2, args);
    if (res && isPromise(res)) {
      res.catch((err) => {
        handleError(err, instance, type2);
      });
    }
    return res;
  }
  if (isArray$3(fn)) {
    const values2 = [];
    for (let i2 = 0; i2 < fn.length; i2++) {
      values2.push(callWithAsyncErrorHandling(fn[i2], instance, type2, args));
    }
    return values2;
  }
}
function handleError(err, instance, type2, throwInDev = true) {
  const contextVNode = instance ? instance.vnode : null;
  const { errorHandler, throwUnhandledErrorInProduction } = instance && instance.appContext.config || EMPTY_OBJ;
  if (instance) {
    let cur2 = instance.parent;
    const exposedInstance = instance.proxy;
    const errorInfo = `https://vuejs.org/error-reference/#runtime-${type2}`;
    while (cur2) {
      const errorCapturedHooks = cur2.ec;
      if (errorCapturedHooks) {
        for (let i2 = 0; i2 < errorCapturedHooks.length; i2++) {
          if (errorCapturedHooks[i2](err, exposedInstance, errorInfo) === false) {
            return;
          }
        }
      }
      cur2 = cur2.parent;
    }
    if (errorHandler) {
      pauseTracking();
      callWithErrorHandling(errorHandler, null, 10, [
        err,
        exposedInstance,
        errorInfo
      ]);
      resetTracking();
      return;
    }
  }
  logError(err, type2, contextVNode, throwInDev, throwUnhandledErrorInProduction);
}
function logError(err, type2, contextVNode, throwInDev = true, throwInProd = false) {
  if (throwInProd) {
    throw err;
  } else {
    console.error(err);
  }
}
const queue = [];
let flushIndex = -1;
const pendingPostFlushCbs = [];
let activePostFlushCbs = null;
let postFlushIndex = 0;
const resolvedPromise = /* @__PURE__ */ Promise.resolve();
let currentFlushPromise = null;
function nextTick(fn) {
  const p2 = currentFlushPromise || resolvedPromise;
  return fn ? p2.then(this ? fn.bind(this) : fn) : p2;
}
function findInsertionIndex$1(id2) {
  let start = flushIndex + 1;
  let end = queue.length;
  while (start < end) {
    const middle = start + end >>> 1;
    const middleJob = queue[middle];
    const middleJobId = getId(middleJob);
    if (middleJobId < id2 || middleJobId === id2 && middleJob.flags & 2) {
      start = middle + 1;
    } else {
      end = middle;
    }
  }
  return start;
}
function queueJob(job) {
  if (!(job.flags & 1)) {
    const jobId = getId(job);
    const lastJob = queue[queue.length - 1];
    if (!lastJob || // fast path when the job id is larger than the tail
    !(job.flags & 2) && jobId >= getId(lastJob)) {
      queue.push(job);
    } else {
      queue.splice(findInsertionIndex$1(jobId), 0, job);
    }
    job.flags |= 1;
    queueFlush();
  }
}
function queueFlush() {
  if (!currentFlushPromise) {
    currentFlushPromise = resolvedPromise.then(flushJobs);
  }
}
function queuePostFlushCb(cb) {
  if (!isArray$3(cb)) {
    if (activePostFlushCbs && cb.id === -1) {
      activePostFlushCbs.splice(postFlushIndex + 1, 0, cb);
    } else if (!(cb.flags & 1)) {
      pendingPostFlushCbs.push(cb);
      cb.flags |= 1;
    }
  } else {
    pendingPostFlushCbs.push(...cb);
  }
  queueFlush();
}
function flushPreFlushCbs(instance, seen, i2 = flushIndex + 1) {
  for (; i2 < queue.length; i2++) {
    const cb = queue[i2];
    if (cb && cb.flags & 2) {
      if (instance && cb.id !== instance.uid) {
        continue;
      }
      queue.splice(i2, 1);
      i2--;
      if (cb.flags & 4) {
        cb.flags &= ~1;
      }
      cb();
      if (!(cb.flags & 4)) {
        cb.flags &= ~1;
      }
    }
  }
}
function flushPostFlushCbs(seen) {
  if (pendingPostFlushCbs.length) {
    const deduped = [...new Set(pendingPostFlushCbs)].sort(
      (a2, b2) => getId(a2) - getId(b2)
    );
    pendingPostFlushCbs.length = 0;
    if (activePostFlushCbs) {
      activePostFlushCbs.push(...deduped);
      return;
    }
    activePostFlushCbs = deduped;
    for (postFlushIndex = 0; postFlushIndex < activePostFlushCbs.length; postFlushIndex++) {
      const cb = activePostFlushCbs[postFlushIndex];
      if (cb.flags & 4) {
        cb.flags &= ~1;
      }
      if (!(cb.flags & 8)) cb();
      cb.flags &= ~1;
    }
    activePostFlushCbs = null;
    postFlushIndex = 0;
  }
}
const getId = (job) => job.id == null ? job.flags & 2 ? -1 : Infinity : job.id;
function flushJobs(seen) {
  try {
    for (flushIndex = 0; flushIndex < queue.length; flushIndex++) {
      const job = queue[flushIndex];
      if (job && !(job.flags & 8)) {
        if (false) ;
        if (job.flags & 4) {
          job.flags &= ~1;
        }
        callWithErrorHandling(
          job,
          job.i,
          job.i ? 15 : 14
        );
        if (!(job.flags & 4)) {
          job.flags &= ~1;
        }
      }
    }
  } finally {
    for (; flushIndex < queue.length; flushIndex++) {
      const job = queue[flushIndex];
      if (job) {
        job.flags &= ~1;
      }
    }
    flushIndex = -1;
    queue.length = 0;
    flushPostFlushCbs();
    currentFlushPromise = null;
    if (queue.length || pendingPostFlushCbs.length) {
      flushJobs();
    }
  }
}
let currentRenderingInstance = null;
let currentScopeId = null;
function setCurrentRenderingInstance(instance) {
  const prev = currentRenderingInstance;
  currentRenderingInstance = instance;
  currentScopeId = instance && instance.type.__scopeId || null;
  return prev;
}
function withCtx(fn, ctx = currentRenderingInstance, isNonScopedSlot) {
  if (!ctx) return fn;
  if (fn._n) {
    return fn;
  }
  const renderFnWithContext = (...args) => {
    if (renderFnWithContext._d) {
      setBlockTracking(-1);
    }
    const prevInstance = setCurrentRenderingInstance(ctx);
    let res;
    try {
      res = fn(...args);
    } finally {
      setCurrentRenderingInstance(prevInstance);
      if (renderFnWithContext._d) {
        setBlockTracking(1);
      }
    }
    return res;
  };
  renderFnWithContext._n = true;
  renderFnWithContext._c = true;
  renderFnWithContext._d = true;
  return renderFnWithContext;
}
function withDirectives(vnode, directives) {
  if (currentRenderingInstance === null) {
    return vnode;
  }
  const instance = getComponentPublicInstance(currentRenderingInstance);
  const bindings = vnode.dirs || (vnode.dirs = []);
  for (let i2 = 0; i2 < directives.length; i2++) {
    let [dir, value, arg, modifiers2 = EMPTY_OBJ] = directives[i2];
    if (dir) {
      if (isFunction(dir)) {
        dir = {
          mounted: dir,
          updated: dir
        };
      }
      if (dir.deep) {
        traverse$1(value);
      }
      bindings.push({
        dir,
        instance,
        value,
        oldValue: void 0,
        arg,
        modifiers: modifiers2
      });
    }
  }
  return vnode;
}
function invokeDirectiveHook(vnode, prevVNode, instance, name2) {
  const bindings = vnode.dirs;
  const oldBindings = prevVNode && prevVNode.dirs;
  for (let i2 = 0; i2 < bindings.length; i2++) {
    const binding = bindings[i2];
    if (oldBindings) {
      binding.oldValue = oldBindings[i2].value;
    }
    let hook = binding.dir[name2];
    if (hook) {
      pauseTracking();
      callWithAsyncErrorHandling(hook, instance, 8, [
        vnode.el,
        binding,
        vnode,
        prevVNode
      ]);
      resetTracking();
    }
  }
}
const TeleportEndKey = Symbol("_vte");
const isTeleport = (type2) => type2.__isTeleport;
const isTeleportDisabled = (props) => props && (props.disabled || props.disabled === "");
const isTeleportDeferred = (props) => props && (props.defer || props.defer === "");
const isTargetSVG = (target) => typeof SVGElement !== "undefined" && target instanceof SVGElement;
const isTargetMathML = (target) => typeof MathMLElement === "function" && target instanceof MathMLElement;
const resolveTarget = (props, select) => {
  const targetSelector = props && props.to;
  if (isString$1(targetSelector)) {
    if (!select) {
      return null;
    } else {
      const target = select(targetSelector);
      return target;
    }
  } else {
    return targetSelector;
  }
};
const TeleportImpl = {
  name: "Teleport",
  __isTeleport: true,
  process(n1, n2, container, anchor, parentComponent, parentSuspense, namespace, slotScopeIds, optimized, internals) {
    const {
      mc: mountChildren,
      pc: patchChildren,
      pbc: patchBlockChildren,
      o: { insert: insert2, querySelector, createText, createComment }
    } = internals;
    const disabled = isTeleportDisabled(n2.props);
    let { shapeFlag, children, dynamicChildren } = n2;
    if (n1 == null) {
      const placeholder2 = n2.el = createText("");
      const mainAnchor = n2.anchor = createText("");
      insert2(placeholder2, container, anchor);
      insert2(mainAnchor, container, anchor);
      const mount = (container2, anchor2) => {
        if (shapeFlag & 16) {
          if (parentComponent && parentComponent.isCE) {
            parentComponent.ce._teleportTarget = container2;
          }
          mountChildren(
            children,
            container2,
            anchor2,
            parentComponent,
            parentSuspense,
            namespace,
            slotScopeIds,
            optimized
          );
        }
      };
      const mountToTarget = () => {
        const target = n2.target = resolveTarget(n2.props, querySelector);
        const targetAnchor = prepareAnchor(target, n2, createText, insert2);
        if (target) {
          if (namespace !== "svg" && isTargetSVG(target)) {
            namespace = "svg";
          } else if (namespace !== "mathml" && isTargetMathML(target)) {
            namespace = "mathml";
          }
          if (!disabled) {
            mount(target, targetAnchor);
            updateCssVars(n2, false);
          }
        }
      };
      if (disabled) {
        mount(container, mainAnchor);
        updateCssVars(n2, true);
      }
      if (isTeleportDeferred(n2.props)) {
        queuePostRenderEffect(mountToTarget, parentSuspense);
      } else {
        mountToTarget();
      }
    } else {
      n2.el = n1.el;
      n2.targetStart = n1.targetStart;
      const mainAnchor = n2.anchor = n1.anchor;
      const target = n2.target = n1.target;
      const targetAnchor = n2.targetAnchor = n1.targetAnchor;
      const wasDisabled = isTeleportDisabled(n1.props);
      const currentContainer = wasDisabled ? container : target;
      const currentAnchor = wasDisabled ? mainAnchor : targetAnchor;
      if (namespace === "svg" || isTargetSVG(target)) {
        namespace = "svg";
      } else if (namespace === "mathml" || isTargetMathML(target)) {
        namespace = "mathml";
      }
      if (dynamicChildren) {
        patchBlockChildren(
          n1.dynamicChildren,
          dynamicChildren,
          currentContainer,
          parentComponent,
          parentSuspense,
          namespace,
          slotScopeIds
        );
        traverseStaticChildren(n1, n2, true);
      } else if (!optimized) {
        patchChildren(
          n1,
          n2,
          currentContainer,
          currentAnchor,
          parentComponent,
          parentSuspense,
          namespace,
          slotScopeIds,
          false
        );
      }
      if (disabled) {
        if (!wasDisabled) {
          moveTeleport(
            n2,
            container,
            mainAnchor,
            internals,
            1
          );
        } else {
          if (n2.props && n1.props && n2.props.to !== n1.props.to) {
            n2.props.to = n1.props.to;
          }
        }
      } else {
        if ((n2.props && n2.props.to) !== (n1.props && n1.props.to)) {
          const nextTarget = n2.target = resolveTarget(
            n2.props,
            querySelector
          );
          if (nextTarget) {
            moveTeleport(
              n2,
              nextTarget,
              null,
              internals,
              0
            );
          }
        } else if (wasDisabled) {
          moveTeleport(
            n2,
            target,
            targetAnchor,
            internals,
            1
          );
        }
      }
      updateCssVars(n2, disabled);
    }
  },
  remove(vnode, parentComponent, parentSuspense, { um: unmount, o: { remove: hostRemove } }, doRemove) {
    const {
      shapeFlag,
      children,
      anchor,
      targetStart,
      targetAnchor,
      target,
      props
    } = vnode;
    if (target) {
      hostRemove(targetStart);
      hostRemove(targetAnchor);
    }
    doRemove && hostRemove(anchor);
    if (shapeFlag & 16) {
      const shouldRemove = doRemove || !isTeleportDisabled(props);
      for (let i2 = 0; i2 < children.length; i2++) {
        const child = children[i2];
        unmount(
          child,
          parentComponent,
          parentSuspense,
          shouldRemove,
          !!child.dynamicChildren
        );
      }
    }
  },
  move: moveTeleport,
  hydrate: hydrateTeleport
};
function moveTeleport(vnode, container, parentAnchor, { o: { insert: insert2 }, m: move }, moveType = 2) {
  if (moveType === 0) {
    insert2(vnode.targetAnchor, container, parentAnchor);
  }
  const { el, anchor, shapeFlag, children, props } = vnode;
  const isReorder = moveType === 2;
  if (isReorder) {
    insert2(el, container, parentAnchor);
  }
  if (!isReorder || isTeleportDisabled(props)) {
    if (shapeFlag & 16) {
      for (let i2 = 0; i2 < children.length; i2++) {
        move(
          children[i2],
          container,
          parentAnchor,
          2
        );
      }
    }
  }
  if (isReorder) {
    insert2(anchor, container, parentAnchor);
  }
}
function hydrateTeleport(node, vnode, parentComponent, parentSuspense, slotScopeIds, optimized, {
  o: { nextSibling, parentNode, querySelector, insert: insert2, createText }
}, hydrateChildren) {
  const target = vnode.target = resolveTarget(
    vnode.props,
    querySelector
  );
  if (target) {
    const disabled = isTeleportDisabled(vnode.props);
    const targetNode = target._lpa || target.firstChild;
    if (vnode.shapeFlag & 16) {
      if (disabled) {
        vnode.anchor = hydrateChildren(
          nextSibling(node),
          vnode,
          parentNode(node),
          parentComponent,
          parentSuspense,
          slotScopeIds,
          optimized
        );
        vnode.targetStart = targetNode;
        vnode.targetAnchor = targetNode && nextSibling(targetNode);
      } else {
        vnode.anchor = nextSibling(node);
        let targetAnchor = targetNode;
        while (targetAnchor) {
          if (targetAnchor && targetAnchor.nodeType === 8) {
            if (targetAnchor.data === "teleport start anchor") {
              vnode.targetStart = targetAnchor;
            } else if (targetAnchor.data === "teleport anchor") {
              vnode.targetAnchor = targetAnchor;
              target._lpa = vnode.targetAnchor && nextSibling(vnode.targetAnchor);
              break;
            }
          }
          targetAnchor = nextSibling(targetAnchor);
        }
        if (!vnode.targetAnchor) {
          prepareAnchor(target, vnode, createText, insert2);
        }
        hydrateChildren(
          targetNode && nextSibling(targetNode),
          vnode,
          target,
          parentComponent,
          parentSuspense,
          slotScopeIds,
          optimized
        );
      }
    }
    updateCssVars(vnode, disabled);
  }
  return vnode.anchor && nextSibling(vnode.anchor);
}
const Teleport = TeleportImpl;
function updateCssVars(vnode, isDisabled) {
  const ctx = vnode.ctx;
  if (ctx && ctx.ut) {
    let node, anchor;
    if (isDisabled) {
      node = vnode.el;
      anchor = vnode.anchor;
    } else {
      node = vnode.targetStart;
      anchor = vnode.targetAnchor;
    }
    while (node && node !== anchor) {
      if (node.nodeType === 1) node.setAttribute("data-v-owner", ctx.uid);
      node = node.nextSibling;
    }
    ctx.ut();
  }
}
function prepareAnchor(target, vnode, createText, insert2) {
  const targetStart = vnode.targetStart = createText("");
  const targetAnchor = vnode.targetAnchor = createText("");
  targetStart[TeleportEndKey] = targetAnchor;
  if (target) {
    insert2(targetStart, target);
    insert2(targetAnchor, target);
  }
  return targetAnchor;
}
const leaveCbKey = Symbol("_leaveCb");
const enterCbKey = Symbol("_enterCb");
function useTransitionState() {
  const state = {
    isMounted: false,
    isLeaving: false,
    isUnmounting: false,
    leavingVNodes: /* @__PURE__ */ new Map()
  };
  onMounted(() => {
    state.isMounted = true;
  });
  onBeforeUnmount(() => {
    state.isUnmounting = true;
  });
  return state;
}
const TransitionHookValidator = [Function, Array];
const BaseTransitionPropsValidators = {
  mode: String,
  appear: Boolean,
  persisted: Boolean,
  // enter
  onBeforeEnter: TransitionHookValidator,
  onEnter: TransitionHookValidator,
  onAfterEnter: TransitionHookValidator,
  onEnterCancelled: TransitionHookValidator,
  // leave
  onBeforeLeave: TransitionHookValidator,
  onLeave: TransitionHookValidator,
  onAfterLeave: TransitionHookValidator,
  onLeaveCancelled: TransitionHookValidator,
  // appear
  onBeforeAppear: TransitionHookValidator,
  onAppear: TransitionHookValidator,
  onAfterAppear: TransitionHookValidator,
  onAppearCancelled: TransitionHookValidator
};
const recursiveGetSubtree = (instance) => {
  const subTree = instance.subTree;
  return subTree.component ? recursiveGetSubtree(subTree.component) : subTree;
};
const BaseTransitionImpl = {
  name: `BaseTransition`,
  props: BaseTransitionPropsValidators,
  setup(props, { slots }) {
    const instance = getCurrentInstance();
    const state = useTransitionState();
    return () => {
      const children = slots.default && getTransitionRawChildren(slots.default(), true);
      if (!children || !children.length) {
        return;
      }
      const child = findNonCommentChild(children);
      const rawProps = toRaw(props);
      const { mode } = rawProps;
      if (state.isLeaving) {
        return emptyPlaceholder(child);
      }
      const innerChild = getInnerChild$1(child);
      if (!innerChild) {
        return emptyPlaceholder(child);
      }
      let enterHooks = resolveTransitionHooks(
        innerChild,
        rawProps,
        state,
        instance,
        // #11061, ensure enterHooks is fresh after clone
        (hooks) => enterHooks = hooks
      );
      if (innerChild.type !== Comment) {
        setTransitionHooks(innerChild, enterHooks);
      }
      const oldChild = instance.subTree;
      const oldInnerChild = oldChild && getInnerChild$1(oldChild);
      if (oldInnerChild && oldInnerChild.type !== Comment && !isSameVNodeType(innerChild, oldInnerChild) && recursiveGetSubtree(instance).type !== Comment) {
        const leavingHooks = resolveTransitionHooks(
          oldInnerChild,
          rawProps,
          state,
          instance
        );
        setTransitionHooks(oldInnerChild, leavingHooks);
        if (mode === "out-in" && innerChild.type !== Comment) {
          state.isLeaving = true;
          leavingHooks.afterLeave = () => {
            state.isLeaving = false;
            if (!(instance.job.flags & 8)) {
              instance.update();
            }
            delete leavingHooks.afterLeave;
          };
          return emptyPlaceholder(child);
        } else if (mode === "in-out" && innerChild.type !== Comment) {
          leavingHooks.delayLeave = (el, earlyRemove, delayedLeave) => {
            const leavingVNodesCache = getLeavingNodesForType(
              state,
              oldInnerChild
            );
            leavingVNodesCache[String(oldInnerChild.key)] = oldInnerChild;
            el[leaveCbKey] = () => {
              earlyRemove();
              el[leaveCbKey] = void 0;
              delete enterHooks.delayedLeave;
            };
            enterHooks.delayedLeave = delayedLeave;
          };
        }
      }
      return child;
    };
  }
};
function findNonCommentChild(children) {
  let child = children[0];
  if (children.length > 1) {
    for (const c2 of children) {
      if (c2.type !== Comment) {
        child = c2;
        break;
      }
    }
  }
  return child;
}
const BaseTransition = BaseTransitionImpl;
function getLeavingNodesForType(state, vnode) {
  const { leavingVNodes } = state;
  let leavingVNodesCache = leavingVNodes.get(vnode.type);
  if (!leavingVNodesCache) {
    leavingVNodesCache = /* @__PURE__ */ Object.create(null);
    leavingVNodes.set(vnode.type, leavingVNodesCache);
  }
  return leavingVNodesCache;
}
function resolveTransitionHooks(vnode, props, state, instance, postClone) {
  const {
    appear,
    mode,
    persisted = false,
    onBeforeEnter,
    onEnter,
    onAfterEnter,
    onEnterCancelled,
    onBeforeLeave,
    onLeave,
    onAfterLeave,
    onLeaveCancelled,
    onBeforeAppear,
    onAppear,
    onAfterAppear,
    onAppearCancelled
  } = props;
  const key2 = String(vnode.key);
  const leavingVNodesCache = getLeavingNodesForType(state, vnode);
  const callHook2 = (hook, args) => {
    hook && callWithAsyncErrorHandling(
      hook,
      instance,
      9,
      args
    );
  };
  const callAsyncHook = (hook, args) => {
    const done = args[1];
    callHook2(hook, args);
    if (isArray$3(hook)) {
      if (hook.every((hook2) => hook2.length <= 1)) done();
    } else if (hook.length <= 1) {
      done();
    }
  };
  const hooks = {
    mode,
    persisted,
    beforeEnter(el) {
      let hook = onBeforeEnter;
      if (!state.isMounted) {
        if (appear) {
          hook = onBeforeAppear || onBeforeEnter;
        } else {
          return;
        }
      }
      if (el[leaveCbKey]) {
        el[leaveCbKey](
          true
          /* cancelled */
        );
      }
      const leavingVNode = leavingVNodesCache[key2];
      if (leavingVNode && isSameVNodeType(vnode, leavingVNode) && leavingVNode.el[leaveCbKey]) {
        leavingVNode.el[leaveCbKey]();
      }
      callHook2(hook, [el]);
    },
    enter(el) {
      let hook = onEnter;
      let afterHook = onAfterEnter;
      let cancelHook = onEnterCancelled;
      if (!state.isMounted) {
        if (appear) {
          hook = onAppear || onEnter;
          afterHook = onAfterAppear || onAfterEnter;
          cancelHook = onAppearCancelled || onEnterCancelled;
        } else {
          return;
        }
      }
      let called = false;
      const done = el[enterCbKey] = (cancelled) => {
        if (called) return;
        called = true;
        if (cancelled) {
          callHook2(cancelHook, [el]);
        } else {
          callHook2(afterHook, [el]);
        }
        if (hooks.delayedLeave) {
          hooks.delayedLeave();
        }
        el[enterCbKey] = void 0;
      };
      if (hook) {
        callAsyncHook(hook, [el, done]);
      } else {
        done();
      }
    },
    leave(el, remove2) {
      const key22 = String(vnode.key);
      if (el[enterCbKey]) {
        el[enterCbKey](
          true
          /* cancelled */
        );
      }
      if (state.isUnmounting) {
        return remove2();
      }
      callHook2(onBeforeLeave, [el]);
      let called = false;
      const done = el[leaveCbKey] = (cancelled) => {
        if (called) return;
        called = true;
        remove2();
        if (cancelled) {
          callHook2(onLeaveCancelled, [el]);
        } else {
          callHook2(onAfterLeave, [el]);
        }
        el[leaveCbKey] = void 0;
        if (leavingVNodesCache[key22] === vnode) {
          delete leavingVNodesCache[key22];
        }
      };
      leavingVNodesCache[key22] = vnode;
      if (onLeave) {
        callAsyncHook(onLeave, [el, done]);
      } else {
        done();
      }
    },
    clone(vnode2) {
      const hooks2 = resolveTransitionHooks(
        vnode2,
        props,
        state,
        instance,
        postClone
      );
      if (postClone) postClone(hooks2);
      return hooks2;
    }
  };
  return hooks;
}
function emptyPlaceholder(vnode) {
  if (isKeepAlive(vnode)) {
    vnode = cloneVNode(vnode);
    vnode.children = null;
    return vnode;
  }
}
function getInnerChild$1(vnode) {
  if (!isKeepAlive(vnode)) {
    if (isTeleport(vnode.type) && vnode.children) {
      return findNonCommentChild(vnode.children);
    }
    return vnode;
  }
  const { shapeFlag, children } = vnode;
  if (children) {
    if (shapeFlag & 16) {
      return children[0];
    }
    if (shapeFlag & 32 && isFunction(children.default)) {
      return children.default();
    }
  }
}
function setTransitionHooks(vnode, hooks) {
  if (vnode.shapeFlag & 6 && vnode.component) {
    vnode.transition = hooks;
    setTransitionHooks(vnode.component.subTree, hooks);
  } else if (vnode.shapeFlag & 128) {
    vnode.ssContent.transition = hooks.clone(vnode.ssContent);
    vnode.ssFallback.transition = hooks.clone(vnode.ssFallback);
  } else {
    vnode.transition = hooks;
  }
}
function getTransitionRawChildren(children, keepComment = false, parentKey) {
  let ret = [];
  let keyedFragmentCount = 0;
  for (let i2 = 0; i2 < children.length; i2++) {
    let child = children[i2];
    const key2 = parentKey == null ? child.key : String(parentKey) + String(child.key != null ? child.key : i2);
    if (child.type === Fragment) {
      if (child.patchFlag & 128) keyedFragmentCount++;
      ret = ret.concat(
        getTransitionRawChildren(child.children, keepComment, key2)
      );
    } else if (keepComment || child.type !== Comment) {
      ret.push(key2 != null ? cloneVNode(child, { key: key2 }) : child);
    }
  }
  if (keyedFragmentCount > 1) {
    for (let i2 = 0; i2 < ret.length; i2++) {
      ret[i2].patchFlag = -2;
    }
  }
  return ret;
}
/*! #__NO_SIDE_EFFECTS__ */
// @__NO_SIDE_EFFECTS__
function defineComponent(options, extraOptions) {
  return isFunction(options) ? (
    // #8236: extend call and options.name access are considered side-effects
    // by Rollup, so we have to wrap it in a pure-annotated IIFE.
    /* @__PURE__ */ (() => extend$3({ name: options.name }, extraOptions, { setup: options }))()
  ) : options;
}
function markAsyncBoundary(instance) {
  instance.ids = [instance.ids[0] + instance.ids[2]++ + "-", 0, 0];
}
function setRef(rawRef, oldRawRef, parentSuspense, vnode, isUnmount = false) {
  if (isArray$3(rawRef)) {
    rawRef.forEach(
      (r2, i2) => setRef(
        r2,
        oldRawRef && (isArray$3(oldRawRef) ? oldRawRef[i2] : oldRawRef),
        parentSuspense,
        vnode,
        isUnmount
      )
    );
    return;
  }
  if (isAsyncWrapper(vnode) && !isUnmount) {
    return;
  }
  const refValue = vnode.shapeFlag & 4 ? getComponentPublicInstance(vnode.component) : vnode.el;
  const value = isUnmount ? null : refValue;
  const { i: owner, r: ref3 } = rawRef;
  const oldRef = oldRawRef && oldRawRef.r;
  const refs = owner.refs === EMPTY_OBJ ? owner.refs = {} : owner.refs;
  const setupState = owner.setupState;
  const rawSetupState = toRaw(setupState);
  const canSetSetupRef = setupState === EMPTY_OBJ ? () => false : (key2) => {
    return hasOwn$2(rawSetupState, key2);
  };
  if (oldRef != null && oldRef !== ref3) {
    if (isString$1(oldRef)) {
      refs[oldRef] = null;
      if (canSetSetupRef(oldRef)) {
        setupState[oldRef] = null;
      }
    } else if (isRef(oldRef)) {
      oldRef.value = null;
    }
  }
  if (isFunction(ref3)) {
    callWithErrorHandling(ref3, owner, 12, [value, refs]);
  } else {
    const _isString = isString$1(ref3);
    const _isRef = isRef(ref3);
    if (_isString || _isRef) {
      const doSet = () => {
        if (rawRef.f) {
          const existing = _isString ? canSetSetupRef(ref3) ? setupState[ref3] : refs[ref3] : ref3.value;
          if (isUnmount) {
            isArray$3(existing) && remove$1(existing, refValue);
          } else {
            if (!isArray$3(existing)) {
              if (_isString) {
                refs[ref3] = [refValue];
                if (canSetSetupRef(ref3)) {
                  setupState[ref3] = refs[ref3];
                }
              } else {
                ref3.value = [refValue];
                if (rawRef.k) refs[rawRef.k] = ref3.value;
              }
            } else if (!existing.includes(refValue)) {
              existing.push(refValue);
            }
          }
        } else if (_isString) {
          refs[ref3] = value;
          if (canSetSetupRef(ref3)) {
            setupState[ref3] = value;
          }
        } else if (_isRef) {
          ref3.value = value;
          if (rawRef.k) refs[rawRef.k] = value;
        } else ;
      };
      if (value) {
        doSet.id = -1;
        queuePostRenderEffect(doSet, parentSuspense);
      } else {
        doSet();
      }
    }
  }
}
getGlobalThis().requestIdleCallback || ((cb) => setTimeout(cb, 1));
getGlobalThis().cancelIdleCallback || ((id2) => clearTimeout(id2));
const isAsyncWrapper = (i2) => !!i2.type.__asyncLoader;
const isKeepAlive = (vnode) => vnode.type.__isKeepAlive;
function onActivated(hook, target) {
  registerKeepAliveHook(hook, "a", target);
}
function onDeactivated(hook, target) {
  registerKeepAliveHook(hook, "da", target);
}
function registerKeepAliveHook(hook, type2, target = currentInstance) {
  const wrappedHook = hook.__wdc || (hook.__wdc = () => {
    let current = target;
    while (current) {
      if (current.isDeactivated) {
        return;
      }
      current = current.parent;
    }
    return hook();
  });
  injectHook(type2, wrappedHook, target);
  if (target) {
    let current = target.parent;
    while (current && current.parent) {
      if (isKeepAlive(current.parent.vnode)) {
        injectToKeepAliveRoot(wrappedHook, type2, target, current);
      }
      current = current.parent;
    }
  }
}
function injectToKeepAliveRoot(hook, type2, target, keepAliveRoot) {
  const injected = injectHook(
    type2,
    hook,
    keepAliveRoot,
    true
    /* prepend */
  );
  onUnmounted(() => {
    remove$1(keepAliveRoot[type2], injected);
  }, target);
}
function injectHook(type2, hook, target = currentInstance, prepend = false) {
  if (target) {
    const hooks = target[type2] || (target[type2] = []);
    const wrappedHook = hook.__weh || (hook.__weh = (...args) => {
      pauseTracking();
      const reset = setCurrentInstance(target);
      const res = callWithAsyncErrorHandling(hook, target, type2, args);
      reset();
      resetTracking();
      return res;
    });
    if (prepend) {
      hooks.unshift(wrappedHook);
    } else {
      hooks.push(wrappedHook);
    }
    return wrappedHook;
  }
}
const createHook = (lifecycle) => (hook, target = currentInstance) => {
  if (!isInSSRComponentSetup || lifecycle === "sp") {
    injectHook(lifecycle, (...args) => hook(...args), target);
  }
};
const onBeforeMount = createHook("bm");
const onMounted = createHook("m");
const onBeforeUpdate = createHook(
  "bu"
);
const onUpdated = createHook("u");
const onBeforeUnmount = createHook(
  "bum"
);
const onUnmounted = createHook("um");
const onServerPrefetch = createHook(
  "sp"
);
const onRenderTriggered = createHook("rtg");
const onRenderTracked = createHook("rtc");
function onErrorCaptured(hook, target = currentInstance) {
  injectHook("ec", hook, target);
}
const COMPONENTS = "components";
function resolveComponent(name2, maybeSelfReference) {
  return resolveAsset(COMPONENTS, name2, true, maybeSelfReference) || name2;
}
const NULL_DYNAMIC_COMPONENT = Symbol.for("v-ndc");
function resolveDynamicComponent(component) {
  if (isString$1(component)) {
    return resolveAsset(COMPONENTS, component, false) || component;
  } else {
    return component || NULL_DYNAMIC_COMPONENT;
  }
}
function resolveAsset(type2, name2, warnMissing = true, maybeSelfReference = false) {
  const instance = currentRenderingInstance || currentInstance;
  if (instance) {
    const Component = instance.type;
    {
      const selfName = getComponentName(
        Component,
        false
      );
      if (selfName && (selfName === name2 || selfName === camelize(name2) || selfName === capitalize$1(camelize(name2)))) {
        return Component;
      }
    }
    const res = (
      // local registration
      // check instance[type] first which is resolved for options API
      resolve(instance[type2] || Component[type2], name2) || // global registration
      resolve(instance.appContext[type2], name2)
    );
    if (!res && maybeSelfReference) {
      return Component;
    }
    return res;
  }
}
function resolve(registry, name2) {
  return registry && (registry[name2] || registry[camelize(name2)] || registry[capitalize$1(camelize(name2))]);
}
function renderList(source2, renderItem, cache2, index2) {
  let ret;
  const cached = cache2;
  const sourceIsArray = isArray$3(source2);
  if (sourceIsArray || isString$1(source2)) {
    const sourceIsReactiveArray = sourceIsArray && isReactive(source2);
    let needsWrap = false;
    if (sourceIsReactiveArray) {
      needsWrap = !isShallow(source2);
      source2 = shallowReadArray(source2);
    }
    ret = new Array(source2.length);
    for (let i2 = 0, l2 = source2.length; i2 < l2; i2++) {
      ret[i2] = renderItem(
        needsWrap ? toReactive(source2[i2]) : source2[i2],
        i2,
        void 0,
        cached
      );
    }
  } else if (typeof source2 === "number") {
    ret = new Array(source2);
    for (let i2 = 0; i2 < source2; i2++) {
      ret[i2] = renderItem(i2 + 1, i2, void 0, cached);
    }
  } else if (isObject$2(source2)) {
    if (source2[Symbol.iterator]) {
      ret = Array.from(
        source2,
        (item, i2) => renderItem(item, i2, void 0, cached)
      );
    } else {
      const keys2 = Object.keys(source2);
      ret = new Array(keys2.length);
      for (let i2 = 0, l2 = keys2.length; i2 < l2; i2++) {
        const key2 = keys2[i2];
        ret[i2] = renderItem(source2[key2], key2, i2, cached);
      }
    }
  } else {
    ret = [];
  }
  return ret;
}
function createSlots(slots, dynamicSlots) {
  for (let i2 = 0; i2 < dynamicSlots.length; i2++) {
    const slot = dynamicSlots[i2];
    if (isArray$3(slot)) {
      for (let j2 = 0; j2 < slot.length; j2++) {
        slots[slot[j2].name] = slot[j2].fn;
      }
    } else if (slot) {
      slots[slot.name] = slot.key ? (...args) => {
        const res = slot.fn(...args);
        if (res) res.key = slot.key;
        return res;
      } : slot.fn;
    }
  }
  return slots;
}
function renderSlot(slots, name2, props = {}, fallback, noSlotted) {
  if (currentRenderingInstance.ce || currentRenderingInstance.parent && isAsyncWrapper(currentRenderingInstance.parent) && currentRenderingInstance.parent.ce) {
    if (name2 !== "default") props.name = name2;
    return openBlock(), createBlock(
      Fragment,
      null,
      [createVNode("slot", props, fallback && fallback())],
      64
    );
  }
  let slot = slots[name2];
  if (slot && slot._c) {
    slot._d = false;
  }
  openBlock();
  const validSlotContent = slot && ensureValidVNode(slot(props));
  const slotKey = props.key || // slot content array of a dynamic conditional slot may have a branch
  // key attached in the `createSlots` helper, respect that
  validSlotContent && validSlotContent.key;
  const rendered = createBlock(
    Fragment,
    {
      key: (slotKey && !isSymbol(slotKey) ? slotKey : `_${name2}`) + // #7256 force differentiate fallback content from actual content
      (!validSlotContent && fallback ? "_fb" : "")
    },
    validSlotContent || (fallback ? fallback() : []),
    validSlotContent && slots._ === 1 ? 64 : -2
  );
  if (!noSlotted && rendered.scopeId) {
    rendered.slotScopeIds = [rendered.scopeId + "-s"];
  }
  if (slot && slot._c) {
    slot._d = true;
  }
  return rendered;
}
function ensureValidVNode(vnodes) {
  return vnodes.some((child) => {
    if (!isVNode(child)) return true;
    if (child.type === Comment) return false;
    if (child.type === Fragment && !ensureValidVNode(child.children))
      return false;
    return true;
  }) ? vnodes : null;
}
function toHandlers(obj, preserveCaseIfNecessary) {
  const ret = {};
  for (const key2 in obj) {
    ret[toHandlerKey(key2)] = obj[key2];
  }
  return ret;
}
const getPublicInstance = (i2) => {
  if (!i2) return null;
  if (isStatefulComponent(i2)) return getComponentPublicInstance(i2);
  return getPublicInstance(i2.parent);
};
const publicPropertiesMap = (
  // Move PURE marker to new line to workaround compiler discarding it
  // due to type annotation
  /* @__PURE__ */ extend$3(/* @__PURE__ */ Object.create(null), {
    $: (i2) => i2,
    $el: (i2) => i2.vnode.el,
    $data: (i2) => i2.data,
    $props: (i2) => i2.props,
    $attrs: (i2) => i2.attrs,
    $slots: (i2) => i2.slots,
    $refs: (i2) => i2.refs,
    $parent: (i2) => getPublicInstance(i2.parent),
    $root: (i2) => getPublicInstance(i2.root),
    $host: (i2) => i2.ce,
    $emit: (i2) => i2.emit,
    $options: (i2) => resolveMergedOptions(i2),
    $forceUpdate: (i2) => i2.f || (i2.f = () => {
      queueJob(i2.update);
    }),
    $nextTick: (i2) => i2.n || (i2.n = nextTick.bind(i2.proxy)),
    $watch: (i2) => instanceWatch.bind(i2)
  })
);
const hasSetupBinding = (state, key2) => state !== EMPTY_OBJ && !state.__isScriptSetup && hasOwn$2(state, key2);
const PublicInstanceProxyHandlers = {
  get({ _: instance }, key2) {
    if (key2 === "__v_skip") {
      return true;
    }
    const { ctx, setupState, data, props, accessCache, type: type2, appContext } = instance;
    let normalizedProps;
    if (key2[0] !== "$") {
      const n2 = accessCache[key2];
      if (n2 !== void 0) {
        switch (n2) {
          case 1:
            return setupState[key2];
          case 2:
            return data[key2];
          case 4:
            return ctx[key2];
          case 3:
            return props[key2];
        }
      } else if (hasSetupBinding(setupState, key2)) {
        accessCache[key2] = 1;
        return setupState[key2];
      } else if (data !== EMPTY_OBJ && hasOwn$2(data, key2)) {
        accessCache[key2] = 2;
        return data[key2];
      } else if (
        // only cache other properties when instance has declared (thus stable)
        // props
        (normalizedProps = instance.propsOptions[0]) && hasOwn$2(normalizedProps, key2)
      ) {
        accessCache[key2] = 3;
        return props[key2];
      } else if (ctx !== EMPTY_OBJ && hasOwn$2(ctx, key2)) {
        accessCache[key2] = 4;
        return ctx[key2];
      } else if (shouldCacheAccess) {
        accessCache[key2] = 0;
      }
    }
    const publicGetter = publicPropertiesMap[key2];
    let cssModule, globalProperties;
    if (publicGetter) {
      if (key2 === "$attrs") {
        track(instance.attrs, "get", "");
      }
      return publicGetter(instance);
    } else if (
      // css module (injected by vue-loader)
      (cssModule = type2.__cssModules) && (cssModule = cssModule[key2])
    ) {
      return cssModule;
    } else if (ctx !== EMPTY_OBJ && hasOwn$2(ctx, key2)) {
      accessCache[key2] = 4;
      return ctx[key2];
    } else if (
      // global properties
      globalProperties = appContext.config.globalProperties, hasOwn$2(globalProperties, key2)
    ) {
      {
        return globalProperties[key2];
      }
    } else ;
  },
  set({ _: instance }, key2, value) {
    const { data, setupState, ctx } = instance;
    if (hasSetupBinding(setupState, key2)) {
      setupState[key2] = value;
      return true;
    } else if (data !== EMPTY_OBJ && hasOwn$2(data, key2)) {
      data[key2] = value;
      return true;
    } else if (hasOwn$2(instance.props, key2)) {
      return false;
    }
    if (key2[0] === "$" && key2.slice(1) in instance) {
      return false;
    } else {
      {
        ctx[key2] = value;
      }
    }
    return true;
  },
  has({
    _: { data, setupState, accessCache, ctx, appContext, propsOptions }
  }, key2) {
    let normalizedProps;
    return !!accessCache[key2] || data !== EMPTY_OBJ && hasOwn$2(data, key2) || hasSetupBinding(setupState, key2) || (normalizedProps = propsOptions[0]) && hasOwn$2(normalizedProps, key2) || hasOwn$2(ctx, key2) || hasOwn$2(publicPropertiesMap, key2) || hasOwn$2(appContext.config.globalProperties, key2);
  },
  defineProperty(target, key2, descriptor) {
    if (descriptor.get != null) {
      target._.accessCache[key2] = 0;
    } else if (hasOwn$2(descriptor, "value")) {
      this.set(target, key2, descriptor.value, null);
    }
    return Reflect.defineProperty(target, key2, descriptor);
  }
};
function useSlots() {
  return getContext().slots;
}
function useAttrs() {
  return getContext().attrs;
}
function getContext() {
  const i2 = getCurrentInstance();
  return i2.setupContext || (i2.setupContext = createSetupContext(i2));
}
function normalizePropsOrEmits(props) {
  return isArray$3(props) ? props.reduce(
    (normalized, p2) => (normalized[p2] = null, normalized),
    {}
  ) : props;
}
function mergeDefaults(raw2, defaults2) {
  const props = normalizePropsOrEmits(raw2);
  for (const key2 in defaults2) {
    if (key2.startsWith("__skip")) continue;
    let opt = props[key2];
    if (opt) {
      if (isArray$3(opt) || isFunction(opt)) {
        opt = props[key2] = { type: opt, default: defaults2[key2] };
      } else {
        opt.default = defaults2[key2];
      }
    } else if (opt === null) {
      opt = props[key2] = { default: defaults2[key2] };
    } else ;
    if (opt && defaults2[`__skip_${key2}`]) {
      opt.skipFactory = true;
    }
  }
  return props;
}
let shouldCacheAccess = true;
function applyOptions(instance) {
  const options = resolveMergedOptions(instance);
  const publicThis = instance.proxy;
  const ctx = instance.ctx;
  shouldCacheAccess = false;
  if (options.beforeCreate) {
    callHook$1(options.beforeCreate, instance, "bc");
  }
  const {
    // state
    data: dataOptions,
    computed: computedOptions,
    methods,
    watch: watchOptions,
    provide: provideOptions,
    inject: injectOptions,
    // lifecycle
    created,
    beforeMount,
    mounted,
    beforeUpdate,
    updated,
    activated,
    deactivated,
    beforeDestroy,
    beforeUnmount,
    destroyed,
    unmounted,
    render: render2,
    renderTracked,
    renderTriggered,
    errorCaptured,
    serverPrefetch,
    // public API
    expose,
    inheritAttrs,
    // assets
    components,
    directives,
    filters
  } = options;
  const checkDuplicateProperties = null;
  if (injectOptions) {
    resolveInjections(injectOptions, ctx, checkDuplicateProperties);
  }
  if (methods) {
    for (const key2 in methods) {
      const methodHandler = methods[key2];
      if (isFunction(methodHandler)) {
        {
          ctx[key2] = methodHandler.bind(publicThis);
        }
      }
    }
  }
  if (dataOptions) {
    const data = dataOptions.call(publicThis, publicThis);
    if (!isObject$2(data)) ;
    else {
      instance.data = reactive(data);
    }
  }
  shouldCacheAccess = true;
  if (computedOptions) {
    for (const key2 in computedOptions) {
      const opt = computedOptions[key2];
      const get2 = isFunction(opt) ? opt.bind(publicThis, publicThis) : isFunction(opt.get) ? opt.get.bind(publicThis, publicThis) : NOOP;
      const set2 = !isFunction(opt) && isFunction(opt.set) ? opt.set.bind(publicThis) : NOOP;
      const c2 = computed({
        get: get2,
        set: set2
      });
      Object.defineProperty(ctx, key2, {
        enumerable: true,
        configurable: true,
        get: () => c2.value,
        set: (v2) => c2.value = v2
      });
    }
  }
  if (watchOptions) {
    for (const key2 in watchOptions) {
      createWatcher(watchOptions[key2], ctx, publicThis, key2);
    }
  }
  if (provideOptions) {
    const provides = isFunction(provideOptions) ? provideOptions.call(publicThis) : provideOptions;
    Reflect.ownKeys(provides).forEach((key2) => {
      provide(key2, provides[key2]);
    });
  }
  if (created) {
    callHook$1(created, instance, "c");
  }
  function registerLifecycleHook(register2, hook) {
    if (isArray$3(hook)) {
      hook.forEach((_hook) => register2(_hook.bind(publicThis)));
    } else if (hook) {
      register2(hook.bind(publicThis));
    }
  }
  registerLifecycleHook(onBeforeMount, beforeMount);
  registerLifecycleHook(onMounted, mounted);
  registerLifecycleHook(onBeforeUpdate, beforeUpdate);
  registerLifecycleHook(onUpdated, updated);
  registerLifecycleHook(onActivated, activated);
  registerLifecycleHook(onDeactivated, deactivated);
  registerLifecycleHook(onErrorCaptured, errorCaptured);
  registerLifecycleHook(onRenderTracked, renderTracked);
  registerLifecycleHook(onRenderTriggered, renderTriggered);
  registerLifecycleHook(onBeforeUnmount, beforeUnmount);
  registerLifecycleHook(onUnmounted, unmounted);
  registerLifecycleHook(onServerPrefetch, serverPrefetch);
  if (isArray$3(expose)) {
    if (expose.length) {
      const exposed = instance.exposed || (instance.exposed = {});
      expose.forEach((key2) => {
        Object.defineProperty(exposed, key2, {
          get: () => publicThis[key2],
          set: (val) => publicThis[key2] = val
        });
      });
    } else if (!instance.exposed) {
      instance.exposed = {};
    }
  }
  if (render2 && instance.render === NOOP) {
    instance.render = render2;
  }
  if (inheritAttrs != null) {
    instance.inheritAttrs = inheritAttrs;
  }
  if (components) instance.components = components;
  if (directives) instance.directives = directives;
  if (serverPrefetch) {
    markAsyncBoundary(instance);
  }
}
function resolveInjections(injectOptions, ctx, checkDuplicateProperties = NOOP) {
  if (isArray$3(injectOptions)) {
    injectOptions = normalizeInject(injectOptions);
  }
  for (const key2 in injectOptions) {
    const opt = injectOptions[key2];
    let injected;
    if (isObject$2(opt)) {
      if ("default" in opt) {
        injected = inject(
          opt.from || key2,
          opt.default,
          true
        );
      } else {
        injected = inject(opt.from || key2);
      }
    } else {
      injected = inject(opt);
    }
    if (isRef(injected)) {
      Object.defineProperty(ctx, key2, {
        enumerable: true,
        configurable: true,
        get: () => injected.value,
        set: (v2) => injected.value = v2
      });
    } else {
      ctx[key2] = injected;
    }
  }
}
function callHook$1(hook, instance, type2) {
  callWithAsyncErrorHandling(
    isArray$3(hook) ? hook.map((h2) => h2.bind(instance.proxy)) : hook.bind(instance.proxy),
    instance,
    type2
  );
}
function createWatcher(raw2, ctx, publicThis, key2) {
  let getter = key2.includes(".") ? createPathGetter(publicThis, key2) : () => publicThis[key2];
  if (isString$1(raw2)) {
    const handler = ctx[raw2];
    if (isFunction(handler)) {
      {
        watch(getter, handler);
      }
    }
  } else if (isFunction(raw2)) {
    {
      watch(getter, raw2.bind(publicThis));
    }
  } else if (isObject$2(raw2)) {
    if (isArray$3(raw2)) {
      raw2.forEach((r2) => createWatcher(r2, ctx, publicThis, key2));
    } else {
      const handler = isFunction(raw2.handler) ? raw2.handler.bind(publicThis) : ctx[raw2.handler];
      if (isFunction(handler)) {
        watch(getter, handler, raw2);
      }
    }
  } else ;
}
function resolveMergedOptions(instance) {
  const base2 = instance.type;
  const { mixins, extends: extendsOptions } = base2;
  const {
    mixins: globalMixins,
    optionsCache: cache2,
    config: { optionMergeStrategies }
  } = instance.appContext;
  const cached = cache2.get(base2);
  let resolved;
  if (cached) {
    resolved = cached;
  } else if (!globalMixins.length && !mixins && !extendsOptions) {
    {
      resolved = base2;
    }
  } else {
    resolved = {};
    if (globalMixins.length) {
      globalMixins.forEach(
        (m2) => mergeOptions$1(resolved, m2, optionMergeStrategies, true)
      );
    }
    mergeOptions$1(resolved, base2, optionMergeStrategies);
  }
  if (isObject$2(base2)) {
    cache2.set(base2, resolved);
  }
  return resolved;
}
function mergeOptions$1(to2, from, strats, asMixin = false) {
  const { mixins, extends: extendsOptions } = from;
  if (extendsOptions) {
    mergeOptions$1(to2, extendsOptions, strats, true);
  }
  if (mixins) {
    mixins.forEach(
      (m2) => mergeOptions$1(to2, m2, strats, true)
    );
  }
  for (const key2 in from) {
    if (asMixin && key2 === "expose") ;
    else {
      const strat = internalOptionMergeStrats[key2] || strats && strats[key2];
      to2[key2] = strat ? strat(to2[key2], from[key2]) : from[key2];
    }
  }
  return to2;
}
const internalOptionMergeStrats = {
  data: mergeDataFn,
  props: mergeEmitsOrPropsOptions,
  emits: mergeEmitsOrPropsOptions,
  // objects
  methods: mergeObjectOptions,
  computed: mergeObjectOptions,
  // lifecycle
  beforeCreate: mergeAsArray,
  created: mergeAsArray,
  beforeMount: mergeAsArray,
  mounted: mergeAsArray,
  beforeUpdate: mergeAsArray,
  updated: mergeAsArray,
  beforeDestroy: mergeAsArray,
  beforeUnmount: mergeAsArray,
  destroyed: mergeAsArray,
  unmounted: mergeAsArray,
  activated: mergeAsArray,
  deactivated: mergeAsArray,
  errorCaptured: mergeAsArray,
  serverPrefetch: mergeAsArray,
  // assets
  components: mergeObjectOptions,
  directives: mergeObjectOptions,
  // watch
  watch: mergeWatchOptions,
  // provide / inject
  provide: mergeDataFn,
  inject: mergeInject
};
function mergeDataFn(to2, from) {
  if (!from) {
    return to2;
  }
  if (!to2) {
    return from;
  }
  return function mergedDataFn() {
    return extend$3(
      isFunction(to2) ? to2.call(this, this) : to2,
      isFunction(from) ? from.call(this, this) : from
    );
  };
}
function mergeInject(to2, from) {
  return mergeObjectOptions(normalizeInject(to2), normalizeInject(from));
}
function normalizeInject(raw2) {
  if (isArray$3(raw2)) {
    const res = {};
    for (let i2 = 0; i2 < raw2.length; i2++) {
      res[raw2[i2]] = raw2[i2];
    }
    return res;
  }
  return raw2;
}
function mergeAsArray(to2, from) {
  return to2 ? [...new Set([].concat(to2, from))] : from;
}
function mergeObjectOptions(to2, from) {
  return to2 ? extend$3(/* @__PURE__ */ Object.create(null), to2, from) : from;
}
function mergeEmitsOrPropsOptions(to2, from) {
  if (to2) {
    if (isArray$3(to2) && isArray$3(from)) {
      return [.../* @__PURE__ */ new Set([...to2, ...from])];
    }
    return extend$3(
      /* @__PURE__ */ Object.create(null),
      normalizePropsOrEmits(to2),
      normalizePropsOrEmits(from != null ? from : {})
    );
  } else {
    return from;
  }
}
function mergeWatchOptions(to2, from) {
  if (!to2) return from;
  if (!from) return to2;
  const merged = extend$3(/* @__PURE__ */ Object.create(null), to2);
  for (const key2 in from) {
    merged[key2] = mergeAsArray(to2[key2], from[key2]);
  }
  return merged;
}
function createAppContext() {
  return {
    app: null,
    config: {
      isNativeTag: NO,
      performance: false,
      globalProperties: {},
      optionMergeStrategies: {},
      errorHandler: void 0,
      warnHandler: void 0,
      compilerOptions: {}
    },
    mixins: [],
    components: {},
    directives: {},
    provides: /* @__PURE__ */ Object.create(null),
    optionsCache: /* @__PURE__ */ new WeakMap(),
    propsCache: /* @__PURE__ */ new WeakMap(),
    emitsCache: /* @__PURE__ */ new WeakMap()
  };
}
let uid$1 = 0;
function createAppAPI(render2, hydrate) {
  return function createApp2(rootComponent, rootProps = null) {
    if (!isFunction(rootComponent)) {
      rootComponent = extend$3({}, rootComponent);
    }
    if (rootProps != null && !isObject$2(rootProps)) {
      rootProps = null;
    }
    const context = createAppContext();
    const installedPlugins = /* @__PURE__ */ new WeakSet();
    const pluginCleanupFns = [];
    let isMounted = false;
    const app = context.app = {
      _uid: uid$1++,
      _component: rootComponent,
      _props: rootProps,
      _container: null,
      _context: context,
      _instance: null,
      version: version$1,
      get config() {
        return context.config;
      },
      set config(v2) {
      },
      use(plugin, ...options) {
        if (installedPlugins.has(plugin)) ;
        else if (plugin && isFunction(plugin.install)) {
          installedPlugins.add(plugin);
          plugin.install(app, ...options);
        } else if (isFunction(plugin)) {
          installedPlugins.add(plugin);
          plugin(app, ...options);
        } else ;
        return app;
      },
      mixin(mixin) {
        {
          if (!context.mixins.includes(mixin)) {
            context.mixins.push(mixin);
          }
        }
        return app;
      },
      component(name2, component) {
        if (!component) {
          return context.components[name2];
        }
        context.components[name2] = component;
        return app;
      },
      directive(name2, directive) {
        if (!directive) {
          return context.directives[name2];
        }
        context.directives[name2] = directive;
        return app;
      },
      mount(rootContainer, isHydrate, namespace) {
        if (!isMounted) {
          const vnode = app._ceVNode || createVNode(rootComponent, rootProps);
          vnode.appContext = context;
          if (namespace === true) {
            namespace = "svg";
          } else if (namespace === false) {
            namespace = void 0;
          }
          if (isHydrate && hydrate) {
            hydrate(vnode, rootContainer);
          } else {
            render2(vnode, rootContainer, namespace);
          }
          isMounted = true;
          app._container = rootContainer;
          rootContainer.__vue_app__ = app;
          return getComponentPublicInstance(vnode.component);
        }
      },
      onUnmount(cleanupFn) {
        pluginCleanupFns.push(cleanupFn);
      },
      unmount() {
        if (isMounted) {
          callWithAsyncErrorHandling(
            pluginCleanupFns,
            app._instance,
            16
          );
          render2(null, app._container);
          delete app._container.__vue_app__;
        }
      },
      provide(key2, value) {
        context.provides[key2] = value;
        return app;
      },
      runWithContext(fn) {
        const lastApp = currentApp;
        currentApp = app;
        try {
          return fn();
        } finally {
          currentApp = lastApp;
        }
      }
    };
    return app;
  };
}
let currentApp = null;
function provide(key2, value) {
  if (!currentInstance) ;
  else {
    let provides = currentInstance.provides;
    const parentProvides = currentInstance.parent && currentInstance.parent.provides;
    if (parentProvides === provides) {
      provides = currentInstance.provides = Object.create(parentProvides);
    }
    provides[key2] = value;
  }
}
function inject(key2, defaultValue, treatDefaultAsFactory = false) {
  const instance = currentInstance || currentRenderingInstance;
  if (instance || currentApp) {
    const provides = currentApp ? currentApp._context.provides : instance ? instance.parent == null ? instance.vnode.appContext && instance.vnode.appContext.provides : instance.parent.provides : void 0;
    if (provides && key2 in provides) {
      return provides[key2];
    } else if (arguments.length > 1) {
      return treatDefaultAsFactory && isFunction(defaultValue) ? defaultValue.call(instance && instance.proxy) : defaultValue;
    } else ;
  }
}
const internalObjectProto = {};
const createInternalObject = () => Object.create(internalObjectProto);
const isInternalObject = (obj) => Object.getPrototypeOf(obj) === internalObjectProto;
function initProps(instance, rawProps, isStateful, isSSR = false) {
  const props = {};
  const attrs = createInternalObject();
  instance.propsDefaults = /* @__PURE__ */ Object.create(null);
  setFullProps(instance, rawProps, props, attrs);
  for (const key2 in instance.propsOptions[0]) {
    if (!(key2 in props)) {
      props[key2] = void 0;
    }
  }
  if (isStateful) {
    instance.props = isSSR ? props : shallowReactive(props);
  } else {
    if (!instance.type.props) {
      instance.props = attrs;
    } else {
      instance.props = props;
    }
  }
  instance.attrs = attrs;
}
function updateProps(instance, rawProps, rawPrevProps, optimized) {
  const {
    props,
    attrs,
    vnode: { patchFlag }
  } = instance;
  const rawCurrentProps = toRaw(props);
  const [options] = instance.propsOptions;
  let hasAttrsChanged = false;
  if (
    // always force full diff in dev
    // - #1942 if hmr is enabled with sfc component
    // - vite#872 non-sfc component used by sfc component
    (optimized || patchFlag > 0) && !(patchFlag & 16)
  ) {
    if (patchFlag & 8) {
      const propsToUpdate = instance.vnode.dynamicProps;
      for (let i2 = 0; i2 < propsToUpdate.length; i2++) {
        let key2 = propsToUpdate[i2];
        if (isEmitListener(instance.emitsOptions, key2)) {
          continue;
        }
        const value = rawProps[key2];
        if (options) {
          if (hasOwn$2(attrs, key2)) {
            if (value !== attrs[key2]) {
              attrs[key2] = value;
              hasAttrsChanged = true;
            }
          } else {
            const camelizedKey = camelize(key2);
            props[camelizedKey] = resolvePropValue(
              options,
              rawCurrentProps,
              camelizedKey,
              value,
              instance,
              false
            );
          }
        } else {
          if (value !== attrs[key2]) {
            attrs[key2] = value;
            hasAttrsChanged = true;
          }
        }
      }
    }
  } else {
    if (setFullProps(instance, rawProps, props, attrs)) {
      hasAttrsChanged = true;
    }
    let kebabKey;
    for (const key2 in rawCurrentProps) {
      if (!rawProps || // for camelCase
      !hasOwn$2(rawProps, key2) && // it's possible the original props was passed in as kebab-case
      // and converted to camelCase (#955)
      ((kebabKey = hyphenate(key2)) === key2 || !hasOwn$2(rawProps, kebabKey))) {
        if (options) {
          if (rawPrevProps && // for camelCase
          (rawPrevProps[key2] !== void 0 || // for kebab-case
          rawPrevProps[kebabKey] !== void 0)) {
            props[key2] = resolvePropValue(
              options,
              rawCurrentProps,
              key2,
              void 0,
              instance,
              true
            );
          }
        } else {
          delete props[key2];
        }
      }
    }
    if (attrs !== rawCurrentProps) {
      for (const key2 in attrs) {
        if (!rawProps || !hasOwn$2(rawProps, key2) && true) {
          delete attrs[key2];
          hasAttrsChanged = true;
        }
      }
    }
  }
  if (hasAttrsChanged) {
    trigger(instance.attrs, "set", "");
  }
}
function setFullProps(instance, rawProps, props, attrs) {
  const [options, needCastKeys] = instance.propsOptions;
  let hasAttrsChanged = false;
  let rawCastValues;
  if (rawProps) {
    for (let key2 in rawProps) {
      if (isReservedProp(key2)) {
        continue;
      }
      const value = rawProps[key2];
      let camelKey;
      if (options && hasOwn$2(options, camelKey = camelize(key2))) {
        if (!needCastKeys || !needCastKeys.includes(camelKey)) {
          props[camelKey] = value;
        } else {
          (rawCastValues || (rawCastValues = {}))[camelKey] = value;
        }
      } else if (!isEmitListener(instance.emitsOptions, key2)) {
        if (!(key2 in attrs) || value !== attrs[key2]) {
          attrs[key2] = value;
          hasAttrsChanged = true;
        }
      }
    }
  }
  if (needCastKeys) {
    const rawCurrentProps = toRaw(props);
    const castValues = rawCastValues || EMPTY_OBJ;
    for (let i2 = 0; i2 < needCastKeys.length; i2++) {
      const key2 = needCastKeys[i2];
      props[key2] = resolvePropValue(
        options,
        rawCurrentProps,
        key2,
        castValues[key2],
        instance,
        !hasOwn$2(castValues, key2)
      );
    }
  }
  return hasAttrsChanged;
}
function resolvePropValue(options, props, key2, value, instance, isAbsent) {
  const opt = options[key2];
  if (opt != null) {
    const hasDefault = hasOwn$2(opt, "default");
    if (hasDefault && value === void 0) {
      const defaultValue = opt.default;
      if (opt.type !== Function && !opt.skipFactory && isFunction(defaultValue)) {
        const { propsDefaults } = instance;
        if (key2 in propsDefaults) {
          value = propsDefaults[key2];
        } else {
          const reset = setCurrentInstance(instance);
          value = propsDefaults[key2] = defaultValue.call(
            null,
            props
          );
          reset();
        }
      } else {
        value = defaultValue;
      }
      if (instance.ce) {
        instance.ce._setProp(key2, value);
      }
    }
    if (opt[
      0
      /* shouldCast */
    ]) {
      if (isAbsent && !hasDefault) {
        value = false;
      } else if (opt[
        1
        /* shouldCastTrue */
      ] && (value === "" || value === hyphenate(key2))) {
        value = true;
      }
    }
  }
  return value;
}
const mixinPropsCache = /* @__PURE__ */ new WeakMap();
function normalizePropsOptions(comp, appContext, asMixin = false) {
  const cache2 = asMixin ? mixinPropsCache : appContext.propsCache;
  const cached = cache2.get(comp);
  if (cached) {
    return cached;
  }
  const raw2 = comp.props;
  const normalized = {};
  const needCastKeys = [];
  let hasExtends = false;
  if (!isFunction(comp)) {
    const extendProps = (raw22) => {
      hasExtends = true;
      const [props, keys2] = normalizePropsOptions(raw22, appContext, true);
      extend$3(normalized, props);
      if (keys2) needCastKeys.push(...keys2);
    };
    if (!asMixin && appContext.mixins.length) {
      appContext.mixins.forEach(extendProps);
    }
    if (comp.extends) {
      extendProps(comp.extends);
    }
    if (comp.mixins) {
      comp.mixins.forEach(extendProps);
    }
  }
  if (!raw2 && !hasExtends) {
    if (isObject$2(comp)) {
      cache2.set(comp, EMPTY_ARR);
    }
    return EMPTY_ARR;
  }
  if (isArray$3(raw2)) {
    for (let i2 = 0; i2 < raw2.length; i2++) {
      const normalizedKey = camelize(raw2[i2]);
      if (validatePropName(normalizedKey)) {
        normalized[normalizedKey] = EMPTY_OBJ;
      }
    }
  } else if (raw2) {
    for (const key2 in raw2) {
      const normalizedKey = camelize(key2);
      if (validatePropName(normalizedKey)) {
        const opt = raw2[key2];
        const prop = normalized[normalizedKey] = isArray$3(opt) || isFunction(opt) ? { type: opt } : extend$3({}, opt);
        const propType = prop.type;
        let shouldCast = false;
        let shouldCastTrue = true;
        if (isArray$3(propType)) {
          for (let index2 = 0; index2 < propType.length; ++index2) {
            const type2 = propType[index2];
            const typeName2 = isFunction(type2) && type2.name;
            if (typeName2 === "Boolean") {
              shouldCast = true;
              break;
            } else if (typeName2 === "String") {
              shouldCastTrue = false;
            }
          }
        } else {
          shouldCast = isFunction(propType) && propType.name === "Boolean";
        }
        prop[
          0
          /* shouldCast */
        ] = shouldCast;
        prop[
          1
          /* shouldCastTrue */
        ] = shouldCastTrue;
        if (shouldCast || hasOwn$2(prop, "default")) {
          needCastKeys.push(normalizedKey);
        }
      }
    }
  }
  const res = [normalized, needCastKeys];
  if (isObject$2(comp)) {
    cache2.set(comp, res);
  }
  return res;
}
function validatePropName(key2) {
  if (key2[0] !== "$" && !isReservedProp(key2)) {
    return true;
  }
  return false;
}
const isInternalKey = (key2) => key2[0] === "_" || key2 === "$stable";
const normalizeSlotValue = (value) => isArray$3(value) ? value.map(normalizeVNode) : [normalizeVNode(value)];
const normalizeSlot$1 = (key2, rawSlot, ctx) => {
  if (rawSlot._n) {
    return rawSlot;
  }
  const normalized = withCtx((...args) => {
    if (false) ;
    return normalizeSlotValue(rawSlot(...args));
  }, ctx);
  normalized._c = false;
  return normalized;
};
const normalizeObjectSlots = (rawSlots, slots, instance) => {
  const ctx = rawSlots._ctx;
  for (const key2 in rawSlots) {
    if (isInternalKey(key2)) continue;
    const value = rawSlots[key2];
    if (isFunction(value)) {
      slots[key2] = normalizeSlot$1(key2, value, ctx);
    } else if (value != null) {
      const normalized = normalizeSlotValue(value);
      slots[key2] = () => normalized;
    }
  }
};
const normalizeVNodeSlots = (instance, children) => {
  const normalized = normalizeSlotValue(children);
  instance.slots.default = () => normalized;
};
const assignSlots = (slots, children, optimized) => {
  for (const key2 in children) {
    if (optimized || key2 !== "_") {
      slots[key2] = children[key2];
    }
  }
};
const initSlots = (instance, children, optimized) => {
  const slots = instance.slots = createInternalObject();
  if (instance.vnode.shapeFlag & 32) {
    const type2 = children._;
    if (type2) {
      assignSlots(slots, children, optimized);
      if (optimized) {
        def(slots, "_", type2, true);
      }
    } else {
      normalizeObjectSlots(children, slots);
    }
  } else if (children) {
    normalizeVNodeSlots(instance, children);
  }
};
const updateSlots = (instance, children, optimized) => {
  const { vnode, slots } = instance;
  let needDeletionCheck = true;
  let deletionComparisonTarget = EMPTY_OBJ;
  if (vnode.shapeFlag & 32) {
    const type2 = children._;
    if (type2) {
      if (optimized && type2 === 1) {
        needDeletionCheck = false;
      } else {
        assignSlots(slots, children, optimized);
      }
    } else {
      needDeletionCheck = !children.$stable;
      normalizeObjectSlots(children, slots);
    }
    deletionComparisonTarget = children;
  } else if (children) {
    normalizeVNodeSlots(instance, children);
    deletionComparisonTarget = { default: 1 };
  }
  if (needDeletionCheck) {
    for (const key2 in slots) {
      if (!isInternalKey(key2) && deletionComparisonTarget[key2] == null) {
        delete slots[key2];
      }
    }
  }
};
const queuePostRenderEffect = queueEffectWithSuspense;
function createRenderer(options) {
  return baseCreateRenderer(options);
}
function baseCreateRenderer(options, createHydrationFns) {
  const target = getGlobalThis();
  target.__VUE__ = true;
  const {
    insert: hostInsert,
    remove: hostRemove,
    patchProp: hostPatchProp,
    createElement: hostCreateElement,
    createText: hostCreateText,
    createComment: hostCreateComment,
    setText: hostSetText,
    setElementText: hostSetElementText,
    parentNode: hostParentNode,
    nextSibling: hostNextSibling,
    setScopeId: hostSetScopeId = NOOP,
    insertStaticContent: hostInsertStaticContent
  } = options;
  const patch2 = (n1, n2, container, anchor = null, parentComponent = null, parentSuspense = null, namespace = void 0, slotScopeIds = null, optimized = !!n2.dynamicChildren) => {
    if (n1 === n2) {
      return;
    }
    if (n1 && !isSameVNodeType(n1, n2)) {
      anchor = getNextHostNode(n1);
      unmount(n1, parentComponent, parentSuspense, true);
      n1 = null;
    }
    if (n2.patchFlag === -2) {
      optimized = false;
      n2.dynamicChildren = null;
    }
    const { type: type2, ref: ref3, shapeFlag } = n2;
    switch (type2) {
      case Text$1:
        processText(n1, n2, container, anchor);
        break;
      case Comment:
        processCommentNode(n1, n2, container, anchor);
        break;
      case Static:
        if (n1 == null) {
          mountStaticNode(n2, container, anchor, namespace);
        }
        break;
      case Fragment:
        processFragment(
          n1,
          n2,
          container,
          anchor,
          parentComponent,
          parentSuspense,
          namespace,
          slotScopeIds,
          optimized
        );
        break;
      default:
        if (shapeFlag & 1) {
          processElement(
            n1,
            n2,
            container,
            anchor,
            parentComponent,
            parentSuspense,
            namespace,
            slotScopeIds,
            optimized
          );
        } else if (shapeFlag & 6) {
          processComponent(
            n1,
            n2,
            container,
            anchor,
            parentComponent,
            parentSuspense,
            namespace,
            slotScopeIds,
            optimized
          );
        } else if (shapeFlag & 64) {
          type2.process(
            n1,
            n2,
            container,
            anchor,
            parentComponent,
            parentSuspense,
            namespace,
            slotScopeIds,
            optimized,
            internals
          );
        } else if (shapeFlag & 128) {
          type2.process(
            n1,
            n2,
            container,
            anchor,
            parentComponent,
            parentSuspense,
            namespace,
            slotScopeIds,
            optimized,
            internals
          );
        } else ;
    }
    if (ref3 != null && parentComponent) {
      setRef(ref3, n1 && n1.ref, parentSuspense, n2 || n1, !n2);
    }
  };
  const processText = (n1, n2, container, anchor) => {
    if (n1 == null) {
      hostInsert(
        n2.el = hostCreateText(n2.children),
        container,
        anchor
      );
    } else {
      const el = n2.el = n1.el;
      if (n2.children !== n1.children) {
        hostSetText(el, n2.children);
      }
    }
  };
  const processCommentNode = (n1, n2, container, anchor) => {
    if (n1 == null) {
      hostInsert(
        n2.el = hostCreateComment(n2.children || ""),
        container,
        anchor
      );
    } else {
      n2.el = n1.el;
    }
  };
  const mountStaticNode = (n2, container, anchor, namespace) => {
    [n2.el, n2.anchor] = hostInsertStaticContent(
      n2.children,
      container,
      anchor,
      namespace,
      n2.el,
      n2.anchor
    );
  };
  const moveStaticNode = ({ el, anchor }, container, nextSibling) => {
    let next;
    while (el && el !== anchor) {
      next = hostNextSibling(el);
      hostInsert(el, container, nextSibling);
      el = next;
    }
    hostInsert(anchor, container, nextSibling);
  };
  const removeStaticNode = ({ el, anchor }) => {
    let next;
    while (el && el !== anchor) {
      next = hostNextSibling(el);
      hostRemove(el);
      el = next;
    }
    hostRemove(anchor);
  };
  const processElement = (n1, n2, container, anchor, parentComponent, parentSuspense, namespace, slotScopeIds, optimized) => {
    if (n2.type === "svg") {
      namespace = "svg";
    } else if (n2.type === "math") {
      namespace = "mathml";
    }
    if (n1 == null) {
      mountElement(
        n2,
        container,
        anchor,
        parentComponent,
        parentSuspense,
        namespace,
        slotScopeIds,
        optimized
      );
    } else {
      patchElement(
        n1,
        n2,
        parentComponent,
        parentSuspense,
        namespace,
        slotScopeIds,
        optimized
      );
    }
  };
  const mountElement = (vnode, container, anchor, parentComponent, parentSuspense, namespace, slotScopeIds, optimized) => {
    let el;
    let vnodeHook;
    const { props, shapeFlag, transition, dirs } = vnode;
    el = vnode.el = hostCreateElement(
      vnode.type,
      namespace,
      props && props.is,
      props
    );
    if (shapeFlag & 8) {
      hostSetElementText(el, vnode.children);
    } else if (shapeFlag & 16) {
      mountChildren(
        vnode.children,
        el,
        null,
        parentComponent,
        parentSuspense,
        resolveChildrenNamespace(vnode, namespace),
        slotScopeIds,
        optimized
      );
    }
    if (dirs) {
      invokeDirectiveHook(vnode, null, parentComponent, "created");
    }
    setScopeId(el, vnode, vnode.scopeId, slotScopeIds, parentComponent);
    if (props) {
      for (const key2 in props) {
        if (key2 !== "value" && !isReservedProp(key2)) {
          hostPatchProp(el, key2, null, props[key2], namespace, parentComponent);
        }
      }
      if ("value" in props) {
        hostPatchProp(el, "value", null, props.value, namespace);
      }
      if (vnodeHook = props.onVnodeBeforeMount) {
        invokeVNodeHook(vnodeHook, parentComponent, vnode);
      }
    }
    if (dirs) {
      invokeDirectiveHook(vnode, null, parentComponent, "beforeMount");
    }
    const needCallTransitionHooks = needTransition(parentSuspense, transition);
    if (needCallTransitionHooks) {
      transition.beforeEnter(el);
    }
    hostInsert(el, container, anchor);
    if ((vnodeHook = props && props.onVnodeMounted) || needCallTransitionHooks || dirs) {
      queuePostRenderEffect(() => {
        vnodeHook && invokeVNodeHook(vnodeHook, parentComponent, vnode);
        needCallTransitionHooks && transition.enter(el);
        dirs && invokeDirectiveHook(vnode, null, parentComponent, "mounted");
      }, parentSuspense);
    }
  };
  const setScopeId = (el, vnode, scopeId, slotScopeIds, parentComponent) => {
    if (scopeId) {
      hostSetScopeId(el, scopeId);
    }
    if (slotScopeIds) {
      for (let i2 = 0; i2 < slotScopeIds.length; i2++) {
        hostSetScopeId(el, slotScopeIds[i2]);
      }
    }
    if (parentComponent) {
      let subTree = parentComponent.subTree;
      if (vnode === subTree || isSuspense(subTree.type) && (subTree.ssContent === vnode || subTree.ssFallback === vnode)) {
        const parentVNode = parentComponent.vnode;
        setScopeId(
          el,
          parentVNode,
          parentVNode.scopeId,
          parentVNode.slotScopeIds,
          parentComponent.parent
        );
      }
    }
  };
  const mountChildren = (children, container, anchor, parentComponent, parentSuspense, namespace, slotScopeIds, optimized, start = 0) => {
    for (let i2 = start; i2 < children.length; i2++) {
      const child = children[i2] = optimized ? cloneIfMounted(children[i2]) : normalizeVNode(children[i2]);
      patch2(
        null,
        child,
        container,
        anchor,
        parentComponent,
        parentSuspense,
        namespace,
        slotScopeIds,
        optimized
      );
    }
  };
  const patchElement = (n1, n2, parentComponent, parentSuspense, namespace, slotScopeIds, optimized) => {
    const el = n2.el = n1.el;
    let { patchFlag, dynamicChildren, dirs } = n2;
    patchFlag |= n1.patchFlag & 16;
    const oldProps = n1.props || EMPTY_OBJ;
    const newProps = n2.props || EMPTY_OBJ;
    let vnodeHook;
    parentComponent && toggleRecurse(parentComponent, false);
    if (vnodeHook = newProps.onVnodeBeforeUpdate) {
      invokeVNodeHook(vnodeHook, parentComponent, n2, n1);
    }
    if (dirs) {
      invokeDirectiveHook(n2, n1, parentComponent, "beforeUpdate");
    }
    parentComponent && toggleRecurse(parentComponent, true);
    if (oldProps.innerHTML && newProps.innerHTML == null || oldProps.textContent && newProps.textContent == null) {
      hostSetElementText(el, "");
    }
    if (dynamicChildren) {
      patchBlockChildren(
        n1.dynamicChildren,
        dynamicChildren,
        el,
        parentComponent,
        parentSuspense,
        resolveChildrenNamespace(n2, namespace),
        slotScopeIds
      );
    } else if (!optimized) {
      patchChildren(
        n1,
        n2,
        el,
        null,
        parentComponent,
        parentSuspense,
        resolveChildrenNamespace(n2, namespace),
        slotScopeIds,
        false
      );
    }
    if (patchFlag > 0) {
      if (patchFlag & 16) {
        patchProps(el, oldProps, newProps, parentComponent, namespace);
      } else {
        if (patchFlag & 2) {
          if (oldProps.class !== newProps.class) {
            hostPatchProp(el, "class", null, newProps.class, namespace);
          }
        }
        if (patchFlag & 4) {
          hostPatchProp(el, "style", oldProps.style, newProps.style, namespace);
        }
        if (patchFlag & 8) {
          const propsToUpdate = n2.dynamicProps;
          for (let i2 = 0; i2 < propsToUpdate.length; i2++) {
            const key2 = propsToUpdate[i2];
            const prev = oldProps[key2];
            const next = newProps[key2];
            if (next !== prev || key2 === "value") {
              hostPatchProp(el, key2, prev, next, namespace, parentComponent);
            }
          }
        }
      }
      if (patchFlag & 1) {
        if (n1.children !== n2.children) {
          hostSetElementText(el, n2.children);
        }
      }
    } else if (!optimized && dynamicChildren == null) {
      patchProps(el, oldProps, newProps, parentComponent, namespace);
    }
    if ((vnodeHook = newProps.onVnodeUpdated) || dirs) {
      queuePostRenderEffect(() => {
        vnodeHook && invokeVNodeHook(vnodeHook, parentComponent, n2, n1);
        dirs && invokeDirectiveHook(n2, n1, parentComponent, "updated");
      }, parentSuspense);
    }
  };
  const patchBlockChildren = (oldChildren, newChildren, fallbackContainer, parentComponent, parentSuspense, namespace, slotScopeIds) => {
    for (let i2 = 0; i2 < newChildren.length; i2++) {
      const oldVNode = oldChildren[i2];
      const newVNode = newChildren[i2];
      const container = (
        // oldVNode may be an errored async setup() component inside Suspense
        // which will not have a mounted element
        oldVNode.el && // - In the case of a Fragment, we need to provide the actual parent
        // of the Fragment itself so it can move its children.
        (oldVNode.type === Fragment || // - In the case of different nodes, there is going to be a replacement
        // which also requires the correct parent container
        !isSameVNodeType(oldVNode, newVNode) || // - In the case of a component, it could contain anything.
        oldVNode.shapeFlag & (6 | 64)) ? hostParentNode(oldVNode.el) : (
          // In other cases, the parent container is not actually used so we
          // just pass the block element here to avoid a DOM parentNode call.
          fallbackContainer
        )
      );
      patch2(
        oldVNode,
        newVNode,
        container,
        null,
        parentComponent,
        parentSuspense,
        namespace,
        slotScopeIds,
        true
      );
    }
  };
  const patchProps = (el, oldProps, newProps, parentComponent, namespace) => {
    if (oldProps !== newProps) {
      if (oldProps !== EMPTY_OBJ) {
        for (const key2 in oldProps) {
          if (!isReservedProp(key2) && !(key2 in newProps)) {
            hostPatchProp(
              el,
              key2,
              oldProps[key2],
              null,
              namespace,
              parentComponent
            );
          }
        }
      }
      for (const key2 in newProps) {
        if (isReservedProp(key2)) continue;
        const next = newProps[key2];
        const prev = oldProps[key2];
        if (next !== prev && key2 !== "value") {
          hostPatchProp(el, key2, prev, next, namespace, parentComponent);
        }
      }
      if ("value" in newProps) {
        hostPatchProp(el, "value", oldProps.value, newProps.value, namespace);
      }
    }
  };
  const processFragment = (n1, n2, container, anchor, parentComponent, parentSuspense, namespace, slotScopeIds, optimized) => {
    const fragmentStartAnchor = n2.el = n1 ? n1.el : hostCreateText("");
    const fragmentEndAnchor = n2.anchor = n1 ? n1.anchor : hostCreateText("");
    let { patchFlag, dynamicChildren, slotScopeIds: fragmentSlotScopeIds } = n2;
    if (fragmentSlotScopeIds) {
      slotScopeIds = slotScopeIds ? slotScopeIds.concat(fragmentSlotScopeIds) : fragmentSlotScopeIds;
    }
    if (n1 == null) {
      hostInsert(fragmentStartAnchor, container, anchor);
      hostInsert(fragmentEndAnchor, container, anchor);
      mountChildren(
        // #10007
        // such fragment like `<></>` will be compiled into
        // a fragment which doesn't have a children.
        // In this case fallback to an empty array
        n2.children || [],
        container,
        fragmentEndAnchor,
        parentComponent,
        parentSuspense,
        namespace,
        slotScopeIds,
        optimized
      );
    } else {
      if (patchFlag > 0 && patchFlag & 64 && dynamicChildren && // #2715 the previous fragment could've been a BAILed one as a result
      // of renderSlot() with no valid children
      n1.dynamicChildren) {
        patchBlockChildren(
          n1.dynamicChildren,
          dynamicChildren,
          container,
          parentComponent,
          parentSuspense,
          namespace,
          slotScopeIds
        );
        if (
          // #2080 if the stable fragment has a key, it's a <template v-for> that may
          //  get moved around. Make sure all root level vnodes inherit el.
          // #2134 or if it's a component root, it may also get moved around
          // as the component is being moved.
          n2.key != null || parentComponent && n2 === parentComponent.subTree
        ) {
          traverseStaticChildren(
            n1,
            n2,
            true
            /* shallow */
          );
        }
      } else {
        patchChildren(
          n1,
          n2,
          container,
          fragmentEndAnchor,
          parentComponent,
          parentSuspense,
          namespace,
          slotScopeIds,
          optimized
        );
      }
    }
  };
  const processComponent = (n1, n2, container, anchor, parentComponent, parentSuspense, namespace, slotScopeIds, optimized) => {
    n2.slotScopeIds = slotScopeIds;
    if (n1 == null) {
      if (n2.shapeFlag & 512) {
        parentComponent.ctx.activate(
          n2,
          container,
          anchor,
          namespace,
          optimized
        );
      } else {
        mountComponent(
          n2,
          container,
          anchor,
          parentComponent,
          parentSuspense,
          namespace,
          optimized
        );
      }
    } else {
      updateComponent(n1, n2, optimized);
    }
  };
  const mountComponent = (initialVNode, container, anchor, parentComponent, parentSuspense, namespace, optimized) => {
    const instance = initialVNode.component = createComponentInstance(
      initialVNode,
      parentComponent,
      parentSuspense
    );
    if (isKeepAlive(initialVNode)) {
      instance.ctx.renderer = internals;
    }
    {
      setupComponent(instance, false, optimized);
    }
    if (instance.asyncDep) {
      parentSuspense && parentSuspense.registerDep(instance, setupRenderEffect, optimized);
      if (!initialVNode.el) {
        const placeholder2 = instance.subTree = createVNode(Comment);
        processCommentNode(null, placeholder2, container, anchor);
      }
    } else {
      setupRenderEffect(
        instance,
        initialVNode,
        container,
        anchor,
        parentSuspense,
        namespace,
        optimized
      );
    }
  };
  const updateComponent = (n1, n2, optimized) => {
    const instance = n2.component = n1.component;
    if (shouldUpdateComponent(n1, n2, optimized)) {
      if (instance.asyncDep && !instance.asyncResolved) {
        updateComponentPreRender(instance, n2, optimized);
        return;
      } else {
        instance.next = n2;
        instance.update();
      }
    } else {
      n2.el = n1.el;
      instance.vnode = n2;
    }
  };
  const setupRenderEffect = (instance, initialVNode, container, anchor, parentSuspense, namespace, optimized) => {
    const componentUpdateFn = () => {
      if (!instance.isMounted) {
        let vnodeHook;
        const { el, props } = initialVNode;
        const { bm, m: m2, parent, root: root2, type: type2 } = instance;
        const isAsyncWrapperVNode = isAsyncWrapper(initialVNode);
        toggleRecurse(instance, false);
        if (bm) {
          invokeArrayFns(bm);
        }
        if (!isAsyncWrapperVNode && (vnodeHook = props && props.onVnodeBeforeMount)) {
          invokeVNodeHook(vnodeHook, parent, initialVNode);
        }
        toggleRecurse(instance, true);
        if (el && hydrateNode) {
          const hydrateSubTree = () => {
            instance.subTree = renderComponentRoot(instance);
            hydrateNode(
              el,
              instance.subTree,
              instance,
              parentSuspense,
              null
            );
          };
          if (isAsyncWrapperVNode && type2.__asyncHydrate) {
            type2.__asyncHydrate(
              el,
              instance,
              hydrateSubTree
            );
          } else {
            hydrateSubTree();
          }
        } else {
          if (root2.ce) {
            root2.ce._injectChildStyle(type2);
          }
          const subTree = instance.subTree = renderComponentRoot(instance);
          patch2(
            null,
            subTree,
            container,
            anchor,
            instance,
            parentSuspense,
            namespace
          );
          initialVNode.el = subTree.el;
        }
        if (m2) {
          queuePostRenderEffect(m2, parentSuspense);
        }
        if (!isAsyncWrapperVNode && (vnodeHook = props && props.onVnodeMounted)) {
          const scopedInitialVNode = initialVNode;
          queuePostRenderEffect(
            () => invokeVNodeHook(vnodeHook, parent, scopedInitialVNode),
            parentSuspense
          );
        }
        if (initialVNode.shapeFlag & 256 || parent && isAsyncWrapper(parent.vnode) && parent.vnode.shapeFlag & 256) {
          instance.a && queuePostRenderEffect(instance.a, parentSuspense);
        }
        instance.isMounted = true;
        initialVNode = container = anchor = null;
      } else {
        let { next, bu, u: u2, parent, vnode } = instance;
        {
          const nonHydratedAsyncRoot = locateNonHydratedAsyncRoot(instance);
          if (nonHydratedAsyncRoot) {
            if (next) {
              next.el = vnode.el;
              updateComponentPreRender(instance, next, optimized);
            }
            nonHydratedAsyncRoot.asyncDep.then(() => {
              if (!instance.isUnmounted) {
                componentUpdateFn();
              }
            });
            return;
          }
        }
        let originNext = next;
        let vnodeHook;
        toggleRecurse(instance, false);
        if (next) {
          next.el = vnode.el;
          updateComponentPreRender(instance, next, optimized);
        } else {
          next = vnode;
        }
        if (bu) {
          invokeArrayFns(bu);
        }
        if (vnodeHook = next.props && next.props.onVnodeBeforeUpdate) {
          invokeVNodeHook(vnodeHook, parent, next, vnode);
        }
        toggleRecurse(instance, true);
        const nextTree = renderComponentRoot(instance);
        const prevTree = instance.subTree;
        instance.subTree = nextTree;
        patch2(
          prevTree,
          nextTree,
          // parent may have changed if it's in a teleport
          hostParentNode(prevTree.el),
          // anchor may have changed if it's in a fragment
          getNextHostNode(prevTree),
          instance,
          parentSuspense,
          namespace
        );
        next.el = nextTree.el;
        if (originNext === null) {
          updateHOCHostEl(instance, nextTree.el);
        }
        if (u2) {
          queuePostRenderEffect(u2, parentSuspense);
        }
        if (vnodeHook = next.props && next.props.onVnodeUpdated) {
          queuePostRenderEffect(
            () => invokeVNodeHook(vnodeHook, parent, next, vnode),
            parentSuspense
          );
        }
      }
    };
    instance.scope.on();
    const effect2 = instance.effect = new ReactiveEffect(componentUpdateFn);
    instance.scope.off();
    const update = instance.update = effect2.run.bind(effect2);
    const job = instance.job = effect2.runIfDirty.bind(effect2);
    job.i = instance;
    job.id = instance.uid;
    effect2.scheduler = () => queueJob(job);
    toggleRecurse(instance, true);
    update();
  };
  const updateComponentPreRender = (instance, nextVNode, optimized) => {
    nextVNode.component = instance;
    const prevProps = instance.vnode.props;
    instance.vnode = nextVNode;
    instance.next = null;
    updateProps(instance, nextVNode.props, prevProps, optimized);
    updateSlots(instance, nextVNode.children, optimized);
    pauseTracking();
    flushPreFlushCbs(instance);
    resetTracking();
  };
  const patchChildren = (n1, n2, container, anchor, parentComponent, parentSuspense, namespace, slotScopeIds, optimized = false) => {
    const c1 = n1 && n1.children;
    const prevShapeFlag = n1 ? n1.shapeFlag : 0;
    const c2 = n2.children;
    const { patchFlag, shapeFlag } = n2;
    if (patchFlag > 0) {
      if (patchFlag & 128) {
        patchKeyedChildren(
          c1,
          c2,
          container,
          anchor,
          parentComponent,
          parentSuspense,
          namespace,
          slotScopeIds,
          optimized
        );
        return;
      } else if (patchFlag & 256) {
        patchUnkeyedChildren(
          c1,
          c2,
          container,
          anchor,
          parentComponent,
          parentSuspense,
          namespace,
          slotScopeIds,
          optimized
        );
        return;
      }
    }
    if (shapeFlag & 8) {
      if (prevShapeFlag & 16) {
        unmountChildren(c1, parentComponent, parentSuspense);
      }
      if (c2 !== c1) {
        hostSetElementText(container, c2);
      }
    } else {
      if (prevShapeFlag & 16) {
        if (shapeFlag & 16) {
          patchKeyedChildren(
            c1,
            c2,
            container,
            anchor,
            parentComponent,
            parentSuspense,
            namespace,
            slotScopeIds,
            optimized
          );
        } else {
          unmountChildren(c1, parentComponent, parentSuspense, true);
        }
      } else {
        if (prevShapeFlag & 8) {
          hostSetElementText(container, "");
        }
        if (shapeFlag & 16) {
          mountChildren(
            c2,
            container,
            anchor,
            parentComponent,
            parentSuspense,
            namespace,
            slotScopeIds,
            optimized
          );
        }
      }
    }
  };
  const patchUnkeyedChildren = (c1, c2, container, anchor, parentComponent, parentSuspense, namespace, slotScopeIds, optimized) => {
    c1 = c1 || EMPTY_ARR;
    c2 = c2 || EMPTY_ARR;
    const oldLength = c1.length;
    const newLength = c2.length;
    const commonLength = Math.min(oldLength, newLength);
    let i2;
    for (i2 = 0; i2 < commonLength; i2++) {
      const nextChild = c2[i2] = optimized ? cloneIfMounted(c2[i2]) : normalizeVNode(c2[i2]);
      patch2(
        c1[i2],
        nextChild,
        container,
        null,
        parentComponent,
        parentSuspense,
        namespace,
        slotScopeIds,
        optimized
      );
    }
    if (oldLength > newLength) {
      unmountChildren(
        c1,
        parentComponent,
        parentSuspense,
        true,
        false,
        commonLength
      );
    } else {
      mountChildren(
        c2,
        container,
        anchor,
        parentComponent,
        parentSuspense,
        namespace,
        slotScopeIds,
        optimized,
        commonLength
      );
    }
  };
  const patchKeyedChildren = (c1, c2, container, parentAnchor, parentComponent, parentSuspense, namespace, slotScopeIds, optimized) => {
    let i2 = 0;
    const l2 = c2.length;
    let e1 = c1.length - 1;
    let e2 = l2 - 1;
    while (i2 <= e1 && i2 <= e2) {
      const n1 = c1[i2];
      const n2 = c2[i2] = optimized ? cloneIfMounted(c2[i2]) : normalizeVNode(c2[i2]);
      if (isSameVNodeType(n1, n2)) {
        patch2(
          n1,
          n2,
          container,
          null,
          parentComponent,
          parentSuspense,
          namespace,
          slotScopeIds,
          optimized
        );
      } else {
        break;
      }
      i2++;
    }
    while (i2 <= e1 && i2 <= e2) {
      const n1 = c1[e1];
      const n2 = c2[e2] = optimized ? cloneIfMounted(c2[e2]) : normalizeVNode(c2[e2]);
      if (isSameVNodeType(n1, n2)) {
        patch2(
          n1,
          n2,
          container,
          null,
          parentComponent,
          parentSuspense,
          namespace,
          slotScopeIds,
          optimized
        );
      } else {
        break;
      }
      e1--;
      e2--;
    }
    if (i2 > e1) {
      if (i2 <= e2) {
        const nextPos = e2 + 1;
        const anchor = nextPos < l2 ? c2[nextPos].el : parentAnchor;
        while (i2 <= e2) {
          patch2(
            null,
            c2[i2] = optimized ? cloneIfMounted(c2[i2]) : normalizeVNode(c2[i2]),
            container,
            anchor,
            parentComponent,
            parentSuspense,
            namespace,
            slotScopeIds,
            optimized
          );
          i2++;
        }
      }
    } else if (i2 > e2) {
      while (i2 <= e1) {
        unmount(c1[i2], parentComponent, parentSuspense, true);
        i2++;
      }
    } else {
      const s1 = i2;
      const s22 = i2;
      const keyToNewIndexMap = /* @__PURE__ */ new Map();
      for (i2 = s22; i2 <= e2; i2++) {
        const nextChild = c2[i2] = optimized ? cloneIfMounted(c2[i2]) : normalizeVNode(c2[i2]);
        if (nextChild.key != null) {
          keyToNewIndexMap.set(nextChild.key, i2);
        }
      }
      let j2;
      let patched = 0;
      const toBePatched = e2 - s22 + 1;
      let moved = false;
      let maxNewIndexSoFar = 0;
      const newIndexToOldIndexMap = new Array(toBePatched);
      for (i2 = 0; i2 < toBePatched; i2++) newIndexToOldIndexMap[i2] = 0;
      for (i2 = s1; i2 <= e1; i2++) {
        const prevChild = c1[i2];
        if (patched >= toBePatched) {
          unmount(prevChild, parentComponent, parentSuspense, true);
          continue;
        }
        let newIndex;
        if (prevChild.key != null) {
          newIndex = keyToNewIndexMap.get(prevChild.key);
        } else {
          for (j2 = s22; j2 <= e2; j2++) {
            if (newIndexToOldIndexMap[j2 - s22] === 0 && isSameVNodeType(prevChild, c2[j2])) {
              newIndex = j2;
              break;
            }
          }
        }
        if (newIndex === void 0) {
          unmount(prevChild, parentComponent, parentSuspense, true);
        } else {
          newIndexToOldIndexMap[newIndex - s22] = i2 + 1;
          if (newIndex >= maxNewIndexSoFar) {
            maxNewIndexSoFar = newIndex;
          } else {
            moved = true;
          }
          patch2(
            prevChild,
            c2[newIndex],
            container,
            null,
            parentComponent,
            parentSuspense,
            namespace,
            slotScopeIds,
            optimized
          );
          patched++;
        }
      }
      const increasingNewIndexSequence = moved ? getSequence(newIndexToOldIndexMap) : EMPTY_ARR;
      j2 = increasingNewIndexSequence.length - 1;
      for (i2 = toBePatched - 1; i2 >= 0; i2--) {
        const nextIndex = s22 + i2;
        const nextChild = c2[nextIndex];
        const anchor = nextIndex + 1 < l2 ? c2[nextIndex + 1].el : parentAnchor;
        if (newIndexToOldIndexMap[i2] === 0) {
          patch2(
            null,
            nextChild,
            container,
            anchor,
            parentComponent,
            parentSuspense,
            namespace,
            slotScopeIds,
            optimized
          );
        } else if (moved) {
          if (j2 < 0 || i2 !== increasingNewIndexSequence[j2]) {
            move(nextChild, container, anchor, 2);
          } else {
            j2--;
          }
        }
      }
    }
  };
  const move = (vnode, container, anchor, moveType, parentSuspense = null) => {
    const { el, type: type2, transition, children, shapeFlag } = vnode;
    if (shapeFlag & 6) {
      move(vnode.component.subTree, container, anchor, moveType);
      return;
    }
    if (shapeFlag & 128) {
      vnode.suspense.move(container, anchor, moveType);
      return;
    }
    if (shapeFlag & 64) {
      type2.move(vnode, container, anchor, internals);
      return;
    }
    if (type2 === Fragment) {
      hostInsert(el, container, anchor);
      for (let i2 = 0; i2 < children.length; i2++) {
        move(children[i2], container, anchor, moveType);
      }
      hostInsert(vnode.anchor, container, anchor);
      return;
    }
    if (type2 === Static) {
      moveStaticNode(vnode, container, anchor);
      return;
    }
    const needTransition2 = moveType !== 2 && shapeFlag & 1 && transition;
    if (needTransition2) {
      if (moveType === 0) {
        transition.beforeEnter(el);
        hostInsert(el, container, anchor);
        queuePostRenderEffect(() => transition.enter(el), parentSuspense);
      } else {
        const { leave, delayLeave, afterLeave } = transition;
        const remove22 = () => hostInsert(el, container, anchor);
        const performLeave = () => {
          leave(el, () => {
            remove22();
            afterLeave && afterLeave();
          });
        };
        if (delayLeave) {
          delayLeave(el, remove22, performLeave);
        } else {
          performLeave();
        }
      }
    } else {
      hostInsert(el, container, anchor);
    }
  };
  const unmount = (vnode, parentComponent, parentSuspense, doRemove = false, optimized = false) => {
    const {
      type: type2,
      props,
      ref: ref3,
      children,
      dynamicChildren,
      shapeFlag,
      patchFlag,
      dirs,
      cacheIndex
    } = vnode;
    if (patchFlag === -2) {
      optimized = false;
    }
    if (ref3 != null) {
      setRef(ref3, null, parentSuspense, vnode, true);
    }
    if (cacheIndex != null) {
      parentComponent.renderCache[cacheIndex] = void 0;
    }
    if (shapeFlag & 256) {
      parentComponent.ctx.deactivate(vnode);
      return;
    }
    const shouldInvokeDirs = shapeFlag & 1 && dirs;
    const shouldInvokeVnodeHook = !isAsyncWrapper(vnode);
    let vnodeHook;
    if (shouldInvokeVnodeHook && (vnodeHook = props && props.onVnodeBeforeUnmount)) {
      invokeVNodeHook(vnodeHook, parentComponent, vnode);
    }
    if (shapeFlag & 6) {
      unmountComponent(vnode.component, parentSuspense, doRemove);
    } else {
      if (shapeFlag & 128) {
        vnode.suspense.unmount(parentSuspense, doRemove);
        return;
      }
      if (shouldInvokeDirs) {
        invokeDirectiveHook(vnode, null, parentComponent, "beforeUnmount");
      }
      if (shapeFlag & 64) {
        vnode.type.remove(
          vnode,
          parentComponent,
          parentSuspense,
          internals,
          doRemove
        );
      } else if (dynamicChildren && // #5154
      // when v-once is used inside a block, setBlockTracking(-1) marks the
      // parent block with hasOnce: true
      // so that it doesn't take the fast path during unmount - otherwise
      // components nested in v-once are never unmounted.
      !dynamicChildren.hasOnce && // #1153: fast path should not be taken for non-stable (v-for) fragments
      (type2 !== Fragment || patchFlag > 0 && patchFlag & 64)) {
        unmountChildren(
          dynamicChildren,
          parentComponent,
          parentSuspense,
          false,
          true
        );
      } else if (type2 === Fragment && patchFlag & (128 | 256) || !optimized && shapeFlag & 16) {
        unmountChildren(children, parentComponent, parentSuspense);
      }
      if (doRemove) {
        remove2(vnode);
      }
    }
    if (shouldInvokeVnodeHook && (vnodeHook = props && props.onVnodeUnmounted) || shouldInvokeDirs) {
      queuePostRenderEffect(() => {
        vnodeHook && invokeVNodeHook(vnodeHook, parentComponent, vnode);
        shouldInvokeDirs && invokeDirectiveHook(vnode, null, parentComponent, "unmounted");
      }, parentSuspense);
    }
  };
  const remove2 = (vnode) => {
    const { type: type2, el, anchor, transition } = vnode;
    if (type2 === Fragment) {
      {
        removeFragment(el, anchor);
      }
      return;
    }
    if (type2 === Static) {
      removeStaticNode(vnode);
      return;
    }
    const performRemove = () => {
      hostRemove(el);
      if (transition && !transition.persisted && transition.afterLeave) {
        transition.afterLeave();
      }
    };
    if (vnode.shapeFlag & 1 && transition && !transition.persisted) {
      const { leave, delayLeave } = transition;
      const performLeave = () => leave(el, performRemove);
      if (delayLeave) {
        delayLeave(vnode.el, performRemove, performLeave);
      } else {
        performLeave();
      }
    } else {
      performRemove();
    }
  };
  const removeFragment = (cur2, end) => {
    let next;
    while (cur2 !== end) {
      next = hostNextSibling(cur2);
      hostRemove(cur2);
      cur2 = next;
    }
    hostRemove(end);
  };
  const unmountComponent = (instance, parentSuspense, doRemove) => {
    const { bum, scope, job, subTree, um, m: m2, a: a2 } = instance;
    invalidateMount(m2);
    invalidateMount(a2);
    if (bum) {
      invokeArrayFns(bum);
    }
    scope.stop();
    if (job) {
      job.flags |= 8;
      unmount(subTree, instance, parentSuspense, doRemove);
    }
    if (um) {
      queuePostRenderEffect(um, parentSuspense);
    }
    queuePostRenderEffect(() => {
      instance.isUnmounted = true;
    }, parentSuspense);
    if (parentSuspense && parentSuspense.pendingBranch && !parentSuspense.isUnmounted && instance.asyncDep && !instance.asyncResolved && instance.suspenseId === parentSuspense.pendingId) {
      parentSuspense.deps--;
      if (parentSuspense.deps === 0) {
        parentSuspense.resolve();
      }
    }
  };
  const unmountChildren = (children, parentComponent, parentSuspense, doRemove = false, optimized = false, start = 0) => {
    for (let i2 = start; i2 < children.length; i2++) {
      unmount(children[i2], parentComponent, parentSuspense, doRemove, optimized);
    }
  };
  const getNextHostNode = (vnode) => {
    if (vnode.shapeFlag & 6) {
      return getNextHostNode(vnode.component.subTree);
    }
    if (vnode.shapeFlag & 128) {
      return vnode.suspense.next();
    }
    const el = hostNextSibling(vnode.anchor || vnode.el);
    const teleportEnd = el && el[TeleportEndKey];
    return teleportEnd ? hostNextSibling(teleportEnd) : el;
  };
  let isFlushing = false;
  const render2 = (vnode, container, namespace) => {
    if (vnode == null) {
      if (container._vnode) {
        unmount(container._vnode, null, null, true);
      }
    } else {
      patch2(
        container._vnode || null,
        vnode,
        container,
        null,
        null,
        null,
        namespace
      );
    }
    container._vnode = vnode;
    if (!isFlushing) {
      isFlushing = true;
      flushPreFlushCbs();
      flushPostFlushCbs();
      isFlushing = false;
    }
  };
  const internals = {
    p: patch2,
    um: unmount,
    m: move,
    r: remove2,
    mt: mountComponent,
    mc: mountChildren,
    pc: patchChildren,
    pbc: patchBlockChildren,
    n: getNextHostNode,
    o: options
  };
  let hydrate;
  let hydrateNode;
  return {
    render: render2,
    hydrate,
    createApp: createAppAPI(render2, hydrate)
  };
}
function resolveChildrenNamespace({ type: type2, props }, currentNamespace) {
  return currentNamespace === "svg" && type2 === "foreignObject" || currentNamespace === "mathml" && type2 === "annotation-xml" && props && props.encoding && props.encoding.includes("html") ? void 0 : currentNamespace;
}
function toggleRecurse({ effect: effect2, job }, allowed) {
  if (allowed) {
    effect2.flags |= 32;
    job.flags |= 4;
  } else {
    effect2.flags &= ~32;
    job.flags &= ~4;
  }
}
function needTransition(parentSuspense, transition) {
  return (!parentSuspense || parentSuspense && !parentSuspense.pendingBranch) && transition && !transition.persisted;
}
function traverseStaticChildren(n1, n2, shallow = false) {
  const ch1 = n1.children;
  const ch2 = n2.children;
  if (isArray$3(ch1) && isArray$3(ch2)) {
    for (let i2 = 0; i2 < ch1.length; i2++) {
      const c1 = ch1[i2];
      let c2 = ch2[i2];
      if (c2.shapeFlag & 1 && !c2.dynamicChildren) {
        if (c2.patchFlag <= 0 || c2.patchFlag === 32) {
          c2 = ch2[i2] = cloneIfMounted(ch2[i2]);
          c2.el = c1.el;
        }
        if (!shallow && c2.patchFlag !== -2)
          traverseStaticChildren(c1, c2);
      }
      if (c2.type === Text$1) {
        c2.el = c1.el;
      }
    }
  }
}
function getSequence(arr) {
  const p2 = arr.slice();
  const result = [0];
  let i2, j2, u2, v2, c2;
  const len = arr.length;
  for (i2 = 0; i2 < len; i2++) {
    const arrI = arr[i2];
    if (arrI !== 0) {
      j2 = result[result.length - 1];
      if (arr[j2] < arrI) {
        p2[i2] = j2;
        result.push(i2);
        continue;
      }
      u2 = 0;
      v2 = result.length - 1;
      while (u2 < v2) {
        c2 = u2 + v2 >> 1;
        if (arr[result[c2]] < arrI) {
          u2 = c2 + 1;
        } else {
          v2 = c2;
        }
      }
      if (arrI < arr[result[u2]]) {
        if (u2 > 0) {
          p2[i2] = result[u2 - 1];
        }
        result[u2] = i2;
      }
    }
  }
  u2 = result.length;
  v2 = result[u2 - 1];
  while (u2-- > 0) {
    result[u2] = v2;
    v2 = p2[v2];
  }
  return result;
}
function locateNonHydratedAsyncRoot(instance) {
  const subComponent = instance.subTree.component;
  if (subComponent) {
    if (subComponent.asyncDep && !subComponent.asyncResolved) {
      return subComponent;
    } else {
      return locateNonHydratedAsyncRoot(subComponent);
    }
  }
}
function invalidateMount(hooks) {
  if (hooks) {
    for (let i2 = 0; i2 < hooks.length; i2++)
      hooks[i2].flags |= 8;
  }
}
const ssrContextKey = Symbol.for("v-scx");
const useSSRContext = () => {
  {
    const ctx = inject(ssrContextKey);
    return ctx;
  }
};
function watchEffect(effect2, options) {
  return doWatch(effect2, null, options);
}
function watchPostEffect(effect2, options) {
  return doWatch(
    effect2,
    null,
    { flush: "post" }
  );
}
function watch(source2, cb, options) {
  return doWatch(source2, cb, options);
}
function doWatch(source2, cb, options = EMPTY_OBJ) {
  const { immediate, deep, flush, once } = options;
  const baseWatchOptions = extend$3({}, options);
  const runsImmediately = cb && immediate || !cb && flush !== "post";
  let ssrCleanup;
  if (isInSSRComponentSetup) {
    if (flush === "sync") {
      const ctx = useSSRContext();
      ssrCleanup = ctx.__watcherHandles || (ctx.__watcherHandles = []);
    } else if (!runsImmediately) {
      const watchStopHandle = () => {
      };
      watchStopHandle.stop = NOOP;
      watchStopHandle.resume = NOOP;
      watchStopHandle.pause = NOOP;
      return watchStopHandle;
    }
  }
  const instance = currentInstance;
  baseWatchOptions.call = (fn, type2, args) => callWithAsyncErrorHandling(fn, instance, type2, args);
  let isPre = false;
  if (flush === "post") {
    baseWatchOptions.scheduler = (job) => {
      queuePostRenderEffect(job, instance && instance.suspense);
    };
  } else if (flush !== "sync") {
    isPre = true;
    baseWatchOptions.scheduler = (job, isFirstRun) => {
      if (isFirstRun) {
        job();
      } else {
        queueJob(job);
      }
    };
  }
  baseWatchOptions.augmentJob = (job) => {
    if (cb) {
      job.flags |= 4;
    }
    if (isPre) {
      job.flags |= 2;
      if (instance) {
        job.id = instance.uid;
        job.i = instance;
      }
    }
  };
  const watchHandle = watch$1(source2, cb, baseWatchOptions);
  if (isInSSRComponentSetup) {
    if (ssrCleanup) {
      ssrCleanup.push(watchHandle);
    } else if (runsImmediately) {
      watchHandle();
    }
  }
  return watchHandle;
}
function instanceWatch(source2, value, options) {
  const publicThis = this.proxy;
  const getter = isString$1(source2) ? source2.includes(".") ? createPathGetter(publicThis, source2) : () => publicThis[source2] : source2.bind(publicThis, publicThis);
  let cb;
  if (isFunction(value)) {
    cb = value;
  } else {
    cb = value.handler;
    options = value;
  }
  const reset = setCurrentInstance(this);
  const res = doWatch(getter, cb.bind(publicThis), options);
  reset();
  return res;
}
function createPathGetter(ctx, path2) {
  const segments = path2.split(".");
  return () => {
    let cur2 = ctx;
    for (let i2 = 0; i2 < segments.length && cur2; i2++) {
      cur2 = cur2[segments[i2]];
    }
    return cur2;
  };
}
const getModelModifiers = (props, modelName) => {
  return modelName === "modelValue" || modelName === "model-value" ? props.modelModifiers : props[`${modelName}Modifiers`] || props[`${camelize(modelName)}Modifiers`] || props[`${hyphenate(modelName)}Modifiers`];
};
function emit(instance, event, ...rawArgs) {
  if (instance.isUnmounted) return;
  const props = instance.vnode.props || EMPTY_OBJ;
  let args = rawArgs;
  const isModelListener2 = event.startsWith("update:");
  const modifiers2 = isModelListener2 && getModelModifiers(props, event.slice(7));
  if (modifiers2) {
    if (modifiers2.trim) {
      args = rawArgs.map((a2) => isString$1(a2) ? a2.trim() : a2);
    }
    if (modifiers2.number) {
      args = rawArgs.map(looseToNumber);
    }
  }
  let handlerName;
  let handler = props[handlerName = toHandlerKey(event)] || // also try camelCase event handler (#2249)
  props[handlerName = toHandlerKey(camelize(event))];
  if (!handler && isModelListener2) {
    handler = props[handlerName = toHandlerKey(hyphenate(event))];
  }
  if (handler) {
    callWithAsyncErrorHandling(
      handler,
      instance,
      6,
      args
    );
  }
  const onceHandler = props[handlerName + `Once`];
  if (onceHandler) {
    if (!instance.emitted) {
      instance.emitted = {};
    } else if (instance.emitted[handlerName]) {
      return;
    }
    instance.emitted[handlerName] = true;
    callWithAsyncErrorHandling(
      onceHandler,
      instance,
      6,
      args
    );
  }
}
function normalizeEmitsOptions(comp, appContext, asMixin = false) {
  const cache2 = appContext.emitsCache;
  const cached = cache2.get(comp);
  if (cached !== void 0) {
    return cached;
  }
  const raw2 = comp.emits;
  let normalized = {};
  let hasExtends = false;
  if (!isFunction(comp)) {
    const extendEmits = (raw22) => {
      const normalizedFromExtend = normalizeEmitsOptions(raw22, appContext, true);
      if (normalizedFromExtend) {
        hasExtends = true;
        extend$3(normalized, normalizedFromExtend);
      }
    };
    if (!asMixin && appContext.mixins.length) {
      appContext.mixins.forEach(extendEmits);
    }
    if (comp.extends) {
      extendEmits(comp.extends);
    }
    if (comp.mixins) {
      comp.mixins.forEach(extendEmits);
    }
  }
  if (!raw2 && !hasExtends) {
    if (isObject$2(comp)) {
      cache2.set(comp, null);
    }
    return null;
  }
  if (isArray$3(raw2)) {
    raw2.forEach((key2) => normalized[key2] = null);
  } else {
    extend$3(normalized, raw2);
  }
  if (isObject$2(comp)) {
    cache2.set(comp, normalized);
  }
  return normalized;
}
function isEmitListener(options, key2) {
  if (!options || !isOn(key2)) {
    return false;
  }
  key2 = key2.slice(2).replace(/Once$/, "");
  return hasOwn$2(options, key2[0].toLowerCase() + key2.slice(1)) || hasOwn$2(options, hyphenate(key2)) || hasOwn$2(options, key2);
}
function markAttrsAccessed() {
}
function renderComponentRoot(instance) {
  const {
    type: Component,
    vnode,
    proxy,
    withProxy,
    propsOptions: [propsOptions],
    slots,
    attrs,
    emit: emit2,
    render: render2,
    renderCache,
    props,
    data,
    setupState,
    ctx,
    inheritAttrs
  } = instance;
  const prev = setCurrentRenderingInstance(instance);
  let result;
  let fallthroughAttrs;
  try {
    if (vnode.shapeFlag & 4) {
      const proxyToUse = withProxy || proxy;
      const thisProxy = false ? new Proxy(proxyToUse, {
        get(target, key2, receiver) {
          warn$1$1(
            `Property '${String(
              key2
            )}' was accessed via 'this'. Avoid using 'this' in templates.`
          );
          return Reflect.get(target, key2, receiver);
        }
      }) : proxyToUse;
      result = normalizeVNode(
        render2.call(
          thisProxy,
          proxyToUse,
          renderCache,
          false ? shallowReadonly(props) : props,
          setupState,
          data,
          ctx
        )
      );
      fallthroughAttrs = attrs;
    } else {
      const render22 = Component;
      if (false) ;
      result = normalizeVNode(
        render22.length > 1 ? render22(
          false ? shallowReadonly(props) : props,
          false ? {
            get attrs() {
              markAttrsAccessed();
              return shallowReadonly(attrs);
            },
            slots,
            emit: emit2
          } : { attrs, slots, emit: emit2 }
        ) : render22(
          false ? shallowReadonly(props) : props,
          null
        )
      );
      fallthroughAttrs = Component.props ? attrs : getFunctionalFallthrough(attrs);
    }
  } catch (err) {
    blockStack.length = 0;
    handleError(err, instance, 1);
    result = createVNode(Comment);
  }
  let root2 = result;
  if (fallthroughAttrs && inheritAttrs !== false) {
    const keys2 = Object.keys(fallthroughAttrs);
    const { shapeFlag } = root2;
    if (keys2.length) {
      if (shapeFlag & (1 | 6)) {
        if (propsOptions && keys2.some(isModelListener)) {
          fallthroughAttrs = filterModelListeners(
            fallthroughAttrs,
            propsOptions
          );
        }
        root2 = cloneVNode(root2, fallthroughAttrs, false, true);
      }
    }
  }
  if (vnode.dirs) {
    root2 = cloneVNode(root2, null, false, true);
    root2.dirs = root2.dirs ? root2.dirs.concat(vnode.dirs) : vnode.dirs;
  }
  if (vnode.transition) {
    setTransitionHooks(root2, vnode.transition);
  }
  {
    result = root2;
  }
  setCurrentRenderingInstance(prev);
  return result;
}
const getFunctionalFallthrough = (attrs) => {
  let res;
  for (const key2 in attrs) {
    if (key2 === "class" || key2 === "style" || isOn(key2)) {
      (res || (res = {}))[key2] = attrs[key2];
    }
  }
  return res;
};
const filterModelListeners = (attrs, props) => {
  const res = {};
  for (const key2 in attrs) {
    if (!isModelListener(key2) || !(key2.slice(9) in props)) {
      res[key2] = attrs[key2];
    }
  }
  return res;
};
function shouldUpdateComponent(prevVNode, nextVNode, optimized) {
  const { props: prevProps, children: prevChildren, component } = prevVNode;
  const { props: nextProps, children: nextChildren, patchFlag } = nextVNode;
  const emits = component.emitsOptions;
  if (nextVNode.dirs || nextVNode.transition) {
    return true;
  }
  if (optimized && patchFlag >= 0) {
    if (patchFlag & 1024) {
      return true;
    }
    if (patchFlag & 16) {
      if (!prevProps) {
        return !!nextProps;
      }
      return hasPropsChanged(prevProps, nextProps, emits);
    } else if (patchFlag & 8) {
      const dynamicProps = nextVNode.dynamicProps;
      for (let i2 = 0; i2 < dynamicProps.length; i2++) {
        const key2 = dynamicProps[i2];
        if (nextProps[key2] !== prevProps[key2] && !isEmitListener(emits, key2)) {
          return true;
        }
      }
    }
  } else {
    if (prevChildren || nextChildren) {
      if (!nextChildren || !nextChildren.$stable) {
        return true;
      }
    }
    if (prevProps === nextProps) {
      return false;
    }
    if (!prevProps) {
      return !!nextProps;
    }
    if (!nextProps) {
      return true;
    }
    return hasPropsChanged(prevProps, nextProps, emits);
  }
  return false;
}
function hasPropsChanged(prevProps, nextProps, emitsOptions) {
  const nextKeys = Object.keys(nextProps);
  if (nextKeys.length !== Object.keys(prevProps).length) {
    return true;
  }
  for (let i2 = 0; i2 < nextKeys.length; i2++) {
    const key2 = nextKeys[i2];
    if (nextProps[key2] !== prevProps[key2] && !isEmitListener(emitsOptions, key2)) {
      return true;
    }
  }
  return false;
}
function updateHOCHostEl({ vnode, parent }, el) {
  while (parent) {
    const root2 = parent.subTree;
    if (root2.suspense && root2.suspense.activeBranch === vnode) {
      root2.el = vnode.el;
    }
    if (root2 === vnode) {
      (vnode = parent.vnode).el = el;
      parent = parent.parent;
    } else {
      break;
    }
  }
}
const isSuspense = (type2) => type2.__isSuspense;
function queueEffectWithSuspense(fn, suspense) {
  if (suspense && suspense.pendingBranch) {
    if (isArray$3(fn)) {
      suspense.effects.push(...fn);
    } else {
      suspense.effects.push(fn);
    }
  } else {
    queuePostFlushCb(fn);
  }
}
const Fragment = Symbol.for("v-fgt");
const Text$1 = Symbol.for("v-txt");
const Comment = Symbol.for("v-cmt");
const Static = Symbol.for("v-stc");
const blockStack = [];
let currentBlock = null;
function openBlock(disableTracking = false) {
  blockStack.push(currentBlock = disableTracking ? null : []);
}
function closeBlock() {
  blockStack.pop();
  currentBlock = blockStack[blockStack.length - 1] || null;
}
let isBlockTreeEnabled = 1;
function setBlockTracking(value) {
  isBlockTreeEnabled += value;
  if (value < 0 && currentBlock) {
    currentBlock.hasOnce = true;
  }
}
function setupBlock(vnode) {
  vnode.dynamicChildren = isBlockTreeEnabled > 0 ? currentBlock || EMPTY_ARR : null;
  closeBlock();
  if (isBlockTreeEnabled > 0 && currentBlock) {
    currentBlock.push(vnode);
  }
  return vnode;
}
function createElementBlock(type2, props, children, patchFlag, dynamicProps, shapeFlag) {
  return setupBlock(
    createBaseVNode(
      type2,
      props,
      children,
      patchFlag,
      dynamicProps,
      shapeFlag,
      true
    )
  );
}
function createBlock(type2, props, children, patchFlag, dynamicProps) {
  return setupBlock(
    createVNode(
      type2,
      props,
      children,
      patchFlag,
      dynamicProps,
      true
    )
  );
}
function isVNode(value) {
  return value ? value.__v_isVNode === true : false;
}
function isSameVNodeType(n1, n2) {
  return n1.type === n2.type && n1.key === n2.key;
}
const normalizeKey = ({ key: key2 }) => key2 != null ? key2 : null;
const normalizeRef = ({
  ref: ref3,
  ref_key,
  ref_for
}) => {
  if (typeof ref3 === "number") {
    ref3 = "" + ref3;
  }
  return ref3 != null ? isString$1(ref3) || isRef(ref3) || isFunction(ref3) ? { i: currentRenderingInstance, r: ref3, k: ref_key, f: !!ref_for } : ref3 : null;
};
function createBaseVNode(type2, props = null, children = null, patchFlag = 0, dynamicProps = null, shapeFlag = type2 === Fragment ? 0 : 1, isBlockNode = false, needFullChildrenNormalization = false) {
  const vnode = {
    __v_isVNode: true,
    __v_skip: true,
    type: type2,
    props,
    key: props && normalizeKey(props),
    ref: props && normalizeRef(props),
    scopeId: currentScopeId,
    slotScopeIds: null,
    children,
    component: null,
    suspense: null,
    ssContent: null,
    ssFallback: null,
    dirs: null,
    transition: null,
    el: null,
    anchor: null,
    target: null,
    targetStart: null,
    targetAnchor: null,
    staticCount: 0,
    shapeFlag,
    patchFlag,
    dynamicProps,
    dynamicChildren: null,
    appContext: null,
    ctx: currentRenderingInstance
  };
  if (needFullChildrenNormalization) {
    normalizeChildren(vnode, children);
    if (shapeFlag & 128) {
      type2.normalize(vnode);
    }
  } else if (children) {
    vnode.shapeFlag |= isString$1(children) ? 8 : 16;
  }
  if (isBlockTreeEnabled > 0 && // avoid a block node from tracking itself
  !isBlockNode && // has current parent block
  currentBlock && // presence of a patch flag indicates this node needs patching on updates.
  // component nodes also should always be patched, because even if the
  // component doesn't need to update, it needs to persist the instance on to
  // the next vnode so that it can be properly unmounted later.
  (vnode.patchFlag > 0 || shapeFlag & 6) && // the EVENTS flag is only for hydration and if it is the only flag, the
  // vnode should not be considered dynamic due to handler caching.
  vnode.patchFlag !== 32) {
    currentBlock.push(vnode);
  }
  return vnode;
}
const createVNode = _createVNode;
function _createVNode(type2, props = null, children = null, patchFlag = 0, dynamicProps = null, isBlockNode = false) {
  if (!type2 || type2 === NULL_DYNAMIC_COMPONENT) {
    type2 = Comment;
  }
  if (isVNode(type2)) {
    const cloned = cloneVNode(
      type2,
      props,
      true
      /* mergeRef: true */
    );
    if (children) {
      normalizeChildren(cloned, children);
    }
    if (isBlockTreeEnabled > 0 && !isBlockNode && currentBlock) {
      if (cloned.shapeFlag & 6) {
        currentBlock[currentBlock.indexOf(type2)] = cloned;
      } else {
        currentBlock.push(cloned);
      }
    }
    cloned.patchFlag = -2;
    return cloned;
  }
  if (isClassComponent(type2)) {
    type2 = type2.__vccOpts;
  }
  if (props) {
    props = guardReactiveProps(props);
    let { class: klass, style: style2 } = props;
    if (klass && !isString$1(klass)) {
      props.class = normalizeClass(klass);
    }
    if (isObject$2(style2)) {
      if (isProxy(style2) && !isArray$3(style2)) {
        style2 = extend$3({}, style2);
      }
      props.style = normalizeStyle(style2);
    }
  }
  const shapeFlag = isString$1(type2) ? 1 : isSuspense(type2) ? 128 : isTeleport(type2) ? 64 : isObject$2(type2) ? 4 : isFunction(type2) ? 2 : 0;
  return createBaseVNode(
    type2,
    props,
    children,
    patchFlag,
    dynamicProps,
    shapeFlag,
    isBlockNode,
    true
  );
}
function guardReactiveProps(props) {
  if (!props) return null;
  return isProxy(props) || isInternalObject(props) ? extend$3({}, props) : props;
}
function cloneVNode(vnode, extraProps, mergeRef = false, cloneTransition = false) {
  const { props, ref: ref3, patchFlag, children, transition } = vnode;
  const mergedProps = extraProps ? mergeProps(props || {}, extraProps) : props;
  const cloned = {
    __v_isVNode: true,
    __v_skip: true,
    type: vnode.type,
    props: mergedProps,
    key: mergedProps && normalizeKey(mergedProps),
    ref: extraProps && extraProps.ref ? (
      // #2078 in the case of <component :is="vnode" ref="extra"/>
      // if the vnode itself already has a ref, cloneVNode will need to merge
      // the refs so the single vnode can be set on multiple refs
      mergeRef && ref3 ? isArray$3(ref3) ? ref3.concat(normalizeRef(extraProps)) : [ref3, normalizeRef(extraProps)] : normalizeRef(extraProps)
    ) : ref3,
    scopeId: vnode.scopeId,
    slotScopeIds: vnode.slotScopeIds,
    children,
    target: vnode.target,
    targetStart: vnode.targetStart,
    targetAnchor: vnode.targetAnchor,
    staticCount: vnode.staticCount,
    shapeFlag: vnode.shapeFlag,
    // if the vnode is cloned with extra props, we can no longer assume its
    // existing patch flag to be reliable and need to add the FULL_PROPS flag.
    // note: preserve flag for fragments since they use the flag for children
    // fast paths only.
    patchFlag: extraProps && vnode.type !== Fragment ? patchFlag === -1 ? 16 : patchFlag | 16 : patchFlag,
    dynamicProps: vnode.dynamicProps,
    dynamicChildren: vnode.dynamicChildren,
    appContext: vnode.appContext,
    dirs: vnode.dirs,
    transition,
    // These should technically only be non-null on mounted VNodes. However,
    // they *should* be copied for kept-alive vnodes. So we just always copy
    // them since them being non-null during a mount doesn't affect the logic as
    // they will simply be overwritten.
    component: vnode.component,
    suspense: vnode.suspense,
    ssContent: vnode.ssContent && cloneVNode(vnode.ssContent),
    ssFallback: vnode.ssFallback && cloneVNode(vnode.ssFallback),
    el: vnode.el,
    anchor: vnode.anchor,
    ctx: vnode.ctx,
    ce: vnode.ce
  };
  if (transition && cloneTransition) {
    setTransitionHooks(
      cloned,
      transition.clone(cloned)
    );
  }
  return cloned;
}
function createTextVNode(text2 = " ", flag = 0) {
  return createVNode(Text$1, null, text2, flag);
}
function createStaticVNode(content2, numberOfNodes) {
  const vnode = createVNode(Static, null, content2);
  vnode.staticCount = numberOfNodes;
  return vnode;
}
function createCommentVNode(text2 = "", asBlock = false) {
  return asBlock ? (openBlock(), createBlock(Comment, null, text2)) : createVNode(Comment, null, text2);
}
function normalizeVNode(child) {
  if (child == null || typeof child === "boolean") {
    return createVNode(Comment);
  } else if (isArray$3(child)) {
    return createVNode(
      Fragment,
      null,
      // #3666, avoid reference pollution when reusing vnode
      child.slice()
    );
  } else if (isVNode(child)) {
    return cloneIfMounted(child);
  } else {
    return createVNode(Text$1, null, String(child));
  }
}
function cloneIfMounted(child) {
  return child.el === null && child.patchFlag !== -1 || child.memo ? child : cloneVNode(child);
}
function normalizeChildren(vnode, children) {
  let type2 = 0;
  const { shapeFlag } = vnode;
  if (children == null) {
    children = null;
  } else if (isArray$3(children)) {
    type2 = 16;
  } else if (typeof children === "object") {
    if (shapeFlag & (1 | 64)) {
      const slot = children.default;
      if (slot) {
        slot._c && (slot._d = false);
        normalizeChildren(vnode, slot());
        slot._c && (slot._d = true);
      }
      return;
    } else {
      type2 = 32;
      const slotFlag = children._;
      if (!slotFlag && !isInternalObject(children)) {
        children._ctx = currentRenderingInstance;
      } else if (slotFlag === 3 && currentRenderingInstance) {
        if (currentRenderingInstance.slots._ === 1) {
          children._ = 1;
        } else {
          children._ = 2;
          vnode.patchFlag |= 1024;
        }
      }
    }
  } else if (isFunction(children)) {
    children = { default: children, _ctx: currentRenderingInstance };
    type2 = 32;
  } else {
    children = String(children);
    if (shapeFlag & 64) {
      type2 = 16;
      children = [createTextVNode(children)];
    } else {
      type2 = 8;
    }
  }
  vnode.children = children;
  vnode.shapeFlag |= type2;
}
function mergeProps(...args) {
  const ret = {};
  for (let i2 = 0; i2 < args.length; i2++) {
    const toMerge = args[i2];
    for (const key2 in toMerge) {
      if (key2 === "class") {
        if (ret.class !== toMerge.class) {
          ret.class = normalizeClass([ret.class, toMerge.class]);
        }
      } else if (key2 === "style") {
        ret.style = normalizeStyle([ret.style, toMerge.style]);
      } else if (isOn(key2)) {
        const existing = ret[key2];
        const incoming = toMerge[key2];
        if (incoming && existing !== incoming && !(isArray$3(existing) && existing.includes(incoming))) {
          ret[key2] = existing ? [].concat(existing, incoming) : incoming;
        }
      } else if (key2 !== "") {
        ret[key2] = toMerge[key2];
      }
    }
  }
  return ret;
}
function invokeVNodeHook(hook, instance, vnode, prevVNode = null) {
  callWithAsyncErrorHandling(hook, instance, 7, [
    vnode,
    prevVNode
  ]);
}
const emptyAppContext = createAppContext();
let uid = 0;
function createComponentInstance(vnode, parent, suspense) {
  const type2 = vnode.type;
  const appContext = (parent ? parent.appContext : vnode.appContext) || emptyAppContext;
  const instance = {
    uid: uid++,
    vnode,
    type: type2,
    parent,
    appContext,
    root: null,
    // to be immediately set
    next: null,
    subTree: null,
    // will be set synchronously right after creation
    effect: null,
    update: null,
    // will be set synchronously right after creation
    job: null,
    scope: new EffectScope(
      true
      /* detached */
    ),
    render: null,
    proxy: null,
    exposed: null,
    exposeProxy: null,
    withProxy: null,
    provides: parent ? parent.provides : Object.create(appContext.provides),
    ids: parent ? parent.ids : ["", 0, 0],
    accessCache: null,
    renderCache: [],
    // local resolved assets
    components: null,
    directives: null,
    // resolved props and emits options
    propsOptions: normalizePropsOptions(type2, appContext),
    emitsOptions: normalizeEmitsOptions(type2, appContext),
    // emit
    emit: null,
    // to be set immediately
    emitted: null,
    // props default value
    propsDefaults: EMPTY_OBJ,
    // inheritAttrs
    inheritAttrs: type2.inheritAttrs,
    // state
    ctx: EMPTY_OBJ,
    data: EMPTY_OBJ,
    props: EMPTY_OBJ,
    attrs: EMPTY_OBJ,
    slots: EMPTY_OBJ,
    refs: EMPTY_OBJ,
    setupState: EMPTY_OBJ,
    setupContext: null,
    // suspense related
    suspense,
    suspenseId: suspense ? suspense.pendingId : 0,
    asyncDep: null,
    asyncResolved: false,
    // lifecycle hooks
    // not using enums here because it results in computed properties
    isMounted: false,
    isUnmounted: false,
    isDeactivated: false,
    bc: null,
    c: null,
    bm: null,
    m: null,
    bu: null,
    u: null,
    um: null,
    bum: null,
    da: null,
    a: null,
    rtg: null,
    rtc: null,
    ec: null,
    sp: null
  };
  {
    instance.ctx = { _: instance };
  }
  instance.root = parent ? parent.root : instance;
  instance.emit = emit.bind(null, instance);
  if (vnode.ce) {
    vnode.ce(instance);
  }
  return instance;
}
let currentInstance = null;
const getCurrentInstance = () => currentInstance || currentRenderingInstance;
let internalSetCurrentInstance;
let setInSSRSetupState;
{
  const g2 = getGlobalThis();
  const registerGlobalSetter = (key2, setter) => {
    let setters;
    if (!(setters = g2[key2])) setters = g2[key2] = [];
    setters.push(setter);
    return (v2) => {
      if (setters.length > 1) setters.forEach((set2) => set2(v2));
      else setters[0](v2);
    };
  };
  internalSetCurrentInstance = registerGlobalSetter(
    `__VUE_INSTANCE_SETTERS__`,
    (v2) => currentInstance = v2
  );
  setInSSRSetupState = registerGlobalSetter(
    `__VUE_SSR_SETTERS__`,
    (v2) => isInSSRComponentSetup = v2
  );
}
const setCurrentInstance = (instance) => {
  const prev = currentInstance;
  internalSetCurrentInstance(instance);
  instance.scope.on();
  return () => {
    instance.scope.off();
    internalSetCurrentInstance(prev);
  };
};
const unsetCurrentInstance = () => {
  currentInstance && currentInstance.scope.off();
  internalSetCurrentInstance(null);
};
function isStatefulComponent(instance) {
  return instance.vnode.shapeFlag & 4;
}
let isInSSRComponentSetup = false;
function setupComponent(instance, isSSR = false, optimized = false) {
  isSSR && setInSSRSetupState(isSSR);
  const { props, children } = instance.vnode;
  const isStateful = isStatefulComponent(instance);
  initProps(instance, props, isStateful, isSSR);
  initSlots(instance, children, optimized);
  const setupResult = isStateful ? setupStatefulComponent(instance, isSSR) : void 0;
  isSSR && setInSSRSetupState(false);
  return setupResult;
}
function setupStatefulComponent(instance, isSSR) {
  const Component = instance.type;
  instance.accessCache = /* @__PURE__ */ Object.create(null);
  instance.proxy = new Proxy(instance.ctx, PublicInstanceProxyHandlers);
  const { setup } = Component;
  if (setup) {
    pauseTracking();
    const setupContext = instance.setupContext = setup.length > 1 ? createSetupContext(instance) : null;
    const reset = setCurrentInstance(instance);
    const setupResult = callWithErrorHandling(
      setup,
      instance,
      0,
      [
        instance.props,
        setupContext
      ]
    );
    const isAsyncSetup = isPromise(setupResult);
    resetTracking();
    reset();
    if ((isAsyncSetup || instance.sp) && !isAsyncWrapper(instance)) {
      markAsyncBoundary(instance);
    }
    if (isAsyncSetup) {
      setupResult.then(unsetCurrentInstance, unsetCurrentInstance);
      if (isSSR) {
        return setupResult.then((resolvedResult) => {
          handleSetupResult(instance, resolvedResult, isSSR);
        }).catch((e2) => {
          handleError(e2, instance, 0);
        });
      } else {
        instance.asyncDep = setupResult;
      }
    } else {
      handleSetupResult(instance, setupResult, isSSR);
    }
  } else {
    finishComponentSetup(instance, isSSR);
  }
}
function handleSetupResult(instance, setupResult, isSSR) {
  if (isFunction(setupResult)) {
    if (instance.type.__ssrInlineRender) {
      instance.ssrRender = setupResult;
    } else {
      instance.render = setupResult;
    }
  } else if (isObject$2(setupResult)) {
    instance.setupState = proxyRefs(setupResult);
  } else ;
  finishComponentSetup(instance, isSSR);
}
let compile;
function finishComponentSetup(instance, isSSR, skipOptions) {
  const Component = instance.type;
  if (!instance.render) {
    if (!isSSR && compile && !Component.render) {
      const template = Component.template || resolveMergedOptions(instance).template;
      if (template) {
        const { isCustomElement, compilerOptions } = instance.appContext.config;
        const { delimiters, compilerOptions: componentCompilerOptions } = Component;
        const finalCompilerOptions = extend$3(
          extend$3(
            {
              isCustomElement,
              delimiters
            },
            compilerOptions
          ),
          componentCompilerOptions
        );
        Component.render = compile(template, finalCompilerOptions);
      }
    }
    instance.render = Component.render || NOOP;
  }
  {
    const reset = setCurrentInstance(instance);
    pauseTracking();
    try {
      applyOptions(instance);
    } finally {
      resetTracking();
      reset();
    }
  }
}
const attrsProxyHandlers = {
  get(target, key2) {
    track(target, "get", "");
    return target[key2];
  }
};
function createSetupContext(instance) {
  const expose = (exposed) => {
    instance.exposed = exposed || {};
  };
  {
    return {
      attrs: new Proxy(instance.attrs, attrsProxyHandlers),
      slots: instance.slots,
      emit: instance.emit,
      expose
    };
  }
}
function getComponentPublicInstance(instance) {
  if (instance.exposed) {
    return instance.exposeProxy || (instance.exposeProxy = new Proxy(proxyRefs(markRaw(instance.exposed)), {
      get(target, key2) {
        if (key2 in target) {
          return target[key2];
        } else if (key2 in publicPropertiesMap) {
          return publicPropertiesMap[key2](instance);
        }
      },
      has(target, key2) {
        return key2 in target || key2 in publicPropertiesMap;
      }
    }));
  } else {
    return instance.proxy;
  }
}
const classifyRE = /(?:^|[-_])(\w)/g;
const classify = (str) => str.replace(classifyRE, (c2) => c2.toUpperCase()).replace(/[-_]/g, "");
function getComponentName(Component, includeInferred = true) {
  return isFunction(Component) ? Component.displayName || Component.name : Component.name || includeInferred && Component.__name;
}
function formatComponentName(instance, Component, isRoot = false) {
  let name2 = getComponentName(Component);
  if (!name2 && Component.__file) {
    const match = Component.__file.match(/([^/\\]+)\.\w+$/);
    if (match) {
      name2 = match[1];
    }
  }
  if (!name2 && instance && instance.parent) {
    const inferFromRegistry = (registry) => {
      for (const key2 in registry) {
        if (registry[key2] === Component) {
          return key2;
        }
      }
    };
    name2 = inferFromRegistry(
      instance.components || instance.parent.type.components
    ) || inferFromRegistry(instance.appContext.components);
  }
  return name2 ? classify(name2) : isRoot ? `App` : `Anonymous`;
}
function isClassComponent(value) {
  return isFunction(value) && "__vccOpts" in value;
}
const computed = (getterOrOptions, debugOptions) => {
  const c2 = computed$1(getterOrOptions, debugOptions, isInSSRComponentSetup);
  return c2;
};
function h$9(type2, propsOrChildren, children) {
  const l2 = arguments.length;
  if (l2 === 2) {
    if (isObject$2(propsOrChildren) && !isArray$3(propsOrChildren)) {
      if (isVNode(propsOrChildren)) {
        return createVNode(type2, null, [propsOrChildren]);
      }
      return createVNode(type2, propsOrChildren);
    } else {
      return createVNode(type2, null, propsOrChildren);
    }
  } else {
    if (l2 > 3) {
      children = Array.prototype.slice.call(arguments, 2);
    } else if (l2 === 3 && isVNode(children)) {
      children = [children];
    }
    return createVNode(type2, propsOrChildren, children);
  }
}
const version$1 = "3.5.12";
/**
* @vue/runtime-dom v3.5.12
* (c) 2018-present Yuxi (Evan) You and Vue contributors
* @license MIT
**/
let policy = void 0;
const tt = typeof window !== "undefined" && window.trustedTypes;
if (tt) {
  try {
    policy = /* @__PURE__ */ tt.createPolicy("vue", {
      createHTML: (val) => val
    });
  } catch (e2) {
  }
}
const unsafeToTrustedHTML = policy ? (val) => policy.createHTML(val) : (val) => val;
const svgNS = "http://www.w3.org/2000/svg";
const mathmlNS = "http://www.w3.org/1998/Math/MathML";
const doc$1 = typeof document !== "undefined" ? document : null;
const templateContainer = doc$1 && /* @__PURE__ */ doc$1.createElement("template");
const nodeOps = {
  insert: (child, parent, anchor) => {
    parent.insertBefore(child, anchor || null);
  },
  remove: (child) => {
    const parent = child.parentNode;
    if (parent) {
      parent.removeChild(child);
    }
  },
  createElement: (tag, namespace, is, props) => {
    const el = namespace === "svg" ? doc$1.createElementNS(svgNS, tag) : namespace === "mathml" ? doc$1.createElementNS(mathmlNS, tag) : is ? doc$1.createElement(tag, { is }) : doc$1.createElement(tag);
    if (tag === "select" && props && props.multiple != null) {
      el.setAttribute("multiple", props.multiple);
    }
    return el;
  },
  createText: (text2) => doc$1.createTextNode(text2),
  createComment: (text2) => doc$1.createComment(text2),
  setText: (node, text2) => {
    node.nodeValue = text2;
  },
  setElementText: (el, text2) => {
    el.textContent = text2;
  },
  parentNode: (node) => node.parentNode,
  nextSibling: (node) => node.nextSibling,
  querySelector: (selector) => doc$1.querySelector(selector),
  setScopeId(el, id2) {
    el.setAttribute(id2, "");
  },
  // __UNSAFE__
  // Reason: innerHTML.
  // Static content here can only come from compiled templates.
  // As long as the user only uses trusted templates, this is safe.
  insertStaticContent(content2, parent, anchor, namespace, start, end) {
    const before = anchor ? anchor.previousSibling : parent.lastChild;
    if (start && (start === end || start.nextSibling)) {
      while (true) {
        parent.insertBefore(start.cloneNode(true), anchor);
        if (start === end || !(start = start.nextSibling)) break;
      }
    } else {
      templateContainer.innerHTML = unsafeToTrustedHTML(
        namespace === "svg" ? `<svg>${content2}</svg>` : namespace === "mathml" ? `<math>${content2}</math>` : content2
      );
      const template = templateContainer.content;
      if (namespace === "svg" || namespace === "mathml") {
        const wrapper = template.firstChild;
        while (wrapper.firstChild) {
          template.appendChild(wrapper.firstChild);
        }
        template.removeChild(wrapper);
      }
      parent.insertBefore(template, anchor);
    }
    return [
      // first
      before ? before.nextSibling : parent.firstChild,
      // last
      anchor ? anchor.previousSibling : parent.lastChild
    ];
  }
};
const TRANSITION = "transition";
const ANIMATION = "animation";
const vtcKey = Symbol("_vtc");
const DOMTransitionPropsValidators = {
  name: String,
  type: String,
  css: {
    type: Boolean,
    default: true
  },
  duration: [String, Number, Object],
  enterFromClass: String,
  enterActiveClass: String,
  enterToClass: String,
  appearFromClass: String,
  appearActiveClass: String,
  appearToClass: String,
  leaveFromClass: String,
  leaveActiveClass: String,
  leaveToClass: String
};
const TransitionPropsValidators = /* @__PURE__ */ extend$3(
  {},
  BaseTransitionPropsValidators,
  DOMTransitionPropsValidators
);
const decorate$1 = (t2) => {
  t2.displayName = "Transition";
  t2.props = TransitionPropsValidators;
  return t2;
};
const Transition = /* @__PURE__ */ decorate$1(
  (props, { slots }) => h$9(BaseTransition, resolveTransitionProps(props), slots)
);
const callHook = (hook, args = []) => {
  if (isArray$3(hook)) {
    hook.forEach((h2) => h2(...args));
  } else if (hook) {
    hook(...args);
  }
};
const hasExplicitCallback = (hook) => {
  return hook ? isArray$3(hook) ? hook.some((h2) => h2.length > 1) : hook.length > 1 : false;
};
function resolveTransitionProps(rawProps) {
  const baseProps = {};
  for (const key2 in rawProps) {
    if (!(key2 in DOMTransitionPropsValidators)) {
      baseProps[key2] = rawProps[key2];
    }
  }
  if (rawProps.css === false) {
    return baseProps;
  }
  const {
    name: name2 = "v",
    type: type2,
    duration,
    enterFromClass = `${name2}-enter-from`,
    enterActiveClass = `${name2}-enter-active`,
    enterToClass = `${name2}-enter-to`,
    appearFromClass = enterFromClass,
    appearActiveClass = enterActiveClass,
    appearToClass = enterToClass,
    leaveFromClass = `${name2}-leave-from`,
    leaveActiveClass = `${name2}-leave-active`,
    leaveToClass = `${name2}-leave-to`
  } = rawProps;
  const durations = normalizeDuration(duration);
  const enterDuration = durations && durations[0];
  const leaveDuration = durations && durations[1];
  const {
    onBeforeEnter,
    onEnter,
    onEnterCancelled,
    onLeave,
    onLeaveCancelled,
    onBeforeAppear = onBeforeEnter,
    onAppear = onEnter,
    onAppearCancelled = onEnterCancelled
  } = baseProps;
  const finishEnter = (el, isAppear, done) => {
    removeTransitionClass(el, isAppear ? appearToClass : enterToClass);
    removeTransitionClass(el, isAppear ? appearActiveClass : enterActiveClass);
    done && done();
  };
  const finishLeave = (el, done) => {
    el._isLeaving = false;
    removeTransitionClass(el, leaveFromClass);
    removeTransitionClass(el, leaveToClass);
    removeTransitionClass(el, leaveActiveClass);
    done && done();
  };
  const makeEnterHook = (isAppear) => {
    return (el, done) => {
      const hook = isAppear ? onAppear : onEnter;
      const resolve2 = () => finishEnter(el, isAppear, done);
      callHook(hook, [el, resolve2]);
      nextFrame(() => {
        removeTransitionClass(el, isAppear ? appearFromClass : enterFromClass);
        addTransitionClass(el, isAppear ? appearToClass : enterToClass);
        if (!hasExplicitCallback(hook)) {
          whenTransitionEnds(el, type2, enterDuration, resolve2);
        }
      });
    };
  };
  return extend$3(baseProps, {
    onBeforeEnter(el) {
      callHook(onBeforeEnter, [el]);
      addTransitionClass(el, enterFromClass);
      addTransitionClass(el, enterActiveClass);
    },
    onBeforeAppear(el) {
      callHook(onBeforeAppear, [el]);
      addTransitionClass(el, appearFromClass);
      addTransitionClass(el, appearActiveClass);
    },
    onEnter: makeEnterHook(false),
    onAppear: makeEnterHook(true),
    onLeave(el, done) {
      el._isLeaving = true;
      const resolve2 = () => finishLeave(el, done);
      addTransitionClass(el, leaveFromClass);
      addTransitionClass(el, leaveActiveClass);
      forceReflow();
      nextFrame(() => {
        if (!el._isLeaving) {
          return;
        }
        removeTransitionClass(el, leaveFromClass);
        addTransitionClass(el, leaveToClass);
        if (!hasExplicitCallback(onLeave)) {
          whenTransitionEnds(el, type2, leaveDuration, resolve2);
        }
      });
      callHook(onLeave, [el, resolve2]);
    },
    onEnterCancelled(el) {
      finishEnter(el, false);
      callHook(onEnterCancelled, [el]);
    },
    onAppearCancelled(el) {
      finishEnter(el, true);
      callHook(onAppearCancelled, [el]);
    },
    onLeaveCancelled(el) {
      finishLeave(el);
      callHook(onLeaveCancelled, [el]);
    }
  });
}
function normalizeDuration(duration) {
  if (duration == null) {
    return null;
  } else if (isObject$2(duration)) {
    return [NumberOf(duration.enter), NumberOf(duration.leave)];
  } else {
    const n2 = NumberOf(duration);
    return [n2, n2];
  }
}
function NumberOf(val) {
  const res = toNumber(val);
  return res;
}
function addTransitionClass(el, cls) {
  cls.split(/\s+/).forEach((c2) => c2 && el.classList.add(c2));
  (el[vtcKey] || (el[vtcKey] = /* @__PURE__ */ new Set())).add(cls);
}
function removeTransitionClass(el, cls) {
  cls.split(/\s+/).forEach((c2) => c2 && el.classList.remove(c2));
  const _vtc = el[vtcKey];
  if (_vtc) {
    _vtc.delete(cls);
    if (!_vtc.size) {
      el[vtcKey] = void 0;
    }
  }
}
function nextFrame(cb) {
  requestAnimationFrame(() => {
    requestAnimationFrame(cb);
  });
}
let endId = 0;
function whenTransitionEnds(el, expectedType, explicitTimeout, resolve2) {
  const id2 = el._endId = ++endId;
  const resolveIfNotStale = () => {
    if (id2 === el._endId) {
      resolve2();
    }
  };
  if (explicitTimeout != null) {
    return setTimeout(resolveIfNotStale, explicitTimeout);
  }
  const { type: type2, timeout, propCount } = getTransitionInfo(el, expectedType);
  if (!type2) {
    return resolve2();
  }
  const endEvent = type2 + "end";
  let ended = 0;
  const end = () => {
    el.removeEventListener(endEvent, onEnd);
    resolveIfNotStale();
  };
  const onEnd = (e2) => {
    if (e2.target === el && ++ended >= propCount) {
      end();
    }
  };
  setTimeout(() => {
    if (ended < propCount) {
      end();
    }
  }, timeout + 1);
  el.addEventListener(endEvent, onEnd);
}
function getTransitionInfo(el, expectedType) {
  const styles = window.getComputedStyle(el);
  const getStyleProperties = (key2) => (styles[key2] || "").split(", ");
  const transitionDelays = getStyleProperties(`${TRANSITION}Delay`);
  const transitionDurations = getStyleProperties(`${TRANSITION}Duration`);
  const transitionTimeout = getTimeout(transitionDelays, transitionDurations);
  const animationDelays = getStyleProperties(`${ANIMATION}Delay`);
  const animationDurations = getStyleProperties(`${ANIMATION}Duration`);
  const animationTimeout = getTimeout(animationDelays, animationDurations);
  let type2 = null;
  let timeout = 0;
  let propCount = 0;
  if (expectedType === TRANSITION) {
    if (transitionTimeout > 0) {
      type2 = TRANSITION;
      timeout = transitionTimeout;
      propCount = transitionDurations.length;
    }
  } else if (expectedType === ANIMATION) {
    if (animationTimeout > 0) {
      type2 = ANIMATION;
      timeout = animationTimeout;
      propCount = animationDurations.length;
    }
  } else {
    timeout = Math.max(transitionTimeout, animationTimeout);
    type2 = timeout > 0 ? transitionTimeout > animationTimeout ? TRANSITION : ANIMATION : null;
    propCount = type2 ? type2 === TRANSITION ? transitionDurations.length : animationDurations.length : 0;
  }
  const hasTransform = type2 === TRANSITION && /\b(transform|all)(,|$)/.test(
    getStyleProperties(`${TRANSITION}Property`).toString()
  );
  return {
    type: type2,
    timeout,
    propCount,
    hasTransform
  };
}
function getTimeout(delays, durations) {
  while (delays.length < durations.length) {
    delays = delays.concat(delays);
  }
  return Math.max(...durations.map((d2, i2) => toMs(d2) + toMs(delays[i2])));
}
function toMs(s3) {
  if (s3 === "auto") return 0;
  return Number(s3.slice(0, -1).replace(",", ".")) * 1e3;
}
function forceReflow() {
  return document.body.offsetHeight;
}
function patchClass(el, value, isSVG) {
  const transitionClasses = el[vtcKey];
  if (transitionClasses) {
    value = (value ? [value, ...transitionClasses] : [...transitionClasses]).join(" ");
  }
  if (value == null) {
    el.removeAttribute("class");
  } else if (isSVG) {
    el.setAttribute("class", value);
  } else {
    el.className = value;
  }
}
const vShowOriginalDisplay = Symbol("_vod");
const vShowHidden = Symbol("_vsh");
const vShow = {
  beforeMount(el, { value }, { transition }) {
    el[vShowOriginalDisplay] = el.style.display === "none" ? "" : el.style.display;
    if (transition && value) {
      transition.beforeEnter(el);
    } else {
      setDisplay(el, value);
    }
  },
  mounted(el, { value }, { transition }) {
    if (transition && value) {
      transition.enter(el);
    }
  },
  updated(el, { value, oldValue }, { transition }) {
    if (!value === !oldValue) return;
    if (transition) {
      if (value) {
        transition.beforeEnter(el);
        setDisplay(el, true);
        transition.enter(el);
      } else {
        transition.leave(el, () => {
          setDisplay(el, false);
        });
      }
    } else {
      setDisplay(el, value);
    }
  },
  beforeUnmount(el, { value }) {
    setDisplay(el, value);
  }
};
function setDisplay(el, value) {
  el.style.display = value ? el[vShowOriginalDisplay] : "none";
  el[vShowHidden] = !value;
}
const CSS_VAR_TEXT = Symbol("");
function useCssVars(getter) {
  const instance = getCurrentInstance();
  if (!instance) {
    return;
  }
  const updateTeleports = instance.ut = (vars = getter(instance.proxy)) => {
    Array.from(
      document.querySelectorAll(`[data-v-owner="${instance.uid}"]`)
    ).forEach((node) => setVarsOnNode(node, vars));
  };
  const setVars = () => {
    const vars = getter(instance.proxy);
    if (instance.ce) {
      setVarsOnNode(instance.ce, vars);
    } else {
      setVarsOnVNode(instance.subTree, vars);
    }
    updateTeleports(vars);
  };
  onBeforeMount(() => {
    watchPostEffect(setVars);
  });
  onMounted(() => {
    const ob = new MutationObserver(setVars);
    ob.observe(instance.subTree.el.parentNode, { childList: true });
    onUnmounted(() => ob.disconnect());
  });
}
function setVarsOnVNode(vnode, vars) {
  if (vnode.shapeFlag & 128) {
    const suspense = vnode.suspense;
    vnode = suspense.activeBranch;
    if (suspense.pendingBranch && !suspense.isHydrating) {
      suspense.effects.push(() => {
        setVarsOnVNode(suspense.activeBranch, vars);
      });
    }
  }
  while (vnode.component) {
    vnode = vnode.component.subTree;
  }
  if (vnode.shapeFlag & 1 && vnode.el) {
    setVarsOnNode(vnode.el, vars);
  } else if (vnode.type === Fragment) {
    vnode.children.forEach((c2) => setVarsOnVNode(c2, vars));
  } else if (vnode.type === Static) {
    let { el, anchor } = vnode;
    while (el) {
      setVarsOnNode(el, vars);
      if (el === anchor) break;
      el = el.nextSibling;
    }
  }
}
function setVarsOnNode(el, vars) {
  if (el.nodeType === 1) {
    const style2 = el.style;
    let cssText = "";
    for (const key2 in vars) {
      style2.setProperty(`--${key2}`, vars[key2]);
      cssText += `--${key2}: ${vars[key2]};`;
    }
    style2[CSS_VAR_TEXT] = cssText;
  }
}
const displayRE = /(^|;)\s*display\s*:/;
function patchStyle(el, prev, next) {
  const style2 = el.style;
  const isCssString = isString$1(next);
  let hasControlledDisplay = false;
  if (next && !isCssString) {
    if (prev) {
      if (!isString$1(prev)) {
        for (const key2 in prev) {
          if (next[key2] == null) {
            setStyle(style2, key2, "");
          }
        }
      } else {
        for (const prevStyle of prev.split(";")) {
          const key2 = prevStyle.slice(0, prevStyle.indexOf(":")).trim();
          if (next[key2] == null) {
            setStyle(style2, key2, "");
          }
        }
      }
    }
    for (const key2 in next) {
      if (key2 === "display") {
        hasControlledDisplay = true;
      }
      setStyle(style2, key2, next[key2]);
    }
  } else {
    if (isCssString) {
      if (prev !== next) {
        const cssVarText = style2[CSS_VAR_TEXT];
        if (cssVarText) {
          next += ";" + cssVarText;
        }
        style2.cssText = next;
        hasControlledDisplay = displayRE.test(next);
      }
    } else if (prev) {
      el.removeAttribute("style");
    }
  }
  if (vShowOriginalDisplay in el) {
    el[vShowOriginalDisplay] = hasControlledDisplay ? style2.display : "";
    if (el[vShowHidden]) {
      style2.display = "none";
    }
  }
}
const importantRE = /\s*!important$/;
function setStyle(style2, name2, val) {
  if (isArray$3(val)) {
    val.forEach((v2) => setStyle(style2, name2, v2));
  } else {
    if (val == null) val = "";
    if (name2.startsWith("--")) {
      style2.setProperty(name2, val);
    } else {
      const prefixed = autoPrefix(style2, name2);
      if (importantRE.test(val)) {
        style2.setProperty(
          hyphenate(prefixed),
          val.replace(importantRE, ""),
          "important"
        );
      } else {
        style2[prefixed] = val;
      }
    }
  }
}
const prefixes = ["Webkit", "Moz", "ms"];
const prefixCache = {};
function autoPrefix(style2, rawName) {
  const cached = prefixCache[rawName];
  if (cached) {
    return cached;
  }
  let name2 = camelize(rawName);
  if (name2 !== "filter" && name2 in style2) {
    return prefixCache[rawName] = name2;
  }
  name2 = capitalize$1(name2);
  for (let i2 = 0; i2 < prefixes.length; i2++) {
    const prefixed = prefixes[i2] + name2;
    if (prefixed in style2) {
      return prefixCache[rawName] = prefixed;
    }
  }
  return rawName;
}
const xlinkNS = "http://www.w3.org/1999/xlink";
function patchAttr(el, key2, value, isSVG, instance, isBoolean2 = isSpecialBooleanAttr(key2)) {
  if (isSVG && key2.startsWith("xlink:")) {
    if (value == null) {
      el.removeAttributeNS(xlinkNS, key2.slice(6, key2.length));
    } else {
      el.setAttributeNS(xlinkNS, key2, value);
    }
  } else {
    if (value == null || isBoolean2 && !includeBooleanAttr(value)) {
      el.removeAttribute(key2);
    } else {
      el.setAttribute(
        key2,
        isBoolean2 ? "" : isSymbol(value) ? String(value) : value
      );
    }
  }
}
function patchDOMProp(el, key2, value, parentComponent, attrName2) {
  if (key2 === "innerHTML" || key2 === "textContent") {
    if (value != null) {
      el[key2] = key2 === "innerHTML" ? unsafeToTrustedHTML(value) : value;
    }
    return;
  }
  const tag = el.tagName;
  if (key2 === "value" && tag !== "PROGRESS" && // custom elements may use _value internally
  !tag.includes("-")) {
    const oldValue = tag === "OPTION" ? el.getAttribute("value") || "" : el.value;
    const newValue = value == null ? (
      // #11647: value should be set as empty string for null and undefined,
      // but <input type="checkbox"> should be set as 'on'.
      el.type === "checkbox" ? "on" : ""
    ) : String(value);
    if (oldValue !== newValue || !("_value" in el)) {
      el.value = newValue;
    }
    if (value == null) {
      el.removeAttribute(key2);
    }
    el._value = value;
    return;
  }
  let needRemove = false;
  if (value === "" || value == null) {
    const type2 = typeof el[key2];
    if (type2 === "boolean") {
      value = includeBooleanAttr(value);
    } else if (value == null && type2 === "string") {
      value = "";
      needRemove = true;
    } else if (type2 === "number") {
      value = 0;
      needRemove = true;
    }
  }
  try {
    el[key2] = value;
  } catch (e2) {
  }
  needRemove && el.removeAttribute(attrName2 || key2);
}
function addEventListener(el, event, handler, options) {
  el.addEventListener(event, handler, options);
}
function removeEventListener(el, event, handler, options) {
  el.removeEventListener(event, handler, options);
}
const veiKey = Symbol("_vei");
function patchEvent(el, rawName, prevValue, nextValue, instance = null) {
  const invokers = el[veiKey] || (el[veiKey] = {});
  const existingInvoker = invokers[rawName];
  if (nextValue && existingInvoker) {
    existingInvoker.value = nextValue;
  } else {
    const [name2, options] = parseName(rawName);
    if (nextValue) {
      const invoker = invokers[rawName] = createInvoker(
        nextValue,
        instance
      );
      addEventListener(el, name2, invoker, options);
    } else if (existingInvoker) {
      removeEventListener(el, name2, existingInvoker, options);
      invokers[rawName] = void 0;
    }
  }
}
const optionsModifierRE = /(?:Once|Passive|Capture)$/;
function parseName(name2) {
  let options;
  if (optionsModifierRE.test(name2)) {
    options = {};
    let m2;
    while (m2 = name2.match(optionsModifierRE)) {
      name2 = name2.slice(0, name2.length - m2[0].length);
      options[m2[0].toLowerCase()] = true;
    }
  }
  const event = name2[2] === ":" ? name2.slice(3) : hyphenate(name2.slice(2));
  return [event, options];
}
let cachedNow = 0;
const p$7 = /* @__PURE__ */ Promise.resolve();
const getNow = () => cachedNow || (p$7.then(() => cachedNow = 0), cachedNow = Date.now());
function createInvoker(initialValue, instance) {
  const invoker = (e2) => {
    if (!e2._vts) {
      e2._vts = Date.now();
    } else if (e2._vts <= invoker.attached) {
      return;
    }
    callWithAsyncErrorHandling(
      patchStopImmediatePropagation(e2, invoker.value),
      instance,
      5,
      [e2]
    );
  };
  invoker.value = initialValue;
  invoker.attached = getNow();
  return invoker;
}
function patchStopImmediatePropagation(e2, value) {
  if (isArray$3(value)) {
    const originalStop = e2.stopImmediatePropagation;
    e2.stopImmediatePropagation = () => {
      originalStop.call(e2);
      e2._stopped = true;
    };
    return value.map(
      (fn) => (e22) => !e22._stopped && fn && fn(e22)
    );
  } else {
    return value;
  }
}
const isNativeOn = (key2) => key2.charCodeAt(0) === 111 && key2.charCodeAt(1) === 110 && // lowercase letter
key2.charCodeAt(2) > 96 && key2.charCodeAt(2) < 123;
const patchProp = (el, key2, prevValue, nextValue, namespace, parentComponent) => {
  const isSVG = namespace === "svg";
  if (key2 === "class") {
    patchClass(el, nextValue, isSVG);
  } else if (key2 === "style") {
    patchStyle(el, prevValue, nextValue);
  } else if (isOn(key2)) {
    if (!isModelListener(key2)) {
      patchEvent(el, key2, prevValue, nextValue, parentComponent);
    }
  } else if (key2[0] === "." ? (key2 = key2.slice(1), true) : key2[0] === "^" ? (key2 = key2.slice(1), false) : shouldSetAsProp(el, key2, nextValue, isSVG)) {
    patchDOMProp(el, key2, nextValue);
    if (!el.tagName.includes("-") && (key2 === "value" || key2 === "checked" || key2 === "selected")) {
      patchAttr(el, key2, nextValue, isSVG, parentComponent, key2 !== "value");
    }
  } else if (
    // #11081 force set props for possible async custom element
    el._isVueCE && (/[A-Z]/.test(key2) || !isString$1(nextValue))
  ) {
    patchDOMProp(el, camelize(key2), nextValue, parentComponent, key2);
  } else {
    if (key2 === "true-value") {
      el._trueValue = nextValue;
    } else if (key2 === "false-value") {
      el._falseValue = nextValue;
    }
    patchAttr(el, key2, nextValue, isSVG);
  }
};
function shouldSetAsProp(el, key2, value, isSVG) {
  if (isSVG) {
    if (key2 === "innerHTML" || key2 === "textContent") {
      return true;
    }
    if (key2 in el && isNativeOn(key2) && isFunction(value)) {
      return true;
    }
    return false;
  }
  if (key2 === "spellcheck" || key2 === "draggable" || key2 === "translate") {
    return false;
  }
  if (key2 === "form") {
    return false;
  }
  if (key2 === "list" && el.tagName === "INPUT") {
    return false;
  }
  if (key2 === "type" && el.tagName === "TEXTAREA") {
    return false;
  }
  if (key2 === "width" || key2 === "height") {
    const tag = el.tagName;
    if (tag === "IMG" || tag === "VIDEO" || tag === "CANVAS" || tag === "SOURCE") {
      return false;
    }
  }
  if (isNativeOn(key2) && isString$1(value)) {
    return false;
  }
  return key2 in el;
}
const getModelAssigner = (vnode) => {
  const fn = vnode.props["onUpdate:modelValue"] || false;
  return isArray$3(fn) ? (value) => invokeArrayFns(fn, value) : fn;
};
function onCompositionStart(e2) {
  e2.target.composing = true;
}
function onCompositionEnd(e2) {
  const target = e2.target;
  if (target.composing) {
    target.composing = false;
    target.dispatchEvent(new Event("input"));
  }
}
const assignKey = Symbol("_assign");
const vModelText = {
  created(el, { modifiers: { lazy, trim, number: number2 } }, vnode) {
    el[assignKey] = getModelAssigner(vnode);
    const castToNumber = number2 || vnode.props && vnode.props.type === "number";
    addEventListener(el, lazy ? "change" : "input", (e2) => {
      if (e2.target.composing) return;
      let domValue = el.value;
      if (trim) {
        domValue = domValue.trim();
      }
      if (castToNumber) {
        domValue = looseToNumber(domValue);
      }
      el[assignKey](domValue);
    });
    if (trim) {
      addEventListener(el, "change", () => {
        el.value = el.value.trim();
      });
    }
    if (!lazy) {
      addEventListener(el, "compositionstart", onCompositionStart);
      addEventListener(el, "compositionend", onCompositionEnd);
      addEventListener(el, "change", onCompositionEnd);
    }
  },
  // set value on mounted so it's after min/max for type="range"
  mounted(el, { value }) {
    el.value = value == null ? "" : value;
  },
  beforeUpdate(el, { value, oldValue, modifiers: { lazy, trim, number: number2 } }, vnode) {
    el[assignKey] = getModelAssigner(vnode);
    if (el.composing) return;
    const elValue = (number2 || el.type === "number") && !/^0\d/.test(el.value) ? looseToNumber(el.value) : el.value;
    const newValue = value == null ? "" : value;
    if (elValue === newValue) {
      return;
    }
    if (document.activeElement === el && el.type !== "range") {
      if (lazy && value === oldValue) {
        return;
      }
      if (trim && el.value.trim() === newValue) {
        return;
      }
    }
    el.value = newValue;
  }
};
const systemModifiers = ["ctrl", "shift", "alt", "meta"];
const modifierGuards = {
  stop: (e2) => e2.stopPropagation(),
  prevent: (e2) => e2.preventDefault(),
  self: (e2) => e2.target !== e2.currentTarget,
  ctrl: (e2) => !e2.ctrlKey,
  shift: (e2) => !e2.shiftKey,
  alt: (e2) => !e2.altKey,
  meta: (e2) => !e2.metaKey,
  left: (e2) => "button" in e2 && e2.button !== 0,
  middle: (e2) => "button" in e2 && e2.button !== 1,
  right: (e2) => "button" in e2 && e2.button !== 2,
  exact: (e2, modifiers2) => systemModifiers.some((m2) => e2[`${m2}Key`] && !modifiers2.includes(m2))
};
const withModifiers = (fn, modifiers2) => {
  const cache2 = fn._withMods || (fn._withMods = {});
  const cacheKey = modifiers2.join(".");
  return cache2[cacheKey] || (cache2[cacheKey] = (event, ...args) => {
    for (let i2 = 0; i2 < modifiers2.length; i2++) {
      const guard = modifierGuards[modifiers2[i2]];
      if (guard && guard(event, modifiers2)) return;
    }
    return fn(event, ...args);
  });
};
const keyNames = {
  esc: "escape",
  space: " ",
  up: "arrow-up",
  left: "arrow-left",
  right: "arrow-right",
  down: "arrow-down",
  delete: "backspace"
};
const withKeys = (fn, modifiers2) => {
  const cache2 = fn._withKeys || (fn._withKeys = {});
  const cacheKey = modifiers2.join(".");
  return cache2[cacheKey] || (cache2[cacheKey] = (event) => {
    if (!("key" in event)) {
      return;
    }
    const eventKey = hyphenate(event.key);
    if (modifiers2.some(
      (k2) => k2 === eventKey || keyNames[k2] === eventKey
    )) {
      return fn(event);
    }
  });
};
const rendererOptions = /* @__PURE__ */ extend$3({ patchProp }, nodeOps);
let renderer;
function ensureRenderer() {
  return renderer || (renderer = createRenderer(rendererOptions));
}
const render = (...args) => {
  ensureRenderer().render(...args);
};
const createApp = (...args) => {
  const app = ensureRenderer().createApp(...args);
  const { mount } = app;
  app.mount = (containerOrSelector) => {
    const container = normalizeContainer(containerOrSelector);
    if (!container) return;
    const component = app._component;
    if (!isFunction(component) && !component.render && !component.template) {
      component.template = container.innerHTML;
    }
    if (container.nodeType === 1) {
      container.textContent = "";
    }
    const proxy = mount(container, false, resolveRootNamespace(container));
    if (container instanceof Element) {
      container.removeAttribute("v-cloak");
      container.setAttribute("data-v-app", "");
    }
    return proxy;
  };
  return app;
};
function resolveRootNamespace(container) {
  if (container instanceof SVGElement) {
    return "svg";
  }
  if (typeof MathMLElement === "function" && container instanceof MathMLElement) {
    return "mathml";
  }
}
function normalizeContainer(container) {
  if (isString$1(container)) {
    const res = document.querySelector(container);
    return res;
  }
  return container;
}
var util;
(function(util2) {
  util2.assertEqual = (val) => val;
  function assertIs(_arg) {
  }
  util2.assertIs = assertIs;
  function assertNever(_x) {
    throw new Error();
  }
  util2.assertNever = assertNever;
  util2.arrayToEnum = (items) => {
    const obj = {};
    for (const item of items) {
      obj[item] = item;
    }
    return obj;
  };
  util2.getValidEnumValues = (obj) => {
    const validKeys = util2.objectKeys(obj).filter((k2) => typeof obj[obj[k2]] !== "number");
    const filtered = {};
    for (const k2 of validKeys) {
      filtered[k2] = obj[k2];
    }
    return util2.objectValues(filtered);
  };
  util2.objectValues = (obj) => {
    return util2.objectKeys(obj).map(function(e2) {
      return obj[e2];
    });
  };
  util2.objectKeys = typeof Object.keys === "function" ? (obj) => Object.keys(obj) : (object2) => {
    const keys2 = [];
    for (const key2 in object2) {
      if (Object.prototype.hasOwnProperty.call(object2, key2)) {
        keys2.push(key2);
      }
    }
    return keys2;
  };
  util2.find = (arr, checker) => {
    for (const item of arr) {
      if (checker(item))
        return item;
    }
    return void 0;
  };
  util2.isInteger = typeof Number.isInteger === "function" ? (val) => Number.isInteger(val) : (val) => typeof val === "number" && isFinite(val) && Math.floor(val) === val;
  function joinValues(array, separator = " | ") {
    return array.map((val) => typeof val === "string" ? `'${val}'` : val).join(separator);
  }
  util2.joinValues = joinValues;
  util2.jsonStringifyReplacer = (_2, value) => {
    if (typeof value === "bigint") {
      return value.toString();
    }
    return value;
  };
})(util || (util = {}));
var objectUtil;
(function(objectUtil2) {
  objectUtil2.mergeShapes = (first, second) => {
    return {
      ...first,
      ...second
      // second overwrites first
    };
  };
})(objectUtil || (objectUtil = {}));
const ZodParsedType = util.arrayToEnum([
  "string",
  "nan",
  "number",
  "integer",
  "float",
  "boolean",
  "date",
  "bigint",
  "symbol",
  "function",
  "undefined",
  "null",
  "array",
  "object",
  "unknown",
  "promise",
  "void",
  "never",
  "map",
  "set"
]);
const getParsedType = (data) => {
  const t2 = typeof data;
  switch (t2) {
    case "undefined":
      return ZodParsedType.undefined;
    case "string":
      return ZodParsedType.string;
    case "number":
      return isNaN(data) ? ZodParsedType.nan : ZodParsedType.number;
    case "boolean":
      return ZodParsedType.boolean;
    case "function":
      return ZodParsedType.function;
    case "bigint":
      return ZodParsedType.bigint;
    case "symbol":
      return ZodParsedType.symbol;
    case "object":
      if (Array.isArray(data)) {
        return ZodParsedType.array;
      }
      if (data === null) {
        return ZodParsedType.null;
      }
      if (data.then && typeof data.then === "function" && data.catch && typeof data.catch === "function") {
        return ZodParsedType.promise;
      }
      if (typeof Map !== "undefined" && data instanceof Map) {
        return ZodParsedType.map;
      }
      if (typeof Set !== "undefined" && data instanceof Set) {
        return ZodParsedType.set;
      }
      if (typeof Date !== "undefined" && data instanceof Date) {
        return ZodParsedType.date;
      }
      return ZodParsedType.object;
    default:
      return ZodParsedType.unknown;
  }
};
const ZodIssueCode = util.arrayToEnum([
  "invalid_type",
  "invalid_literal",
  "custom",
  "invalid_union",
  "invalid_union_discriminator",
  "invalid_enum_value",
  "unrecognized_keys",
  "invalid_arguments",
  "invalid_return_type",
  "invalid_date",
  "invalid_string",
  "too_small",
  "too_big",
  "invalid_intersection_types",
  "not_multiple_of",
  "not_finite"
]);
const quotelessJson = (obj) => {
  const json2 = JSON.stringify(obj, null, 2);
  return json2.replace(/"([^"]+)":/g, "$1:");
};
class ZodError extends Error {
  constructor(issues) {
    super();
    this.issues = [];
    this.addIssue = (sub) => {
      this.issues = [...this.issues, sub];
    };
    this.addIssues = (subs = []) => {
      this.issues = [...this.issues, ...subs];
    };
    const actualProto = new.target.prototype;
    if (Object.setPrototypeOf) {
      Object.setPrototypeOf(this, actualProto);
    } else {
      this.__proto__ = actualProto;
    }
    this.name = "ZodError";
    this.issues = issues;
  }
  get errors() {
    return this.issues;
  }
  format(_mapper) {
    const mapper = _mapper || function(issue) {
      return issue.message;
    };
    const fieldErrors = { _errors: [] };
    const processError = (error2) => {
      for (const issue of error2.issues) {
        if (issue.code === "invalid_union") {
          issue.unionErrors.map(processError);
        } else if (issue.code === "invalid_return_type") {
          processError(issue.returnTypeError);
        } else if (issue.code === "invalid_arguments") {
          processError(issue.argumentsError);
        } else if (issue.path.length === 0) {
          fieldErrors._errors.push(mapper(issue));
        } else {
          let curr = fieldErrors;
          let i2 = 0;
          while (i2 < issue.path.length) {
            const el = issue.path[i2];
            const terminal = i2 === issue.path.length - 1;
            if (!terminal) {
              curr[el] = curr[el] || { _errors: [] };
            } else {
              curr[el] = curr[el] || { _errors: [] };
              curr[el]._errors.push(mapper(issue));
            }
            curr = curr[el];
            i2++;
          }
        }
      }
    };
    processError(this);
    return fieldErrors;
  }
  static assert(value) {
    if (!(value instanceof ZodError)) {
      throw new Error(`Not a ZodError: ${value}`);
    }
  }
  toString() {
    return this.message;
  }
  get message() {
    return JSON.stringify(this.issues, util.jsonStringifyReplacer, 2);
  }
  get isEmpty() {
    return this.issues.length === 0;
  }
  flatten(mapper = (issue) => issue.message) {
    const fieldErrors = {};
    const formErrors = [];
    for (const sub of this.issues) {
      if (sub.path.length > 0) {
        fieldErrors[sub.path[0]] = fieldErrors[sub.path[0]] || [];
        fieldErrors[sub.path[0]].push(mapper(sub));
      } else {
        formErrors.push(mapper(sub));
      }
    }
    return { formErrors, fieldErrors };
  }
  get formErrors() {
    return this.flatten();
  }
}
ZodError.create = (issues) => {
  const error2 = new ZodError(issues);
  return error2;
};
const errorMap = (issue, _ctx) => {
  let message;
  switch (issue.code) {
    case ZodIssueCode.invalid_type:
      if (issue.received === ZodParsedType.undefined) {
        message = "Required";
      } else {
        message = `Expected ${issue.expected}, received ${issue.received}`;
      }
      break;
    case ZodIssueCode.invalid_literal:
      message = `Invalid literal value, expected ${JSON.stringify(issue.expected, util.jsonStringifyReplacer)}`;
      break;
    case ZodIssueCode.unrecognized_keys:
      message = `Unrecognized key(s) in object: ${util.joinValues(issue.keys, ", ")}`;
      break;
    case ZodIssueCode.invalid_union:
      message = `Invalid input`;
      break;
    case ZodIssueCode.invalid_union_discriminator:
      message = `Invalid discriminator value. Expected ${util.joinValues(issue.options)}`;
      break;
    case ZodIssueCode.invalid_enum_value:
      message = `Invalid enum value. Expected ${util.joinValues(issue.options)}, received '${issue.received}'`;
      break;
    case ZodIssueCode.invalid_arguments:
      message = `Invalid function arguments`;
      break;
    case ZodIssueCode.invalid_return_type:
      message = `Invalid function return type`;
      break;
    case ZodIssueCode.invalid_date:
      message = `Invalid date`;
      break;
    case ZodIssueCode.invalid_string:
      if (typeof issue.validation === "object") {
        if ("includes" in issue.validation) {
          message = `Invalid input: must include "${issue.validation.includes}"`;
          if (typeof issue.validation.position === "number") {
            message = `${message} at one or more positions greater than or equal to ${issue.validation.position}`;
          }
        } else if ("startsWith" in issue.validation) {
          message = `Invalid input: must start with "${issue.validation.startsWith}"`;
        } else if ("endsWith" in issue.validation) {
          message = `Invalid input: must end with "${issue.validation.endsWith}"`;
        } else {
          util.assertNever(issue.validation);
        }
      } else if (issue.validation !== "regex") {
        message = `Invalid ${issue.validation}`;
      } else {
        message = "Invalid";
      }
      break;
    case ZodIssueCode.too_small:
      if (issue.type === "array")
        message = `Array must contain ${issue.exact ? "exactly" : issue.inclusive ? `at least` : `more than`} ${issue.minimum} element(s)`;
      else if (issue.type === "string")
        message = `String must contain ${issue.exact ? "exactly" : issue.inclusive ? `at least` : `over`} ${issue.minimum} character(s)`;
      else if (issue.type === "number")
        message = `Number must be ${issue.exact ? `exactly equal to ` : issue.inclusive ? `greater than or equal to ` : `greater than `}${issue.minimum}`;
      else if (issue.type === "date")
        message = `Date must be ${issue.exact ? `exactly equal to ` : issue.inclusive ? `greater than or equal to ` : `greater than `}${new Date(Number(issue.minimum))}`;
      else
        message = "Invalid input";
      break;
    case ZodIssueCode.too_big:
      if (issue.type === "array")
        message = `Array must contain ${issue.exact ? `exactly` : issue.inclusive ? `at most` : `less than`} ${issue.maximum} element(s)`;
      else if (issue.type === "string")
        message = `String must contain ${issue.exact ? `exactly` : issue.inclusive ? `at most` : `under`} ${issue.maximum} character(s)`;
      else if (issue.type === "number")
        message = `Number must be ${issue.exact ? `exactly` : issue.inclusive ? `less than or equal to` : `less than`} ${issue.maximum}`;
      else if (issue.type === "bigint")
        message = `BigInt must be ${issue.exact ? `exactly` : issue.inclusive ? `less than or equal to` : `less than`} ${issue.maximum}`;
      else if (issue.type === "date")
        message = `Date must be ${issue.exact ? `exactly` : issue.inclusive ? `smaller than or equal to` : `smaller than`} ${new Date(Number(issue.maximum))}`;
      else
        message = "Invalid input";
      break;
    case ZodIssueCode.custom:
      message = `Invalid input`;
      break;
    case ZodIssueCode.invalid_intersection_types:
      message = `Intersection results could not be merged`;
      break;
    case ZodIssueCode.not_multiple_of:
      message = `Number must be a multiple of ${issue.multipleOf}`;
      break;
    case ZodIssueCode.not_finite:
      message = "Number must be finite";
      break;
    default:
      message = _ctx.defaultError;
      util.assertNever(issue);
  }
  return { message };
};
let overrideErrorMap = errorMap;
function setErrorMap(map2) {
  overrideErrorMap = map2;
}
function getErrorMap() {
  return overrideErrorMap;
}
const makeIssue = (params) => {
  const { data, path: path2, errorMaps, issueData } = params;
  const fullPath = [...path2, ...issueData.path || []];
  const fullIssue = {
    ...issueData,
    path: fullPath
  };
  if (issueData.message !== void 0) {
    return {
      ...issueData,
      path: fullPath,
      message: issueData.message
    };
  }
  let errorMessage = "";
  const maps = errorMaps.filter((m2) => !!m2).slice().reverse();
  for (const map2 of maps) {
    errorMessage = map2(fullIssue, { data, defaultError: errorMessage }).message;
  }
  return {
    ...issueData,
    path: fullPath,
    message: errorMessage
  };
};
const EMPTY_PATH = [];
function addIssueToContext(ctx, issueData) {
  const overrideMap = getErrorMap();
  const issue = makeIssue({
    issueData,
    data: ctx.data,
    path: ctx.path,
    errorMaps: [
      ctx.common.contextualErrorMap,
      ctx.schemaErrorMap,
      overrideMap,
      overrideMap === errorMap ? void 0 : errorMap
      // then global default map
    ].filter((x2) => !!x2)
  });
  ctx.common.issues.push(issue);
}
class ParseStatus {
  constructor() {
    this.value = "valid";
  }
  dirty() {
    if (this.value === "valid")
      this.value = "dirty";
  }
  abort() {
    if (this.value !== "aborted")
      this.value = "aborted";
  }
  static mergeArray(status, results) {
    const arrayValue = [];
    for (const s3 of results) {
      if (s3.status === "aborted")
        return INVALID;
      if (s3.status === "dirty")
        status.dirty();
      arrayValue.push(s3.value);
    }
    return { status: status.value, value: arrayValue };
  }
  static async mergeObjectAsync(status, pairs2) {
    const syncPairs = [];
    for (const pair2 of pairs2) {
      const key2 = await pair2.key;
      const value = await pair2.value;
      syncPairs.push({
        key: key2,
        value
      });
    }
    return ParseStatus.mergeObjectSync(status, syncPairs);
  }
  static mergeObjectSync(status, pairs2) {
    const finalObject = {};
    for (const pair2 of pairs2) {
      const { key: key2, value } = pair2;
      if (key2.status === "aborted")
        return INVALID;
      if (value.status === "aborted")
        return INVALID;
      if (key2.status === "dirty")
        status.dirty();
      if (value.status === "dirty")
        status.dirty();
      if (key2.value !== "__proto__" && (typeof value.value !== "undefined" || pair2.alwaysSet)) {
        finalObject[key2.value] = value.value;
      }
    }
    return { status: status.value, value: finalObject };
  }
}
const INVALID = Object.freeze({
  status: "aborted"
});
const DIRTY = (value) => ({ status: "dirty", value });
const OK = (value) => ({ status: "valid", value });
const isAborted = (x2) => x2.status === "aborted";
const isDirty = (x2) => x2.status === "dirty";
const isValid = (x2) => x2.status === "valid";
const isAsync = (x2) => typeof Promise !== "undefined" && x2 instanceof Promise;
function __classPrivateFieldGet(receiver, state, kind, f2) {
  if (typeof state === "function" ? receiver !== state || !f2 : !state.has(receiver)) throw new TypeError("Cannot read private member from an object whose class did not declare it");
  return state.get(receiver);
}
function __classPrivateFieldSet(receiver, state, value, kind, f2) {
  if (typeof state === "function" ? receiver !== state || !f2 : !state.has(receiver)) throw new TypeError("Cannot write private member to an object whose class did not declare it");
  return state.set(receiver, value), value;
}
typeof SuppressedError === "function" ? SuppressedError : function(error2, suppressed, message) {
  var e2 = new Error(message);
  return e2.name = "SuppressedError", e2.error = error2, e2.suppressed = suppressed, e2;
};
var errorUtil;
(function(errorUtil2) {
  errorUtil2.errToObj = (message) => typeof message === "string" ? { message } : message || {};
  errorUtil2.toString = (message) => typeof message === "string" ? message : message === null || message === void 0 ? void 0 : message.message;
})(errorUtil || (errorUtil = {}));
var _ZodEnum_cache, _ZodNativeEnum_cache;
class ParseInputLazyPath {
  constructor(parent, value, path2, key2) {
    this._cachedPath = [];
    this.parent = parent;
    this.data = value;
    this._path = path2;
    this._key = key2;
  }
  get path() {
    if (!this._cachedPath.length) {
      if (this._key instanceof Array) {
        this._cachedPath.push(...this._path, ...this._key);
      } else {
        this._cachedPath.push(...this._path, this._key);
      }
    }
    return this._cachedPath;
  }
}
const handleResult = (ctx, result) => {
  if (isValid(result)) {
    return { success: true, data: result.value };
  } else {
    if (!ctx.common.issues.length) {
      throw new Error("Validation failed but no issues detected.");
    }
    return {
      success: false,
      get error() {
        if (this._error)
          return this._error;
        const error2 = new ZodError(ctx.common.issues);
        this._error = error2;
        return this._error;
      }
    };
  }
};
function processCreateParams(params) {
  if (!params)
    return {};
  const { errorMap: errorMap2, invalid_type_error, required_error, description: description2 } = params;
  if (errorMap2 && (invalid_type_error || required_error)) {
    throw new Error(`Can't use "invalid_type_error" or "required_error" in conjunction with custom error map.`);
  }
  if (errorMap2)
    return { errorMap: errorMap2, description: description2 };
  const customMap = (iss, ctx) => {
    var _a2, _b;
    const { message } = params;
    if (iss.code === "invalid_enum_value") {
      return { message: message !== null && message !== void 0 ? message : ctx.defaultError };
    }
    if (typeof ctx.data === "undefined") {
      return { message: (_a2 = message !== null && message !== void 0 ? message : required_error) !== null && _a2 !== void 0 ? _a2 : ctx.defaultError };
    }
    if (iss.code !== "invalid_type")
      return { message: ctx.defaultError };
    return { message: (_b = message !== null && message !== void 0 ? message : invalid_type_error) !== null && _b !== void 0 ? _b : ctx.defaultError };
  };
  return { errorMap: customMap, description: description2 };
}
class ZodType {
  constructor(def2) {
    this.spa = this.safeParseAsync;
    this._def = def2;
    this.parse = this.parse.bind(this);
    this.safeParse = this.safeParse.bind(this);
    this.parseAsync = this.parseAsync.bind(this);
    this.safeParseAsync = this.safeParseAsync.bind(this);
    this.spa = this.spa.bind(this);
    this.refine = this.refine.bind(this);
    this.refinement = this.refinement.bind(this);
    this.superRefine = this.superRefine.bind(this);
    this.optional = this.optional.bind(this);
    this.nullable = this.nullable.bind(this);
    this.nullish = this.nullish.bind(this);
    this.array = this.array.bind(this);
    this.promise = this.promise.bind(this);
    this.or = this.or.bind(this);
    this.and = this.and.bind(this);
    this.transform = this.transform.bind(this);
    this.brand = this.brand.bind(this);
    this.default = this.default.bind(this);
    this.catch = this.catch.bind(this);
    this.describe = this.describe.bind(this);
    this.pipe = this.pipe.bind(this);
    this.readonly = this.readonly.bind(this);
    this.isNullable = this.isNullable.bind(this);
    this.isOptional = this.isOptional.bind(this);
  }
  get description() {
    return this._def.description;
  }
  _getType(input) {
    return getParsedType(input.data);
  }
  _getOrReturnCtx(input, ctx) {
    return ctx || {
      common: input.parent.common,
      data: input.data,
      parsedType: getParsedType(input.data),
      schemaErrorMap: this._def.errorMap,
      path: input.path,
      parent: input.parent
    };
  }
  _processInputParams(input) {
    return {
      status: new ParseStatus(),
      ctx: {
        common: input.parent.common,
        data: input.data,
        parsedType: getParsedType(input.data),
        schemaErrorMap: this._def.errorMap,
        path: input.path,
        parent: input.parent
      }
    };
  }
  _parseSync(input) {
    const result = this._parse(input);
    if (isAsync(result)) {
      throw new Error("Synchronous parse encountered promise.");
    }
    return result;
  }
  _parseAsync(input) {
    const result = this._parse(input);
    return Promise.resolve(result);
  }
  parse(data, params) {
    const result = this.safeParse(data, params);
    if (result.success)
      return result.data;
    throw result.error;
  }
  safeParse(data, params) {
    var _a2;
    const ctx = {
      common: {
        issues: [],
        async: (_a2 = params === null || params === void 0 ? void 0 : params.async) !== null && _a2 !== void 0 ? _a2 : false,
        contextualErrorMap: params === null || params === void 0 ? void 0 : params.errorMap
      },
      path: (params === null || params === void 0 ? void 0 : params.path) || [],
      schemaErrorMap: this._def.errorMap,
      parent: null,
      data,
      parsedType: getParsedType(data)
    };
    const result = this._parseSync({ data, path: ctx.path, parent: ctx });
    return handleResult(ctx, result);
  }
  async parseAsync(data, params) {
    const result = await this.safeParseAsync(data, params);
    if (result.success)
      return result.data;
    throw result.error;
  }
  async safeParseAsync(data, params) {
    const ctx = {
      common: {
        issues: [],
        contextualErrorMap: params === null || params === void 0 ? void 0 : params.errorMap,
        async: true
      },
      path: (params === null || params === void 0 ? void 0 : params.path) || [],
      schemaErrorMap: this._def.errorMap,
      parent: null,
      data,
      parsedType: getParsedType(data)
    };
    const maybeAsyncResult = this._parse({ data, path: ctx.path, parent: ctx });
    const result = await (isAsync(maybeAsyncResult) ? maybeAsyncResult : Promise.resolve(maybeAsyncResult));
    return handleResult(ctx, result);
  }
  refine(check, message) {
    const getIssueProperties = (val) => {
      if (typeof message === "string" || typeof message === "undefined") {
        return { message };
      } else if (typeof message === "function") {
        return message(val);
      } else {
        return message;
      }
    };
    return this._refinement((val, ctx) => {
      const result = check(val);
      const setError = () => ctx.addIssue({
        code: ZodIssueCode.custom,
        ...getIssueProperties(val)
      });
      if (typeof Promise !== "undefined" && result instanceof Promise) {
        return result.then((data) => {
          if (!data) {
            setError();
            return false;
          } else {
            return true;
          }
        });
      }
      if (!result) {
        setError();
        return false;
      } else {
        return true;
      }
    });
  }
  refinement(check, refinementData) {
    return this._refinement((val, ctx) => {
      if (!check(val)) {
        ctx.addIssue(typeof refinementData === "function" ? refinementData(val, ctx) : refinementData);
        return false;
      } else {
        return true;
      }
    });
  }
  _refinement(refinement) {
    return new ZodEffects({
      schema: this,
      typeName: ZodFirstPartyTypeKind.ZodEffects,
      effect: { type: "refinement", refinement }
    });
  }
  superRefine(refinement) {
    return this._refinement(refinement);
  }
  optional() {
    return ZodOptional.create(this, this._def);
  }
  nullable() {
    return ZodNullable.create(this, this._def);
  }
  nullish() {
    return this.nullable().optional();
  }
  array() {
    return ZodArray.create(this, this._def);
  }
  promise() {
    return ZodPromise.create(this, this._def);
  }
  or(option2) {
    return ZodUnion.create([this, option2], this._def);
  }
  and(incoming) {
    return ZodIntersection.create(this, incoming, this._def);
  }
  transform(transform) {
    return new ZodEffects({
      ...processCreateParams(this._def),
      schema: this,
      typeName: ZodFirstPartyTypeKind.ZodEffects,
      effect: { type: "transform", transform }
    });
  }
  default(def2) {
    const defaultValueFunc = typeof def2 === "function" ? def2 : () => def2;
    return new ZodDefault({
      ...processCreateParams(this._def),
      innerType: this,
      defaultValue: defaultValueFunc,
      typeName: ZodFirstPartyTypeKind.ZodDefault
    });
  }
  brand() {
    return new ZodBranded({
      typeName: ZodFirstPartyTypeKind.ZodBranded,
      type: this,
      ...processCreateParams(this._def)
    });
  }
  catch(def2) {
    const catchValueFunc = typeof def2 === "function" ? def2 : () => def2;
    return new ZodCatch({
      ...processCreateParams(this._def),
      innerType: this,
      catchValue: catchValueFunc,
      typeName: ZodFirstPartyTypeKind.ZodCatch
    });
  }
  describe(description2) {
    const This = this.constructor;
    return new This({
      ...this._def,
      description: description2
    });
  }
  pipe(target) {
    return ZodPipeline.create(this, target);
  }
  readonly() {
    return ZodReadonly.create(this);
  }
  isOptional() {
    return this.safeParse(void 0).success;
  }
  isNullable() {
    return this.safeParse(null).success;
  }
}
const cuidRegex = /^c[^\s-]{8,}$/i;
const cuid2Regex = /^[0-9a-z]+$/;
const ulidRegex = /^[0-9A-HJKMNP-TV-Z]{26}$/;
const uuidRegex = /^[0-9a-fA-F]{8}\b-[0-9a-fA-F]{4}\b-[0-9a-fA-F]{4}\b-[0-9a-fA-F]{4}\b-[0-9a-fA-F]{12}$/i;
const nanoidRegex = /^[a-z0-9_-]{21}$/i;
const durationRegex = /^[-+]?P(?!$)(?:(?:[-+]?\d+Y)|(?:[-+]?\d+[.,]\d+Y$))?(?:(?:[-+]?\d+M)|(?:[-+]?\d+[.,]\d+M$))?(?:(?:[-+]?\d+W)|(?:[-+]?\d+[.,]\d+W$))?(?:(?:[-+]?\d+D)|(?:[-+]?\d+[.,]\d+D$))?(?:T(?=[\d+-])(?:(?:[-+]?\d+H)|(?:[-+]?\d+[.,]\d+H$))?(?:(?:[-+]?\d+M)|(?:[-+]?\d+[.,]\d+M$))?(?:[-+]?\d+(?:[.,]\d+)?S)?)??$/;
const emailRegex = /^(?!\.)(?!.*\.\.)([A-Z0-9_'+\-\.]*)[A-Z0-9_+-]@([A-Z0-9][A-Z0-9\-]*\.)+[A-Z]{2,}$/i;
const _emojiRegex = `^(\\p{Extended_Pictographic}|\\p{Emoji_Component})+$`;
let emojiRegex;
const ipv4Regex = /^(?:(?:25[0-5]|2[0-4][0-9]|1[0-9][0-9]|[1-9][0-9]|[0-9])\.){3}(?:25[0-5]|2[0-4][0-9]|1[0-9][0-9]|[1-9][0-9]|[0-9])$/;
const ipv6Regex = /^(([a-f0-9]{1,4}:){7}|::([a-f0-9]{1,4}:){0,6}|([a-f0-9]{1,4}:){1}:([a-f0-9]{1,4}:){0,5}|([a-f0-9]{1,4}:){2}:([a-f0-9]{1,4}:){0,4}|([a-f0-9]{1,4}:){3}:([a-f0-9]{1,4}:){0,3}|([a-f0-9]{1,4}:){4}:([a-f0-9]{1,4}:){0,2}|([a-f0-9]{1,4}:){5}:([a-f0-9]{1,4}:){0,1})([a-f0-9]{1,4}|(((25[0-5])|(2[0-4][0-9])|(1[0-9]{2})|([0-9]{1,2}))\.){3}((25[0-5])|(2[0-4][0-9])|(1[0-9]{2})|([0-9]{1,2})))$/;
const base64Regex = /^([0-9a-zA-Z+/]{4})*(([0-9a-zA-Z+/]{2}==)|([0-9a-zA-Z+/]{3}=))?$/;
const dateRegexSource = `((\\d\\d[2468][048]|\\d\\d[13579][26]|\\d\\d0[48]|[02468][048]00|[13579][26]00)-02-29|\\d{4}-((0[13578]|1[02])-(0[1-9]|[12]\\d|3[01])|(0[469]|11)-(0[1-9]|[12]\\d|30)|(02)-(0[1-9]|1\\d|2[0-8])))`;
const dateRegex = new RegExp(`^${dateRegexSource}$`);
function timeRegexSource(args) {
  let regex = `([01]\\d|2[0-3]):[0-5]\\d:[0-5]\\d`;
  if (args.precision) {
    regex = `${regex}\\.\\d{${args.precision}}`;
  } else if (args.precision == null) {
    regex = `${regex}(\\.\\d+)?`;
  }
  return regex;
}
function timeRegex(args) {
  return new RegExp(`^${timeRegexSource(args)}$`);
}
function datetimeRegex(args) {
  let regex = `${dateRegexSource}T${timeRegexSource(args)}`;
  const opts = [];
  opts.push(args.local ? `Z?` : `Z`);
  if (args.offset)
    opts.push(`([+-]\\d{2}:?\\d{2})`);
  regex = `${regex}(${opts.join("|")})`;
  return new RegExp(`^${regex}$`);
}
function isValidIP(ip, version2) {
  if ((version2 === "v4" || !version2) && ipv4Regex.test(ip)) {
    return true;
  }
  if ((version2 === "v6" || !version2) && ipv6Regex.test(ip)) {
    return true;
  }
  return false;
}
class ZodString extends ZodType {
  _parse(input) {
    if (this._def.coerce) {
      input.data = String(input.data);
    }
    const parsedType = this._getType(input);
    if (parsedType !== ZodParsedType.string) {
      const ctx2 = this._getOrReturnCtx(input);
      addIssueToContext(ctx2, {
        code: ZodIssueCode.invalid_type,
        expected: ZodParsedType.string,
        received: ctx2.parsedType
      });
      return INVALID;
    }
    const status = new ParseStatus();
    let ctx = void 0;
    for (const check of this._def.checks) {
      if (check.kind === "min") {
        if (input.data.length < check.value) {
          ctx = this._getOrReturnCtx(input, ctx);
          addIssueToContext(ctx, {
            code: ZodIssueCode.too_small,
            minimum: check.value,
            type: "string",
            inclusive: true,
            exact: false,
            message: check.message
          });
          status.dirty();
        }
      } else if (check.kind === "max") {
        if (input.data.length > check.value) {
          ctx = this._getOrReturnCtx(input, ctx);
          addIssueToContext(ctx, {
            code: ZodIssueCode.too_big,
            maximum: check.value,
            type: "string",
            inclusive: true,
            exact: false,
            message: check.message
          });
          status.dirty();
        }
      } else if (check.kind === "length") {
        const tooBig = input.data.length > check.value;
        const tooSmall = input.data.length < check.value;
        if (tooBig || tooSmall) {
          ctx = this._getOrReturnCtx(input, ctx);
          if (tooBig) {
            addIssueToContext(ctx, {
              code: ZodIssueCode.too_big,
              maximum: check.value,
              type: "string",
              inclusive: true,
              exact: true,
              message: check.message
            });
          } else if (tooSmall) {
            addIssueToContext(ctx, {
              code: ZodIssueCode.too_small,
              minimum: check.value,
              type: "string",
              inclusive: true,
              exact: true,
              message: check.message
            });
          }
          status.dirty();
        }
      } else if (check.kind === "email") {
        if (!emailRegex.test(input.data)) {
          ctx = this._getOrReturnCtx(input, ctx);
          addIssueToContext(ctx, {
            validation: "email",
            code: ZodIssueCode.invalid_string,
            message: check.message
          });
          status.dirty();
        }
      } else if (check.kind === "emoji") {
        if (!emojiRegex) {
          emojiRegex = new RegExp(_emojiRegex, "u");
        }
        if (!emojiRegex.test(input.data)) {
          ctx = this._getOrReturnCtx(input, ctx);
          addIssueToContext(ctx, {
            validation: "emoji",
            code: ZodIssueCode.invalid_string,
            message: check.message
          });
          status.dirty();
        }
      } else if (check.kind === "uuid") {
        if (!uuidRegex.test(input.data)) {
          ctx = this._getOrReturnCtx(input, ctx);
          addIssueToContext(ctx, {
            validation: "uuid",
            code: ZodIssueCode.invalid_string,
            message: check.message
          });
          status.dirty();
        }
      } else if (check.kind === "nanoid") {
        if (!nanoidRegex.test(input.data)) {
          ctx = this._getOrReturnCtx(input, ctx);
          addIssueToContext(ctx, {
            validation: "nanoid",
            code: ZodIssueCode.invalid_string,
            message: check.message
          });
          status.dirty();
        }
      } else if (check.kind === "cuid") {
        if (!cuidRegex.test(input.data)) {
          ctx = this._getOrReturnCtx(input, ctx);
          addIssueToContext(ctx, {
            validation: "cuid",
            code: ZodIssueCode.invalid_string,
            message: check.message
          });
          status.dirty();
        }
      } else if (check.kind === "cuid2") {
        if (!cuid2Regex.test(input.data)) {
          ctx = this._getOrReturnCtx(input, ctx);
          addIssueToContext(ctx, {
            validation: "cuid2",
            code: ZodIssueCode.invalid_string,
            message: check.message
          });
          status.dirty();
        }
      } else if (check.kind === "ulid") {
        if (!ulidRegex.test(input.data)) {
          ctx = this._getOrReturnCtx(input, ctx);
          addIssueToContext(ctx, {
            validation: "ulid",
            code: ZodIssueCode.invalid_string,
            message: check.message
          });
          status.dirty();
        }
      } else if (check.kind === "url") {
        try {
          new URL(input.data);
        } catch (_a2) {
          ctx = this._getOrReturnCtx(input, ctx);
          addIssueToContext(ctx, {
            validation: "url",
            code: ZodIssueCode.invalid_string,
            message: check.message
          });
          status.dirty();
        }
      } else if (check.kind === "regex") {
        check.regex.lastIndex = 0;
        const testResult = check.regex.test(input.data);
        if (!testResult) {
          ctx = this._getOrReturnCtx(input, ctx);
          addIssueToContext(ctx, {
            validation: "regex",
            code: ZodIssueCode.invalid_string,
            message: check.message
          });
          status.dirty();
        }
      } else if (check.kind === "trim") {
        input.data = input.data.trim();
      } else if (check.kind === "includes") {
        if (!input.data.includes(check.value, check.position)) {
          ctx = this._getOrReturnCtx(input, ctx);
          addIssueToContext(ctx, {
            code: ZodIssueCode.invalid_string,
            validation: { includes: check.value, position: check.position },
            message: check.message
          });
          status.dirty();
        }
      } else if (check.kind === "toLowerCase") {
        input.data = input.data.toLowerCase();
      } else if (check.kind === "toUpperCase") {
        input.data = input.data.toUpperCase();
      } else if (check.kind === "startsWith") {
        if (!input.data.startsWith(check.value)) {
          ctx = this._getOrReturnCtx(input, ctx);
          addIssueToContext(ctx, {
            code: ZodIssueCode.invalid_string,
            validation: { startsWith: check.value },
            message: check.message
          });
          status.dirty();
        }
      } else if (check.kind === "endsWith") {
        if (!input.data.endsWith(check.value)) {
          ctx = this._getOrReturnCtx(input, ctx);
          addIssueToContext(ctx, {
            code: ZodIssueCode.invalid_string,
            validation: { endsWith: check.value },
            message: check.message
          });
          status.dirty();
        }
      } else if (check.kind === "datetime") {
        const regex = datetimeRegex(check);
        if (!regex.test(input.data)) {
          ctx = this._getOrReturnCtx(input, ctx);
          addIssueToContext(ctx, {
            code: ZodIssueCode.invalid_string,
            validation: "datetime",
            message: check.message
          });
          status.dirty();
        }
      } else if (check.kind === "date") {
        const regex = dateRegex;
        if (!regex.test(input.data)) {
          ctx = this._getOrReturnCtx(input, ctx);
          addIssueToContext(ctx, {
            code: ZodIssueCode.invalid_string,
            validation: "date",
            message: check.message
          });
          status.dirty();
        }
      } else if (check.kind === "time") {
        const regex = timeRegex(check);
        if (!regex.test(input.data)) {
          ctx = this._getOrReturnCtx(input, ctx);
          addIssueToContext(ctx, {
            code: ZodIssueCode.invalid_string,
            validation: "time",
            message: check.message
          });
          status.dirty();
        }
      } else if (check.kind === "duration") {
        if (!durationRegex.test(input.data)) {
          ctx = this._getOrReturnCtx(input, ctx);
          addIssueToContext(ctx, {
            validation: "duration",
            code: ZodIssueCode.invalid_string,
            message: check.message
          });
          status.dirty();
        }
      } else if (check.kind === "ip") {
        if (!isValidIP(input.data, check.version)) {
          ctx = this._getOrReturnCtx(input, ctx);
          addIssueToContext(ctx, {
            validation: "ip",
            code: ZodIssueCode.invalid_string,
            message: check.message
          });
          status.dirty();
        }
      } else if (check.kind === "base64") {
        if (!base64Regex.test(input.data)) {
          ctx = this._getOrReturnCtx(input, ctx);
          addIssueToContext(ctx, {
            validation: "base64",
            code: ZodIssueCode.invalid_string,
            message: check.message
          });
          status.dirty();
        }
      } else {
        util.assertNever(check);
      }
    }
    return { status: status.value, value: input.data };
  }
  _regex(regex, validation, message) {
    return this.refinement((data) => regex.test(data), {
      validation,
      code: ZodIssueCode.invalid_string,
      ...errorUtil.errToObj(message)
    });
  }
  _addCheck(check) {
    return new ZodString({
      ...this._def,
      checks: [...this._def.checks, check]
    });
  }
  email(message) {
    return this._addCheck({ kind: "email", ...errorUtil.errToObj(message) });
  }
  url(message) {
    return this._addCheck({ kind: "url", ...errorUtil.errToObj(message) });
  }
  emoji(message) {
    return this._addCheck({ kind: "emoji", ...errorUtil.errToObj(message) });
  }
  uuid(message) {
    return this._addCheck({ kind: "uuid", ...errorUtil.errToObj(message) });
  }
  nanoid(message) {
    return this._addCheck({ kind: "nanoid", ...errorUtil.errToObj(message) });
  }
  cuid(message) {
    return this._addCheck({ kind: "cuid", ...errorUtil.errToObj(message) });
  }
  cuid2(message) {
    return this._addCheck({ kind: "cuid2", ...errorUtil.errToObj(message) });
  }
  ulid(message) {
    return this._addCheck({ kind: "ulid", ...errorUtil.errToObj(message) });
  }
  base64(message) {
    return this._addCheck({ kind: "base64", ...errorUtil.errToObj(message) });
  }
  ip(options) {
    return this._addCheck({ kind: "ip", ...errorUtil.errToObj(options) });
  }
  datetime(options) {
    var _a2, _b;
    if (typeof options === "string") {
      return this._addCheck({
        kind: "datetime",
        precision: null,
        offset: false,
        local: false,
        message: options
      });
    }
    return this._addCheck({
      kind: "datetime",
      precision: typeof (options === null || options === void 0 ? void 0 : options.precision) === "undefined" ? null : options === null || options === void 0 ? void 0 : options.precision,
      offset: (_a2 = options === null || options === void 0 ? void 0 : options.offset) !== null && _a2 !== void 0 ? _a2 : false,
      local: (_b = options === null || options === void 0 ? void 0 : options.local) !== null && _b !== void 0 ? _b : false,
      ...errorUtil.errToObj(options === null || options === void 0 ? void 0 : options.message)
    });
  }
  date(message) {
    return this._addCheck({ kind: "date", message });
  }
  time(options) {
    if (typeof options === "string") {
      return this._addCheck({
        kind: "time",
        precision: null,
        message: options
      });
    }
    return this._addCheck({
      kind: "time",
      precision: typeof (options === null || options === void 0 ? void 0 : options.precision) === "undefined" ? null : options === null || options === void 0 ? void 0 : options.precision,
      ...errorUtil.errToObj(options === null || options === void 0 ? void 0 : options.message)
    });
  }
  duration(message) {
    return this._addCheck({ kind: "duration", ...errorUtil.errToObj(message) });
  }
  regex(regex, message) {
    return this._addCheck({
      kind: "regex",
      regex,
      ...errorUtil.errToObj(message)
    });
  }
  includes(value, options) {
    return this._addCheck({
      kind: "includes",
      value,
      position: options === null || options === void 0 ? void 0 : options.position,
      ...errorUtil.errToObj(options === null || options === void 0 ? void 0 : options.message)
    });
  }
  startsWith(value, message) {
    return this._addCheck({
      kind: "startsWith",
      value,
      ...errorUtil.errToObj(message)
    });
  }
  endsWith(value, message) {
    return this._addCheck({
      kind: "endsWith",
      value,
      ...errorUtil.errToObj(message)
    });
  }
  min(minLength, message) {
    return this._addCheck({
      kind: "min",
      value: minLength,
      ...errorUtil.errToObj(message)
    });
  }
  max(maxLength, message) {
    return this._addCheck({
      kind: "max",
      value: maxLength,
      ...errorUtil.errToObj(message)
    });
  }
  length(len, message) {
    return this._addCheck({
      kind: "length",
      value: len,
      ...errorUtil.errToObj(message)
    });
  }
  /**
   * @deprecated Use z.string().min(1) instead.
   * @see {@link ZodString.min}
   */
  nonempty(message) {
    return this.min(1, errorUtil.errToObj(message));
  }
  trim() {
    return new ZodString({
      ...this._def,
      checks: [...this._def.checks, { kind: "trim" }]
    });
  }
  toLowerCase() {
    return new ZodString({
      ...this._def,
      checks: [...this._def.checks, { kind: "toLowerCase" }]
    });
  }
  toUpperCase() {
    return new ZodString({
      ...this._def,
      checks: [...this._def.checks, { kind: "toUpperCase" }]
    });
  }
  get isDatetime() {
    return !!this._def.checks.find((ch) => ch.kind === "datetime");
  }
  get isDate() {
    return !!this._def.checks.find((ch) => ch.kind === "date");
  }
  get isTime() {
    return !!this._def.checks.find((ch) => ch.kind === "time");
  }
  get isDuration() {
    return !!this._def.checks.find((ch) => ch.kind === "duration");
  }
  get isEmail() {
    return !!this._def.checks.find((ch) => ch.kind === "email");
  }
  get isURL() {
    return !!this._def.checks.find((ch) => ch.kind === "url");
  }
  get isEmoji() {
    return !!this._def.checks.find((ch) => ch.kind === "emoji");
  }
  get isUUID() {
    return !!this._def.checks.find((ch) => ch.kind === "uuid");
  }
  get isNANOID() {
    return !!this._def.checks.find((ch) => ch.kind === "nanoid");
  }
  get isCUID() {
    return !!this._def.checks.find((ch) => ch.kind === "cuid");
  }
  get isCUID2() {
    return !!this._def.checks.find((ch) => ch.kind === "cuid2");
  }
  get isULID() {
    return !!this._def.checks.find((ch) => ch.kind === "ulid");
  }
  get isIP() {
    return !!this._def.checks.find((ch) => ch.kind === "ip");
  }
  get isBase64() {
    return !!this._def.checks.find((ch) => ch.kind === "base64");
  }
  get minLength() {
    let min2 = null;
    for (const ch of this._def.checks) {
      if (ch.kind === "min") {
        if (min2 === null || ch.value > min2)
          min2 = ch.value;
      }
    }
    return min2;
  }
  get maxLength() {
    let max2 = null;
    for (const ch of this._def.checks) {
      if (ch.kind === "max") {
        if (max2 === null || ch.value < max2)
          max2 = ch.value;
      }
    }
    return max2;
  }
}
ZodString.create = (params) => {
  var _a2;
  return new ZodString({
    checks: [],
    typeName: ZodFirstPartyTypeKind.ZodString,
    coerce: (_a2 = params === null || params === void 0 ? void 0 : params.coerce) !== null && _a2 !== void 0 ? _a2 : false,
    ...processCreateParams(params)
  });
};
function floatSafeRemainder(val, step) {
  const valDecCount = (val.toString().split(".")[1] || "").length;
  const stepDecCount = (step.toString().split(".")[1] || "").length;
  const decCount = valDecCount > stepDecCount ? valDecCount : stepDecCount;
  const valInt = parseInt(val.toFixed(decCount).replace(".", ""));
  const stepInt = parseInt(step.toFixed(decCount).replace(".", ""));
  return valInt % stepInt / Math.pow(10, decCount);
}
class ZodNumber extends ZodType {
  constructor() {
    super(...arguments);
    this.min = this.gte;
    this.max = this.lte;
    this.step = this.multipleOf;
  }
  _parse(input) {
    if (this._def.coerce) {
      input.data = Number(input.data);
    }
    const parsedType = this._getType(input);
    if (parsedType !== ZodParsedType.number) {
      const ctx2 = this._getOrReturnCtx(input);
      addIssueToContext(ctx2, {
        code: ZodIssueCode.invalid_type,
        expected: ZodParsedType.number,
        received: ctx2.parsedType
      });
      return INVALID;
    }
    let ctx = void 0;
    const status = new ParseStatus();
    for (const check of this._def.checks) {
      if (check.kind === "int") {
        if (!util.isInteger(input.data)) {
          ctx = this._getOrReturnCtx(input, ctx);
          addIssueToContext(ctx, {
            code: ZodIssueCode.invalid_type,
            expected: "integer",
            received: "float",
            message: check.message
          });
          status.dirty();
        }
      } else if (check.kind === "min") {
        const tooSmall = check.inclusive ? input.data < check.value : input.data <= check.value;
        if (tooSmall) {
          ctx = this._getOrReturnCtx(input, ctx);
          addIssueToContext(ctx, {
            code: ZodIssueCode.too_small,
            minimum: check.value,
            type: "number",
            inclusive: check.inclusive,
            exact: false,
            message: check.message
          });
          status.dirty();
        }
      } else if (check.kind === "max") {
        const tooBig = check.inclusive ? input.data > check.value : input.data >= check.value;
        if (tooBig) {
          ctx = this._getOrReturnCtx(input, ctx);
          addIssueToContext(ctx, {
            code: ZodIssueCode.too_big,
            maximum: check.value,
            type: "number",
            inclusive: check.inclusive,
            exact: false,
            message: check.message
          });
          status.dirty();
        }
      } else if (check.kind === "multipleOf") {
        if (floatSafeRemainder(input.data, check.value) !== 0) {
          ctx = this._getOrReturnCtx(input, ctx);
          addIssueToContext(ctx, {
            code: ZodIssueCode.not_multiple_of,
            multipleOf: check.value,
            message: check.message
          });
          status.dirty();
        }
      } else if (check.kind === "finite") {
        if (!Number.isFinite(input.data)) {
          ctx = this._getOrReturnCtx(input, ctx);
          addIssueToContext(ctx, {
            code: ZodIssueCode.not_finite,
            message: check.message
          });
          status.dirty();
        }
      } else {
        util.assertNever(check);
      }
    }
    return { status: status.value, value: input.data };
  }
  gte(value, message) {
    return this.setLimit("min", value, true, errorUtil.toString(message));
  }
  gt(value, message) {
    return this.setLimit("min", value, false, errorUtil.toString(message));
  }
  lte(value, message) {
    return this.setLimit("max", value, true, errorUtil.toString(message));
  }
  lt(value, message) {
    return this.setLimit("max", value, false, errorUtil.toString(message));
  }
  setLimit(kind, value, inclusive, message) {
    return new ZodNumber({
      ...this._def,
      checks: [
        ...this._def.checks,
        {
          kind,
          value,
          inclusive,
          message: errorUtil.toString(message)
        }
      ]
    });
  }
  _addCheck(check) {
    return new ZodNumber({
      ...this._def,
      checks: [...this._def.checks, check]
    });
  }
  int(message) {
    return this._addCheck({
      kind: "int",
      message: errorUtil.toString(message)
    });
  }
  positive(message) {
    return this._addCheck({
      kind: "min",
      value: 0,
      inclusive: false,
      message: errorUtil.toString(message)
    });
  }
  negative(message) {
    return this._addCheck({
      kind: "max",
      value: 0,
      inclusive: false,
      message: errorUtil.toString(message)
    });
  }
  nonpositive(message) {
    return this._addCheck({
      kind: "max",
      value: 0,
      inclusive: true,
      message: errorUtil.toString(message)
    });
  }
  nonnegative(message) {
    return this._addCheck({
      kind: "min",
      value: 0,
      inclusive: true,
      message: errorUtil.toString(message)
    });
  }
  multipleOf(value, message) {
    return this._addCheck({
      kind: "multipleOf",
      value,
      message: errorUtil.toString(message)
    });
  }
  finite(message) {
    return this._addCheck({
      kind: "finite",
      message: errorUtil.toString(message)
    });
  }
  safe(message) {
    return this._addCheck({
      kind: "min",
      inclusive: true,
      value: Number.MIN_SAFE_INTEGER,
      message: errorUtil.toString(message)
    })._addCheck({
      kind: "max",
      inclusive: true,
      value: Number.MAX_SAFE_INTEGER,
      message: errorUtil.toString(message)
    });
  }
  get minValue() {
    let min2 = null;
    for (const ch of this._def.checks) {
      if (ch.kind === "min") {
        if (min2 === null || ch.value > min2)
          min2 = ch.value;
      }
    }
    return min2;
  }
  get maxValue() {
    let max2 = null;
    for (const ch of this._def.checks) {
      if (ch.kind === "max") {
        if (max2 === null || ch.value < max2)
          max2 = ch.value;
      }
    }
    return max2;
  }
  get isInt() {
    return !!this._def.checks.find((ch) => ch.kind === "int" || ch.kind === "multipleOf" && util.isInteger(ch.value));
  }
  get isFinite() {
    let max2 = null, min2 = null;
    for (const ch of this._def.checks) {
      if (ch.kind === "finite" || ch.kind === "int" || ch.kind === "multipleOf") {
        return true;
      } else if (ch.kind === "min") {
        if (min2 === null || ch.value > min2)
          min2 = ch.value;
      } else if (ch.kind === "max") {
        if (max2 === null || ch.value < max2)
          max2 = ch.value;
      }
    }
    return Number.isFinite(min2) && Number.isFinite(max2);
  }
}
ZodNumber.create = (params) => {
  return new ZodNumber({
    checks: [],
    typeName: ZodFirstPartyTypeKind.ZodNumber,
    coerce: (params === null || params === void 0 ? void 0 : params.coerce) || false,
    ...processCreateParams(params)
  });
};
class ZodBigInt extends ZodType {
  constructor() {
    super(...arguments);
    this.min = this.gte;
    this.max = this.lte;
  }
  _parse(input) {
    if (this._def.coerce) {
      input.data = BigInt(input.data);
    }
    const parsedType = this._getType(input);
    if (parsedType !== ZodParsedType.bigint) {
      const ctx2 = this._getOrReturnCtx(input);
      addIssueToContext(ctx2, {
        code: ZodIssueCode.invalid_type,
        expected: ZodParsedType.bigint,
        received: ctx2.parsedType
      });
      return INVALID;
    }
    let ctx = void 0;
    const status = new ParseStatus();
    for (const check of this._def.checks) {
      if (check.kind === "min") {
        const tooSmall = check.inclusive ? input.data < check.value : input.data <= check.value;
        if (tooSmall) {
          ctx = this._getOrReturnCtx(input, ctx);
          addIssueToContext(ctx, {
            code: ZodIssueCode.too_small,
            type: "bigint",
            minimum: check.value,
            inclusive: check.inclusive,
            message: check.message
          });
          status.dirty();
        }
      } else if (check.kind === "max") {
        const tooBig = check.inclusive ? input.data > check.value : input.data >= check.value;
        if (tooBig) {
          ctx = this._getOrReturnCtx(input, ctx);
          addIssueToContext(ctx, {
            code: ZodIssueCode.too_big,
            type: "bigint",
            maximum: check.value,
            inclusive: check.inclusive,
            message: check.message
          });
          status.dirty();
        }
      } else if (check.kind === "multipleOf") {
        if (input.data % check.value !== BigInt(0)) {
          ctx = this._getOrReturnCtx(input, ctx);
          addIssueToContext(ctx, {
            code: ZodIssueCode.not_multiple_of,
            multipleOf: check.value,
            message: check.message
          });
          status.dirty();
        }
      } else {
        util.assertNever(check);
      }
    }
    return { status: status.value, value: input.data };
  }
  gte(value, message) {
    return this.setLimit("min", value, true, errorUtil.toString(message));
  }
  gt(value, message) {
    return this.setLimit("min", value, false, errorUtil.toString(message));
  }
  lte(value, message) {
    return this.setLimit("max", value, true, errorUtil.toString(message));
  }
  lt(value, message) {
    return this.setLimit("max", value, false, errorUtil.toString(message));
  }
  setLimit(kind, value, inclusive, message) {
    return new ZodBigInt({
      ...this._def,
      checks: [
        ...this._def.checks,
        {
          kind,
          value,
          inclusive,
          message: errorUtil.toString(message)
        }
      ]
    });
  }
  _addCheck(check) {
    return new ZodBigInt({
      ...this._def,
      checks: [...this._def.checks, check]
    });
  }
  positive(message) {
    return this._addCheck({
      kind: "min",
      value: BigInt(0),
      inclusive: false,
      message: errorUtil.toString(message)
    });
  }
  negative(message) {
    return this._addCheck({
      kind: "max",
      value: BigInt(0),
      inclusive: false,
      message: errorUtil.toString(message)
    });
  }
  nonpositive(message) {
    return this._addCheck({
      kind: "max",
      value: BigInt(0),
      inclusive: true,
      message: errorUtil.toString(message)
    });
  }
  nonnegative(message) {
    return this._addCheck({
      kind: "min",
      value: BigInt(0),
      inclusive: true,
      message: errorUtil.toString(message)
    });
  }
  multipleOf(value, message) {
    return this._addCheck({
      kind: "multipleOf",
      value,
      message: errorUtil.toString(message)
    });
  }
  get minValue() {
    let min2 = null;
    for (const ch of this._def.checks) {
      if (ch.kind === "min") {
        if (min2 === null || ch.value > min2)
          min2 = ch.value;
      }
    }
    return min2;
  }
  get maxValue() {
    let max2 = null;
    for (const ch of this._def.checks) {
      if (ch.kind === "max") {
        if (max2 === null || ch.value < max2)
          max2 = ch.value;
      }
    }
    return max2;
  }
}
ZodBigInt.create = (params) => {
  var _a2;
  return new ZodBigInt({
    checks: [],
    typeName: ZodFirstPartyTypeKind.ZodBigInt,
    coerce: (_a2 = params === null || params === void 0 ? void 0 : params.coerce) !== null && _a2 !== void 0 ? _a2 : false,
    ...processCreateParams(params)
  });
};
class ZodBoolean extends ZodType {
  _parse(input) {
    if (this._def.coerce) {
      input.data = Boolean(input.data);
    }
    const parsedType = this._getType(input);
    if (parsedType !== ZodParsedType.boolean) {
      const ctx = this._getOrReturnCtx(input);
      addIssueToContext(ctx, {
        code: ZodIssueCode.invalid_type,
        expected: ZodParsedType.boolean,
        received: ctx.parsedType
      });
      return INVALID;
    }
    return OK(input.data);
  }
}
ZodBoolean.create = (params) => {
  return new ZodBoolean({
    typeName: ZodFirstPartyTypeKind.ZodBoolean,
    coerce: (params === null || params === void 0 ? void 0 : params.coerce) || false,
    ...processCreateParams(params)
  });
};
class ZodDate extends ZodType {
  _parse(input) {
    if (this._def.coerce) {
      input.data = new Date(input.data);
    }
    const parsedType = this._getType(input);
    if (parsedType !== ZodParsedType.date) {
      const ctx2 = this._getOrReturnCtx(input);
      addIssueToContext(ctx2, {
        code: ZodIssueCode.invalid_type,
        expected: ZodParsedType.date,
        received: ctx2.parsedType
      });
      return INVALID;
    }
    if (isNaN(input.data.getTime())) {
      const ctx2 = this._getOrReturnCtx(input);
      addIssueToContext(ctx2, {
        code: ZodIssueCode.invalid_date
      });
      return INVALID;
    }
    const status = new ParseStatus();
    let ctx = void 0;
    for (const check of this._def.checks) {
      if (check.kind === "min") {
        if (input.data.getTime() < check.value) {
          ctx = this._getOrReturnCtx(input, ctx);
          addIssueToContext(ctx, {
            code: ZodIssueCode.too_small,
            message: check.message,
            inclusive: true,
            exact: false,
            minimum: check.value,
            type: "date"
          });
          status.dirty();
        }
      } else if (check.kind === "max") {
        if (input.data.getTime() > check.value) {
          ctx = this._getOrReturnCtx(input, ctx);
          addIssueToContext(ctx, {
            code: ZodIssueCode.too_big,
            message: check.message,
            inclusive: true,
            exact: false,
            maximum: check.value,
            type: "date"
          });
          status.dirty();
        }
      } else {
        util.assertNever(check);
      }
    }
    return {
      status: status.value,
      value: new Date(input.data.getTime())
    };
  }
  _addCheck(check) {
    return new ZodDate({
      ...this._def,
      checks: [...this._def.checks, check]
    });
  }
  min(minDate, message) {
    return this._addCheck({
      kind: "min",
      value: minDate.getTime(),
      message: errorUtil.toString(message)
    });
  }
  max(maxDate, message) {
    return this._addCheck({
      kind: "max",
      value: maxDate.getTime(),
      message: errorUtil.toString(message)
    });
  }
  get minDate() {
    let min2 = null;
    for (const ch of this._def.checks) {
      if (ch.kind === "min") {
        if (min2 === null || ch.value > min2)
          min2 = ch.value;
      }
    }
    return min2 != null ? new Date(min2) : null;
  }
  get maxDate() {
    let max2 = null;
    for (const ch of this._def.checks) {
      if (ch.kind === "max") {
        if (max2 === null || ch.value < max2)
          max2 = ch.value;
      }
    }
    return max2 != null ? new Date(max2) : null;
  }
}
ZodDate.create = (params) => {
  return new ZodDate({
    checks: [],
    coerce: (params === null || params === void 0 ? void 0 : params.coerce) || false,
    typeName: ZodFirstPartyTypeKind.ZodDate,
    ...processCreateParams(params)
  });
};
class ZodSymbol extends ZodType {
  _parse(input) {
    const parsedType = this._getType(input);
    if (parsedType !== ZodParsedType.symbol) {
      const ctx = this._getOrReturnCtx(input);
      addIssueToContext(ctx, {
        code: ZodIssueCode.invalid_type,
        expected: ZodParsedType.symbol,
        received: ctx.parsedType
      });
      return INVALID;
    }
    return OK(input.data);
  }
}
ZodSymbol.create = (params) => {
  return new ZodSymbol({
    typeName: ZodFirstPartyTypeKind.ZodSymbol,
    ...processCreateParams(params)
  });
};
class ZodUndefined extends ZodType {
  _parse(input) {
    const parsedType = this._getType(input);
    if (parsedType !== ZodParsedType.undefined) {
      const ctx = this._getOrReturnCtx(input);
      addIssueToContext(ctx, {
        code: ZodIssueCode.invalid_type,
        expected: ZodParsedType.undefined,
        received: ctx.parsedType
      });
      return INVALID;
    }
    return OK(input.data);
  }
}
ZodUndefined.create = (params) => {
  return new ZodUndefined({
    typeName: ZodFirstPartyTypeKind.ZodUndefined,
    ...processCreateParams(params)
  });
};
class ZodNull extends ZodType {
  _parse(input) {
    const parsedType = this._getType(input);
    if (parsedType !== ZodParsedType.null) {
      const ctx = this._getOrReturnCtx(input);
      addIssueToContext(ctx, {
        code: ZodIssueCode.invalid_type,
        expected: ZodParsedType.null,
        received: ctx.parsedType
      });
      return INVALID;
    }
    return OK(input.data);
  }
}
ZodNull.create = (params) => {
  return new ZodNull({
    typeName: ZodFirstPartyTypeKind.ZodNull,
    ...processCreateParams(params)
  });
};
class ZodAny extends ZodType {
  constructor() {
    super(...arguments);
    this._any = true;
  }
  _parse(input) {
    return OK(input.data);
  }
}
ZodAny.create = (params) => {
  return new ZodAny({
    typeName: ZodFirstPartyTypeKind.ZodAny,
    ...processCreateParams(params)
  });
};
class ZodUnknown extends ZodType {
  constructor() {
    super(...arguments);
    this._unknown = true;
  }
  _parse(input) {
    return OK(input.data);
  }
}
ZodUnknown.create = (params) => {
  return new ZodUnknown({
    typeName: ZodFirstPartyTypeKind.ZodUnknown,
    ...processCreateParams(params)
  });
};
class ZodNever extends ZodType {
  _parse(input) {
    const ctx = this._getOrReturnCtx(input);
    addIssueToContext(ctx, {
      code: ZodIssueCode.invalid_type,
      expected: ZodParsedType.never,
      received: ctx.parsedType
    });
    return INVALID;
  }
}
ZodNever.create = (params) => {
  return new ZodNever({
    typeName: ZodFirstPartyTypeKind.ZodNever,
    ...processCreateParams(params)
  });
};
class ZodVoid extends ZodType {
  _parse(input) {
    const parsedType = this._getType(input);
    if (parsedType !== ZodParsedType.undefined) {
      const ctx = this._getOrReturnCtx(input);
      addIssueToContext(ctx, {
        code: ZodIssueCode.invalid_type,
        expected: ZodParsedType.void,
        received: ctx.parsedType
      });
      return INVALID;
    }
    return OK(input.data);
  }
}
ZodVoid.create = (params) => {
  return new ZodVoid({
    typeName: ZodFirstPartyTypeKind.ZodVoid,
    ...processCreateParams(params)
  });
};
class ZodArray extends ZodType {
  _parse(input) {
    const { ctx, status } = this._processInputParams(input);
    const def2 = this._def;
    if (ctx.parsedType !== ZodParsedType.array) {
      addIssueToContext(ctx, {
        code: ZodIssueCode.invalid_type,
        expected: ZodParsedType.array,
        received: ctx.parsedType
      });
      return INVALID;
    }
    if (def2.exactLength !== null) {
      const tooBig = ctx.data.length > def2.exactLength.value;
      const tooSmall = ctx.data.length < def2.exactLength.value;
      if (tooBig || tooSmall) {
        addIssueToContext(ctx, {
          code: tooBig ? ZodIssueCode.too_big : ZodIssueCode.too_small,
          minimum: tooSmall ? def2.exactLength.value : void 0,
          maximum: tooBig ? def2.exactLength.value : void 0,
          type: "array",
          inclusive: true,
          exact: true,
          message: def2.exactLength.message
        });
        status.dirty();
      }
    }
    if (def2.minLength !== null) {
      if (ctx.data.length < def2.minLength.value) {
        addIssueToContext(ctx, {
          code: ZodIssueCode.too_small,
          minimum: def2.minLength.value,
          type: "array",
          inclusive: true,
          exact: false,
          message: def2.minLength.message
        });
        status.dirty();
      }
    }
    if (def2.maxLength !== null) {
      if (ctx.data.length > def2.maxLength.value) {
        addIssueToContext(ctx, {
          code: ZodIssueCode.too_big,
          maximum: def2.maxLength.value,
          type: "array",
          inclusive: true,
          exact: false,
          message: def2.maxLength.message
        });
        status.dirty();
      }
    }
    if (ctx.common.async) {
      return Promise.all([...ctx.data].map((item, i2) => {
        return def2.type._parseAsync(new ParseInputLazyPath(ctx, item, ctx.path, i2));
      })).then((result2) => {
        return ParseStatus.mergeArray(status, result2);
      });
    }
    const result = [...ctx.data].map((item, i2) => {
      return def2.type._parseSync(new ParseInputLazyPath(ctx, item, ctx.path, i2));
    });
    return ParseStatus.mergeArray(status, result);
  }
  get element() {
    return this._def.type;
  }
  min(minLength, message) {
    return new ZodArray({
      ...this._def,
      minLength: { value: minLength, message: errorUtil.toString(message) }
    });
  }
  max(maxLength, message) {
    return new ZodArray({
      ...this._def,
      maxLength: { value: maxLength, message: errorUtil.toString(message) }
    });
  }
  length(len, message) {
    return new ZodArray({
      ...this._def,
      exactLength: { value: len, message: errorUtil.toString(message) }
    });
  }
  nonempty(message) {
    return this.min(1, message);
  }
}
ZodArray.create = (schema2, params) => {
  return new ZodArray({
    type: schema2,
    minLength: null,
    maxLength: null,
    exactLength: null,
    typeName: ZodFirstPartyTypeKind.ZodArray,
    ...processCreateParams(params)
  });
};
function deepPartialify(schema2) {
  if (schema2 instanceof ZodObject) {
    const newShape = {};
    for (const key2 in schema2.shape) {
      const fieldSchema = schema2.shape[key2];
      newShape[key2] = ZodOptional.create(deepPartialify(fieldSchema));
    }
    return new ZodObject({
      ...schema2._def,
      shape: () => newShape
    });
  } else if (schema2 instanceof ZodArray) {
    return new ZodArray({
      ...schema2._def,
      type: deepPartialify(schema2.element)
    });
  } else if (schema2 instanceof ZodOptional) {
    return ZodOptional.create(deepPartialify(schema2.unwrap()));
  } else if (schema2 instanceof ZodNullable) {
    return ZodNullable.create(deepPartialify(schema2.unwrap()));
  } else if (schema2 instanceof ZodTuple) {
    return ZodTuple.create(schema2.items.map((item) => deepPartialify(item)));
  } else {
    return schema2;
  }
}
class ZodObject extends ZodType {
  constructor() {
    super(...arguments);
    this._cached = null;
    this.nonstrict = this.passthrough;
    this.augment = this.extend;
  }
  _getCached() {
    if (this._cached !== null)
      return this._cached;
    const shape = this._def.shape();
    const keys2 = util.objectKeys(shape);
    return this._cached = { shape, keys: keys2 };
  }
  _parse(input) {
    const parsedType = this._getType(input);
    if (parsedType !== ZodParsedType.object) {
      const ctx2 = this._getOrReturnCtx(input);
      addIssueToContext(ctx2, {
        code: ZodIssueCode.invalid_type,
        expected: ZodParsedType.object,
        received: ctx2.parsedType
      });
      return INVALID;
    }
    const { status, ctx } = this._processInputParams(input);
    const { shape, keys: shapeKeys } = this._getCached();
    const extraKeys = [];
    if (!(this._def.catchall instanceof ZodNever && this._def.unknownKeys === "strip")) {
      for (const key2 in ctx.data) {
        if (!shapeKeys.includes(key2)) {
          extraKeys.push(key2);
        }
      }
    }
    const pairs2 = [];
    for (const key2 of shapeKeys) {
      const keyValidator = shape[key2];
      const value = ctx.data[key2];
      pairs2.push({
        key: { status: "valid", value: key2 },
        value: keyValidator._parse(new ParseInputLazyPath(ctx, value, ctx.path, key2)),
        alwaysSet: key2 in ctx.data
      });
    }
    if (this._def.catchall instanceof ZodNever) {
      const unknownKeys = this._def.unknownKeys;
      if (unknownKeys === "passthrough") {
        for (const key2 of extraKeys) {
          pairs2.push({
            key: { status: "valid", value: key2 },
            value: { status: "valid", value: ctx.data[key2] }
          });
        }
      } else if (unknownKeys === "strict") {
        if (extraKeys.length > 0) {
          addIssueToContext(ctx, {
            code: ZodIssueCode.unrecognized_keys,
            keys: extraKeys
          });
          status.dirty();
        }
      } else if (unknownKeys === "strip") ;
      else {
        throw new Error(`Internal ZodObject error: invalid unknownKeys value.`);
      }
    } else {
      const catchall = this._def.catchall;
      for (const key2 of extraKeys) {
        const value = ctx.data[key2];
        pairs2.push({
          key: { status: "valid", value: key2 },
          value: catchall._parse(
            new ParseInputLazyPath(ctx, value, ctx.path, key2)
            //, ctx.child(key), value, getParsedType(value)
          ),
          alwaysSet: key2 in ctx.data
        });
      }
    }
    if (ctx.common.async) {
      return Promise.resolve().then(async () => {
        const syncPairs = [];
        for (const pair2 of pairs2) {
          const key2 = await pair2.key;
          const value = await pair2.value;
          syncPairs.push({
            key: key2,
            value,
            alwaysSet: pair2.alwaysSet
          });
        }
        return syncPairs;
      }).then((syncPairs) => {
        return ParseStatus.mergeObjectSync(status, syncPairs);
      });
    } else {
      return ParseStatus.mergeObjectSync(status, pairs2);
    }
  }
  get shape() {
    return this._def.shape();
  }
  strict(message) {
    errorUtil.errToObj;
    return new ZodObject({
      ...this._def,
      unknownKeys: "strict",
      ...message !== void 0 ? {
        errorMap: (issue, ctx) => {
          var _a2, _b, _c, _d;
          const defaultError = (_c = (_b = (_a2 = this._def).errorMap) === null || _b === void 0 ? void 0 : _b.call(_a2, issue, ctx).message) !== null && _c !== void 0 ? _c : ctx.defaultError;
          if (issue.code === "unrecognized_keys")
            return {
              message: (_d = errorUtil.errToObj(message).message) !== null && _d !== void 0 ? _d : defaultError
            };
          return {
            message: defaultError
          };
        }
      } : {}
    });
  }
  strip() {
    return new ZodObject({
      ...this._def,
      unknownKeys: "strip"
    });
  }
  passthrough() {
    return new ZodObject({
      ...this._def,
      unknownKeys: "passthrough"
    });
  }
  // const AugmentFactory =
  //   <Def extends ZodObjectDef>(def: Def) =>
  //   <Augmentation extends ZodRawShape>(
  //     augmentation: Augmentation
  //   ): ZodObject<
  //     extendShape<ReturnType<Def["shape"]>, Augmentation>,
  //     Def["unknownKeys"],
  //     Def["catchall"]
  //   > => {
  //     return new ZodObject({
  //       ...def,
  //       shape: () => ({
  //         ...def.shape(),
  //         ...augmentation,
  //       }),
  //     }) as any;
  //   };
  extend(augmentation) {
    return new ZodObject({
      ...this._def,
      shape: () => ({
        ...this._def.shape(),
        ...augmentation
      })
    });
  }
  /**
   * Prior to [email protected] there was a bug in the
   * inferred type of merged objects. Please
   * upgrade if you are experiencing issues.
   */
  merge(merging) {
    const merged = new ZodObject({
      unknownKeys: merging._def.unknownKeys,
      catchall: merging._def.catchall,
      shape: () => ({
        ...this._def.shape(),
        ...merging._def.shape()
      }),
      typeName: ZodFirstPartyTypeKind.ZodObject
    });
    return merged;
  }
  // merge<
  //   Incoming extends AnyZodObject,
  //   Augmentation extends Incoming["shape"],
  //   NewOutput extends {
  //     [k in keyof Augmentation | keyof Output]: k extends keyof Augmentation
  //       ? Augmentation[k]["_output"]
  //       : k extends keyof Output
  //       ? Output[k]
  //       : never;
  //   },
  //   NewInput extends {
  //     [k in keyof Augmentation | keyof Input]: k extends keyof Augmentation
  //       ? Augmentation[k]["_input"]
  //       : k extends keyof Input
  //       ? Input[k]
  //       : never;
  //   }
  // >(
  //   merging: Incoming
  // ): ZodObject<
  //   extendShape<T, ReturnType<Incoming["_def"]["shape"]>>,
  //   Incoming["_def"]["unknownKeys"],
  //   Incoming["_def"]["catchall"],
  //   NewOutput,
  //   NewInput
  // > {
  //   const merged: any = new ZodObject({
  //     unknownKeys: merging._def.unknownKeys,
  //     catchall: merging._def.catchall,
  //     shape: () =>
  //       objectUtil.mergeShapes(this._def.shape(), merging._def.shape()),
  //     typeName: ZodFirstPartyTypeKind.ZodObject,
  //   }) as any;
  //   return merged;
  // }
  setKey(key2, schema2) {
    return this.augment({ [key2]: schema2 });
  }
  // merge<Incoming extends AnyZodObject>(
  //   merging: Incoming
  // ): //ZodObject<T & Incoming["_shape"], UnknownKeys, Catchall> = (merging) => {
  // ZodObject<
  //   extendShape<T, ReturnType<Incoming["_def"]["shape"]>>,
  //   Incoming["_def"]["unknownKeys"],
  //   Incoming["_def"]["catchall"]
  // > {
  //   // const mergedShape = objectUtil.mergeShapes(
  //   //   this._def.shape(),
  //   //   merging._def.shape()
  //   // );
  //   const merged: any = new ZodObject({
  //     unknownKeys: merging._def.unknownKeys,
  //     catchall: merging._def.catchall,
  //     shape: () =>
  //       objectUtil.mergeShapes(this._def.shape(), merging._def.shape()),
  //     typeName: ZodFirstPartyTypeKind.ZodObject,
  //   }) as any;
  //   return merged;
  // }
  catchall(index2) {
    return new ZodObject({
      ...this._def,
      catchall: index2
    });
  }
  pick(mask) {
    const shape = {};
    util.objectKeys(mask).forEach((key2) => {
      if (mask[key2] && this.shape[key2]) {
        shape[key2] = this.shape[key2];
      }
    });
    return new ZodObject({
      ...this._def,
      shape: () => shape
    });
  }
  omit(mask) {
    const shape = {};
    util.objectKeys(this.shape).forEach((key2) => {
      if (!mask[key2]) {
        shape[key2] = this.shape[key2];
      }
    });
    return new ZodObject({
      ...this._def,
      shape: () => shape
    });
  }
  /**
   * @deprecated
   */
  deepPartial() {
    return deepPartialify(this);
  }
  partial(mask) {
    const newShape = {};
    util.objectKeys(this.shape).forEach((key2) => {
      const fieldSchema = this.shape[key2];
      if (mask && !mask[key2]) {
        newShape[key2] = fieldSchema;
      } else {
        newShape[key2] = fieldSchema.optional();
      }
    });
    return new ZodObject({
      ...this._def,
      shape: () => newShape
    });
  }
  required(mask) {
    const newShape = {};
    util.objectKeys(this.shape).forEach((key2) => {
      if (mask && !mask[key2]) {
        newShape[key2] = this.shape[key2];
      } else {
        const fieldSchema = this.shape[key2];
        let newField = fieldSchema;
        while (newField instanceof ZodOptional) {
          newField = newField._def.innerType;
        }
        newShape[key2] = newField;
      }
    });
    return new ZodObject({
      ...this._def,
      shape: () => newShape
    });
  }
  keyof() {
    return createZodEnum(util.objectKeys(this.shape));
  }
}
ZodObject.create = (shape, params) => {
  return new ZodObject({
    shape: () => shape,
    unknownKeys: "strip",
    catchall: ZodNever.create(),
    typeName: ZodFirstPartyTypeKind.ZodObject,
    ...processCreateParams(params)
  });
};
ZodObject.strictCreate = (shape, params) => {
  return new ZodObject({
    shape: () => shape,
    unknownKeys: "strict",
    catchall: ZodNever.create(),
    typeName: ZodFirstPartyTypeKind.ZodObject,
    ...processCreateParams(params)
  });
};
ZodObject.lazycreate = (shape, params) => {
  return new ZodObject({
    shape,
    unknownKeys: "strip",
    catchall: ZodNever.create(),
    typeName: ZodFirstPartyTypeKind.ZodObject,
    ...processCreateParams(params)
  });
};
class ZodUnion extends ZodType {
  _parse(input) {
    const { ctx } = this._processInputParams(input);
    const options = this._def.options;
    function handleResults(results) {
      for (const result of results) {
        if (result.result.status === "valid") {
          return result.result;
        }
      }
      for (const result of results) {
        if (result.result.status === "dirty") {
          ctx.common.issues.push(...result.ctx.common.issues);
          return result.result;
        }
      }
      const unionErrors = results.map((result) => new ZodError(result.ctx.common.issues));
      addIssueToContext(ctx, {
        code: ZodIssueCode.invalid_union,
        unionErrors
      });
      return INVALID;
    }
    if (ctx.common.async) {
      return Promise.all(options.map(async (option2) => {
        const childCtx = {
          ...ctx,
          common: {
            ...ctx.common,
            issues: []
          },
          parent: null
        };
        return {
          result: await option2._parseAsync({
            data: ctx.data,
            path: ctx.path,
            parent: childCtx
          }),
          ctx: childCtx
        };
      })).then(handleResults);
    } else {
      let dirty = void 0;
      const issues = [];
      for (const option2 of options) {
        const childCtx = {
          ...ctx,
          common: {
            ...ctx.common,
            issues: []
          },
          parent: null
        };
        const result = option2._parseSync({
          data: ctx.data,
          path: ctx.path,
          parent: childCtx
        });
        if (result.status === "valid") {
          return result;
        } else if (result.status === "dirty" && !dirty) {
          dirty = { result, ctx: childCtx };
        }
        if (childCtx.common.issues.length) {
          issues.push(childCtx.common.issues);
        }
      }
      if (dirty) {
        ctx.common.issues.push(...dirty.ctx.common.issues);
        return dirty.result;
      }
      const unionErrors = issues.map((issues2) => new ZodError(issues2));
      addIssueToContext(ctx, {
        code: ZodIssueCode.invalid_union,
        unionErrors
      });
      return INVALID;
    }
  }
  get options() {
    return this._def.options;
  }
}
ZodUnion.create = (types2, params) => {
  return new ZodUnion({
    options: types2,
    typeName: ZodFirstPartyTypeKind.ZodUnion,
    ...processCreateParams(params)
  });
};
const getDiscriminator = (type2) => {
  if (type2 instanceof ZodLazy) {
    return getDiscriminator(type2.schema);
  } else if (type2 instanceof ZodEffects) {
    return getDiscriminator(type2.innerType());
  } else if (type2 instanceof ZodLiteral) {
    return [type2.value];
  } else if (type2 instanceof ZodEnum) {
    return type2.options;
  } else if (type2 instanceof ZodNativeEnum) {
    return util.objectValues(type2.enum);
  } else if (type2 instanceof ZodDefault) {
    return getDiscriminator(type2._def.innerType);
  } else if (type2 instanceof ZodUndefined) {
    return [void 0];
  } else if (type2 instanceof ZodNull) {
    return [null];
  } else if (type2 instanceof ZodOptional) {
    return [void 0, ...getDiscriminator(type2.unwrap())];
  } else if (type2 instanceof ZodNullable) {
    return [null, ...getDiscriminator(type2.unwrap())];
  } else if (type2 instanceof ZodBranded) {
    return getDiscriminator(type2.unwrap());
  } else if (type2 instanceof ZodReadonly) {
    return getDiscriminator(type2.unwrap());
  } else if (type2 instanceof ZodCatch) {
    return getDiscriminator(type2._def.innerType);
  } else {
    return [];
  }
};
class ZodDiscriminatedUnion extends ZodType {
  _parse(input) {
    const { ctx } = this._processInputParams(input);
    if (ctx.parsedType !== ZodParsedType.object) {
      addIssueToContext(ctx, {
        code: ZodIssueCode.invalid_type,
        expected: ZodParsedType.object,
        received: ctx.parsedType
      });
      return INVALID;
    }
    const discriminator = this.discriminator;
    const discriminatorValue = ctx.data[discriminator];
    const option2 = this.optionsMap.get(discriminatorValue);
    if (!option2) {
      addIssueToContext(ctx, {
        code: ZodIssueCode.invalid_union_discriminator,
        options: Array.from(this.optionsMap.keys()),
        path: [discriminator]
      });
      return INVALID;
    }
    if (ctx.common.async) {
      return option2._parseAsync({
        data: ctx.data,
        path: ctx.path,
        parent: ctx
      });
    } else {
      return option2._parseSync({
        data: ctx.data,
        path: ctx.path,
        parent: ctx
      });
    }
  }
  get discriminator() {
    return this._def.discriminator;
  }
  get options() {
    return this._def.options;
  }
  get optionsMap() {
    return this._def.optionsMap;
  }
  /**
   * The constructor of the discriminated union schema. Its behaviour is very similar to that of the normal z.union() constructor.
   * However, it only allows a union of objects, all of which need to share a discriminator property. This property must
   * have a different value for each object in the union.
   * @param discriminator the name of the discriminator property
   * @param types an array of object schemas
   * @param params
   */
  static create(discriminator, options, params) {
    const optionsMap = /* @__PURE__ */ new Map();
    for (const type2 of options) {
      const discriminatorValues = getDiscriminator(type2.shape[discriminator]);
      if (!discriminatorValues.length) {
        throw new Error(`A discriminator value for key \`${discriminator}\` could not be extracted from all schema options`);
      }
      for (const value of discriminatorValues) {
        if (optionsMap.has(value)) {
          throw new Error(`Discriminator property ${String(discriminator)} has duplicate value ${String(value)}`);
        }
        optionsMap.set(value, type2);
      }
    }
    return new ZodDiscriminatedUnion({
      typeName: ZodFirstPartyTypeKind.ZodDiscriminatedUnion,
      discriminator,
      options,
      optionsMap,
      ...processCreateParams(params)
    });
  }
}
function mergeValues(a2, b2) {
  const aType = getParsedType(a2);
  const bType = getParsedType(b2);
  if (a2 === b2) {
    return { valid: true, data: a2 };
  } else if (aType === ZodParsedType.object && bType === ZodParsedType.object) {
    const bKeys = util.objectKeys(b2);
    const sharedKeys = util.objectKeys(a2).filter((key2) => bKeys.indexOf(key2) !== -1);
    const newObj = { ...a2, ...b2 };
    for (const key2 of sharedKeys) {
      const sharedValue = mergeValues(a2[key2], b2[key2]);
      if (!sharedValue.valid) {
        return { valid: false };
      }
      newObj[key2] = sharedValue.data;
    }
    return { valid: true, data: newObj };
  } else if (aType === ZodParsedType.array && bType === ZodParsedType.array) {
    if (a2.length !== b2.length) {
      return { valid: false };
    }
    const newArray = [];
    for (let index2 = 0; index2 < a2.length; index2++) {
      const itemA = a2[index2];
      const itemB = b2[index2];
      const sharedValue = mergeValues(itemA, itemB);
      if (!sharedValue.valid) {
        return { valid: false };
      }
      newArray.push(sharedValue.data);
    }
    return { valid: true, data: newArray };
  } else if (aType === ZodParsedType.date && bType === ZodParsedType.date && +a2 === +b2) {
    return { valid: true, data: a2 };
  } else {
    return { valid: false };
  }
}
class ZodIntersection extends ZodType {
  _parse(input) {
    const { status, ctx } = this._processInputParams(input);
    const handleParsed = (parsedLeft, parsedRight) => {
      if (isAborted(parsedLeft) || isAborted(parsedRight)) {
        return INVALID;
      }
      const merged = mergeValues(parsedLeft.value, parsedRight.value);
      if (!merged.valid) {
        addIssueToContext(ctx, {
          code: ZodIssueCode.invalid_intersection_types
        });
        return INVALID;
      }
      if (isDirty(parsedLeft) || isDirty(parsedRight)) {
        status.dirty();
      }
      return { status: status.value, value: merged.data };
    };
    if (ctx.common.async) {
      return Promise.all([
        this._def.left._parseAsync({
          data: ctx.data,
          path: ctx.path,
          parent: ctx
        }),
        this._def.right._parseAsync({
          data: ctx.data,
          path: ctx.path,
          parent: ctx
        })
      ]).then(([left, right]) => handleParsed(left, right));
    } else {
      return handleParsed(this._def.left._parseSync({
        data: ctx.data,
        path: ctx.path,
        parent: ctx
      }), this._def.right._parseSync({
        data: ctx.data,
        path: ctx.path,
        parent: ctx
      }));
    }
  }
}
ZodIntersection.create = (left, right, params) => {
  return new ZodIntersection({
    left,
    right,
    typeName: ZodFirstPartyTypeKind.ZodIntersection,
    ...processCreateParams(params)
  });
};
class ZodTuple extends ZodType {
  _parse(input) {
    const { status, ctx } = this._processInputParams(input);
    if (ctx.parsedType !== ZodParsedType.array) {
      addIssueToContext(ctx, {
        code: ZodIssueCode.invalid_type,
        expected: ZodParsedType.array,
        received: ctx.parsedType
      });
      return INVALID;
    }
    if (ctx.data.length < this._def.items.length) {
      addIssueToContext(ctx, {
        code: ZodIssueCode.too_small,
        minimum: this._def.items.length,
        inclusive: true,
        exact: false,
        type: "array"
      });
      return INVALID;
    }
    const rest = this._def.rest;
    if (!rest && ctx.data.length > this._def.items.length) {
      addIssueToContext(ctx, {
        code: ZodIssueCode.too_big,
        maximum: this._def.items.length,
        inclusive: true,
        exact: false,
        type: "array"
      });
      status.dirty();
    }
    const items = [...ctx.data].map((item, itemIndex) => {
      const schema2 = this._def.items[itemIndex] || this._def.rest;
      if (!schema2)
        return null;
      return schema2._parse(new ParseInputLazyPath(ctx, item, ctx.path, itemIndex));
    }).filter((x2) => !!x2);
    if (ctx.common.async) {
      return Promise.all(items).then((results) => {
        return ParseStatus.mergeArray(status, results);
      });
    } else {
      return ParseStatus.mergeArray(status, items);
    }
  }
  get items() {
    return this._def.items;
  }
  rest(rest) {
    return new ZodTuple({
      ...this._def,
      rest
    });
  }
}
ZodTuple.create = (schemas2, params) => {
  if (!Array.isArray(schemas2)) {
    throw new Error("You must pass an array of schemas to z.tuple([ ... ])");
  }
  return new ZodTuple({
    items: schemas2,
    typeName: ZodFirstPartyTypeKind.ZodTuple,
    rest: null,
    ...processCreateParams(params)
  });
};
class ZodRecord extends ZodType {
  get keySchema() {
    return this._def.keyType;
  }
  get valueSchema() {
    return this._def.valueType;
  }
  _parse(input) {
    const { status, ctx } = this._processInputParams(input);
    if (ctx.parsedType !== ZodParsedType.object) {
      addIssueToContext(ctx, {
        code: ZodIssueCode.invalid_type,
        expected: ZodParsedType.object,
        received: ctx.parsedType
      });
      return INVALID;
    }
    const pairs2 = [];
    const keyType = this._def.keyType;
    const valueType = this._def.valueType;
    for (const key2 in ctx.data) {
      pairs2.push({
        key: keyType._parse(new ParseInputLazyPath(ctx, key2, ctx.path, key2)),
        value: valueType._parse(new ParseInputLazyPath(ctx, ctx.data[key2], ctx.path, key2)),
        alwaysSet: key2 in ctx.data
      });
    }
    if (ctx.common.async) {
      return ParseStatus.mergeObjectAsync(status, pairs2);
    } else {
      return ParseStatus.mergeObjectSync(status, pairs2);
    }
  }
  get element() {
    return this._def.valueType;
  }
  static create(first, second, third) {
    if (second instanceof ZodType) {
      return new ZodRecord({
        keyType: first,
        valueType: second,
        typeName: ZodFirstPartyTypeKind.ZodRecord,
        ...processCreateParams(third)
      });
    }
    return new ZodRecord({
      keyType: ZodString.create(),
      valueType: first,
      typeName: ZodFirstPartyTypeKind.ZodRecord,
      ...processCreateParams(second)
    });
  }
}
class ZodMap extends ZodType {
  get keySchema() {
    return this._def.keyType;
  }
  get valueSchema() {
    return this._def.valueType;
  }
  _parse(input) {
    const { status, ctx } = this._processInputParams(input);
    if (ctx.parsedType !== ZodParsedType.map) {
      addIssueToContext(ctx, {
        code: ZodIssueCode.invalid_type,
        expected: ZodParsedType.map,
        received: ctx.parsedType
      });
      return INVALID;
    }
    const keyType = this._def.keyType;
    const valueType = this._def.valueType;
    const pairs2 = [...ctx.data.entries()].map(([key2, value], index2) => {
      return {
        key: keyType._parse(new ParseInputLazyPath(ctx, key2, ctx.path, [index2, "key"])),
        value: valueType._parse(new ParseInputLazyPath(ctx, value, ctx.path, [index2, "value"]))
      };
    });
    if (ctx.common.async) {
      const finalMap = /* @__PURE__ */ new Map();
      return Promise.resolve().then(async () => {
        for (const pair2 of pairs2) {
          const key2 = await pair2.key;
          const value = await pair2.value;
          if (key2.status === "aborted" || value.status === "aborted") {
            return INVALID;
          }
          if (key2.status === "dirty" || value.status === "dirty") {
            status.dirty();
          }
          finalMap.set(key2.value, value.value);
        }
        return { status: status.value, value: finalMap };
      });
    } else {
      const finalMap = /* @__PURE__ */ new Map();
      for (const pair2 of pairs2) {
        const key2 = pair2.key;
        const value = pair2.value;
        if (key2.status === "aborted" || value.status === "aborted") {
          return INVALID;
        }
        if (key2.status === "dirty" || value.status === "dirty") {
          status.dirty();
        }
        finalMap.set(key2.value, value.value);
      }
      return { status: status.value, value: finalMap };
    }
  }
}
ZodMap.create = (keyType, valueType, params) => {
  return new ZodMap({
    valueType,
    keyType,
    typeName: ZodFirstPartyTypeKind.ZodMap,
    ...processCreateParams(params)
  });
};
class ZodSet extends ZodType {
  _parse(input) {
    const { status, ctx } = this._processInputParams(input);
    if (ctx.parsedType !== ZodParsedType.set) {
      addIssueToContext(ctx, {
        code: ZodIssueCode.invalid_type,
        expected: ZodParsedType.set,
        received: ctx.parsedType
      });
      return INVALID;
    }
    const def2 = this._def;
    if (def2.minSize !== null) {
      if (ctx.data.size < def2.minSize.value) {
        addIssueToContext(ctx, {
          code: ZodIssueCode.too_small,
          minimum: def2.minSize.value,
          type: "set",
          inclusive: true,
          exact: false,
          message: def2.minSize.message
        });
        status.dirty();
      }
    }
    if (def2.maxSize !== null) {
      if (ctx.data.size > def2.maxSize.value) {
        addIssueToContext(ctx, {
          code: ZodIssueCode.too_big,
          maximum: def2.maxSize.value,
          type: "set",
          inclusive: true,
          exact: false,
          message: def2.maxSize.message
        });
        status.dirty();
      }
    }
    const valueType = this._def.valueType;
    function finalizeSet(elements2) {
      const parsedSet = /* @__PURE__ */ new Set();
      for (const element2 of elements2) {
        if (element2.status === "aborted")
          return INVALID;
        if (element2.status === "dirty")
          status.dirty();
        parsedSet.add(element2.value);
      }
      return { status: status.value, value: parsedSet };
    }
    const elements = [...ctx.data.values()].map((item, i2) => valueType._parse(new ParseInputLazyPath(ctx, item, ctx.path, i2)));
    if (ctx.common.async) {
      return Promise.all(elements).then((elements2) => finalizeSet(elements2));
    } else {
      return finalizeSet(elements);
    }
  }
  min(minSize, message) {
    return new ZodSet({
      ...this._def,
      minSize: { value: minSize, message: errorUtil.toString(message) }
    });
  }
  max(maxSize, message) {
    return new ZodSet({
      ...this._def,
      maxSize: { value: maxSize, message: errorUtil.toString(message) }
    });
  }
  size(size2, message) {
    return this.min(size2, message).max(size2, message);
  }
  nonempty(message) {
    return this.min(1, message);
  }
}
ZodSet.create = (valueType, params) => {
  return new ZodSet({
    valueType,
    minSize: null,
    maxSize: null,
    typeName: ZodFirstPartyTypeKind.ZodSet,
    ...processCreateParams(params)
  });
};
class ZodFunction extends ZodType {
  constructor() {
    super(...arguments);
    this.validate = this.implement;
  }
  _parse(input) {
    const { ctx } = this._processInputParams(input);
    if (ctx.parsedType !== ZodParsedType.function) {
      addIssueToContext(ctx, {
        code: ZodIssueCode.invalid_type,
        expected: ZodParsedType.function,
        received: ctx.parsedType
      });
      return INVALID;
    }
    function makeArgsIssue(args, error2) {
      return makeIssue({
        data: args,
        path: ctx.path,
        errorMaps: [
          ctx.common.contextualErrorMap,
          ctx.schemaErrorMap,
          getErrorMap(),
          errorMap
        ].filter((x2) => !!x2),
        issueData: {
          code: ZodIssueCode.invalid_arguments,
          argumentsError: error2
        }
      });
    }
    function makeReturnsIssue(returns, error2) {
      return makeIssue({
        data: returns,
        path: ctx.path,
        errorMaps: [
          ctx.common.contextualErrorMap,
          ctx.schemaErrorMap,
          getErrorMap(),
          errorMap
        ].filter((x2) => !!x2),
        issueData: {
          code: ZodIssueCode.invalid_return_type,
          returnTypeError: error2
        }
      });
    }
    const params = { errorMap: ctx.common.contextualErrorMap };
    const fn = ctx.data;
    if (this._def.returns instanceof ZodPromise) {
      const me2 = this;
      return OK(async function(...args) {
        const error2 = new ZodError([]);
        const parsedArgs = await me2._def.args.parseAsync(args, params).catch((e2) => {
          error2.addIssue(makeArgsIssue(args, e2));
          throw error2;
        });
        const result = await Reflect.apply(fn, this, parsedArgs);
        const parsedReturns = await me2._def.returns._def.type.parseAsync(result, params).catch((e2) => {
          error2.addIssue(makeReturnsIssue(result, e2));
          throw error2;
        });
        return parsedReturns;
      });
    } else {
      const me2 = this;
      return OK(function(...args) {
        const parsedArgs = me2._def.args.safeParse(args, params);
        if (!parsedArgs.success) {
          throw new ZodError([makeArgsIssue(args, parsedArgs.error)]);
        }
        const result = Reflect.apply(fn, this, parsedArgs.data);
        const parsedReturns = me2._def.returns.safeParse(result, params);
        if (!parsedReturns.success) {
          throw new ZodError([makeReturnsIssue(result, parsedReturns.error)]);
        }
        return parsedReturns.data;
      });
    }
  }
  parameters() {
    return this._def.args;
  }
  returnType() {
    return this._def.returns;
  }
  args(...items) {
    return new ZodFunction({
      ...this._def,
      args: ZodTuple.create(items).rest(ZodUnknown.create())
    });
  }
  returns(returnType) {
    return new ZodFunction({
      ...this._def,
      returns: returnType
    });
  }
  implement(func) {
    const validatedFunc = this.parse(func);
    return validatedFunc;
  }
  strictImplement(func) {
    const validatedFunc = this.parse(func);
    return validatedFunc;
  }
  static create(args, returns, params) {
    return new ZodFunction({
      args: args ? args : ZodTuple.create([]).rest(ZodUnknown.create()),
      returns: returns || ZodUnknown.create(),
      typeName: ZodFirstPartyTypeKind.ZodFunction,
      ...processCreateParams(params)
    });
  }
}
class ZodLazy extends ZodType {
  get schema() {
    return this._def.getter();
  }
  _parse(input) {
    const { ctx } = this._processInputParams(input);
    const lazySchema = this._def.getter();
    return lazySchema._parse({ data: ctx.data, path: ctx.path, parent: ctx });
  }
}
ZodLazy.create = (getter, params) => {
  return new ZodLazy({
    getter,
    typeName: ZodFirstPartyTypeKind.ZodLazy,
    ...processCreateParams(params)
  });
};
class ZodLiteral extends ZodType {
  _parse(input) {
    if (input.data !== this._def.value) {
      const ctx = this._getOrReturnCtx(input);
      addIssueToContext(ctx, {
        received: ctx.data,
        code: ZodIssueCode.invalid_literal,
        expected: this._def.value
      });
      return INVALID;
    }
    return { status: "valid", value: input.data };
  }
  get value() {
    return this._def.value;
  }
}
ZodLiteral.create = (value, params) => {
  return new ZodLiteral({
    value,
    typeName: ZodFirstPartyTypeKind.ZodLiteral,
    ...processCreateParams(params)
  });
};
function createZodEnum(values2, params) {
  return new ZodEnum({
    values: values2,
    typeName: ZodFirstPartyTypeKind.ZodEnum,
    ...processCreateParams(params)
  });
}
class ZodEnum extends ZodType {
  constructor() {
    super(...arguments);
    _ZodEnum_cache.set(this, void 0);
  }
  _parse(input) {
    if (typeof input.data !== "string") {
      const ctx = this._getOrReturnCtx(input);
      const expectedValues = this._def.values;
      addIssueToContext(ctx, {
        expected: util.joinValues(expectedValues),
        received: ctx.parsedType,
        code: ZodIssueCode.invalid_type
      });
      return INVALID;
    }
    if (!__classPrivateFieldGet(this, _ZodEnum_cache)) {
      __classPrivateFieldSet(this, _ZodEnum_cache, new Set(this._def.values));
    }
    if (!__classPrivateFieldGet(this, _ZodEnum_cache).has(input.data)) {
      const ctx = this._getOrReturnCtx(input);
      const expectedValues = this._def.values;
      addIssueToContext(ctx, {
        received: ctx.data,
        code: ZodIssueCode.invalid_enum_value,
        options: expectedValues
      });
      return INVALID;
    }
    return OK(input.data);
  }
  get options() {
    return this._def.values;
  }
  get enum() {
    const enumValues = {};
    for (const val of this._def.values) {
      enumValues[val] = val;
    }
    return enumValues;
  }
  get Values() {
    const enumValues = {};
    for (const val of this._def.values) {
      enumValues[val] = val;
    }
    return enumValues;
  }
  get Enum() {
    const enumValues = {};
    for (const val of this._def.values) {
      enumValues[val] = val;
    }
    return enumValues;
  }
  extract(values2, newDef = this._def) {
    return ZodEnum.create(values2, {
      ...this._def,
      ...newDef
    });
  }
  exclude(values2, newDef = this._def) {
    return ZodEnum.create(this.options.filter((opt) => !values2.includes(opt)), {
      ...this._def,
      ...newDef
    });
  }
}
_ZodEnum_cache = /* @__PURE__ */ new WeakMap();
ZodEnum.create = createZodEnum;
class ZodNativeEnum extends ZodType {
  constructor() {
    super(...arguments);
    _ZodNativeEnum_cache.set(this, void 0);
  }
  _parse(input) {
    const nativeEnumValues = util.getValidEnumValues(this._def.values);
    const ctx = this._getOrReturnCtx(input);
    if (ctx.parsedType !== ZodParsedType.string && ctx.parsedType !== ZodParsedType.number) {
      const expectedValues = util.objectValues(nativeEnumValues);
      addIssueToContext(ctx, {
        expected: util.joinValues(expectedValues),
        received: ctx.parsedType,
        code: ZodIssueCode.invalid_type
      });
      return INVALID;
    }
    if (!__classPrivateFieldGet(this, _ZodNativeEnum_cache)) {
      __classPrivateFieldSet(this, _ZodNativeEnum_cache, new Set(util.getValidEnumValues(this._def.values)));
    }
    if (!__classPrivateFieldGet(this, _ZodNativeEnum_cache).has(input.data)) {
      const expectedValues = util.objectValues(nativeEnumValues);
      addIssueToContext(ctx, {
        received: ctx.data,
        code: ZodIssueCode.invalid_enum_value,
        options: expectedValues
      });
      return INVALID;
    }
    return OK(input.data);
  }
  get enum() {
    return this._def.values;
  }
}
_ZodNativeEnum_cache = /* @__PURE__ */ new WeakMap();
ZodNativeEnum.create = (values2, params) => {
  return new ZodNativeEnum({
    values: values2,
    typeName: ZodFirstPartyTypeKind.ZodNativeEnum,
    ...processCreateParams(params)
  });
};
class ZodPromise extends ZodType {
  unwrap() {
    return this._def.type;
  }
  _parse(input) {
    const { ctx } = this._processInputParams(input);
    if (ctx.parsedType !== ZodParsedType.promise && ctx.common.async === false) {
      addIssueToContext(ctx, {
        code: ZodIssueCode.invalid_type,
        expected: ZodParsedType.promise,
        received: ctx.parsedType
      });
      return INVALID;
    }
    const promisified = ctx.parsedType === ZodParsedType.promise ? ctx.data : Promise.resolve(ctx.data);
    return OK(promisified.then((data) => {
      return this._def.type.parseAsync(data, {
        path: ctx.path,
        errorMap: ctx.common.contextualErrorMap
      });
    }));
  }
}
ZodPromise.create = (schema2, params) => {
  return new ZodPromise({
    type: schema2,
    typeName: ZodFirstPartyTypeKind.ZodPromise,
    ...processCreateParams(params)
  });
};
class ZodEffects extends ZodType {
  innerType() {
    return this._def.schema;
  }
  sourceType() {
    return this._def.schema._def.typeName === ZodFirstPartyTypeKind.ZodEffects ? this._def.schema.sourceType() : this._def.schema;
  }
  _parse(input) {
    const { status, ctx } = this._processInputParams(input);
    const effect = this._def.effect || null;
    const checkCtx = {
      addIssue: (arg) => {
        addIssueToContext(ctx, arg);
        if (arg.fatal) {
          status.abort();
        } else {
          status.dirty();
        }
      },
      get path() {
        return ctx.path;
      }
    };
    checkCtx.addIssue = checkCtx.addIssue.bind(checkCtx);
    if (effect.type === "preprocess") {
      const processed = effect.transform(ctx.data, checkCtx);
      if (ctx.common.async) {
        return Promise.resolve(processed).then(async (processed2) => {
          if (status.value === "aborted")
            return INVALID;
          const result = await this._def.schema._parseAsync({
            data: processed2,
            path: ctx.path,
            parent: ctx
          });
          if (result.status === "aborted")
            return INVALID;
          if (result.status === "dirty")
            return DIRTY(result.value);
          if (status.value === "dirty")
            return DIRTY(result.value);
          return result;
        });
      } else {
        if (status.value === "aborted")
          return INVALID;
        const result = this._def.schema._parseSync({
          data: processed,
          path: ctx.path,
          parent: ctx
        });
        if (result.status === "aborted")
          return INVALID;
        if (result.status === "dirty")
          return DIRTY(result.value);
        if (status.value === "dirty")
          return DIRTY(result.value);
        return result;
      }
    }
    if (effect.type === "refinement") {
      const executeRefinement = (acc) => {
        const result = effect.refinement(acc, checkCtx);
        if (ctx.common.async) {
          return Promise.resolve(result);
        }
        if (result instanceof Promise) {
          throw new Error("Async refinement encountered during synchronous parse operation. Use .parseAsync instead.");
        }
        return acc;
      };
      if (ctx.common.async === false) {
        const inner = this._def.schema._parseSync({
          data: ctx.data,
          path: ctx.path,
          parent: ctx
        });
        if (inner.status === "aborted")
          return INVALID;
        if (inner.status === "dirty")
          status.dirty();
        executeRefinement(inner.value);
        return { status: status.value, value: inner.value };
      } else {
        return this._def.schema._parseAsync({ data: ctx.data, path: ctx.path, parent: ctx }).then((inner) => {
          if (inner.status === "aborted")
            return INVALID;
          if (inner.status === "dirty")
            status.dirty();
          return executeRefinement(inner.value).then(() => {
            return { status: status.value, value: inner.value };
          });
        });
      }
    }
    if (effect.type === "transform") {
      if (ctx.common.async === false) {
        const base2 = this._def.schema._parseSync({
          data: ctx.data,
          path: ctx.path,
          parent: ctx
        });
        if (!isValid(base2))
          return base2;
        const result = effect.transform(base2.value, checkCtx);
        if (result instanceof Promise) {
          throw new Error(`Asynchronous transform encountered during synchronous parse operation. Use .parseAsync instead.`);
        }
        return { status: status.value, value: result };
      } else {
        return this._def.schema._parseAsync({ data: ctx.data, path: ctx.path, parent: ctx }).then((base2) => {
          if (!isValid(base2))
            return base2;
          return Promise.resolve(effect.transform(base2.value, checkCtx)).then((result) => ({ status: status.value, value: result }));
        });
      }
    }
    util.assertNever(effect);
  }
}
ZodEffects.create = (schema2, effect, params) => {
  return new ZodEffects({
    schema: schema2,
    typeName: ZodFirstPartyTypeKind.ZodEffects,
    effect,
    ...processCreateParams(params)
  });
};
ZodEffects.createWithPreprocess = (preprocess, schema2, params) => {
  return new ZodEffects({
    schema: schema2,
    effect: { type: "preprocess", transform: preprocess },
    typeName: ZodFirstPartyTypeKind.ZodEffects,
    ...processCreateParams(params)
  });
};
class ZodOptional extends ZodType {
  _parse(input) {
    const parsedType = this._getType(input);
    if (parsedType === ZodParsedType.undefined) {
      return OK(void 0);
    }
    return this._def.innerType._parse(input);
  }
  unwrap() {
    return this._def.innerType;
  }
}
ZodOptional.create = (type2, params) => {
  return new ZodOptional({
    innerType: type2,
    typeName: ZodFirstPartyTypeKind.ZodOptional,
    ...processCreateParams(params)
  });
};
class ZodNullable extends ZodType {
  _parse(input) {
    const parsedType = this._getType(input);
    if (parsedType === ZodParsedType.null) {
      return OK(null);
    }
    return this._def.innerType._parse(input);
  }
  unwrap() {
    return this._def.innerType;
  }
}
ZodNullable.create = (type2, params) => {
  return new ZodNullable({
    innerType: type2,
    typeName: ZodFirstPartyTypeKind.ZodNullable,
    ...processCreateParams(params)
  });
};
class ZodDefault extends ZodType {
  _parse(input) {
    const { ctx } = this._processInputParams(input);
    let data = ctx.data;
    if (ctx.parsedType === ZodParsedType.undefined) {
      data = this._def.defaultValue();
    }
    return this._def.innerType._parse({
      data,
      path: ctx.path,
      parent: ctx
    });
  }
  removeDefault() {
    return this._def.innerType;
  }
}
ZodDefault.create = (type2, params) => {
  return new ZodDefault({
    innerType: type2,
    typeName: ZodFirstPartyTypeKind.ZodDefault,
    defaultValue: typeof params.default === "function" ? params.default : () => params.default,
    ...processCreateParams(params)
  });
};
class ZodCatch extends ZodType {
  _parse(input) {
    const { ctx } = this._processInputParams(input);
    const newCtx = {
      ...ctx,
      common: {
        ...ctx.common,
        issues: []
      }
    };
    const result = this._def.innerType._parse({
      data: newCtx.data,
      path: newCtx.path,
      parent: {
        ...newCtx
      }
    });
    if (isAsync(result)) {
      return result.then((result2) => {
        return {
          status: "valid",
          value: result2.status === "valid" ? result2.value : this._def.catchValue({
            get error() {
              return new ZodError(newCtx.common.issues);
            },
            input: newCtx.data
          })
        };
      });
    } else {
      return {
        status: "valid",
        value: result.status === "valid" ? result.value : this._def.catchValue({
          get error() {
            return new ZodError(newCtx.common.issues);
          },
          input: newCtx.data
        })
      };
    }
  }
  removeCatch() {
    return this._def.innerType;
  }
}
ZodCatch.create = (type2, params) => {
  return new ZodCatch({
    innerType: type2,
    typeName: ZodFirstPartyTypeKind.ZodCatch,
    catchValue: typeof params.catch === "function" ? params.catch : () => params.catch,
    ...processCreateParams(params)
  });
};
class ZodNaN extends ZodType {
  _parse(input) {
    const parsedType = this._getType(input);
    if (parsedType !== ZodParsedType.nan) {
      const ctx = this._getOrReturnCtx(input);
      addIssueToContext(ctx, {
        code: ZodIssueCode.invalid_type,
        expected: ZodParsedType.nan,
        received: ctx.parsedType
      });
      return INVALID;
    }
    return { status: "valid", value: input.data };
  }
}
ZodNaN.create = (params) => {
  return new ZodNaN({
    typeName: ZodFirstPartyTypeKind.ZodNaN,
    ...processCreateParams(params)
  });
};
const BRAND = Symbol("zod_brand");
class ZodBranded extends ZodType {
  _parse(input) {
    const { ctx } = this._processInputParams(input);
    const data = ctx.data;
    return this._def.type._parse({
      data,
      path: ctx.path,
      parent: ctx
    });
  }
  unwrap() {
    return this._def.type;
  }
}
class ZodPipeline extends ZodType {
  _parse(input) {
    const { status, ctx } = this._processInputParams(input);
    if (ctx.common.async) {
      const handleAsync = async () => {
        const inResult = await this._def.in._parseAsync({
          data: ctx.data,
          path: ctx.path,
          parent: ctx
        });
        if (inResult.status === "aborted")
          return INVALID;
        if (inResult.status === "dirty") {
          status.dirty();
          return DIRTY(inResult.value);
        } else {
          return this._def.out._parseAsync({
            data: inResult.value,
            path: ctx.path,
            parent: ctx
          });
        }
      };
      return handleAsync();
    } else {
      const inResult = this._def.in._parseSync({
        data: ctx.data,
        path: ctx.path,
        parent: ctx
      });
      if (inResult.status === "aborted")
        return INVALID;
      if (inResult.status === "dirty") {
        status.dirty();
        return {
          status: "dirty",
          value: inResult.value
        };
      } else {
        return this._def.out._parseSync({
          data: inResult.value,
          path: ctx.path,
          parent: ctx
        });
      }
    }
  }
  static create(a2, b2) {
    return new ZodPipeline({
      in: a2,
      out: b2,
      typeName: ZodFirstPartyTypeKind.ZodPipeline
    });
  }
}
class ZodReadonly extends ZodType {
  _parse(input) {
    const result = this._def.innerType._parse(input);
    const freeze = (data) => {
      if (isValid(data)) {
        data.value = Object.freeze(data.value);
      }
      return data;
    };
    return isAsync(result) ? result.then((data) => freeze(data)) : freeze(result);
  }
  unwrap() {
    return this._def.innerType;
  }
}
ZodReadonly.create = (type2, params) => {
  return new ZodReadonly({
    innerType: type2,
    typeName: ZodFirstPartyTypeKind.ZodReadonly,
    ...processCreateParams(params)
  });
};
function custom(check, params = {}, fatal) {
  if (check)
    return ZodAny.create().superRefine((data, ctx) => {
      var _a2, _b;
      if (!check(data)) {
        const p2 = typeof params === "function" ? params(data) : typeof params === "string" ? { message: params } : params;
        const _fatal = (_b = (_a2 = p2.fatal) !== null && _a2 !== void 0 ? _a2 : fatal) !== null && _b !== void 0 ? _b : true;
        const p22 = typeof p2 === "string" ? { message: p2 } : p2;
        ctx.addIssue({ code: "custom", ...p22, fatal: _fatal });
      }
    });
  return ZodAny.create();
}
const late = {
  object: ZodObject.lazycreate
};
var ZodFirstPartyTypeKind;
(function(ZodFirstPartyTypeKind2) {
  ZodFirstPartyTypeKind2["ZodString"] = "ZodString";
  ZodFirstPartyTypeKind2["ZodNumber"] = "ZodNumber";
  ZodFirstPartyTypeKind2["ZodNaN"] = "ZodNaN";
  ZodFirstPartyTypeKind2["ZodBigInt"] = "ZodBigInt";
  ZodFirstPartyTypeKind2["ZodBoolean"] = "ZodBoolean";
  ZodFirstPartyTypeKind2["ZodDate"] = "ZodDate";
  ZodFirstPartyTypeKind2["ZodSymbol"] = "ZodSymbol";
  ZodFirstPartyTypeKind2["ZodUndefined"] = "ZodUndefined";
  ZodFirstPartyTypeKind2["ZodNull"] = "ZodNull";
  ZodFirstPartyTypeKind2["ZodAny"] = "ZodAny";
  ZodFirstPartyTypeKind2["ZodUnknown"] = "ZodUnknown";
  ZodFirstPartyTypeKind2["ZodNever"] = "ZodNever";
  ZodFirstPartyTypeKind2["ZodVoid"] = "ZodVoid";
  ZodFirstPartyTypeKind2["ZodArray"] = "ZodArray";
  ZodFirstPartyTypeKind2["ZodObject"] = "ZodObject";
  ZodFirstPartyTypeKind2["ZodUnion"] = "ZodUnion";
  ZodFirstPartyTypeKind2["ZodDiscriminatedUnion"] = "ZodDiscriminatedUnion";
  ZodFirstPartyTypeKind2["ZodIntersection"] = "ZodIntersection";
  ZodFirstPartyTypeKind2["ZodTuple"] = "ZodTuple";
  ZodFirstPartyTypeKind2["ZodRecord"] = "ZodRecord";
  ZodFirstPartyTypeKind2["ZodMap"] = "ZodMap";
  ZodFirstPartyTypeKind2["ZodSet"] = "ZodSet";
  ZodFirstPartyTypeKind2["ZodFunction"] = "ZodFunction";
  ZodFirstPartyTypeKind2["ZodLazy"] = "ZodLazy";
  ZodFirstPartyTypeKind2["ZodLiteral"] = "ZodLiteral";
  ZodFirstPartyTypeKind2["ZodEnum"] = "ZodEnum";
  ZodFirstPartyTypeKind2["ZodEffects"] = "ZodEffects";
  ZodFirstPartyTypeKind2["ZodNativeEnum"] = "ZodNativeEnum";
  ZodFirstPartyTypeKind2["ZodOptional"] = "ZodOptional";
  ZodFirstPartyTypeKind2["ZodNullable"] = "ZodNullable";
  ZodFirstPartyTypeKind2["ZodDefault"] = "ZodDefault";
  ZodFirstPartyTypeKind2["ZodCatch"] = "ZodCatch";
  ZodFirstPartyTypeKind2["ZodPromise"] = "ZodPromise";
  ZodFirstPartyTypeKind2["ZodBranded"] = "ZodBranded";
  ZodFirstPartyTypeKind2["ZodPipeline"] = "ZodPipeline";
  ZodFirstPartyTypeKind2["ZodReadonly"] = "ZodReadonly";
})(ZodFirstPartyTypeKind || (ZodFirstPartyTypeKind = {}));
const instanceOfType = (cls, params = {
  message: `Input not instance of ${cls.name}`
}) => custom((data) => data instanceof cls, params);
const stringType = ZodString.create;
const numberType = ZodNumber.create;
const nanType = ZodNaN.create;
const bigIntType = ZodBigInt.create;
const booleanType = ZodBoolean.create;
const dateType = ZodDate.create;
const symbolType = ZodSymbol.create;
const undefinedType = ZodUndefined.create;
const nullType = ZodNull.create;
const anyType = ZodAny.create;
const unknownType = ZodUnknown.create;
const neverType = ZodNever.create;
const voidType = ZodVoid.create;
const arrayType = ZodArray.create;
const objectType = ZodObject.create;
const strictObjectType = ZodObject.strictCreate;
const unionType = ZodUnion.create;
const discriminatedUnionType = ZodDiscriminatedUnion.create;
const intersectionType = ZodIntersection.create;
const tupleType = ZodTuple.create;
const recordType = ZodRecord.create;
const mapType = ZodMap.create;
const setType = ZodSet.create;
const functionType = ZodFunction.create;
const lazyType = ZodLazy.create;
const literalType = ZodLiteral.create;
const enumType = ZodEnum.create;
const nativeEnumType = ZodNativeEnum.create;
const promiseType = ZodPromise.create;
const effectsType = ZodEffects.create;
const optionalType = ZodOptional.create;
const nullableType = ZodNullable.create;
const preprocessType = ZodEffects.createWithPreprocess;
const pipelineType = ZodPipeline.create;
const ostring = () => stringType().optional();
const onumber = () => numberType().optional();
const oboolean = () => booleanType().optional();
const coerce = {
  string: (arg) => ZodString.create({ ...arg, coerce: true }),
  number: (arg) => ZodNumber.create({ ...arg, coerce: true }),
  boolean: (arg) => ZodBoolean.create({
    ...arg,
    coerce: true
  }),
  bigint: (arg) => ZodBigInt.create({ ...arg, coerce: true }),
  date: (arg) => ZodDate.create({ ...arg, coerce: true })
};
const NEVER = INVALID;
var z$8 = /* @__PURE__ */ Object.freeze({
  __proto__: null,
  defaultErrorMap: errorMap,
  setErrorMap,
  getErrorMap,
  makeIssue,
  EMPTY_PATH,
  addIssueToContext,
  ParseStatus,
  INVALID,
  DIRTY,
  OK,
  isAborted,
  isDirty,
  isValid,
  isAsync,
  get util() {
    return util;
  },
  get objectUtil() {
    return objectUtil;
  },
  ZodParsedType,
  getParsedType,
  ZodType,
  datetimeRegex,
  ZodString,
  ZodNumber,
  ZodBigInt,
  ZodBoolean,
  ZodDate,
  ZodSymbol,
  ZodUndefined,
  ZodNull,
  ZodAny,
  ZodUnknown,
  ZodNever,
  ZodVoid,
  ZodArray,
  ZodObject,
  ZodUnion,
  ZodDiscriminatedUnion,
  ZodIntersection,
  ZodTuple,
  ZodRecord,
  ZodMap,
  ZodSet,
  ZodFunction,
  ZodLazy,
  ZodLiteral,
  ZodEnum,
  ZodNativeEnum,
  ZodPromise,
  ZodEffects,
  ZodTransformer: ZodEffects,
  ZodOptional,
  ZodNullable,
  ZodDefault,
  ZodCatch,
  ZodNaN,
  BRAND,
  ZodBranded,
  ZodPipeline,
  ZodReadonly,
  custom,
  Schema: ZodType,
  ZodSchema: ZodType,
  late,
  get ZodFirstPartyTypeKind() {
    return ZodFirstPartyTypeKind;
  },
  coerce,
  any: anyType,
  array: arrayType,
  bigint: bigIntType,
  boolean: booleanType,
  date: dateType,
  discriminatedUnion: discriminatedUnionType,
  effect: effectsType,
  "enum": enumType,
  "function": functionType,
  "instanceof": instanceOfType,
  intersection: intersectionType,
  lazy: lazyType,
  literal: literalType,
  map: mapType,
  nan: nanType,
  nativeEnum: nativeEnumType,
  never: neverType,
  "null": nullType,
  nullable: nullableType,
  number: numberType,
  object: objectType,
  oboolean,
  onumber,
  optional: optionalType,
  ostring,
  pipeline: pipelineType,
  preprocess: preprocessType,
  promise: promiseType,
  record: recordType,
  set: setType,
  strictObject: strictObjectType,
  string: stringType,
  symbol: symbolType,
  transformer: effectsType,
  tuple: tupleType,
  "undefined": undefinedType,
  union: unionType,
  unknown: unknownType,
  "void": voidType,
  NEVER,
  ZodIssueCode,
  quotelessJson,
  ZodError
});
const urlAlphabet = "useandom-26T198340PX75pxJACKVERYMINDBUSHWOLF_GQZbfghjklqvwyzrict";
let nanoid = (size2 = 21) => {
  let id2 = "";
  let bytes = crypto.getRandomValues(new Uint8Array(size2));
  while (size2--) {
    id2 += urlAlphabet[bytes[size2] & 63];
  }
  return id2;
};
const nanoidSchema = z$8.string().min(7).optional().default(() => nanoid());
const cookieSchema = z$8.object({
  uid: nanoidSchema,
  /**  Defines the cookie name and its value. A cookie definition begins with a name-value pair.  */
  name: z$8.string().default("Default Cookie"),
  value: z$8.string().default("Default Value"),
  /** Defines the host to which the cookie will be sent. */
  domain: z$8.string().optional(),
  /** Indicates the maximum lifetime of the cookie as an HTTP-date timestamp. See Date for the required formatting. */
  expires: z$8.date().optional(),
  /**
   * Forbids JavaScript from accessing the cookie, for example, through the Document.cookie property. Note that a cookie
   * that has been created with HttpOnly will still be sent with JavaScript-initiated requests, for example, when
   * calling XMLHttpRequest.send() or fetch(). This mitigates attacks against cross-site scripting (XSS).
   */
  httpOnly: z$8.boolean().optional(),
  /**
   * Indicates the number of seconds until the cookie expires. A zero or negative number will expire the cookie
   * immediately. If both Expires and Max-Age are set, Max-Age has precedence.
   */
  maxAge: z$8.number().optional(),
  /**
   * Indicates that the cookie should be stored using partitioned storage. See Cookies Having Independent Partitioned
   * State (CHIPS) for more details.
   */
  partitioned: z$8.boolean().optional(),
  /** Indicates the path that must exist in the requested URL for the browser to send the Cookie header. */
  path: z$8.string().optional(),
  /**
   * Controls whether or not a cookie is sent with cross-site requests, providing some protection against cross-site
   * request forgery attacks (CSRF).
   */
  sameSite: z$8.union([z$8.literal("Lax"), z$8.literal("Strict"), z$8.literal("None")]).default("None"),
  /**
   * Indicates that the cookie is sent to the server only when a request is made with the https: scheme (except on
   * localhost), and therefore, is more resistant to man-in-the-middle attacks.
   */
  secure: z$8.boolean().optional()
});
const environmentSchema = z$8.object({
  uid: nanoidSchema,
  name: z$8.string().optional().default("Default Environment"),
  color: z$8.string().optional().default("blue"),
  value: z$8.string().default(""),
  isDefault: z$8.boolean().optional()
});
const apiKeyExampleSchema = z$8.object({
  type: z$8.literal("apiKey").default("apiKey"),
  name: z$8.string().default(""),
  value: z$8.string().default("")
});
const httpExampleSchema = z$8.object({
  type: z$8.literal("http").default("http"),
  username: z$8.string().default(""),
  password: z$8.string().default(""),
  token: z$8.string().default("")
});
const oauthImplicitExampleSchema = z$8.object({
  type: z$8.literal("oauth-implicit").default("oauth-implicit"),
  token: z$8.string().default("")
});
const oauthPasswordExampleSchema = z$8.object({
  type: z$8.literal("oauth-password").default("oauth-password"),
  token: z$8.string().default(""),
  username: z$8.string().default(""),
  password: z$8.string().default(""),
  clientSecret: z$8.string().default("")
});
const oauthClientCredentialsExampleSchema = z$8.object({
  type: z$8.literal("oauth-clientCredentials").default("oauth-clientCredentials"),
  token: z$8.string().default(""),
  clientSecret: z$8.string().default("")
});
const oauthAuthorizationCodeExampleSchema = z$8.object({
  type: z$8.literal("oauth-authorizationCode").default("oauth-authorizationCode"),
  token: z$8.string().default(""),
  clientSecret: z$8.string().default("")
});
const securitySchemeExampleValueSchema = z$8.union([
  apiKeyExampleSchema,
  httpExampleSchema,
  oauthImplicitExampleSchema,
  oauthPasswordExampleSchema,
  oauthClientCredentialsExampleSchema,
  oauthAuthorizationCodeExampleSchema
]);
function authExampleFromSchema(scheme, baseValues = {}) {
  if (scheme.type === "apiKey")
    return apiKeyExampleSchema.parse({ name: scheme.name, ...baseValues });
  if (scheme.type === "http")
    return httpExampleSchema.parse(baseValues);
  if (scheme.type === "oauth2") {
    if (scheme.flow.type === "authorizationCode")
      return oauthAuthorizationCodeExampleSchema.parse(baseValues);
    if (scheme.flow.type === "clientCredentials")
      return oauthClientCredentialsExampleSchema.parse(baseValues);
    if (scheme.flow.type === "implicit")
      return oauthImplicitExampleSchema.parse(baseValues);
    if (scheme.flow.type === "password")
      return oauthPasswordExampleSchema.parse(baseValues);
  }
  throw Error("INVALID SCHEMA FOR OAUTH EXAMPLE");
}
const commonProps = z$8.object({
  /* A description for security scheme. CommonMark syntax MAY be used for rich text representation. */
  description: z$8.string().optional()
});
const extendedSecuritySchema = z$8.object({
  uid: nanoidSchema,
  /** The name key that links a security requirement to a security object */
  nameKey: z$8.string().optional().default("")
});
const securitySchemeApiKeyIn = ["query", "header", "cookie"];
const oasSecuritySchemeApiKey = commonProps.extend({
  type: z$8.literal("apiKey"),
  /** REQUIRED. The name of the header, query or cookie parameter to be used. */
  name: z$8.string().optional().default(""),
  /** REQUIRED. The location of the API key. Valid values are "query", "header" or "cookie". */
  in: z$8.enum(securitySchemeApiKeyIn).optional().default("header")
});
const securityApiKeySchema = oasSecuritySchemeApiKey.merge(extendedSecuritySchema);
const oasSecuritySchemeHttp = commonProps.extend({
  type: z$8.literal("http"),
  /**
   * REQUIRED. The name of the HTTP Authorization scheme to be used in the Authorization header as defined in
   * [RFC7235]. The values used SHOULD be registered in the IANA Authentication Scheme registry.
   */
  scheme: z$8.string().toLowerCase().pipe(z$8.enum(["basic", "bearer"])).optional().default("basic"),
  /**
   * A hint to the client to identify how the bearer token is formatted.
   * Bearer tokens are usually generated by an authorization server, so
   * this information is primarily for documentation purposes.
   */
  bearerFormat: z$8.union([z$8.literal("JWT"), z$8.string()]).optional().default("JWT")
});
const securityHttpSchema = oasSecuritySchemeHttp.merge(extendedSecuritySchema);
const oasSecuritySchemeOpenId = commonProps.extend({
  type: z$8.literal("openIdConnect"),
  /**
   * REQUIRED. OpenId Connect URL to discover OAuth2 configuration values. This MUST be in the
   * form of a URL. The OpenID Connect standard requires the use of TLS.
   */
  openIdConnectUrl: z$8.string().optional().default("")
});
const securityOpenIdSchema = oasSecuritySchemeOpenId.merge(extendedSecuritySchema);
const authorizationUrl = z$8.string().default("");
const tokenUrl = z$8.string().default("");
const oauthCommon = z$8.object({
  /**
   * The URL to be used for obtaining refresh tokens. This MUST be in the form of a
   * URL. The OAuth2 standard requires the use of TLS.
   */
  refreshUrl: z$8.string().optional().default(""),
  /**
   * REQUIRED. The available scopes for the OAuth2 security scheme. A map
   * between the scope name and a short description for it. The map MAY be empty.
   */
  scopes: z$8.union([
    z$8.map(z$8.string(), z$8.string().optional()),
    z$8.record(z$8.string(), z$8.string().optional()),
    z$8.object({})
  ]).optional().default({}),
  selectedScopes: z$8.array(z$8.string()).optional().default([])
});
const oasOauthFlowSchema = z$8.discriminatedUnion("type", [
  /** Configuration for the OAuth Implicit flow */
  oauthCommon.extend({
    "type": z$8.literal("implicit"),
    authorizationUrl,
    "x-scalar-redirect-uri": z$8.string().optional().default("")
  }),
  /** Configuration for the OAuth Resource Owner Password flow */
  oauthCommon.extend({
    type: z$8.literal("password"),
    tokenUrl
  }),
  /** Configuration for the OAuth Client Credentials flow. Previously called application in OpenAPI 2.0. */
  oauthCommon.extend({
    type: z$8.literal("clientCredentials"),
    tokenUrl
  }),
  /** Configuration for the OAuth Authorization Code flow. Previously called accessCode in OpenAPI 2.0.*/
  oauthCommon.extend({
    "type": z$8.literal("authorizationCode"),
    authorizationUrl,
    "x-scalar-redirect-uri": z$8.string().optional().default(""),
    tokenUrl
  })
]).optional().default({ type: "implicit", authorizationUrl: "http://localhost:8080" });
const oasSecuritySchemeOauth2 = commonProps.extend({
  "type": z$8.literal("oauth2"),
  /** REQUIRED. An object containing configuration information for the flow types supported. */
  "flow": oasOauthFlowSchema,
  /** Extension to save the client Id associated with an oauth flow */
  "x-scalar-client-id": z$8.string().optional().default("")
});
const securityOauthSchema = oasSecuritySchemeOauth2.merge(extendedSecuritySchema);
const oasSecurityRequirementSchema = z$8.record(z$8.string(), z$8.array(z$8.string()).optional().default([]));
z$8.union([
  oasSecuritySchemeApiKey,
  oasSecuritySchemeHttp,
  oasSecuritySchemeOauth2,
  oasSecuritySchemeOpenId
]);
const securitySchemeSchema = z$8.union([
  securityApiKeySchema,
  securityHttpSchema,
  securityOpenIdSchema,
  securityOauthSchema
]);
const oasLicenseSchema = z$8.object({
  /** REQUIRED. The license name used for the API. */
  name: z$8.string().optional().default("name"),
  /** An SPDX license expression for the API. The identifier field is mutually exclusive of the url field. */
  identifier: z$8.string().optional(),
  /**
   * A URL to the license used for the API. This MUST be in the form of a URL. The url field
   * is mutually exclusive of the identifier field.
   */
  url: z$8.string().url().optional()
});
const oasContactSchema = z$8.object({
  /** The identifying name of the contact person/organization. */
  name: z$8.string().optional(),
  /** The URL pointing to the contact information. This MUST be in the form of a URL. */
  url: z$8.string().url().optional(),
  /** The email address of the contact person/organization. This MUST be in the form of an email address. */
  email: z$8.string().email().optional()
});
const oasInfoSchema = z$8.object({
  /** REQUIRED. The title of the API. */
  title: z$8.string().optional().default("OpenAPI Spec"),
  /** A short summary of the API. */
  summary: z$8.string().optional(),
  /** A description of the API. CommonMark syntax MAY be used for rich text representation. */
  description: z$8.string().optional(),
  /** A URL to the Terms of Service for the API. This MUST be in the form of a URL. */
  termsOfService: z$8.string().optional(),
  /** The contact information for the exposed API. */
  contact: oasContactSchema.optional(),
  /** The license information for the exposed API. */
  license: oasLicenseSchema.optional(),
  /**
   * REQUIRED. The version of the OpenAPI document (which is distinct from the OpenAPI
   * Specification version or the API implementation version).
   */
  version: z$8.string().optional().default("1.0")
});
const oasExternalDocumentationSchema = z$8.object({
  /** A description of the target documentation. CommonMark syntax MAY be used for rich text representation. */
  description: z$8.string().optional(),
  /** REQUIRED. The URL for the target documentation. This MUST be in the form of a URL. */
  url: z$8.string().default("")
});
const xScalarNestedSchema = z$8.object({
  tagName: z$8.string()
}).array();
const oasTagSchema = z$8.object({
  "type": z$8.literal("tag").optional().default("tag"),
  /** REQUIRED. The name of the tag. */
  "name": z$8.string(),
  /** A description for the tag. CommonMark syntax MAY be used for rich text representation. */
  "description": z$8.string().optional(),
  /** Additional external documentation for this tag. */
  "externalDocs": oasExternalDocumentationSchema.optional(),
  "x-scalar-children": xScalarNestedSchema.default([])
});
const tagSchema = oasTagSchema.extend({
  uid: nanoidSchema,
  children: nanoidSchema.array().default([])
});
const oasCollectionSchema = z$8.object({
  "type": z$8.literal("collection").optional().default("collection"),
  "openapi": z$8.union([
    z$8.string(),
    z$8.literal("3.0.0"),
    z$8.literal("3.1.0"),
    z$8.literal("4.0.0")
  ]).optional().default("3.1.0"),
  "jsonSchemaDialect": z$8.string().optional(),
  "info": oasInfoSchema.optional(),
  /**
   * A declaration of which security mechanisms can be used across the API. The list of
   * values includes alternative security requirement objects that can be used. Only
   * one of the security requirement objects need to be satisfied to authorize a request.
   * Individual operations can override this definition. To make security optional, an empty
   * security requirement ({}) can be included in the array.
   */
  "security": z$8.array(oasSecurityRequirementSchema).optional().default([]),
  "externalDocs": oasExternalDocumentationSchema.optional(),
  /** TODO: Type these */
  "components": z$8.record(z$8.string(), z$8.unknown()).optional(),
  /** TODO: Type these */
  "webhooks": z$8.record(z$8.string(), z$8.unknown()).optional(),
  /** A custom icon representing the collection */
  "x-scalar-icon": z$8.string().optional().default("interface-content-folder")
  // These properties will be stripped out and mapped back as id lists
  // servers
  // paths/**
  // servers
  // tags
  // security
});
const extendedCollectionSchema = z$8.object({
  uid: nanoidSchema,
  /** A list of security schemes UIDs associated with the collection */
  securitySchemes: z$8.string().array().default([]),
  /** The currently selected server */
  selectedServerUid: z$8.string().default(""),
  /** UIDs which refer to servers on the workspace base */
  servers: nanoidSchema.array().default([]),
  /** Request UIDs associated with a collection */
  requests: nanoidSchema.array().default([]),
  /** Tag UIDs associated with the collection */
  tags: nanoidSchema.array().default([]),
  /** List of requests without tags and top level tag "folders" */
  children: nanoidSchema.array().default([]),
  /**
   * Map of security schemas to their value sets
   *
   * For each selected security schema we should have an entry here
   * The entry will contain the secret values (but not the schema definition)
   */
  auth: z$8.record(nanoidSchema, securitySchemeExampleValueSchema).default({}),
  /** A link to where this document is stored, useful for live sync and possibly git sync down the line */
  documentUrl: z$8.string().optional(),
  /**
   * Enables polling of OpenAPI document urls
   *
   * @remarks Only effective when `documentUrl` is set
   */
  watchForChanges: z$8.boolean().optional().default(false),
  /**
   * Status of the watcher from above
   *
   * @defaults to idle for all collections, doesn't mean that it can watch for changes
   */
  watchForChangesStatus: z$8.enum(["IDLE", "WATCHING", "ERROR"]).optional().default("IDLE")
});
const collectionSchema = oasCollectionSchema.merge(extendedCollectionSchema);
const oasServerVariableSchema = z$8.object({
  /**
   * An enumeration of string values to be used if the substitution options are from a limited set.
   * The array MUST NOT be empty.
   */
  enum: z$8.string().array().min(1).optional(),
  /**
   * REQUIRED. The default value to use for substitution, which SHALL be sent if an alternate value is not supplied.
   * Note this behavior is different than the Schema Object’s treatment of default values, because in those cases
   * parameter values are optional. If the enum is defined, the value MUST exist in the enum’s values.
   */
  default: z$8.string().optional().default("default"),
  /** An optional description for the server variable. CommonMark syntax MAY be used for rich text representation. */
  description: z$8.string().optional()
});
const oasServerSchema = z$8.object({
  /**
   * REQUIRED. A URL to the target host. This URL supports Server Variables and MAY be relative, to indicate that
   * the host location is relative to the location where the OpenAPI document is being served. Variable substitutions
   * will be made when a variable is named in {brackets}.
   */
  url: z$8.string().optional().default(""),
  /**
   * An optional string describing the host designated by the URL. CommonMark syntax MAY be used for rich text
   * representation.
   */
  description: z$8.string().optional(),
  /** A map between a variable name and its value. The value is used for substitution in the server’s URL template. */
  variables: z$8.record(z$8.string(), oasServerVariableSchema).optional()
});
const serverSchema = oasServerSchema.extend({
  uid: nanoidSchema
});
const parameterTypeSchema = z$8.enum(["path", "query", "header", "cookie"]);
const parameterStyleSchema = z$8.enum([
  "matrix",
  "simple",
  "form",
  "label",
  "spaceDelimited",
  "pipeDelimited",
  "deepObject"
]);
const oasParameterSchema = z$8.object({
  in: parameterTypeSchema,
  name: z$8.string(),
  description: z$8.string().optional(),
  /** Defaulted to false */
  required: z$8.boolean().optional().default(false),
  /** Defaulted to false */
  deprecated: z$8.boolean().optional().default(false),
  schema: z$8.unknown().optional(),
  content: z$8.unknown().optional(),
  /** Defaulted according to @url https://spec.openapis.org/oas/v3.1.0#parameter-object */
  style: parameterStyleSchema.optional()
});
const requestMethods = [
  "connect",
  "delete",
  "get",
  "head",
  "options",
  "patch",
  "post",
  "put",
  "trace"
];
const requestBodySchema = z$8.any();
const oasRequestSchema = z$8.object({
  /**
   * A list of tags for API documentation control. Tags can be used for logical
   * grouping of operations by resources or any other qualifier.
   *
   * These tags are the openapi spec tag names, not uids
   */
  tags: z$8.string().array().optional(),
  /** A short summary of what the operation does. */
  summary: z$8.string().optional(),
  /** A verbose explanation of the operation behavior. CommonMark syntax MAY be used for rich text representation. */
  description: z$8.string().optional(),
  /**
   * Unique string used to identify the operation. The id MUST be unique among all operations described in the API.
   * The operationId value is case-sensitive. Tools and libraries MAY use the operationId to uniquely identify an
   * operation, therefore, it is RECOMMENDED to follow bin common programming naming conventions./
   */
  operationId: z$8.string().optional(),
  /**
   * A declaration of which security mechanisms can be used across the API. The list of
   * values includes alternative security requirement objects that can be used. Only
   * one of the security requirement objects need to be satisfied to authorize a request.
   * Individual operations can override this definition. To make security optional, an empty
   * security requirement ({}) can be included in the array.
   */
  security: z$8.array(oasSecurityRequirementSchema).optional(),
  /**
   * The request body applicable for this operation. The requestBody is fully supported in HTTP methods where the
   * HTTP 1.1 specification [RFC7231] has explicitly defined semantics for request bodies. In other cases where the
   * HTTP spec is vague (such as GET, HEAD and DELETE), requestBody is permitted but does not have well-defined
   * semantics and SHOULD be avoided if possible.
   */
  requestBody: requestBodySchema.optional(),
  /**
   * Request parameters
   */
  parameters: oasParameterSchema.array().optional(),
  /**
   * External documentation object
   */
  externalDocs: oasExternalDocumentationSchema.optional(),
  deprecated: z$8.boolean().optional(),
  /** Response formats */
  responses: z$8.record(z$8.string(), z$8.any()).optional()
});
const extendedRequestSchema = z$8.object({
  type: z$8.literal("request").optional().default("request"),
  uid: nanoidSchema,
  /** Path Key */
  path: z$8.string().optional().default(""),
  /** Request Method */
  method: z$8.enum(requestMethods).default("get"),
  /** List of server UIDs specific to the request */
  servers: nanoidSchema.array().default([]),
  /** The currently selected server */
  selectedServerUid: z$8.string().default(""),
  /** List of example UIDs associated with the request */
  examples: nanoidSchema.array().default([]),
  /** List of security scheme UIDs associated with the request */
  selectedSecuritySchemeUids: nanoidSchema.array().default([])
});
const requestSchema = oasRequestSchema.merge(extendedRequestSchema);
function schemaModel(data, schema2, throwError = true, errorLocation) {
  const result = schema2.safeParse(data);
  if (!result.success) {
    console.group("Schema Error");
    console.warn(JSON.stringify(result.error.format(), null, 2));
    console.log("Received: ", data);
    console.groupEnd();
  }
  if (throwError && !result.success)
    throw new Error("Zod validation failure");
  return result.data;
}
function json2xml(data, tab) {
  const toXml = function(value, key2, indentation2) {
    let xml3 = "";
    if (value instanceof Array) {
      for (let i2 = 0, n2 = value.length; i2 < n2; i2++) {
        xml3 += indentation2 + toXml(value[i2], key2, indentation2 + "	") + "\n";
      }
    } else if (typeof value == "object") {
      let hasChild2 = false;
      xml3 += indentation2 + "<" + key2;
      for (const m2 in value) {
        if (m2.charAt(0) == "@")
          xml3 += " " + m2.substr(1) + '="' + value[m2].toString() + '"';
        else
          hasChild2 = true;
      }
      xml3 += hasChild2 ? ">" : "/>";
      if (hasChild2) {
        for (const m2 in value) {
          if (m2 == "#text")
            xml3 += value[m2];
          else if (m2 == "#cdata")
            xml3 += "<![CDATA[" + value[m2] + "]]>";
          else if (m2.charAt(0) != "@")
            xml3 += toXml(value[m2], m2, indentation2 + "	");
        }
        xml3 += (xml3.charAt(xml3.length - 1) == "\n" ? indentation2 : "") + "</" + key2 + ">";
      }
    } else {
      xml3 += indentation2 + "<" + key2 + ">" + value.toString() + "</" + key2 + ">";
    }
    return xml3;
  };
  let xml2 = "";
  for (const key2 in data) {
    xml2 += toXml(data[key2], key2, "");
  }
  return tab ? xml2.replace(/\t/g, tab) : xml2.replace(/\t|\n/g, "");
}
function normalizeMimeType(contentType) {
  if (typeof contentType !== "string") {
    return void 0;
  }
  return contentType.replace(/;.*$/, "").replace(/\/.+\+/, "/").trim();
}
function normalizeMimeTypeObject(content2) {
  if (!content2) {
    return content2;
  }
  const newContent = {
    ...content2
  };
  Object.keys(newContent).forEach((key2) => {
    const newKey = normalizeMimeType(key2);
    if (newKey === void 0) {
      return;
    }
    newContent[newKey] = newContent[key2];
    if (key2 !== newKey) {
      delete newContent[key2];
    }
  });
  return newContent;
}
const ALIAS = Symbol.for("yaml.alias");
const DOC = Symbol.for("yaml.document");
const MAP = Symbol.for("yaml.map");
const PAIR = Symbol.for("yaml.pair");
const SCALAR$1 = Symbol.for("yaml.scalar");
const SEQ = Symbol.for("yaml.seq");
const NODE_TYPE = Symbol.for("yaml.node.type");
const isAlias = (node) => !!node && typeof node === "object" && node[NODE_TYPE] === ALIAS;
const isDocument = (node) => !!node && typeof node === "object" && node[NODE_TYPE] === DOC;
const isMap = (node) => !!node && typeof node === "object" && node[NODE_TYPE] === MAP;
const isPair = (node) => !!node && typeof node === "object" && node[NODE_TYPE] === PAIR;
const isScalar = (node) => !!node && typeof node === "object" && node[NODE_TYPE] === SCALAR$1;
const isSeq = (node) => !!node && typeof node === "object" && node[NODE_TYPE] === SEQ;
function isCollection(node) {
  if (node && typeof node === "object")
    switch (node[NODE_TYPE]) {
      case MAP:
      case SEQ:
        return true;
    }
  return false;
}
function isNode$2(node) {
  if (node && typeof node === "object")
    switch (node[NODE_TYPE]) {
      case ALIAS:
      case MAP:
      case SCALAR$1:
      case SEQ:
        return true;
    }
  return false;
}
const hasAnchor = (node) => (isScalar(node) || isCollection(node)) && !!node.anchor;
const BREAK = Symbol("break visit");
const SKIP$1 = Symbol("skip children");
const REMOVE = Symbol("remove node");
function visit$1(node, visitor) {
  const visitor_ = initVisitor(visitor);
  if (isDocument(node)) {
    const cd = visit_(null, node.contents, visitor_, Object.freeze([node]));
    if (cd === REMOVE)
      node.contents = null;
  } else
    visit_(null, node, visitor_, Object.freeze([]));
}
visit$1.BREAK = BREAK;
visit$1.SKIP = SKIP$1;
visit$1.REMOVE = REMOVE;
function visit_(key2, node, visitor, path2) {
  const ctrl = callVisitor(key2, node, visitor, path2);
  if (isNode$2(ctrl) || isPair(ctrl)) {
    replaceNode(key2, path2, ctrl);
    return visit_(key2, ctrl, visitor, path2);
  }
  if (typeof ctrl !== "symbol") {
    if (isCollection(node)) {
      path2 = Object.freeze(path2.concat(node));
      for (let i2 = 0; i2 < node.items.length; ++i2) {
        const ci = visit_(i2, node.items[i2], visitor, path2);
        if (typeof ci === "number")
          i2 = ci - 1;
        else if (ci === BREAK)
          return BREAK;
        else if (ci === REMOVE) {
          node.items.splice(i2, 1);
          i2 -= 1;
        }
      }
    } else if (isPair(node)) {
      path2 = Object.freeze(path2.concat(node));
      const ck = visit_("key", node.key, visitor, path2);
      if (ck === BREAK)
        return BREAK;
      else if (ck === REMOVE)
        node.key = null;
      const cv = visit_("value", node.value, visitor, path2);
      if (cv === BREAK)
        return BREAK;
      else if (cv === REMOVE)
        node.value = null;
    }
  }
  return ctrl;
}
function initVisitor(visitor) {
  if (typeof visitor === "object" && (visitor.Collection || visitor.Node || visitor.Value)) {
    return Object.assign({
      Alias: visitor.Node,
      Map: visitor.Node,
      Scalar: visitor.Node,
      Seq: visitor.Node
    }, visitor.Value && {
      Map: visitor.Value,
      Scalar: visitor.Value,
      Seq: visitor.Value
    }, visitor.Collection && {
      Map: visitor.Collection,
      Seq: visitor.Collection
    }, visitor);
  }
  return visitor;
}
function callVisitor(key2, node, visitor, path2) {
  var _a2, _b, _c, _d, _e;
  if (typeof visitor === "function")
    return visitor(key2, node, path2);
  if (isMap(node))
    return (_a2 = visitor.Map) == null ? void 0 : _a2.call(visitor, key2, node, path2);
  if (isSeq(node))
    return (_b = visitor.Seq) == null ? void 0 : _b.call(visitor, key2, node, path2);
  if (isPair(node))
    return (_c = visitor.Pair) == null ? void 0 : _c.call(visitor, key2, node, path2);
  if (isScalar(node))
    return (_d = visitor.Scalar) == null ? void 0 : _d.call(visitor, key2, node, path2);
  if (isAlias(node))
    return (_e = visitor.Alias) == null ? void 0 : _e.call(visitor, key2, node, path2);
  return void 0;
}
function replaceNode(key2, path2, node) {
  const parent = path2[path2.length - 1];
  if (isCollection(parent)) {
    parent.items[key2] = node;
  } else if (isPair(parent)) {
    if (key2 === "key")
      parent.key = node;
    else
      parent.value = node;
  } else if (isDocument(parent)) {
    parent.contents = node;
  } else {
    const pt = isAlias(parent) ? "alias" : "scalar";
    throw new Error(`Cannot replace node with ${pt} parent`);
  }
}
const escapeChars = {
  "!": "%21",
  ",": "%2C",
  "[": "%5B",
  "]": "%5D",
  "{": "%7B",
  "}": "%7D"
};
const escapeTagName = (tn) => tn.replace(/[!,[\]{}]/g, (ch) => escapeChars[ch]);
class Directives {
  constructor(yaml2, tags2) {
    this.docStart = null;
    this.docEnd = false;
    this.yaml = Object.assign({}, Directives.defaultYaml, yaml2);
    this.tags = Object.assign({}, Directives.defaultTags, tags2);
  }
  clone() {
    const copy = new Directives(this.yaml, this.tags);
    copy.docStart = this.docStart;
    return copy;
  }
  /**
   * During parsing, get a Directives instance for the current document and
   * update the stream state according to the current version's spec.
   */
  atDocument() {
    const res = new Directives(this.yaml, this.tags);
    switch (this.yaml.version) {
      case "1.1":
        this.atNextDocument = true;
        break;
      case "1.2":
        this.atNextDocument = false;
        this.yaml = {
          explicit: Directives.defaultYaml.explicit,
          version: "1.2"
        };
        this.tags = Object.assign({}, Directives.defaultTags);
        break;
    }
    return res;
  }
  /**
   * @param onError - May be called even if the action was successful
   * @returns `true` on success
   */
  add(line, onError) {
    if (this.atNextDocument) {
      this.yaml = { explicit: Directives.defaultYaml.explicit, version: "1.1" };
      this.tags = Object.assign({}, Directives.defaultTags);
      this.atNextDocument = false;
    }
    const parts = line.trim().split(/[ \t]+/);
    const name2 = parts.shift();
    switch (name2) {
      case "%TAG": {
        if (parts.length !== 2) {
          onError(0, "%TAG directive should contain exactly two parts");
          if (parts.length < 2)
            return false;
        }
        const [handle2, prefix] = parts;
        this.tags[handle2] = prefix;
        return true;
      }
      case "%YAML": {
        this.yaml.explicit = true;
        if (parts.length !== 1) {
          onError(0, "%YAML directive should contain exactly one part");
          return false;
        }
        const [version2] = parts;
        if (version2 === "1.1" || version2 === "1.2") {
          this.yaml.version = version2;
          return true;
        } else {
          const isValid2 = /^\d+\.\d+$/.test(version2);
          onError(6, `Unsupported YAML version ${version2}`, isValid2);
          return false;
        }
      }
      default:
        onError(0, `Unknown directive ${name2}`, true);
        return false;
    }
  }
  /**
   * Resolves a tag, matching handles to those defined in %TAG directives.
   *
   * @returns Resolved tag, which may also be the non-specific tag `'!'` or a
   *   `'!local'` tag, or `null` if unresolvable.
   */
  tagName(source2, onError) {
    if (source2 === "!")
      return "!";
    if (source2[0] !== "!") {
      onError(`Not a valid tag: ${source2}`);
      return null;
    }
    if (source2[1] === "<") {
      const verbatim = source2.slice(2, -1);
      if (verbatim === "!" || verbatim === "!!") {
        onError(`Verbatim tags aren't resolved, so ${source2} is invalid.`);
        return null;
      }
      if (source2[source2.length - 1] !== ">")
        onError("Verbatim tags must end with a >");
      return verbatim;
    }
    const [, handle2, suffix] = source2.match(/^(.*!)([^!]*)$/s);
    if (!suffix)
      onError(`The ${source2} tag has no suffix`);
    const prefix = this.tags[handle2];
    if (prefix) {
      try {
        return prefix + decodeURIComponent(suffix);
      } catch (error2) {
        onError(String(error2));
        return null;
      }
    }
    if (handle2 === "!")
      return source2;
    onError(`Could not resolve tag: ${source2}`);
    return null;
  }
  /**
   * Given a fully resolved tag, returns its printable string form,
   * taking into account current tag prefixes and defaults.
   */
  tagString(tag) {
    for (const [handle2, prefix] of Object.entries(this.tags)) {
      if (tag.startsWith(prefix))
        return handle2 + escapeTagName(tag.substring(prefix.length));
    }
    return tag[0] === "!" ? tag : `!<${tag}>`;
  }
  toString(doc2) {
    const lines = this.yaml.explicit ? [`%YAML ${this.yaml.version || "1.2"}`] : [];
    const tagEntries = Object.entries(this.tags);
    let tagNames;
    if (doc2 && tagEntries.length > 0 && isNode$2(doc2.contents)) {
      const tags2 = {};
      visit$1(doc2.contents, (_key, node) => {
        if (isNode$2(node) && node.tag)
          tags2[node.tag] = true;
      });
      tagNames = Object.keys(tags2);
    } else
      tagNames = [];
    for (const [handle2, prefix] of tagEntries) {
      if (handle2 === "!!" && prefix === "tag:yaml.org,2002:")
        continue;
      if (!doc2 || tagNames.some((tn) => tn.startsWith(prefix)))
        lines.push(`%TAG ${handle2} ${prefix}`);
    }
    return lines.join("\n");
  }
}
Directives.defaultYaml = { explicit: false, version: "1.2" };
Directives.defaultTags = { "!!": "tag:yaml.org,2002:" };
function anchorIsValid(anchor) {
  if (/[\x00-\x19\s,[\]{}]/.test(anchor)) {
    const sa = JSON.stringify(anchor);
    const msg = `Anchor must not contain whitespace or control characters: ${sa}`;
    throw new Error(msg);
  }
  return true;
}
function anchorNames(root2) {
  const anchors = /* @__PURE__ */ new Set();
  visit$1(root2, {
    Value(_key, node) {
      if (node.anchor)
        anchors.add(node.anchor);
    }
  });
  return anchors;
}
function findNewAnchor(prefix, exclude) {
  for (let i2 = 1; true; ++i2) {
    const name2 = `${prefix}${i2}`;
    if (!exclude.has(name2))
      return name2;
  }
}
function createNodeAnchors(doc2, prefix) {
  const aliasObjects = [];
  const sourceObjects = /* @__PURE__ */ new Map();
  let prevAnchors = null;
  return {
    onAnchor: (source2) => {
      aliasObjects.push(source2);
      if (!prevAnchors)
        prevAnchors = anchorNames(doc2);
      const anchor = findNewAnchor(prefix, prevAnchors);
      prevAnchors.add(anchor);
      return anchor;
    },
    /**
     * With circular references, the source node is only resolved after all
     * of its child nodes are. This is why anchors are set only after all of
     * the nodes have been created.
     */
    setAnchors: () => {
      for (const source2 of aliasObjects) {
        const ref2 = sourceObjects.get(source2);
        if (typeof ref2 === "object" && ref2.anchor && (isScalar(ref2.node) || isCollection(ref2.node))) {
          ref2.node.anchor = ref2.anchor;
        } else {
          const error2 = new Error("Failed to resolve repeated object (this should not happen)");
          error2.source = source2;
          throw error2;
        }
      }
    },
    sourceObjects
  };
}
function applyReviver(reviver, obj, key2, val) {
  if (val && typeof val === "object") {
    if (Array.isArray(val)) {
      for (let i2 = 0, len = val.length; i2 < len; ++i2) {
        const v0 = val[i2];
        const v1 = applyReviver(reviver, val, String(i2), v0);
        if (v1 === void 0)
          delete val[i2];
        else if (v1 !== v0)
          val[i2] = v1;
      }
    } else if (val instanceof Map) {
      for (const k2 of Array.from(val.keys())) {
        const v0 = val.get(k2);
        const v1 = applyReviver(reviver, val, k2, v0);
        if (v1 === void 0)
          val.delete(k2);
        else if (v1 !== v0)
          val.set(k2, v1);
      }
    } else if (val instanceof Set) {
      for (const v0 of Array.from(val)) {
        const v1 = applyReviver(reviver, val, v0, v0);
        if (v1 === void 0)
          val.delete(v0);
        else if (v1 !== v0) {
          val.delete(v0);
          val.add(v1);
        }
      }
    } else {
      for (const [k2, v0] of Object.entries(val)) {
        const v1 = applyReviver(reviver, val, k2, v0);
        if (v1 === void 0)
          delete val[k2];
        else if (v1 !== v0)
          val[k2] = v1;
      }
    }
  }
  return reviver.call(obj, key2, val);
}
function toJS(value, arg, ctx) {
  if (Array.isArray(value))
    return value.map((v2, i2) => toJS(v2, String(i2), ctx));
  if (value && typeof value.toJSON === "function") {
    if (!ctx || !hasAnchor(value))
      return value.toJSON(arg, ctx);
    const data = { aliasCount: 0, count: 1, res: void 0 };
    ctx.anchors.set(value, data);
    ctx.onCreate = (res2) => {
      data.res = res2;
      delete ctx.onCreate;
    };
    const res = value.toJSON(arg, ctx);
    if (ctx.onCreate)
      ctx.onCreate(res);
    return res;
  }
  if (typeof value === "bigint" && !(ctx == null ? void 0 : ctx.keep))
    return Number(value);
  return value;
}
class NodeBase {
  constructor(type2) {
    Object.defineProperty(this, NODE_TYPE, { value: type2 });
  }
  /** Create a copy of this node.  */
  clone() {
    const copy = Object.create(Object.getPrototypeOf(this), Object.getOwnPropertyDescriptors(this));
    if (this.range)
      copy.range = this.range.slice();
    return copy;
  }
  /** A plain JavaScript representation of this node. */
  toJS(doc2, { mapAsMap, maxAliasCount, onAnchor, reviver } = {}) {
    if (!isDocument(doc2))
      throw new TypeError("A document argument is required");
    const ctx = {
      anchors: /* @__PURE__ */ new Map(),
      doc: doc2,
      keep: true,
      mapAsMap: mapAsMap === true,
      mapKeyWarned: false,
      maxAliasCount: typeof maxAliasCount === "number" ? maxAliasCount : 100
    };
    const res = toJS(this, "", ctx);
    if (typeof onAnchor === "function")
      for (const { count, res: res2 } of ctx.anchors.values())
        onAnchor(res2, count);
    return typeof reviver === "function" ? applyReviver(reviver, { "": res }, "", res) : res;
  }
}
let Alias$1 = class Alias extends NodeBase {
  constructor(source2) {
    super(ALIAS);
    this.source = source2;
    Object.defineProperty(this, "tag", {
      set() {
        throw new Error("Alias nodes cannot have tags");
      }
    });
  }
  /**
   * Resolve the value of this alias within `doc`, finding the last
   * instance of the `source` anchor before this node.
   */
  resolve(doc2) {
    let found = void 0;
    visit$1(doc2, {
      Node: (_key, node) => {
        if (node === this)
          return visit$1.BREAK;
        if (node.anchor === this.source)
          found = node;
      }
    });
    return found;
  }
  toJSON(_arg, ctx) {
    if (!ctx)
      return { source: this.source };
    const { anchors, doc: doc2, maxAliasCount } = ctx;
    const source2 = this.resolve(doc2);
    if (!source2) {
      const msg = `Unresolved alias (the anchor must be set before the alias): ${this.source}`;
      throw new ReferenceError(msg);
    }
    let data = anchors.get(source2);
    if (!data) {
      toJS(source2, null, ctx);
      data = anchors.get(source2);
    }
    if (!data || data.res === void 0) {
      const msg = "This should not happen: Alias anchor was not resolved?";
      throw new ReferenceError(msg);
    }
    if (maxAliasCount >= 0) {
      data.count += 1;
      if (data.aliasCount === 0)
        data.aliasCount = getAliasCount(doc2, source2, anchors);
      if (data.count * data.aliasCount > maxAliasCount) {
        const msg = "Excessive alias count indicates a resource exhaustion attack";
        throw new ReferenceError(msg);
      }
    }
    return data.res;
  }
  toString(ctx, _onComment, _onChompKeep) {
    const src = `*${this.source}`;
    if (ctx) {
      anchorIsValid(this.source);
      if (ctx.options.verifyAliasOrder && !ctx.anchors.has(this.source)) {
        const msg = `Unresolved alias (the anchor must be set before the alias): ${this.source}`;
        throw new Error(msg);
      }
      if (ctx.implicitKey)
        return `${src} `;
    }
    return src;
  }
};
function getAliasCount(doc2, node, anchors) {
  if (isAlias(node)) {
    const source2 = node.resolve(doc2);
    const anchor = anchors && source2 && anchors.get(source2);
    return anchor ? anchor.count * anchor.aliasCount : 0;
  } else if (isCollection(node)) {
    let count = 0;
    for (const item of node.items) {
      const c2 = getAliasCount(doc2, item, anchors);
      if (c2 > count)
        count = c2;
    }
    return count;
  } else if (isPair(node)) {
    const kc = getAliasCount(doc2, node.key, anchors);
    const vc = getAliasCount(doc2, node.value, anchors);
    return Math.max(kc, vc);
  }
  return 1;
}
const isScalarValue = (value) => !value || typeof value !== "function" && typeof value !== "object";
class Scalar extends NodeBase {
  constructor(value) {
    super(SCALAR$1);
    this.value = value;
  }
  toJSON(arg, ctx) {
    return (ctx == null ? void 0 : ctx.keep) ? this.value : toJS(this.value, arg, ctx);
  }
  toString() {
    return String(this.value);
  }
}
Scalar.BLOCK_FOLDED = "BLOCK_FOLDED";
Scalar.BLOCK_LITERAL = "BLOCK_LITERAL";
Scalar.PLAIN = "PLAIN";
Scalar.QUOTE_DOUBLE = "QUOTE_DOUBLE";
Scalar.QUOTE_SINGLE = "QUOTE_SINGLE";
const defaultTagPrefix = "tag:yaml.org,2002:";
function findTagObject(value, tagName2, tags2) {
  if (tagName2) {
    const match = tags2.filter((t2) => t2.tag === tagName2);
    const tagObj = match.find((t2) => !t2.format) ?? match[0];
    if (!tagObj)
      throw new Error(`Tag ${tagName2} not found`);
    return tagObj;
  }
  return tags2.find((t2) => {
    var _a2;
    return ((_a2 = t2.identify) == null ? void 0 : _a2.call(t2, value)) && !t2.format;
  });
}
function createNode(value, tagName2, ctx) {
  var _a2, _b, _c;
  if (isDocument(value))
    value = value.contents;
  if (isNode$2(value))
    return value;
  if (isPair(value)) {
    const map2 = (_b = (_a2 = ctx.schema[MAP]).createNode) == null ? void 0 : _b.call(_a2, ctx.schema, null, ctx);
    map2.items.push(value);
    return map2;
  }
  if (value instanceof String || value instanceof Number || value instanceof Boolean || typeof BigInt !== "undefined" && value instanceof BigInt) {
    value = value.valueOf();
  }
  const { aliasDuplicateObjects, onAnchor, onTagObj, schema: schema2, sourceObjects } = ctx;
  let ref2 = void 0;
  if (aliasDuplicateObjects && value && typeof value === "object") {
    ref2 = sourceObjects.get(value);
    if (ref2) {
      if (!ref2.anchor)
        ref2.anchor = onAnchor(value);
      return new Alias$1(ref2.anchor);
    } else {
      ref2 = { anchor: null, node: null };
      sourceObjects.set(value, ref2);
    }
  }
  if (tagName2 == null ? void 0 : tagName2.startsWith("!!"))
    tagName2 = defaultTagPrefix + tagName2.slice(2);
  let tagObj = findTagObject(value, tagName2, schema2.tags);
  if (!tagObj) {
    if (value && typeof value.toJSON === "function") {
      value = value.toJSON();
    }
    if (!value || typeof value !== "object") {
      const node2 = new Scalar(value);
      if (ref2)
        ref2.node = node2;
      return node2;
    }
    tagObj = value instanceof Map ? schema2[MAP] : Symbol.iterator in Object(value) ? schema2[SEQ] : schema2[MAP];
  }
  if (onTagObj) {
    onTagObj(tagObj);
    delete ctx.onTagObj;
  }
  const node = (tagObj == null ? void 0 : tagObj.createNode) ? tagObj.createNode(ctx.schema, value, ctx) : typeof ((_c = tagObj == null ? void 0 : tagObj.nodeClass) == null ? void 0 : _c.from) === "function" ? tagObj.nodeClass.from(ctx.schema, value, ctx) : new Scalar(value);
  if (tagName2)
    node.tag = tagName2;
  else if (!tagObj.default)
    node.tag = tagObj.tag;
  if (ref2)
    ref2.node = node;
  return node;
}
function collectionFromPath(schema2, path2, value) {
  let v2 = value;
  for (let i2 = path2.length - 1; i2 >= 0; --i2) {
    const k2 = path2[i2];
    if (typeof k2 === "number" && Number.isInteger(k2) && k2 >= 0) {
      const a2 = [];
      a2[k2] = v2;
      v2 = a2;
    } else {
      v2 = /* @__PURE__ */ new Map([[k2, v2]]);
    }
  }
  return createNode(v2, void 0, {
    aliasDuplicateObjects: false,
    keepUndefined: false,
    onAnchor: () => {
      throw new Error("This should not happen, please report a bug.");
    },
    schema: schema2,
    sourceObjects: /* @__PURE__ */ new Map()
  });
}
const isEmptyPath = (path2) => path2 == null || typeof path2 === "object" && !!path2[Symbol.iterator]().next().done;
class Collection extends NodeBase {
  constructor(type2, schema2) {
    super(type2);
    Object.defineProperty(this, "schema", {
      value: schema2,
      configurable: true,
      enumerable: false,
      writable: true
    });
  }
  /**
   * Create a copy of this collection.
   *
   * @param schema - If defined, overwrites the original's schema
   */
  clone(schema2) {
    const copy = Object.create(Object.getPrototypeOf(this), Object.getOwnPropertyDescriptors(this));
    if (schema2)
      copy.schema = schema2;
    copy.items = copy.items.map((it) => isNode$2(it) || isPair(it) ? it.clone(schema2) : it);
    if (this.range)
      copy.range = this.range.slice();
    return copy;
  }
  /**
   * Adds a value to the collection. For `!!map` and `!!omap` the value must
   * be a Pair instance or a `{ key, value }` object, which may not have a key
   * that already exists in the map.
   */
  addIn(path2, value) {
    if (isEmptyPath(path2))
      this.add(value);
    else {
      const [key2, ...rest] = path2;
      const node = this.get(key2, true);
      if (isCollection(node))
        node.addIn(rest, value);
      else if (node === void 0 && this.schema)
        this.set(key2, collectionFromPath(this.schema, rest, value));
      else
        throw new Error(`Expected YAML collection at ${key2}. Remaining path: ${rest}`);
    }
  }
  /**
   * Removes a value from the collection.
   * @returns `true` if the item was found and removed.
   */
  deleteIn(path2) {
    const [key2, ...rest] = path2;
    if (rest.length === 0)
      return this.delete(key2);
    const node = this.get(key2, true);
    if (isCollection(node))
      return node.deleteIn(rest);
    else
      throw new Error(`Expected YAML collection at ${key2}. Remaining path: ${rest}`);
  }
  /**
   * Returns item at `key`, or `undefined` if not found. By default unwraps
   * scalar values from their surrounding node; to disable set `keepScalar` to
   * `true` (collections are always returned intact).
   */
  getIn(path2, keepScalar) {
    const [key2, ...rest] = path2;
    const node = this.get(key2, true);
    if (rest.length === 0)
      return !keepScalar && isScalar(node) ? node.value : node;
    else
      return isCollection(node) ? node.getIn(rest, keepScalar) : void 0;
  }
  hasAllNullValues(allowScalar) {
    return this.items.every((node) => {
      if (!isPair(node))
        return false;
      const n2 = node.value;
      return n2 == null || allowScalar && isScalar(n2) && n2.value == null && !n2.commentBefore && !n2.comment && !n2.tag;
    });
  }
  /**
   * Checks if the collection includes a value with the key `key`.
   */
  hasIn(path2) {
    const [key2, ...rest] = path2;
    if (rest.length === 0)
      return this.has(key2);
    const node = this.get(key2, true);
    return isCollection(node) ? node.hasIn(rest) : false;
  }
  /**
   * Sets a value in this collection. For `!!set`, `value` needs to be a
   * boolean to add/remove the item from the set.
   */
  setIn(path2, value) {
    const [key2, ...rest] = path2;
    if (rest.length === 0) {
      this.set(key2, value);
    } else {
      const node = this.get(key2, true);
      if (isCollection(node))
        node.setIn(rest, value);
      else if (node === void 0 && this.schema)
        this.set(key2, collectionFromPath(this.schema, rest, value));
      else
        throw new Error(`Expected YAML collection at ${key2}. Remaining path: ${rest}`);
    }
  }
}
Collection.maxFlowStringSingleLineLength = 60;
const stringifyComment = (str) => str.replace(/^(?!$)(?: $)?/gm, "#");
function indentComment(comment2, indent) {
  if (/^\n+$/.test(comment2))
    return comment2.substring(1);
  return indent ? comment2.replace(/^(?! *$)/gm, indent) : comment2;
}
const lineComment = (str, indent, comment2) => str.endsWith("\n") ? indentComment(comment2, indent) : comment2.includes("\n") ? "\n" + indentComment(comment2, indent) : (str.endsWith(" ") ? "" : " ") + comment2;
const FOLD_FLOW = "flow";
const FOLD_BLOCK = "block";
const FOLD_QUOTED = "quoted";
function foldFlowLines(text2, indent, mode = "flow", { indentAtStart, lineWidth = 80, minContentWidth = 20, onFold, onOverflow } = {}) {
  if (!lineWidth || lineWidth < 0)
    return text2;
  const endStep = Math.max(1 + minContentWidth, 1 + lineWidth - indent.length);
  if (text2.length <= endStep)
    return text2;
  const folds = [];
  const escapedFolds = {};
  let end = lineWidth - indent.length;
  if (typeof indentAtStart === "number") {
    if (indentAtStart > lineWidth - Math.max(2, minContentWidth))
      folds.push(0);
    else
      end = lineWidth - indentAtStart;
  }
  let split = void 0;
  let prev = void 0;
  let overflow = false;
  let i2 = -1;
  let escStart = -1;
  let escEnd = -1;
  if (mode === FOLD_BLOCK) {
    i2 = consumeMoreIndentedLines(text2, i2, indent.length);
    if (i2 !== -1)
      end = i2 + endStep;
  }
  for (let ch; ch = text2[i2 += 1]; ) {
    if (mode === FOLD_QUOTED && ch === "\\") {
      escStart = i2;
      switch (text2[i2 + 1]) {
        case "x":
          i2 += 3;
          break;
        case "u":
          i2 += 5;
          break;
        case "U":
          i2 += 9;
          break;
        default:
          i2 += 1;
      }
      escEnd = i2;
    }
    if (ch === "\n") {
      if (mode === FOLD_BLOCK)
        i2 = consumeMoreIndentedLines(text2, i2, indent.length);
      end = i2 + indent.length + endStep;
      split = void 0;
    } else {
      if (ch === " " && prev && prev !== " " && prev !== "\n" && prev !== "	") {
        const next = text2[i2 + 1];
        if (next && next !== " " && next !== "\n" && next !== "	")
          split = i2;
      }
      if (i2 >= end) {
        if (split) {
          folds.push(split);
          end = split + endStep;
          split = void 0;
        } else if (mode === FOLD_QUOTED) {
          while (prev === " " || prev === "	") {
            prev = ch;
            ch = text2[i2 += 1];
            overflow = true;
          }
          const j2 = i2 > escEnd + 1 ? i2 - 2 : escStart - 1;
          if (escapedFolds[j2])
            return text2;
          folds.push(j2);
          escapedFolds[j2] = true;
          end = j2 + endStep;
          split = void 0;
        } else {
          overflow = true;
        }
      }
    }
    prev = ch;
  }
  if (overflow && onOverflow)
    onOverflow();
  if (folds.length === 0)
    return text2;
  if (onFold)
    onFold();
  let res = text2.slice(0, folds[0]);
  for (let i3 = 0; i3 < folds.length; ++i3) {
    const fold = folds[i3];
    const end2 = folds[i3 + 1] || text2.length;
    if (fold === 0)
      res = `
${indent}${text2.slice(0, end2)}`;
    else {
      if (mode === FOLD_QUOTED && escapedFolds[fold])
        res += `${text2[fold]}\\`;
      res += `
${indent}${text2.slice(fold + 1, end2)}`;
    }
  }
  return res;
}
function consumeMoreIndentedLines(text2, i2, indent) {
  let end = i2;
  let start = i2 + 1;
  let ch = text2[start];
  while (ch === " " || ch === "	") {
    if (i2 < start + indent) {
      ch = text2[++i2];
    } else {
      do {
        ch = text2[++i2];
      } while (ch && ch !== "\n");
      end = i2;
      start = i2 + 1;
      ch = text2[start];
    }
  }
  return end;
}
const getFoldOptions = (ctx, isBlock2) => ({
  indentAtStart: isBlock2 ? ctx.indent.length : ctx.indentAtStart,
  lineWidth: ctx.options.lineWidth,
  minContentWidth: ctx.options.minContentWidth
});
const containsDocumentMarker = (str) => /^(%|---|\.\.\.)/m.test(str);
function lineLengthOverLimit(str, lineWidth, indentLength) {
  if (!lineWidth || lineWidth < 0)
    return false;
  const limit = lineWidth - indentLength;
  const strLen = str.length;
  if (strLen <= limit)
    return false;
  for (let i2 = 0, start = 0; i2 < strLen; ++i2) {
    if (str[i2] === "\n") {
      if (i2 - start > limit)
        return true;
      start = i2 + 1;
      if (strLen - start <= limit)
        return false;
    }
  }
  return true;
}
function doubleQuotedString(value, ctx) {
  const json2 = JSON.stringify(value);
  if (ctx.options.doubleQuotedAsJSON)
    return json2;
  const { implicitKey } = ctx;
  const minMultiLineLength = ctx.options.doubleQuotedMinMultiLineLength;
  const indent = ctx.indent || (containsDocumentMarker(value) ? "  " : "");
  let str = "";
  let start = 0;
  for (let i2 = 0, ch = json2[i2]; ch; ch = json2[++i2]) {
    if (ch === " " && json2[i2 + 1] === "\\" && json2[i2 + 2] === "n") {
      str += json2.slice(start, i2) + "\\ ";
      i2 += 1;
      start = i2;
      ch = "\\";
    }
    if (ch === "\\")
      switch (json2[i2 + 1]) {
        case "u":
          {
            str += json2.slice(start, i2);
            const code = json2.substr(i2 + 2, 4);
            switch (code) {
              case "0000":
                str += "\\0";
                break;
              case "0007":
                str += "\\a";
                break;
              case "000b":
                str += "\\v";
                break;
              case "001b":
                str += "\\e";
                break;
              case "0085":
                str += "\\N";
                break;
              case "00a0":
                str += "\\_";
                break;
              case "2028":
                str += "\\L";
                break;
              case "2029":
                str += "\\P";
                break;
              default:
                if (code.substr(0, 2) === "00")
                  str += "\\x" + code.substr(2);
                else
                  str += json2.substr(i2, 6);
            }
            i2 += 5;
            start = i2 + 1;
          }
          break;
        case "n":
          if (implicitKey || json2[i2 + 2] === '"' || json2.length < minMultiLineLength) {
            i2 += 1;
          } else {
            str += json2.slice(start, i2) + "\n\n";
            while (json2[i2 + 2] === "\\" && json2[i2 + 3] === "n" && json2[i2 + 4] !== '"') {
              str += "\n";
              i2 += 2;
            }
            str += indent;
            if (json2[i2 + 2] === " ")
              str += "\\";
            i2 += 1;
            start = i2 + 1;
          }
          break;
        default:
          i2 += 1;
      }
  }
  str = start ? str + json2.slice(start) : json2;
  return implicitKey ? str : foldFlowLines(str, indent, FOLD_QUOTED, getFoldOptions(ctx, false));
}
function singleQuotedString(value, ctx) {
  if (ctx.options.singleQuote === false || ctx.implicitKey && value.includes("\n") || /[ \t]\n|\n[ \t]/.test(value))
    return doubleQuotedString(value, ctx);
  const indent = ctx.indent || (containsDocumentMarker(value) ? "  " : "");
  const res = "'" + value.replace(/'/g, "''").replace(/\n+/g, `$&
${indent}`) + "'";
  return ctx.implicitKey ? res : foldFlowLines(res, indent, FOLD_FLOW, getFoldOptions(ctx, false));
}
function quotedString(value, ctx) {
  const { singleQuote } = ctx.options;
  let qs;
  if (singleQuote === false)
    qs = doubleQuotedString;
  else {
    const hasDouble = value.includes('"');
    const hasSingle = value.includes("'");
    if (hasDouble && !hasSingle)
      qs = singleQuotedString;
    else if (hasSingle && !hasDouble)
      qs = doubleQuotedString;
    else
      qs = singleQuote ? singleQuotedString : doubleQuotedString;
  }
  return qs(value, ctx);
}
let blockEndNewlines;
try {
  blockEndNewlines = new RegExp("(^|(?<!\n))\n+(?!\n|$)", "g");
} catch {
  blockEndNewlines = /\n+(?!\n|$)/g;
}
function blockString({ comment: comment2, type: type2, value }, ctx, onComment, onChompKeep) {
  const { blockQuote, commentString, lineWidth } = ctx.options;
  if (!blockQuote || /\n[\t ]+$/.test(value) || /^\s*$/.test(value)) {
    return quotedString(value, ctx);
  }
  const indent = ctx.indent || (ctx.forceBlockIndent || containsDocumentMarker(value) ? "  " : "");
  const literal2 = blockQuote === "literal" ? true : blockQuote === "folded" || type2 === Scalar.BLOCK_FOLDED ? false : type2 === Scalar.BLOCK_LITERAL ? true : !lineLengthOverLimit(value, lineWidth, indent.length);
  if (!value)
    return literal2 ? "|\n" : ">\n";
  let chomp;
  let endStart;
  for (endStart = value.length; endStart > 0; --endStart) {
    const ch = value[endStart - 1];
    if (ch !== "\n" && ch !== "	" && ch !== " ")
      break;
  }
  let end = value.substring(endStart);
  const endNlPos = end.indexOf("\n");
  if (endNlPos === -1) {
    chomp = "-";
  } else if (value === end || endNlPos !== end.length - 1) {
    chomp = "+";
    if (onChompKeep)
      onChompKeep();
  } else {
    chomp = "";
  }
  if (end) {
    value = value.slice(0, -end.length);
    if (end[end.length - 1] === "\n")
      end = end.slice(0, -1);
    end = end.replace(blockEndNewlines, `$&${indent}`);
  }
  let startWithSpace = false;
  let startEnd;
  let startNlPos = -1;
  for (startEnd = 0; startEnd < value.length; ++startEnd) {
    const ch = value[startEnd];
    if (ch === " ")
      startWithSpace = true;
    else if (ch === "\n")
      startNlPos = startEnd;
    else
      break;
  }
  let start = value.substring(0, startNlPos < startEnd ? startNlPos + 1 : startEnd);
  if (start) {
    value = value.substring(start.length);
    start = start.replace(/\n+/g, `$&${indent}`);
  }
  const indentSize = indent ? "2" : "1";
  let header = (literal2 ? "|" : ">") + (startWithSpace ? indentSize : "") + chomp;
  if (comment2) {
    header += " " + commentString(comment2.replace(/ ?[\r\n]+/g, " "));
    if (onComment)
      onComment();
  }
  if (literal2) {
    value = value.replace(/\n+/g, `$&${indent}`);
    return `${header}
${indent}${start}${value}${end}`;
  }
  value = value.replace(/\n+/g, "\n$&").replace(/(?:^|\n)([\t ].*)(?:([\n\t ]*)\n(?![\n\t ]))?/g, "$1$2").replace(/\n+/g, `$&${indent}`);
  const body2 = foldFlowLines(`${start}${value}${end}`, indent, FOLD_BLOCK, getFoldOptions(ctx, true));
  return `${header}
${indent}${body2}`;
}
function plainString(item, ctx, onComment, onChompKeep) {
  const { type: type2, value } = item;
  const { actualString, implicitKey, indent, indentStep, inFlow } = ctx;
  if (implicitKey && value.includes("\n") || inFlow && /[[\]{},]/.test(value)) {
    return quotedString(value, ctx);
  }
  if (!value || /^[\n\t ,[\]{}#&*!|>'"%@`]|^[?-]$|^[?-][ \t]|[\n:][ \t]|[ \t]\n|[\n\t ]#|[\n\t :]$/.test(value)) {
    return implicitKey || inFlow || !value.includes("\n") ? quotedString(value, ctx) : blockString(item, ctx, onComment, onChompKeep);
  }
  if (!implicitKey && !inFlow && type2 !== Scalar.PLAIN && value.includes("\n")) {
    return blockString(item, ctx, onComment, onChompKeep);
  }
  if (containsDocumentMarker(value)) {
    if (indent === "") {
      ctx.forceBlockIndent = true;
      return blockString(item, ctx, onComment, onChompKeep);
    } else if (implicitKey && indent === indentStep) {
      return quotedString(value, ctx);
    }
  }
  const str = value.replace(/\n+/g, `$&
${indent}`);
  if (actualString) {
    const test = (tag) => {
      var _a2;
      return tag.default && tag.tag !== "tag:yaml.org,2002:str" && ((_a2 = tag.test) == null ? void 0 : _a2.test(str));
    };
    const { compat, tags: tags2 } = ctx.doc.schema;
    if (tags2.some(test) || (compat == null ? void 0 : compat.some(test)))
      return quotedString(value, ctx);
  }
  return implicitKey ? str : foldFlowLines(str, indent, FOLD_FLOW, getFoldOptions(ctx, false));
}
function stringifyString(item, ctx, onComment, onChompKeep) {
  const { implicitKey, inFlow } = ctx;
  const ss = typeof item.value === "string" ? item : Object.assign({}, item, { value: String(item.value) });
  let { type: type2 } = item;
  if (type2 !== Scalar.QUOTE_DOUBLE) {
    if (/[\x00-\x08\x0b-\x1f\x7f-\x9f\u{D800}-\u{DFFF}]/u.test(ss.value))
      type2 = Scalar.QUOTE_DOUBLE;
  }
  const _stringify = (_type) => {
    switch (_type) {
      case Scalar.BLOCK_FOLDED:
      case Scalar.BLOCK_LITERAL:
        return implicitKey || inFlow ? quotedString(ss.value, ctx) : blockString(ss, ctx, onComment, onChompKeep);
      case Scalar.QUOTE_DOUBLE:
        return doubleQuotedString(ss.value, ctx);
      case Scalar.QUOTE_SINGLE:
        return singleQuotedString(ss.value, ctx);
      case Scalar.PLAIN:
        return plainString(ss, ctx, onComment, onChompKeep);
      default:
        return null;
    }
  };
  let res = _stringify(type2);
  if (res === null) {
    const { defaultKeyType, defaultStringType } = ctx.options;
    const t2 = implicitKey && defaultKeyType || defaultStringType;
    res = _stringify(t2);
    if (res === null)
      throw new Error(`Unsupported default string type ${t2}`);
  }
  return res;
}
function createStringifyContext(doc2, options) {
  const opt = Object.assign({
    blockQuote: true,
    commentString: stringifyComment,
    defaultKeyType: null,
    defaultStringType: "PLAIN",
    directives: null,
    doubleQuotedAsJSON: false,
    doubleQuotedMinMultiLineLength: 40,
    falseStr: "false",
    flowCollectionPadding: true,
    indentSeq: true,
    lineWidth: 80,
    minContentWidth: 20,
    nullStr: "null",
    simpleKeys: false,
    singleQuote: null,
    trueStr: "true",
    verifyAliasOrder: true
  }, doc2.schema.toStringOptions, options);
  let inFlow;
  switch (opt.collectionStyle) {
    case "block":
      inFlow = false;
      break;
    case "flow":
      inFlow = true;
      break;
    default:
      inFlow = null;
  }
  return {
    anchors: /* @__PURE__ */ new Set(),
    doc: doc2,
    flowCollectionPadding: opt.flowCollectionPadding ? " " : "",
    indent: "",
    indentStep: typeof opt.indent === "number" ? " ".repeat(opt.indent) : "  ",
    inFlow,
    options: opt
  };
}
function getTagObject(tags2, item) {
  var _a2;
  if (item.tag) {
    const match = tags2.filter((t2) => t2.tag === item.tag);
    if (match.length > 0)
      return match.find((t2) => t2.format === item.format) ?? match[0];
  }
  let tagObj = void 0;
  let obj;
  if (isScalar(item)) {
    obj = item.value;
    const match = tags2.filter((t2) => {
      var _a3;
      return (_a3 = t2.identify) == null ? void 0 : _a3.call(t2, obj);
    });
    tagObj = match.find((t2) => t2.format === item.format) ?? match.find((t2) => !t2.format);
  } else {
    obj = item;
    tagObj = tags2.find((t2) => t2.nodeClass && obj instanceof t2.nodeClass);
  }
  if (!tagObj) {
    const name2 = ((_a2 = obj == null ? void 0 : obj.constructor) == null ? void 0 : _a2.name) ?? typeof obj;
    throw new Error(`Tag not resolved for ${name2} value`);
  }
  return tagObj;
}
function stringifyProps(node, tagObj, { anchors, doc: doc2 }) {
  if (!doc2.directives)
    return "";
  const props = [];
  const anchor = (isScalar(node) || isCollection(node)) && node.anchor;
  if (anchor && anchorIsValid(anchor)) {
    anchors.add(anchor);
    props.push(`&${anchor}`);
  }
  const tag = node.tag ? node.tag : tagObj.default ? null : tagObj.tag;
  if (tag)
    props.push(doc2.directives.tagString(tag));
  return props.join(" ");
}
function stringify$3(item, ctx, onComment, onChompKeep) {
  var _a2;
  if (isPair(item))
    return item.toString(ctx, onComment, onChompKeep);
  if (isAlias(item)) {
    if (ctx.doc.directives)
      return item.toString(ctx);
    if ((_a2 = ctx.resolvedAliases) == null ? void 0 : _a2.has(item)) {
      throw new TypeError(`Cannot stringify circular structure without alias nodes`);
    } else {
      if (ctx.resolvedAliases)
        ctx.resolvedAliases.add(item);
      else
        ctx.resolvedAliases = /* @__PURE__ */ new Set([item]);
      item = item.resolve(ctx.doc);
    }
  }
  let tagObj = void 0;
  const node = isNode$2(item) ? item : ctx.doc.createNode(item, { onTagObj: (o2) => tagObj = o2 });
  if (!tagObj)
    tagObj = getTagObject(ctx.doc.schema.tags, node);
  const props = stringifyProps(node, tagObj, ctx);
  if (props.length > 0)
    ctx.indentAtStart = (ctx.indentAtStart ?? 0) + props.length + 1;
  const str = typeof tagObj.stringify === "function" ? tagObj.stringify(node, ctx, onComment, onChompKeep) : isScalar(node) ? stringifyString(node, ctx, onComment, onChompKeep) : node.toString(ctx, onComment, onChompKeep);
  if (!props)
    return str;
  return isScalar(node) || str[0] === "{" || str[0] === "[" ? `${props} ${str}` : `${props}
${ctx.indent}${str}`;
}
function stringifyPair({ key: key2, value }, ctx, onComment, onChompKeep) {
  const { allNullValues, doc: doc2, indent, indentStep, options: { commentString, indentSeq, simpleKeys } } = ctx;
  let keyComment = isNode$2(key2) && key2.comment || null;
  if (simpleKeys) {
    if (keyComment) {
      throw new Error("With simple keys, key nodes cannot have comments");
    }
    if (isCollection(key2) || !isNode$2(key2) && typeof key2 === "object") {
      const msg = "With simple keys, collection cannot be used as a key value";
      throw new Error(msg);
    }
  }
  let explicitKey = !simpleKeys && (!key2 || keyComment && value == null && !ctx.inFlow || isCollection(key2) || (isScalar(key2) ? key2.type === Scalar.BLOCK_FOLDED || key2.type === Scalar.BLOCK_LITERAL : typeof key2 === "object"));
  ctx = Object.assign({}, ctx, {
    allNullValues: false,
    implicitKey: !explicitKey && (simpleKeys || !allNullValues),
    indent: indent + indentStep
  });
  let keyCommentDone = false;
  let chompKeep = false;
  let str = stringify$3(key2, ctx, () => keyCommentDone = true, () => chompKeep = true);
  if (!explicitKey && !ctx.inFlow && str.length > 1024) {
    if (simpleKeys)
      throw new Error("With simple keys, single line scalar must not span more than 1024 characters");
    explicitKey = true;
  }
  if (ctx.inFlow) {
    if (allNullValues || value == null) {
      if (keyCommentDone && onComment)
        onComment();
      return str === "" ? "?" : explicitKey ? `? ${str}` : str;
    }
  } else if (allNullValues && !simpleKeys || value == null && explicitKey) {
    str = `? ${str}`;
    if (keyComment && !keyCommentDone) {
      str += lineComment(str, ctx.indent, commentString(keyComment));
    } else if (chompKeep && onChompKeep)
      onChompKeep();
    return str;
  }
  if (keyCommentDone)
    keyComment = null;
  if (explicitKey) {
    if (keyComment)
      str += lineComment(str, ctx.indent, commentString(keyComment));
    str = `? ${str}
${indent}:`;
  } else {
    str = `${str}:`;
    if (keyComment)
      str += lineComment(str, ctx.indent, commentString(keyComment));
  }
  let vsb, vcb, valueComment;
  if (isNode$2(value)) {
    vsb = !!value.spaceBefore;
    vcb = value.commentBefore;
    valueComment = value.comment;
  } else {
    vsb = false;
    vcb = null;
    valueComment = null;
    if (value && typeof value === "object")
      value = doc2.createNode(value);
  }
  ctx.implicitKey = false;
  if (!explicitKey && !keyComment && isScalar(value))
    ctx.indentAtStart = str.length + 1;
  chompKeep = false;
  if (!indentSeq && indentStep.length >= 2 && !ctx.inFlow && !explicitKey && isSeq(value) && !value.flow && !value.tag && !value.anchor) {
    ctx.indent = ctx.indent.substring(2);
  }
  let valueCommentDone = false;
  const valueStr = stringify$3(value, ctx, () => valueCommentDone = true, () => chompKeep = true);
  let ws = " ";
  if (keyComment || vsb || vcb) {
    ws = vsb ? "\n" : "";
    if (vcb) {
      const cs = commentString(vcb);
      ws += `
${indentComment(cs, ctx.indent)}`;
    }
    if (valueStr === "" && !ctx.inFlow) {
      if (ws === "\n")
        ws = "\n\n";
    } else {
      ws += `
${ctx.indent}`;
    }
  } else if (!explicitKey && isCollection(value)) {
    const vs0 = valueStr[0];
    const nl0 = valueStr.indexOf("\n");
    const hasNewline = nl0 !== -1;
    const flow = ctx.inFlow ?? value.flow ?? value.items.length === 0;
    if (hasNewline || !flow) {
      let hasPropsLine = false;
      if (hasNewline && (vs0 === "&" || vs0 === "!")) {
        let sp0 = valueStr.indexOf(" ");
        if (vs0 === "&" && sp0 !== -1 && sp0 < nl0 && valueStr[sp0 + 1] === "!") {
          sp0 = valueStr.indexOf(" ", sp0 + 1);
        }
        if (sp0 === -1 || nl0 < sp0)
          hasPropsLine = true;
      }
      if (!hasPropsLine)
        ws = `
${ctx.indent}`;
    }
  } else if (valueStr === "" || valueStr[0] === "\n") {
    ws = "";
  }
  str += ws + valueStr;
  if (ctx.inFlow) {
    if (valueCommentDone && onComment)
      onComment();
  } else if (valueComment && !valueCommentDone) {
    str += lineComment(str, ctx.indent, commentString(valueComment));
  } else if (chompKeep && onChompKeep) {
    onChompKeep();
  }
  return str;
}
function warn$1(logLevel, warning) {
  if (logLevel === "debug" || logLevel === "warn") {
    if (typeof process !== "undefined" && process.emitWarning)
      process.emitWarning(warning);
    else
      console.warn(warning);
  }
}
const MERGE_KEY = "<<";
function addPairToJSMap(ctx, map2, { key: key2, value }) {
  if ((ctx == null ? void 0 : ctx.doc.schema.merge) && isMergeKey(key2)) {
    value = isAlias(value) ? value.resolve(ctx.doc) : value;
    if (isSeq(value))
      for (const it of value.items)
        mergeToJSMap(ctx, map2, it);
    else if (Array.isArray(value))
      for (const it of value)
        mergeToJSMap(ctx, map2, it);
    else
      mergeToJSMap(ctx, map2, value);
  } else {
    const jsKey = toJS(key2, "", ctx);
    if (map2 instanceof Map) {
      map2.set(jsKey, toJS(value, jsKey, ctx));
    } else if (map2 instanceof Set) {
      map2.add(jsKey);
    } else {
      const stringKey = stringifyKey(key2, jsKey, ctx);
      const jsValue = toJS(value, stringKey, ctx);
      if (stringKey in map2)
        Object.defineProperty(map2, stringKey, {
          value: jsValue,
          writable: true,
          enumerable: true,
          configurable: true
        });
      else
        map2[stringKey] = jsValue;
    }
  }
  return map2;
}
const isMergeKey = (key2) => key2 === MERGE_KEY || isScalar(key2) && key2.value === MERGE_KEY && (!key2.type || key2.type === Scalar.PLAIN);
function mergeToJSMap(ctx, map2, value) {
  const source2 = ctx && isAlias(value) ? value.resolve(ctx.doc) : value;
  if (!isMap(source2))
    throw new Error("Merge sources must be maps or map aliases");
  const srcMap = source2.toJSON(null, ctx, Map);
  for (const [key2, value2] of srcMap) {
    if (map2 instanceof Map) {
      if (!map2.has(key2))
        map2.set(key2, value2);
    } else if (map2 instanceof Set) {
      map2.add(key2);
    } else if (!Object.prototype.hasOwnProperty.call(map2, key2)) {
      Object.defineProperty(map2, key2, {
        value: value2,
        writable: true,
        enumerable: true,
        configurable: true
      });
    }
  }
  return map2;
}
function stringifyKey(key2, jsKey, ctx) {
  if (jsKey === null)
    return "";
  if (typeof jsKey !== "object")
    return String(jsKey);
  if (isNode$2(key2) && (ctx == null ? void 0 : ctx.doc)) {
    const strCtx = createStringifyContext(ctx.doc, {});
    strCtx.anchors = /* @__PURE__ */ new Set();
    for (const node of ctx.anchors.keys())
      strCtx.anchors.add(node.anchor);
    strCtx.inFlow = true;
    strCtx.inStringifyKey = true;
    const strKey = key2.toString(strCtx);
    if (!ctx.mapKeyWarned) {
      let jsonStr = JSON.stringify(strKey);
      if (jsonStr.length > 40)
        jsonStr = jsonStr.substring(0, 36) + '..."';
      warn$1(ctx.doc.options.logLevel, `Keys with collection values will be stringified due to JS Object restrictions: ${jsonStr}. Set mapAsMap: true to use object keys.`);
      ctx.mapKeyWarned = true;
    }
    return strKey;
  }
  return JSON.stringify(jsKey);
}
function createPair(key2, value, ctx) {
  const k2 = createNode(key2, void 0, ctx);
  const v2 = createNode(value, void 0, ctx);
  return new Pair(k2, v2);
}
class Pair {
  constructor(key2, value = null) {
    Object.defineProperty(this, NODE_TYPE, { value: PAIR });
    this.key = key2;
    this.value = value;
  }
  clone(schema2) {
    let { key: key2, value } = this;
    if (isNode$2(key2))
      key2 = key2.clone(schema2);
    if (isNode$2(value))
      value = value.clone(schema2);
    return new Pair(key2, value);
  }
  toJSON(_2, ctx) {
    const pair2 = (ctx == null ? void 0 : ctx.mapAsMap) ? /* @__PURE__ */ new Map() : {};
    return addPairToJSMap(ctx, pair2, this);
  }
  toString(ctx, onComment, onChompKeep) {
    return (ctx == null ? void 0 : ctx.doc) ? stringifyPair(this, ctx, onComment, onChompKeep) : JSON.stringify(this);
  }
}
function stringifyCollection(collection, ctx, options) {
  const flow = ctx.inFlow ?? collection.flow;
  const stringify2 = flow ? stringifyFlowCollection : stringifyBlockCollection;
  return stringify2(collection, ctx, options);
}
function stringifyBlockCollection({ comment: comment2, items }, ctx, { blockItemPrefix, flowChars, itemIndent, onChompKeep, onComment }) {
  const { indent, options: { commentString } } = ctx;
  const itemCtx = Object.assign({}, ctx, { indent: itemIndent, type: null });
  let chompKeep = false;
  const lines = [];
  for (let i2 = 0; i2 < items.length; ++i2) {
    const item = items[i2];
    let comment3 = null;
    if (isNode$2(item)) {
      if (!chompKeep && item.spaceBefore)
        lines.push("");
      addCommentBefore(ctx, lines, item.commentBefore, chompKeep);
      if (item.comment)
        comment3 = item.comment;
    } else if (isPair(item)) {
      const ik = isNode$2(item.key) ? item.key : null;
      if (ik) {
        if (!chompKeep && ik.spaceBefore)
          lines.push("");
        addCommentBefore(ctx, lines, ik.commentBefore, chompKeep);
      }
    }
    chompKeep = false;
    let str2 = stringify$3(item, itemCtx, () => comment3 = null, () => chompKeep = true);
    if (comment3)
      str2 += lineComment(str2, itemIndent, commentString(comment3));
    if (chompKeep && comment3)
      chompKeep = false;
    lines.push(blockItemPrefix + str2);
  }
  let str;
  if (lines.length === 0) {
    str = flowChars.start + flowChars.end;
  } else {
    str = lines[0];
    for (let i2 = 1; i2 < lines.length; ++i2) {
      const line = lines[i2];
      str += line ? `
${indent}${line}` : "\n";
    }
  }
  if (comment2) {
    str += "\n" + indentComment(commentString(comment2), indent);
    if (onComment)
      onComment();
  } else if (chompKeep && onChompKeep)
    onChompKeep();
  return str;
}
function stringifyFlowCollection({ items }, ctx, { flowChars, itemIndent }) {
  const { indent, indentStep, flowCollectionPadding: fcPadding, options: { commentString } } = ctx;
  itemIndent += indentStep;
  const itemCtx = Object.assign({}, ctx, {
    indent: itemIndent,
    inFlow: true,
    type: null
  });
  let reqNewline = false;
  let linesAtValue = 0;
  const lines = [];
  for (let i2 = 0; i2 < items.length; ++i2) {
    const item = items[i2];
    let comment2 = null;
    if (isNode$2(item)) {
      if (item.spaceBefore)
        lines.push("");
      addCommentBefore(ctx, lines, item.commentBefore, false);
      if (item.comment)
        comment2 = item.comment;
    } else if (isPair(item)) {
      const ik = isNode$2(item.key) ? item.key : null;
      if (ik) {
        if (ik.spaceBefore)
          lines.push("");
        addCommentBefore(ctx, lines, ik.commentBefore, false);
        if (ik.comment)
          reqNewline = true;
      }
      const iv = isNode$2(item.value) ? item.value : null;
      if (iv) {
        if (iv.comment)
          comment2 = iv.comment;
        if (iv.commentBefore)
          reqNewline = true;
      } else if (item.value == null && (ik == null ? void 0 : ik.comment)) {
        comment2 = ik.comment;
      }
    }
    if (comment2)
      reqNewline = true;
    let str = stringify$3(item, itemCtx, () => comment2 = null);
    if (i2 < items.length - 1)
      str += ",";
    if (comment2)
      str += lineComment(str, itemIndent, commentString(comment2));
    if (!reqNewline && (lines.length > linesAtValue || str.includes("\n")))
      reqNewline = true;
    lines.push(str);
    linesAtValue = lines.length;
  }
  const { start, end } = flowChars;
  if (lines.length === 0) {
    return start + end;
  } else {
    if (!reqNewline) {
      const len = lines.reduce((sum, line) => sum + line.length + 2, 2);
      reqNewline = ctx.options.lineWidth > 0 && len > ctx.options.lineWidth;
    }
    if (reqNewline) {
      let str = start;
      for (const line of lines)
        str += line ? `
${indentStep}${indent}${line}` : "\n";
      return `${str}
${indent}${end}`;
    } else {
      return `${start}${fcPadding}${lines.join(" ")}${fcPadding}${end}`;
    }
  }
}
function addCommentBefore({ indent, options: { commentString } }, lines, comment2, chompKeep) {
  if (comment2 && chompKeep)
    comment2 = comment2.replace(/^\n+/, "");
  if (comment2) {
    const ic = indentComment(commentString(comment2), indent);
    lines.push(ic.trimStart());
  }
}
function findPair(items, key2) {
  const k2 = isScalar(key2) ? key2.value : key2;
  for (const it of items) {
    if (isPair(it)) {
      if (it.key === key2 || it.key === k2)
        return it;
      if (isScalar(it.key) && it.key.value === k2)
        return it;
    }
  }
  return void 0;
}
class YAMLMap extends Collection {
  static get tagName() {
    return "tag:yaml.org,2002:map";
  }
  constructor(schema2) {
    super(MAP, schema2);
    this.items = [];
  }
  /**
   * A generic collection parsing method that can be extended
   * to other node classes that inherit from YAMLMap
   */
  static from(schema2, obj, ctx) {
    const { keepUndefined, replacer: replacer2 } = ctx;
    const map2 = new this(schema2);
    const add2 = (key2, value) => {
      if (typeof replacer2 === "function")
        value = replacer2.call(obj, key2, value);
      else if (Array.isArray(replacer2) && !replacer2.includes(key2))
        return;
      if (value !== void 0 || keepUndefined)
        map2.items.push(createPair(key2, value, ctx));
    };
    if (obj instanceof Map) {
      for (const [key2, value] of obj)
        add2(key2, value);
    } else if (obj && typeof obj === "object") {
      for (const key2 of Object.keys(obj))
        add2(key2, obj[key2]);
    }
    if (typeof schema2.sortMapEntries === "function") {
      map2.items.sort(schema2.sortMapEntries);
    }
    return map2;
  }
  /**
   * Adds a value to the collection.
   *
   * @param overwrite - If not set `true`, using a key that is already in the
   *   collection will throw. Otherwise, overwrites the previous value.
   */
  add(pair2, overwrite) {
    var _a2;
    let _pair;
    if (isPair(pair2))
      _pair = pair2;
    else if (!pair2 || typeof pair2 !== "object" || !("key" in pair2)) {
      _pair = new Pair(pair2, pair2 == null ? void 0 : pair2.value);
    } else
      _pair = new Pair(pair2.key, pair2.value);
    const prev = findPair(this.items, _pair.key);
    const sortEntries = (_a2 = this.schema) == null ? void 0 : _a2.sortMapEntries;
    if (prev) {
      if (!overwrite)
        throw new Error(`Key ${_pair.key} already set`);
      if (isScalar(prev.value) && isScalarValue(_pair.value))
        prev.value.value = _pair.value;
      else
        prev.value = _pair.value;
    } else if (sortEntries) {
      const i2 = this.items.findIndex((item) => sortEntries(_pair, item) < 0);
      if (i2 === -1)
        this.items.push(_pair);
      else
        this.items.splice(i2, 0, _pair);
    } else {
      this.items.push(_pair);
    }
  }
  delete(key2) {
    const it = findPair(this.items, key2);
    if (!it)
      return false;
    const del = this.items.splice(this.items.indexOf(it), 1);
    return del.length > 0;
  }
  get(key2, keepScalar) {
    const it = findPair(this.items, key2);
    const node = it == null ? void 0 : it.value;
    return (!keepScalar && isScalar(node) ? node.value : node) ?? void 0;
  }
  has(key2) {
    return !!findPair(this.items, key2);
  }
  set(key2, value) {
    this.add(new Pair(key2, value), true);
  }
  /**
   * @param ctx - Conversion context, originally set in Document#toJS()
   * @param {Class} Type - If set, forces the returned collection type
   * @returns Instance of Type, Map, or Object
   */
  toJSON(_2, ctx, Type) {
    const map2 = Type ? new Type() : (ctx == null ? void 0 : ctx.mapAsMap) ? /* @__PURE__ */ new Map() : {};
    if (ctx == null ? void 0 : ctx.onCreate)
      ctx.onCreate(map2);
    for (const item of this.items)
      addPairToJSMap(ctx, map2, item);
    return map2;
  }
  toString(ctx, onComment, onChompKeep) {
    if (!ctx)
      return JSON.stringify(this);
    for (const item of this.items) {
      if (!isPair(item))
        throw new Error(`Map items must all be pairs; found ${JSON.stringify(item)} instead`);
    }
    if (!ctx.allNullValues && this.hasAllNullValues(false))
      ctx = Object.assign({}, ctx, { allNullValues: true });
    return stringifyCollection(this, ctx, {
      blockItemPrefix: "",
      flowChars: { start: "{", end: "}" },
      itemIndent: ctx.indent || "",
      onChompKeep,
      onComment
    });
  }
}
const map = {
  collection: "map",
  default: true,
  nodeClass: YAMLMap,
  tag: "tag:yaml.org,2002:map",
  resolve(map2, onError) {
    if (!isMap(map2))
      onError("Expected a mapping for this tag");
    return map2;
  },
  createNode: (schema2, obj, ctx) => YAMLMap.from(schema2, obj, ctx)
};
class YAMLSeq extends Collection {
  static get tagName() {
    return "tag:yaml.org,2002:seq";
  }
  constructor(schema2) {
    super(SEQ, schema2);
    this.items = [];
  }
  add(value) {
    this.items.push(value);
  }
  /**
   * Removes a value from the collection.
   *
   * `key` must contain a representation of an integer for this to succeed.
   * It may be wrapped in a `Scalar`.
   *
   * @returns `true` if the item was found and removed.
   */
  delete(key2) {
    const idx = asItemIndex(key2);
    if (typeof idx !== "number")
      return false;
    const del = this.items.splice(idx, 1);
    return del.length > 0;
  }
  get(key2, keepScalar) {
    const idx = asItemIndex(key2);
    if (typeof idx !== "number")
      return void 0;
    const it = this.items[idx];
    return !keepScalar && isScalar(it) ? it.value : it;
  }
  /**
   * Checks if the collection includes a value with the key `key`.
   *
   * `key` must contain a representation of an integer for this to succeed.
   * It may be wrapped in a `Scalar`.
   */
  has(key2) {
    const idx = asItemIndex(key2);
    return typeof idx === "number" && idx < this.items.length;
  }
  /**
   * Sets a value in this collection. For `!!set`, `value` needs to be a
   * boolean to add/remove the item from the set.
   *
   * If `key` does not contain a representation of an integer, this will throw.
   * It may be wrapped in a `Scalar`.
   */
  set(key2, value) {
    const idx = asItemIndex(key2);
    if (typeof idx !== "number")
      throw new Error(`Expected a valid index, not ${key2}.`);
    const prev = this.items[idx];
    if (isScalar(prev) && isScalarValue(value))
      prev.value = value;
    else
      this.items[idx] = value;
  }
  toJSON(_2, ctx) {
    const seq2 = [];
    if (ctx == null ? void 0 : ctx.onCreate)
      ctx.onCreate(seq2);
    let i2 = 0;
    for (const item of this.items)
      seq2.push(toJS(item, String(i2++), ctx));
    return seq2;
  }
  toString(ctx, onComment, onChompKeep) {
    if (!ctx)
      return JSON.stringify(this);
    return stringifyCollection(this, ctx, {
      blockItemPrefix: "- ",
      flowChars: { start: "[", end: "]" },
      itemIndent: (ctx.indent || "") + "  ",
      onChompKeep,
      onComment
    });
  }
  static from(schema2, obj, ctx) {
    const { replacer: replacer2 } = ctx;
    const seq2 = new this(schema2);
    if (obj && Symbol.iterator in Object(obj)) {
      let i2 = 0;
      for (let it of obj) {
        if (typeof replacer2 === "function") {
          const key2 = obj instanceof Set ? it : String(i2++);
          it = replacer2.call(obj, key2, it);
        }
        seq2.items.push(createNode(it, void 0, ctx));
      }
    }
    return seq2;
  }
}
function asItemIndex(key2) {
  let idx = isScalar(key2) ? key2.value : key2;
  if (idx && typeof idx === "string")
    idx = Number(idx);
  return typeof idx === "number" && Number.isInteger(idx) && idx >= 0 ? idx : null;
}
const seq = {
  collection: "seq",
  default: true,
  nodeClass: YAMLSeq,
  tag: "tag:yaml.org,2002:seq",
  resolve(seq2, onError) {
    if (!isSeq(seq2))
      onError("Expected a sequence for this tag");
    return seq2;
  },
  createNode: (schema2, obj, ctx) => YAMLSeq.from(schema2, obj, ctx)
};
const string$1 = {
  identify: (value) => typeof value === "string",
  default: true,
  tag: "tag:yaml.org,2002:str",
  resolve: (str) => str,
  stringify(item, ctx, onComment, onChompKeep) {
    ctx = Object.assign({ actualString: true }, ctx);
    return stringifyString(item, ctx, onComment, onChompKeep);
  }
};
const nullTag = {
  identify: (value) => value == null,
  createNode: () => new Scalar(null),
  default: true,
  tag: "tag:yaml.org,2002:null",
  test: /^(?:~|[Nn]ull|NULL)?$/,
  resolve: () => new Scalar(null),
  stringify: ({ source: source2 }, ctx) => typeof source2 === "string" && nullTag.test.test(source2) ? source2 : ctx.options.nullStr
};
const boolTag = {
  identify: (value) => typeof value === "boolean",
  default: true,
  tag: "tag:yaml.org,2002:bool",
  test: /^(?:[Tt]rue|TRUE|[Ff]alse|FALSE)$/,
  resolve: (str) => new Scalar(str[0] === "t" || str[0] === "T"),
  stringify({ source: source2, value }, ctx) {
    if (source2 && boolTag.test.test(source2)) {
      const sv = source2[0] === "t" || source2[0] === "T";
      if (value === sv)
        return source2;
    }
    return value ? ctx.options.trueStr : ctx.options.falseStr;
  }
};
function stringifyNumber({ format: format2, minFractionDigits, tag, value }) {
  if (typeof value === "bigint")
    return String(value);
  const num = typeof value === "number" ? value : Number(value);
  if (!isFinite(num))
    return isNaN(num) ? ".nan" : num < 0 ? "-.inf" : ".inf";
  let n2 = JSON.stringify(value);
  if (!format2 && minFractionDigits && (!tag || tag === "tag:yaml.org,2002:float") && /^\d/.test(n2)) {
    let i2 = n2.indexOf(".");
    if (i2 < 0) {
      i2 = n2.length;
      n2 += ".";
    }
    let d2 = minFractionDigits - (n2.length - i2 - 1);
    while (d2-- > 0)
      n2 += "0";
  }
  return n2;
}
const floatNaN$1 = {
  identify: (value) => typeof value === "number",
  default: true,
  tag: "tag:yaml.org,2002:float",
  test: /^(?:[-+]?\.(?:inf|Inf|INF)|\.nan|\.NaN|\.NAN)$/,
  resolve: (str) => str.slice(-3).toLowerCase() === "nan" ? NaN : str[0] === "-" ? Number.NEGATIVE_INFINITY : Number.POSITIVE_INFINITY,
  stringify: stringifyNumber
};
const floatExp$1 = {
  identify: (value) => typeof value === "number",
  default: true,
  tag: "tag:yaml.org,2002:float",
  format: "EXP",
  test: /^[-+]?(?:\.[0-9]+|[0-9]+(?:\.[0-9]*)?)[eE][-+]?[0-9]+$/,
  resolve: (str) => parseFloat(str),
  stringify(node) {
    const num = Number(node.value);
    return isFinite(num) ? num.toExponential() : stringifyNumber(node);
  }
};
const float$1 = {
  identify: (value) => typeof value === "number",
  default: true,
  tag: "tag:yaml.org,2002:float",
  test: /^[-+]?(?:\.[0-9]+|[0-9]+\.[0-9]*)$/,
  resolve(str) {
    const node = new Scalar(parseFloat(str));
    const dot2 = str.indexOf(".");
    if (dot2 !== -1 && str[str.length - 1] === "0")
      node.minFractionDigits = str.length - dot2 - 1;
    return node;
  },
  stringify: stringifyNumber
};
const intIdentify$2 = (value) => typeof value === "bigint" || Number.isInteger(value);
const intResolve$1 = (str, offset2, radix, { intAsBigInt }) => intAsBigInt ? BigInt(str) : parseInt(str.substring(offset2), radix);
function intStringify$1(node, radix, prefix) {
  const { value } = node;
  if (intIdentify$2(value) && value >= 0)
    return prefix + value.toString(radix);
  return stringifyNumber(node);
}
const intOct$1 = {
  identify: (value) => intIdentify$2(value) && value >= 0,
  default: true,
  tag: "tag:yaml.org,2002:int",
  format: "OCT",
  test: /^0o[0-7]+$/,
  resolve: (str, _onError, opt) => intResolve$1(str, 2, 8, opt),
  stringify: (node) => intStringify$1(node, 8, "0o")
};
const int$1 = {
  identify: intIdentify$2,
  default: true,
  tag: "tag:yaml.org,2002:int",
  test: /^[-+]?[0-9]+$/,
  resolve: (str, _onError, opt) => intResolve$1(str, 0, 10, opt),
  stringify: stringifyNumber
};
const intHex$1 = {
  identify: (value) => intIdentify$2(value) && value >= 0,
  default: true,
  tag: "tag:yaml.org,2002:int",
  format: "HEX",
  test: /^0x[0-9a-fA-F]+$/,
  resolve: (str, _onError, opt) => intResolve$1(str, 2, 16, opt),
  stringify: (node) => intStringify$1(node, 16, "0x")
};
const schema$2 = [
  map,
  seq,
  string$1,
  nullTag,
  boolTag,
  intOct$1,
  int$1,
  intHex$1,
  floatNaN$1,
  floatExp$1,
  float$1
];
function intIdentify$1(value) {
  return typeof value === "bigint" || Number.isInteger(value);
}
const stringifyJSON = ({ value }) => JSON.stringify(value);
const jsonScalars = [
  {
    identify: (value) => typeof value === "string",
    default: true,
    tag: "tag:yaml.org,2002:str",
    resolve: (str) => str,
    stringify: stringifyJSON
  },
  {
    identify: (value) => value == null,
    createNode: () => new Scalar(null),
    default: true,
    tag: "tag:yaml.org,2002:null",
    test: /^null$/,
    resolve: () => null,
    stringify: stringifyJSON
  },
  {
    identify: (value) => typeof value === "boolean",
    default: true,
    tag: "tag:yaml.org,2002:bool",
    test: /^true|false$/,
    resolve: (str) => str === "true",
    stringify: stringifyJSON
  },
  {
    identify: intIdentify$1,
    default: true,
    tag: "tag:yaml.org,2002:int",
    test: /^-?(?:0|[1-9][0-9]*)$/,
    resolve: (str, _onError, { intAsBigInt }) => intAsBigInt ? BigInt(str) : parseInt(str, 10),
    stringify: ({ value }) => intIdentify$1(value) ? value.toString() : JSON.stringify(value)
  },
  {
    identify: (value) => typeof value === "number",
    default: true,
    tag: "tag:yaml.org,2002:float",
    test: /^-?(?:0|[1-9][0-9]*)(?:\.[0-9]*)?(?:[eE][-+]?[0-9]+)?$/,
    resolve: (str) => parseFloat(str),
    stringify: stringifyJSON
  }
];
const jsonError = {
  default: true,
  tag: "",
  test: /^/,
  resolve(str, onError) {
    onError(`Unresolved plain scalar ${JSON.stringify(str)}`);
    return str;
  }
};
const schema$1 = [map, seq].concat(jsonScalars, jsonError);
const binary = {
  identify: (value) => value instanceof Uint8Array,
  // Buffer inherits from Uint8Array
  default: false,
  tag: "tag:yaml.org,2002:binary",
  /**
   * Returns a Buffer in node and an Uint8Array in browsers
   *
   * To use the resulting buffer as an image, you'll want to do something like:
   *
   *   const blob = new Blob([buffer], { type: 'image/jpeg' })
   *   document.querySelector('#photo').src = URL.createObjectURL(blob)
   */
  resolve(src, onError) {
    if (typeof Buffer === "function") {
      return Buffer.from(src, "base64");
    } else if (typeof atob === "function") {
      const str = atob(src.replace(/[\n\r]/g, ""));
      const buffer = new Uint8Array(str.length);
      for (let i2 = 0; i2 < str.length; ++i2)
        buffer[i2] = str.charCodeAt(i2);
      return buffer;
    } else {
      onError("This environment does not support reading binary tags; either Buffer or atob is required");
      return src;
    }
  },
  stringify({ comment: comment2, type: type2, value }, ctx, onComment, onChompKeep) {
    const buf = value;
    let str;
    if (typeof Buffer === "function") {
      str = buf instanceof Buffer ? buf.toString("base64") : Buffer.from(buf.buffer).toString("base64");
    } else if (typeof btoa === "function") {
      let s3 = "";
      for (let i2 = 0; i2 < buf.length; ++i2)
        s3 += String.fromCharCode(buf[i2]);
      str = btoa(s3);
    } else {
      throw new Error("This environment does not support writing binary tags; either Buffer or btoa is required");
    }
    if (!type2)
      type2 = Scalar.BLOCK_LITERAL;
    if (type2 !== Scalar.QUOTE_DOUBLE) {
      const lineWidth = Math.max(ctx.options.lineWidth - ctx.indent.length, ctx.options.minContentWidth);
      const n2 = Math.ceil(str.length / lineWidth);
      const lines = new Array(n2);
      for (let i2 = 0, o2 = 0; i2 < n2; ++i2, o2 += lineWidth) {
        lines[i2] = str.substr(o2, lineWidth);
      }
      str = lines.join(type2 === Scalar.BLOCK_LITERAL ? "\n" : " ");
    }
    return stringifyString({ comment: comment2, type: type2, value: str }, ctx, onComment, onChompKeep);
  }
};
function resolvePairs(seq2, onError) {
  if (isSeq(seq2)) {
    for (let i2 = 0; i2 < seq2.items.length; ++i2) {
      let item = seq2.items[i2];
      if (isPair(item))
        continue;
      else if (isMap(item)) {
        if (item.items.length > 1)
          onError("Each pair must have its own sequence indicator");
        const pair2 = item.items[0] || new Pair(new Scalar(null));
        if (item.commentBefore)
          pair2.key.commentBefore = pair2.key.commentBefore ? `${item.commentBefore}
${pair2.key.commentBefore}` : item.commentBefore;
        if (item.comment) {
          const cn = pair2.value ?? pair2.key;
          cn.comment = cn.comment ? `${item.comment}
${cn.comment}` : item.comment;
        }
        item = pair2;
      }
      seq2.items[i2] = isPair(item) ? item : new Pair(item);
    }
  } else
    onError("Expected a sequence for this tag");
  return seq2;
}
function createPairs(schema2, iterable, ctx) {
  const { replacer: replacer2 } = ctx;
  const pairs2 = new YAMLSeq(schema2);
  pairs2.tag = "tag:yaml.org,2002:pairs";
  let i2 = 0;
  if (iterable && Symbol.iterator in Object(iterable))
    for (let it of iterable) {
      if (typeof replacer2 === "function")
        it = replacer2.call(iterable, String(i2++), it);
      let key2, value;
      if (Array.isArray(it)) {
        if (it.length === 2) {
          key2 = it[0];
          value = it[1];
        } else
          throw new TypeError(`Expected [key, value] tuple: ${it}`);
      } else if (it && it instanceof Object) {
        const keys2 = Object.keys(it);
        if (keys2.length === 1) {
          key2 = keys2[0];
          value = it[key2];
        } else {
          throw new TypeError(`Expected tuple with one key, not ${keys2.length} keys`);
        }
      } else {
        key2 = it;
      }
      pairs2.items.push(createPair(key2, value, ctx));
    }
  return pairs2;
}
const pairs = {
  collection: "seq",
  default: false,
  tag: "tag:yaml.org,2002:pairs",
  resolve: resolvePairs,
  createNode: createPairs
};
class YAMLOMap extends YAMLSeq {
  constructor() {
    super();
    this.add = YAMLMap.prototype.add.bind(this);
    this.delete = YAMLMap.prototype.delete.bind(this);
    this.get = YAMLMap.prototype.get.bind(this);
    this.has = YAMLMap.prototype.has.bind(this);
    this.set = YAMLMap.prototype.set.bind(this);
    this.tag = YAMLOMap.tag;
  }
  /**
   * If `ctx` is given, the return type is actually `Map<unknown, unknown>`,
   * but TypeScript won't allow widening the signature of a child method.
   */
  toJSON(_2, ctx) {
    if (!ctx)
      return super.toJSON(_2);
    const map2 = /* @__PURE__ */ new Map();
    if (ctx == null ? void 0 : ctx.onCreate)
      ctx.onCreate(map2);
    for (const pair2 of this.items) {
      let key2, value;
      if (isPair(pair2)) {
        key2 = toJS(pair2.key, "", ctx);
        value = toJS(pair2.value, key2, ctx);
      } else {
        key2 = toJS(pair2, "", ctx);
      }
      if (map2.has(key2))
        throw new Error("Ordered maps must not include duplicate keys");
      map2.set(key2, value);
    }
    return map2;
  }
  static from(schema2, iterable, ctx) {
    const pairs2 = createPairs(schema2, iterable, ctx);
    const omap2 = new this();
    omap2.items = pairs2.items;
    return omap2;
  }
}
YAMLOMap.tag = "tag:yaml.org,2002:omap";
const omap = {
  collection: "seq",
  identify: (value) => value instanceof Map,
  nodeClass: YAMLOMap,
  default: false,
  tag: "tag:yaml.org,2002:omap",
  resolve(seq2, onError) {
    const pairs2 = resolvePairs(seq2, onError);
    const seenKeys = [];
    for (const { key: key2 } of pairs2.items) {
      if (isScalar(key2)) {
        if (seenKeys.includes(key2.value)) {
          onError(`Ordered maps must not include duplicate keys: ${key2.value}`);
        } else {
          seenKeys.push(key2.value);
        }
      }
    }
    return Object.assign(new YAMLOMap(), pairs2);
  },
  createNode: (schema2, iterable, ctx) => YAMLOMap.from(schema2, iterable, ctx)
};
function boolStringify({ value, source: source2 }, ctx) {
  const boolObj = value ? trueTag : falseTag;
  if (source2 && boolObj.test.test(source2))
    return source2;
  return value ? ctx.options.trueStr : ctx.options.falseStr;
}
const trueTag = {
  identify: (value) => value === true,
  default: true,
  tag: "tag:yaml.org,2002:bool",
  test: /^(?:Y|y|[Yy]es|YES|[Tt]rue|TRUE|[Oo]n|ON)$/,
  resolve: () => new Scalar(true),
  stringify: boolStringify
};
const falseTag = {
  identify: (value) => value === false,
  default: true,
  tag: "tag:yaml.org,2002:bool",
  test: /^(?:N|n|[Nn]o|NO|[Ff]alse|FALSE|[Oo]ff|OFF)$/,
  resolve: () => new Scalar(false),
  stringify: boolStringify
};
const floatNaN = {
  identify: (value) => typeof value === "number",
  default: true,
  tag: "tag:yaml.org,2002:float",
  test: /^(?:[-+]?\.(?:inf|Inf|INF)|\.nan|\.NaN|\.NAN)$/,
  resolve: (str) => str.slice(-3).toLowerCase() === "nan" ? NaN : str[0] === "-" ? Number.NEGATIVE_INFINITY : Number.POSITIVE_INFINITY,
  stringify: stringifyNumber
};
const floatExp = {
  identify: (value) => typeof value === "number",
  default: true,
  tag: "tag:yaml.org,2002:float",
  format: "EXP",
  test: /^[-+]?(?:[0-9][0-9_]*)?(?:\.[0-9_]*)?[eE][-+]?[0-9]+$/,
  resolve: (str) => parseFloat(str.replace(/_/g, "")),
  stringify(node) {
    const num = Number(node.value);
    return isFinite(num) ? num.toExponential() : stringifyNumber(node);
  }
};
const float = {
  identify: (value) => typeof value === "number",
  default: true,
  tag: "tag:yaml.org,2002:float",
  test: /^[-+]?(?:[0-9][0-9_]*)?\.[0-9_]*$/,
  resolve(str) {
    const node = new Scalar(parseFloat(str.replace(/_/g, "")));
    const dot2 = str.indexOf(".");
    if (dot2 !== -1) {
      const f2 = str.substring(dot2 + 1).replace(/_/g, "");
      if (f2[f2.length - 1] === "0")
        node.minFractionDigits = f2.length;
    }
    return node;
  },
  stringify: stringifyNumber
};
const intIdentify = (value) => typeof value === "bigint" || Number.isInteger(value);
function intResolve(str, offset2, radix, { intAsBigInt }) {
  const sign = str[0];
  if (sign === "-" || sign === "+")
    offset2 += 1;
  str = str.substring(offset2).replace(/_/g, "");
  if (intAsBigInt) {
    switch (radix) {
      case 2:
        str = `0b${str}`;
        break;
      case 8:
        str = `0o${str}`;
        break;
      case 16:
        str = `0x${str}`;
        break;
    }
    const n3 = BigInt(str);
    return sign === "-" ? BigInt(-1) * n3 : n3;
  }
  const n2 = parseInt(str, radix);
  return sign === "-" ? -1 * n2 : n2;
}
function intStringify(node, radix, prefix) {
  const { value } = node;
  if (intIdentify(value)) {
    const str = value.toString(radix);
    return value < 0 ? "-" + prefix + str.substr(1) : prefix + str;
  }
  return stringifyNumber(node);
}
const intBin = {
  identify: intIdentify,
  default: true,
  tag: "tag:yaml.org,2002:int",
  format: "BIN",
  test: /^[-+]?0b[0-1_]+$/,
  resolve: (str, _onError, opt) => intResolve(str, 2, 2, opt),
  stringify: (node) => intStringify(node, 2, "0b")
};
const intOct = {
  identify: intIdentify,
  default: true,
  tag: "tag:yaml.org,2002:int",
  format: "OCT",
  test: /^[-+]?0[0-7_]+$/,
  resolve: (str, _onError, opt) => intResolve(str, 1, 8, opt),
  stringify: (node) => intStringify(node, 8, "0")
};
const int = {
  identify: intIdentify,
  default: true,
  tag: "tag:yaml.org,2002:int",
  test: /^[-+]?[0-9][0-9_]*$/,
  resolve: (str, _onError, opt) => intResolve(str, 0, 10, opt),
  stringify: stringifyNumber
};
const intHex = {
  identify: intIdentify,
  default: true,
  tag: "tag:yaml.org,2002:int",
  format: "HEX",
  test: /^[-+]?0x[0-9a-fA-F_]+$/,
  resolve: (str, _onError, opt) => intResolve(str, 2, 16, opt),
  stringify: (node) => intStringify(node, 16, "0x")
};
class YAMLSet extends YAMLMap {
  constructor(schema2) {
    super(schema2);
    this.tag = YAMLSet.tag;
  }
  add(key2) {
    let pair2;
    if (isPair(key2))
      pair2 = key2;
    else if (key2 && typeof key2 === "object" && "key" in key2 && "value" in key2 && key2.value === null)
      pair2 = new Pair(key2.key, null);
    else
      pair2 = new Pair(key2, null);
    const prev = findPair(this.items, pair2.key);
    if (!prev)
      this.items.push(pair2);
  }
  /**
   * If `keepPair` is `true`, returns the Pair matching `key`.
   * Otherwise, returns the value of that Pair's key.
   */
  get(key2, keepPair) {
    const pair2 = findPair(this.items, key2);
    return !keepPair && isPair(pair2) ? isScalar(pair2.key) ? pair2.key.value : pair2.key : pair2;
  }
  set(key2, value) {
    if (typeof value !== "boolean")
      throw new Error(`Expected boolean value for set(key, value) in a YAML set, not ${typeof value}`);
    const prev = findPair(this.items, key2);
    if (prev && !value) {
      this.items.splice(this.items.indexOf(prev), 1);
    } else if (!prev && value) {
      this.items.push(new Pair(key2));
    }
  }
  toJSON(_2, ctx) {
    return super.toJSON(_2, ctx, Set);
  }
  toString(ctx, onComment, onChompKeep) {
    if (!ctx)
      return JSON.stringify(this);
    if (this.hasAllNullValues(true))
      return super.toString(Object.assign({}, ctx, { allNullValues: true }), onComment, onChompKeep);
    else
      throw new Error("Set items must all have null values");
  }
  static from(schema2, iterable, ctx) {
    const { replacer: replacer2 } = ctx;
    const set2 = new this(schema2);
    if (iterable && Symbol.iterator in Object(iterable))
      for (let value of iterable) {
        if (typeof replacer2 === "function")
          value = replacer2.call(iterable, value, value);
        set2.items.push(createPair(value, null, ctx));
      }
    return set2;
  }
}
YAMLSet.tag = "tag:yaml.org,2002:set";
const set$1 = {
  collection: "map",
  identify: (value) => value instanceof Set,
  nodeClass: YAMLSet,
  default: false,
  tag: "tag:yaml.org,2002:set",
  createNode: (schema2, iterable, ctx) => YAMLSet.from(schema2, iterable, ctx),
  resolve(map2, onError) {
    if (isMap(map2)) {
      if (map2.hasAllNullValues(true))
        return Object.assign(new YAMLSet(), map2);
      else
        onError("Set items must all have null values");
    } else
      onError("Expected a mapping for this tag");
    return map2;
  }
};
function parseSexagesimal(str, asBigInt) {
  const sign = str[0];
  const parts = sign === "-" || sign === "+" ? str.substring(1) : str;
  const num = (n2) => asBigInt ? BigInt(n2) : Number(n2);
  const res = parts.replace(/_/g, "").split(":").reduce((res2, p2) => res2 * num(60) + num(p2), num(0));
  return sign === "-" ? num(-1) * res : res;
}
function stringifySexagesimal(node) {
  let { value } = node;
  let num = (n2) => n2;
  if (typeof value === "bigint")
    num = (n2) => BigInt(n2);
  else if (isNaN(value) || !isFinite(value))
    return stringifyNumber(node);
  let sign = "";
  if (value < 0) {
    sign = "-";
    value *= num(-1);
  }
  const _60 = num(60);
  const parts = [value % _60];
  if (value < 60) {
    parts.unshift(0);
  } else {
    value = (value - parts[0]) / _60;
    parts.unshift(value % _60);
    if (value >= 60) {
      value = (value - parts[0]) / _60;
      parts.unshift(value);
    }
  }
  return sign + parts.map((n2) => String(n2).padStart(2, "0")).join(":").replace(/000000\d*$/, "");
}
const intTime = {
  identify: (value) => typeof value === "bigint" || Number.isInteger(value),
  default: true,
  tag: "tag:yaml.org,2002:int",
  format: "TIME",
  test: /^[-+]?[0-9][0-9_]*(?::[0-5]?[0-9])+$/,
  resolve: (str, _onError, { intAsBigInt }) => parseSexagesimal(str, intAsBigInt),
  stringify: stringifySexagesimal
};
const floatTime = {
  identify: (value) => typeof value === "number",
  default: true,
  tag: "tag:yaml.org,2002:float",
  format: "TIME",
  test: /^[-+]?[0-9][0-9_]*(?::[0-5]?[0-9])+\.[0-9_]*$/,
  resolve: (str) => parseSexagesimal(str, false),
  stringify: stringifySexagesimal
};
const timestamp = {
  identify: (value) => value instanceof Date,
  default: true,
  tag: "tag:yaml.org,2002:timestamp",
  // If the time zone is omitted, the timestamp is assumed to be specified in UTC. The time part
  // may be omitted altogether, resulting in a date format. In such a case, the time part is
  // assumed to be 00:00:00Z (start of day, UTC).
  test: RegExp("^([0-9]{4})-([0-9]{1,2})-([0-9]{1,2})(?:(?:t|T|[ \\t]+)([0-9]{1,2}):([0-9]{1,2}):([0-9]{1,2}(\\.[0-9]+)?)(?:[ \\t]*(Z|[-+][012]?[0-9](?::[0-9]{2})?))?)?$"),
  resolve(str) {
    const match = str.match(timestamp.test);
    if (!match)
      throw new Error("!!timestamp expects a date, starting with yyyy-mm-dd");
    const [, year, month, day, hour, minute, second] = match.map(Number);
    const millisec = match[7] ? Number((match[7] + "00").substr(1, 3)) : 0;
    let date = Date.UTC(year, month - 1, day, hour || 0, minute || 0, second || 0, millisec);
    const tz = match[8];
    if (tz && tz !== "Z") {
      let d2 = parseSexagesimal(tz, false);
      if (Math.abs(d2) < 30)
        d2 *= 60;
      date -= 6e4 * d2;
    }
    return new Date(date);
  },
  stringify: ({ value }) => value.toISOString().replace(/((T00:00)?:00)?\.000Z$/, "")
};
const schema = [
  map,
  seq,
  string$1,
  nullTag,
  trueTag,
  falseTag,
  intBin,
  intOct,
  int,
  intHex,
  floatNaN,
  floatExp,
  float,
  binary,
  omap,
  pairs,
  set$1,
  intTime,
  floatTime,
  timestamp
];
const schemas = /* @__PURE__ */ new Map([
  ["core", schema$2],
  ["failsafe", [map, seq, string$1]],
  ["json", schema$1],
  ["yaml11", schema],
  ["yaml-1.1", schema]
]);
const tagsByName = {
  binary,
  bool: boolTag,
  float: float$1,
  floatExp: floatExp$1,
  floatNaN: floatNaN$1,
  floatTime,
  int: int$1,
  intHex: intHex$1,
  intOct: intOct$1,
  intTime,
  map,
  null: nullTag,
  omap,
  pairs,
  seq,
  set: set$1,
  timestamp
};
const coreKnownTags = {
  "tag:yaml.org,2002:binary": binary,
  "tag:yaml.org,2002:omap": omap,
  "tag:yaml.org,2002:pairs": pairs,
  "tag:yaml.org,2002:set": set$1,
  "tag:yaml.org,2002:timestamp": timestamp
};
function getTags(customTags, schemaName) {
  let tags2 = schemas.get(schemaName);
  if (!tags2) {
    if (Array.isArray(customTags))
      tags2 = [];
    else {
      const keys2 = Array.from(schemas.keys()).filter((key2) => key2 !== "yaml11").map((key2) => JSON.stringify(key2)).join(", ");
      throw new Error(`Unknown schema "${schemaName}"; use one of ${keys2} or define customTags array`);
    }
  }
  if (Array.isArray(customTags)) {
    for (const tag of customTags)
      tags2 = tags2.concat(tag);
  } else if (typeof customTags === "function") {
    tags2 = customTags(tags2.slice());
  }
  return tags2.map((tag) => {
    if (typeof tag !== "string")
      return tag;
    const tagObj = tagsByName[tag];
    if (tagObj)
      return tagObj;
    const keys2 = Object.keys(tagsByName).map((key2) => JSON.stringify(key2)).join(", ");
    throw new Error(`Unknown custom tag "${tag}"; use one of ${keys2}`);
  });
}
const sortMapEntriesByKey = (a2, b2) => a2.key < b2.key ? -1 : a2.key > b2.key ? 1 : 0;
let Schema$2 = class Schema {
  constructor({ compat, customTags, merge: merge2, resolveKnownTags, schema: schema2, sortMapEntries, toStringDefaults }) {
    this.compat = Array.isArray(compat) ? getTags(compat, "compat") : compat ? getTags(null, compat) : null;
    this.merge = !!merge2;
    this.name = typeof schema2 === "string" && schema2 || "core";
    this.knownTags = resolveKnownTags ? coreKnownTags : {};
    this.tags = getTags(customTags, this.name);
    this.toStringOptions = toStringDefaults ?? null;
    Object.defineProperty(this, MAP, { value: map });
    Object.defineProperty(this, SCALAR$1, { value: string$1 });
    Object.defineProperty(this, SEQ, { value: seq });
    this.sortMapEntries = typeof sortMapEntries === "function" ? sortMapEntries : sortMapEntries === true ? sortMapEntriesByKey : null;
  }
  clone() {
    const copy = Object.create(Schema.prototype, Object.getOwnPropertyDescriptors(this));
    copy.tags = this.tags.slice();
    return copy;
  }
};
function stringifyDocument(doc2, options) {
  var _a2;
  const lines = [];
  let hasDirectives = options.directives === true;
  if (options.directives !== false && doc2.directives) {
    const dir = doc2.directives.toString(doc2);
    if (dir) {
      lines.push(dir);
      hasDirectives = true;
    } else if (doc2.directives.docStart)
      hasDirectives = true;
  }
  if (hasDirectives)
    lines.push("---");
  const ctx = createStringifyContext(doc2, options);
  const { commentString } = ctx.options;
  if (doc2.commentBefore) {
    if (lines.length !== 1)
      lines.unshift("");
    const cs = commentString(doc2.commentBefore);
    lines.unshift(indentComment(cs, ""));
  }
  let chompKeep = false;
  let contentComment = null;
  if (doc2.contents) {
    if (isNode$2(doc2.contents)) {
      if (doc2.contents.spaceBefore && hasDirectives)
        lines.push("");
      if (doc2.contents.commentBefore) {
        const cs = commentString(doc2.contents.commentBefore);
        lines.push(indentComment(cs, ""));
      }
      ctx.forceBlockIndent = !!doc2.comment;
      contentComment = doc2.contents.comment;
    }
    const onChompKeep = contentComment ? void 0 : () => chompKeep = true;
    let body2 = stringify$3(doc2.contents, ctx, () => contentComment = null, onChompKeep);
    if (contentComment)
      body2 += lineComment(body2, "", commentString(contentComment));
    if ((body2[0] === "|" || body2[0] === ">") && lines[lines.length - 1] === "---") {
      lines[lines.length - 1] = `--- ${body2}`;
    } else
      lines.push(body2);
  } else {
    lines.push(stringify$3(doc2.contents, ctx));
  }
  if ((_a2 = doc2.directives) == null ? void 0 : _a2.docEnd) {
    if (doc2.comment) {
      const cs = commentString(doc2.comment);
      if (cs.includes("\n")) {
        lines.push("...");
        lines.push(indentComment(cs, ""));
      } else {
        lines.push(`... ${cs}`);
      }
    } else {
      lines.push("...");
    }
  } else {
    let dc = doc2.comment;
    if (dc && chompKeep)
      dc = dc.replace(/^\n+/, "");
    if (dc) {
      if ((!chompKeep || contentComment) && lines[lines.length - 1] !== "")
        lines.push("");
      lines.push(indentComment(commentString(dc), ""));
    }
  }
  return lines.join("\n") + "\n";
}
class Document {
  constructor(value, replacer2, options) {
    this.commentBefore = null;
    this.comment = null;
    this.errors = [];
    this.warnings = [];
    Object.defineProperty(this, NODE_TYPE, { value: DOC });
    let _replacer = null;
    if (typeof replacer2 === "function" || Array.isArray(replacer2)) {
      _replacer = replacer2;
    } else if (options === void 0 && replacer2) {
      options = replacer2;
      replacer2 = void 0;
    }
    const opt = Object.assign({
      intAsBigInt: false,
      keepSourceTokens: false,
      logLevel: "warn",
      prettyErrors: true,
      strict: true,
      uniqueKeys: true,
      version: "1.2"
    }, options);
    this.options = opt;
    let { version: version2 } = opt;
    if (options == null ? void 0 : options._directives) {
      this.directives = options._directives.atDocument();
      if (this.directives.yaml.explicit)
        version2 = this.directives.yaml.version;
    } else
      this.directives = new Directives({ version: version2 });
    this.setSchema(version2, options);
    this.contents = value === void 0 ? null : this.createNode(value, _replacer, options);
  }
  /**
   * Create a deep copy of this Document and its contents.
   *
   * Custom Node values that inherit from `Object` still refer to their original instances.
   */
  clone() {
    const copy = Object.create(Document.prototype, {
      [NODE_TYPE]: { value: DOC }
    });
    copy.commentBefore = this.commentBefore;
    copy.comment = this.comment;
    copy.errors = this.errors.slice();
    copy.warnings = this.warnings.slice();
    copy.options = Object.assign({}, this.options);
    if (this.directives)
      copy.directives = this.directives.clone();
    copy.schema = this.schema.clone();
    copy.contents = isNode$2(this.contents) ? this.contents.clone(copy.schema) : this.contents;
    if (this.range)
      copy.range = this.range.slice();
    return copy;
  }
  /** Adds a value to the document. */
  add(value) {
    if (assertCollection(this.contents))
      this.contents.add(value);
  }
  /** Adds a value to the document. */
  addIn(path2, value) {
    if (assertCollection(this.contents))
      this.contents.addIn(path2, value);
  }
  /**
   * Create a new `Alias` node, ensuring that the target `node` has the required anchor.
   *
   * If `node` already has an anchor, `name` is ignored.
   * Otherwise, the `node.anchor` value will be set to `name`,
   * or if an anchor with that name is already present in the document,
   * `name` will be used as a prefix for a new unique anchor.
   * If `name` is undefined, the generated anchor will use 'a' as a prefix.
   */
  createAlias(node, name2) {
    if (!node.anchor) {
      const prev = anchorNames(this);
      node.anchor = // eslint-disable-next-line @typescript-eslint/prefer-nullish-coalescing
      !name2 || prev.has(name2) ? findNewAnchor(name2 || "a", prev) : name2;
    }
    return new Alias$1(node.anchor);
  }
  createNode(value, replacer2, options) {
    let _replacer = void 0;
    if (typeof replacer2 === "function") {
      value = replacer2.call({ "": value }, "", value);
      _replacer = replacer2;
    } else if (Array.isArray(replacer2)) {
      const keyToStr = (v2) => typeof v2 === "number" || v2 instanceof String || v2 instanceof Number;
      const asStr = replacer2.filter(keyToStr).map(String);
      if (asStr.length > 0)
        replacer2 = replacer2.concat(asStr);
      _replacer = replacer2;
    } else if (options === void 0 && replacer2) {
      options = replacer2;
      replacer2 = void 0;
    }
    const { aliasDuplicateObjects, anchorPrefix, flow, keepUndefined, onTagObj, tag } = options ?? {};
    const { onAnchor, setAnchors, sourceObjects } = createNodeAnchors(
      this,
      // eslint-disable-next-line @typescript-eslint/prefer-nullish-coalescing
      anchorPrefix || "a"
    );
    const ctx = {
      aliasDuplicateObjects: aliasDuplicateObjects ?? true,
      keepUndefined: keepUndefined ?? false,
      onAnchor,
      onTagObj,
      replacer: _replacer,
      schema: this.schema,
      sourceObjects
    };
    const node = createNode(value, tag, ctx);
    if (flow && isCollection(node))
      node.flow = true;
    setAnchors();
    return node;
  }
  /**
   * Convert a key and a value into a `Pair` using the current schema,
   * recursively wrapping all values as `Scalar` or `Collection` nodes.
   */
  createPair(key2, value, options = {}) {
    const k2 = this.createNode(key2, null, options);
    const v2 = this.createNode(value, null, options);
    return new Pair(k2, v2);
  }
  /**
   * Removes a value from the document.
   * @returns `true` if the item was found and removed.
   */
  delete(key2) {
    return assertCollection(this.contents) ? this.contents.delete(key2) : false;
  }
  /**
   * Removes a value from the document.
   * @returns `true` if the item was found and removed.
   */
  deleteIn(path2) {
    if (isEmptyPath(path2)) {
      if (this.contents == null)
        return false;
      this.contents = null;
      return true;
    }
    return assertCollection(this.contents) ? this.contents.deleteIn(path2) : false;
  }
  /**
   * Returns item at `key`, or `undefined` if not found. By default unwraps
   * scalar values from their surrounding node; to disable set `keepScalar` to
   * `true` (collections are always returned intact).
   */
  get(key2, keepScalar) {
    return isCollection(this.contents) ? this.contents.get(key2, keepScalar) : void 0;
  }
  /**
   * Returns item at `path`, or `undefined` if not found. By default unwraps
   * scalar values from their surrounding node; to disable set `keepScalar` to
   * `true` (collections are always returned intact).
   */
  getIn(path2, keepScalar) {
    if (isEmptyPath(path2))
      return !keepScalar && isScalar(this.contents) ? this.contents.value : this.contents;
    return isCollection(this.contents) ? this.contents.getIn(path2, keepScalar) : void 0;
  }
  /**
   * Checks if the document includes a value with the key `key`.
   */
  has(key2) {
    return isCollection(this.contents) ? this.contents.has(key2) : false;
  }
  /**
   * Checks if the document includes a value at `path`.
   */
  hasIn(path2) {
    if (isEmptyPath(path2))
      return this.contents !== void 0;
    return isCollection(this.contents) ? this.contents.hasIn(path2) : false;
  }
  /**
   * Sets a value in this document. For `!!set`, `value` needs to be a
   * boolean to add/remove the item from the set.
   */
  set(key2, value) {
    if (this.contents == null) {
      this.contents = collectionFromPath(this.schema, [key2], value);
    } else if (assertCollection(this.contents)) {
      this.contents.set(key2, value);
    }
  }
  /**
   * Sets a value in this document. For `!!set`, `value` needs to be a
   * boolean to add/remove the item from the set.
   */
  setIn(path2, value) {
    if (isEmptyPath(path2)) {
      this.contents = value;
    } else if (this.contents == null) {
      this.contents = collectionFromPath(this.schema, Array.from(path2), value);
    } else if (assertCollection(this.contents)) {
      this.contents.setIn(path2, value);
    }
  }
  /**
   * Change the YAML version and schema used by the document.
   * A `null` version disables support for directives, explicit tags, anchors, and aliases.
   * It also requires the `schema` option to be given as a `Schema` instance value.
   *
   * Overrides all previously set schema options.
   */
  setSchema(version2, options = {}) {
    if (typeof version2 === "number")
      version2 = String(version2);
    let opt;
    switch (version2) {
      case "1.1":
        if (this.directives)
          this.directives.yaml.version = "1.1";
        else
          this.directives = new Directives({ version: "1.1" });
        opt = { merge: true, resolveKnownTags: false, schema: "yaml-1.1" };
        break;
      case "1.2":
      case "next":
        if (this.directives)
          this.directives.yaml.version = version2;
        else
          this.directives = new Directives({ version: version2 });
        opt = { merge: false, resolveKnownTags: true, schema: "core" };
        break;
      case null:
        if (this.directives)
          delete this.directives;
        opt = null;
        break;
      default: {
        const sv = JSON.stringify(version2);
        throw new Error(`Expected '1.1', '1.2' or null as first argument, but found: ${sv}`);
      }
    }
    if (options.schema instanceof Object)
      this.schema = options.schema;
    else if (opt)
      this.schema = new Schema$2(Object.assign(opt, options));
    else
      throw new Error(`With a null YAML version, the { schema: Schema } option is required`);
  }
  // json & jsonArg are only used from toJSON()
  toJS({ json: json2, jsonArg, mapAsMap, maxAliasCount, onAnchor, reviver } = {}) {
    const ctx = {
      anchors: /* @__PURE__ */ new Map(),
      doc: this,
      keep: !json2,
      mapAsMap: mapAsMap === true,
      mapKeyWarned: false,
      maxAliasCount: typeof maxAliasCount === "number" ? maxAliasCount : 100
    };
    const res = toJS(this.contents, jsonArg ?? "", ctx);
    if (typeof onAnchor === "function")
      for (const { count, res: res2 } of ctx.anchors.values())
        onAnchor(res2, count);
    return typeof reviver === "function" ? applyReviver(reviver, { "": res }, "", res) : res;
  }
  /**
   * A JSON representation of the document `contents`.
   *
   * @param jsonArg Used by `JSON.stringify` to indicate the array index or
   *   property name.
   */
  toJSON(jsonArg, onAnchor) {
    return this.toJS({ json: true, jsonArg, mapAsMap: false, onAnchor });
  }
  /** A YAML representation of the document. */
  toString(options = {}) {
    if (this.errors.length > 0)
      throw new Error("Document with errors cannot be stringified");
    if ("indent" in options && (!Number.isInteger(options.indent) || Number(options.indent) <= 0)) {
      const s3 = JSON.stringify(options.indent);
      throw new Error(`"indent" option must be a positive integer, not ${s3}`);
    }
    return stringifyDocument(this, options);
  }
}
function assertCollection(contents) {
  if (isCollection(contents))
    return true;
  throw new Error("Expected a YAML collection as document contents");
}
class YAMLError extends Error {
  constructor(name2, pos, code, message) {
    super();
    this.name = name2;
    this.code = code;
    this.message = message;
    this.pos = pos;
  }
}
class YAMLParseError extends YAMLError {
  constructor(pos, code, message) {
    super("YAMLParseError", pos, code, message);
  }
}
class YAMLWarning extends YAMLError {
  constructor(pos, code, message) {
    super("YAMLWarning", pos, code, message);
  }
}
const prettifyError = (src, lc) => (error2) => {
  if (error2.pos[0] === -1)
    return;
  error2.linePos = error2.pos.map((pos) => lc.linePos(pos));
  const { line, col } = error2.linePos[0];
  error2.message += ` at line ${line}, column ${col}`;
  let ci = col - 1;
  let lineStr = src.substring(lc.lineStarts[line - 1], lc.lineStarts[line]).replace(/[\n\r]+$/, "");
  if (ci >= 60 && lineStr.length > 80) {
    const trimStart = Math.min(ci - 39, lineStr.length - 79);
    lineStr = "…" + lineStr.substring(trimStart);
    ci -= trimStart - 1;
  }
  if (lineStr.length > 80)
    lineStr = lineStr.substring(0, 79) + "…";
  if (line > 1 && /^ *$/.test(lineStr.substring(0, ci))) {
    let prev = src.substring(lc.lineStarts[line - 2], lc.lineStarts[line - 1]);
    if (prev.length > 80)
      prev = prev.substring(0, 79) + "…\n";
    lineStr = prev + lineStr;
  }
  if (/[^ ]/.test(lineStr)) {
    let count = 1;
    const end = error2.linePos[1];
    if (end && end.line === line && end.col > col) {
      count = Math.max(1, Math.min(end.col - col, 80 - ci));
    }
    const pointer = " ".repeat(ci) + "^".repeat(count);
    error2.message += `:

${lineStr}
${pointer}
`;
  }
};
function resolveProps(tokens, { flow, indicator, next, offset: offset2, onError, parentIndent, startOnNewline }) {
  let spaceBefore = false;
  let atNewline = startOnNewline;
  let hasSpace = startOnNewline;
  let comment2 = "";
  let commentSep = "";
  let hasNewline = false;
  let hasNewlineAfterProp = false;
  let reqSpace = false;
  let tab = null;
  let anchor = null;
  let tag = null;
  let comma2 = null;
  let found = null;
  let start = null;
  for (const token of tokens) {
    if (reqSpace) {
      if (token.type !== "space" && token.type !== "newline" && token.type !== "comma")
        onError(token.offset, "MISSING_CHAR", "Tags and anchors must be separated from the next token by white space");
      reqSpace = false;
    }
    if (tab) {
      if (atNewline && token.type !== "comment" && token.type !== "newline") {
        onError(tab, "TAB_AS_INDENT", "Tabs are not allowed as indentation");
      }
      tab = null;
    }
    switch (token.type) {
      case "space":
        if (!flow && (indicator !== "doc-start" || (next == null ? void 0 : next.type) !== "flow-collection") && token.source.includes("	")) {
          tab = token;
        }
        hasSpace = true;
        break;
      case "comment": {
        if (!hasSpace)
          onError(token, "MISSING_CHAR", "Comments must be separated from other tokens by white space characters");
        const cb = token.source.substring(1) || " ";
        if (!comment2)
          comment2 = cb;
        else
          comment2 += commentSep + cb;
        commentSep = "";
        atNewline = false;
        break;
      }
      case "newline":
        if (atNewline) {
          if (comment2)
            comment2 += token.source;
          else
            spaceBefore = true;
        } else
          commentSep += token.source;
        atNewline = true;
        hasNewline = true;
        if (anchor || tag)
          hasNewlineAfterProp = true;
        hasSpace = true;
        break;
      case "anchor":
        if (anchor)
          onError(token, "MULTIPLE_ANCHORS", "A node can have at most one anchor");
        if (token.source.endsWith(":"))
          onError(token.offset + token.source.length - 1, "BAD_ALIAS", "Anchor ending in : is ambiguous", true);
        anchor = token;
        if (start === null)
          start = token.offset;
        atNewline = false;
        hasSpace = false;
        reqSpace = true;
        break;
      case "tag": {
        if (tag)
          onError(token, "MULTIPLE_TAGS", "A node can have at most one tag");
        tag = token;
        if (start === null)
          start = token.offset;
        atNewline = false;
        hasSpace = false;
        reqSpace = true;
        break;
      }
      case indicator:
        if (anchor || tag)
          onError(token, "BAD_PROP_ORDER", `Anchors and tags must be after the ${token.source} indicator`);
        if (found)
          onError(token, "UNEXPECTED_TOKEN", `Unexpected ${token.source} in ${flow ?? "collection"}`);
        found = token;
        atNewline = indicator === "seq-item-ind" || indicator === "explicit-key-ind";
        hasSpace = false;
        break;
      case "comma":
        if (flow) {
          if (comma2)
            onError(token, "UNEXPECTED_TOKEN", `Unexpected , in ${flow}`);
          comma2 = token;
          atNewline = false;
          hasSpace = false;
          break;
        }
      default:
        onError(token, "UNEXPECTED_TOKEN", `Unexpected ${token.type} token`);
        atNewline = false;
        hasSpace = false;
    }
  }
  const last = tokens[tokens.length - 1];
  const end = last ? last.offset + last.source.length : offset2;
  if (reqSpace && next && next.type !== "space" && next.type !== "newline" && next.type !== "comma" && (next.type !== "scalar" || next.source !== "")) {
    onError(next.offset, "MISSING_CHAR", "Tags and anchors must be separated from the next token by white space");
  }
  if (tab && (atNewline && tab.indent <= parentIndent || (next == null ? void 0 : next.type) === "block-map" || (next == null ? void 0 : next.type) === "block-seq"))
    onError(tab, "TAB_AS_INDENT", "Tabs are not allowed as indentation");
  return {
    comma: comma2,
    found,
    spaceBefore,
    comment: comment2,
    hasNewline,
    hasNewlineAfterProp,
    anchor,
    tag,
    end,
    start: start ?? end
  };
}
function containsNewline(key2) {
  if (!key2)
    return null;
  switch (key2.type) {
    case "alias":
    case "scalar":
    case "double-quoted-scalar":
    case "single-quoted-scalar":
      if (key2.source.includes("\n"))
        return true;
      if (key2.end) {
        for (const st of key2.end)
          if (st.type === "newline")
            return true;
      }
      return false;
    case "flow-collection":
      for (const it of key2.items) {
        for (const st of it.start)
          if (st.type === "newline")
            return true;
        if (it.sep) {
          for (const st of it.sep)
            if (st.type === "newline")
              return true;
        }
        if (containsNewline(it.key) || containsNewline(it.value))
          return true;
      }
      return false;
    default:
      return true;
  }
}
function flowIndentCheck(indent, fc, onError) {
  if ((fc == null ? void 0 : fc.type) === "flow-collection") {
    const end = fc.end[0];
    if (end.indent === indent && (end.source === "]" || end.source === "}") && containsNewline(fc)) {
      const msg = "Flow end indicator should be more indented than parent";
      onError(end, "BAD_INDENT", msg, true);
    }
  }
}
function mapIncludes(ctx, items, search2) {
  const { uniqueKeys } = ctx.options;
  if (uniqueKeys === false)
    return false;
  const isEqual = typeof uniqueKeys === "function" ? uniqueKeys : (a2, b2) => a2 === b2 || isScalar(a2) && isScalar(b2) && a2.value === b2.value && !(a2.value === "<<" && ctx.schema.merge);
  return items.some((pair2) => isEqual(pair2.key, search2));
}
const startColMsg = "All mapping items must start at the same column";
function resolveBlockMap({ composeNode: composeNode2, composeEmptyNode: composeEmptyNode2 }, ctx, bm, onError, tag) {
  var _a2;
  const NodeClass = (tag == null ? void 0 : tag.nodeClass) ?? YAMLMap;
  const map2 = new NodeClass(ctx.schema);
  if (ctx.atRoot)
    ctx.atRoot = false;
  let offset2 = bm.offset;
  let commentEnd = null;
  for (const collItem of bm.items) {
    const { start, key: key2, sep, value } = collItem;
    const keyProps = resolveProps(start, {
      indicator: "explicit-key-ind",
      next: key2 ?? (sep == null ? void 0 : sep[0]),
      offset: offset2,
      onError,
      parentIndent: bm.indent,
      startOnNewline: true
    });
    const implicitKey = !keyProps.found;
    if (implicitKey) {
      if (key2) {
        if (key2.type === "block-seq")
          onError(offset2, "BLOCK_AS_IMPLICIT_KEY", "A block sequence may not be used as an implicit map key");
        else if ("indent" in key2 && key2.indent !== bm.indent)
          onError(offset2, "BAD_INDENT", startColMsg);
      }
      if (!keyProps.anchor && !keyProps.tag && !sep) {
        commentEnd = keyProps.end;
        if (keyProps.comment) {
          if (map2.comment)
            map2.comment += "\n" + keyProps.comment;
          else
            map2.comment = keyProps.comment;
        }
        continue;
      }
      if (keyProps.hasNewlineAfterProp || containsNewline(key2)) {
        onError(key2 ?? start[start.length - 1], "MULTILINE_IMPLICIT_KEY", "Implicit keys need to be on a single line");
      }
    } else if (((_a2 = keyProps.found) == null ? void 0 : _a2.indent) !== bm.indent) {
      onError(offset2, "BAD_INDENT", startColMsg);
    }
    const keyStart = keyProps.end;
    const keyNode = key2 ? composeNode2(ctx, key2, keyProps, onError) : composeEmptyNode2(ctx, keyStart, start, null, keyProps, onError);
    if (ctx.schema.compat)
      flowIndentCheck(bm.indent, key2, onError);
    if (mapIncludes(ctx, map2.items, keyNode))
      onError(keyStart, "DUPLICATE_KEY", "Map keys must be unique");
    const valueProps = resolveProps(sep ?? [], {
      indicator: "map-value-ind",
      next: value,
      offset: keyNode.range[2],
      onError,
      parentIndent: bm.indent,
      startOnNewline: !key2 || key2.type === "block-scalar"
    });
    offset2 = valueProps.end;
    if (valueProps.found) {
      if (implicitKey) {
        if ((value == null ? void 0 : value.type) === "block-map" && !valueProps.hasNewline)
          onError(offset2, "BLOCK_AS_IMPLICIT_KEY", "Nested mappings are not allowed in compact mappings");
        if (ctx.options.strict && keyProps.start < valueProps.found.offset - 1024)
          onError(keyNode.range, "KEY_OVER_1024_CHARS", "The : indicator must be at most 1024 chars after the start of an implicit block mapping key");
      }
      const valueNode = value ? composeNode2(ctx, value, valueProps, onError) : composeEmptyNode2(ctx, offset2, sep, null, valueProps, onError);
      if (ctx.schema.compat)
        flowIndentCheck(bm.indent, value, onError);
      offset2 = valueNode.range[2];
      const pair2 = new Pair(keyNode, valueNode);
      if (ctx.options.keepSourceTokens)
        pair2.srcToken = collItem;
      map2.items.push(pair2);
    } else {
      if (implicitKey)
        onError(keyNode.range, "MISSING_CHAR", "Implicit map keys need to be followed by map values");
      if (valueProps.comment) {
        if (keyNode.comment)
          keyNode.comment += "\n" + valueProps.comment;
        else
          keyNode.comment = valueProps.comment;
      }
      const pair2 = new Pair(keyNode);
      if (ctx.options.keepSourceTokens)
        pair2.srcToken = collItem;
      map2.items.push(pair2);
    }
  }
  if (commentEnd && commentEnd < offset2)
    onError(commentEnd, "IMPOSSIBLE", "Map comment with trailing content");
  map2.range = [bm.offset, offset2, commentEnd ?? offset2];
  return map2;
}
function resolveBlockSeq({ composeNode: composeNode2, composeEmptyNode: composeEmptyNode2 }, ctx, bs, onError, tag) {
  const NodeClass = (tag == null ? void 0 : tag.nodeClass) ?? YAMLSeq;
  const seq2 = new NodeClass(ctx.schema);
  if (ctx.atRoot)
    ctx.atRoot = false;
  let offset2 = bs.offset;
  let commentEnd = null;
  for (const { start, value } of bs.items) {
    const props = resolveProps(start, {
      indicator: "seq-item-ind",
      next: value,
      offset: offset2,
      onError,
      parentIndent: bs.indent,
      startOnNewline: true
    });
    if (!props.found) {
      if (props.anchor || props.tag || value) {
        if (value && value.type === "block-seq")
          onError(props.end, "BAD_INDENT", "All sequence items must start at the same column");
        else
          onError(offset2, "MISSING_CHAR", "Sequence item without - indicator");
      } else {
        commentEnd = props.end;
        if (props.comment)
          seq2.comment = props.comment;
        continue;
      }
    }
    const node = value ? composeNode2(ctx, value, props, onError) : composeEmptyNode2(ctx, props.end, start, null, props, onError);
    if (ctx.schema.compat)
      flowIndentCheck(bs.indent, value, onError);
    offset2 = node.range[2];
    seq2.items.push(node);
  }
  seq2.range = [bs.offset, offset2, commentEnd ?? offset2];
  return seq2;
}
function resolveEnd(end, offset2, reqSpace, onError) {
  let comment2 = "";
  if (end) {
    let hasSpace = false;
    let sep = "";
    for (const token of end) {
      const { source: source2, type: type2 } = token;
      switch (type2) {
        case "space":
          hasSpace = true;
          break;
        case "comment": {
          if (reqSpace && !hasSpace)
            onError(token, "MISSING_CHAR", "Comments must be separated from other tokens by white space characters");
          const cb = source2.substring(1) || " ";
          if (!comment2)
            comment2 = cb;
          else
            comment2 += sep + cb;
          sep = "";
          break;
        }
        case "newline":
          if (comment2)
            sep += source2;
          hasSpace = true;
          break;
        default:
          onError(token, "UNEXPECTED_TOKEN", `Unexpected ${type2} at node end`);
      }
      offset2 += source2.length;
    }
  }
  return { comment: comment2, offset: offset2 };
}
const blockMsg = "Block collections are not allowed within flow collections";
const isBlock = (token) => token && (token.type === "block-map" || token.type === "block-seq");
function resolveFlowCollection({ composeNode: composeNode2, composeEmptyNode: composeEmptyNode2 }, ctx, fc, onError, tag) {
  const isMap2 = fc.start.source === "{";
  const fcName = isMap2 ? "flow map" : "flow sequence";
  const NodeClass = (tag == null ? void 0 : tag.nodeClass) ?? (isMap2 ? YAMLMap : YAMLSeq);
  const coll = new NodeClass(ctx.schema);
  coll.flow = true;
  const atRoot = ctx.atRoot;
  if (atRoot)
    ctx.atRoot = false;
  let offset2 = fc.offset + fc.start.source.length;
  for (let i2 = 0; i2 < fc.items.length; ++i2) {
    const collItem = fc.items[i2];
    const { start, key: key2, sep, value } = collItem;
    const props = resolveProps(start, {
      flow: fcName,
      indicator: "explicit-key-ind",
      next: key2 ?? (sep == null ? void 0 : sep[0]),
      offset: offset2,
      onError,
      parentIndent: fc.indent,
      startOnNewline: false
    });
    if (!props.found) {
      if (!props.anchor && !props.tag && !sep && !value) {
        if (i2 === 0 && props.comma)
          onError(props.comma, "UNEXPECTED_TOKEN", `Unexpected , in ${fcName}`);
        else if (i2 < fc.items.length - 1)
          onError(props.start, "UNEXPECTED_TOKEN", `Unexpected empty item in ${fcName}`);
        if (props.comment) {
          if (coll.comment)
            coll.comment += "\n" + props.comment;
          else
            coll.comment = props.comment;
        }
        offset2 = props.end;
        continue;
      }
      if (!isMap2 && ctx.options.strict && containsNewline(key2))
        onError(
          key2,
          // checked by containsNewline()
          "MULTILINE_IMPLICIT_KEY",
          "Implicit keys of flow sequence pairs need to be on a single line"
        );
    }
    if (i2 === 0) {
      if (props.comma)
        onError(props.comma, "UNEXPECTED_TOKEN", `Unexpected , in ${fcName}`);
    } else {
      if (!props.comma)
        onError(props.start, "MISSING_CHAR", `Missing , between ${fcName} items`);
      if (props.comment) {
        let prevItemComment = "";
        loop: for (const st of start) {
          switch (st.type) {
            case "comma":
            case "space":
              break;
            case "comment":
              prevItemComment = st.source.substring(1);
              break loop;
            default:
              break loop;
          }
        }
        if (prevItemComment) {
          let prev = coll.items[coll.items.length - 1];
          if (isPair(prev))
            prev = prev.value ?? prev.key;
          if (prev.comment)
            prev.comment += "\n" + prevItemComment;
          else
            prev.comment = prevItemComment;
          props.comment = props.comment.substring(prevItemComment.length + 1);
        }
      }
    }
    if (!isMap2 && !sep && !props.found) {
      const valueNode = value ? composeNode2(ctx, value, props, onError) : composeEmptyNode2(ctx, props.end, sep, null, props, onError);
      coll.items.push(valueNode);
      offset2 = valueNode.range[2];
      if (isBlock(value))
        onError(valueNode.range, "BLOCK_IN_FLOW", blockMsg);
    } else {
      const keyStart = props.end;
      const keyNode = key2 ? composeNode2(ctx, key2, props, onError) : composeEmptyNode2(ctx, keyStart, start, null, props, onError);
      if (isBlock(key2))
        onError(keyNode.range, "BLOCK_IN_FLOW", blockMsg);
      const valueProps = resolveProps(sep ?? [], {
        flow: fcName,
        indicator: "map-value-ind",
        next: value,
        offset: keyNode.range[2],
        onError,
        parentIndent: fc.indent,
        startOnNewline: false
      });
      if (valueProps.found) {
        if (!isMap2 && !props.found && ctx.options.strict) {
          if (sep)
            for (const st of sep) {
              if (st === valueProps.found)
                break;
              if (st.type === "newline") {
                onError(st, "MULTILINE_IMPLICIT_KEY", "Implicit keys of flow sequence pairs need to be on a single line");
                break;
              }
            }
          if (props.start < valueProps.found.offset - 1024)
            onError(valueProps.found, "KEY_OVER_1024_CHARS", "The : indicator must be at most 1024 chars after the start of an implicit flow sequence key");
        }
      } else if (value) {
        if ("source" in value && value.source && value.source[0] === ":")
          onError(value, "MISSING_CHAR", `Missing space after : in ${fcName}`);
        else
          onError(valueProps.start, "MISSING_CHAR", `Missing , or : between ${fcName} items`);
      }
      const valueNode = value ? composeNode2(ctx, value, valueProps, onError) : valueProps.found ? composeEmptyNode2(ctx, valueProps.end, sep, null, valueProps, onError) : null;
      if (valueNode) {
        if (isBlock(value))
          onError(valueNode.range, "BLOCK_IN_FLOW", blockMsg);
      } else if (valueProps.comment) {
        if (keyNode.comment)
          keyNode.comment += "\n" + valueProps.comment;
        else
          keyNode.comment = valueProps.comment;
      }
      const pair2 = new Pair(keyNode, valueNode);
      if (ctx.options.keepSourceTokens)
        pair2.srcToken = collItem;
      if (isMap2) {
        const map2 = coll;
        if (mapIncludes(ctx, map2.items, keyNode))
          onError(keyStart, "DUPLICATE_KEY", "Map keys must be unique");
        map2.items.push(pair2);
      } else {
        const map2 = new YAMLMap(ctx.schema);
        map2.flow = true;
        map2.items.push(pair2);
        coll.items.push(map2);
      }
      offset2 = valueNode ? valueNode.range[2] : valueProps.end;
    }
  }
  const expectedEnd = isMap2 ? "}" : "]";
  const [ce2, ...ee2] = fc.end;
  let cePos = offset2;
  if (ce2 && ce2.source === expectedEnd)
    cePos = ce2.offset + ce2.source.length;
  else {
    const name2 = fcName[0].toUpperCase() + fcName.substring(1);
    const msg = atRoot ? `${name2} must end with a ${expectedEnd}` : `${name2} in block collection must be sufficiently indented and end with a ${expectedEnd}`;
    onError(offset2, atRoot ? "MISSING_CHAR" : "BAD_INDENT", msg);
    if (ce2 && ce2.source.length !== 1)
      ee2.unshift(ce2);
  }
  if (ee2.length > 0) {
    const end = resolveEnd(ee2, cePos, ctx.options.strict, onError);
    if (end.comment) {
      if (coll.comment)
        coll.comment += "\n" + end.comment;
      else
        coll.comment = end.comment;
    }
    coll.range = [fc.offset, cePos, end.offset];
  } else {
    coll.range = [fc.offset, cePos, cePos];
  }
  return coll;
}
function resolveCollection(CN2, ctx, token, onError, tagName2, tag) {
  const coll = token.type === "block-map" ? resolveBlockMap(CN2, ctx, token, onError, tag) : token.type === "block-seq" ? resolveBlockSeq(CN2, ctx, token, onError, tag) : resolveFlowCollection(CN2, ctx, token, onError, tag);
  const Coll = coll.constructor;
  if (tagName2 === "!" || tagName2 === Coll.tagName) {
    coll.tag = Coll.tagName;
    return coll;
  }
  if (tagName2)
    coll.tag = tagName2;
  return coll;
}
function composeCollection(CN2, ctx, token, tagToken, onError) {
  var _a2;
  const tagName2 = !tagToken ? null : ctx.directives.tagName(tagToken.source, (msg) => onError(tagToken, "TAG_RESOLVE_FAILED", msg));
  const expType = token.type === "block-map" ? "map" : token.type === "block-seq" ? "seq" : token.start.source === "{" ? "map" : "seq";
  if (!tagToken || !tagName2 || tagName2 === "!" || tagName2 === YAMLMap.tagName && expType === "map" || tagName2 === YAMLSeq.tagName && expType === "seq" || !expType) {
    return resolveCollection(CN2, ctx, token, onError, tagName2);
  }
  let tag = ctx.schema.tags.find((t2) => t2.tag === tagName2 && t2.collection === expType);
  if (!tag) {
    const kt = ctx.schema.knownTags[tagName2];
    if (kt && kt.collection === expType) {
      ctx.schema.tags.push(Object.assign({}, kt, { default: false }));
      tag = kt;
    } else {
      if (kt == null ? void 0 : kt.collection) {
        onError(tagToken, "BAD_COLLECTION_TYPE", `${kt.tag} used for ${expType} collection, but expects ${kt.collection}`, true);
      } else {
        onError(tagToken, "TAG_RESOLVE_FAILED", `Unresolved tag: ${tagName2}`, true);
      }
      return resolveCollection(CN2, ctx, token, onError, tagName2);
    }
  }
  const coll = resolveCollection(CN2, ctx, token, onError, tagName2, tag);
  const res = ((_a2 = tag.resolve) == null ? void 0 : _a2.call(tag, coll, (msg) => onError(tagToken, "TAG_RESOLVE_FAILED", msg), ctx.options)) ?? coll;
  const node = isNode$2(res) ? res : new Scalar(res);
  node.range = coll.range;
  node.tag = tagName2;
  if (tag == null ? void 0 : tag.format)
    node.format = tag.format;
  return node;
}
function resolveBlockScalar(ctx, scalar, onError) {
  const start = scalar.offset;
  const header = parseBlockScalarHeader(scalar, ctx.options.strict, onError);
  if (!header)
    return { value: "", type: null, comment: "", range: [start, start, start] };
  const type2 = header.mode === ">" ? Scalar.BLOCK_FOLDED : Scalar.BLOCK_LITERAL;
  const lines = scalar.source ? splitLines(scalar.source) : [];
  let chompStart = lines.length;
  for (let i2 = lines.length - 1; i2 >= 0; --i2) {
    const content2 = lines[i2][1];
    if (content2 === "" || content2 === "\r")
      chompStart = i2;
    else
      break;
  }
  if (chompStart === 0) {
    const value2 = header.chomp === "+" && lines.length > 0 ? "\n".repeat(Math.max(1, lines.length - 1)) : "";
    let end2 = start + header.length;
    if (scalar.source)
      end2 += scalar.source.length;
    return { value: value2, type: type2, comment: header.comment, range: [start, end2, end2] };
  }
  let trimIndent = scalar.indent + header.indent;
  let offset2 = scalar.offset + header.length;
  let contentStart = 0;
  for (let i2 = 0; i2 < chompStart; ++i2) {
    const [indent, content2] = lines[i2];
    if (content2 === "" || content2 === "\r") {
      if (header.indent === 0 && indent.length > trimIndent)
        trimIndent = indent.length;
    } else {
      if (indent.length < trimIndent) {
        const message = "Block scalars with more-indented leading empty lines must use an explicit indentation indicator";
        onError(offset2 + indent.length, "MISSING_CHAR", message);
      }
      if (header.indent === 0)
        trimIndent = indent.length;
      contentStart = i2;
      if (trimIndent === 0 && !ctx.atRoot) {
        const message = "Block scalar values in collections must be indented";
        onError(offset2, "BAD_INDENT", message);
      }
      break;
    }
    offset2 += indent.length + content2.length + 1;
  }
  for (let i2 = lines.length - 1; i2 >= chompStart; --i2) {
    if (lines[i2][0].length > trimIndent)
      chompStart = i2 + 1;
  }
  let value = "";
  let sep = "";
  let prevMoreIndented = false;
  for (let i2 = 0; i2 < contentStart; ++i2)
    value += lines[i2][0].slice(trimIndent) + "\n";
  for (let i2 = contentStart; i2 < chompStart; ++i2) {
    let [indent, content2] = lines[i2];
    offset2 += indent.length + content2.length + 1;
    const crlf = content2[content2.length - 1] === "\r";
    if (crlf)
      content2 = content2.slice(0, -1);
    if (content2 && indent.length < trimIndent) {
      const src = header.indent ? "explicit indentation indicator" : "first line";
      const message = `Block scalar lines must not be less indented than their ${src}`;
      onError(offset2 - content2.length - (crlf ? 2 : 1), "BAD_INDENT", message);
      indent = "";
    }
    if (type2 === Scalar.BLOCK_LITERAL) {
      value += sep + indent.slice(trimIndent) + content2;
      sep = "\n";
    } else if (indent.length > trimIndent || content2[0] === "	") {
      if (sep === " ")
        sep = "\n";
      else if (!prevMoreIndented && sep === "\n")
        sep = "\n\n";
      value += sep + indent.slice(trimIndent) + content2;
      sep = "\n";
      prevMoreIndented = true;
    } else if (content2 === "") {
      if (sep === "\n")
        value += "\n";
      else
        sep = "\n";
    } else {
      value += sep + content2;
      sep = " ";
      prevMoreIndented = false;
    }
  }
  switch (header.chomp) {
    case "-":
      break;
    case "+":
      for (let i2 = chompStart; i2 < lines.length; ++i2)
        value += "\n" + lines[i2][0].slice(trimIndent);
      if (value[value.length - 1] !== "\n")
        value += "\n";
      break;
    default:
      value += "\n";
  }
  const end = start + header.length + scalar.source.length;
  return { value, type: type2, comment: header.comment, range: [start, end, end] };
}
function parseBlockScalarHeader({ offset: offset2, props }, strict, onError) {
  if (props[0].type !== "block-scalar-header") {
    onError(props[0], "IMPOSSIBLE", "Block scalar header not found");
    return null;
  }
  const { source: source2 } = props[0];
  const mode = source2[0];
  let indent = 0;
  let chomp = "";
  let error2 = -1;
  for (let i2 = 1; i2 < source2.length; ++i2) {
    const ch = source2[i2];
    if (!chomp && (ch === "-" || ch === "+"))
      chomp = ch;
    else {
      const n2 = Number(ch);
      if (!indent && n2)
        indent = n2;
      else if (error2 === -1)
        error2 = offset2 + i2;
    }
  }
  if (error2 !== -1)
    onError(error2, "UNEXPECTED_TOKEN", `Block scalar header includes extra characters: ${source2}`);
  let hasSpace = false;
  let comment2 = "";
  let length = source2.length;
  for (let i2 = 1; i2 < props.length; ++i2) {
    const token = props[i2];
    switch (token.type) {
      case "space":
        hasSpace = true;
      case "newline":
        length += token.source.length;
        break;
      case "comment":
        if (strict && !hasSpace) {
          const message = "Comments must be separated from other tokens by white space characters";
          onError(token, "MISSING_CHAR", message);
        }
        length += token.source.length;
        comment2 = token.source.substring(1);
        break;
      case "error":
        onError(token, "UNEXPECTED_TOKEN", token.message);
        length += token.source.length;
        break;
      default: {
        const message = `Unexpected token in block scalar header: ${token.type}`;
        onError(token, "UNEXPECTED_TOKEN", message);
        const ts = token.source;
        if (ts && typeof ts === "string")
          length += ts.length;
      }
    }
  }
  return { mode, indent, chomp, comment: comment2, length };
}
function splitLines(source2) {
  const split = source2.split(/\n( *)/);
  const first = split[0];
  const m2 = first.match(/^( *)/);
  const line0 = (m2 == null ? void 0 : m2[1]) ? [m2[1], first.slice(m2[1].length)] : ["", first];
  const lines = [line0];
  for (let i2 = 1; i2 < split.length; i2 += 2)
    lines.push([split[i2], split[i2 + 1]]);
  return lines;
}
function resolveFlowScalar(scalar, strict, onError) {
  const { offset: offset2, type: type2, source: source2, end } = scalar;
  let _type;
  let value;
  const _onError = (rel, code, msg) => onError(offset2 + rel, code, msg);
  switch (type2) {
    case "scalar":
      _type = Scalar.PLAIN;
      value = plainValue(source2, _onError);
      break;
    case "single-quoted-scalar":
      _type = Scalar.QUOTE_SINGLE;
      value = singleQuotedValue(source2, _onError);
      break;
    case "double-quoted-scalar":
      _type = Scalar.QUOTE_DOUBLE;
      value = doubleQuotedValue(source2, _onError);
      break;
    default:
      onError(scalar, "UNEXPECTED_TOKEN", `Expected a flow scalar value, but found: ${type2}`);
      return {
        value: "",
        type: null,
        comment: "",
        range: [offset2, offset2 + source2.length, offset2 + source2.length]
      };
  }
  const valueEnd = offset2 + source2.length;
  const re2 = resolveEnd(end, valueEnd, strict, onError);
  return {
    value,
    type: _type,
    comment: re2.comment,
    range: [offset2, valueEnd, re2.offset]
  };
}
function plainValue(source2, onError) {
  let badChar = "";
  switch (source2[0]) {
    case "	":
      badChar = "a tab character";
      break;
    case ",":
      badChar = "flow indicator character ,";
      break;
    case "%":
      badChar = "directive indicator character %";
      break;
    case "|":
    case ">": {
      badChar = `block scalar indicator ${source2[0]}`;
      break;
    }
    case "@":
    case "`": {
      badChar = `reserved character ${source2[0]}`;
      break;
    }
  }
  if (badChar)
    onError(0, "BAD_SCALAR_START", `Plain value cannot start with ${badChar}`);
  return foldLines(source2);
}
function singleQuotedValue(source2, onError) {
  if (source2[source2.length - 1] !== "'" || source2.length === 1)
    onError(source2.length, "MISSING_CHAR", "Missing closing 'quote");
  return foldLines(source2.slice(1, -1)).replace(/''/g, "'");
}
function foldLines(source2) {
  let first, line;
  try {
    first = new RegExp("(.*?)(?<![ 	])[ 	]*\r?\n", "sy");
    line = new RegExp("[ 	]*(.*?)(?:(?<![ 	])[ 	]*)?\r?\n", "sy");
  } catch (_2) {
    first = /(.*?)[ \t]*\r?\n/sy;
    line = /[ \t]*(.*?)[ \t]*\r?\n/sy;
  }
  let match = first.exec(source2);
  if (!match)
    return source2;
  let res = match[1];
  let sep = " ";
  let pos = first.lastIndex;
  line.lastIndex = pos;
  while (match = line.exec(source2)) {
    if (match[1] === "") {
      if (sep === "\n")
        res += sep;
      else
        sep = "\n";
    } else {
      res += sep + match[1];
      sep = " ";
    }
    pos = line.lastIndex;
  }
  const last = /[ \t]*(.*)/sy;
  last.lastIndex = pos;
  match = last.exec(source2);
  return res + sep + ((match == null ? void 0 : match[1]) ?? "");
}
function doubleQuotedValue(source2, onError) {
  let res = "";
  for (let i2 = 1; i2 < source2.length - 1; ++i2) {
    const ch = source2[i2];
    if (ch === "\r" && source2[i2 + 1] === "\n")
      continue;
    if (ch === "\n") {
      const { fold, offset: offset2 } = foldNewline(source2, i2);
      res += fold;
      i2 = offset2;
    } else if (ch === "\\") {
      let next = source2[++i2];
      const cc = escapeCodes[next];
      if (cc)
        res += cc;
      else if (next === "\n") {
        next = source2[i2 + 1];
        while (next === " " || next === "	")
          next = source2[++i2 + 1];
      } else if (next === "\r" && source2[i2 + 1] === "\n") {
        next = source2[++i2 + 1];
        while (next === " " || next === "	")
          next = source2[++i2 + 1];
      } else if (next === "x" || next === "u" || next === "U") {
        const length = { x: 2, u: 4, U: 8 }[next];
        res += parseCharCode(source2, i2 + 1, length, onError);
        i2 += length;
      } else {
        const raw2 = source2.substr(i2 - 1, 2);
        onError(i2 - 1, "BAD_DQ_ESCAPE", `Invalid escape sequence ${raw2}`);
        res += raw2;
      }
    } else if (ch === " " || ch === "	") {
      const wsStart = i2;
      let next = source2[i2 + 1];
      while (next === " " || next === "	")
        next = source2[++i2 + 1];
      if (next !== "\n" && !(next === "\r" && source2[i2 + 2] === "\n"))
        res += i2 > wsStart ? source2.slice(wsStart, i2 + 1) : ch;
    } else {
      res += ch;
    }
  }
  if (source2[source2.length - 1] !== '"' || source2.length === 1)
    onError(source2.length, "MISSING_CHAR", 'Missing closing "quote');
  return res;
}
function foldNewline(source2, offset2) {
  let fold = "";
  let ch = source2[offset2 + 1];
  while (ch === " " || ch === "	" || ch === "\n" || ch === "\r") {
    if (ch === "\r" && source2[offset2 + 2] !== "\n")
      break;
    if (ch === "\n")
      fold += "\n";
    offset2 += 1;
    ch = source2[offset2 + 1];
  }
  if (!fold)
    fold = " ";
  return { fold, offset: offset2 };
}
const escapeCodes = {
  "0": "\0",
  // null character
  a: "\x07",
  // bell character
  b: "\b",
  // backspace
  e: "\x1B",
  // escape character
  f: "\f",
  // form feed
  n: "\n",
  // line feed
  r: "\r",
  // carriage return
  t: "	",
  // horizontal tab
  v: "\v",
  // vertical tab
  N: "…",
  // Unicode next line
  _: " ",
  // Unicode non-breaking space
  L: "\u2028",
  // Unicode line separator
  P: "\u2029",
  // Unicode paragraph separator
  " ": " ",
  '"': '"',
  "/": "/",
  "\\": "\\",
  "	": "	"
};
function parseCharCode(source2, offset2, length, onError) {
  const cc = source2.substr(offset2, length);
  const ok2 = cc.length === length && /^[0-9a-fA-F]+$/.test(cc);
  const code = ok2 ? parseInt(cc, 16) : NaN;
  if (isNaN(code)) {
    const raw2 = source2.substr(offset2 - 2, length + 2);
    onError(offset2 - 2, "BAD_DQ_ESCAPE", `Invalid escape sequence ${raw2}`);
    return raw2;
  }
  return String.fromCodePoint(code);
}
function composeScalar(ctx, token, tagToken, onError) {
  const { value, type: type2, comment: comment2, range } = token.type === "block-scalar" ? resolveBlockScalar(ctx, token, onError) : resolveFlowScalar(token, ctx.options.strict, onError);
  const tagName2 = tagToken ? ctx.directives.tagName(tagToken.source, (msg) => onError(tagToken, "TAG_RESOLVE_FAILED", msg)) : null;
  const tag = tagToken && tagName2 ? findScalarTagByName(ctx.schema, value, tagName2, tagToken, onError) : token.type === "scalar" ? findScalarTagByTest(ctx, value, token, onError) : ctx.schema[SCALAR$1];
  let scalar;
  try {
    const res = tag.resolve(value, (msg) => onError(tagToken ?? token, "TAG_RESOLVE_FAILED", msg), ctx.options);
    scalar = isScalar(res) ? res : new Scalar(res);
  } catch (error2) {
    const msg = error2 instanceof Error ? error2.message : String(error2);
    onError(tagToken ?? token, "TAG_RESOLVE_FAILED", msg);
    scalar = new Scalar(value);
  }
  scalar.range = range;
  scalar.source = value;
  if (type2)
    scalar.type = type2;
  if (tagName2)
    scalar.tag = tagName2;
  if (tag.format)
    scalar.format = tag.format;
  if (comment2)
    scalar.comment = comment2;
  return scalar;
}
function findScalarTagByName(schema2, value, tagName2, tagToken, onError) {
  var _a2;
  if (tagName2 === "!")
    return schema2[SCALAR$1];
  const matchWithTest = [];
  for (const tag of schema2.tags) {
    if (!tag.collection && tag.tag === tagName2) {
      if (tag.default && tag.test)
        matchWithTest.push(tag);
      else
        return tag;
    }
  }
  for (const tag of matchWithTest)
    if ((_a2 = tag.test) == null ? void 0 : _a2.test(value))
      return tag;
  const kt = schema2.knownTags[tagName2];
  if (kt && !kt.collection) {
    schema2.tags.push(Object.assign({}, kt, { default: false, test: void 0 }));
    return kt;
  }
  onError(tagToken, "TAG_RESOLVE_FAILED", `Unresolved tag: ${tagName2}`, tagName2 !== "tag:yaml.org,2002:str");
  return schema2[SCALAR$1];
}
function findScalarTagByTest({ directives, schema: schema2 }, value, token, onError) {
  const tag = schema2.tags.find((tag2) => {
    var _a2;
    return tag2.default && ((_a2 = tag2.test) == null ? void 0 : _a2.test(value));
  }) || schema2[SCALAR$1];
  if (schema2.compat) {
    const compat = schema2.compat.find((tag2) => {
      var _a2;
      return tag2.default && ((_a2 = tag2.test) == null ? void 0 : _a2.test(value));
    }) ?? schema2[SCALAR$1];
    if (tag.tag !== compat.tag) {
      const ts = directives.tagString(tag.tag);
      const cs = directives.tagString(compat.tag);
      const msg = `Value may be parsed as either ${ts} or ${cs}`;
      onError(token, "TAG_RESOLVE_FAILED", msg, true);
    }
  }
  return tag;
}
function emptyScalarPosition(offset2, before, pos) {
  if (before) {
    if (pos === null)
      pos = before.length;
    for (let i2 = pos - 1; i2 >= 0; --i2) {
      let st = before[i2];
      switch (st.type) {
        case "space":
        case "comment":
        case "newline":
          offset2 -= st.source.length;
          continue;
      }
      st = before[++i2];
      while ((st == null ? void 0 : st.type) === "space") {
        offset2 += st.source.length;
        st = before[++i2];
      }
      break;
    }
  }
  return offset2;
}
const CN = { composeNode, composeEmptyNode };
function composeNode(ctx, token, props, onError) {
  const { spaceBefore, comment: comment2, anchor, tag } = props;
  let node;
  let isSrcToken = true;
  switch (token.type) {
    case "alias":
      node = composeAlias(ctx, token, onError);
      if (anchor || tag)
        onError(token, "ALIAS_PROPS", "An alias node must not specify any properties");
      break;
    case "scalar":
    case "single-quoted-scalar":
    case "double-quoted-scalar":
    case "block-scalar":
      node = composeScalar(ctx, token, tag, onError);
      if (anchor)
        node.anchor = anchor.source.substring(1);
      break;
    case "block-map":
    case "block-seq":
    case "flow-collection":
      node = composeCollection(CN, ctx, token, tag, onError);
      if (anchor)
        node.anchor = anchor.source.substring(1);
      break;
    default: {
      const message = token.type === "error" ? token.message : `Unsupported token (type: ${token.type})`;
      onError(token, "UNEXPECTED_TOKEN", message);
      node = composeEmptyNode(ctx, token.offset, void 0, null, props, onError);
      isSrcToken = false;
    }
  }
  if (anchor && node.anchor === "")
    onError(anchor, "BAD_ALIAS", "Anchor cannot be an empty string");
  if (spaceBefore)
    node.spaceBefore = true;
  if (comment2) {
    if (token.type === "scalar" && token.source === "")
      node.comment = comment2;
    else
      node.commentBefore = comment2;
  }
  if (ctx.options.keepSourceTokens && isSrcToken)
    node.srcToken = token;
  return node;
}
function composeEmptyNode(ctx, offset2, before, pos, { spaceBefore, comment: comment2, anchor, tag, end }, onError) {
  const token = {
    type: "scalar",
    offset: emptyScalarPosition(offset2, before, pos),
    indent: -1,
    source: ""
  };
  const node = composeScalar(ctx, token, tag, onError);
  if (anchor) {
    node.anchor = anchor.source.substring(1);
    if (node.anchor === "")
      onError(anchor, "BAD_ALIAS", "Anchor cannot be an empty string");
  }
  if (spaceBefore)
    node.spaceBefore = true;
  if (comment2) {
    node.comment = comment2;
    node.range[2] = end;
  }
  return node;
}
function composeAlias({ options }, { offset: offset2, source: source2, end }, onError) {
  const alias = new Alias$1(source2.substring(1));
  if (alias.source === "")
    onError(offset2, "BAD_ALIAS", "Alias cannot be an empty string");
  if (alias.source.endsWith(":"))
    onError(offset2 + source2.length - 1, "BAD_ALIAS", "Alias ending in : is ambiguous", true);
  const valueEnd = offset2 + source2.length;
  const re2 = resolveEnd(end, valueEnd, options.strict, onError);
  alias.range = [offset2, valueEnd, re2.offset];
  if (re2.comment)
    alias.comment = re2.comment;
  return alias;
}
function composeDoc(options, directives, { offset: offset2, start, value, end }, onError) {
  const opts = Object.assign({ _directives: directives }, options);
  const doc2 = new Document(void 0, opts);
  const ctx = {
    atRoot: true,
    directives: doc2.directives,
    options: doc2.options,
    schema: doc2.schema
  };
  const props = resolveProps(start, {
    indicator: "doc-start",
    next: value ?? (end == null ? void 0 : end[0]),
    offset: offset2,
    onError,
    parentIndent: 0,
    startOnNewline: true
  });
  if (props.found) {
    doc2.directives.docStart = true;
    if (value && (value.type === "block-map" || value.type === "block-seq") && !props.hasNewline)
      onError(props.end, "MISSING_CHAR", "Block collection cannot start on same line with directives-end marker");
  }
  doc2.contents = value ? composeNode(ctx, value, props, onError) : composeEmptyNode(ctx, props.end, start, null, props, onError);
  const contentEnd = doc2.contents.range[2];
  const re2 = resolveEnd(end, contentEnd, false, onError);
  if (re2.comment)
    doc2.comment = re2.comment;
  doc2.range = [offset2, contentEnd, re2.offset];
  return doc2;
}
function getErrorPos(src) {
  if (typeof src === "number")
    return [src, src + 1];
  if (Array.isArray(src))
    return src.length === 2 ? src : [src[0], src[1]];
  const { offset: offset2, source: source2 } = src;
  return [offset2, offset2 + (typeof source2 === "string" ? source2.length : 1)];
}
function parsePrelude(prelude) {
  var _a2;
  let comment2 = "";
  let atComment = false;
  let afterEmptyLine = false;
  for (let i2 = 0; i2 < prelude.length; ++i2) {
    const source2 = prelude[i2];
    switch (source2[0]) {
      case "#":
        comment2 += (comment2 === "" ? "" : afterEmptyLine ? "\n\n" : "\n") + (source2.substring(1) || " ");
        atComment = true;
        afterEmptyLine = false;
        break;
      case "%":
        if (((_a2 = prelude[i2 + 1]) == null ? void 0 : _a2[0]) !== "#")
          i2 += 1;
        atComment = false;
        break;
      default:
        if (!atComment)
          afterEmptyLine = true;
        atComment = false;
    }
  }
  return { comment: comment2, afterEmptyLine };
}
class Composer {
  constructor(options = {}) {
    this.doc = null;
    this.atDirectives = false;
    this.prelude = [];
    this.errors = [];
    this.warnings = [];
    this.onError = (source2, code, message, warning) => {
      const pos = getErrorPos(source2);
      if (warning)
        this.warnings.push(new YAMLWarning(pos, code, message));
      else
        this.errors.push(new YAMLParseError(pos, code, message));
    };
    this.directives = new Directives({ version: options.version || "1.2" });
    this.options = options;
  }
  decorate(doc2, afterDoc) {
    const { comment: comment2, afterEmptyLine } = parsePrelude(this.prelude);
    if (comment2) {
      const dc = doc2.contents;
      if (afterDoc) {
        doc2.comment = doc2.comment ? `${doc2.comment}
${comment2}` : comment2;
      } else if (afterEmptyLine || doc2.directives.docStart || !dc) {
        doc2.commentBefore = comment2;
      } else if (isCollection(dc) && !dc.flow && dc.items.length > 0) {
        let it = dc.items[0];
        if (isPair(it))
          it = it.key;
        const cb = it.commentBefore;
        it.commentBefore = cb ? `${comment2}
${cb}` : comment2;
      } else {
        const cb = dc.commentBefore;
        dc.commentBefore = cb ? `${comment2}
${cb}` : comment2;
      }
    }
    if (afterDoc) {
      Array.prototype.push.apply(doc2.errors, this.errors);
      Array.prototype.push.apply(doc2.warnings, this.warnings);
    } else {
      doc2.errors = this.errors;
      doc2.warnings = this.warnings;
    }
    this.prelude = [];
    this.errors = [];
    this.warnings = [];
  }
  /**
   * Current stream status information.
   *
   * Mostly useful at the end of input for an empty stream.
   */
  streamInfo() {
    return {
      comment: parsePrelude(this.prelude).comment,
      directives: this.directives,
      errors: this.errors,
      warnings: this.warnings
    };
  }
  /**
   * Compose tokens into documents.
   *
   * @param forceDoc - If the stream contains no document, still emit a final document including any comments and directives that would be applied to a subsequent document.
   * @param endOffset - Should be set if `forceDoc` is also set, to set the document range end and to indicate errors correctly.
   */
  *compose(tokens, forceDoc = false, endOffset = -1) {
    for (const token of tokens)
      yield* this.next(token);
    yield* this.end(forceDoc, endOffset);
  }
  /** Advance the composer by one CST token. */
  *next(token) {
    switch (token.type) {
      case "directive":
        this.directives.add(token.source, (offset2, message, warning) => {
          const pos = getErrorPos(token);
          pos[0] += offset2;
          this.onError(pos, "BAD_DIRECTIVE", message, warning);
        });
        this.prelude.push(token.source);
        this.atDirectives = true;
        break;
      case "document": {
        const doc2 = composeDoc(this.options, this.directives, token, this.onError);
        if (this.atDirectives && !doc2.directives.docStart)
          this.onError(token, "MISSING_CHAR", "Missing directives-end/doc-start indicator line");
        this.decorate(doc2, false);
        if (this.doc)
          yield this.doc;
        this.doc = doc2;
        this.atDirectives = false;
        break;
      }
      case "byte-order-mark":
      case "space":
        break;
      case "comment":
      case "newline":
        this.prelude.push(token.source);
        break;
      case "error": {
        const msg = token.source ? `${token.message}: ${JSON.stringify(token.source)}` : token.message;
        const error2 = new YAMLParseError(getErrorPos(token), "UNEXPECTED_TOKEN", msg);
        if (this.atDirectives || !this.doc)
          this.errors.push(error2);
        else
          this.doc.errors.push(error2);
        break;
      }
      case "doc-end": {
        if (!this.doc) {
          const msg = "Unexpected doc-end without preceding document";
          this.errors.push(new YAMLParseError(getErrorPos(token), "UNEXPECTED_TOKEN", msg));
          break;
        }
        this.doc.directives.docEnd = true;
        const end = resolveEnd(token.end, token.offset + token.source.length, this.doc.options.strict, this.onError);
        this.decorate(this.doc, true);
        if (end.comment) {
          const dc = this.doc.comment;
          this.doc.comment = dc ? `${dc}
${end.comment}` : end.comment;
        }
        this.doc.range[2] = end.offset;
        break;
      }
      default:
        this.errors.push(new YAMLParseError(getErrorPos(token), "UNEXPECTED_TOKEN", `Unsupported token ${token.type}`));
    }
  }
  /**
   * Call at end of input to yield any remaining document.
   *
   * @param forceDoc - If the stream contains no document, still emit a final document including any comments and directives that would be applied to a subsequent document.
   * @param endOffset - Should be set if `forceDoc` is also set, to set the document range end and to indicate errors correctly.
   */
  *end(forceDoc = false, endOffset = -1) {
    if (this.doc) {
      this.decorate(this.doc, true);
      yield this.doc;
      this.doc = null;
    } else if (forceDoc) {
      const opts = Object.assign({ _directives: this.directives }, this.options);
      const doc2 = new Document(void 0, opts);
      if (this.atDirectives)
        this.onError(endOffset, "MISSING_CHAR", "Missing directives-end indicator line");
      doc2.range = [0, endOffset, endOffset];
      this.decorate(doc2, false);
      yield doc2;
    }
  }
}
const BOM = "\uFEFF";
const DOCUMENT = "";
const FLOW_END = "";
const SCALAR = "";
function tokenType(source2) {
  switch (source2) {
    case BOM:
      return "byte-order-mark";
    case DOCUMENT:
      return "doc-mode";
    case FLOW_END:
      return "flow-error-end";
    case SCALAR:
      return "scalar";
    case "---":
      return "doc-start";
    case "...":
      return "doc-end";
    case "":
    case "\n":
    case "\r\n":
      return "newline";
    case "-":
      return "seq-item-ind";
    case "?":
      return "explicit-key-ind";
    case ":":
      return "map-value-ind";
    case "{":
      return "flow-map-start";
    case "}":
      return "flow-map-end";
    case "[":
      return "flow-seq-start";
    case "]":
      return "flow-seq-end";
    case ",":
      return "comma";
  }
  switch (source2[0]) {
    case " ":
    case "	":
      return "space";
    case "#":
      return "comment";
    case "%":
      return "directive-line";
    case "*":
      return "alias";
    case "&":
      return "anchor";
    case "!":
      return "tag";
    case "'":
      return "single-quoted-scalar";
    case '"':
      return "double-quoted-scalar";
    case "|":
    case ">":
      return "block-scalar-header";
  }
  return null;
}
function isEmpty(ch) {
  switch (ch) {
    case void 0:
    case " ":
    case "\n":
    case "\r":
    case "	":
      return true;
    default:
      return false;
  }
}
const hexDigits$2 = new Set("0123456789ABCDEFabcdef");
const tagChars = new Set("0123456789ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz-#;/?:@&=+$_.!~*'()");
const flowIndicatorChars = new Set(",[]{}");
const invalidAnchorChars = new Set(" ,[]{}\n\r	");
const isNotAnchorChar = (ch) => !ch || invalidAnchorChars.has(ch);
class Lexer {
  constructor() {
    this.atEnd = false;
    this.blockScalarIndent = -1;
    this.blockScalarKeep = false;
    this.buffer = "";
    this.flowKey = false;
    this.flowLevel = 0;
    this.indentNext = 0;
    this.indentValue = 0;
    this.lineEndPos = null;
    this.next = null;
    this.pos = 0;
  }
  /**
   * Generate YAML tokens from the `source` string. If `incomplete`,
   * a part of the last line may be left as a buffer for the next call.
   *
   * @returns A generator of lexical tokens
   */
  *lex(source2, incomplete = false) {
    if (source2) {
      if (typeof source2 !== "string")
        throw TypeError("source is not a string");
      this.buffer = this.buffer ? this.buffer + source2 : source2;
      this.lineEndPos = null;
    }
    this.atEnd = !incomplete;
    let next = this.next ?? "stream";
    while (next && (incomplete || this.hasChars(1)))
      next = yield* this.parseNext(next);
  }
  atLineEnd() {
    let i2 = this.pos;
    let ch = this.buffer[i2];
    while (ch === " " || ch === "	")
      ch = this.buffer[++i2];
    if (!ch || ch === "#" || ch === "\n")
      return true;
    if (ch === "\r")
      return this.buffer[i2 + 1] === "\n";
    return false;
  }
  charAt(n2) {
    return this.buffer[this.pos + n2];
  }
  continueScalar(offset2) {
    let ch = this.buffer[offset2];
    if (this.indentNext > 0) {
      let indent = 0;
      while (ch === " ")
        ch = this.buffer[++indent + offset2];
      if (ch === "\r") {
        const next = this.buffer[indent + offset2 + 1];
        if (next === "\n" || !next && !this.atEnd)
          return offset2 + indent + 1;
      }
      return ch === "\n" || indent >= this.indentNext || !ch && !this.atEnd ? offset2 + indent : -1;
    }
    if (ch === "-" || ch === ".") {
      const dt2 = this.buffer.substr(offset2, 3);
      if ((dt2 === "---" || dt2 === "...") && isEmpty(this.buffer[offset2 + 3]))
        return -1;
    }
    return offset2;
  }
  getLine() {
    let end = this.lineEndPos;
    if (typeof end !== "number" || end !== -1 && end < this.pos) {
      end = this.buffer.indexOf("\n", this.pos);
      this.lineEndPos = end;
    }
    if (end === -1)
      return this.atEnd ? this.buffer.substring(this.pos) : null;
    if (this.buffer[end - 1] === "\r")
      end -= 1;
    return this.buffer.substring(this.pos, end);
  }
  hasChars(n2) {
    return this.pos + n2 <= this.buffer.length;
  }
  setNext(state) {
    this.buffer = this.buffer.substring(this.pos);
    this.pos = 0;
    this.lineEndPos = null;
    this.next = state;
    return null;
  }
  peek(n2) {
    return this.buffer.substr(this.pos, n2);
  }
  *parseNext(next) {
    switch (next) {
      case "stream":
        return yield* this.parseStream();
      case "line-start":
        return yield* this.parseLineStart();
      case "block-start":
        return yield* this.parseBlockStart();
      case "doc":
        return yield* this.parseDocument();
      case "flow":
        return yield* this.parseFlowCollection();
      case "quoted-scalar":
        return yield* this.parseQuotedScalar();
      case "block-scalar":
        return yield* this.parseBlockScalar();
      case "plain-scalar":
        return yield* this.parsePlainScalar();
    }
  }
  *parseStream() {
    let line = this.getLine();
    if (line === null)
      return this.setNext("stream");
    if (line[0] === BOM) {
      yield* this.pushCount(1);
      line = line.substring(1);
    }
    if (line[0] === "%") {
      let dirEnd = line.length;
      let cs = line.indexOf("#");
      while (cs !== -1) {
        const ch = line[cs - 1];
        if (ch === " " || ch === "	") {
          dirEnd = cs - 1;
          break;
        } else {
          cs = line.indexOf("#", cs + 1);
        }
      }
      while (true) {
        const ch = line[dirEnd - 1];
        if (ch === " " || ch === "	")
          dirEnd -= 1;
        else
          break;
      }
      const n2 = (yield* this.pushCount(dirEnd)) + (yield* this.pushSpaces(true));
      yield* this.pushCount(line.length - n2);
      this.pushNewline();
      return "stream";
    }
    if (this.atLineEnd()) {
      const sp = yield* this.pushSpaces(true);
      yield* this.pushCount(line.length - sp);
      yield* this.pushNewline();
      return "stream";
    }
    yield DOCUMENT;
    return yield* this.parseLineStart();
  }
  *parseLineStart() {
    const ch = this.charAt(0);
    if (!ch && !this.atEnd)
      return this.setNext("line-start");
    if (ch === "-" || ch === ".") {
      if (!this.atEnd && !this.hasChars(4))
        return this.setNext("line-start");
      const s3 = this.peek(3);
      if (s3 === "---" && isEmpty(this.charAt(3))) {
        yield* this.pushCount(3);
        this.indentValue = 0;
        this.indentNext = 0;
        return "doc";
      } else if (s3 === "..." && isEmpty(this.charAt(3))) {
        yield* this.pushCount(3);
        return "stream";
      }
    }
    this.indentValue = yield* this.pushSpaces(false);
    if (this.indentNext > this.indentValue && !isEmpty(this.charAt(1)))
      this.indentNext = this.indentValue;
    return yield* this.parseBlockStart();
  }
  *parseBlockStart() {
    const [ch0, ch1] = this.peek(2);
    if (!ch1 && !this.atEnd)
      return this.setNext("block-start");
    if ((ch0 === "-" || ch0 === "?" || ch0 === ":") && isEmpty(ch1)) {
      const n2 = (yield* this.pushCount(1)) + (yield* this.pushSpaces(true));
      this.indentNext = this.indentValue + 1;
      this.indentValue += n2;
      return yield* this.parseBlockStart();
    }
    return "doc";
  }
  *parseDocument() {
    yield* this.pushSpaces(true);
    const line = this.getLine();
    if (line === null)
      return this.setNext("doc");
    let n2 = yield* this.pushIndicators();
    switch (line[n2]) {
      case "#":
        yield* this.pushCount(line.length - n2);
      case void 0:
        yield* this.pushNewline();
        return yield* this.parseLineStart();
      case "{":
      case "[":
        yield* this.pushCount(1);
        this.flowKey = false;
        this.flowLevel = 1;
        return "flow";
      case "}":
      case "]":
        yield* this.pushCount(1);
        return "doc";
      case "*":
        yield* this.pushUntil(isNotAnchorChar);
        return "doc";
      case '"':
      case "'":
        return yield* this.parseQuotedScalar();
      case "|":
      case ">":
        n2 += yield* this.parseBlockScalarHeader();
        n2 += yield* this.pushSpaces(true);
        yield* this.pushCount(line.length - n2);
        yield* this.pushNewline();
        return yield* this.parseBlockScalar();
      default:
        return yield* this.parsePlainScalar();
    }
  }
  *parseFlowCollection() {
    let nl, sp;
    let indent = -1;
    do {
      nl = yield* this.pushNewline();
      if (nl > 0) {
        sp = yield* this.pushSpaces(false);
        this.indentValue = indent = sp;
      } else {
        sp = 0;
      }
      sp += yield* this.pushSpaces(true);
    } while (nl + sp > 0);
    const line = this.getLine();
    if (line === null)
      return this.setNext("flow");
    if (indent !== -1 && indent < this.indentNext && line[0] !== "#" || indent === 0 && (line.startsWith("---") || line.startsWith("...")) && isEmpty(line[3])) {
      const atFlowEndMarker = indent === this.indentNext - 1 && this.flowLevel === 1 && (line[0] === "]" || line[0] === "}");
      if (!atFlowEndMarker) {
        this.flowLevel = 0;
        yield FLOW_END;
        return yield* this.parseLineStart();
      }
    }
    let n2 = 0;
    while (line[n2] === ",") {
      n2 += yield* this.pushCount(1);
      n2 += yield* this.pushSpaces(true);
      this.flowKey = false;
    }
    n2 += yield* this.pushIndicators();
    switch (line[n2]) {
      case void 0:
        return "flow";
      case "#":
        yield* this.pushCount(line.length - n2);
        return "flow";
      case "{":
      case "[":
        yield* this.pushCount(1);
        this.flowKey = false;
        this.flowLevel += 1;
        return "flow";
      case "}":
      case "]":
        yield* this.pushCount(1);
        this.flowKey = true;
        this.flowLevel -= 1;
        return this.flowLevel ? "flow" : "doc";
      case "*":
        yield* this.pushUntil(isNotAnchorChar);
        return "flow";
      case '"':
      case "'":
        this.flowKey = true;
        return yield* this.parseQuotedScalar();
      case ":": {
        const next = this.charAt(1);
        if (this.flowKey || isEmpty(next) || next === ",") {
          this.flowKey = false;
          yield* this.pushCount(1);
          yield* this.pushSpaces(true);
          return "flow";
        }
      }
      default:
        this.flowKey = false;
        return yield* this.parsePlainScalar();
    }
  }
  *parseQuotedScalar() {
    const quote = this.charAt(0);
    let end = this.buffer.indexOf(quote, this.pos + 1);
    if (quote === "'") {
      while (end !== -1 && this.buffer[end + 1] === "'")
        end = this.buffer.indexOf("'", end + 2);
    } else {
      while (end !== -1) {
        let n2 = 0;
        while (this.buffer[end - 1 - n2] === "\\")
          n2 += 1;
        if (n2 % 2 === 0)
          break;
        end = this.buffer.indexOf('"', end + 1);
      }
    }
    const qb = this.buffer.substring(0, end);
    let nl = qb.indexOf("\n", this.pos);
    if (nl !== -1) {
      while (nl !== -1) {
        const cs = this.continueScalar(nl + 1);
        if (cs === -1)
          break;
        nl = qb.indexOf("\n", cs);
      }
      if (nl !== -1) {
        end = nl - (qb[nl - 1] === "\r" ? 2 : 1);
      }
    }
    if (end === -1) {
      if (!this.atEnd)
        return this.setNext("quoted-scalar");
      end = this.buffer.length;
    }
    yield* this.pushToIndex(end + 1, false);
    return this.flowLevel ? "flow" : "doc";
  }
  *parseBlockScalarHeader() {
    this.blockScalarIndent = -1;
    this.blockScalarKeep = false;
    let i2 = this.pos;
    while (true) {
      const ch = this.buffer[++i2];
      if (ch === "+")
        this.blockScalarKeep = true;
      else if (ch > "0" && ch <= "9")
        this.blockScalarIndent = Number(ch) - 1;
      else if (ch !== "-")
        break;
    }
    return yield* this.pushUntil((ch) => isEmpty(ch) || ch === "#");
  }
  *parseBlockScalar() {
    let nl = this.pos - 1;
    let indent = 0;
    let ch;
    loop: for (let i3 = this.pos; ch = this.buffer[i3]; ++i3) {
      switch (ch) {
        case " ":
          indent += 1;
          break;
        case "\n":
          nl = i3;
          indent = 0;
          break;
        case "\r": {
          const next = this.buffer[i3 + 1];
          if (!next && !this.atEnd)
            return this.setNext("block-scalar");
          if (next === "\n")
            break;
        }
        default:
          break loop;
      }
    }
    if (!ch && !this.atEnd)
      return this.setNext("block-scalar");
    if (indent >= this.indentNext) {
      if (this.blockScalarIndent === -1)
        this.indentNext = indent;
      else {
        this.indentNext = this.blockScalarIndent + (this.indentNext === 0 ? 1 : this.indentNext);
      }
      do {
        const cs = this.continueScalar(nl + 1);
        if (cs === -1)
          break;
        nl = this.buffer.indexOf("\n", cs);
      } while (nl !== -1);
      if (nl === -1) {
        if (!this.atEnd)
          return this.setNext("block-scalar");
        nl = this.buffer.length;
      }
    }
    let i2 = nl + 1;
    ch = this.buffer[i2];
    while (ch === " ")
      ch = this.buffer[++i2];
    if (ch === "	") {
      while (ch === "	" || ch === " " || ch === "\r" || ch === "\n")
        ch = this.buffer[++i2];
      nl = i2 - 1;
    } else if (!this.blockScalarKeep) {
      do {
        let i3 = nl - 1;
        let ch2 = this.buffer[i3];
        if (ch2 === "\r")
          ch2 = this.buffer[--i3];
        const lastChar = i3;
        while (ch2 === " ")
          ch2 = this.buffer[--i3];
        if (ch2 === "\n" && i3 >= this.pos && i3 + 1 + indent > lastChar)
          nl = i3;
        else
          break;
      } while (true);
    }
    yield SCALAR;
    yield* this.pushToIndex(nl + 1, true);
    return yield* this.parseLineStart();
  }
  *parsePlainScalar() {
    const inFlow = this.flowLevel > 0;
    let end = this.pos - 1;
    let i2 = this.pos - 1;
    let ch;
    while (ch = this.buffer[++i2]) {
      if (ch === ":") {
        const next = this.buffer[i2 + 1];
        if (isEmpty(next) || inFlow && flowIndicatorChars.has(next))
          break;
        end = i2;
      } else if (isEmpty(ch)) {
        let next = this.buffer[i2 + 1];
        if (ch === "\r") {
          if (next === "\n") {
            i2 += 1;
            ch = "\n";
            next = this.buffer[i2 + 1];
          } else
            end = i2;
        }
        if (next === "#" || inFlow && flowIndicatorChars.has(next))
          break;
        if (ch === "\n") {
          const cs = this.continueScalar(i2 + 1);
          if (cs === -1)
            break;
          i2 = Math.max(i2, cs - 2);
        }
      } else {
        if (inFlow && flowIndicatorChars.has(ch))
          break;
        end = i2;
      }
    }
    if (!ch && !this.atEnd)
      return this.setNext("plain-scalar");
    yield SCALAR;
    yield* this.pushToIndex(end + 1, true);
    return inFlow ? "flow" : "doc";
  }
  *pushCount(n2) {
    if (n2 > 0) {
      yield this.buffer.substr(this.pos, n2);
      this.pos += n2;
      return n2;
    }
    return 0;
  }
  *pushToIndex(i2, allowEmpty) {
    const s3 = this.buffer.slice(this.pos, i2);
    if (s3) {
      yield s3;
      this.pos += s3.length;
      return s3.length;
    } else if (allowEmpty)
      yield "";
    return 0;
  }
  *pushIndicators() {
    switch (this.charAt(0)) {
      case "!":
        return (yield* this.pushTag()) + (yield* this.pushSpaces(true)) + (yield* this.pushIndicators());
      case "&":
        return (yield* this.pushUntil(isNotAnchorChar)) + (yield* this.pushSpaces(true)) + (yield* this.pushIndicators());
      case "-":
      case "?":
      case ":": {
        const inFlow = this.flowLevel > 0;
        const ch1 = this.charAt(1);
        if (isEmpty(ch1) || inFlow && flowIndicatorChars.has(ch1)) {
          if (!inFlow)
            this.indentNext = this.indentValue + 1;
          else if (this.flowKey)
            this.flowKey = false;
          return (yield* this.pushCount(1)) + (yield* this.pushSpaces(true)) + (yield* this.pushIndicators());
        }
      }
    }
    return 0;
  }
  *pushTag() {
    if (this.charAt(1) === "<") {
      let i2 = this.pos + 2;
      let ch = this.buffer[i2];
      while (!isEmpty(ch) && ch !== ">")
        ch = this.buffer[++i2];
      return yield* this.pushToIndex(ch === ">" ? i2 + 1 : i2, false);
    } else {
      let i2 = this.pos + 1;
      let ch = this.buffer[i2];
      while (ch) {
        if (tagChars.has(ch))
          ch = this.buffer[++i2];
        else if (ch === "%" && hexDigits$2.has(this.buffer[i2 + 1]) && hexDigits$2.has(this.buffer[i2 + 2])) {
          ch = this.buffer[i2 += 3];
        } else
          break;
      }
      return yield* this.pushToIndex(i2, false);
    }
  }
  *pushNewline() {
    const ch = this.buffer[this.pos];
    if (ch === "\n")
      return yield* this.pushCount(1);
    else if (ch === "\r" && this.charAt(1) === "\n")
      return yield* this.pushCount(2);
    else
      return 0;
  }
  *pushSpaces(allowTabs) {
    let i2 = this.pos - 1;
    let ch;
    do {
      ch = this.buffer[++i2];
    } while (ch === " " || allowTabs && ch === "	");
    const n2 = i2 - this.pos;
    if (n2 > 0) {
      yield this.buffer.substr(this.pos, n2);
      this.pos = i2;
    }
    return n2;
  }
  *pushUntil(test) {
    let i2 = this.pos;
    let ch = this.buffer[i2];
    while (!test(ch))
      ch = this.buffer[++i2];
    return yield* this.pushToIndex(i2, false);
  }
}
class LineCounter {
  constructor() {
    this.lineStarts = [];
    this.addNewLine = (offset2) => this.lineStarts.push(offset2);
    this.linePos = (offset2) => {
      let low = 0;
      let high = this.lineStarts.length;
      while (low < high) {
        const mid = low + high >> 1;
        if (this.lineStarts[mid] < offset2)
          low = mid + 1;
        else
          high = mid;
      }
      if (this.lineStarts[low] === offset2)
        return { line: low + 1, col: 1 };
      if (low === 0)
        return { line: 0, col: offset2 };
      const start = this.lineStarts[low - 1];
      return { line: low, col: offset2 - start + 1 };
    };
  }
}
function includesToken(list, type2) {
  for (let i2 = 0; i2 < list.length; ++i2)
    if (list[i2].type === type2)
      return true;
  return false;
}
function findNonEmptyIndex(list) {
  for (let i2 = 0; i2 < list.length; ++i2) {
    switch (list[i2].type) {
      case "space":
      case "comment":
      case "newline":
        break;
      default:
        return i2;
    }
  }
  return -1;
}
function isFlowToken(token) {
  switch (token == null ? void 0 : token.type) {
    case "alias":
    case "scalar":
    case "single-quoted-scalar":
    case "double-quoted-scalar":
    case "flow-collection":
      return true;
    default:
      return false;
  }
}
function getPrevProps(parent) {
  switch (parent.type) {
    case "document":
      return parent.start;
    case "block-map": {
      const it = parent.items[parent.items.length - 1];
      return it.sep ?? it.start;
    }
    case "block-seq":
      return parent.items[parent.items.length - 1].start;
    default:
      return [];
  }
}
function getFirstKeyStartProps(prev) {
  var _a2;
  if (prev.length === 0)
    return [];
  let i2 = prev.length;
  loop: while (--i2 >= 0) {
    switch (prev[i2].type) {
      case "doc-start":
      case "explicit-key-ind":
      case "map-value-ind":
      case "seq-item-ind":
      case "newline":
        break loop;
    }
  }
  while (((_a2 = prev[++i2]) == null ? void 0 : _a2.type) === "space") {
  }
  return prev.splice(i2, prev.length);
}
function fixFlowSeqItems(fc) {
  if (fc.start.type === "flow-seq-start") {
    for (const it of fc.items) {
      if (it.sep && !it.value && !includesToken(it.start, "explicit-key-ind") && !includesToken(it.sep, "map-value-ind")) {
        if (it.key)
          it.value = it.key;
        delete it.key;
        if (isFlowToken(it.value)) {
          if (it.value.end)
            Array.prototype.push.apply(it.value.end, it.sep);
          else
            it.value.end = it.sep;
        } else
          Array.prototype.push.apply(it.start, it.sep);
        delete it.sep;
      }
    }
  }
}
let Parser$2 = class Parser {
  /**
   * @param onNewLine - If defined, called separately with the start position of
   *   each new line (in `parse()`, including the start of input).
   */
  constructor(onNewLine) {
    this.atNewLine = true;
    this.atScalar = false;
    this.indent = 0;
    this.offset = 0;
    this.onKeyLine = false;
    this.stack = [];
    this.source = "";
    this.type = "";
    this.lexer = new Lexer();
    this.onNewLine = onNewLine;
  }
  /**
   * Parse `source` as a YAML stream.
   * If `incomplete`, a part of the last line may be left as a buffer for the next call.
   *
   * Errors are not thrown, but yielded as `{ type: 'error', message }` tokens.
   *
   * @returns A generator of tokens representing each directive, document, and other structure.
   */
  *parse(source2, incomplete = false) {
    if (this.onNewLine && this.offset === 0)
      this.onNewLine(0);
    for (const lexeme of this.lexer.lex(source2, incomplete))
      yield* this.next(lexeme);
    if (!incomplete)
      yield* this.end();
  }
  /**
   * Advance the parser by the `source` of one lexical token.
   */
  *next(source2) {
    this.source = source2;
    if (this.atScalar) {
      this.atScalar = false;
      yield* this.step();
      this.offset += source2.length;
      return;
    }
    const type2 = tokenType(source2);
    if (!type2) {
      const message = `Not a YAML token: ${source2}`;
      yield* this.pop({ type: "error", offset: this.offset, message, source: source2 });
      this.offset += source2.length;
    } else if (type2 === "scalar") {
      this.atNewLine = false;
      this.atScalar = true;
      this.type = "scalar";
    } else {
      this.type = type2;
      yield* this.step();
      switch (type2) {
        case "newline":
          this.atNewLine = true;
          this.indent = 0;
          if (this.onNewLine)
            this.onNewLine(this.offset + source2.length);
          break;
        case "space":
          if (this.atNewLine && source2[0] === " ")
            this.indent += source2.length;
          break;
        case "explicit-key-ind":
        case "map-value-ind":
        case "seq-item-ind":
          if (this.atNewLine)
            this.indent += source2.length;
          break;
        case "doc-mode":
        case "flow-error-end":
          return;
        default:
          this.atNewLine = false;
      }
      this.offset += source2.length;
    }
  }
  /** Call at end of input to push out any remaining constructions */
  *end() {
    while (this.stack.length > 0)
      yield* this.pop();
  }
  get sourceToken() {
    const st = {
      type: this.type,
      offset: this.offset,
      indent: this.indent,
      source: this.source
    };
    return st;
  }
  *step() {
    const top2 = this.peek(1);
    if (this.type === "doc-end" && (!top2 || top2.type !== "doc-end")) {
      while (this.stack.length > 0)
        yield* this.pop();
      this.stack.push({
        type: "doc-end",
        offset: this.offset,
        source: this.source
      });
      return;
    }
    if (!top2)
      return yield* this.stream();
    switch (top2.type) {
      case "document":
        return yield* this.document(top2);
      case "alias":
      case "scalar":
      case "single-quoted-scalar":
      case "double-quoted-scalar":
        return yield* this.scalar(top2);
      case "block-scalar":
        return yield* this.blockScalar(top2);
      case "block-map":
        return yield* this.blockMap(top2);
      case "block-seq":
        return yield* this.blockSequence(top2);
      case "flow-collection":
        return yield* this.flowCollection(top2);
      case "doc-end":
        return yield* this.documentEnd(top2);
    }
    yield* this.pop();
  }
  peek(n2) {
    return this.stack[this.stack.length - n2];
  }
  *pop(error2) {
    const token = error2 ?? this.stack.pop();
    if (!token) {
      const message = "Tried to pop an empty stack";
      yield { type: "error", offset: this.offset, source: "", message };
    } else if (this.stack.length === 0) {
      yield token;
    } else {
      const top2 = this.peek(1);
      if (token.type === "block-scalar") {
        token.indent = "indent" in top2 ? top2.indent : 0;
      } else if (token.type === "flow-collection" && top2.type === "document") {
        token.indent = 0;
      }
      if (token.type === "flow-collection")
        fixFlowSeqItems(token);
      switch (top2.type) {
        case "document":
          top2.value = token;
          break;
        case "block-scalar":
          top2.props.push(token);
          break;
        case "block-map": {
          const it = top2.items[top2.items.length - 1];
          if (it.value) {
            top2.items.push({ start: [], key: token, sep: [] });
            this.onKeyLine = true;
            return;
          } else if (it.sep) {
            it.value = token;
          } else {
            Object.assign(it, { key: token, sep: [] });
            this.onKeyLine = !it.explicitKey;
            return;
          }
          break;
        }
        case "block-seq": {
          const it = top2.items[top2.items.length - 1];
          if (it.value)
            top2.items.push({ start: [], value: token });
          else
            it.value = token;
          break;
        }
        case "flow-collection": {
          const it = top2.items[top2.items.length - 1];
          if (!it || it.value)
            top2.items.push({ start: [], key: token, sep: [] });
          else if (it.sep)
            it.value = token;
          else
            Object.assign(it, { key: token, sep: [] });
          return;
        }
        default:
          yield* this.pop();
          yield* this.pop(token);
      }
      if ((top2.type === "document" || top2.type === "block-map" || top2.type === "block-seq") && (token.type === "block-map" || token.type === "block-seq")) {
        const last = token.items[token.items.length - 1];
        if (last && !last.sep && !last.value && last.start.length > 0 && findNonEmptyIndex(last.start) === -1 && (token.indent === 0 || last.start.every((st) => st.type !== "comment" || st.indent < token.indent))) {
          if (top2.type === "document")
            top2.end = last.start;
          else
            top2.items.push({ start: last.start });
          token.items.splice(-1, 1);
        }
      }
    }
  }
  *stream() {
    switch (this.type) {
      case "directive-line":
        yield { type: "directive", offset: this.offset, source: this.source };
        return;
      case "byte-order-mark":
      case "space":
      case "comment":
      case "newline":
        yield this.sourceToken;
        return;
      case "doc-mode":
      case "doc-start": {
        const doc2 = {
          type: "document",
          offset: this.offset,
          start: []
        };
        if (this.type === "doc-start")
          doc2.start.push(this.sourceToken);
        this.stack.push(doc2);
        return;
      }
    }
    yield {
      type: "error",
      offset: this.offset,
      message: `Unexpected ${this.type} token in YAML stream`,
      source: this.source
    };
  }
  *document(doc2) {
    if (doc2.value)
      return yield* this.lineEnd(doc2);
    switch (this.type) {
      case "doc-start": {
        if (findNonEmptyIndex(doc2.start) !== -1) {
          yield* this.pop();
          yield* this.step();
        } else
          doc2.start.push(this.sourceToken);
        return;
      }
      case "anchor":
      case "tag":
      case "space":
      case "comment":
      case "newline":
        doc2.start.push(this.sourceToken);
        return;
    }
    const bv = this.startBlockValue(doc2);
    if (bv)
      this.stack.push(bv);
    else {
      yield {
        type: "error",
        offset: this.offset,
        message: `Unexpected ${this.type} token in YAML document`,
        source: this.source
      };
    }
  }
  *scalar(scalar) {
    if (this.type === "map-value-ind") {
      const prev = getPrevProps(this.peek(2));
      const start = getFirstKeyStartProps(prev);
      let sep;
      if (scalar.end) {
        sep = scalar.end;
        sep.push(this.sourceToken);
        delete scalar.end;
      } else
        sep = [this.sourceToken];
      const map2 = {
        type: "block-map",
        offset: scalar.offset,
        indent: scalar.indent,
        items: [{ start, key: scalar, sep }]
      };
      this.onKeyLine = true;
      this.stack[this.stack.length - 1] = map2;
    } else
      yield* this.lineEnd(scalar);
  }
  *blockScalar(scalar) {
    switch (this.type) {
      case "space":
      case "comment":
      case "newline":
        scalar.props.push(this.sourceToken);
        return;
      case "scalar":
        scalar.source = this.source;
        this.atNewLine = true;
        this.indent = 0;
        if (this.onNewLine) {
          let nl = this.source.indexOf("\n") + 1;
          while (nl !== 0) {
            this.onNewLine(this.offset + nl);
            nl = this.source.indexOf("\n", nl) + 1;
          }
        }
        yield* this.pop();
        break;
      default:
        yield* this.pop();
        yield* this.step();
    }
  }
  *blockMap(map2) {
    var _a2;
    const it = map2.items[map2.items.length - 1];
    switch (this.type) {
      case "newline":
        this.onKeyLine = false;
        if (it.value) {
          const end = "end" in it.value ? it.value.end : void 0;
          const last = Array.isArray(end) ? end[end.length - 1] : void 0;
          if ((last == null ? void 0 : last.type) === "comment")
            end == null ? void 0 : end.push(this.sourceToken);
          else
            map2.items.push({ start: [this.sourceToken] });
        } else if (it.sep) {
          it.sep.push(this.sourceToken);
        } else {
          it.start.push(this.sourceToken);
        }
        return;
      case "space":
      case "comment":
        if (it.value) {
          map2.items.push({ start: [this.sourceToken] });
        } else if (it.sep) {
          it.sep.push(this.sourceToken);
        } else {
          if (this.atIndentedComment(it.start, map2.indent)) {
            const prev = map2.items[map2.items.length - 2];
            const end = (_a2 = prev == null ? void 0 : prev.value) == null ? void 0 : _a2.end;
            if (Array.isArray(end)) {
              Array.prototype.push.apply(end, it.start);
              end.push(this.sourceToken);
              map2.items.pop();
              return;
            }
          }
          it.start.push(this.sourceToken);
        }
        return;
    }
    if (this.indent >= map2.indent) {
      const atMapIndent = !this.onKeyLine && this.indent === map2.indent;
      const atNextItem = atMapIndent && (it.sep || it.explicitKey) && this.type !== "seq-item-ind";
      let start = [];
      if (atNextItem && it.sep && !it.value) {
        const nl = [];
        for (let i2 = 0; i2 < it.sep.length; ++i2) {
          const st = it.sep[i2];
          switch (st.type) {
            case "newline":
              nl.push(i2);
              break;
            case "space":
              break;
            case "comment":
              if (st.indent > map2.indent)
                nl.length = 0;
              break;
            default:
              nl.length = 0;
          }
        }
        if (nl.length >= 2)
          start = it.sep.splice(nl[1]);
      }
      switch (this.type) {
        case "anchor":
        case "tag":
          if (atNextItem || it.value) {
            start.push(this.sourceToken);
            map2.items.push({ start });
            this.onKeyLine = true;
          } else if (it.sep) {
            it.sep.push(this.sourceToken);
          } else {
            it.start.push(this.sourceToken);
          }
          return;
        case "explicit-key-ind":
          if (!it.sep && !it.explicitKey) {
            it.start.push(this.sourceToken);
            it.explicitKey = true;
          } else if (atNextItem || it.value) {
            start.push(this.sourceToken);
            map2.items.push({ start, explicitKey: true });
          } else {
            this.stack.push({
              type: "block-map",
              offset: this.offset,
              indent: this.indent,
              items: [{ start: [this.sourceToken], explicitKey: true }]
            });
          }
          this.onKeyLine = true;
          return;
        case "map-value-ind":
          if (it.explicitKey) {
            if (!it.sep) {
              if (includesToken(it.start, "newline")) {
                Object.assign(it, { key: null, sep: [this.sourceToken] });
              } else {
                const start2 = getFirstKeyStartProps(it.start);
                this.stack.push({
                  type: "block-map",
                  offset: this.offset,
                  indent: this.indent,
                  items: [{ start: start2, key: null, sep: [this.sourceToken] }]
                });
              }
            } else if (it.value) {
              map2.items.push({ start: [], key: null, sep: [this.sourceToken] });
            } else if (includesToken(it.sep, "map-value-ind")) {
              this.stack.push({
                type: "block-map",
                offset: this.offset,
                indent: this.indent,
                items: [{ start, key: null, sep: [this.sourceToken] }]
              });
            } else if (isFlowToken(it.key) && !includesToken(it.sep, "newline")) {
              const start2 = getFirstKeyStartProps(it.start);
              const key2 = it.key;
              const sep = it.sep;
              sep.push(this.sourceToken);
              delete it.key, delete it.sep;
              this.stack.push({
                type: "block-map",
                offset: this.offset,
                indent: this.indent,
                items: [{ start: start2, key: key2, sep }]
              });
            } else if (start.length > 0) {
              it.sep = it.sep.concat(start, this.sourceToken);
            } else {
              it.sep.push(this.sourceToken);
            }
          } else {
            if (!it.sep) {
              Object.assign(it, { key: null, sep: [this.sourceToken] });
            } else if (it.value || atNextItem) {
              map2.items.push({ start, key: null, sep: [this.sourceToken] });
            } else if (includesToken(it.sep, "map-value-ind")) {
              this.stack.push({
                type: "block-map",
                offset: this.offset,
                indent: this.indent,
                items: [{ start: [], key: null, sep: [this.sourceToken] }]
              });
            } else {
              it.sep.push(this.sourceToken);
            }
          }
          this.onKeyLine = true;
          return;
        case "alias":
        case "scalar":
        case "single-quoted-scalar":
        case "double-quoted-scalar": {
          const fs = this.flowScalar(this.type);
          if (atNextItem || it.value) {
            map2.items.push({ start, key: fs, sep: [] });
            this.onKeyLine = true;
          } else if (it.sep) {
            this.stack.push(fs);
          } else {
            Object.assign(it, { key: fs, sep: [] });
            this.onKeyLine = true;
          }
          return;
        }
        default: {
          const bv = this.startBlockValue(map2);
          if (bv) {
            if (atMapIndent && bv.type !== "block-seq") {
              map2.items.push({ start });
            }
            this.stack.push(bv);
            return;
          }
        }
      }
    }
    yield* this.pop();
    yield* this.step();
  }
  *blockSequence(seq2) {
    var _a2;
    const it = seq2.items[seq2.items.length - 1];
    switch (this.type) {
      case "newline":
        if (it.value) {
          const end = "end" in it.value ? it.value.end : void 0;
          const last = Array.isArray(end) ? end[end.length - 1] : void 0;
          if ((last == null ? void 0 : last.type) === "comment")
            end == null ? void 0 : end.push(this.sourceToken);
          else
            seq2.items.push({ start: [this.sourceToken] });
        } else
          it.start.push(this.sourceToken);
        return;
      case "space":
      case "comment":
        if (it.value)
          seq2.items.push({ start: [this.sourceToken] });
        else {
          if (this.atIndentedComment(it.start, seq2.indent)) {
            const prev = seq2.items[seq2.items.length - 2];
            const end = (_a2 = prev == null ? void 0 : prev.value) == null ? void 0 : _a2.end;
            if (Array.isArray(end)) {
              Array.prototype.push.apply(end, it.start);
              end.push(this.sourceToken);
              seq2.items.pop();
              return;
            }
          }
          it.start.push(this.sourceToken);
        }
        return;
      case "anchor":
      case "tag":
        if (it.value || this.indent <= seq2.indent)
          break;
        it.start.push(this.sourceToken);
        return;
      case "seq-item-ind":
        if (this.indent !== seq2.indent)
          break;
        if (it.value || includesToken(it.start, "seq-item-ind"))
          seq2.items.push({ start: [this.sourceToken] });
        else
          it.start.push(this.sourceToken);
        return;
    }
    if (this.indent > seq2.indent) {
      const bv = this.startBlockValue(seq2);
      if (bv) {
        this.stack.push(bv);
        return;
      }
    }
    yield* this.pop();
    yield* this.step();
  }
  *flowCollection(fc) {
    const it = fc.items[fc.items.length - 1];
    if (this.type === "flow-error-end") {
      let top2;
      do {
        yield* this.pop();
        top2 = this.peek(1);
      } while (top2 && top2.type === "flow-collection");
    } else if (fc.end.length === 0) {
      switch (this.type) {
        case "comma":
        case "explicit-key-ind":
          if (!it || it.sep)
            fc.items.push({ start: [this.sourceToken] });
          else
            it.start.push(this.sourceToken);
          return;
        case "map-value-ind":
          if (!it || it.value)
            fc.items.push({ start: [], key: null, sep: [this.sourceToken] });
          else if (it.sep)
            it.sep.push(this.sourceToken);
          else
            Object.assign(it, { key: null, sep: [this.sourceToken] });
          return;
        case "space":
        case "comment":
        case "newline":
        case "anchor":
        case "tag":
          if (!it || it.value)
            fc.items.push({ start: [this.sourceToken] });
          else if (it.sep)
            it.sep.push(this.sourceToken);
          else
            it.start.push(this.sourceToken);
          return;
        case "alias":
        case "scalar":
        case "single-quoted-scalar":
        case "double-quoted-scalar": {
          const fs = this.flowScalar(this.type);
          if (!it || it.value)
            fc.items.push({ start: [], key: fs, sep: [] });
          else if (it.sep)
            this.stack.push(fs);
          else
            Object.assign(it, { key: fs, sep: [] });
          return;
        }
        case "flow-map-end":
        case "flow-seq-end":
          fc.end.push(this.sourceToken);
          return;
      }
      const bv = this.startBlockValue(fc);
      if (bv)
        this.stack.push(bv);
      else {
        yield* this.pop();
        yield* this.step();
      }
    } else {
      const parent = this.peek(2);
      if (parent.type === "block-map" && (this.type === "map-value-ind" && parent.indent === fc.indent || this.type === "newline" && !parent.items[parent.items.length - 1].sep)) {
        yield* this.pop();
        yield* this.step();
      } else if (this.type === "map-value-ind" && parent.type !== "flow-collection") {
        const prev = getPrevProps(parent);
        const start = getFirstKeyStartProps(prev);
        fixFlowSeqItems(fc);
        const sep = fc.end.splice(1, fc.end.length);
        sep.push(this.sourceToken);
        const map2 = {
          type: "block-map",
          offset: fc.offset,
          indent: fc.indent,
          items: [{ start, key: fc, sep }]
        };
        this.onKeyLine = true;
        this.stack[this.stack.length - 1] = map2;
      } else {
        yield* this.lineEnd(fc);
      }
    }
  }
  flowScalar(type2) {
    if (this.onNewLine) {
      let nl = this.source.indexOf("\n") + 1;
      while (nl !== 0) {
        this.onNewLine(this.offset + nl);
        nl = this.source.indexOf("\n", nl) + 1;
      }
    }
    return {
      type: type2,
      offset: this.offset,
      indent: this.indent,
      source: this.source
    };
  }
  startBlockValue(parent) {
    switch (this.type) {
      case "alias":
      case "scalar":
      case "single-quoted-scalar":
      case "double-quoted-scalar":
        return this.flowScalar(this.type);
      case "block-scalar-header":
        return {
          type: "block-scalar",
          offset: this.offset,
          indent: this.indent,
          props: [this.sourceToken],
          source: ""
        };
      case "flow-map-start":
      case "flow-seq-start":
        return {
          type: "flow-collection",
          offset: this.offset,
          indent: this.indent,
          start: this.sourceToken,
          items: [],
          end: []
        };
      case "seq-item-ind":
        return {
          type: "block-seq",
          offset: this.offset,
          indent: this.indent,
          items: [{ start: [this.sourceToken] }]
        };
      case "explicit-key-ind": {
        this.onKeyLine = true;
        const prev = getPrevProps(parent);
        const start = getFirstKeyStartProps(prev);
        start.push(this.sourceToken);
        return {
          type: "block-map",
          offset: this.offset,
          indent: this.indent,
          items: [{ start, explicitKey: true }]
        };
      }
      case "map-value-ind": {
        this.onKeyLine = true;
        const prev = getPrevProps(parent);
        const start = getFirstKeyStartProps(prev);
        return {
          type: "block-map",
          offset: this.offset,
          indent: this.indent,
          items: [{ start, key: null, sep: [this.sourceToken] }]
        };
      }
    }
    return null;
  }
  atIndentedComment(start, indent) {
    if (this.type !== "comment")
      return false;
    if (this.indent <= indent)
      return false;
    return start.every((st) => st.type === "newline" || st.type === "space");
  }
  *documentEnd(docEnd) {
    if (this.type !== "doc-mode") {
      if (docEnd.end)
        docEnd.end.push(this.sourceToken);
      else
        docEnd.end = [this.sourceToken];
      if (this.type === "newline")
        yield* this.pop();
    }
  }
  *lineEnd(token) {
    switch (this.type) {
      case "comma":
      case "doc-start":
      case "doc-end":
      case "flow-seq-end":
      case "flow-map-end":
      case "map-value-ind":
        yield* this.pop();
        yield* this.step();
        break;
      case "newline":
        this.onKeyLine = false;
      case "space":
      case "comment":
      default:
        if (token.end)
          token.end.push(this.sourceToken);
        else
          token.end = [this.sourceToken];
        if (this.type === "newline")
          yield* this.pop();
    }
  }
};
function parseOptions(options) {
  const prettyErrors = options.prettyErrors !== false;
  const lineCounter = options.lineCounter || prettyErrors && new LineCounter() || null;
  return { lineCounter, prettyErrors };
}
function parseDocument(source2, options = {}) {
  const { lineCounter, prettyErrors } = parseOptions(options);
  const parser2 = new Parser$2(lineCounter == null ? void 0 : lineCounter.addNewLine);
  const composer = new Composer(options);
  let doc2 = null;
  for (const _doc of composer.compose(parser2.parse(source2), true, source2.length)) {
    if (!doc2)
      doc2 = _doc;
    else if (doc2.options.logLevel !== "silent") {
      doc2.errors.push(new YAMLParseError(_doc.range.slice(0, 2), "MULTIPLE_DOCS", "Source contains multiple documents; please use YAML.parseAllDocuments()"));
      break;
    }
  }
  if (prettyErrors && lineCounter) {
    doc2.errors.forEach(prettifyError(source2, lineCounter));
    doc2.warnings.forEach(prettifyError(source2, lineCounter));
  }
  return doc2;
}
function parse$8(src, reviver, options) {
  let _reviver = void 0;
  if (typeof reviver === "function") {
    _reviver = reviver;
  } else if (options === void 0 && reviver && typeof reviver === "object") {
    options = reviver;
  }
  const doc2 = parseDocument(src, options);
  if (!doc2)
    return null;
  doc2.warnings.forEach((warning) => warn$1(doc2.options.logLevel, warning));
  if (doc2.errors.length > 0) {
    if (doc2.options.logLevel !== "silent")
      throw doc2.errors[0];
    else
      doc2.errors = [];
  }
  return doc2.toJS(Object.assign({ reviver: _reviver }, options));
}
const json$2 = {
  /** Parse and throw if the return value is not an object */
  parse: (val) => {
    const jsonObject = JSON.parse(val);
    if (typeof jsonObject !== "object")
      throw Error("Invalid JSON object");
    return jsonObject;
  },
  /** Parse and return a fallback on failure */
  parseSafe(val, fallback) {
    try {
      return json$2.parse(val);
    } catch (err) {
      return typeof fallback === "function" ? fallback(err) : fallback;
    }
  },
  stringify: (val) => JSON.stringify(val)
};
const isJsonString = (value) => {
  if (typeof value !== "string")
    return false;
  return !!json$2.parseSafe(value, false);
};
function formatJsonOrYamlString(value) {
  const trimmed = value.trim();
  if (trimmed[0] !== "{" && trimmed[0] !== "[")
    return value;
  try {
    return JSON.stringify(JSON.parse(value), null, 2);
  } catch {
    return value;
  }
}
const prettyPrintJson = (value) => {
  if (typeof value === "string") {
    if (isJsonString(value)) {
      return JSON.stringify(JSON.parse(value), null, 2);
    }
    return value;
  }
  if (typeof value === "object") {
    try {
      return JSON.stringify(value, null, 2);
    } catch {
      return replaceCircularDependencies(value);
    }
  }
  return (value == null ? void 0 : value.toString()) ?? "";
};
function replaceCircularDependencies(content2) {
  const cache2 = /* @__PURE__ */ new Set();
  return JSON.stringify(content2, (key2, value) => {
    if (typeof value === "object" && value !== null) {
      if (cache2.has(value)) {
        return "[Circular]";
      }
      cache2.add(value);
    }
    return value;
  }, 2);
}
const MAX_LEVELS_DEEP = 5;
const genericExampleValues = {
  // 'date-time': '1970-01-01T00:00:00Z',
  "date-time": (/* @__PURE__ */ new Date()).toISOString(),
  // 'date': '1970-01-01',
  "date": (/* @__PURE__ */ new Date()).toISOString().split("T")[0],
  "email": "[email protected]",
  "hostname": "example.com",
  // https://tools.ietf.org/html/rfc6531#section-3.3
  "idn-email": "[email protected]",
  // https://tools.ietf.org/html/rfc5890#section-2.3.2.3
  "idn-hostname": "example.com",
  "ipv4": "127.0.0.1",
  "ipv6": "51d4:7fab:bfbf:b7d7:b2cb:d4b4:3dad:d998",
  "iri-reference": "/entitiy/1",
  // https://tools.ietf.org/html/rfc3987
  "iri": "https://example.com/entity/123",
  "json-pointer": "/nested/objects",
  "password": "super-secret",
  "regex": "/[a-z]/",
  // https://tools.ietf.org/html/draft-handrews-relative-json-pointer-01
  "relative-json-pointer": "1/nested/objects",
  // full-time in https://tools.ietf.org/html/rfc3339#section-5.6
  // 'time': '00:00:00Z',
  "time": (/* @__PURE__ */ new Date()).toISOString().split("T")[1].split(".")[0],
  // either a URI or relative-reference https://tools.ietf.org/html/rfc3986#section-4.1
  "uri-reference": "../folder",
  "uri-template": "https://example.com/{id}",
  "uri": "https://example.com",
  "uuid": "123e4567-e89b-12d3-a456-426614174000"
};
function guessFromFormat(schema2, fallback = "") {
  return genericExampleValues[schema2.format] ?? fallback;
}
const resultCache = /* @__PURE__ */ new WeakMap();
function cache$1(schema2, result) {
  if (typeof result !== "object" || result === null) {
    return result;
  }
  resultCache.set(schema2, result);
  return result;
}
const getExampleFromSchema = (schema2, options, level = 0, parentSchema, name2) => {
  var _a2, _b, _c, _d, _e, _f, _g, _h, _i, _j, _k, _l, _m;
  if (resultCache.has(schema2)) {
    return resultCache.get(schema2);
  }
  if (level === MAX_LEVELS_DEEP + 1) {
    try {
      JSON.stringify(schema2);
    } catch {
      return "[Circular Reference]";
    }
  }
  const makeUpRandomData = !!(options == null ? void 0 : options.emptyString);
  if ((options == null ? void 0 : options.mode) === "write" && schema2.readOnly || (options == null ? void 0 : options.mode) === "read" && schema2.writeOnly) {
    return void 0;
  }
  if (schema2["x-variable"]) {
    const value = (_a2 = options == null ? void 0 : options.variables) == null ? void 0 : _a2[schema2["x-variable"]];
    if (value !== void 0) {
      if (schema2.type === "number" || schema2.type === "integer") {
        return parseInt(value, 10);
      }
      return cache$1(schema2, value);
    }
  }
  if (Array.isArray(schema2.examples) && schema2.examples.length > 0) {
    return cache$1(schema2, schema2.examples[0]);
  }
  if (schema2.example !== void 0) {
    return cache$1(schema2, schema2.example);
  }
  if (schema2.default !== void 0) {
    return cache$1(schema2, schema2.default);
  }
  if (Array.isArray(schema2.enum) && schema2.enum.length > 0) {
    return cache$1(schema2, schema2.enum[0]);
  }
  const isObjectOrArray = schema2.type === "object" || schema2.type === "array" || !!((_c = (_b = schema2.allOf) == null ? void 0 : _b.at) == null ? void 0 : _c.call(_b, 0)) || !!((_e = (_d = schema2.anyOf) == null ? void 0 : _d.at) == null ? void 0 : _e.call(_d, 0)) || !!((_g = (_f = schema2.oneOf) == null ? void 0 : _f.at) == null ? void 0 : _g.call(_f, 0));
  if (!isObjectOrArray && (options == null ? void 0 : options.omitEmptyAndOptionalProperties) === true) {
    const isRequired = schema2.required === true || (parentSchema == null ? void 0 : parentSchema.required) === true || ((_h = parentSchema == null ? void 0 : parentSchema.required) == null ? void 0 : _h.includes(name2 ?? schema2.name));
    if (!isRequired) {
      return void 0;
    }
  }
  if (schema2.type === "object" || schema2.properties !== void 0) {
    const response = {};
    if (schema2.properties !== void 0) {
      for (const propertyName2 in schema2.properties) {
        if (Object.prototype.hasOwnProperty.call(schema2.properties, propertyName2)) {
          const property = schema2.properties[propertyName2];
          const propertyXmlTagName = (options == null ? void 0 : options.xml) ? (_i = property.xml) == null ? void 0 : _i.name : void 0;
          response[propertyXmlTagName ?? propertyName2] = getExampleFromSchema(property, options, level + 1, schema2, propertyName2);
          if (typeof response[propertyXmlTagName ?? propertyName2] === "undefined") {
            delete response[propertyXmlTagName ?? propertyName2];
          }
        }
      }
    }
    if (schema2.additionalProperties !== void 0) {
      const anyTypeIsValid = (
        // true
        schema2.additionalProperties === true || // or an empty object {}
        typeof schema2.additionalProperties === "object" && !Object.keys(schema2.additionalProperties).length
      );
      if (anyTypeIsValid) {
        response["ANY_ADDITIONAL_PROPERTY"] = "anything";
      } else if (schema2.additionalProperties !== false) {
        response["ANY_ADDITIONAL_PROPERTY"] = getExampleFromSchema(schema2.additionalProperties, options, level + 1);
      }
    }
    if (schema2.anyOf !== void 0) {
      Object.assign(response, getExampleFromSchema(schema2.anyOf[0], options, level + 1));
    } else if (schema2.oneOf !== void 0) {
      Object.assign(response, getExampleFromSchema(schema2.oneOf[0], options, level + 1));
    } else if (schema2.allOf !== void 0) {
      Object.assign(response, ...schema2.allOf.map((item) => getExampleFromSchema(item, options, level + 1, schema2)).filter((item) => item !== void 0));
    }
    return cache$1(schema2, response);
  }
  if (schema2.type === "array" || schema2.items !== void 0) {
    const itemsXmlTagName = (_k = (_j = schema2 == null ? void 0 : schema2.items) == null ? void 0 : _j.xml) == null ? void 0 : _k.name;
    const wrapItems = !!((options == null ? void 0 : options.xml) && ((_l = schema2.xml) == null ? void 0 : _l.wrapped) && itemsXmlTagName);
    if (schema2.example !== void 0) {
      return cache$1(schema2, wrapItems ? { [itemsXmlTagName]: schema2.example } : schema2.example);
    }
    if (schema2.items) {
      const rules = ["anyOf", "oneOf", "allOf"];
      for (const rule of rules) {
        if (!schema2.items[rule]) {
          continue;
        }
        const schemas2 = ["anyOf", "oneOf"].includes(rule) ? (
          // Use the first item only
          schema2.items[rule].slice(0, 1)
        ) : (
          // Use all items
          schema2.items[rule]
        );
        const exampleFromRule = schemas2.map((item) => getExampleFromSchema(item, options, level + 1, schema2)).filter((item) => item !== void 0);
        return cache$1(schema2, wrapItems ? [{ [itemsXmlTagName]: exampleFromRule }] : exampleFromRule);
      }
    }
    if ((_m = schema2.items) == null ? void 0 : _m.type) {
      const exampleFromSchema = getExampleFromSchema(schema2.items, options, level + 1);
      return wrapItems ? [{ [itemsXmlTagName]: exampleFromSchema }] : [exampleFromSchema];
    }
    return [];
  }
  const exampleValues = {
    string: makeUpRandomData ? guessFromFormat(schema2, options == null ? void 0 : options.emptyString) : "",
    boolean: true,
    integer: schema2.min ?? 1,
    number: schema2.min ?? 1,
    array: []
  };
  if (schema2.type !== void 0 && exampleValues[schema2.type] !== void 0) {
    return cache$1(schema2, exampleValues[schema2.type]);
  }
  const discriminateSchema = schema2.oneOf || schema2.anyOf;
  if (Array.isArray(discriminateSchema) && discriminateSchema.length > 0) {
    const firstOneOfItem = discriminateSchema[0];
    return getExampleFromSchema(firstOneOfItem, options, level + 1);
  }
  if (Array.isArray(schema2.allOf)) {
    let example = null;
    schema2.allOf.forEach((allOfItem) => {
      const newExample = getExampleFromSchema(allOfItem, options, level + 1);
      example = typeof newExample === "object" && typeof example === "object" ? {
        ...example ?? {},
        ...newExample
      } : Array.isArray(newExample) && Array.isArray(example) ? [...example ?? {}, ...newExample] : newExample;
    });
    return cache$1(schema2, example);
  }
  if (Array.isArray(schema2.type)) {
    if (schema2.type.includes("null")) {
      return null;
    }
    const exampleValue = exampleValues[schema2.type[0]];
    if (exampleValue !== void 0) {
      return cache$1(schema2, exampleValue);
    }
  }
  return null;
};
function getParametersFromOperation(operation, where, requiredOnly = true) {
  var _a2;
  const parameters = [
    ...operation.pathParameters || [],
    ...((_a2 = operation.information) == null ? void 0 : _a2.parameters) || []
  ];
  const params = parameters.filter((parameter) => parameter.in === where).filter((parameter) => requiredOnly && parameter.required || !requiredOnly).map((parameter) => ({
    name: parameter.name,
    description: parameter.description ?? null,
    value: parameter.example ? parameter.example : parameter.schema ? getExampleFromSchema(parameter.schema, { mode: "write" }) : "",
    required: parameter.required ?? false,
    enabled: parameter.required ?? false
  }));
  return params.sort((a2, b2) => {
    if (a2.required && !b2.required)
      return -1;
    if (!a2.required && b2.required)
      return 1;
    return 0;
  });
}
function getParamsFromObject(obj, prefix = "") {
  return Object.entries(obj).flatMap(([key2, value]) => {
    const newKey = prefix ? `${prefix}[${key2}]` : key2;
    if (typeof value === "object" && value !== null) {
      return getParamsFromObject(value, newKey);
    }
    return [{ name: newKey, value }];
  });
}
const mimeTypes = [
  "application/json",
  "application/octet-stream",
  "application/x-www-form-urlencoded",
  "application/xml",
  "multipart/form-data",
  "text/plain"
];
function getRequestBodyFromOperation(operation, selectedExampleKey) {
  var _a2, _b, _c, _d;
  const originalContent = (_b = (_a2 = operation.information) == null ? void 0 : _a2.requestBody) == null ? void 0 : _b.content;
  const content2 = normalizeMimeTypeObject(originalContent);
  const mimeType2 = mimeTypes.find((currentMimeType) => !!(content2 == null ? void 0 : content2[currentMimeType]));
  const examples = (_c = content2 == null ? void 0 : content2["application/json"]) == null ? void 0 : _c.examples;
  const selectedExample = (_d = examples ?? {}) == null ? void 0 : _d[Object.keys(examples ?? {})[0]];
  if (selectedExample) {
    return {
      body: {
        mimeType: "application/json",
        text: prettyPrintJson(selectedExample == null ? void 0 : selectedExample.value)
      }
    };
  }
  const bodyParameters = getParametersFromOperation(operation, "body", false);
  if (bodyParameters.length > 0) {
    return {
      body: {
        mimeType: "application/json",
        text: prettyPrintJson(bodyParameters[0].value)
      }
    };
  }
  const formDataParameters = getParametersFromOperation(operation, "formData", false);
  if (formDataParameters.length > 0) {
    return {
      body: {
        mimeType: "application/x-www-form-urlencoded",
        params: formDataParameters.map((parameter) => ({
          name: parameter.name,
          /**
           * TODO: This value MUST be a string
           * Figure out why this is not always a string
           *
           * JSON.stringify is a TEMPORARY fix
           */
          value: typeof parameter.value === "string" ? parameter.value : JSON.stringify(parameter.value)
        }))
      }
    };
  }
  if (!mimeType2) {
    return null;
  }
  const requestBodyObject = content2 == null ? void 0 : content2[mimeType2];
  const headers = [
    {
      name: "Content-Type",
      value: mimeType2
    }
  ];
  const example = (requestBodyObject == null ? void 0 : requestBodyObject.example) ? requestBodyObject == null ? void 0 : requestBodyObject.example : void 0;
  if (mimeType2 === "application/json") {
    const exampleFromSchema = (requestBodyObject == null ? void 0 : requestBodyObject.schema) ? getExampleFromSchema(requestBodyObject == null ? void 0 : requestBodyObject.schema, {
      mode: "write",
      omitEmptyAndOptionalProperties: true
    }) : null;
    const body2 = example ?? exampleFromSchema;
    return {
      headers,
      body: {
        mimeType: mimeType2,
        text: typeof body2 === "string" ? body2 : JSON.stringify(body2, null, 2)
      }
    };
  }
  if (mimeType2 === "application/xml") {
    const exampleFromSchema = (requestBodyObject == null ? void 0 : requestBodyObject.schema) ? getExampleFromSchema(requestBodyObject == null ? void 0 : requestBodyObject.schema, {
      xml: true,
      mode: "write",
      omitEmptyAndOptionalProperties: true
    }) : null;
    return {
      headers,
      body: {
        mimeType: mimeType2,
        text: example ?? json2xml(exampleFromSchema, "  ")
      }
    };
  }
  if (mimeType2 === "application/octet-stream") {
    return {
      headers,
      body: {
        mimeType: mimeType2,
        text: "BINARY"
      }
    };
  }
  if (mimeType2 === "text/plain") {
    const exampleFromSchema = (requestBodyObject == null ? void 0 : requestBodyObject.schema) ? getExampleFromSchema(requestBodyObject == null ? void 0 : requestBodyObject.schema, {
      xml: true,
      mode: "write",
      omitEmptyAndOptionalProperties: true
    }) : null;
    return {
      headers,
      body: {
        mimeType: mimeType2,
        text: example ?? exampleFromSchema ?? ""
      }
    };
  }
  if (mimeType2 === "multipart/form-data" || mimeType2 === "application/x-www-form-urlencoded") {
    const exampleFromSchema = (requestBodyObject == null ? void 0 : requestBodyObject.schema) ? getExampleFromSchema(requestBodyObject == null ? void 0 : requestBodyObject.schema, {
      xml: true,
      mode: "write",
      omitEmptyAndOptionalProperties: true
    }) : null;
    return {
      headers,
      body: {
        mimeType: mimeType2,
        params: getParamsFromObject(example ?? exampleFromSchema ?? {})
      }
    };
  }
  return null;
}
const requestExampleParametersSchema = z$8.object({
  key: z$8.string().default(""),
  value: z$8.coerce.string().default(""),
  enabled: z$8.boolean().default(true),
  file: z$8.any().optional(),
  description: z$8.string().optional(),
  /** Params are linked to parents such as path params and global headers/cookies */
  refUid: nanoidSchema.optional(),
  required: z$8.boolean().optional(),
  enum: z$8.array(z$8.string()).optional(),
  type: z$8.string().optional(),
  format: z$8.string().optional(),
  minimum: z$8.number().optional(),
  maximum: z$8.number().optional(),
  default: z$8.any().optional(),
  nullable: z$8.boolean().optional()
});
const exampleRequestBodyEncoding = [
  "json",
  "text",
  "html",
  "javascript",
  "xml",
  "yaml",
  "edn"
];
const exampleRequestBodySchema = z$8.object({
  raw: z$8.object({
    encoding: z$8.enum(exampleRequestBodyEncoding).default("json"),
    value: z$8.string().default("")
  }).optional(),
  formData: z$8.object({
    encoding: z$8.union([z$8.literal("form-data"), z$8.literal("urlencoded")]).default("form-data"),
    value: requestExampleParametersSchema.array().default([])
  }).optional(),
  binary: z$8.instanceof(Blob).optional(),
  activeBody: z$8.union([z$8.literal("raw"), z$8.literal("formData"), z$8.literal("binary")]).default("raw")
});
const requestExampleSchema = z$8.object({
  type: z$8.literal("requestExample").optional().default("requestExample"),
  uid: nanoidSchema,
  requestUid: nanoidSchema,
  name: z$8.string().optional().default("Name"),
  body: exampleRequestBodySchema.optional().default({}),
  parameters: z$8.object({
    path: requestExampleParametersSchema.array().default([]),
    query: requestExampleParametersSchema.array().default([]),
    headers: requestExampleParametersSchema.array().default([]),
    cookies: requestExampleParametersSchema.array().default([])
  }).optional().default({}),
  serverVariables: z$8.record(z$8.string(), z$8.array(z$8.string())).optional()
});
function createParamInstance(param) {
  var _a2;
  const schema2 = param.schema;
  const value = String((schema2 == null ? void 0 : schema2.default) ?? ((_a2 = schema2 == null ? void 0 : schema2.examples) == null ? void 0 : _a2[0]) ?? "");
  const example = schemaModel({
    ...schema2,
    key: param.name,
    value,
    description: param.description,
    required: param.required,
    /** Initialized all required properties to enabled */
    enabled: !!param.required
  }, requestExampleParametersSchema, false);
  if (!example) {
    console.warn(`Example at ${param.name} is invalid.`);
    return requestExampleParametersSchema.parse({});
  } else
    return example;
}
function createExampleFromRequest(request, name2, server) {
  var _a2, _b, _c, _d, _e;
  const parameters = {
    path: [],
    query: [],
    cookie: [],
    header: []
  };
  (_a2 = request.parameters) == null ? void 0 : _a2.forEach((p2) => parameters[p2.in].push(createParamInstance(p2)));
  const body2 = {
    activeBody: "raw",
    raw: {
      encoding: "json",
      value: ""
    }
  };
  if (request.requestBody) {
    const requestBody = getRequestBodyFromOperation({
      path: request.path,
      information: {
        requestBody: request.requestBody
      }
    });
    if (((_b = requestBody == null ? void 0 : requestBody.body) == null ? void 0 : _b.mimeType) === "application/json") {
      body2.activeBody = "raw";
      body2.raw = {
        encoding: "json",
        value: requestBody.body.text ?? JSON.stringify({})
      };
    }
    if (((_c = requestBody == null ? void 0 : requestBody.body) == null ? void 0 : _c.mimeType) === "application/xml") {
      body2.activeBody = "raw";
      body2.raw = {
        encoding: "xml",
        value: requestBody.body.text ?? ""
      };
    }
    if (((_d = requestBody == null ? void 0 : requestBody.body) == null ? void 0 : _d.mimeType) === "application/octet-stream") {
      body2.activeBody = "binary";
      body2.binary = void 0;
    }
    if (((_e = requestBody == null ? void 0 : requestBody.body) == null ? void 0 : _e.mimeType) === "application/x-www-form-urlencoded") {
      body2.activeBody = "formData";
      body2.formData = void 0;
    }
  }
  const serverVariables = {};
  const example = schemaModel({
    requestUid: request.uid,
    parameters,
    name: name2,
    body: body2,
    serverVariables
  }, requestExampleSchema, false);
  if (!example) {
    console.warn(`Example at ${request.uid} is invalid.`);
    return requestExampleSchema.parse({});
  } else
    return example;
}
const F$3 = [
  "alternate",
  "default",
  "moon",
  "purple",
  "solarized",
  "bluePlanet",
  "deepSpace",
  "saturn",
  "kepler",
  "mars",
  "none"
], M$4 = {
  default: "Default",
  alternate: "Alternate",
  moon: "Moon",
  purple: "Purple",
  solarized: "Solarized",
  bluePlanet: "Blue Planet",
  saturn: "Saturn",
  kepler: "Kepler-11e",
  mars: "Mars",
  deepSpace: "Deep Space",
  none: ""
};
const HOTKEY_EVENT_NAMES = [
  "closeModal",
  "navigateSearchResultsDown",
  "selectSearchResult",
  "navigateSearchResultsUp",
  "openCommandPalette",
  "createNew",
  "toggleSidebar",
  "addTopNav",
  "closeTopNav",
  "navigateTopNavLeft",
  "navigateTopNavRight",
  "focusAddressBar",
  "jumpToTab",
  "jumpToLastTab",
  "focusRequestSearch"
];
const KEYDOWN_KEYS = [
  "Space",
  "Backspace",
  "Tab",
  "Enter",
  "Escape",
  "ArrowDown",
  "ArrowLeft",
  "ArrowRight",
  "ArrowUp",
  "End",
  "Home",
  "PageDown",
  "PageUp",
  "Delete",
  "0",
  "1",
  "2",
  "3",
  "4",
  "5",
  "6",
  "7",
  "8",
  "9",
  "a",
  "b",
  "c",
  "d",
  "e",
  "f",
  "g",
  "h",
  "i",
  "j",
  "k",
  "l",
  "m",
  "n",
  "o",
  "p",
  "q",
  "r",
  "s",
  "t",
  "u",
  "v",
  "w",
  "x",
  "y",
  "z",
  "0",
  "1",
  "2",
  "3",
  "4",
  "5",
  "6",
  "7",
  "8",
  "9",
  "*",
  "+",
  "-",
  ".",
  "/",
  "F1",
  "F2",
  "F3",
  "F4",
  "F5",
  "F6",
  "F7",
  "F8",
  "F9",
  "F10",
  "F11",
  "F12",
  ";",
  "=",
  ",",
  "-",
  ".",
  "/",
  "`",
  "[",
  "\\",
  "]",
  ""
];
const modifier = z$8.enum(["Meta", "Control", "Shift", "Alt", "default"]).optional().default("default");
const modifiers$1 = z$8.array(modifier).optional().default(["default"]);
const hotKeys = z$8.record(z$8.enum(KEYDOWN_KEYS), z$8.object({
  modifiers: modifiers$1.optional(),
  event: z$8.enum(HOTKEY_EVENT_NAMES)
}));
const hotKeyConfigSchema = z$8.object({
  modifiers: modifiers$1,
  hotKeys: hotKeys.optional()
}).optional();
const workspaceSchema = z$8.object({
  uid: nanoidSchema,
  name: z$8.string().default("Default Workspace"),
  /** Workspace description */
  description: z$8.string().default("Basic Scalar Workspace"),
  /** Controls read only mode for most entitites, but not things like params */
  isReadOnly: z$8.boolean().default(false),
  /** List of all collection uids in a given workspace */
  collections: z$8.array(z$8.string()).default([]),
  /** List of all environment uids in a given workspace */
  environments: z$8.array(z$8.string()).default([]),
  /** Customize hotkeys */
  hotKeyConfig: hotKeyConfigSchema,
  /** Active Environment ID to use for requests  */
  activeEnvironmentId: z$8.string().optional().default("default"),
  /** List of all cookie uids in a given workspace */
  cookies: z$8.array(z$8.string()).default([]),
  /** Workspace level proxy for all requests to be sent through */
  proxyUrl: z$8.string().optional(),
  /** Workspace level theme, we might move this to user level later */
  themeId: z$8.enum(F$3).optional().default("default")
});
const createHash = (input) => {
  let chr = 0;
  let hash2 = 0;
  let i2 = 0;
  if (!(input == null ? void 0 : input.length))
    return hash2;
  for (i2 = 0; i2 < input.length; i2++) {
    chr = input.charCodeAt(i2);
    hash2 = (hash2 << 5) - hash2 + chr;
    hash2 |= 0;
  }
  return hash2;
};
function redirectToProxy(proxy, url) {
  if (!shouldUseProxy(proxy, url)) {
    return url ?? "";
  }
  const newUrl = new URL(url);
  newUrl.href = proxy;
  newUrl.searchParams.append("scalar_url", url);
  return newUrl.toString();
}
const isRelativePath = (url) => !/^https?:\/\//.test(url);
function shouldUseProxy(proxy, url) {
  if (!proxy || !url)
    return false;
  if (isRelativePath(url))
    return false;
  if (isRequestToLocalhost(url))
    return false;
  return true;
}
function isRequestToLocalhost(url) {
  const { hostname } = new URL(url);
  const listOfLocalUrls = ["localhost", "127.0.0.1", "[::1]"];
  return listOfLocalUrls.includes(hostname);
}
const OLD_PROXY_URL = "https://api.scalar.com/request-proxy";
const NEW_PROXY_URL = "https://proxy.scalar.com";
async function fetchSpecFromUrl(url, proxy, beautify = true) {
  if (proxy === OLD_PROXY_URL) {
    proxy = NEW_PROXY_URL;
  }
  const response = await fetch(proxy ? redirectToProxy(proxy, url) : url);
  if (response.status !== 200) {
    console.error(`[fetchSpecFromUrl] Failed to fetch the specification at ${url} (Status: ${response.status})`);
    if (!proxy) {
      console.warn(`[fetchSpecFromUrl] Tried to fetch the specification (url: ${url}) without a proxy. Are the CORS headers configured to allow cross-domain requests? https://developer.mozilla.org/en-US/docs/Web/HTTP/CORS`);
    }
    throw new Error(`Failed to fetch the specification (Status: ${response.status})`);
  }
  if (beautify)
    return formatJsonOrYamlString(await response.text());
  else
    return await response.text();
}
const REQUEST_METHODS = {
  get: {
    short: "GET",
    color: "text-blue",
    backgroundColor: "bg-blue"
  },
  post: {
    short: "POST",
    color: "text-green",
    backgroundColor: "bg-green"
  },
  put: {
    short: "PUT",
    color: "text-orange",
    backgroundColor: "bg-orange"
  },
  patch: {
    short: "PATCH",
    color: "text-yellow",
    backgroundColor: "bg-yellow"
  },
  delete: {
    short: "DEL",
    color: "text-red",
    backgroundColor: "bg-red"
  },
  options: {
    short: "OPTS",
    color: "text-purple",
    backgroundColor: "bg-purple"
  },
  head: {
    short: "HEAD",
    color: "text-scalar-c-2",
    backgroundColor: "bg-c-2"
  },
  connect: {
    short: "CONN",
    color: "text-c-2",
    backgroundColor: "bg-c-2"
  },
  trace: {
    short: "TRACE",
    color: "text-c-2",
    backgroundColor: "bg-c-2"
  }
};
const BODY_METHODS = ["post", "put", "patch", "delete"];
const canMethodHaveBody = (method) => BODY_METHODS.includes(method);
const getHttpMethodInfo = (methodName) => {
  const normalizedMethod = methodName.trim().toLowerCase();
  return REQUEST_METHODS[normalizedMethod] ?? {
    short: normalizedMethod,
    color: "text-c-2",
    backgroundColor: "bg-c-2"
  };
};
const httpStatusCodes = {
  100: {
    name: "Continue",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/100"
  },
  101: {
    name: "Switching Protocols",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/101"
  },
  102: {
    name: "Processing",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/102"
  },
  103: {
    name: "Early Hints",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/103"
  },
  200: {
    name: "OK",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/200"
  },
  201: {
    name: "Created",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/201"
  },
  202: {
    name: "Accepted",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/202"
  },
  203: {
    name: "Non-Authoritative Information",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/203"
  },
  204: {
    name: "No Content",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/204"
  },
  205: {
    name: "Reset Content",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/205"
  },
  206: {
    name: "Partial Content",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/206"
  },
  207: {
    name: "Multi-Status",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/207"
  },
  208: {
    name: "Already Reported",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/208"
  },
  226: {
    name: "IM Used",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/226"
  },
  300: {
    name: "Multiple Choices",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/300"
  },
  301: {
    name: "Moved Permanently",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/301"
  },
  302: {
    name: "Found",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/302"
  },
  303: {
    name: "See Other",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/303"
  },
  304: {
    name: "Not Modified",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/304"
  },
  305: {
    name: "Use Proxy",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/305"
  },
  306: {
    name: "(Unused)",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/306"
  },
  307: {
    name: "Temporary Redirect",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/307"
  },
  308: {
    name: "Permanent Redirect",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/308"
  },
  400: {
    name: "Bad Request",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/400"
  },
  401: {
    name: "Unauthorized",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/401"
  },
  402: {
    name: "Payment Required",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/402"
  },
  403: {
    name: "Forbidden",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/403"
  },
  404: {
    name: "Not Found",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/404"
  },
  405: {
    name: "Method Not Allowed",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/405"
  },
  406: {
    name: "Not Acceptable",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/406"
  },
  407: {
    name: "Proxy Authentication Required",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/407"
  },
  408: {
    name: "Request Timeout",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/408"
  },
  409: {
    name: "Conflict",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/409"
  },
  410: {
    name: "Gone",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/410"
  },
  411: {
    name: "Length Required",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/411"
  },
  412: {
    name: "Precondition Failed",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/412"
  },
  413: {
    name: "Content Too Large",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/413"
  },
  414: {
    name: "URI Too Long",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/414"
  },
  415: {
    name: "Unsupported Media Type",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/415"
  },
  416: {
    name: "Range Not Satisfiable",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/416"
  },
  417: {
    name: "Expectation Failed",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/417"
  },
  418: {
    name: "I'm a teapot",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/418"
  },
  421: {
    name: "Misdirected Request",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/421"
  },
  422: {
    name: "Unprocessable Content",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/422"
  },
  423: {
    name: "Locked",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/423"
  },
  424: {
    name: "Failed Dependency",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/424"
  },
  425: {
    name: "Too Early",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/425"
  },
  426: {
    name: "Upgrade Required",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/426"
  },
  428: {
    name: "Precondition Required",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/428"
  },
  429: {
    name: "Too Many Requests",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/429"
  },
  431: {
    name: "Request Header Fields Too Large",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/431"
  },
  451: {
    name: "Unavailable For Legal Reasons",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/451"
  },
  500: {
    name: "Internal Server Error",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/500"
  },
  501: {
    name: "Not Implemented",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/501"
  },
  502: {
    name: "Bad Gateway",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/502"
  },
  503: {
    name: "Service Unavailable",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/503"
  },
  504: {
    name: "Gateway Timeout",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/504"
  },
  505: {
    name: "HTTP Version Not Supported",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/505"
  },
  506: {
    name: "Variant Also Negotiates",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/506"
  },
  507: {
    name: "Insufficient Storage",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/507"
  },
  508: {
    name: "Loop Detected",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/508"
  },
  510: {
    name: "Not Extended",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/510"
  },
  511: {
    name: "Network Authentication Required",
    url: "https://developer.mozilla.org/en-US/docs/Web/HTTP/Status/511"
  }
};
const iterateTitle = (title2, checkDuplicates, separator = " #") => {
  if (!checkDuplicates(title2))
    return title2;
  const split = title2.split(separator);
  const newTitle = split.length > 1 ? `${split.slice(0, -1).join()}${separator}${Number(split.at(-1)) + 1}` : `${split.join()}${separator}2`;
  return iterateTitle(newTitle, checkDuplicates, separator);
};
const LS_KEYS = {
  COLLECTION: "collection",
  COOKIE: "cookie",
  ENVIRONMENT: "environment",
  REQUEST: "request",
  REQUEST_EXAMPLE: "requestExample",
  SECURITY_SCHEME: "securityScheme",
  SERVER: "server",
  TAG: "tag",
  WORKSPACE: "workspace"
};
function objectMerge(target, replacement) {
  Object.keys(target).forEach((key2) => {
    if (!Object.hasOwn(replacement, key2)) {
      delete target[key2];
    }
  });
  Object.assign(target, replacement);
  return target;
}
const camelToTitleWords = (camelStr) => camelStr.replace(/([A-Z])/g, (match) => ` ${match}`).replace(/^./, (match) => match.toUpperCase()).trim();
const capitalize = (str) => str[0].toUpperCase() + str.slice(1);
const variableRegex = /{{((?:[^{}]|{[^{}]*})*)}}/g;
const pathRegex = new RegExp("(?<!{){([^{}]+)}(?!})", "g");
const DATA_VERSION = "2.1.0";
const DATA_VERSION_LS_LEY = "scalar_api_client_data_version";
const { parse: $parse, stringify: $stringify } = JSON;
const { keys } = Object;
const Primitive = String;
const primitive = "string";
const ignore = {};
const object = "object";
const noop$2 = (_2, value) => value;
const primitives = (value) => value instanceof Primitive ? Primitive(value) : value;
const Primitives = (_2, value) => typeof value === primitive ? new Primitive(value) : value;
const revive = (input, parsed, output, $2) => {
  const lazy = [];
  for (let ke2 = keys(output), { length } = ke2, y2 = 0; y2 < length; y2++) {
    const k2 = ke2[y2];
    const value = output[k2];
    if (value instanceof Primitive) {
      const tmp = input[value];
      if (typeof tmp === object && !parsed.has(tmp)) {
        parsed.add(tmp);
        output[k2] = ignore;
        lazy.push({ k: k2, a: [input, parsed, tmp, $2] });
      } else
        output[k2] = $2.call(output, k2, tmp);
    } else if (output[k2] !== ignore)
      output[k2] = $2.call(output, k2, value);
  }
  for (let { length } = lazy, i2 = 0; i2 < length; i2++) {
    const { k: k2, a: a2 } = lazy[i2];
    output[k2] = $2.call(output, k2, revive.apply(null, a2));
  }
  return output;
};
const set = (known, input, value) => {
  const index2 = Primitive(input.push(value) - 1);
  known.set(value, index2);
  return index2;
};
const parse$7 = (text2, reviver) => {
  const input = $parse(text2, Primitives).map(primitives);
  const value = input[0];
  const $2 = noop$2;
  const tmp = typeof value === object && value ? revive(input, /* @__PURE__ */ new Set(), value, $2) : value;
  return $2.call({ "": tmp }, "", tmp);
};
const stringify$2 = (value, replacer2, space2) => {
  const $2 = noop$2;
  const known = /* @__PURE__ */ new Map();
  const input = [];
  const output = [];
  let i2 = +set(known, input, $2.call({ "": value }, "", value));
  let firstRun = !i2;
  while (i2 < input.length) {
    firstRun = true;
    output[i2] = $stringify(input[i2++], replace, space2);
  }
  return "[" + output.join(",") + "]";
  function replace(key2, value2) {
    if (firstRun) {
      firstRun = !firstRun;
      return value2;
    }
    const after = $2.call(this, key2, value2);
    switch (typeof after) {
      case object:
        if (after === null) return after;
      case primitive:
        return known.get(after) || set(known, input, after);
    }
    return after;
  }
};
const parseLocalStorage = (lsKey) => {
  const item = localStorage.getItem(lsKey) || "[{}]";
  const data = item[0] === "[" ? parse$7(item) : JSON.parse(item);
  return data;
};
const getLocalStorageVersion = () => {
  const collectionStr = localStorage.getItem("collection");
  const dataVersion = localStorage.getItem(DATA_VERSION_LS_LEY);
  if (!(collectionStr == null ? void 0 : collectionStr.length) || (collectionStr == null ? void 0 : collectionStr[0]) === "{")
    return "0.0.0";
  try {
    const [collection] = Object.values(parse$7(collectionStr) ?? {});
    if ((collection == null ? void 0 : collection.type) === "collection")
      return "2.1.0";
    if (dataVersion)
      return dataVersion;
    return "0.0.0";
  } catch (e2) {
    console.error(e2);
    if (dataVersion)
      return dataVersion;
    return "0.0.0";
  }
};
const semverLessThan = (left, right) => {
  const parseSemver = (version2) => {
    const [major, minor = 0, patch3 = 0] = version2.split(".").map((part) => parseInt(part, 10));
    return { major, minor, patch: patch3 };
  };
  const { major: major1, minor: minor1, patch: patch1 } = parseSemver(left);
  const { major: major2, minor: minor2, patch: patch2 } = parseSemver(right);
  if (major1 < major2)
    return true;
  if (major1 > major2)
    return false;
  if (minor1 < minor2)
    return true;
  if (minor1 > minor2)
    return false;
  return patch1 < patch2;
};
const migrate_v_2_1_0 = (data) => {
  console.info("Performing data migration v-0.0.0 to v-2.1.0");
  const oldData = {
    ...data,
    // @ts-expect-error Tags used to be called folders
    folders: parseLocalStorage("folder")
  };
  const flattenChildren = (childUids) => childUids.reduce((prev, uid2) => {
    var _a2;
    const request = oldData.requests[uid2];
    if (request) {
      prev.requestUids.add(uid2);
      (_a2 = request.securitySchemeUids) == null ? void 0 : _a2.forEach((s3) => prev.authUids.add(s3));
    } else if (oldData.folders[uid2]) {
      const { requestUids, tagUids, authUids } = flattenChildren(oldData.folders[uid2].childUids ?? []);
      prev.tagUids.add(uid2);
      requestUids.forEach((r2) => prev.requestUids.add(r2));
      tagUids.forEach((t2) => prev.tagUids.add(t2));
      authUids.forEach((a2) => prev.authUids.add(a2));
    }
    return prev;
  }, {
    requestUids: /* @__PURE__ */ new Set(),
    tagUids: /* @__PURE__ */ new Set(),
    authUids: /* @__PURE__ */ new Set()
  });
  const migrateAuth = (scheme) => {
    if (scheme.type === "apiKey")
      return { type: "apiKey", name: scheme.name, value: scheme.value ?? "" };
    if (scheme.type === "http")
      return {
        type: "http",
        username: scheme.value ?? "",
        password: scheme.secondValue ?? "",
        token: scheme.value ?? ""
      };
    if (scheme.type === "oauth2" && scheme.flow.type === "implicit")
      return {
        type: "oauth-implicit",
        token: scheme.flow.token ?? ""
      };
    if (scheme.type === "oauth2" && scheme.flow.type === "password")
      return {
        type: "oauth-password",
        token: scheme.flow.token ?? "",
        username: scheme.flow.value ?? "",
        password: scheme.flow.secondValue ?? "",
        clientSecret: scheme.flow.clientSecret ?? ""
      };
    if (scheme.type === "oauth2" && scheme.flow.type === "clientCredentials")
      return {
        type: "oauth-clientCredentials",
        token: scheme.flow.token ?? "",
        clientSecret: scheme.flow.clientSecret ?? ""
      };
    if (scheme.type === "oauth2" && scheme.flow.type === "authorizationCode")
      return {
        type: "oauth-authorizationCode",
        token: scheme.flow.token ?? "",
        clientSecret: scheme.flow.clientSecret ?? ""
      };
    return {
      type: "apiKey",
      name: "",
      value: ""
    };
  };
  const requestSecurityDict = {};
  const collections = Object.values(oldData.collections ?? {}).map((c2) => {
    var _a2, _b, _c, _d, _e, _f, _g;
    const { requestUids, tagUids, authUids } = flattenChildren(c2.childUids ?? []);
    const securitySchemesSet = /* @__PURE__ */ new Set([
      ...authUids,
      ...Object.values(c2.securitySchemeDict ?? {})
    ]);
    const securitySchemes2 = [...securitySchemesSet];
    requestUids.forEach((r2) => requestSecurityDict[r2] = securitySchemes2);
    const auth = securitySchemes2.reduce((prev, uid2) => {
      const scheme = oldData.securitySchemes[uid2];
      if (scheme.uid)
        prev[uid2] = migrateAuth(scheme);
      return prev;
    }, {});
    return {
      "type": "collection",
      "openapi": ((_a2 = c2.spec) == null ? void 0 : _a2.openapi) || "3.1.0",
      "info": ((_b = c2.spec) == null ? void 0 : _b.info) || { title: "OpenAPI Spec", version: "0.0.1" },
      "security": ((_c = c2.spec) == null ? void 0 : _c.security) || [],
      "externalDocs": (_d = c2.spec) == null ? void 0 : _d.externalDocs,
      "uid": c2.uid,
      securitySchemes: securitySchemes2,
      "selectedServerUid": c2.selectedServerUid || ((_f = (_e = c2.spec) == null ? void 0 : _e.serverUids) == null ? void 0 : _f[0]) || "",
      "servers": ((_g = c2.spec) == null ? void 0 : _g.serverUids) || [],
      "requests": [...requestUids],
      "tags": [...tagUids],
      auth,
      "children": c2.childUids || [],
      "x-scalar-icon": "interface-content-folder",
      "watchForChanges": false,
      "watchForChangesStatus": "IDLE"
    };
  });
  const cookies = Object.values(oldData.cookies ?? {});
  const environments = Object.values(oldData.environments ?? {}).map((e2) => ({
    ...e2,
    value: e2.raw ?? ""
  }));
  const requests = Object.values(oldData.requests ?? {}).map((r2) => {
    var _a2, _b, _c, _d, _e;
    const parameters = [
      ...Object.values(((_a2 = r2.parameters) == null ? void 0 : _a2.path) ?? {}),
      ...Object.values(((_b = r2.parameters) == null ? void 0 : _b.query) ?? {}),
      ...Object.values(((_c = r2.parameters) == null ? void 0 : _c.headers) ?? {}),
      ...Object.values(((_d = r2.parameters) == null ? void 0 : _d.cookies) ?? {})
    ].filter((p2) => p2);
    const selectedSecuritySchemeUids = (r2.selectedSecuritySchemeUids || []).filter((s3) => requestSecurityDict[r2.uid].includes(s3));
    return {
      ...r2,
      parameters,
      type: "request",
      method: ((_e = r2.method) == null ? void 0 : _e.toLowerCase()) ?? "get",
      examples: r2.childUids || [],
      selectedSecuritySchemeUids,
      selectedServerUid: "",
      servers: []
    };
  });
  const requestExamples = Object.values(oldData.requestExamples ?? {}).map((e2) => ({
    ...e2,
    type: "requestExample"
  }));
  const migrateFlow = (flow) => {
    const base2 = {
      refreshUrl: flow.refreshUrl || "",
      selectedScopes: flow.selectedScopes || [],
      scopes: flow.scopes || {}
    };
    if (flow.type === "implicit")
      return {
        ...flow,
        ...base2,
        "type": "implicit",
        "x-scalar-redirect-uri": ("redirectUri" in flow ? flow.redirectUri : "") || ""
      };
    if (flow.type === "password")
      return {
        ...flow,
        ...base2,
        tokenUrl: flow.tokenUrl || ""
      };
    if (flow.type === "clientCredentials")
      return {
        ...flow,
        ...base2,
        tokenUrl: flow.tokenUrl || ""
      };
    return {
      ...flow,
      ...base2,
      "x-scalar-redirect-uri": ("redirectUri" in flow ? flow.redirectUri : "") || "",
      "authorizationUrl": flow.authorizationUrl || "",
      "tokenUrl": flow.tokenUrl || ""
    };
  };
  const getNameKey = (scheme) => {
    switch (scheme == null ? void 0 : scheme.type) {
      case "apiKey":
        return `${capitalize(scheme.in)}`;
      case "http": {
        return `${capitalize(scheme.scheme)} Authentication`;
      }
      case "oauth2":
        return camelToTitleWords(scheme.flow.type);
      case "openIdConnect":
        return `Open ID Connect`;
      default:
        return "None";
    }
  };
  const securitySchemes = Object.values(oldData.securitySchemes ?? {}).map((s3) => s3.type === "oauth2" ? {
    ...s3,
    "nameKey": getNameKey(s3),
    "x-scalar-client-id": s3.clientId || "",
    "flow": migrateFlow(s3.flow)
  } : { ...s3, nameKey: getNameKey(s3) });
  const servers = Object.values(oldData.servers ?? {}).map((s3) => ({
    ...s3,
    variables: s3.variables ?? {}
  }));
  const tags2 = Object.values(oldData.folders ?? {}).map((f2) => ({
    "type": "tag",
    "uid": f2.uid,
    "name": f2.name || "unknownTag",
    "description": f2.description,
    "children": f2.childUids || [],
    "x-scalar-children": []
  }));
  const workspaces = Object.values(oldData.workspaces ?? {}).map((w2) => ({
    ...w2,
    description: w2.description ?? "Basic Scalar Workspace",
    cookies: w2.cookieUids || [],
    collections: w2.collectionUids || [],
    environments: w2.environmentUids || []
  }));
  return {
    collections,
    cookies,
    environments,
    requestExamples,
    requests,
    securitySchemes,
    servers,
    tags: tags2,
    workspaces
  };
};
const migrator = () => {
  const dataVersion = getLocalStorageVersion();
  console.info("Data version: " + dataVersion);
  let data = {
    collections: parseLocalStorage("collection"),
    cookies: parseLocalStorage("cookie"),
    environments: parseLocalStorage("environment"),
    requestExamples: parseLocalStorage("requestExample"),
    requests: parseLocalStorage("request"),
    securitySchemes: parseLocalStorage("securityScheme"),
    servers: parseLocalStorage("server"),
    tags: parseLocalStorage("tag"),
    workspaces: parseLocalStorage("workspace")
  };
  if (semverLessThan(dataVersion, "2.1.0"))
    data = migrate_v_2_1_0(data);
  else
    data = {
      collections: Object.values(data.collections),
      cookies: Object.values(data.cookies),
      environments: Object.values(data.environments),
      requestExamples: Object.values(data.requestExamples),
      requests: Object.values(data.requests),
      securitySchemes: Object.values(data.securitySchemes),
      servers: Object.values(data.servers),
      tags: Object.values(data.tags),
      workspaces: Object.values(data.workspaces)
    };
  return data;
};
const loadResources = (resources, schema2, add2) => resources.forEach((payload) => {
  const resource = schemaModel(payload, schema2, false);
  if (resource) add2(resource);
});
const loadAllResources = (mutators) => {
  const {
    collectionMutators,
    cookieMutators,
    environmentMutators,
    tagMutators,
    requestExampleMutators,
    requestMutators,
    serverMutators,
    securitySchemeMutators,
    workspaceMutators
  } = mutators;
  try {
    const {
      collections,
      cookies,
      environments,
      requestExamples,
      requests,
      servers,
      securitySchemes,
      tags: tags2,
      workspaces
    } = migrator();
    loadResources(collections, collectionSchema, collectionMutators.rawAdd);
    loadResources(cookies, cookieSchema, cookieMutators.add);
    loadResources(environments, environmentSchema, environmentMutators.add);
    loadResources(
      requestExamples,
      requestExampleSchema,
      requestExampleMutators.rawAdd
    );
    loadResources(requests, requestSchema, requestMutators.rawAdd);
    loadResources(servers, serverSchema, serverMutators.rawAdd);
    loadResources(
      securitySchemes,
      securitySchemeSchema,
      securitySchemeMutators.rawAdd
    );
    loadResources(tags2, tagSchema, tagMutators.rawAdd);
    loadResources(workspaces, workspaceSchema, workspaceMutators.rawAdd);
    localStorage.setItem(DATA_VERSION_LS_LEY, DATA_VERSION);
  } catch (e2) {
    console.error(e2);
  }
};
function getDotPathValue(path2, context) {
  const pathKeys = path2.split(".");
  const result = pathKeys.reduce(
    (nested, currentKey) => nested == null ? void 0 : nested[currentKey],
    context
  );
  return typeof result === "string" ? result : JSON.stringify(result);
}
function replaceTemplateVariables(templateString, context) {
  const variableRegex2 = /{{\s*([^}\s]+?)\s*}}|{\s*([^}\s]+?)\s*}|:\b[\w.]+\b/g;
  const matches = templateString.match(variableRegex2) ?? [];
  let substitutedString = templateString;
  matches.forEach((m2) => {
    const key2 = m2.startsWith(":") ? m2.slice(1) : m2.replace(/[{}]/g, "").trim();
    const value = getDotPathValue(key2, context);
    if (value !== null && value !== void 0)
      substitutedString = substitutedString.replaceAll(m2, value);
  });
  return substitutedString;
}
function flattenEnvVars(environment) {
  function getNestedKeyValues(item, prefix) {
    const keys2 = Object.keys(item);
    const values2 = [];
    keys2.forEach((k2) => {
      const prefixedKey = prefix ? `${prefix}.${k2}` : k2;
      if (typeof item[k2] === "object") {
        values2.push(...getNestedKeyValues(item[k2], prefixedKey));
      } else {
        values2.push([prefixedKey, String(item[k2])]);
      }
    });
    return values2;
  }
  return getNestedKeyValues(environment);
}
/*!
  * vue-router v4.3.3
  * (c) 2024 Eduardo San Martin Morote
  * @license MIT
  */
const isBrowser = typeof document !== "undefined";
function isESModule(obj) {
  return obj.__esModule || obj[Symbol.toStringTag] === "Module";
}
const assign$1 = Object.assign;
function applyToParams(fn, params) {
  const newParams = {};
  for (const key2 in params) {
    const value = params[key2];
    newParams[key2] = isArray$2(value) ? value.map(fn) : fn(value);
  }
  return newParams;
}
const noop$1 = () => {
};
const isArray$2 = Array.isArray;
const HASH_RE = /#/g;
const AMPERSAND_RE = /&/g;
const SLASH_RE = /\//g;
const EQUAL_RE = /=/g;
const IM_RE = /\?/g;
const PLUS_RE = /\+/g;
const ENC_BRACKET_OPEN_RE = /%5B/g;
const ENC_BRACKET_CLOSE_RE = /%5D/g;
const ENC_CARET_RE = /%5E/g;
const ENC_BACKTICK_RE = /%60/g;
const ENC_CURLY_OPEN_RE = /%7B/g;
const ENC_PIPE_RE = /%7C/g;
const ENC_CURLY_CLOSE_RE = /%7D/g;
const ENC_SPACE_RE = /%20/g;
function commonEncode(text2) {
  return encodeURI("" + text2).replace(ENC_PIPE_RE, "|").replace(ENC_BRACKET_OPEN_RE, "[").replace(ENC_BRACKET_CLOSE_RE, "]");
}
function encodeHash(text2) {
  return commonEncode(text2).replace(ENC_CURLY_OPEN_RE, "{").replace(ENC_CURLY_CLOSE_RE, "}").replace(ENC_CARET_RE, "^");
}
function encodeQueryValue(text2) {
  return commonEncode(text2).replace(PLUS_RE, "%2B").replace(ENC_SPACE_RE, "+").replace(HASH_RE, "%23").replace(AMPERSAND_RE, "%26").replace(ENC_BACKTICK_RE, "`").replace(ENC_CURLY_OPEN_RE, "{").replace(ENC_CURLY_CLOSE_RE, "}").replace(ENC_CARET_RE, "^");
}
function encodeQueryKey(text2) {
  return encodeQueryValue(text2).replace(EQUAL_RE, "%3D");
}
function encodePath(text2) {
  return commonEncode(text2).replace(HASH_RE, "%23").replace(IM_RE, "%3F");
}
function encodeParam(text2) {
  return text2 == null ? "" : encodePath(text2).replace(SLASH_RE, "%2F");
}
function decode(text2) {
  try {
    return decodeURIComponent("" + text2);
  } catch (err) {
  }
  return "" + text2;
}
const TRAILING_SLASH_RE = /\/$/;
const removeTrailingSlash = (path2) => path2.replace(TRAILING_SLASH_RE, "");
function parseURL(parseQuery2, location2, currentLocation = "/") {
  let path2, query = {}, searchString = "", hash2 = "";
  const hashPos = location2.indexOf("#");
  let searchPos = location2.indexOf("?");
  if (hashPos < searchPos && hashPos >= 0) {
    searchPos = -1;
  }
  if (searchPos > -1) {
    path2 = location2.slice(0, searchPos);
    searchString = location2.slice(searchPos + 1, hashPos > -1 ? hashPos : location2.length);
    query = parseQuery2(searchString);
  }
  if (hashPos > -1) {
    path2 = path2 || location2.slice(0, hashPos);
    hash2 = location2.slice(hashPos, location2.length);
  }
  path2 = resolveRelativePath(path2 != null ? path2 : location2, currentLocation);
  return {
    fullPath: path2 + (searchString && "?") + searchString + hash2,
    path: path2,
    query,
    hash: decode(hash2)
  };
}
function stringifyURL(stringifyQuery2, location2) {
  const query = location2.query ? stringifyQuery2(location2.query) : "";
  return location2.path + (query && "?") + query + (location2.hash || "");
}
function stripBase(pathname, base2) {
  if (!base2 || !pathname.toLowerCase().startsWith(base2.toLowerCase()))
    return pathname;
  return pathname.slice(base2.length) || "/";
}
function isSameRouteLocation(stringifyQuery2, a2, b2) {
  const aLastIndex = a2.matched.length - 1;
  const bLastIndex = b2.matched.length - 1;
  return aLastIndex > -1 && aLastIndex === bLastIndex && isSameRouteRecord(a2.matched[aLastIndex], b2.matched[bLastIndex]) && isSameRouteLocationParams(a2.params, b2.params) && stringifyQuery2(a2.query) === stringifyQuery2(b2.query) && a2.hash === b2.hash;
}
function isSameRouteRecord(a2, b2) {
  return (a2.aliasOf || a2) === (b2.aliasOf || b2);
}
function isSameRouteLocationParams(a2, b2) {
  if (Object.keys(a2).length !== Object.keys(b2).length)
    return false;
  for (const key2 in a2) {
    if (!isSameRouteLocationParamsValue(a2[key2], b2[key2]))
      return false;
  }
  return true;
}
function isSameRouteLocationParamsValue(a2, b2) {
  return isArray$2(a2) ? isEquivalentArray(a2, b2) : isArray$2(b2) ? isEquivalentArray(b2, a2) : a2 === b2;
}
function isEquivalentArray(a2, b2) {
  return isArray$2(b2) ? a2.length === b2.length && a2.every((value, i2) => value === b2[i2]) : a2.length === 1 && a2[0] === b2;
}
function resolveRelativePath(to2, from) {
  if (to2.startsWith("/"))
    return to2;
  if (!to2)
    return from;
  const fromSegments = from.split("/");
  const toSegments = to2.split("/");
  const lastToSegment = toSegments[toSegments.length - 1];
  if (lastToSegment === ".." || lastToSegment === ".") {
    toSegments.push("");
  }
  let position2 = fromSegments.length - 1;
  let toPosition;
  let segment;
  for (toPosition = 0; toPosition < toSegments.length; toPosition++) {
    segment = toSegments[toPosition];
    if (segment === ".")
      continue;
    if (segment === "..") {
      if (position2 > 1)
        position2--;
    } else
      break;
  }
  return fromSegments.slice(0, position2).join("/") + "/" + toSegments.slice(toPosition).join("/");
}
var NavigationType;
(function(NavigationType2) {
  NavigationType2["pop"] = "pop";
  NavigationType2["push"] = "push";
})(NavigationType || (NavigationType = {}));
var NavigationDirection;
(function(NavigationDirection2) {
  NavigationDirection2["back"] = "back";
  NavigationDirection2["forward"] = "forward";
  NavigationDirection2["unknown"] = "";
})(NavigationDirection || (NavigationDirection = {}));
const START = "";
function normalizeBase(base2) {
  if (!base2) {
    if (isBrowser) {
      const baseEl = document.querySelector("base");
      base2 = baseEl && baseEl.getAttribute("href") || "/";
      base2 = base2.replace(/^\w+:\/\/[^\/]+/, "");
    } else {
      base2 = "/";
    }
  }
  if (base2[0] !== "/" && base2[0] !== "#")
    base2 = "/" + base2;
  return removeTrailingSlash(base2);
}
const BEFORE_HASH_RE = /^[^#]+#/;
function createHref(base2, location2) {
  return base2.replace(BEFORE_HASH_RE, "#") + location2;
}
function getElementPosition(el, offset2) {
  const docRect = document.documentElement.getBoundingClientRect();
  const elRect = el.getBoundingClientRect();
  return {
    behavior: offset2.behavior,
    left: elRect.left - docRect.left - (offset2.left || 0),
    top: elRect.top - docRect.top - (offset2.top || 0)
  };
}
const computeScrollPosition = () => ({
  left: window.scrollX,
  top: window.scrollY
});
function scrollToPosition(position2) {
  let scrollToOptions;
  if ("el" in position2) {
    const positionEl = position2.el;
    const isIdSelector = typeof positionEl === "string" && positionEl.startsWith("#");
    const el = typeof positionEl === "string" ? isIdSelector ? document.getElementById(positionEl.slice(1)) : document.querySelector(positionEl) : positionEl;
    if (!el) {
      return;
    }
    scrollToOptions = getElementPosition(el, position2);
  } else {
    scrollToOptions = position2;
  }
  if ("scrollBehavior" in document.documentElement.style)
    window.scrollTo(scrollToOptions);
  else {
    window.scrollTo(scrollToOptions.left != null ? scrollToOptions.left : window.scrollX, scrollToOptions.top != null ? scrollToOptions.top : window.scrollY);
  }
}
function getScrollKey(path2, delta) {
  const position2 = history.state ? history.state.position - delta : -1;
  return position2 + path2;
}
const scrollPositions = /* @__PURE__ */ new Map();
function saveScrollPosition(key2, scrollPosition) {
  scrollPositions.set(key2, scrollPosition);
}
function getSavedScrollPosition(key2) {
  const scroll = scrollPositions.get(key2);
  scrollPositions.delete(key2);
  return scroll;
}
let createBaseLocation = () => location.protocol + "//" + location.host;
function createCurrentLocation(base2, location2) {
  const { pathname, search: search2, hash: hash2 } = location2;
  const hashPos = base2.indexOf("#");
  if (hashPos > -1) {
    let slicePos = hash2.includes(base2.slice(hashPos)) ? base2.slice(hashPos).length : 1;
    let pathFromHash = hash2.slice(slicePos);
    if (pathFromHash[0] !== "/")
      pathFromHash = "/" + pathFromHash;
    return stripBase(pathFromHash, "");
  }
  const path2 = stripBase(pathname, base2);
  return path2 + search2 + hash2;
}
function useHistoryListeners(base2, historyState, currentLocation, replace) {
  let listeners = [];
  let teardowns = [];
  let pauseState = null;
  const popStateHandler = ({ state }) => {
    const to2 = createCurrentLocation(base2, location);
    const from = currentLocation.value;
    const fromState = historyState.value;
    let delta = 0;
    if (state) {
      currentLocation.value = to2;
      historyState.value = state;
      if (pauseState && pauseState === from) {
        pauseState = null;
        return;
      }
      delta = fromState ? state.position - fromState.position : 0;
    } else {
      replace(to2);
    }
    listeners.forEach((listener) => {
      listener(currentLocation.value, from, {
        delta,
        type: NavigationType.pop,
        direction: delta ? delta > 0 ? NavigationDirection.forward : NavigationDirection.back : NavigationDirection.unknown
      });
    });
  };
  function pauseListeners() {
    pauseState = currentLocation.value;
  }
  function listen(callback) {
    listeners.push(callback);
    const teardown = () => {
      const index2 = listeners.indexOf(callback);
      if (index2 > -1)
        listeners.splice(index2, 1);
    };
    teardowns.push(teardown);
    return teardown;
  }
  function beforeUnloadListener() {
    const { history: history2 } = window;
    if (!history2.state)
      return;
    history2.replaceState(assign$1({}, history2.state, { scroll: computeScrollPosition() }), "");
  }
  function destroy() {
    for (const teardown of teardowns)
      teardown();
    teardowns = [];
    window.removeEventListener("popstate", popStateHandler);
    window.removeEventListener("beforeunload", beforeUnloadListener);
  }
  window.addEventListener("popstate", popStateHandler);
  window.addEventListener("beforeunload", beforeUnloadListener, {
    passive: true
  });
  return {
    pauseListeners,
    listen,
    destroy
  };
}
function buildState(back, current, forward, replaced = false, computeScroll = false) {
  return {
    back,
    current,
    forward,
    replaced,
    position: window.history.length,
    scroll: computeScroll ? computeScrollPosition() : null
  };
}
function useHistoryStateNavigation(base2) {
  const { history: history2, location: location2 } = window;
  const currentLocation = {
    value: createCurrentLocation(base2, location2)
  };
  const historyState = { value: history2.state };
  if (!historyState.value) {
    changeLocation(currentLocation.value, {
      back: null,
      current: currentLocation.value,
      forward: null,
      // the length is off by one, we need to decrease it
      position: history2.length - 1,
      replaced: true,
      // don't add a scroll as the user may have an anchor, and we want
      // scrollBehavior to be triggered without a saved position
      scroll: null
    }, true);
  }
  function changeLocation(to2, state, replace2) {
    const hashIndex = base2.indexOf("#");
    const url = hashIndex > -1 ? (location2.host && document.querySelector("base") ? base2 : base2.slice(hashIndex)) + to2 : createBaseLocation() + base2 + to2;
    try {
      history2[replace2 ? "replaceState" : "pushState"](state, "", url);
      historyState.value = state;
    } catch (err) {
      {
        console.error(err);
      }
      location2[replace2 ? "replace" : "assign"](url);
    }
  }
  function replace(to2, data) {
    const state = assign$1({}, history2.state, buildState(
      historyState.value.back,
      // keep back and forward entries but override current position
      to2,
      historyState.value.forward,
      true
    ), data, { position: historyState.value.position });
    changeLocation(to2, state, true);
    currentLocation.value = to2;
  }
  function push(to2, data) {
    const currentState = assign$1(
      {},
      // use current history state to gracefully handle a wrong call to
      // history.replaceState
      // https://github.com/vuejs/router/issues/366
      historyState.value,
      history2.state,
      {
        forward: to2,
        scroll: computeScrollPosition()
      }
    );
    changeLocation(currentState.current, currentState, true);
    const state = assign$1({}, buildState(currentLocation.value, to2, null), { position: currentState.position + 1 }, data);
    changeLocation(to2, state, false);
    currentLocation.value = to2;
  }
  return {
    location: currentLocation,
    state: historyState,
    push,
    replace
  };
}
function createWebHistory(base2) {
  base2 = normalizeBase(base2);
  const historyNavigation = useHistoryStateNavigation(base2);
  const historyListeners = useHistoryListeners(base2, historyNavigation.state, historyNavigation.location, historyNavigation.replace);
  function go2(delta, triggerListeners = true) {
    if (!triggerListeners)
      historyListeners.pauseListeners();
    history.go(delta);
  }
  const routerHistory = assign$1({
    // it's overridden right after
    location: "",
    base: base2,
    go: go2,
    createHref: createHref.bind(null, base2)
  }, historyNavigation, historyListeners);
  Object.defineProperty(routerHistory, "location", {
    enumerable: true,
    get: () => historyNavigation.location.value
  });
  Object.defineProperty(routerHistory, "state", {
    enumerable: true,
    get: () => historyNavigation.state.value
  });
  return routerHistory;
}
function createMemoryHistory(base2 = "") {
  let listeners = [];
  let queue2 = [START];
  let position2 = 0;
  base2 = normalizeBase(base2);
  function setLocation(location2) {
    position2++;
    if (position2 !== queue2.length) {
      queue2.splice(position2);
    }
    queue2.push(location2);
  }
  function triggerListeners(to2, from, { direction, delta }) {
    const info = {
      direction,
      delta,
      type: NavigationType.pop
    };
    for (const callback of listeners) {
      callback(to2, from, info);
    }
  }
  const routerHistory = {
    // rewritten by Object.defineProperty
    location: START,
    // TODO: should be kept in queue
    state: {},
    base: base2,
    createHref: createHref.bind(null, base2),
    replace(to2) {
      queue2.splice(position2--, 1);
      setLocation(to2);
    },
    push(to2, data) {
      setLocation(to2);
    },
    listen(callback) {
      listeners.push(callback);
      return () => {
        const index2 = listeners.indexOf(callback);
        if (index2 > -1)
          listeners.splice(index2, 1);
      };
    },
    destroy() {
      listeners = [];
      queue2 = [START];
      position2 = 0;
    },
    go(delta, shouldTrigger = true) {
      const from = this.location;
      const direction = (
        // we are considering delta === 0 going forward, but in abstract mode
        // using 0 for the delta doesn't make sense like it does in html5 where
        // it reloads the page
        delta < 0 ? NavigationDirection.back : NavigationDirection.forward
      );
      position2 = Math.max(0, Math.min(position2 + delta, queue2.length - 1));
      if (shouldTrigger) {
        triggerListeners(this.location, from, {
          direction,
          delta
        });
      }
    }
  };
  Object.defineProperty(routerHistory, "location", {
    enumerable: true,
    get: () => queue2[position2]
  });
  return routerHistory;
}
function isRouteLocation(route) {
  return typeof route === "string" || route && typeof route === "object";
}
function isRouteName(name2) {
  return typeof name2 === "string" || typeof name2 === "symbol";
}
const START_LOCATION_NORMALIZED = {
  path: "/",
  name: void 0,
  params: {},
  query: {},
  hash: "",
  fullPath: "/",
  matched: [],
  meta: {},
  redirectedFrom: void 0
};
const NavigationFailureSymbol = Symbol("");
var NavigationFailureType;
(function(NavigationFailureType2) {
  NavigationFailureType2[NavigationFailureType2["aborted"] = 4] = "aborted";
  NavigationFailureType2[NavigationFailureType2["cancelled"] = 8] = "cancelled";
  NavigationFailureType2[NavigationFailureType2["duplicated"] = 16] = "duplicated";
})(NavigationFailureType || (NavigationFailureType = {}));
function createRouterError(type2, params) {
  {
    return assign$1(new Error(), {
      type: type2,
      [NavigationFailureSymbol]: true
    }, params);
  }
}
function isNavigationFailure(error2, type2) {
  return error2 instanceof Error && NavigationFailureSymbol in error2 && (type2 == null || !!(error2.type & type2));
}
const BASE_PARAM_PATTERN = "[^/]+?";
const BASE_PATH_PARSER_OPTIONS = {
  sensitive: false,
  strict: false,
  start: true,
  end: true
};
const REGEX_CHARS_RE = /[.+*?^${}()[\]/\\]/g;
function tokensToParser(segments, extraOptions) {
  const options = assign$1({}, BASE_PATH_PARSER_OPTIONS, extraOptions);
  const score2 = [];
  let pattern = options.start ? "^" : "";
  const keys2 = [];
  for (const segment of segments) {
    const segmentScores = segment.length ? [] : [
      90
      /* PathScore.Root */
    ];
    if (options.strict && !segment.length)
      pattern += "/";
    for (let tokenIndex = 0; tokenIndex < segment.length; tokenIndex++) {
      const token = segment[tokenIndex];
      let subSegmentScore = 40 + (options.sensitive ? 0.25 : 0);
      if (token.type === 0) {
        if (!tokenIndex)
          pattern += "/";
        pattern += token.value.replace(REGEX_CHARS_RE, "\\$&");
        subSegmentScore += 40;
      } else if (token.type === 1) {
        const { value, repeatable, optional: optional2, regexp } = token;
        keys2.push({
          name: value,
          repeatable,
          optional: optional2
        });
        const re22 = regexp ? regexp : BASE_PARAM_PATTERN;
        if (re22 !== BASE_PARAM_PATTERN) {
          subSegmentScore += 10;
          try {
            new RegExp(`(${re22})`);
          } catch (err) {
            throw new Error(`Invalid custom RegExp for param "${value}" (${re22}): ` + err.message);
          }
        }
        let subPattern = repeatable ? `((?:${re22})(?:/(?:${re22}))*)` : `(${re22})`;
        if (!tokenIndex)
          subPattern = // avoid an optional / if there are more segments e.g. /:p?-static
          // or /:p?-:p2
          optional2 && segment.length < 2 ? `(?:/${subPattern})` : "/" + subPattern;
        if (optional2)
          subPattern += "?";
        pattern += subPattern;
        subSegmentScore += 20;
        if (optional2)
          subSegmentScore += -8;
        if (repeatable)
          subSegmentScore += -20;
        if (re22 === ".*")
          subSegmentScore += -50;
      }
      segmentScores.push(subSegmentScore);
    }
    score2.push(segmentScores);
  }
  if (options.strict && options.end) {
    const i2 = score2.length - 1;
    score2[i2][score2[i2].length - 1] += 0.7000000000000001;
  }
  if (!options.strict)
    pattern += "/?";
  if (options.end)
    pattern += "$";
  else if (options.strict)
    pattern += "(?:/|$)";
  const re2 = new RegExp(pattern, options.sensitive ? "" : "i");
  function parse3(path2) {
    const match = path2.match(re2);
    const params = {};
    if (!match)
      return null;
    for (let i2 = 1; i2 < match.length; i2++) {
      const value = match[i2] || "";
      const key2 = keys2[i2 - 1];
      params[key2.name] = value && key2.repeatable ? value.split("/") : value;
    }
    return params;
  }
  function stringify2(params) {
    let path2 = "";
    let avoidDuplicatedSlash = false;
    for (const segment of segments) {
      if (!avoidDuplicatedSlash || !path2.endsWith("/"))
        path2 += "/";
      avoidDuplicatedSlash = false;
      for (const token of segment) {
        if (token.type === 0) {
          path2 += token.value;
        } else if (token.type === 1) {
          const { value, repeatable, optional: optional2 } = token;
          const param = value in params ? params[value] : "";
          if (isArray$2(param) && !repeatable) {
            throw new Error(`Provided param "${value}" is an array but it is not repeatable (* or + modifiers)`);
          }
          const text2 = isArray$2(param) ? param.join("/") : param;
          if (!text2) {
            if (optional2) {
              if (segment.length < 2) {
                if (path2.endsWith("/"))
                  path2 = path2.slice(0, -1);
                else
                  avoidDuplicatedSlash = true;
              }
            } else
              throw new Error(`Missing required param "${value}"`);
          }
          path2 += text2;
        }
      }
    }
    return path2 || "/";
  }
  return {
    re: re2,
    score: score2,
    keys: keys2,
    parse: parse3,
    stringify: stringify2
  };
}
function compareScoreArray(a2, b2) {
  let i2 = 0;
  while (i2 < a2.length && i2 < b2.length) {
    const diff2 = b2[i2] - a2[i2];
    if (diff2)
      return diff2;
    i2++;
  }
  if (a2.length < b2.length) {
    return a2.length === 1 && a2[0] === 40 + 40 ? -1 : 1;
  } else if (a2.length > b2.length) {
    return b2.length === 1 && b2[0] === 40 + 40 ? 1 : -1;
  }
  return 0;
}
function comparePathParserScore(a2, b2) {
  let i2 = 0;
  const aScore = a2.score;
  const bScore = b2.score;
  while (i2 < aScore.length && i2 < bScore.length) {
    const comp = compareScoreArray(aScore[i2], bScore[i2]);
    if (comp)
      return comp;
    i2++;
  }
  if (Math.abs(bScore.length - aScore.length) === 1) {
    if (isLastScoreNegative(aScore))
      return 1;
    if (isLastScoreNegative(bScore))
      return -1;
  }
  return bScore.length - aScore.length;
}
function isLastScoreNegative(score2) {
  const last = score2[score2.length - 1];
  return score2.length > 0 && last[last.length - 1] < 0;
}
const ROOT_TOKEN = {
  type: 0,
  value: ""
};
const VALID_PARAM_RE = /[a-zA-Z0-9_]/;
function tokenizePath(path2) {
  if (!path2)
    return [[]];
  if (path2 === "/")
    return [[ROOT_TOKEN]];
  if (!path2.startsWith("/")) {
    throw new Error(`Invalid path "${path2}"`);
  }
  function crash(message) {
    throw new Error(`ERR (${state})/"${buffer}": ${message}`);
  }
  let state = 0;
  let previousState = state;
  const tokens = [];
  let segment;
  function finalizeSegment() {
    if (segment)
      tokens.push(segment);
    segment = [];
  }
  let i2 = 0;
  let char;
  let buffer = "";
  let customRe = "";
  function consumeBuffer() {
    if (!buffer)
      return;
    if (state === 0) {
      segment.push({
        type: 0,
        value: buffer
      });
    } else if (state === 1 || state === 2 || state === 3) {
      if (segment.length > 1 && (char === "*" || char === "+"))
        crash(`A repeatable param (${buffer}) must be alone in its segment. eg: '/:ids+.`);
      segment.push({
        type: 1,
        value: buffer,
        regexp: customRe,
        repeatable: char === "*" || char === "+",
        optional: char === "*" || char === "?"
      });
    } else {
      crash("Invalid state to consume buffer");
    }
    buffer = "";
  }
  function addCharToBuffer() {
    buffer += char;
  }
  while (i2 < path2.length) {
    char = path2[i2++];
    if (char === "\\" && state !== 2) {
      previousState = state;
      state = 4;
      continue;
    }
    switch (state) {
      case 0:
        if (char === "/") {
          if (buffer) {
            consumeBuffer();
          }
          finalizeSegment();
        } else if (char === ":") {
          consumeBuffer();
          state = 1;
        } else {
          addCharToBuffer();
        }
        break;
      case 4:
        addCharToBuffer();
        state = previousState;
        break;
      case 1:
        if (char === "(") {
          state = 2;
        } else if (VALID_PARAM_RE.test(char)) {
          addCharToBuffer();
        } else {
          consumeBuffer();
          state = 0;
          if (char !== "*" && char !== "?" && char !== "+")
            i2--;
        }
        break;
      case 2:
        if (char === ")") {
          if (customRe[customRe.length - 1] == "\\")
            customRe = customRe.slice(0, -1) + char;
          else
            state = 3;
        } else {
          customRe += char;
        }
        break;
      case 3:
        consumeBuffer();
        state = 0;
        if (char !== "*" && char !== "?" && char !== "+")
          i2--;
        customRe = "";
        break;
      default:
        crash("Unknown state");
        break;
    }
  }
  if (state === 2)
    crash(`Unfinished custom RegExp for param "${buffer}"`);
  consumeBuffer();
  finalizeSegment();
  return tokens;
}
function createRouteRecordMatcher(record, parent, options) {
  const parser2 = tokensToParser(tokenizePath(record.path), options);
  const matcher = assign$1(parser2, {
    record,
    parent,
    // these needs to be populated by the parent
    children: [],
    alias: []
  });
  if (parent) {
    if (!matcher.record.aliasOf === !parent.record.aliasOf)
      parent.children.push(matcher);
  }
  return matcher;
}
function createRouterMatcher(routes2, globalOptions) {
  const matchers = [];
  const matcherMap = /* @__PURE__ */ new Map();
  globalOptions = mergeOptions({ strict: false, end: true, sensitive: false }, globalOptions);
  function getRecordMatcher(name2) {
    return matcherMap.get(name2);
  }
  function addRoute(record, parent, originalRecord) {
    const isRootAdd = !originalRecord;
    const mainNormalizedRecord = normalizeRouteRecord(record);
    mainNormalizedRecord.aliasOf = originalRecord && originalRecord.record;
    const options = mergeOptions(globalOptions, record);
    const normalizedRecords = [
      mainNormalizedRecord
    ];
    if ("alias" in record) {
      const aliases = typeof record.alias === "string" ? [record.alias] : record.alias;
      for (const alias of aliases) {
        normalizedRecords.push(assign$1({}, mainNormalizedRecord, {
          // this allows us to hold a copy of the `components` option
          // so that async components cache is hold on the original record
          components: originalRecord ? originalRecord.record.components : mainNormalizedRecord.components,
          path: alias,
          // we might be the child of an alias
          aliasOf: originalRecord ? originalRecord.record : mainNormalizedRecord
          // the aliases are always of the same kind as the original since they
          // are defined on the same record
        }));
      }
    }
    let matcher;
    let originalMatcher;
    for (const normalizedRecord of normalizedRecords) {
      const { path: path2 } = normalizedRecord;
      if (parent && path2[0] !== "/") {
        const parentPath = parent.record.path;
        const connectingSlash = parentPath[parentPath.length - 1] === "/" ? "" : "/";
        normalizedRecord.path = parent.record.path + (path2 && connectingSlash + path2);
      }
      matcher = createRouteRecordMatcher(normalizedRecord, parent, options);
      if (originalRecord) {
        originalRecord.alias.push(matcher);
      } else {
        originalMatcher = originalMatcher || matcher;
        if (originalMatcher !== matcher)
          originalMatcher.alias.push(matcher);
        if (isRootAdd && record.name && !isAliasRecord(matcher))
          removeRoute(record.name);
      }
      if (isMatchable(matcher)) {
        insertMatcher(matcher);
      }
      if (mainNormalizedRecord.children) {
        const children = mainNormalizedRecord.children;
        for (let i2 = 0; i2 < children.length; i2++) {
          addRoute(children[i2], matcher, originalRecord && originalRecord.children[i2]);
        }
      }
      originalRecord = originalRecord || matcher;
    }
    return originalMatcher ? () => {
      removeRoute(originalMatcher);
    } : noop$1;
  }
  function removeRoute(matcherRef) {
    if (isRouteName(matcherRef)) {
      const matcher = matcherMap.get(matcherRef);
      if (matcher) {
        matcherMap.delete(matcherRef);
        matchers.splice(matchers.indexOf(matcher), 1);
        matcher.children.forEach(removeRoute);
        matcher.alias.forEach(removeRoute);
      }
    } else {
      const index2 = matchers.indexOf(matcherRef);
      if (index2 > -1) {
        matchers.splice(index2, 1);
        if (matcherRef.record.name)
          matcherMap.delete(matcherRef.record.name);
        matcherRef.children.forEach(removeRoute);
        matcherRef.alias.forEach(removeRoute);
      }
    }
  }
  function getRoutes() {
    return matchers;
  }
  function insertMatcher(matcher) {
    const index2 = findInsertionIndex(matcher, matchers);
    matchers.splice(index2, 0, matcher);
    if (matcher.record.name && !isAliasRecord(matcher))
      matcherMap.set(matcher.record.name, matcher);
  }
  function resolve2(location2, currentLocation) {
    let matcher;
    let params = {};
    let path2;
    let name2;
    if ("name" in location2 && location2.name) {
      matcher = matcherMap.get(location2.name);
      if (!matcher)
        throw createRouterError(1, {
          location: location2
        });
      name2 = matcher.record.name;
      params = assign$1(
        // paramsFromLocation is a new object
        paramsFromLocation(
          currentLocation.params,
          // only keep params that exist in the resolved location
          // only keep optional params coming from a parent record
          matcher.keys.filter((k2) => !k2.optional).concat(matcher.parent ? matcher.parent.keys.filter((k2) => k2.optional) : []).map((k2) => k2.name)
        ),
        // discard any existing params in the current location that do not exist here
        // #1497 this ensures better active/exact matching
        location2.params && paramsFromLocation(location2.params, matcher.keys.map((k2) => k2.name))
      );
      path2 = matcher.stringify(params);
    } else if (location2.path != null) {
      path2 = location2.path;
      matcher = matchers.find((m2) => m2.re.test(path2));
      if (matcher) {
        params = matcher.parse(path2);
        name2 = matcher.record.name;
      }
    } else {
      matcher = currentLocation.name ? matcherMap.get(currentLocation.name) : matchers.find((m2) => m2.re.test(currentLocation.path));
      if (!matcher)
        throw createRouterError(1, {
          location: location2,
          currentLocation
        });
      name2 = matcher.record.name;
      params = assign$1({}, currentLocation.params, location2.params);
      path2 = matcher.stringify(params);
    }
    const matched = [];
    let parentMatcher = matcher;
    while (parentMatcher) {
      matched.unshift(parentMatcher.record);
      parentMatcher = parentMatcher.parent;
    }
    return {
      name: name2,
      path: path2,
      params,
      matched,
      meta: mergeMetaFields(matched)
    };
  }
  routes2.forEach((route) => addRoute(route));
  return { addRoute, resolve: resolve2, removeRoute, getRoutes, getRecordMatcher };
}
function paramsFromLocation(params, keys2) {
  const newParams = {};
  for (const key2 of keys2) {
    if (key2 in params)
      newParams[key2] = params[key2];
  }
  return newParams;
}
function normalizeRouteRecord(record) {
  return {
    path: record.path,
    redirect: record.redirect,
    name: record.name,
    meta: record.meta || {},
    aliasOf: void 0,
    beforeEnter: record.beforeEnter,
    props: normalizeRecordProps(record),
    children: record.children || [],
    instances: {},
    leaveGuards: /* @__PURE__ */ new Set(),
    updateGuards: /* @__PURE__ */ new Set(),
    enterCallbacks: {},
    components: "components" in record ? record.components || null : record.component && { default: record.component }
  };
}
function normalizeRecordProps(record) {
  const propsObject = {};
  const props = record.props || false;
  if ("component" in record) {
    propsObject.default = props;
  } else {
    for (const name2 in record.components)
      propsObject[name2] = typeof props === "object" ? props[name2] : props;
  }
  return propsObject;
}
function isAliasRecord(record) {
  while (record) {
    if (record.record.aliasOf)
      return true;
    record = record.parent;
  }
  return false;
}
function mergeMetaFields(matched) {
  return matched.reduce((meta2, record) => assign$1(meta2, record.meta), {});
}
function mergeOptions(defaults2, partialOptions) {
  const options = {};
  for (const key2 in defaults2) {
    options[key2] = key2 in partialOptions ? partialOptions[key2] : defaults2[key2];
  }
  return options;
}
function findInsertionIndex(matcher, matchers) {
  let lower = 0;
  let upper = matchers.length;
  while (lower !== upper) {
    const mid = lower + upper >> 1;
    const sortOrder = comparePathParserScore(matcher, matchers[mid]);
    if (sortOrder < 0) {
      upper = mid;
    } else {
      lower = mid + 1;
    }
  }
  const insertionAncestor = getInsertionAncestor(matcher);
  if (insertionAncestor) {
    upper = matchers.lastIndexOf(insertionAncestor, upper - 1);
  }
  return upper;
}
function getInsertionAncestor(matcher) {
  let ancestor = matcher;
  while (ancestor = ancestor.parent) {
    if (isMatchable(ancestor) && comparePathParserScore(matcher, ancestor) === 0) {
      return ancestor;
    }
  }
  return;
}
function isMatchable({ record }) {
  return !!(record.name || record.components && Object.keys(record.components).length || record.redirect);
}
function parseQuery$1(search2) {
  const query = {};
  if (search2 === "" || search2 === "?")
    return query;
  const hasLeadingIM = search2[0] === "?";
  const searchParams = (hasLeadingIM ? search2.slice(1) : search2).split("&");
  for (let i2 = 0; i2 < searchParams.length; ++i2) {
    const searchParam = searchParams[i2].replace(PLUS_RE, " ");
    const eqPos = searchParam.indexOf("=");
    const key2 = decode(eqPos < 0 ? searchParam : searchParam.slice(0, eqPos));
    const value = eqPos < 0 ? null : decode(searchParam.slice(eqPos + 1));
    if (key2 in query) {
      let currentValue = query[key2];
      if (!isArray$2(currentValue)) {
        currentValue = query[key2] = [currentValue];
      }
      currentValue.push(value);
    } else {
      query[key2] = value;
    }
  }
  return query;
}
function stringifyQuery(query) {
  let search2 = "";
  for (let key2 in query) {
    const value = query[key2];
    key2 = encodeQueryKey(key2);
    if (value == null) {
      if (value !== void 0) {
        search2 += (search2.length ? "&" : "") + key2;
      }
      continue;
    }
    const values2 = isArray$2(value) ? value.map((v2) => v2 && encodeQueryValue(v2)) : [value && encodeQueryValue(value)];
    values2.forEach((value2) => {
      if (value2 !== void 0) {
        search2 += (search2.length ? "&" : "") + key2;
        if (value2 != null)
          search2 += "=" + value2;
      }
    });
  }
  return search2;
}
function normalizeQuery(query) {
  const normalizedQuery = {};
  for (const key2 in query) {
    const value = query[key2];
    if (value !== void 0) {
      normalizedQuery[key2] = isArray$2(value) ? value.map((v2) => v2 == null ? null : "" + v2) : value == null ? value : "" + value;
    }
  }
  return normalizedQuery;
}
const matchedRouteKey = Symbol("");
const viewDepthKey = Symbol("");
const routerKey = Symbol("");
const routeLocationKey = Symbol("");
const routerViewLocationKey = Symbol("");
function useCallbacks() {
  let handlers2 = [];
  function add2(handler) {
    handlers2.push(handler);
    return () => {
      const i2 = handlers2.indexOf(handler);
      if (i2 > -1)
        handlers2.splice(i2, 1);
    };
  }
  function reset() {
    handlers2 = [];
  }
  return {
    add: add2,
    list: () => handlers2.slice(),
    reset
  };
}
function guardToPromiseFn(guard, to2, from, record, name2, runWithContext = (fn) => fn()) {
  const enterCallbackArray = record && // name is defined if record is because of the function overload
  (record.enterCallbacks[name2] = record.enterCallbacks[name2] || []);
  return () => new Promise((resolve2, reject) => {
    const next = (valid2) => {
      if (valid2 === false) {
        reject(createRouterError(4, {
          from,
          to: to2
        }));
      } else if (valid2 instanceof Error) {
        reject(valid2);
      } else if (isRouteLocation(valid2)) {
        reject(createRouterError(2, {
          from: to2,
          to: valid2
        }));
      } else {
        if (enterCallbackArray && // since enterCallbackArray is truthy, both record and name also are
        record.enterCallbacks[name2] === enterCallbackArray && typeof valid2 === "function") {
          enterCallbackArray.push(valid2);
        }
        resolve2();
      }
    };
    const guardReturn = runWithContext(() => guard.call(record && record.instances[name2], to2, from, next));
    let guardCall = Promise.resolve(guardReturn);
    if (guard.length < 3)
      guardCall = guardCall.then(next);
    guardCall.catch((err) => reject(err));
  });
}
function extractComponentsGuards(matched, guardType, to2, from, runWithContext = (fn) => fn()) {
  const guards = [];
  for (const record of matched) {
    for (const name2 in record.components) {
      let rawComponent = record.components[name2];
      if (guardType !== "beforeRouteEnter" && !record.instances[name2])
        continue;
      if (isRouteComponent(rawComponent)) {
        const options = rawComponent.__vccOpts || rawComponent;
        const guard = options[guardType];
        guard && guards.push(guardToPromiseFn(guard, to2, from, record, name2, runWithContext));
      } else {
        let componentPromise = rawComponent();
        guards.push(() => componentPromise.then((resolved) => {
          if (!resolved)
            return Promise.reject(new Error(`Couldn't resolve component "${name2}" at "${record.path}"`));
          const resolvedComponent = isESModule(resolved) ? resolved.default : resolved;
          record.components[name2] = resolvedComponent;
          const options = resolvedComponent.__vccOpts || resolvedComponent;
          const guard = options[guardType];
          return guard && guardToPromiseFn(guard, to2, from, record, name2, runWithContext)();
        }));
      }
    }
  }
  return guards;
}
function isRouteComponent(component) {
  return typeof component === "object" || "displayName" in component || "props" in component || "__vccOpts" in component;
}
function useLink(props) {
  const router2 = inject(routerKey);
  const currentRoute = inject(routeLocationKey);
  const route = computed(() => {
    const to2 = unref(props.to);
    return router2.resolve(to2);
  });
  const activeRecordIndex = computed(() => {
    const { matched } = route.value;
    const { length } = matched;
    const routeMatched = matched[length - 1];
    const currentMatched = currentRoute.matched;
    if (!routeMatched || !currentMatched.length)
      return -1;
    const index2 = currentMatched.findIndex(isSameRouteRecord.bind(null, routeMatched));
    if (index2 > -1)
      return index2;
    const parentRecordPath = getOriginalPath(matched[length - 2]);
    return (
      // we are dealing with nested routes
      length > 1 && // if the parent and matched route have the same path, this link is
      // referring to the empty child. Or we currently are on a different
      // child of the same parent
      getOriginalPath(routeMatched) === parentRecordPath && // avoid comparing the child with its parent
      currentMatched[currentMatched.length - 1].path !== parentRecordPath ? currentMatched.findIndex(isSameRouteRecord.bind(null, matched[length - 2])) : index2
    );
  });
  const isActive = computed(() => activeRecordIndex.value > -1 && includesParams(currentRoute.params, route.value.params));
  const isExactActive = computed(() => activeRecordIndex.value > -1 && activeRecordIndex.value === currentRoute.matched.length - 1 && isSameRouteLocationParams(currentRoute.params, route.value.params));
  function navigate(e2 = {}) {
    if (guardEvent(e2)) {
      return router2[unref(props.replace) ? "replace" : "push"](
        unref(props.to)
        // avoid uncaught errors are they are logged anyway
      ).catch(noop$1);
    }
    return Promise.resolve();
  }
  return {
    route,
    href: computed(() => route.value.href),
    isActive,
    isExactActive,
    navigate
  };
}
const RouterLinkImpl = /* @__PURE__ */ defineComponent({
  name: "RouterLink",
  compatConfig: { MODE: 3 },
  props: {
    to: {
      type: [String, Object],
      required: true
    },
    replace: Boolean,
    activeClass: String,
    // inactiveClass: String,
    exactActiveClass: String,
    custom: Boolean,
    ariaCurrentValue: {
      type: String,
      default: "page"
    }
  },
  useLink,
  setup(props, { slots }) {
    const link = reactive(useLink(props));
    const { options } = inject(routerKey);
    const elClass = computed(() => ({
      [getLinkClass(props.activeClass, options.linkActiveClass, "router-link-active")]: link.isActive,
      // [getLinkClass(
      //   props.inactiveClass,
      //   options.linkInactiveClass,
      //   'router-link-inactive'
      // )]: !link.isExactActive,
      [getLinkClass(props.exactActiveClass, options.linkExactActiveClass, "router-link-exact-active")]: link.isExactActive
    }));
    return () => {
      const children = slots.default && slots.default(link);
      return props.custom ? children : h$9("a", {
        "aria-current": link.isExactActive ? props.ariaCurrentValue : null,
        href: link.href,
        // this would override user added attrs but Vue will still add
        // the listener, so we end up triggering both
        onClick: link.navigate,
        class: elClass.value
      }, children);
    };
  }
});
const RouterLink = RouterLinkImpl;
function guardEvent(e2) {
  if (e2.metaKey || e2.altKey || e2.ctrlKey || e2.shiftKey)
    return;
  if (e2.defaultPrevented)
    return;
  if (e2.button !== void 0 && e2.button !== 0)
    return;
  if (e2.currentTarget && e2.currentTarget.getAttribute) {
    const target = e2.currentTarget.getAttribute("target");
    if (/\b_blank\b/i.test(target))
      return;
  }
  if (e2.preventDefault)
    e2.preventDefault();
  return true;
}
function includesParams(outer, inner) {
  for (const key2 in inner) {
    const innerValue = inner[key2];
    const outerValue = outer[key2];
    if (typeof innerValue === "string") {
      if (innerValue !== outerValue)
        return false;
    } else {
      if (!isArray$2(outerValue) || outerValue.length !== innerValue.length || innerValue.some((value, i2) => value !== outerValue[i2]))
        return false;
    }
  }
  return true;
}
function getOriginalPath(record) {
  return record ? record.aliasOf ? record.aliasOf.path : record.path : "";
}
const getLinkClass = (propClass, globalClass, defaultClass) => propClass != null ? propClass : globalClass != null ? globalClass : defaultClass;
const RouterViewImpl = /* @__PURE__ */ defineComponent({
  name: "RouterView",
  // #674 we manually inherit them
  inheritAttrs: false,
  props: {
    name: {
      type: String,
      default: "default"
    },
    route: Object
  },
  // Better compat for @vue/compat users
  // https://github.com/vuejs/router/issues/1315
  compatConfig: { MODE: 3 },
  setup(props, { attrs, slots }) {
    const injectedRoute = inject(routerViewLocationKey);
    const routeToDisplay = computed(() => props.route || injectedRoute.value);
    const injectedDepth = inject(viewDepthKey, 0);
    const depth = computed(() => {
      let initialDepth = unref(injectedDepth);
      const { matched } = routeToDisplay.value;
      let matchedRoute;
      while ((matchedRoute = matched[initialDepth]) && !matchedRoute.components) {
        initialDepth++;
      }
      return initialDepth;
    });
    const matchedRouteRef = computed(() => routeToDisplay.value.matched[depth.value]);
    provide(viewDepthKey, computed(() => depth.value + 1));
    provide(matchedRouteKey, matchedRouteRef);
    provide(routerViewLocationKey, routeToDisplay);
    const viewRef = ref();
    watch(() => [viewRef.value, matchedRouteRef.value, props.name], ([instance, to2, name2], [oldInstance, from, oldName]) => {
      if (to2) {
        to2.instances[name2] = instance;
        if (from && from !== to2 && instance && instance === oldInstance) {
          if (!to2.leaveGuards.size) {
            to2.leaveGuards = from.leaveGuards;
          }
          if (!to2.updateGuards.size) {
            to2.updateGuards = from.updateGuards;
          }
        }
      }
      if (instance && to2 && // if there is no instance but to and from are the same this might be
      // the first visit
      (!from || !isSameRouteRecord(to2, from) || !oldInstance)) {
        (to2.enterCallbacks[name2] || []).forEach((callback) => callback(instance));
      }
    }, { flush: "post" });
    return () => {
      const route = routeToDisplay.value;
      const currentName = props.name;
      const matchedRoute = matchedRouteRef.value;
      const ViewComponent = matchedRoute && matchedRoute.components[currentName];
      if (!ViewComponent) {
        return normalizeSlot(slots.default, { Component: ViewComponent, route });
      }
      const routePropsOption = matchedRoute.props[currentName];
      const routeProps = routePropsOption ? routePropsOption === true ? route.params : typeof routePropsOption === "function" ? routePropsOption(route) : routePropsOption : null;
      const onVnodeUnmounted = (vnode) => {
        if (vnode.component.isUnmounted) {
          matchedRoute.instances[currentName] = null;
        }
      };
      const component = h$9(ViewComponent, assign$1({}, routeProps, attrs, {
        onVnodeUnmounted,
        ref: viewRef
      }));
      return (
        // pass the vnode to the slot as a prop.
        // h and <component :is="..."> both accept vnodes
        normalizeSlot(slots.default, { Component: component, route }) || component
      );
    };
  }
});
function normalizeSlot(slot, data) {
  if (!slot)
    return null;
  const slotContent = slot(data);
  return slotContent.length === 1 ? slotContent[0] : slotContent;
}
const RouterView = RouterViewImpl;
function createRouter(options) {
  const matcher = createRouterMatcher(options.routes, options);
  const parseQuery$1$1 = options.parseQuery || parseQuery$1;
  const stringifyQuery$1 = options.stringifyQuery || stringifyQuery;
  const routerHistory = options.history;
  const beforeGuards = useCallbacks();
  const beforeResolveGuards = useCallbacks();
  const afterGuards = useCallbacks();
  const currentRoute = shallowRef(START_LOCATION_NORMALIZED);
  let pendingLocation = START_LOCATION_NORMALIZED;
  if (isBrowser && options.scrollBehavior && "scrollRestoration" in history) {
    history.scrollRestoration = "manual";
  }
  const normalizeParams = applyToParams.bind(null, (paramValue) => "" + paramValue);
  const encodeParams = applyToParams.bind(null, encodeParam);
  const decodeParams = (
    // @ts-expect-error: intentionally avoid the type check
    applyToParams.bind(null, decode)
  );
  function addRoute(parentOrRoute, route) {
    let parent;
    let record;
    if (isRouteName(parentOrRoute)) {
      parent = matcher.getRecordMatcher(parentOrRoute);
      record = route;
    } else {
      record = parentOrRoute;
    }
    return matcher.addRoute(record, parent);
  }
  function removeRoute(name2) {
    const recordMatcher = matcher.getRecordMatcher(name2);
    if (recordMatcher) {
      matcher.removeRoute(recordMatcher);
    }
  }
  function getRoutes() {
    return matcher.getRoutes().map((routeMatcher) => routeMatcher.record);
  }
  function hasRoute(name2) {
    return !!matcher.getRecordMatcher(name2);
  }
  function resolve2(rawLocation, currentLocation) {
    currentLocation = assign$1({}, currentLocation || currentRoute.value);
    if (typeof rawLocation === "string") {
      const locationNormalized = parseURL(parseQuery$1$1, rawLocation, currentLocation.path);
      const matchedRoute2 = matcher.resolve({ path: locationNormalized.path }, currentLocation);
      const href2 = routerHistory.createHref(locationNormalized.fullPath);
      return assign$1(locationNormalized, matchedRoute2, {
        params: decodeParams(matchedRoute2.params),
        hash: decode(locationNormalized.hash),
        redirectedFrom: void 0,
        href: href2
      });
    }
    let matcherLocation;
    if (rawLocation.path != null) {
      matcherLocation = assign$1({}, rawLocation, {
        path: parseURL(parseQuery$1$1, rawLocation.path, currentLocation.path).path
      });
    } else {
      const targetParams = assign$1({}, rawLocation.params);
      for (const key2 in targetParams) {
        if (targetParams[key2] == null) {
          delete targetParams[key2];
        }
      }
      matcherLocation = assign$1({}, rawLocation, {
        params: encodeParams(targetParams)
      });
      currentLocation.params = encodeParams(currentLocation.params);
    }
    const matchedRoute = matcher.resolve(matcherLocation, currentLocation);
    const hash2 = rawLocation.hash || "";
    matchedRoute.params = normalizeParams(decodeParams(matchedRoute.params));
    const fullPath = stringifyURL(stringifyQuery$1, assign$1({}, rawLocation, {
      hash: encodeHash(hash2),
      path: matchedRoute.path
    }));
    const href = routerHistory.createHref(fullPath);
    return assign$1({
      fullPath,
      // keep the hash encoded so fullPath is effectively path + encodedQuery +
      // hash
      hash: hash2,
      query: (
        // if the user is using a custom query lib like qs, we might have
        // nested objects, so we keep the query as is, meaning it can contain
        // numbers at `$route.query`, but at the point, the user will have to
        // use their own type anyway.
        // https://github.com/vuejs/router/issues/328#issuecomment-649481567
        stringifyQuery$1 === stringifyQuery ? normalizeQuery(rawLocation.query) : rawLocation.query || {}
      )
    }, matchedRoute, {
      redirectedFrom: void 0,
      href
    });
  }
  function locationAsObject(to2) {
    return typeof to2 === "string" ? parseURL(parseQuery$1$1, to2, currentRoute.value.path) : assign$1({}, to2);
  }
  function checkCanceledNavigation(to2, from) {
    if (pendingLocation !== to2) {
      return createRouterError(8, {
        from,
        to: to2
      });
    }
  }
  function push(to2) {
    return pushWithRedirect(to2);
  }
  function replace(to2) {
    return push(assign$1(locationAsObject(to2), { replace: true }));
  }
  function handleRedirectRecord(to2) {
    const lastMatched = to2.matched[to2.matched.length - 1];
    if (lastMatched && lastMatched.redirect) {
      const { redirect } = lastMatched;
      let newTargetLocation = typeof redirect === "function" ? redirect(to2) : redirect;
      if (typeof newTargetLocation === "string") {
        newTargetLocation = newTargetLocation.includes("?") || newTargetLocation.includes("#") ? newTargetLocation = locationAsObject(newTargetLocation) : (
          // force empty params
          { path: newTargetLocation }
        );
        newTargetLocation.params = {};
      }
      return assign$1({
        query: to2.query,
        hash: to2.hash,
        // avoid transferring params if the redirect has a path
        params: newTargetLocation.path != null ? {} : to2.params
      }, newTargetLocation);
    }
  }
  function pushWithRedirect(to2, redirectedFrom) {
    const targetLocation = pendingLocation = resolve2(to2);
    const from = currentRoute.value;
    const data = to2.state;
    const force = to2.force;
    const replace2 = to2.replace === true;
    const shouldRedirect = handleRedirectRecord(targetLocation);
    if (shouldRedirect)
      return pushWithRedirect(
        assign$1(locationAsObject(shouldRedirect), {
          state: typeof shouldRedirect === "object" ? assign$1({}, data, shouldRedirect.state) : data,
          force,
          replace: replace2
        }),
        // keep original redirectedFrom if it exists
        redirectedFrom || targetLocation
      );
    const toLocation = targetLocation;
    toLocation.redirectedFrom = redirectedFrom;
    let failure;
    if (!force && isSameRouteLocation(stringifyQuery$1, from, targetLocation)) {
      failure = createRouterError(16, { to: toLocation, from });
      handleScroll(
        from,
        from,
        // this is a push, the only way for it to be triggered from a
        // history.listen is with a redirect, which makes it become a push
        true,
        // This cannot be the first navigation because the initial location
        // cannot be manually navigated to
        false
      );
    }
    return (failure ? Promise.resolve(failure) : navigate(toLocation, from)).catch((error2) => isNavigationFailure(error2) ? (
      // navigation redirects still mark the router as ready
      isNavigationFailure(
        error2,
        2
        /* ErrorTypes.NAVIGATION_GUARD_REDIRECT */
      ) ? error2 : markAsReady(error2)
    ) : (
      // reject any unknown error
      triggerError(error2, toLocation, from)
    )).then((failure2) => {
      if (failure2) {
        if (isNavigationFailure(
          failure2,
          2
          /* ErrorTypes.NAVIGATION_GUARD_REDIRECT */
        )) {
          return pushWithRedirect(
            // keep options
            assign$1({
              // preserve an existing replacement but allow the redirect to override it
              replace: replace2
            }, locationAsObject(failure2.to), {
              state: typeof failure2.to === "object" ? assign$1({}, data, failure2.to.state) : data,
              force
            }),
            // preserve the original redirectedFrom if any
            redirectedFrom || toLocation
          );
        }
      } else {
        failure2 = finalizeNavigation(toLocation, from, true, replace2, data);
      }
      triggerAfterEach(toLocation, from, failure2);
      return failure2;
    });
  }
  function checkCanceledNavigationAndReject(to2, from) {
    const error2 = checkCanceledNavigation(to2, from);
    return error2 ? Promise.reject(error2) : Promise.resolve();
  }
  function runWithContext(fn) {
    const app = installedApps.values().next().value;
    return app && typeof app.runWithContext === "function" ? app.runWithContext(fn) : fn();
  }
  function navigate(to2, from) {
    let guards;
    const [leavingRecords, updatingRecords, enteringRecords] = extractChangingRecords(to2, from);
    guards = extractComponentsGuards(leavingRecords.reverse(), "beforeRouteLeave", to2, from);
    for (const record of leavingRecords) {
      record.leaveGuards.forEach((guard) => {
        guards.push(guardToPromiseFn(guard, to2, from));
      });
    }
    const canceledNavigationCheck = checkCanceledNavigationAndReject.bind(null, to2, from);
    guards.push(canceledNavigationCheck);
    return runGuardQueue(guards).then(() => {
      guards = [];
      for (const guard of beforeGuards.list()) {
        guards.push(guardToPromiseFn(guard, to2, from));
      }
      guards.push(canceledNavigationCheck);
      return runGuardQueue(guards);
    }).then(() => {
      guards = extractComponentsGuards(updatingRecords, "beforeRouteUpdate", to2, from);
      for (const record of updatingRecords) {
        record.updateGuards.forEach((guard) => {
          guards.push(guardToPromiseFn(guard, to2, from));
        });
      }
      guards.push(canceledNavigationCheck);
      return runGuardQueue(guards);
    }).then(() => {
      guards = [];
      for (const record of enteringRecords) {
        if (record.beforeEnter) {
          if (isArray$2(record.beforeEnter)) {
            for (const beforeEnter of record.beforeEnter)
              guards.push(guardToPromiseFn(beforeEnter, to2, from));
          } else {
            guards.push(guardToPromiseFn(record.beforeEnter, to2, from));
          }
        }
      }
      guards.push(canceledNavigationCheck);
      return runGuardQueue(guards);
    }).then(() => {
      to2.matched.forEach((record) => record.enterCallbacks = {});
      guards = extractComponentsGuards(enteringRecords, "beforeRouteEnter", to2, from, runWithContext);
      guards.push(canceledNavigationCheck);
      return runGuardQueue(guards);
    }).then(() => {
      guards = [];
      for (const guard of beforeResolveGuards.list()) {
        guards.push(guardToPromiseFn(guard, to2, from));
      }
      guards.push(canceledNavigationCheck);
      return runGuardQueue(guards);
    }).catch((err) => isNavigationFailure(
      err,
      8
      /* ErrorTypes.NAVIGATION_CANCELLED */
    ) ? err : Promise.reject(err));
  }
  function triggerAfterEach(to2, from, failure) {
    afterGuards.list().forEach((guard) => runWithContext(() => guard(to2, from, failure)));
  }
  function finalizeNavigation(toLocation, from, isPush, replace2, data) {
    const error2 = checkCanceledNavigation(toLocation, from);
    if (error2)
      return error2;
    const isFirstNavigation = from === START_LOCATION_NORMALIZED;
    const state = !isBrowser ? {} : history.state;
    if (isPush) {
      if (replace2 || isFirstNavigation)
        routerHistory.replace(toLocation.fullPath, assign$1({
          scroll: isFirstNavigation && state && state.scroll
        }, data));
      else
        routerHistory.push(toLocation.fullPath, data);
    }
    currentRoute.value = toLocation;
    handleScroll(toLocation, from, isPush, isFirstNavigation);
    markAsReady();
  }
  let removeHistoryListener;
  function setupListeners() {
    if (removeHistoryListener)
      return;
    removeHistoryListener = routerHistory.listen((to2, _from, info) => {
      if (!router2.listening)
        return;
      const toLocation = resolve2(to2);
      const shouldRedirect = handleRedirectRecord(toLocation);
      if (shouldRedirect) {
        pushWithRedirect(assign$1(shouldRedirect, { replace: true }), toLocation).catch(noop$1);
        return;
      }
      pendingLocation = toLocation;
      const from = currentRoute.value;
      if (isBrowser) {
        saveScrollPosition(getScrollKey(from.fullPath, info.delta), computeScrollPosition());
      }
      navigate(toLocation, from).catch((error2) => {
        if (isNavigationFailure(
          error2,
          4 | 8
          /* ErrorTypes.NAVIGATION_CANCELLED */
        )) {
          return error2;
        }
        if (isNavigationFailure(
          error2,
          2
          /* ErrorTypes.NAVIGATION_GUARD_REDIRECT */
        )) {
          pushWithRedirect(
            error2.to,
            toLocation
            // avoid an uncaught rejection, let push call triggerError
          ).then((failure) => {
            if (isNavigationFailure(
              failure,
              4 | 16
              /* ErrorTypes.NAVIGATION_DUPLICATED */
            ) && !info.delta && info.type === NavigationType.pop) {
              routerHistory.go(-1, false);
            }
          }).catch(noop$1);
          return Promise.reject();
        }
        if (info.delta) {
          routerHistory.go(-info.delta, false);
        }
        return triggerError(error2, toLocation, from);
      }).then((failure) => {
        failure = failure || finalizeNavigation(
          // after navigation, all matched components are resolved
          toLocation,
          from,
          false
        );
        if (failure) {
          if (info.delta && // a new navigation has been triggered, so we do not want to revert, that will change the current history
          // entry while a different route is displayed
          !isNavigationFailure(
            failure,
            8
            /* ErrorTypes.NAVIGATION_CANCELLED */
          )) {
            routerHistory.go(-info.delta, false);
          } else if (info.type === NavigationType.pop && isNavigationFailure(
            failure,
            4 | 16
            /* ErrorTypes.NAVIGATION_DUPLICATED */
          )) {
            routerHistory.go(-1, false);
          }
        }
        triggerAfterEach(toLocation, from, failure);
      }).catch(noop$1);
    });
  }
  let readyHandlers = useCallbacks();
  let errorListeners = useCallbacks();
  let ready;
  function triggerError(error2, to2, from) {
    markAsReady(error2);
    const list = errorListeners.list();
    if (list.length) {
      list.forEach((handler) => handler(error2, to2, from));
    } else {
      console.error(error2);
    }
    return Promise.reject(error2);
  }
  function isReady() {
    if (ready && currentRoute.value !== START_LOCATION_NORMALIZED)
      return Promise.resolve();
    return new Promise((resolve22, reject) => {
      readyHandlers.add([resolve22, reject]);
    });
  }
  function markAsReady(err) {
    if (!ready) {
      ready = !err;
      setupListeners();
      readyHandlers.list().forEach(([resolve22, reject]) => err ? reject(err) : resolve22());
      readyHandlers.reset();
    }
    return err;
  }
  function handleScroll(to2, from, isPush, isFirstNavigation) {
    const { scrollBehavior } = options;
    if (!isBrowser || !scrollBehavior)
      return Promise.resolve();
    const scrollPosition = !isPush && getSavedScrollPosition(getScrollKey(to2.fullPath, 0)) || (isFirstNavigation || !isPush) && history.state && history.state.scroll || null;
    return nextTick().then(() => scrollBehavior(to2, from, scrollPosition)).then((position2) => position2 && scrollToPosition(position2)).catch((err) => triggerError(err, to2, from));
  }
  const go2 = (delta) => routerHistory.go(delta);
  let started;
  const installedApps = /* @__PURE__ */ new Set();
  const router2 = {
    currentRoute,
    listening: true,
    addRoute,
    removeRoute,
    hasRoute,
    getRoutes,
    resolve: resolve2,
    options,
    push,
    replace,
    go: go2,
    back: () => go2(-1),
    forward: () => go2(1),
    beforeEach: beforeGuards.add,
    beforeResolve: beforeResolveGuards.add,
    afterEach: afterGuards.add,
    onError: errorListeners.add,
    isReady,
    install(app) {
      const router22 = this;
      app.component("RouterLink", RouterLink);
      app.component("RouterView", RouterView);
      app.config.globalProperties.$router = router22;
      Object.defineProperty(app.config.globalProperties, "$route", {
        enumerable: true,
        get: () => unref(currentRoute)
      });
      if (isBrowser && // used for the initial navigation client side to avoid pushing
      // multiple times when the router is used in multiple apps
      !started && currentRoute.value === START_LOCATION_NORMALIZED) {
        started = true;
        push(routerHistory.location).catch((err) => {
        });
      }
      const reactiveRoute = {};
      for (const key2 in START_LOCATION_NORMALIZED) {
        Object.defineProperty(reactiveRoute, key2, {
          get: () => currentRoute.value[key2],
          enumerable: true
        });
      }
      app.provide(routerKey, router22);
      app.provide(routeLocationKey, shallowReactive(reactiveRoute));
      app.provide(routerViewLocationKey, currentRoute);
      const unmountApp = app.unmount;
      installedApps.add(app);
      app.unmount = function() {
        installedApps.delete(app);
        if (installedApps.size < 1) {
          pendingLocation = START_LOCATION_NORMALIZED;
          removeHistoryListener && removeHistoryListener();
          removeHistoryListener = null;
          currentRoute.value = START_LOCATION_NORMALIZED;
          started = false;
          ready = false;
        }
        unmountApp();
      };
    }
  };
  function runGuardQueue(guards) {
    return guards.reduce((promise, guard) => promise.then(() => runWithContext(guard)), Promise.resolve());
  }
  return router2;
}
function extractChangingRecords(to2, from) {
  const leavingRecords = [];
  const updatingRecords = [];
  const enteringRecords = [];
  const len = Math.max(from.matched.length, to2.matched.length);
  for (let i2 = 0; i2 < len; i2++) {
    const recordFrom = from.matched[i2];
    if (recordFrom) {
      if (to2.matched.find((record) => isSameRouteRecord(record, recordFrom)))
        updatingRecords.push(recordFrom);
      else
        leavingRecords.push(recordFrom);
    }
    const recordTo = to2.matched[i2];
    if (recordTo) {
      if (!from.matched.find((record) => isSameRouteRecord(record, recordTo))) {
        enteringRecords.push(recordTo);
      }
    }
  }
  return [leavingRecords, updatingRecords, enteringRecords];
}
function useRouter() {
  return inject(routerKey);
}
function useRoute() {
  return inject(routeLocationKey);
}
var PathId = /* @__PURE__ */ ((PathId2) => {
  PathId2["Request"] = "request";
  PathId2["Examples"] = "examples";
  PathId2["Cookies"] = "cookies";
  PathId2["Collection"] = "collection";
  PathId2["Schema"] = "schema";
  PathId2["Environment"] = "environment";
  PathId2["Servers"] = "servers";
  PathId2["Workspace"] = "workspace";
  PathId2["Settings"] = "settings";
  return PathId2;
})(PathId || {});
const requestRoutes = [
  {
    path: "",
    redirect: (to2) => `${to2.fullPath.replace(/\/$/, "")}/request/default`
  },
  {
    path: "request",
    redirect: (to2) => `${to2.fullPath.replace(/\/$/, "")}/default`
  },
  {
    name: "request",
    path: `request/:${"request"}`,
    component: () => Promise.resolve().then(() => Request$1)
  },
  {
    name: "examples",
    path: `request/:${"request"}/examples/:${"examples"}`,
    component: () => Promise.resolve().then(() => Request$1)
  }
];
const modalRoutes = [
  {
    path: "/",
    redirect: "/workspace/default/request/default"
  },
  {
    path: "/workspace",
    redirect: "/workspace/default/request/default"
  },
  {
    path: `/workspace/:${"workspace"}`,
    children: requestRoutes
  }
];
const routes = [
  {
    path: "/",
    redirect: redirectToDefaultWorkspace
  },
  {
    path: "/workspace",
    redirect: redirectToDefaultWorkspace
  },
  {
    path: `/workspace/:${"workspace"}`,
    children: [
      ...requestRoutes,
      // {
      //   path: 'collection',
      //   redirect: (to) =>
      //     `${to.fullPath.replace(/\/$/, '')}/default`,
      // },
      // {
      //   name: PathId.Collection,
      //   path: `collection/:${PathId.Collection}`,
      //   component: () => import('@/views/Collection/Collection.vue'),
      //   children: [
      //     // Nested collection request
      //     {
      //       path: `request/${PathId.Request}`,
      //       component: () => import('@/views/Request/Request.vue'),
      //     },
      //   ],
      // },
      /** Components will map to each section of the spec components object */
      // {
      //   path: 'components',
      //   redirect: '/components/schemas/default',
      //   children: [
      //     {
      //       path: `schemas/:${PathId.Schema}`,
      //       component: () => import('@/views/Components/Schemas/Schemas.vue'),
      //     },
      //   ],
      // },
      {
        path: "environment",
        redirect: (to2) => `${to2.fullPath.replace(/\/$/, "")}/default`
      },
      {
        name: "environment",
        path: `environment/:${"environment"}`,
        component: () => Promise.resolve().then(() => Environment)
      },
      {
        path: "cookies",
        redirect: (to2) => `${to2.fullPath.replace(/\/$/, "")}/default`
      },
      {
        name: "cookies",
        path: `cookies/:${"cookies"}`,
        component: () => Promise.resolve().then(() => Cookies)
      },
      {
        path: "servers",
        redirect: (to2) => `${to2.fullPath.replace(/\/$/, "")}/default`
      },
      {
        name: "servers",
        path: `servers/:${"servers"}`,
        component: () => Promise.resolve().then(() => Servers)
      },
      {
        path: "settings",
        redirect: (to2) => `${to2.fullPath.replace(/\/$/, "")}/general`
      },
      {
        name: "settings",
        path: `settings/:${"settings"}`,
        component: () => Promise.resolve().then(() => Settings)
      }
    ]
  }
];
const router = createRouter({
  history: createWebHistory(),
  routes
});
const createModalRouter = () => createRouter({
  history: createMemoryHistory(),
  routes: modalRoutes
});
const WORKSPACE_KEY = "activeWorkspace";
function redirectToDefaultWorkspace() {
  const workspace = localStorage.getItem(WORKSPACE_KEY) ?? "default";
  return `/workspace/${workspace}/request/default`;
}
function fallbackMissingParams(key2, item) {
  var _a2, _b;
  if (router.currentRoute.value && // If the item is missing then we know the UID is no longer in use and redirect to the default
  !item && ((_a2 = router.currentRoute.value) == null ? void 0 : _a2.params[key2]) && ((_b = router.currentRoute.value) == null ? void 0 : _b.params[key2]) !== "default" && // We only redirect if the key is missing for the matching route
  router.currentRoute.value.path.includes(key2)) {
    router.push({
      params: {
        ...router.currentRoute.value.params,
        [key2]: "default"
      }
    });
  }
}
function setNestedValue(obj, path2, value) {
  const keys2 = path2.split(".");
  keys2.reduce((acc, current, idx) => {
    if (idx === keys2.length - 1)
      acc[current] = value;
    return acc[current];
  }, obj);
  return obj;
}
function getNestedValue(obj, path2) {
  const keys2 = path2.split(".");
  return keys2.reduce((acc, current) => {
    return acc[current];
  }, obj);
}
class Mutation {
  constructor(parentData, maxRecords = 5e3, debug = false) {
    /** Object reference for the given data to be tracked */
    __publicField(this, "parentData");
    /** Maximum number of record to keep (how many times you can 'undo' a mutation) */
    __publicField(this, "maxRecords");
    /** List of all mutation records */
    __publicField(this, "records", []);
    /** List of side effect handlers to run whenever the data changes */
    __publicField(this, "sideEffects", []);
    /** Active mutation index. Allows rolling forward and backwards */
    __publicField(this, "idx", 0);
    /** Optional debug messages */
    __publicField(this, "debug");
    this.maxRecords = maxRecords;
    this.parentData = parentData;
    this.debug = debug;
  }
  /** Mutate without saving a record. Private function. */
  _unsavedMutate(path2, value) {
    setNestedValue(this.parentData, path2, value);
    this.runSideEffects(path2);
  }
  /** Side effects must take ONLY an object of the specified type and act on it */
  addSideEffect(triggers, effect, name2, immediate = true) {
    this.sideEffects.push({ triggers, effect, name: name2 });
    if (immediate) {
      effect(this.parentData);
      if (this.debug) {
        console.info(`Running mutation side effect: ${name2}`, "debug");
      }
    }
  }
  /** Runs all side effects that match the path trigger */
  runSideEffects(path2) {
    this.sideEffects.forEach(({ effect, triggers, name: name2 }) => {
      const triggerEffect = triggers.some((trigger2) => path2.includes(trigger2)) || path2.length < 1;
      if (triggerEffect) {
        effect(this.parentData);
        if (this.debug) {
          console.info(`Running mutation side effect: ${name2}`, "debug");
        }
      }
    });
  }
  /** Mutate an object with the new property value and run side effects */
  mutate(path2, value, previousValue = null) {
    if (this.idx < this.records.length - 1)
      this.records.splice(this.idx + 1);
    const prev = getNestedValue(this.parentData, path2);
    if (prev === value)
      return;
    setNestedValue(this.parentData, path2, value);
    this.runSideEffects(path2);
    this.records.push({
      prev: previousValue ?? prev,
      // Optional explicit previous value
      value,
      path: path2
    });
    this.idx = this.records.length - 1;
    if (this.records.length > this.maxRecords)
      this.records.shift();
    if (this.debug) {
      console.info(`Set object '${this.idx}' '${path2}' to ${value}`, "debug");
    }
  }
  /** Undo the previous mutation */
  undo() {
    if (this.idx < 0 || this.records.length < 1)
      return false;
    if (this.debug)
      console.info("Undoing Mutation", "debug");
    const record = this.records[this.idx];
    this.idx -= 1;
    this._unsavedMutate(record.path, record.prev);
    return true;
  }
  /** Roll forward to the next available mutation if its exists */
  redo() {
    if (this.idx > this.records.length - 2)
      return false;
    if (this.debug)
      console.info("Redoing Mutation", "debug");
    const record = this.records[this.idx + 1];
    this.idx += 1;
    this._unsavedMutate(record.path, record.value);
    return true;
  }
}
const LS_CONFIG = {
  /** The debounce time in milliseconds for saving to localStorage per resource */
  DEBOUNCE_MS: 328,
  /** The max wait time in milliseconds for saving to localStorage per resource */
  MAX_WAIT_MS: 1e3
};
function debounce(fn, wait, { maxWait } = {}) {
  let timer = null;
  let maxTimer = null;
  return function(...args) {
    if (timer)
      clearTimeout(timer);
    timer = setTimeout(() => {
      maxTimer !== null ? clearTimeout(maxTimer) : null;
      maxTimer = null;
      fn.apply(this, args);
    }, wait);
    if (maxWait && !maxTimer)
      maxTimer = setTimeout(() => {
        timer !== null ? clearTimeout(timer) : null;
        maxTimer = null;
        fn.apply(this, args);
      }, maxWait);
  };
}
const MAX_MUTATION_RECORDS = 500;
function mutationFactory(entityMap, mutationMap, localStorageKey, maxNumberRecords = MAX_MUTATION_RECORDS) {
  function getMutator(uid2) {
    const mutator = mutationMap[uid2];
    if (!mutator)
      console.warn(`Missing ${entityMap[uid2] ? "mutator" : "object"} for uid: ${uid2}`);
    return mutator ?? null;
  }
  const onChange = localStorageKey ? debounce(() => localStorage.setItem(localStorageKey, stringify$2(entityMap)), LS_CONFIG.DEBOUNCE_MS, { maxWait: LS_CONFIG.MAX_WAIT_MS }) : () => null;
  const add2 = (item) => {
    entityMap[item.uid] = item;
    mutationMap[item.uid] = new Mutation(item, maxNumberRecords);
    onChange();
  };
  return {
    /** Adds a new item to the record of tracked items and creates a new mutation tracking instance */
    add: add2,
    delete: (uid2) => {
      delete entityMap[uid2];
      delete mutationMap[uid2];
      onChange();
    },
    /** Destructive, overwrites a record to a new item and creates a new mutation tracking instance */
    set: (item) => {
      entityMap[item.uid] = item;
      mutationMap[item.uid] = new Mutation(item, maxNumberRecords);
      onChange();
    },
    /** Update a nested property and track the mutation */
    edit: (uid2, path2, value) => {
      const mutator = getMutator(uid2);
      mutator == null ? void 0 : mutator.mutate(path2, value);
      onChange();
    },
    /** Commit an untracked edit to the object (undo/redo will not work) */
    untrackedEdit: (uid2, path2, value) => {
      const mutator = getMutator(uid2);
      mutator == null ? void 0 : mutator._unsavedMutate(path2, value);
      onChange();
    },
    /** Undo the last mutation */
    undo: (uid2) => {
      const mutator = getMutator(uid2);
      mutator == null ? void 0 : mutator.undo();
      onChange();
    },
    /** Redo a mutation if available */
    redo: (uid2) => {
      const mutator = getMutator(uid2);
      mutator == null ? void 0 : mutator.redo();
      onChange();
    }
  };
}
function createStoreCollections(useLocalStorage) {
  const collections = reactive({});
  const collectionMutators = mutationFactory(
    collections,
    reactive({}),
    useLocalStorage && LS_KEYS.COLLECTION
  );
  return {
    collections,
    collectionMutators
  };
}
function extendedCollectionDataFactory({
  requests,
  requestMutators,
  requestExamples,
  requestExampleMutators,
  workspaces,
  workspaceMutators,
  collections,
  collectionMutators,
  tagMutators
}) {
  const addCollection = (payload, workspaceUid) => {
    const collection = collectionSchema.parse(payload);
    workspaceMutators.edit(workspaceUid, "collections", [
      ...workspaces[workspaceUid].collections,
      collection.uid
    ]);
    collectionMutators.add(collection);
    return collection;
  };
  const deleteCollection = (collection, workspace) => {
    var _a2, _b;
    if (!workspace.uid) return;
    if (((_b = (_a2 = collections[collection.uid]) == null ? void 0 : _a2.info) == null ? void 0 : _b.title) === "Drafts") {
      console.warn("The drafts collection cannot be deleted");
      return;
    }
    if (Object.values(collections).length === 1) {
      console.warn("You must have at least one collection");
      return;
    }
    collection.tags.forEach((uid2) => tagMutators.delete(uid2));
    collection.requests.forEach((uid2) => {
      const request = requests[uid2];
      if (!request) return;
      requestMutators.delete(uid2);
      request.examples.forEach(
        (e2) => requestExamples[e2] && requestExampleMutators.delete(e2)
      );
    });
    workspaceMutators.edit(
      workspace.uid,
      "collections",
      workspace.collections.filter((uid2) => uid2 !== collection.uid)
    );
    collectionMutators.delete(collection.uid);
  };
  return {
    addCollection,
    deleteCollection
  };
}
function createStoreCookies(useLocalStorage) {
  const cookies = reactive({});
  const cookieMutators = mutationFactory(
    cookies,
    reactive({}),
    useLocalStorage && LS_KEYS.COOKIE
  );
  cookieMutators.add(
    cookieSchema.parse({
      uid: "default",
      name: "Cookie",
      value: "",
      domain: "",
      path: "/",
      secure: false,
      httpOnly: false,
      sameSite: "None"
    })
  );
  return {
    cookies,
    cookieMutators
  };
}
function createStoreEnvironments(useLocalStorage) {
  const environments = reactive({});
  const environmentMutators = mutationFactory(
    environments,
    reactive({}),
    useLocalStorage && LS_KEYS.ENVIRONMENT
  );
  environmentMutators.add(
    environmentSchema.parse({
      uid: "default",
      name: "Global Environment",
      color: "blue",
      raw: JSON.stringify({ exampleKey: "exampleValue" }, null, 2),
      parsed: [],
      isDefault: true
    })
  );
  return {
    environments,
    environmentMutators
  };
}
function extendedEnvironmentDataFactory({
  environmentMutators
}) {
  const deleteEnvironment = (uid2) => {
    if (uid2 === "default") {
      console.warn("Default environment cannot be deleted.");
      return;
    }
    environmentMutators.delete(uid2);
  };
  return { deleteEnvironment };
}
function createEventBus() {
  const listeners = /* @__PURE__ */ new Set();
  function on(listener) {
    listeners.add(listener);
    const _off = () => off(listener);
    return _off;
  }
  function once(listener) {
    function _listener(...args) {
      off(_listener);
      listener(...args);
    }
    return on(_listener);
  }
  function off(listener) {
    listeners.delete(listener);
  }
  function reset() {
    listeners.clear();
  }
  function emit2(payload) {
    listeners == null ? void 0 : listeners.forEach((v2) => v2(payload));
  }
  return {
    on,
    once,
    off,
    emit: emit2,
    reset,
    listeners: () => Array.from(listeners)
  };
}
function createStoreEvents() {
  return {
    /**
     * Event bus to execute requests, usually triggered by the send button in the address bar
     * OR the keyboard shortcut
     */
    executeRequest: createEventBus(),
    /**
     * Event bus to cancel requests, usually triggered by response loading overlay
     */
    cancelRequest: createEventBus(),
    /**
     * Event bus to keep track of when a request is started, stopped, or aborted
     */
    requestStatus: createEventBus(),
    /**
     * Event bus for controlling the Command Palette
     *
     * @param commandName - the command name you wish to execute, leave empty for the full palette
     */
    commandPalette: createEventBus(),
    /**
     * Event bus for handling hot keys
     */
    hotKeys: createEventBus()
  };
}
function keysOf(obj) {
  return obj ? Object.keys(obj).map((k2) => String(k2)) : [];
}
var title = "A JSON Schema for Swagger 2.0 API.";
var id$2 = "http://swagger.io/v2/schema.json#";
var $schema$2 = "http://json-schema.org/draft-04/schema#";
var type$2 = "object";
var required$2 = [
  "swagger",
  "info",
  "paths"
];
var additionalProperties$1 = false;
var patternProperties$1 = {
  "^x-": {
    $ref: "#/definitions/vendorExtension"
  }
};
var properties$3 = {
  swagger: {
    type: "string",
    "enum": [
      "2.0"
    ],
    description: "The Swagger version of this document."
  },
  info: {
    $ref: "#/definitions/info"
  },
  host: {
    type: "string",
    pattern: "^[^{}/ :\\\\]+(?::\\d+)?$",
    description: "The host (name or ip) of the API. Example: 'swagger.io'"
  },
  basePath: {
    type: "string",
    pattern: "^/",
    description: "The base path to the API. Example: '/api'."
  },
  schemes: {
    $ref: "#/definitions/schemesList"
  },
  consumes: {
    description: "A list of MIME types accepted by the API.",
    allOf: [
      {
        $ref: "#/definitions/mediaTypeList"
      }
    ]
  },
  produces: {
    description: "A list of MIME types the API can produce.",
    allOf: [
      {
        $ref: "#/definitions/mediaTypeList"
      }
    ]
  },
  paths: {
    $ref: "#/definitions/paths"
  },
  definitions: {
    $ref: "#/definitions/definitions"
  },
  parameters: {
    $ref: "#/definitions/parameterDefinitions"
  },
  responses: {
    $ref: "#/definitions/responseDefinitions"
  },
  security: {
    $ref: "#/definitions/security"
  },
  securityDefinitions: {
    $ref: "#/definitions/securityDefinitions"
  },
  tags: {
    type: "array",
    items: {
      $ref: "#/definitions/tag"
    },
    uniqueItems: true
  },
  externalDocs: {
    $ref: "#/definitions/externalDocs"
  }
};
var definitions$1 = {
  info: {
    type: "object",
    description: "General information about the API.",
    required: [
      "version",
      "title"
    ],
    additionalProperties: false,
    patternProperties: {
      "^x-": {
        $ref: "#/definitions/vendorExtension"
      }
    },
    properties: {
      title: {
        type: "string",
        description: "A unique and precise title of the API."
      },
      version: {
        type: "string",
        description: "A semantic version number of the API."
      },
      description: {
        type: "string",
        description: "A longer description of the API. Should be different from the title.  GitHub Flavored Markdown is allowed."
      },
      termsOfService: {
        type: "string",
        description: "The terms of service for the API."
      },
      contact: {
        $ref: "#/definitions/contact"
      },
      license: {
        $ref: "#/definitions/license"
      }
    }
  },
  contact: {
    type: "object",
    description: "Contact information for the owners of the API.",
    additionalProperties: false,
    properties: {
      name: {
        type: "string",
        description: "The identifying name of the contact person/organization."
      },
      url: {
        type: "string",
        description: "The URL pointing to the contact information.",
        format: "uri"
      },
      email: {
        type: "string",
        description: "The email address of the contact person/organization.",
        format: "email"
      }
    },
    patternProperties: {
      "^x-": {
        $ref: "#/definitions/vendorExtension"
      }
    }
  },
  license: {
    type: "object",
    required: [
      "name"
    ],
    additionalProperties: false,
    properties: {
      name: {
        type: "string",
        description: "The name of the license type. It's encouraged to use an OSI compatible license."
      },
      url: {
        type: "string",
        description: "The URL pointing to the license.",
        format: "uri"
      }
    },
    patternProperties: {
      "^x-": {
        $ref: "#/definitions/vendorExtension"
      }
    }
  },
  paths: {
    type: "object",
    description: "Relative paths to the individual endpoints. They must be relative to the 'basePath'.",
    patternProperties: {
      "^x-": {
        $ref: "#/definitions/vendorExtension"
      },
      "^/": {
        $ref: "#/definitions/pathItem"
      }
    },
    additionalProperties: false
  },
  definitions: {
    type: "object",
    additionalProperties: {
      $ref: "#/definitions/schema"
    },
    description: "One or more JSON objects describing the schemas being consumed and produced by the API."
  },
  parameterDefinitions: {
    type: "object",
    additionalProperties: {
      $ref: "#/definitions/parameter"
    },
    description: "One or more JSON representations for parameters"
  },
  responseDefinitions: {
    type: "object",
    additionalProperties: {
      $ref: "#/definitions/response"
    },
    description: "One or more JSON representations for responses"
  },
  externalDocs: {
    type: "object",
    additionalProperties: false,
    description: "information about external documentation",
    required: [
      "url"
    ],
    properties: {
      description: {
        type: "string"
      },
      url: {
        type: "string",
        format: "uri"
      }
    },
    patternProperties: {
      "^x-": {
        $ref: "#/definitions/vendorExtension"
      }
    }
  },
  examples: {
    type: "object",
    additionalProperties: true
  },
  mimeType: {
    type: "string",
    description: "The MIME type of the HTTP message."
  },
  operation: {
    type: "object",
    required: [
      "responses"
    ],
    additionalProperties: false,
    patternProperties: {
      "^x-": {
        $ref: "#/definitions/vendorExtension"
      }
    },
    properties: {
      tags: {
        type: "array",
        items: {
          type: "string"
        },
        uniqueItems: true
      },
      summary: {
        type: "string",
        description: "A brief summary of the operation."
      },
      description: {
        type: "string",
        description: "A longer description of the operation, GitHub Flavored Markdown is allowed."
      },
      externalDocs: {
        $ref: "#/definitions/externalDocs"
      },
      operationId: {
        type: "string",
        description: "A unique identifier of the operation."
      },
      produces: {
        description: "A list of MIME types the API can produce.",
        allOf: [
          {
            $ref: "#/definitions/mediaTypeList"
          }
        ]
      },
      consumes: {
        description: "A list of MIME types the API can consume.",
        allOf: [
          {
            $ref: "#/definitions/mediaTypeList"
          }
        ]
      },
      parameters: {
        $ref: "#/definitions/parametersList"
      },
      responses: {
        $ref: "#/definitions/responses"
      },
      schemes: {
        $ref: "#/definitions/schemesList"
      },
      deprecated: {
        type: "boolean",
        "default": false
      },
      security: {
        $ref: "#/definitions/security"
      }
    }
  },
  pathItem: {
    type: "object",
    additionalProperties: false,
    patternProperties: {
      "^x-": {
        $ref: "#/definitions/vendorExtension"
      }
    },
    properties: {
      $ref: {
        type: "string"
      },
      get: {
        $ref: "#/definitions/operation"
      },
      put: {
        $ref: "#/definitions/operation"
      },
      post: {
        $ref: "#/definitions/operation"
      },
      "delete": {
        $ref: "#/definitions/operation"
      },
      options: {
        $ref: "#/definitions/operation"
      },
      head: {
        $ref: "#/definitions/operation"
      },
      patch: {
        $ref: "#/definitions/operation"
      },
      parameters: {
        $ref: "#/definitions/parametersList"
      }
    }
  },
  responses: {
    type: "object",
    description: "Response objects names can either be any valid HTTP status code or 'default'.",
    minProperties: 1,
    additionalProperties: false,
    patternProperties: {
      "^([0-9]{3})$|^(default)$": {
        $ref: "#/definitions/responseValue"
      },
      "^x-": {
        $ref: "#/definitions/vendorExtension"
      }
    },
    not: {
      type: "object",
      additionalProperties: false,
      patternProperties: {
        "^x-": {
          $ref: "#/definitions/vendorExtension"
        }
      }
    }
  },
  responseValue: {
    oneOf: [
      {
        $ref: "#/definitions/response"
      },
      {
        $ref: "#/definitions/jsonReference"
      }
    ]
  },
  response: {
    type: "object",
    required: [
      "description"
    ],
    properties: {
      description: {
        type: "string"
      },
      schema: {
        oneOf: [
          {
            $ref: "#/definitions/schema"
          },
          {
            $ref: "#/definitions/fileSchema"
          }
        ]
      },
      headers: {
        $ref: "#/definitions/headers"
      },
      examples: {
        $ref: "#/definitions/examples"
      }
    },
    additionalProperties: false,
    patternProperties: {
      "^x-": {
        $ref: "#/definitions/vendorExtension"
      }
    }
  },
  headers: {
    type: "object",
    additionalProperties: {
      $ref: "#/definitions/header"
    }
  },
  header: {
    type: "object",
    additionalProperties: false,
    required: [
      "type"
    ],
    properties: {
      type: {
        type: "string",
        "enum": [
          "string",
          "number",
          "integer",
          "boolean",
          "array"
        ]
      },
      format: {
        type: "string"
      },
      items: {
        $ref: "#/definitions/primitivesItems"
      },
      collectionFormat: {
        $ref: "#/definitions/collectionFormat"
      },
      "default": {
        $ref: "#/definitions/default"
      },
      maximum: {
        $ref: "#/definitions/maximum"
      },
      exclusiveMaximum: {
        $ref: "#/definitions/exclusiveMaximum"
      },
      minimum: {
        $ref: "#/definitions/minimum"
      },
      exclusiveMinimum: {
        $ref: "#/definitions/exclusiveMinimum"
      },
      maxLength: {
        $ref: "#/definitions/maxLength"
      },
      minLength: {
        $ref: "#/definitions/minLength"
      },
      pattern: {
        $ref: "#/definitions/pattern"
      },
      maxItems: {
        $ref: "#/definitions/maxItems"
      },
      minItems: {
        $ref: "#/definitions/minItems"
      },
      uniqueItems: {
        $ref: "#/definitions/uniqueItems"
      },
      "enum": {
        $ref: "#/definitions/enum"
      },
      multipleOf: {
        $ref: "#/definitions/multipleOf"
      },
      description: {
        type: "string"
      }
    },
    patternProperties: {
      "^x-": {
        $ref: "#/definitions/vendorExtension"
      }
    }
  },
  vendorExtension: {
    description: "Any property starting with x- is valid.",
    additionalProperties: true,
    additionalItems: true
  },
  bodyParameter: {
    type: "object",
    required: [
      "name",
      "in",
      "schema"
    ],
    patternProperties: {
      "^x-": {
        $ref: "#/definitions/vendorExtension"
      }
    },
    properties: {
      description: {
        type: "string",
        description: "A brief description of the parameter. This could contain examples of use.  GitHub Flavored Markdown is allowed."
      },
      name: {
        type: "string",
        description: "The name of the parameter."
      },
      "in": {
        type: "string",
        description: "Determines the location of the parameter.",
        "enum": [
          "body"
        ]
      },
      required: {
        type: "boolean",
        description: "Determines whether or not this parameter is required or optional.",
        "default": false
      },
      schema: {
        $ref: "#/definitions/schema"
      }
    },
    additionalProperties: false
  },
  headerParameterSubSchema: {
    additionalProperties: false,
    patternProperties: {
      "^x-": {
        $ref: "#/definitions/vendorExtension"
      }
    },
    properties: {
      required: {
        type: "boolean",
        description: "Determines whether or not this parameter is required or optional.",
        "default": false
      },
      "in": {
        type: "string",
        description: "Determines the location of the parameter.",
        "enum": [
          "header"
        ]
      },
      description: {
        type: "string",
        description: "A brief description of the parameter. This could contain examples of use.  GitHub Flavored Markdown is allowed."
      },
      name: {
        type: "string",
        description: "The name of the parameter."
      },
      type: {
        type: "string",
        "enum": [
          "string",
          "number",
          "boolean",
          "integer",
          "array"
        ]
      },
      format: {
        type: "string"
      },
      items: {
        $ref: "#/definitions/primitivesItems"
      },
      collectionFormat: {
        $ref: "#/definitions/collectionFormat"
      },
      "default": {
        $ref: "#/definitions/default"
      },
      maximum: {
        $ref: "#/definitions/maximum"
      },
      exclusiveMaximum: {
        $ref: "#/definitions/exclusiveMaximum"
      },
      minimum: {
        $ref: "#/definitions/minimum"
      },
      exclusiveMinimum: {
        $ref: "#/definitions/exclusiveMinimum"
      },
      maxLength: {
        $ref: "#/definitions/maxLength"
      },
      minLength: {
        $ref: "#/definitions/minLength"
      },
      pattern: {
        $ref: "#/definitions/pattern"
      },
      maxItems: {
        $ref: "#/definitions/maxItems"
      },
      minItems: {
        $ref: "#/definitions/minItems"
      },
      uniqueItems: {
        $ref: "#/definitions/uniqueItems"
      },
      "enum": {
        $ref: "#/definitions/enum"
      },
      multipleOf: {
        $ref: "#/definitions/multipleOf"
      }
    }
  },
  queryParameterSubSchema: {
    additionalProperties: false,
    patternProperties: {
      "^x-": {
        $ref: "#/definitions/vendorExtension"
      }
    },
    properties: {
      required: {
        type: "boolean",
        description: "Determines whether or not this parameter is required or optional.",
        "default": false
      },
      "in": {
        type: "string",
        description: "Determines the location of the parameter.",
        "enum": [
          "query"
        ]
      },
      description: {
        type: "string",
        description: "A brief description of the parameter. This could contain examples of use.  GitHub Flavored Markdown is allowed."
      },
      name: {
        type: "string",
        description: "The name of the parameter."
      },
      allowEmptyValue: {
        type: "boolean",
        "default": false,
        description: "allows sending a parameter by name only or with an empty value."
      },
      type: {
        type: "string",
        "enum": [
          "string",
          "number",
          "boolean",
          "integer",
          "array"
        ]
      },
      format: {
        type: "string"
      },
      items: {
        $ref: "#/definitions/primitivesItems"
      },
      collectionFormat: {
        $ref: "#/definitions/collectionFormatWithMulti"
      },
      "default": {
        $ref: "#/definitions/default"
      },
      maximum: {
        $ref: "#/definitions/maximum"
      },
      exclusiveMaximum: {
        $ref: "#/definitions/exclusiveMaximum"
      },
      minimum: {
        $ref: "#/definitions/minimum"
      },
      exclusiveMinimum: {
        $ref: "#/definitions/exclusiveMinimum"
      },
      maxLength: {
        $ref: "#/definitions/maxLength"
      },
      minLength: {
        $ref: "#/definitions/minLength"
      },
      pattern: {
        $ref: "#/definitions/pattern"
      },
      maxItems: {
        $ref: "#/definitions/maxItems"
      },
      minItems: {
        $ref: "#/definitions/minItems"
      },
      uniqueItems: {
        $ref: "#/definitions/uniqueItems"
      },
      "enum": {
        $ref: "#/definitions/enum"
      },
      multipleOf: {
        $ref: "#/definitions/multipleOf"
      }
    }
  },
  formDataParameterSubSchema: {
    additionalProperties: false,
    patternProperties: {
      "^x-": {
        $ref: "#/definitions/vendorExtension"
      }
    },
    properties: {
      required: {
        type: "boolean",
        description: "Determines whether or not this parameter is required or optional.",
        "default": false
      },
      "in": {
        type: "string",
        description: "Determines the location of the parameter.",
        "enum": [
          "formData"
        ]
      },
      description: {
        type: "string",
        description: "A brief description of the parameter. This could contain examples of use.  GitHub Flavored Markdown is allowed."
      },
      name: {
        type: "string",
        description: "The name of the parameter."
      },
      allowEmptyValue: {
        type: "boolean",
        "default": false,
        description: "allows sending a parameter by name only or with an empty value."
      },
      type: {
        type: "string",
        "enum": [
          "string",
          "number",
          "boolean",
          "integer",
          "array",
          "file"
        ]
      },
      format: {
        type: "string"
      },
      items: {
        $ref: "#/definitions/primitivesItems"
      },
      collectionFormat: {
        $ref: "#/definitions/collectionFormatWithMulti"
      },
      "default": {
        $ref: "#/definitions/default"
      },
      maximum: {
        $ref: "#/definitions/maximum"
      },
      exclusiveMaximum: {
        $ref: "#/definitions/exclusiveMaximum"
      },
      minimum: {
        $ref: "#/definitions/minimum"
      },
      exclusiveMinimum: {
        $ref: "#/definitions/exclusiveMinimum"
      },
      maxLength: {
        $ref: "#/definitions/maxLength"
      },
      minLength: {
        $ref: "#/definitions/minLength"
      },
      pattern: {
        $ref: "#/definitions/pattern"
      },
      maxItems: {
        $ref: "#/definitions/maxItems"
      },
      minItems: {
        $ref: "#/definitions/minItems"
      },
      uniqueItems: {
        $ref: "#/definitions/uniqueItems"
      },
      "enum": {
        $ref: "#/definitions/enum"
      },
      multipleOf: {
        $ref: "#/definitions/multipleOf"
      }
    }
  },
  pathParameterSubSchema: {
    additionalProperties: false,
    patternProperties: {
      "^x-": {
        $ref: "#/definitions/vendorExtension"
      }
    },
    required: [
      "required"
    ],
    properties: {
      required: {
        type: "boolean",
        "enum": [
          true
        ],
        description: "Determines whether or not this parameter is required or optional."
      },
      "in": {
        type: "string",
        description: "Determines the location of the parameter.",
        "enum": [
          "path"
        ]
      },
      description: {
        type: "string",
        description: "A brief description of the parameter. This could contain examples of use.  GitHub Flavored Markdown is allowed."
      },
      name: {
        type: "string",
        description: "The name of the parameter."
      },
      type: {
        type: "string",
        "enum": [
          "string",
          "number",
          "boolean",
          "integer",
          "array"
        ]
      },
      format: {
        type: "string"
      },
      items: {
        $ref: "#/definitions/primitivesItems"
      },
      collectionFormat: {
        $ref: "#/definitions/collectionFormat"
      },
      "default": {
        $ref: "#/definitions/default"
      },
      maximum: {
        $ref: "#/definitions/maximum"
      },
      exclusiveMaximum: {
        $ref: "#/definitions/exclusiveMaximum"
      },
      minimum: {
        $ref: "#/definitions/minimum"
      },
      exclusiveMinimum: {
        $ref: "#/definitions/exclusiveMinimum"
      },
      maxLength: {
        $ref: "#/definitions/maxLength"
      },
      minLength: {
        $ref: "#/definitions/minLength"
      },
      pattern: {
        $ref: "#/definitions/pattern"
      },
      maxItems: {
        $ref: "#/definitions/maxItems"
      },
      minItems: {
        $ref: "#/definitions/minItems"
      },
      uniqueItems: {
        $ref: "#/definitions/uniqueItems"
      },
      "enum": {
        $ref: "#/definitions/enum"
      },
      multipleOf: {
        $ref: "#/definitions/multipleOf"
      }
    }
  },
  nonBodyParameter: {
    type: "object",
    required: [
      "name",
      "in",
      "type"
    ],
    oneOf: [
      {
        $ref: "#/definitions/headerParameterSubSchema"
      },
      {
        $ref: "#/definitions/formDataParameterSubSchema"
      },
      {
        $ref: "#/definitions/queryParameterSubSchema"
      },
      {
        $ref: "#/definitions/pathParameterSubSchema"
      }
    ]
  },
  parameter: {
    oneOf: [
      {
        $ref: "#/definitions/bodyParameter"
      },
      {
        $ref: "#/definitions/nonBodyParameter"
      }
    ]
  },
  schema: {
    type: "object",
    description: "A deterministic version of a JSON Schema object.",
    patternProperties: {
      "^x-": {
        $ref: "#/definitions/vendorExtension"
      }
    },
    properties: {
      $ref: {
        type: "string"
      },
      format: {
        type: "string"
      },
      title: {
        $ref: "http://json-schema.org/draft-04/schema#/properties/title"
      },
      description: {
        $ref: "http://json-schema.org/draft-04/schema#/properties/description"
      },
      "default": {
        $ref: "http://json-schema.org/draft-04/schema#/properties/default"
      },
      multipleOf: {
        $ref: "http://json-schema.org/draft-04/schema#/properties/multipleOf"
      },
      maximum: {
        $ref: "http://json-schema.org/draft-04/schema#/properties/maximum"
      },
      exclusiveMaximum: {
        $ref: "http://json-schema.org/draft-04/schema#/properties/exclusiveMaximum"
      },
      minimum: {
        $ref: "http://json-schema.org/draft-04/schema#/properties/minimum"
      },
      exclusiveMinimum: {
        $ref: "http://json-schema.org/draft-04/schema#/properties/exclusiveMinimum"
      },
      maxLength: {
        $ref: "http://json-schema.org/draft-04/schema#/definitions/positiveInteger"
      },
      minLength: {
        $ref: "http://json-schema.org/draft-04/schema#/definitions/positiveIntegerDefault0"
      },
      pattern: {
        $ref: "http://json-schema.org/draft-04/schema#/properties/pattern"
      },
      maxItems: {
        $ref: "http://json-schema.org/draft-04/schema#/definitions/positiveInteger"
      },
      minItems: {
        $ref: "http://json-schema.org/draft-04/schema#/definitions/positiveIntegerDefault0"
      },
      uniqueItems: {
        $ref: "http://json-schema.org/draft-04/schema#/properties/uniqueItems"
      },
      maxProperties: {
        $ref: "http://json-schema.org/draft-04/schema#/definitions/positiveInteger"
      },
      minProperties: {
        $ref: "http://json-schema.org/draft-04/schema#/definitions/positiveIntegerDefault0"
      },
      required: {
        $ref: "http://json-schema.org/draft-04/schema#/definitions/stringArray"
      },
      "enum": {
        $ref: "http://json-schema.org/draft-04/schema#/properties/enum"
      },
      additionalProperties: {
        anyOf: [
          {
            $ref: "#/definitions/schema"
          },
          {
            type: "boolean"
          }
        ],
        "default": {}
      },
      type: {
        $ref: "http://json-schema.org/draft-04/schema#/properties/type"
      },
      items: {
        anyOf: [
          {
            $ref: "#/definitions/schema"
          },
          {
            type: "array",
            minItems: 1,
            items: {
              $ref: "#/definitions/schema"
            }
          }
        ],
        "default": {}
      },
      allOf: {
        type: "array",
        minItems: 1,
        items: {
          $ref: "#/definitions/schema"
        }
      },
      properties: {
        type: "object",
        additionalProperties: {
          $ref: "#/definitions/schema"
        },
        "default": {}
      },
      discriminator: {
        type: "string"
      },
      readOnly: {
        type: "boolean",
        "default": false
      },
      xml: {
        $ref: "#/definitions/xml"
      },
      externalDocs: {
        $ref: "#/definitions/externalDocs"
      },
      example: {}
    },
    additionalProperties: false
  },
  fileSchema: {
    type: "object",
    description: "A deterministic version of a JSON Schema object.",
    patternProperties: {
      "^x-": {
        $ref: "#/definitions/vendorExtension"
      }
    },
    required: [
      "type"
    ],
    properties: {
      format: {
        type: "string"
      },
      title: {
        $ref: "http://json-schema.org/draft-04/schema#/properties/title"
      },
      description: {
        $ref: "http://json-schema.org/draft-04/schema#/properties/description"
      },
      "default": {
        $ref: "http://json-schema.org/draft-04/schema#/properties/default"
      },
      required: {
        $ref: "http://json-schema.org/draft-04/schema#/definitions/stringArray"
      },
      type: {
        type: "string",
        "enum": [
          "file"
        ]
      },
      readOnly: {
        type: "boolean",
        "default": false
      },
      externalDocs: {
        $ref: "#/definitions/externalDocs"
      },
      example: {}
    },
    additionalProperties: false
  },
  primitivesItems: {
    type: "object",
    additionalProperties: false,
    properties: {
      type: {
        type: "string",
        "enum": [
          "string",
          "number",
          "integer",
          "boolean",
          "array"
        ]
      },
      format: {
        type: "string"
      },
      items: {
        $ref: "#/definitions/primitivesItems"
      },
      collectionFormat: {
        $ref: "#/definitions/collectionFormat"
      },
      "default": {
        $ref: "#/definitions/default"
      },
      maximum: {
        $ref: "#/definitions/maximum"
      },
      exclusiveMaximum: {
        $ref: "#/definitions/exclusiveMaximum"
      },
      minimum: {
        $ref: "#/definitions/minimum"
      },
      exclusiveMinimum: {
        $ref: "#/definitions/exclusiveMinimum"
      },
      maxLength: {
        $ref: "#/definitions/maxLength"
      },
      minLength: {
        $ref: "#/definitions/minLength"
      },
      pattern: {
        $ref: "#/definitions/pattern"
      },
      maxItems: {
        $ref: "#/definitions/maxItems"
      },
      minItems: {
        $ref: "#/definitions/minItems"
      },
      uniqueItems: {
        $ref: "#/definitions/uniqueItems"
      },
      "enum": {
        $ref: "#/definitions/enum"
      },
      multipleOf: {
        $ref: "#/definitions/multipleOf"
      }
    },
    patternProperties: {
      "^x-": {
        $ref: "#/definitions/vendorExtension"
      }
    }
  },
  security: {
    type: "array",
    items: {
      $ref: "#/definitions/securityRequirement"
    },
    uniqueItems: true
  },
  securityRequirement: {
    type: "object",
    additionalProperties: {
      type: "array",
      items: {
        type: "string"
      },
      uniqueItems: true
    }
  },
  xml: {
    type: "object",
    additionalProperties: false,
    properties: {
      name: {
        type: "string"
      },
      namespace: {
        type: "string"
      },
      prefix: {
        type: "string"
      },
      attribute: {
        type: "boolean",
        "default": false
      },
      wrapped: {
        type: "boolean",
        "default": false
      }
    },
    patternProperties: {
      "^x-": {
        $ref: "#/definitions/vendorExtension"
      }
    }
  },
  tag: {
    type: "object",
    additionalProperties: false,
    required: [
      "name"
    ],
    properties: {
      name: {
        type: "string"
      },
      description: {
        type: "string"
      },
      externalDocs: {
        $ref: "#/definitions/externalDocs"
      }
    },
    patternProperties: {
      "^x-": {
        $ref: "#/definitions/vendorExtension"
      }
    }
  },
  securityDefinitions: {
    type: "object",
    additionalProperties: {
      oneOf: [
        {
          $ref: "#/definitions/basicAuthenticationSecurity"
        },
        {
          $ref: "#/definitions/apiKeySecurity"
        },
        {
          $ref: "#/definitions/oauth2ImplicitSecurity"
        },
        {
          $ref: "#/definitions/oauth2PasswordSecurity"
        },
        {
          $ref: "#/definitions/oauth2ApplicationSecurity"
        },
        {
          $ref: "#/definitions/oauth2AccessCodeSecurity"
        }
      ]
    }
  },
  basicAuthenticationSecurity: {
    type: "object",
    additionalProperties: false,
    required: [
      "type"
    ],
    properties: {
      type: {
        type: "string",
        "enum": [
          "basic"
        ]
      },
      description: {
        type: "string"
      }
    },
    patternProperties: {
      "^x-": {
        $ref: "#/definitions/vendorExtension"
      }
    }
  },
  apiKeySecurity: {
    type: "object",
    additionalProperties: false,
    required: [
      "type",
      "name",
      "in"
    ],
    properties: {
      type: {
        type: "string",
        "enum": [
          "apiKey"
        ]
      },
      name: {
        type: "string"
      },
      "in": {
        type: "string",
        "enum": [
          "header",
          "query"
        ]
      },
      description: {
        type: "string"
      }
    },
    patternProperties: {
      "^x-": {
        $ref: "#/definitions/vendorExtension"
      }
    }
  },
  oauth2ImplicitSecurity: {
    type: "object",
    additionalProperties: false,
    required: [
      "type",
      "flow",
      "authorizationUrl"
    ],
    properties: {
      type: {
        type: "string",
        "enum": [
          "oauth2"
        ]
      },
      flow: {
        type: "string",
        "enum": [
          "implicit"
        ]
      },
      scopes: {
        $ref: "#/definitions/oauth2Scopes"
      },
      authorizationUrl: {
        type: "string",
        format: "uri"
      },
      description: {
        type: "string"
      }
    },
    patternProperties: {
      "^x-": {
        $ref: "#/definitions/vendorExtension"
      }
    }
  },
  oauth2PasswordSecurity: {
    type: "object",
    additionalProperties: false,
    required: [
      "type",
      "flow",
      "tokenUrl"
    ],
    properties: {
      type: {
        type: "string",
        "enum": [
          "oauth2"
        ]
      },
      flow: {
        type: "string",
        "enum": [
          "password"
        ]
      },
      scopes: {
        $ref: "#/definitions/oauth2Scopes"
      },
      tokenUrl: {
        type: "string",
        format: "uri"
      },
      description: {
        type: "string"
      }
    },
    patternProperties: {
      "^x-": {
        $ref: "#/definitions/vendorExtension"
      }
    }
  },
  oauth2ApplicationSecurity: {
    type: "object",
    additionalProperties: false,
    required: [
      "type",
      "flow",
      "tokenUrl"
    ],
    properties: {
      type: {
        type: "string",
        "enum": [
          "oauth2"
        ]
      },
      flow: {
        type: "string",
        "enum": [
          "application"
        ]
      },
      scopes: {
        $ref: "#/definitions/oauth2Scopes"
      },
      tokenUrl: {
        type: "string",
        format: "uri"
      },
      description: {
        type: "string"
      }
    },
    patternProperties: {
      "^x-": {
        $ref: "#/definitions/vendorExtension"
      }
    }
  },
  oauth2AccessCodeSecurity: {
    type: "object",
    additionalProperties: false,
    required: [
      "type",
      "flow",
      "authorizationUrl",
      "tokenUrl"
    ],
    properties: {
      type: {
        type: "string",
        "enum": [
          "oauth2"
        ]
      },
      flow: {
        type: "string",
        "enum": [
          "accessCode"
        ]
      },
      scopes: {
        $ref: "#/definitions/oauth2Scopes"
      },
      authorizationUrl: {
        type: "string",
        format: "uri"
      },
      tokenUrl: {
        type: "string",
        format: "uri"
      },
      description: {
        type: "string"
      }
    },
    patternProperties: {
      "^x-": {
        $ref: "#/definitions/vendorExtension"
      }
    }
  },
  oauth2Scopes: {
    type: "object",
    additionalProperties: {
      type: "string"
    }
  },
  mediaTypeList: {
    type: "array",
    items: {
      $ref: "#/definitions/mimeType"
    },
    uniqueItems: true
  },
  parametersList: {
    type: "array",
    description: "The parameters needed to send a valid API call.",
    additionalItems: false,
    items: {
      oneOf: [
        {
          $ref: "#/definitions/parameter"
        },
        {
          $ref: "#/definitions/jsonReference"
        }
      ]
    },
    uniqueItems: true
  },
  schemesList: {
    type: "array",
    description: "The transfer protocol of the API.",
    items: {
      type: "string",
      "enum": [
        "http",
        "https",
        "ws",
        "wss"
      ]
    },
    uniqueItems: true
  },
  collectionFormat: {
    type: "string",
    "enum": [
      "csv",
      "ssv",
      "tsv",
      "pipes"
    ],
    "default": "csv"
  },
  collectionFormatWithMulti: {
    type: "string",
    "enum": [
      "csv",
      "ssv",
      "tsv",
      "pipes",
      "multi"
    ],
    "default": "csv"
  },
  title: {
    $ref: "http://json-schema.org/draft-04/schema#/properties/title"
  },
  description: {
    $ref: "http://json-schema.org/draft-04/schema#/properties/description"
  },
  "default": {
    $ref: "http://json-schema.org/draft-04/schema#/properties/default"
  },
  multipleOf: {
    $ref: "http://json-schema.org/draft-04/schema#/properties/multipleOf"
  },
  maximum: {
    $ref: "http://json-schema.org/draft-04/schema#/properties/maximum"
  },
  exclusiveMaximum: {
    $ref: "http://json-schema.org/draft-04/schema#/properties/exclusiveMaximum"
  },
  minimum: {
    $ref: "http://json-schema.org/draft-04/schema#/properties/minimum"
  },
  exclusiveMinimum: {
    $ref: "http://json-schema.org/draft-04/schema#/properties/exclusiveMinimum"
  },
  maxLength: {
    $ref: "http://json-schema.org/draft-04/schema#/definitions/positiveInteger"
  },
  minLength: {
    $ref: "http://json-schema.org/draft-04/schema#/definitions/positiveIntegerDefault0"
  },
  pattern: {
    $ref: "http://json-schema.org/draft-04/schema#/properties/pattern"
  },
  maxItems: {
    $ref: "http://json-schema.org/draft-04/schema#/definitions/positiveInteger"
  },
  minItems: {
    $ref: "http://json-schema.org/draft-04/schema#/definitions/positiveIntegerDefault0"
  },
  uniqueItems: {
    $ref: "http://json-schema.org/draft-04/schema#/properties/uniqueItems"
  },
  "enum": {
    $ref: "http://json-schema.org/draft-04/schema#/properties/enum"
  },
  jsonReference: {
    type: "object",
    required: [
      "$ref"
    ],
    additionalProperties: false,
    properties: {
      $ref: {
        type: "string"
      }
    }
  }
};
var Swagger20 = {
  title,
  id: id$2,
  $schema: $schema$2,
  type: type$2,
  required: required$2,
  additionalProperties: additionalProperties$1,
  patternProperties: patternProperties$1,
  properties: properties$3,
  definitions: definitions$1
};
var id$1 = "https://spec.openapis.org/oas/3.0/schema/2021-09-28";
var $schema$1 = "http://json-schema.org/draft-04/schema#";
var description$1 = "The description of OpenAPI v3.0.x documents, as defined by https://spec.openapis.org/oas/v3.0.3";
var type$1 = "object";
var required$1 = [
  "openapi",
  "info",
  "paths"
];
var properties$2 = {
  openapi: {
    type: "string",
    pattern: "^3\\.0\\.\\d(-.+)?$"
  },
  info: {
    $ref: "#/definitions/Info"
  },
  externalDocs: {
    $ref: "#/definitions/ExternalDocumentation"
  },
  servers: {
    type: "array",
    items: {
      $ref: "#/definitions/Server"
    }
  },
  security: {
    type: "array",
    items: {
      $ref: "#/definitions/SecurityRequirement"
    }
  },
  tags: {
    type: "array",
    items: {
      $ref: "#/definitions/Tag"
    },
    uniqueItems: true
  },
  paths: {
    $ref: "#/definitions/Paths"
  },
  components: {
    $ref: "#/definitions/Components"
  }
};
var patternProperties = {
  "^x-": {}
};
var additionalProperties = false;
var definitions = {
  Reference: {
    type: "object",
    required: [
      "$ref"
    ],
    patternProperties: {
      "^\\$ref$": {
        type: "string",
        format: "uri-reference"
      }
    }
  },
  Info: {
    type: "object",
    required: [
      "title",
      "version"
    ],
    properties: {
      title: {
        type: "string"
      },
      description: {
        type: "string"
      },
      termsOfService: {
        type: "string",
        format: "uri-reference"
      },
      contact: {
        $ref: "#/definitions/Contact"
      },
      license: {
        $ref: "#/definitions/License"
      },
      version: {
        type: "string"
      }
    },
    patternProperties: {
      "^x-": {}
    },
    additionalProperties: false
  },
  Contact: {
    type: "object",
    properties: {
      name: {
        type: "string"
      },
      url: {
        type: "string",
        format: "uri-reference"
      },
      email: {
        type: "string",
        format: "email"
      }
    },
    patternProperties: {
      "^x-": {}
    },
    additionalProperties: false
  },
  License: {
    type: "object",
    required: [
      "name"
    ],
    properties: {
      name: {
        type: "string"
      },
      url: {
        type: "string",
        format: "uri-reference"
      }
    },
    patternProperties: {
      "^x-": {}
    },
    additionalProperties: false
  },
  Server: {
    type: "object",
    required: [
      "url"
    ],
    properties: {
      url: {
        type: "string"
      },
      description: {
        type: "string"
      },
      variables: {
        type: "object",
        additionalProperties: {
          $ref: "#/definitions/ServerVariable"
        }
      }
    },
    patternProperties: {
      "^x-": {}
    },
    additionalProperties: false
  },
  ServerVariable: {
    type: "object",
    required: [
      "default"
    ],
    properties: {
      "enum": {
        type: "array",
        items: {
          type: "string"
        }
      },
      "default": {
        type: "string"
      },
      description: {
        type: "string"
      }
    },
    patternProperties: {
      "^x-": {}
    },
    additionalProperties: false
  },
  Components: {
    type: "object",
    properties: {
      schemas: {
        type: "object",
        patternProperties: {
          "^[a-zA-Z0-9\\.\\-_]+$": {
            oneOf: [
              {
                $ref: "#/definitions/Schema"
              },
              {
                $ref: "#/definitions/Reference"
              }
            ]
          }
        }
      },
      responses: {
        type: "object",
        patternProperties: {
          "^[a-zA-Z0-9\\.\\-_]+$": {
            oneOf: [
              {
                $ref: "#/definitions/Reference"
              },
              {
                $ref: "#/definitions/Response"
              }
            ]
          }
        }
      },
      parameters: {
        type: "object",
        patternProperties: {
          "^[a-zA-Z0-9\\.\\-_]+$": {
            oneOf: [
              {
                $ref: "#/definitions/Reference"
              },
              {
                $ref: "#/definitions/Parameter"
              }
            ]
          }
        }
      },
      examples: {
        type: "object",
        patternProperties: {
          "^[a-zA-Z0-9\\.\\-_]+$": {
            oneOf: [
              {
                $ref: "#/definitions/Reference"
              },
              {
                $ref: "#/definitions/Example"
              }
            ]
          }
        }
      },
      requestBodies: {
        type: "object",
        patternProperties: {
          "^[a-zA-Z0-9\\.\\-_]+$": {
            oneOf: [
              {
                $ref: "#/definitions/Reference"
              },
              {
                $ref: "#/definitions/RequestBody"
              }
            ]
          }
        }
      },
      headers: {
        type: "object",
        patternProperties: {
          "^[a-zA-Z0-9\\.\\-_]+$": {
            oneOf: [
              {
                $ref: "#/definitions/Reference"
              },
              {
                $ref: "#/definitions/Header"
              }
            ]
          }
        }
      },
      securitySchemes: {
        type: "object",
        patternProperties: {
          "^[a-zA-Z0-9\\.\\-_]+$": {
            oneOf: [
              {
                $ref: "#/definitions/Reference"
              },
              {
                $ref: "#/definitions/SecurityScheme"
              }
            ]
          }
        }
      },
      links: {
        type: "object",
        patternProperties: {
          "^[a-zA-Z0-9\\.\\-_]+$": {
            oneOf: [
              {
                $ref: "#/definitions/Reference"
              },
              {
                $ref: "#/definitions/Link"
              }
            ]
          }
        }
      },
      callbacks: {
        type: "object",
        patternProperties: {
          "^[a-zA-Z0-9\\.\\-_]+$": {
            oneOf: [
              {
                $ref: "#/definitions/Reference"
              },
              {
                $ref: "#/definitions/Callback"
              }
            ]
          }
        }
      }
    },
    patternProperties: {
      "^x-": {}
    },
    additionalProperties: false
  },
  Schema: {
    type: "object",
    properties: {
      title: {
        type: "string"
      },
      multipleOf: {
        type: "number",
        minimum: 0,
        exclusiveMinimum: true
      },
      maximum: {
        type: "number"
      },
      exclusiveMaximum: {
        type: "boolean",
        "default": false
      },
      minimum: {
        type: "number"
      },
      exclusiveMinimum: {
        type: "boolean",
        "default": false
      },
      maxLength: {
        type: "integer",
        minimum: 0
      },
      minLength: {
        type: "integer",
        minimum: 0,
        "default": 0
      },
      pattern: {
        type: "string",
        format: "regex"
      },
      maxItems: {
        type: "integer",
        minimum: 0
      },
      minItems: {
        type: "integer",
        minimum: 0,
        "default": 0
      },
      uniqueItems: {
        type: "boolean",
        "default": false
      },
      maxProperties: {
        type: "integer",
        minimum: 0
      },
      minProperties: {
        type: "integer",
        minimum: 0,
        "default": 0
      },
      required: {
        type: "array",
        items: {
          type: "string"
        },
        minItems: 1,
        uniqueItems: true
      },
      "enum": {
        type: "array",
        items: {},
        minItems: 1,
        uniqueItems: false
      },
      type: {
        type: "string",
        "enum": [
          "array",
          "boolean",
          "integer",
          "number",
          "object",
          "string"
        ]
      },
      not: {
        oneOf: [
          {
            $ref: "#/definitions/Schema"
          },
          {
            $ref: "#/definitions/Reference"
          }
        ]
      },
      allOf: {
        type: "array",
        items: {
          oneOf: [
            {
              $ref: "#/definitions/Schema"
            },
            {
              $ref: "#/definitions/Reference"
            }
          ]
        }
      },
      oneOf: {
        type: "array",
        items: {
          oneOf: [
            {
              $ref: "#/definitions/Schema"
            },
            {
              $ref: "#/definitions/Reference"
            }
          ]
        }
      },
      anyOf: {
        type: "array",
        items: {
          oneOf: [
            {
              $ref: "#/definitions/Schema"
            },
            {
              $ref: "#/definitions/Reference"
            }
          ]
        }
      },
      items: {
        oneOf: [
          {
            $ref: "#/definitions/Schema"
          },
          {
            $ref: "#/definitions/Reference"
          }
        ]
      },
      properties: {
        type: "object",
        additionalProperties: {
          oneOf: [
            {
              $ref: "#/definitions/Schema"
            },
            {
              $ref: "#/definitions/Reference"
            }
          ]
        }
      },
      additionalProperties: {
        oneOf: [
          {
            $ref: "#/definitions/Schema"
          },
          {
            $ref: "#/definitions/Reference"
          },
          {
            type: "boolean"
          }
        ],
        "default": true
      },
      description: {
        type: "string"
      },
      format: {
        type: "string"
      },
      "default": {},
      nullable: {
        type: "boolean",
        "default": false
      },
      discriminator: {
        $ref: "#/definitions/Discriminator"
      },
      readOnly: {
        type: "boolean",
        "default": false
      },
      writeOnly: {
        type: "boolean",
        "default": false
      },
      example: {},
      externalDocs: {
        $ref: "#/definitions/ExternalDocumentation"
      },
      deprecated: {
        type: "boolean",
        "default": false
      },
      xml: {
        $ref: "#/definitions/XML"
      }
    },
    patternProperties: {
      "^x-": {}
    },
    additionalProperties: false
  },
  Discriminator: {
    type: "object",
    required: [
      "propertyName"
    ],
    properties: {
      propertyName: {
        type: "string"
      },
      mapping: {
        type: "object",
        additionalProperties: {
          type: "string"
        }
      }
    }
  },
  XML: {
    type: "object",
    properties: {
      name: {
        type: "string"
      },
      namespace: {
        type: "string",
        format: "uri"
      },
      prefix: {
        type: "string"
      },
      attribute: {
        type: "boolean",
        "default": false
      },
      wrapped: {
        type: "boolean",
        "default": false
      }
    },
    patternProperties: {
      "^x-": {}
    },
    additionalProperties: false
  },
  Response: {
    type: "object",
    required: [
      "description"
    ],
    properties: {
      description: {
        type: "string"
      },
      headers: {
        type: "object",
        additionalProperties: {
          oneOf: [
            {
              $ref: "#/definitions/Header"
            },
            {
              $ref: "#/definitions/Reference"
            }
          ]
        }
      },
      content: {
        type: "object",
        additionalProperties: {
          $ref: "#/definitions/MediaType"
        }
      },
      links: {
        type: "object",
        additionalProperties: {
          oneOf: [
            {
              $ref: "#/definitions/Link"
            },
            {
              $ref: "#/definitions/Reference"
            }
          ]
        }
      }
    },
    patternProperties: {
      "^x-": {}
    },
    additionalProperties: false
  },
  MediaType: {
    type: "object",
    properties: {
      schema: {
        oneOf: [
          {
            $ref: "#/definitions/Schema"
          },
          {
            $ref: "#/definitions/Reference"
          }
        ]
      },
      example: {},
      examples: {
        type: "object",
        additionalProperties: {
          oneOf: [
            {
              $ref: "#/definitions/Example"
            },
            {
              $ref: "#/definitions/Reference"
            }
          ]
        }
      },
      encoding: {
        type: "object",
        additionalProperties: {
          $ref: "#/definitions/Encoding"
        }
      }
    },
    patternProperties: {
      "^x-": {}
    },
    additionalProperties: false,
    allOf: [
      {
        $ref: "#/definitions/ExampleXORExamples"
      }
    ]
  },
  Example: {
    type: "object",
    properties: {
      summary: {
        type: "string"
      },
      description: {
        type: "string"
      },
      value: {},
      externalValue: {
        type: "string",
        format: "uri-reference"
      }
    },
    patternProperties: {
      "^x-": {}
    },
    additionalProperties: false
  },
  Header: {
    type: "object",
    properties: {
      description: {
        type: "string"
      },
      required: {
        type: "boolean",
        "default": false
      },
      deprecated: {
        type: "boolean",
        "default": false
      },
      allowEmptyValue: {
        type: "boolean",
        "default": false
      },
      style: {
        type: "string",
        "enum": [
          "simple"
        ],
        "default": "simple"
      },
      explode: {
        type: "boolean"
      },
      allowReserved: {
        type: "boolean",
        "default": false
      },
      schema: {
        oneOf: [
          {
            $ref: "#/definitions/Schema"
          },
          {
            $ref: "#/definitions/Reference"
          }
        ]
      },
      content: {
        type: "object",
        additionalProperties: {
          $ref: "#/definitions/MediaType"
        },
        minProperties: 1,
        maxProperties: 1
      },
      example: {},
      examples: {
        type: "object",
        additionalProperties: {
          oneOf: [
            {
              $ref: "#/definitions/Example"
            },
            {
              $ref: "#/definitions/Reference"
            }
          ]
        }
      }
    },
    patternProperties: {
      "^x-": {}
    },
    additionalProperties: false,
    allOf: [
      {
        $ref: "#/definitions/ExampleXORExamples"
      },
      {
        $ref: "#/definitions/SchemaXORContent"
      }
    ]
  },
  Paths: {
    type: "object",
    patternProperties: {
      "^\\/": {
        $ref: "#/definitions/PathItem"
      },
      "^x-": {}
    },
    additionalProperties: false
  },
  PathItem: {
    type: "object",
    properties: {
      $ref: {
        type: "string"
      },
      summary: {
        type: "string"
      },
      description: {
        type: "string"
      },
      servers: {
        type: "array",
        items: {
          $ref: "#/definitions/Server"
        }
      },
      parameters: {
        type: "array",
        items: {
          oneOf: [
            {
              $ref: "#/definitions/Parameter"
            },
            {
              $ref: "#/definitions/Reference"
            }
          ]
        },
        uniqueItems: true
      }
    },
    patternProperties: {
      "^(get|put|post|delete|options|head|patch|trace)$": {
        $ref: "#/definitions/Operation"
      },
      "^x-": {}
    },
    additionalProperties: false
  },
  Operation: {
    type: "object",
    required: [
      "responses"
    ],
    properties: {
      tags: {
        type: "array",
        items: {
          type: "string"
        }
      },
      summary: {
        type: "string"
      },
      description: {
        type: "string"
      },
      externalDocs: {
        $ref: "#/definitions/ExternalDocumentation"
      },
      operationId: {
        type: "string"
      },
      parameters: {
        type: "array",
        items: {
          oneOf: [
            {
              $ref: "#/definitions/Parameter"
            },
            {
              $ref: "#/definitions/Reference"
            }
          ]
        },
        uniqueItems: true
      },
      requestBody: {
        oneOf: [
          {
            $ref: "#/definitions/RequestBody"
          },
          {
            $ref: "#/definitions/Reference"
          }
        ]
      },
      responses: {
        $ref: "#/definitions/Responses"
      },
      callbacks: {
        type: "object",
        additionalProperties: {
          oneOf: [
            {
              $ref: "#/definitions/Callback"
            },
            {
              $ref: "#/definitions/Reference"
            }
          ]
        }
      },
      deprecated: {
        type: "boolean",
        "default": false
      },
      security: {
        type: "array",
        items: {
          $ref: "#/definitions/SecurityRequirement"
        }
      },
      servers: {
        type: "array",
        items: {
          $ref: "#/definitions/Server"
        }
      }
    },
    patternProperties: {
      "^x-": {}
    },
    additionalProperties: false
  },
  Responses: {
    type: "object",
    properties: {
      "default": {
        oneOf: [
          {
            $ref: "#/definitions/Response"
          },
          {
            $ref: "#/definitions/Reference"
          }
        ]
      }
    },
    patternProperties: {
      "^[1-5](?:\\d{2}|XX)$": {
        oneOf: [
          {
            $ref: "#/definitions/Response"
          },
          {
            $ref: "#/definitions/Reference"
          }
        ]
      },
      "^x-": {}
    },
    minProperties: 1,
    additionalProperties: false
  },
  SecurityRequirement: {
    type: "object",
    additionalProperties: {
      type: "array",
      items: {
        type: "string"
      }
    }
  },
  Tag: {
    type: "object",
    required: [
      "name"
    ],
    properties: {
      name: {
        type: "string"
      },
      description: {
        type: "string"
      },
      externalDocs: {
        $ref: "#/definitions/ExternalDocumentation"
      }
    },
    patternProperties: {
      "^x-": {}
    },
    additionalProperties: false
  },
  ExternalDocumentation: {
    type: "object",
    required: [
      "url"
    ],
    properties: {
      description: {
        type: "string"
      },
      url: {
        type: "string",
        format: "uri-reference"
      }
    },
    patternProperties: {
      "^x-": {}
    },
    additionalProperties: false
  },
  ExampleXORExamples: {
    description: "Example and examples are mutually exclusive",
    not: {
      required: [
        "example",
        "examples"
      ]
    }
  },
  SchemaXORContent: {
    description: "Schema and content are mutually exclusive, at least one is required",
    not: {
      required: [
        "schema",
        "content"
      ]
    },
    oneOf: [
      {
        required: [
          "schema"
        ]
      },
      {
        required: [
          "content"
        ],
        description: "Some properties are not allowed if content is present",
        allOf: [
          {
            not: {
              required: [
                "style"
              ]
            }
          },
          {
            not: {
              required: [
                "explode"
              ]
            }
          },
          {
            not: {
              required: [
                "allowReserved"
              ]
            }
          },
          {
            not: {
              required: [
                "example"
              ]
            }
          },
          {
            not: {
              required: [
                "examples"
              ]
            }
          }
        ]
      }
    ]
  },
  Parameter: {
    type: "object",
    properties: {
      name: {
        type: "string"
      },
      "in": {
        type: "string"
      },
      description: {
        type: "string"
      },
      required: {
        type: "boolean",
        "default": false
      },
      deprecated: {
        type: "boolean",
        "default": false
      },
      allowEmptyValue: {
        type: "boolean",
        "default": false
      },
      style: {
        type: "string"
      },
      explode: {
        type: "boolean"
      },
      allowReserved: {
        type: "boolean",
        "default": false
      },
      schema: {
        oneOf: [
          {
            $ref: "#/definitions/Schema"
          },
          {
            $ref: "#/definitions/Reference"
          }
        ]
      },
      content: {
        type: "object",
        additionalProperties: {
          $ref: "#/definitions/MediaType"
        },
        minProperties: 1,
        maxProperties: 1
      },
      example: {},
      examples: {
        type: "object",
        additionalProperties: {
          oneOf: [
            {
              $ref: "#/definitions/Example"
            },
            {
              $ref: "#/definitions/Reference"
            }
          ]
        }
      }
    },
    patternProperties: {
      "^x-": {}
    },
    additionalProperties: false,
    required: [
      "name",
      "in"
    ],
    allOf: [
      {
        $ref: "#/definitions/ExampleXORExamples"
      },
      {
        $ref: "#/definitions/SchemaXORContent"
      },
      {
        $ref: "#/definitions/ParameterLocation"
      }
    ]
  },
  ParameterLocation: {
    description: "Parameter location",
    oneOf: [
      {
        description: "Parameter in path",
        required: [
          "required"
        ],
        properties: {
          "in": {
            "enum": [
              "path"
            ]
          },
          style: {
            "enum": [
              "matrix",
              "label",
              "simple"
            ],
            "default": "simple"
          },
          required: {
            "enum": [
              true
            ]
          }
        }
      },
      {
        description: "Parameter in query",
        properties: {
          "in": {
            "enum": [
              "query"
            ]
          },
          style: {
            "enum": [
              "form",
              "spaceDelimited",
              "pipeDelimited",
              "deepObject"
            ],
            "default": "form"
          }
        }
      },
      {
        description: "Parameter in header",
        properties: {
          "in": {
            "enum": [
              "header"
            ]
          },
          style: {
            "enum": [
              "simple"
            ],
            "default": "simple"
          }
        }
      },
      {
        description: "Parameter in cookie",
        properties: {
          "in": {
            "enum": [
              "cookie"
            ]
          },
          style: {
            "enum": [
              "form"
            ],
            "default": "form"
          }
        }
      }
    ]
  },
  RequestBody: {
    type: "object",
    required: [
      "content"
    ],
    properties: {
      description: {
        type: "string"
      },
      content: {
        type: "object",
        additionalProperties: {
          $ref: "#/definitions/MediaType"
        }
      },
      required: {
        type: "boolean",
        "default": false
      }
    },
    patternProperties: {
      "^x-": {}
    },
    additionalProperties: false
  },
  SecurityScheme: {
    oneOf: [
      {
        $ref: "#/definitions/APIKeySecurityScheme"
      },
      {
        $ref: "#/definitions/HTTPSecurityScheme"
      },
      {
        $ref: "#/definitions/OAuth2SecurityScheme"
      },
      {
        $ref: "#/definitions/OpenIdConnectSecurityScheme"
      }
    ]
  },
  APIKeySecurityScheme: {
    type: "object",
    required: [
      "type",
      "name",
      "in"
    ],
    properties: {
      type: {
        type: "string",
        "enum": [
          "apiKey"
        ]
      },
      name: {
        type: "string"
      },
      "in": {
        type: "string",
        "enum": [
          "header",
          "query",
          "cookie"
        ]
      },
      description: {
        type: "string"
      }
    },
    patternProperties: {
      "^x-": {}
    },
    additionalProperties: false
  },
  HTTPSecurityScheme: {
    type: "object",
    required: [
      "scheme",
      "type"
    ],
    properties: {
      scheme: {
        type: "string"
      },
      bearerFormat: {
        type: "string"
      },
      description: {
        type: "string"
      },
      type: {
        type: "string",
        "enum": [
          "http"
        ]
      }
    },
    patternProperties: {
      "^x-": {}
    },
    additionalProperties: false,
    oneOf: [
      {
        description: "Bearer",
        properties: {
          scheme: {
            type: "string",
            pattern: "^[Bb][Ee][Aa][Rr][Ee][Rr]$"
          }
        }
      },
      {
        description: "Non Bearer",
        not: {
          required: [
            "bearerFormat"
          ]
        },
        properties: {
          scheme: {
            not: {
              type: "string",
              pattern: "^[Bb][Ee][Aa][Rr][Ee][Rr]$"
            }
          }
        }
      }
    ]
  },
  OAuth2SecurityScheme: {
    type: "object",
    required: [
      "type",
      "flows"
    ],
    properties: {
      type: {
        type: "string",
        "enum": [
          "oauth2"
        ]
      },
      flows: {
        $ref: "#/definitions/OAuthFlows"
      },
      description: {
        type: "string"
      }
    },
    patternProperties: {
      "^x-": {}
    },
    additionalProperties: false
  },
  OpenIdConnectSecurityScheme: {
    type: "object",
    required: [
      "type",
      "openIdConnectUrl"
    ],
    properties: {
      type: {
        type: "string",
        "enum": [
          "openIdConnect"
        ]
      },
      openIdConnectUrl: {
        type: "string",
        format: "uri-reference"
      },
      description: {
        type: "string"
      }
    },
    patternProperties: {
      "^x-": {}
    },
    additionalProperties: false
  },
  OAuthFlows: {
    type: "object",
    properties: {
      implicit: {
        $ref: "#/definitions/ImplicitOAuthFlow"
      },
      password: {
        $ref: "#/definitions/PasswordOAuthFlow"
      },
      clientCredentials: {
        $ref: "#/definitions/ClientCredentialsFlow"
      },
      authorizationCode: {
        $ref: "#/definitions/AuthorizationCodeOAuthFlow"
      }
    },
    patternProperties: {
      "^x-": {}
    },
    additionalProperties: false
  },
  ImplicitOAuthFlow: {
    type: "object",
    required: [
      "authorizationUrl",
      "scopes"
    ],
    properties: {
      authorizationUrl: {
        type: "string",
        format: "uri-reference"
      },
      refreshUrl: {
        type: "string",
        format: "uri-reference"
      },
      scopes: {
        type: "object",
        additionalProperties: {
          type: "string"
        }
      }
    },
    patternProperties: {
      "^x-": {}
    },
    additionalProperties: false
  },
  PasswordOAuthFlow: {
    type: "object",
    required: [
      "tokenUrl",
      "scopes"
    ],
    properties: {
      tokenUrl: {
        type: "string",
        format: "uri-reference"
      },
      refreshUrl: {
        type: "string",
        format: "uri-reference"
      },
      scopes: {
        type: "object",
        additionalProperties: {
          type: "string"
        }
      }
    },
    patternProperties: {
      "^x-": {}
    },
    additionalProperties: false
  },
  ClientCredentialsFlow: {
    type: "object",
    required: [
      "tokenUrl",
      "scopes"
    ],
    properties: {
      tokenUrl: {
        type: "string",
        format: "uri-reference"
      },
      refreshUrl: {
        type: "string",
        format: "uri-reference"
      },
      scopes: {
        type: "object",
        additionalProperties: {
          type: "string"
        }
      }
    },
    patternProperties: {
      "^x-": {}
    },
    additionalProperties: false
  },
  AuthorizationCodeOAuthFlow: {
    type: "object",
    required: [
      "authorizationUrl",
      "tokenUrl",
      "scopes"
    ],
    properties: {
      authorizationUrl: {
        type: "string",
        format: "uri-reference"
      },
      tokenUrl: {
        type: "string",
        format: "uri-reference"
      },
      refreshUrl: {
        type: "string",
        format: "uri-reference"
      },
      scopes: {
        type: "object",
        additionalProperties: {
          type: "string"
        }
      }
    },
    patternProperties: {
      "^x-": {}
    },
    additionalProperties: false
  },
  Link: {
    type: "object",
    properties: {
      operationId: {
        type: "string"
      },
      operationRef: {
        type: "string",
        format: "uri-reference"
      },
      parameters: {
        type: "object",
        additionalProperties: {}
      },
      requestBody: {},
      description: {
        type: "string"
      },
      server: {
        $ref: "#/definitions/Server"
      }
    },
    patternProperties: {
      "^x-": {}
    },
    additionalProperties: false,
    not: {
      description: "Operation Id and Operation Ref are mutually exclusive",
      required: [
        "operationId",
        "operationRef"
      ]
    }
  },
  Callback: {
    type: "object",
    additionalProperties: {
      $ref: "#/definitions/PathItem"
    },
    patternProperties: {
      "^x-": {}
    }
  },
  Encoding: {
    type: "object",
    properties: {
      contentType: {
        type: "string"
      },
      headers: {
        type: "object",
        additionalProperties: {
          oneOf: [
            {
              $ref: "#/definitions/Header"
            },
            {
              $ref: "#/definitions/Reference"
            }
          ]
        }
      },
      style: {
        type: "string",
        "enum": [
          "form",
          "spaceDelimited",
          "pipeDelimited",
          "deepObject"
        ]
      },
      explode: {
        type: "boolean"
      },
      allowReserved: {
        type: "boolean",
        "default": false
      }
    },
    additionalProperties: false
  }
};
var OpenApi30 = {
  id: id$1,
  $schema: $schema$1,
  description: description$1,
  type: type$1,
  required: required$1,
  properties: properties$2,
  patternProperties,
  additionalProperties,
  definitions
};
var $id = "https://spec.openapis.org/oas/3.1/schema/2022-10-07";
var $schema = "https://json-schema.org/draft/2020-12/schema";
var description = "The description of OpenAPI v3.1.x documents without schema validation, as defined by https://spec.openapis.org/oas/v3.1.0";
var type = "object";
var properties$1 = {
  openapi: {
    type: "string",
    pattern: "^3\\.1\\.\\d+(-.+)?$"
  },
  info: {
    $ref: "#/$defs/info"
  },
  jsonSchemaDialect: {
    type: "string",
    format: "uri",
    "default": "https://spec.openapis.org/oas/3.1/dialect/base"
  },
  servers: {
    type: "array",
    items: {
      $ref: "#/$defs/server"
    },
    "default": [
      {
        url: "/"
      }
    ]
  },
  paths: {
    $ref: "#/$defs/paths"
  },
  webhooks: {
    type: "object",
    additionalProperties: {
      $ref: "#/$defs/path-item-or-reference"
    }
  },
  components: {
    $ref: "#/$defs/components"
  },
  security: {
    type: "array",
    items: {
      $ref: "#/$defs/security-requirement"
    }
  },
  tags: {
    type: "array",
    items: {
      $ref: "#/$defs/tag"
    }
  },
  externalDocs: {
    $ref: "#/$defs/external-documentation"
  }
};
var required = [
  "openapi",
  "info"
];
var anyOf = [
  {
    required: [
      "paths"
    ]
  },
  {
    required: [
      "components"
    ]
  },
  {
    required: [
      "webhooks"
    ]
  }
];
var $ref = "#/$defs/specification-extensions";
var unevaluatedProperties = false;
var $defs = {
  info: {
    $comment: "https://spec.openapis.org/oas/v3.1.0#info-object",
    type: "object",
    properties: {
      title: {
        type: "string"
      },
      summary: {
        type: "string"
      },
      description: {
        type: "string"
      },
      termsOfService: {
        type: "string",
        format: "uri"
      },
      contact: {
        $ref: "#/$defs/contact"
      },
      license: {
        $ref: "#/$defs/license"
      },
      version: {
        type: "string"
      }
    },
    required: [
      "title",
      "version"
    ],
    $ref: "#/$defs/specification-extensions",
    unevaluatedProperties: false
  },
  contact: {
    $comment: "https://spec.openapis.org/oas/v3.1.0#contact-object",
    type: "object",
    properties: {
      name: {
        type: "string"
      },
      url: {
        type: "string",
        format: "uri"
      },
      email: {
        type: "string",
        format: "email"
      }
    },
    $ref: "#/$defs/specification-extensions",
    unevaluatedProperties: false
  },
  license: {
    $comment: "https://spec.openapis.org/oas/v3.1.0#license-object",
    type: "object",
    properties: {
      name: {
        type: "string"
      },
      identifier: {
        type: "string"
      },
      url: {
        type: "string",
        format: "uri"
      }
    },
    required: [
      "name"
    ],
    dependentSchemas: {
      identifier: {
        not: {
          required: [
            "url"
          ]
        }
      }
    },
    $ref: "#/$defs/specification-extensions",
    unevaluatedProperties: false
  },
  server: {
    $comment: "https://spec.openapis.org/oas/v3.1.0#server-object",
    type: "object",
    properties: {
      url: {
        type: "string"
      },
      description: {
        type: "string"
      },
      variables: {
        type: "object",
        additionalProperties: {
          $ref: "#/$defs/server-variable"
        }
      }
    },
    required: [
      "url"
    ],
    $ref: "#/$defs/specification-extensions",
    unevaluatedProperties: false
  },
  "server-variable": {
    $comment: "https://spec.openapis.org/oas/v3.1.0#server-variable-object",
    type: "object",
    properties: {
      "enum": {
        type: "array",
        items: {
          type: "string"
        },
        minItems: 1
      },
      "default": {
        type: "string"
      },
      description: {
        type: "string"
      }
    },
    required: [
      "default"
    ],
    $ref: "#/$defs/specification-extensions",
    unevaluatedProperties: false
  },
  components: {
    $comment: "https://spec.openapis.org/oas/v3.1.0#components-object",
    type: "object",
    properties: {
      schemas: {
        type: "object",
        additionalProperties: {
          $ref: "#/$defs/schema"
        }
      },
      responses: {
        type: "object",
        additionalProperties: {
          $ref: "#/$defs/response-or-reference"
        }
      },
      parameters: {
        type: "object",
        additionalProperties: {
          $ref: "#/$defs/parameter-or-reference"
        }
      },
      examples: {
        type: "object",
        additionalProperties: {
          $ref: "#/$defs/example-or-reference"
        }
      },
      requestBodies: {
        type: "object",
        additionalProperties: {
          $ref: "#/$defs/request-body-or-reference"
        }
      },
      headers: {
        type: "object",
        additionalProperties: {
          $ref: "#/$defs/header-or-reference"
        }
      },
      securitySchemes: {
        type: "object",
        additionalProperties: {
          $ref: "#/$defs/security-scheme-or-reference"
        }
      },
      links: {
        type: "object",
        additionalProperties: {
          $ref: "#/$defs/link-or-reference"
        }
      },
      callbacks: {
        type: "object",
        additionalProperties: {
          $ref: "#/$defs/callbacks-or-reference"
        }
      },
      pathItems: {
        type: "object",
        additionalProperties: {
          $ref: "#/$defs/path-item-or-reference"
        }
      }
    },
    patternProperties: {
      "^(schemas|responses|parameters|examples|requestBodies|headers|securitySchemes|links|callbacks|pathItems)$": {
        $comment: "Enumerating all of the property names in the regex above is necessary for unevaluatedProperties to work as expected",
        propertyNames: {
          pattern: "^[a-zA-Z0-9._-]+$"
        }
      }
    },
    $ref: "#/$defs/specification-extensions",
    unevaluatedProperties: false
  },
  paths: {
    $comment: "https://spec.openapis.org/oas/v3.1.0#paths-object",
    type: "object",
    patternProperties: {
      "^/": {
        $ref: "#/$defs/path-item"
      }
    },
    $ref: "#/$defs/specification-extensions",
    unevaluatedProperties: false
  },
  "path-item": {
    $comment: "https://spec.openapis.org/oas/v3.1.0#path-item-object",
    type: "object",
    properties: {
      summary: {
        type: "string"
      },
      description: {
        type: "string"
      },
      servers: {
        type: "array",
        items: {
          $ref: "#/$defs/server"
        }
      },
      parameters: {
        type: "array",
        items: {
          $ref: "#/$defs/parameter-or-reference"
        }
      },
      get: {
        $ref: "#/$defs/operation"
      },
      put: {
        $ref: "#/$defs/operation"
      },
      post: {
        $ref: "#/$defs/operation"
      },
      "delete": {
        $ref: "#/$defs/operation"
      },
      options: {
        $ref: "#/$defs/operation"
      },
      head: {
        $ref: "#/$defs/operation"
      },
      patch: {
        $ref: "#/$defs/operation"
      },
      trace: {
        $ref: "#/$defs/operation"
      }
    },
    $ref: "#/$defs/specification-extensions",
    unevaluatedProperties: false
  },
  "path-item-or-reference": {
    "if": {
      type: "object",
      required: [
        "$ref"
      ]
    },
    then: {
      $ref: "#/$defs/reference"
    },
    "else": {
      $ref: "#/$defs/path-item"
    }
  },
  operation: {
    $comment: "https://spec.openapis.org/oas/v3.1.0#operation-object",
    type: "object",
    properties: {
      tags: {
        type: "array",
        items: {
          type: "string"
        }
      },
      summary: {
        type: "string"
      },
      description: {
        type: "string"
      },
      externalDocs: {
        $ref: "#/$defs/external-documentation"
      },
      operationId: {
        type: "string"
      },
      parameters: {
        type: "array",
        items: {
          $ref: "#/$defs/parameter-or-reference"
        }
      },
      requestBody: {
        $ref: "#/$defs/request-body-or-reference"
      },
      responses: {
        $ref: "#/$defs/responses"
      },
      callbacks: {
        type: "object",
        additionalProperties: {
          $ref: "#/$defs/callbacks-or-reference"
        }
      },
      deprecated: {
        "default": false,
        type: "boolean"
      },
      security: {
        type: "array",
        items: {
          $ref: "#/$defs/security-requirement"
        }
      },
      servers: {
        type: "array",
        items: {
          $ref: "#/$defs/server"
        }
      }
    },
    $ref: "#/$defs/specification-extensions",
    unevaluatedProperties: false
  },
  "external-documentation": {
    $comment: "https://spec.openapis.org/oas/v3.1.0#external-documentation-object",
    type: "object",
    properties: {
      description: {
        type: "string"
      },
      url: {
        type: "string",
        format: "uri"
      }
    },
    required: [
      "url"
    ],
    $ref: "#/$defs/specification-extensions",
    unevaluatedProperties: false
  },
  parameter: {
    $comment: "https://spec.openapis.org/oas/v3.1.0#parameter-object",
    type: "object",
    properties: {
      name: {
        type: "string"
      },
      "in": {
        "enum": [
          "query",
          "header",
          "path",
          "cookie"
        ]
      },
      description: {
        type: "string"
      },
      required: {
        "default": false,
        type: "boolean"
      },
      deprecated: {
        "default": false,
        type: "boolean"
      },
      schema: {
        $ref: "#/$defs/schema"
      },
      content: {
        $ref: "#/$defs/content",
        minProperties: 1,
        maxProperties: 1
      }
    },
    required: [
      "name",
      "in"
    ],
    oneOf: [
      {
        required: [
          "schema"
        ]
      },
      {
        required: [
          "content"
        ]
      }
    ],
    "if": {
      properties: {
        "in": {
          "const": "query"
        }
      },
      required: [
        "in"
      ]
    },
    then: {
      properties: {
        allowEmptyValue: {
          "default": false,
          type: "boolean"
        }
      }
    },
    dependentSchemas: {
      schema: {
        properties: {
          style: {
            type: "string"
          },
          explode: {
            type: "boolean"
          }
        },
        allOf: [
          {
            $ref: "#/$defs/examples"
          },
          {
            $ref: "#/$defs/parameter/dependentSchemas/schema/$defs/styles-for-path"
          },
          {
            $ref: "#/$defs/parameter/dependentSchemas/schema/$defs/styles-for-header"
          },
          {
            $ref: "#/$defs/parameter/dependentSchemas/schema/$defs/styles-for-query"
          },
          {
            $ref: "#/$defs/parameter/dependentSchemas/schema/$defs/styles-for-cookie"
          },
          {
            $ref: "#/$defs/parameter/dependentSchemas/schema/$defs/styles-for-form"
          }
        ],
        $defs: {
          "styles-for-path": {
            "if": {
              properties: {
                "in": {
                  "const": "path"
                }
              },
              required: [
                "in"
              ]
            },
            then: {
              properties: {
                name: {
                  pattern: "[^/#?]+$"
                },
                style: {
                  "default": "simple",
                  "enum": [
                    "matrix",
                    "label",
                    "simple"
                  ]
                },
                required: {
                  "const": true
                }
              },
              required: [
                "required"
              ]
            }
          },
          "styles-for-header": {
            "if": {
              properties: {
                "in": {
                  "const": "header"
                }
              },
              required: [
                "in"
              ]
            },
            then: {
              properties: {
                style: {
                  "default": "simple",
                  "const": "simple"
                }
              }
            }
          },
          "styles-for-query": {
            "if": {
              properties: {
                "in": {
                  "const": "query"
                }
              },
              required: [
                "in"
              ]
            },
            then: {
              properties: {
                style: {
                  "default": "form",
                  "enum": [
                    "form",
                    "spaceDelimited",
                    "pipeDelimited",
                    "deepObject"
                  ]
                },
                allowReserved: {
                  "default": false,
                  type: "boolean"
                }
              }
            }
          },
          "styles-for-cookie": {
            "if": {
              properties: {
                "in": {
                  "const": "cookie"
                }
              },
              required: [
                "in"
              ]
            },
            then: {
              properties: {
                style: {
                  "default": "form",
                  "const": "form"
                }
              }
            }
          },
          "styles-for-form": {
            "if": {
              properties: {
                style: {
                  "const": "form"
                }
              },
              required: [
                "style"
              ]
            },
            then: {
              properties: {
                explode: {
                  "default": true
                }
              }
            },
            "else": {
              properties: {
                explode: {
                  "default": false
                }
              }
            }
          }
        }
      }
    },
    $ref: "#/$defs/specification-extensions",
    unevaluatedProperties: false
  },
  "parameter-or-reference": {
    "if": {
      type: "object",
      required: [
        "$ref"
      ]
    },
    then: {
      $ref: "#/$defs/reference"
    },
    "else": {
      $ref: "#/$defs/parameter"
    }
  },
  "request-body": {
    $comment: "https://spec.openapis.org/oas/v3.1.0#request-body-object",
    type: "object",
    properties: {
      description: {
        type: "string"
      },
      content: {
        $ref: "#/$defs/content"
      },
      required: {
        "default": false,
        type: "boolean"
      }
    },
    required: [
      "content"
    ],
    $ref: "#/$defs/specification-extensions",
    unevaluatedProperties: false
  },
  "request-body-or-reference": {
    "if": {
      type: "object",
      required: [
        "$ref"
      ]
    },
    then: {
      $ref: "#/$defs/reference"
    },
    "else": {
      $ref: "#/$defs/request-body"
    }
  },
  content: {
    $comment: "https://spec.openapis.org/oas/v3.1.0#fixed-fields-10",
    type: "object",
    additionalProperties: {
      $ref: "#/$defs/media-type"
    },
    propertyNames: {
      format: "media-range"
    }
  },
  "media-type": {
    $comment: "https://spec.openapis.org/oas/v3.1.0#media-type-object",
    type: "object",
    properties: {
      schema: {
        $ref: "#/$defs/schema"
      },
      encoding: {
        type: "object",
        additionalProperties: {
          $ref: "#/$defs/encoding"
        }
      }
    },
    allOf: [
      {
        $ref: "#/$defs/specification-extensions"
      },
      {
        $ref: "#/$defs/examples"
      }
    ],
    unevaluatedProperties: false
  },
  encoding: {
    $comment: "https://spec.openapis.org/oas/v3.1.0#encoding-object",
    type: "object",
    properties: {
      contentType: {
        type: "string",
        format: "media-range"
      },
      headers: {
        type: "object",
        additionalProperties: {
          $ref: "#/$defs/header-or-reference"
        }
      },
      style: {
        "default": "form",
        "enum": [
          "form",
          "spaceDelimited",
          "pipeDelimited",
          "deepObject"
        ]
      },
      explode: {
        type: "boolean"
      },
      allowReserved: {
        "default": false,
        type: "boolean"
      }
    },
    allOf: [
      {
        $ref: "#/$defs/specification-extensions"
      },
      {
        $ref: "#/$defs/encoding/$defs/explode-default"
      }
    ],
    unevaluatedProperties: false,
    $defs: {
      "explode-default": {
        "if": {
          properties: {
            style: {
              "const": "form"
            }
          },
          required: [
            "style"
          ]
        },
        then: {
          properties: {
            explode: {
              "default": true
            }
          }
        },
        "else": {
          properties: {
            explode: {
              "default": false
            }
          }
        }
      }
    }
  },
  responses: {
    $comment: "https://spec.openapis.org/oas/v3.1.0#responses-object",
    type: "object",
    properties: {
      "default": {
        $ref: "#/$defs/response-or-reference"
      }
    },
    patternProperties: {
      "^[1-5](?:[0-9]{2}|XX)$": {
        $ref: "#/$defs/response-or-reference"
      }
    },
    minProperties: 1,
    $ref: "#/$defs/specification-extensions",
    unevaluatedProperties: false
  },
  response: {
    $comment: "https://spec.openapis.org/oas/v3.1.0#response-object",
    type: "object",
    properties: {
      description: {
        type: "string"
      },
      headers: {
        type: "object",
        additionalProperties: {
          $ref: "#/$defs/header-or-reference"
        }
      },
      content: {
        $ref: "#/$defs/content"
      },
      links: {
        type: "object",
        additionalProperties: {
          $ref: "#/$defs/link-or-reference"
        }
      }
    },
    required: [
      "description"
    ],
    $ref: "#/$defs/specification-extensions",
    unevaluatedProperties: false
  },
  "response-or-reference": {
    "if": {
      type: "object",
      required: [
        "$ref"
      ]
    },
    then: {
      $ref: "#/$defs/reference"
    },
    "else": {
      $ref: "#/$defs/response"
    }
  },
  callbacks: {
    $comment: "https://spec.openapis.org/oas/v3.1.0#callback-object",
    type: "object",
    $ref: "#/$defs/specification-extensions",
    additionalProperties: {
      $ref: "#/$defs/path-item-or-reference"
    }
  },
  "callbacks-or-reference": {
    "if": {
      type: "object",
      required: [
        "$ref"
      ]
    },
    then: {
      $ref: "#/$defs/reference"
    },
    "else": {
      $ref: "#/$defs/callbacks"
    }
  },
  example: {
    $comment: "https://spec.openapis.org/oas/v3.1.0#example-object",
    type: "object",
    properties: {
      summary: {
        type: "string"
      },
      description: {
        type: "string"
      },
      value: true,
      externalValue: {
        type: "string",
        format: "uri"
      }
    },
    not: {
      required: [
        "value",
        "externalValue"
      ]
    },
    $ref: "#/$defs/specification-extensions",
    unevaluatedProperties: false
  },
  "example-or-reference": {
    "if": {
      type: "object",
      required: [
        "$ref"
      ]
    },
    then: {
      $ref: "#/$defs/reference"
    },
    "else": {
      $ref: "#/$defs/example"
    }
  },
  link: {
    $comment: "https://spec.openapis.org/oas/v3.1.0#link-object",
    type: "object",
    properties: {
      operationRef: {
        type: "string",
        format: "uri-reference"
      },
      operationId: {
        type: "string"
      },
      parameters: {
        $ref: "#/$defs/map-of-strings"
      },
      requestBody: true,
      description: {
        type: "string"
      },
      body: {
        $ref: "#/$defs/server"
      }
    },
    oneOf: [
      {
        required: [
          "operationRef"
        ]
      },
      {
        required: [
          "operationId"
        ]
      }
    ],
    $ref: "#/$defs/specification-extensions",
    unevaluatedProperties: false
  },
  "link-or-reference": {
    "if": {
      type: "object",
      required: [
        "$ref"
      ]
    },
    then: {
      $ref: "#/$defs/reference"
    },
    "else": {
      $ref: "#/$defs/link"
    }
  },
  header: {
    $comment: "https://spec.openapis.org/oas/v3.1.0#header-object",
    type: "object",
    properties: {
      description: {
        type: "string"
      },
      required: {
        "default": false,
        type: "boolean"
      },
      deprecated: {
        "default": false,
        type: "boolean"
      },
      schema: {
        $ref: "#/$defs/schema"
      },
      content: {
        $ref: "#/$defs/content",
        minProperties: 1,
        maxProperties: 1
      }
    },
    oneOf: [
      {
        required: [
          "schema"
        ]
      },
      {
        required: [
          "content"
        ]
      }
    ],
    dependentSchemas: {
      schema: {
        properties: {
          style: {
            "default": "simple",
            "const": "simple"
          },
          explode: {
            "default": false,
            type: "boolean"
          }
        },
        $ref: "#/$defs/examples"
      }
    },
    $ref: "#/$defs/specification-extensions",
    unevaluatedProperties: false
  },
  "header-or-reference": {
    "if": {
      type: "object",
      required: [
        "$ref"
      ]
    },
    then: {
      $ref: "#/$defs/reference"
    },
    "else": {
      $ref: "#/$defs/header"
    }
  },
  tag: {
    $comment: "https://spec.openapis.org/oas/v3.1.0#tag-object",
    type: "object",
    properties: {
      name: {
        type: "string"
      },
      description: {
        type: "string"
      },
      externalDocs: {
        $ref: "#/$defs/external-documentation"
      }
    },
    required: [
      "name"
    ],
    $ref: "#/$defs/specification-extensions",
    unevaluatedProperties: false
  },
  reference: {
    $comment: "https://spec.openapis.org/oas/v3.1.0#reference-object",
    type: "object",
    properties: {
      $ref: {
        type: "string",
        format: "uri-reference"
      },
      summary: {
        type: "string"
      },
      description: {
        type: "string"
      }
    },
    unevaluatedProperties: false
  },
  schema: {
    $comment: "https://spec.openapis.org/oas/v3.1.0#schema-object",
    $dynamicAnchor: "meta",
    type: [
      "object",
      "boolean"
    ]
  },
  "security-scheme": {
    $comment: "https://spec.openapis.org/oas/v3.1.0#security-scheme-object",
    type: "object",
    properties: {
      type: {
        "enum": [
          "apiKey",
          "http",
          "mutualTLS",
          "oauth2",
          "openIdConnect"
        ]
      },
      description: {
        type: "string"
      }
    },
    required: [
      "type"
    ],
    allOf: [
      {
        $ref: "#/$defs/specification-extensions"
      },
      {
        $ref: "#/$defs/security-scheme/$defs/type-apikey"
      },
      {
        $ref: "#/$defs/security-scheme/$defs/type-http"
      },
      {
        $ref: "#/$defs/security-scheme/$defs/type-http-bearer"
      },
      {
        $ref: "#/$defs/security-scheme/$defs/type-oauth2"
      },
      {
        $ref: "#/$defs/security-scheme/$defs/type-oidc"
      }
    ],
    unevaluatedProperties: false,
    $defs: {
      "type-apikey": {
        "if": {
          properties: {
            type: {
              "const": "apiKey"
            }
          },
          required: [
            "type"
          ]
        },
        then: {
          properties: {
            name: {
              type: "string"
            },
            "in": {
              "enum": [
                "query",
                "header",
                "cookie"
              ]
            }
          },
          required: [
            "name",
            "in"
          ]
        }
      },
      "type-http": {
        "if": {
          properties: {
            type: {
              "const": "http"
            }
          },
          required: [
            "type"
          ]
        },
        then: {
          properties: {
            scheme: {
              type: "string"
            }
          },
          required: [
            "scheme"
          ]
        }
      },
      "type-http-bearer": {
        "if": {
          properties: {
            type: {
              "const": "http"
            },
            scheme: {
              type: "string",
              pattern: "^[Bb][Ee][Aa][Rr][Ee][Rr]$"
            }
          },
          required: [
            "type",
            "scheme"
          ]
        },
        then: {
          properties: {
            bearerFormat: {
              type: "string"
            }
          }
        }
      },
      "type-oauth2": {
        "if": {
          properties: {
            type: {
              "const": "oauth2"
            }
          },
          required: [
            "type"
          ]
        },
        then: {
          properties: {
            flows: {
              $ref: "#/$defs/oauth-flows"
            }
          },
          required: [
            "flows"
          ]
        }
      },
      "type-oidc": {
        "if": {
          properties: {
            type: {
              "const": "openIdConnect"
            }
          },
          required: [
            "type"
          ]
        },
        then: {
          properties: {
            openIdConnectUrl: {
              type: "string",
              format: "uri"
            }
          },
          required: [
            "openIdConnectUrl"
          ]
        }
      }
    }
  },
  "security-scheme-or-reference": {
    "if": {
      type: "object",
      required: [
        "$ref"
      ]
    },
    then: {
      $ref: "#/$defs/reference"
    },
    "else": {
      $ref: "#/$defs/security-scheme"
    }
  },
  "oauth-flows": {
    type: "object",
    properties: {
      implicit: {
        $ref: "#/$defs/oauth-flows/$defs/implicit"
      },
      password: {
        $ref: "#/$defs/oauth-flows/$defs/password"
      },
      clientCredentials: {
        $ref: "#/$defs/oauth-flows/$defs/client-credentials"
      },
      authorizationCode: {
        $ref: "#/$defs/oauth-flows/$defs/authorization-code"
      }
    },
    $ref: "#/$defs/specification-extensions",
    unevaluatedProperties: false,
    $defs: {
      implicit: {
        type: "object",
        properties: {
          authorizationUrl: {
            type: "string",
            format: "uri"
          },
          refreshUrl: {
            type: "string",
            format: "uri"
          },
          scopes: {
            $ref: "#/$defs/map-of-strings"
          }
        },
        required: [
          "authorizationUrl",
          "scopes"
        ],
        $ref: "#/$defs/specification-extensions",
        unevaluatedProperties: false
      },
      password: {
        type: "object",
        properties: {
          tokenUrl: {
            type: "string",
            format: "uri"
          },
          refreshUrl: {
            type: "string",
            format: "uri"
          },
          scopes: {
            $ref: "#/$defs/map-of-strings"
          }
        },
        required: [
          "tokenUrl",
          "scopes"
        ],
        $ref: "#/$defs/specification-extensions",
        unevaluatedProperties: false
      },
      "client-credentials": {
        type: "object",
        properties: {
          tokenUrl: {
            type: "string",
            format: "uri"
          },
          refreshUrl: {
            type: "string",
            format: "uri"
          },
          scopes: {
            $ref: "#/$defs/map-of-strings"
          }
        },
        required: [
          "tokenUrl",
          "scopes"
        ],
        $ref: "#/$defs/specification-extensions",
        unevaluatedProperties: false
      },
      "authorization-code": {
        type: "object",
        properties: {
          authorizationUrl: {
            type: "string",
            format: "uri"
          },
          tokenUrl: {
            type: "string",
            format: "uri"
          },
          refreshUrl: {
            type: "string",
            format: "uri"
          },
          scopes: {
            $ref: "#/$defs/map-of-strings"
          }
        },
        required: [
          "authorizationUrl",
          "tokenUrl",
          "scopes"
        ],
        $ref: "#/$defs/specification-extensions",
        unevaluatedProperties: false
      }
    }
  },
  "security-requirement": {
    $comment: "https://spec.openapis.org/oas/v3.1.0#security-requirement-object",
    type: "object",
    additionalProperties: {
      type: "array",
      items: {
        type: "string"
      }
    }
  },
  "specification-extensions": {
    $comment: "https://spec.openapis.org/oas/v3.1.0#specification-extensions",
    patternProperties: {
      "^x-": true
    }
  },
  examples: {
    properties: {
      example: true,
      examples: {
        type: "object",
        additionalProperties: {
          $ref: "#/$defs/example-or-reference"
        }
      }
    }
  },
  "map-of-strings": {
    type: "object",
    additionalProperties: {
      type: "string"
    }
  }
};
var OpenApi31 = {
  $id,
  $schema,
  description,
  type,
  properties: properties$1,
  required,
  anyOf,
  $ref,
  unevaluatedProperties,
  $defs
};
const OpenApiSpecifications = {
  "2.0": Swagger20,
  "3.0": OpenApi30,
  "3.1": OpenApi31
};
const OpenApiVersions = Object.keys(OpenApiSpecifications);
const ERRORS$1 = {
  EMPTY_OR_INVALID: "Can’t find JSON, YAML or filename in data",
  // URI_MUST_BE_STRING: 'uri parameter or $id attribute must be a string',
  OPENAPI_VERSION_NOT_SUPPORTED: "Can’t find supported Swagger/OpenAPI version in specification, version must be a string.",
  INVALID_REFERENCE: "Can’t resolve reference: %s",
  EXTERNAL_REFERENCE_NOT_FOUND: "Can’t resolve external reference: %s",
  FILE_DOES_NOT_EXIST: "File does not exist: %s",
  NO_CONTENT: "No content found"
};
function getDefaultExportFromCjs(x2) {
  return x2 && x2.__esModule && Object.prototype.hasOwnProperty.call(x2, "default") ? x2["default"] : x2;
}
function details(specification) {
  for (const version2 of new Set(OpenApiVersions)) {
    const specificationType = version2 === "2.0" ? "swagger" : "openapi";
    const value = specification[specificationType];
    if (typeof value === "string" && value.startsWith(version2)) {
      return {
        version: version2,
        specificationType,
        specificationVersion: value
      };
    }
  }
  return {
    version: void 0,
    specificationType: void 0,
    specificationVersion: void 0
  };
}
function getEntrypoint(filesystem) {
  return filesystem == null ? void 0 : filesystem.find((file) => file.isEntrypoint);
}
function unescapeJsonPointer(uri) {
  return decodeURI(uri.replace(/~1/g, "/").replace(/~0/g, "~"));
}
function getSegmentsFromPath(path2) {
  return (
    // /paths/~1test
    path2.split("/").slice(1).map(unescapeJsonPointer)
  );
}
function traverse(specification, transform, path2 = []) {
  const result = {};
  for (const [key2, value] of Object.entries(specification)) {
    const currentPath = [...path2, key2];
    if (Array.isArray(value)) {
      result[key2] = value.map((item, index2) => {
        if (typeof item === "object" && item !== null) {
          return traverse(item, transform, [...currentPath, index2.toString()]);
        }
        return item;
      });
    } else if (typeof value === "object" && value !== null) {
      result[key2] = traverse(value, transform, currentPath);
    } else {
      result[key2] = value;
    }
  }
  return transform(result, path2);
}
function getListOfReferences(specification) {
  const references = [];
  if (!specification || typeof specification !== "object") {
    return references;
  }
  traverse(specification, (value) => {
    if (value.$ref && typeof value.$ref === "string" && !value.$ref.startsWith("#")) {
      references.push(value.$ref.split("#")[0]);
    }
    return value;
  });
  return [...new Set(references)];
}
function isFilesystem(value) {
  return typeof value !== "undefined" && Array.isArray(value) && value.length > 0 && value.some((file) => file.isEntrypoint === true);
}
function normalize$2(specification) {
  if (isFilesystem(specification)) {
    return specification;
  }
  if (typeof specification === "string") {
    try {
      return JSON.parse(specification);
    } catch (error2) {
      return parse$8(specification, {
        maxAliasCount: 1e4
      });
    }
  }
  return specification;
}
function makeFilesystem(value, overwrites = {}) {
  if (isFilesystem(value)) {
    return value;
  }
  const specification = normalize$2(value);
  return [
    {
      isEntrypoint: true,
      specification,
      filename: null,
      dir: "./",
      references: getListOfReferences(specification),
      ...overwrites
    }
  ];
}
function resolveReferences(input, options, file, errors2) {
  if (errors2 === void 0) {
    errors2 = [];
  }
  const clonedInput = structuredClone(input);
  const filesystem = makeFilesystem(clonedInput);
  const entrypoint = getEntrypoint(filesystem);
  resolve2((file == null ? void 0 : file.specification) ?? entrypoint.specification, filesystem, file ?? entrypoint);
  resolve2((file == null ? void 0 : file.specification) ?? entrypoint.specification, filesystem, file ?? entrypoint);
  errors2 = errors2.filter((error2, index2, self2) => index2 === self2.findIndex((t2) => t2.message === error2.message && t2.code === error2.code));
  return {
    valid: errors2.length === 0,
    errors: errors2,
    schema: (file ?? getEntrypoint(filesystem)).specification
  };
  function resolve2(schema2, resolveFilesystem, resolveFile) {
    let result;
    Object.entries(schema2 ?? {}).forEach(([_2, value]) => {
      if (schema2.$ref !== void 0) {
        const target = resolveUri(schema2.$ref, options, resolveFile, resolveFilesystem, errors2);
        if (target === void 0) {
          return void 0;
        }
        delete schema2.$ref;
        if (typeof target === "object") {
          Object.keys(target).forEach((key2) => {
            if (schema2[key2] === void 0) {
              schema2[key2] = target[key2];
            }
          });
        }
      }
      if (typeof value === "object" && !isCircular(value)) {
        result = resolve2(value, resolveFilesystem, resolveFile);
      }
    });
    return {
      errors: (result == null ? void 0 : result.errors) ?? []
    };
  }
}
function isCircular(schema2) {
  try {
    JSON.stringify(schema2);
    return false;
  } catch (error2) {
    return true;
  }
}
function resolveUri(uri, options, file, filesystem, errors2) {
  if (typeof uri !== "string") {
    errors2.push({
      code: "INVALID_REFERENCE",
      message: ERRORS$1.INVALID_REFERENCE.replace("%s", uri)
    });
    return;
  }
  const [prefix, path2] = uri.split("#", 2);
  const isDifferentFile = prefix !== file.filename;
  if (prefix && isDifferentFile) {
    const externalReference = filesystem.find((entry) => {
      return entry.filename === prefix;
    });
    if (!externalReference) {
      errors2.push({
        code: "EXTERNAL_REFERENCE_NOT_FOUND",
        message: ERRORS$1.EXTERNAL_REFERENCE_NOT_FOUND.replace("%s", prefix)
      });
      return;
    }
    const result = resolveReferences(filesystem, options, externalReference, errors2);
    if (path2 === void 0) {
      return result.schema;
    }
    return resolveUri(`#${path2}`, options, externalReference, filesystem, errors2);
  }
  const segments = getSegmentsFromPath(path2);
  try {
    return segments.reduce((acc, key2) => {
      return acc[key2];
    }, file.specification);
  } catch (error2) {
    errors2.push({
      code: "INVALID_REFERENCE",
      message: ERRORS$1.INVALID_REFERENCE.replace("%s", uri)
    });
  }
}
async function dereference(value, options) {
  const filesystem = makeFilesystem(value);
  const entrypoint = getEntrypoint(filesystem);
  const result = resolveReferences(filesystem, options);
  return {
    specification: entrypoint.specification,
    errors: result.errors,
    schema: result.schema,
    ...details(entrypoint.specification)
  };
}
async function load(value, options) {
  var _a2, _b;
  const errors2 = [];
  let content2;
  {
    content2 = normalize$2(value);
  }
  if (content2 === void 0) {
    errors2.push({
      code: "NO_CONTENT",
      message: ERRORS$1.NO_CONTENT
    });
    return {
      specification: null,
      filesystem: [],
      errors: errors2
    };
  }
  let filesystem = makeFilesystem(content2, {
    filename: null
  });
  const newEntry = getEntrypoint(filesystem);
  const listOfReferences = newEntry.references ?? getListOfReferences(content2);
  if (listOfReferences.length === 0) {
    return {
      specification: (_a2 = getEntrypoint(filesystem)) == null ? void 0 : _a2.specification,
      filesystem,
      errors: errors2
    };
  }
  for (const reference of listOfReferences) {
    {
      continue;
    }
  }
  return {
    specification: (_b = getEntrypoint(filesystem)) == null ? void 0 : _b.specification,
    filesystem,
    errors: errors2
  };
}
function upgradeFromThreeToThreeOne(originalSpecification) {
  var _a2;
  let specification = originalSpecification;
  if ((_a2 = specification.openapi) == null ? void 0 : _a2.startsWith("3.0")) {
    specification.openapi = "3.1.0";
  } else {
    return specification;
  }
  specification = traverse(specification, (schema2) => {
    if (schema2.type !== "undefined" && schema2.nullable === true) {
      schema2.type = ["null", schema2.type];
      delete schema2.nullable;
    }
    return schema2;
  });
  specification = traverse(specification, (schema2) => {
    if (schema2.exclusiveMinimum === true) {
      schema2.exclusiveMinimum = schema2.minimum;
      delete schema2.minimum;
    } else if (schema2.exclusiveMinimum === false) {
      delete schema2.exclusiveMinimum;
    }
    if (schema2.exclusiveMaximum === true) {
      schema2.exclusiveMaximum = schema2.maximum;
      delete schema2.maximum;
    } else if (schema2.exclusiveMaximum === false) {
      delete schema2.exclusiveMaximum;
    }
    return schema2;
  });
  specification = traverse(specification, (schema2, path2) => {
    if (schema2.example !== void 0) {
      if (isSchemaPath(path2)) {
        schema2.examples = [schema2.example];
      } else {
        schema2.examples = {
          default: schema2.example
        };
      }
      delete schema2.example;
    }
    return schema2;
  });
  specification = traverse(specification, (schema2) => {
    if (schema2.type === "object" && schema2.properties !== void 0) {
      const entries2 = Object.entries(schema2.properties);
      for (const [_2, value] of entries2) {
        if (typeof value === "object" && value.type === "string" && value.format === "binary") {
          value.contentEncoding = "application/octet-stream";
          delete value.format;
        }
      }
    }
    return schema2;
  });
  specification = traverse(specification, (schema2) => {
    if (schema2.type === "string" && schema2.format === "binary") {
      return void 0;
    }
    return schema2;
  });
  specification = traverse(specification, (schema2) => {
    if (schema2.type === "string" && schema2.format === "base64") {
      return {
        type: "string",
        contentEncoding: "base64"
      };
    }
    return schema2;
  });
  return specification;
}
function isSchemaPath(path2) {
  const schemaLocations = [
    ["components", "schemas"],
    "properties",
    "items",
    "allOf",
    "anyOf",
    "oneOf",
    "not",
    "additionalProperties"
  ];
  return schemaLocations.some((location2) => {
    if (Array.isArray(location2)) {
      return location2.every((segment, index2) => path2[index2] === segment);
    }
    return path2.includes(location2);
  }) || path2.includes("schema") || path2.some((segment) => segment.endsWith("Schema"));
}
function upgradeFromTwoToThree(specification) {
  var _a2, _b, _c;
  if ((_a2 = specification.swagger) == null ? void 0 : _a2.startsWith("2.0")) {
    specification.openapi = "3.0.3";
    delete specification.swagger;
  } else {
    return specification;
  }
  console.warn(`[upgradeFromTwoToThree] The upgrade from Swagger 2.0 to OpenAPI 3.0 documents is experimental and lacks features.`);
  if (specification.host) {
    const schemes = ((_b = specification.schemes) == null ? void 0 : _b.length) ? specification.schemes : ["http"];
    specification.servers = schemes.map((scheme) => ({
      url: `${scheme}://${specification.host}${specification.basePath ?? ""}`
    }));
    delete specification.basePath;
    delete specification.schemes;
    delete specification.host;
  }
  if (specification.definitions) {
    if (typeof specification.components !== "object") {
      specification.components = {};
    }
    specification.components.schemas = specification.definitions;
    delete specification.definitions;
    specification = traverse(specification, (schema2) => {
      var _a3;
      if ((_a3 = schema2.$ref) == null ? void 0 : _a3.startsWith("#/definitions/")) {
        schema2.$ref = schema2.$ref.replace(/^#\/definitions\//, "#/components/schemas/");
      }
      return schema2;
    });
  }
  if (specification.paths) {
    for (const path2 in specification.paths) {
      if (Object.hasOwn(specification.paths, path2)) {
        const pathItem = specification.paths[path2];
        for (const method in pathItem) {
          if (Object.hasOwn(pathItem, method)) {
            const operationItem = pathItem[method];
            if (operationItem.parameters) {
              const bodyParameter = structuredClone(operationItem.parameters.find((parameter) => parameter.in === "body") ?? {});
              if (bodyParameter && Object.keys(bodyParameter).length) {
                delete bodyParameter.name;
                delete bodyParameter.in;
                const consumes = specification.consumes ?? operationItem.consumes ?? ["application/json"];
                if (typeof operationItem.requestBody !== "object") {
                  operationItem.requestBody = {};
                }
                if (typeof operationItem.requestBody.content !== "object") {
                  operationItem.requestBody.content = {};
                }
                const { schema: schema2, ...requestBody } = bodyParameter;
                operationItem.requestBody = {
                  ...operationItem.requestBody,
                  ...requestBody
                };
                for (const type2 of consumes) {
                  operationItem.requestBody.content[type2] = {
                    schema: schema2
                  };
                }
              }
              operationItem.parameters = operationItem.parameters.filter((parameter) => parameter.in !== "body");
              delete operationItem.consumes;
              const formDataParameters = operationItem.parameters.filter((parameter) => parameter.in === "formData");
              if (formDataParameters.length > 0) {
                if (typeof operationItem.requestBody !== "object") {
                  operationItem.requestBody = {};
                }
                if (typeof operationItem.requestBody.content !== "object") {
                  operationItem.requestBody.content = {};
                }
                operationItem.requestBody.content["application/x-www-form-urlencoded"] = {
                  schema: {
                    type: "object",
                    properties: {},
                    required: []
                    // Initialize required array
                  }
                };
                for (const param of formDataParameters) {
                  operationItem.requestBody.content["application/x-www-form-urlencoded"].schema.properties[param.name] = {
                    type: param.type,
                    description: param.description
                  };
                  if (param.required) {
                    operationItem.requestBody.content["application/x-www-form-urlencoded"].schema.required.push(param.name);
                  }
                }
                operationItem.parameters = operationItem.parameters.filter((parameter) => parameter.in !== "formData");
              }
            }
            if (operationItem.responses) {
              for (const response in operationItem.responses) {
                if (Object.hasOwn(operationItem.responses, response)) {
                  const responseItem = operationItem.responses[response];
                  if (responseItem.schema) {
                    const produces = specification.produces ?? operationItem.produces ?? ["application/json"];
                    if (typeof responseItem.content !== "object") {
                      responseItem.content = {};
                    }
                    for (const type2 of produces) {
                      responseItem.content[type2] = {
                        schema: responseItem.schema
                      };
                    }
                    delete responseItem.schema;
                  }
                }
              }
            }
            delete operationItem.produces;
            if (((_c = operationItem.parameters) == null ? void 0 : _c.length) === 0) {
              delete operationItem.parameters;
            }
          }
        }
      }
    }
  }
  if (specification.securityDefinitions) {
    if (typeof specification.components !== "object") {
      specification.components = {};
    }
    specification.components.securitySchemes = {};
    for (const [key2, securityScheme] of Object.entries(specification.securityDefinitions)) {
      if (typeof securityScheme === "object") {
        if ("type" in securityScheme && securityScheme.type === "oauth2") {
          const { flow, authorizationUrl: authorizationUrl2, tokenUrl: tokenUrl2, scopes } = securityScheme;
          specification.components.securitySchemes[key2] = {
            type: "oauth2",
            flows: {
              [flow]: {
                ...authorizationUrl2 && { authorizationUrl: authorizationUrl2 },
                ...tokenUrl2 && { tokenUrl: tokenUrl2 },
                ...scopes && { scopes }
              }
            }
          };
        } else {
          specification.components.securitySchemes[key2] = securityScheme;
        }
      }
    }
    delete specification.securityDefinitions;
  }
  return specification;
}
function upgrade(value) {
  const upgraders = [upgradeFromTwoToThree, upgradeFromThreeToThreeOne];
  const result = upgraders.reduce((currentSpecification, upgrader) => upgrader(currentSpecification), getEntrypoint(makeFilesystem(value)).specification);
  return {
    specification: result,
    // TODO: Make dynamic
    version: "3.1"
  };
}
const convertOauth2Flows = (security, nameKey) => {
  if (security.type === "oauth2") {
    const entries2 = Object.entries(security.flows ?? {});
    if (entries2.length) {
      const [[type2, flow]] = entries2;
      return {
        ...security,
        nameKey,
        flow: {
          ...flow,
          type: type2
        }
      };
    }
  }
  return {
    ...security,
    nameKey
  };
};
const parseSchema = async (spec) => {
  const { filesystem } = await load(spec);
  const { specification } = upgrade(filesystem);
  const { schema: schema2, errors: errors2 = [] } = await dereference(specification);
  return { schema: schema2, errors: errors2 };
};
async function importSpecToWorkspace(spec, { documentUrl, watchForChanges, preferredSecurityScheme } = {}) {
  var _a2, _b, _c, _d, _e;
  const { schema: schema2, errors: errors2 } = await parseSchema(spec);
  const importWarnings = [...errors2.map((e2) => e2.message)];
  if (!schema2)
    return { importWarnings, error: true };
  const requests = [];
  const servers = serverSchema.array().parse(((_a2 = schema2.servers) == null ? void 0 : _a2.map((s3) => s3 ?? [
    {
      url: typeof window !== "undefined" ? window.location.origin : "http://localhost",
      description: "Replace with your API server"
    }
  ])) ?? []);
  const tagNames = /* @__PURE__ */ new Set();
  const security = ((_b = schema2.components) == null ? void 0 : _b.securitySchemes) ?? (schema2 == null ? void 0 : schema2.securityDefinitions) ?? {};
  const securitySchemes = (_d = (_c = Object.entries(security)).map) == null ? void 0 : _d.call(_c, ([nameKey, s3]) => {
    const scheme = schemaModel(
      // We must convert flows to a singular object, technically not spec compliant so we grab the first
      s3.type === "oauth2" ? convertOauth2Flows(s3, nameKey) : {
        ...s3,
        nameKey
      },
      securitySchemeSchema,
      false
    );
    if (!scheme)
      importWarnings.push(`Security scheme ${nameKey} is invalid.`);
    return scheme;
  }).filter((v2) => !!v2);
  const securitySchemeMap = {};
  securitySchemes.forEach((s3) => {
    securitySchemeMap[s3.nameKey] = s3.uid;
  });
  keysOf(schema2.paths ?? {}).forEach((pathString) => {
    var _a3;
    const path2 = (_a3 = schema2 == null ? void 0 : schema2.paths) == null ? void 0 : _a3[pathString];
    if (!path2)
      return;
    const pathServers = serverSchema.array().parse(path2.servers ?? []);
    servers.push(...pathServers);
    requestMethods.forEach((method) => {
      var _a4;
      const operation = path2[method];
      if (operation && typeof operation === "object") {
        const operationServers = serverSchema.array().parse(operation.servers ?? []);
        servers.push(...operationServers);
        (_a4 = operation.tags) == null ? void 0 : _a4.forEach((t2) => tagNames.add(t2));
        const { security: operationSecurity, ...operationWithoutSecurity } = operation;
        const securityRequirements = (operationSecurity ?? schema2.security ?? []).flatMap((s3) => {
          const keys2 = Object.keys(s3);
          if (keys2.length)
            return keys2[0];
          else
            return [];
        });
        let selectedSecuritySchemeUids = [];
        if (securityRequirements.length) {
          const name2 = preferredSecurityScheme && securityRequirements.includes(preferredSecurityScheme ?? "") ? preferredSecurityScheme : securityRequirements[0];
          const uid2 = securitySchemeMap[name2];
          selectedSecuritySchemeUids = [uid2];
        }
        const requestPayload = {
          ...operationWithoutSecurity,
          method,
          path: pathString,
          selectedSecuritySchemeUids,
          // Merge path and operation level parameters
          parameters: [
            ...(path2 == null ? void 0 : path2.parameters) ?? [],
            ...operation.parameters ?? []
          ],
          servers: [...pathServers, ...operationServers].map((s3) => s3.uid)
        };
        if (operationSecurity == null ? void 0 : operationSecurity.length)
          requestPayload.security = operationSecurity.map((s3) => {
            const keys2 = Object.keys(s3);
            if (keys2.length) {
              const [key2] = Object.keys(s3);
              return {
                [key2]: s3[key2]
              };
            } else
              return s3;
          });
        const request = schemaModel(requestPayload, requestSchema, false);
        if (!request)
          importWarnings.push(`${method} Request at ${path2} is invalid.`);
        else
          requests.push(request);
      }
    });
  });
  const tags2 = schemaModel((schema2 == null ? void 0 : schema2.tags) ?? [], tagSchema.array(), false) ?? [];
  tags2.forEach((t2) => tagNames.delete(t2.name));
  tagNames.forEach((name2) => tags2.push(tagSchema.parse({ name: name2 })));
  const tagMap = {};
  tags2.forEach((t2) => {
    tagMap[t2.name] = t2;
  });
  const collectionChildren = new Set(tags2.map((t2) => t2.uid));
  tags2.forEach((t2) => {
    var _a3;
    (_a3 = t2["x-scalar-children"]) == null ? void 0 : _a3.forEach((c2) => {
      const nestedUid = tagMap[c2.tagName].uid;
      t2.children.push(nestedUid);
      collectionChildren.delete(nestedUid);
    });
  });
  requests.forEach((r2) => {
    if (r2.tags) {
      r2.tags.forEach((t2) => {
        tagMap[t2].children.push(r2.uid);
      });
    } else {
      collectionChildren.add(r2.uid);
    }
  });
  const examples = [];
  requests.forEach((request) => {
    const example = createExampleFromRequest(request, "Default Example");
    examples.push(example);
    request.examples.push(example.uid);
  });
  const auth = securitySchemes == null ? void 0 : securitySchemes.reduce((prev, s3) => {
    const example = authExampleFromSchema(s3);
    if (example)
      prev[s3.uid] = example;
    return prev;
  }, {});
  const collection = collectionSchema.parse({
    ...schema2,
    watchForChanges,
    documentUrl,
    auth,
    requests: requests.map((r2) => r2.uid),
    servers: servers.map((s3) => s3.uid),
    tags: tags2.map((t2) => t2.uid),
    children: [...collectionChildren],
    security: schema2.security ?? [{}],
    selectedServerUid: (_e = servers == null ? void 0 : servers[0]) == null ? void 0 : _e.uid,
    components: {
      ...schema2.components
    },
    securitySchemes: securitySchemes.map((s3) => s3.uid)
  });
  return {
    error: false,
    servers,
    schema: schema2,
    requests,
    examples,
    collection,
    tags: tags2,
    securitySchemes
  };
}
const specDictionary = {};
function importSpecFileFactory({
  requestMutators,
  collectionMutators,
  serverMutators,
  tagMutators,
  securitySchemeMutators,
  requestExampleMutators,
  workspaceMutators,
  workspaces
}) {
  const importSpecFile = async (_spec, workspaceUid, {
    documentUrl,
    watchForChanges = false,
    overloadServers,
    preferredSecurityScheme
  } = {}) => {
    var _a2;
    const spec = toRaw(_spec);
    if ((overloadServers == null ? void 0 : overloadServers.length) && typeof spec === "object")
      spec.servers = overloadServers;
    const workspaceEntities = await importSpecToWorkspace(spec, {
      documentUrl,
      preferredSecurityScheme,
      watchForChanges
    });
    if (workspaceEntities.error) {
      console.group("IMPORT ERRORS");
      workspaceEntities.importWarnings.forEach((w2) => console.warn(w2));
      console.groupEnd();
      return void 0;
    }
    if (documentUrl && typeof spec === "string") {
      specDictionary[documentUrl] = {
        hash: createHash(spec),
        schema: workspaceEntities.schema
      };
    }
    workspaceEntities.examples.forEach((e2) => requestExampleMutators.add(e2));
    workspaceEntities.requests.forEach((r2) => requestMutators.add(r2));
    workspaceEntities.tags.forEach((t2) => tagMutators.add(t2));
    workspaceEntities.servers.forEach((s3) => serverMutators.add(s3));
    workspaceEntities.securitySchemes.forEach(
      (s3) => securitySchemeMutators.add(s3)
    );
    collectionMutators.add(workspaceEntities.collection);
    workspaceMutators.edit(workspaceUid, "collections", [
      ...((_a2 = workspaces[workspaceUid]) == null ? void 0 : _a2.collections) ?? [],
      workspaceEntities.collection.uid
    ]);
    return workspaceEntities.collection;
  };
  async function importSpecFromUrl(url, workspaceUid, {
    proxy,
    overloadServers,
    watchForChanges = false,
    preferredSecurityScheme
  } = {}) {
    try {
      const spec = await fetchSpecFromUrl(url, proxy);
      return [
        null,
        await importSpecFile(spec, workspaceUid, {
          documentUrl: url,
          overloadServers,
          watchForChanges,
          preferredSecurityScheme
        })
      ];
    } catch (error2) {
      console.error("Failed to fetch spec from URL:", error2);
      return [normalizeError(error2), null];
    }
  }
  return {
    importSpecFile,
    importSpecFromUrl
  };
}
function createStoreRequestExamples(useLocalStorage) {
  const requestExamples = reactive({});
  const requestExampleMutators = mutationFactory(
    requestExamples,
    reactive({}),
    useLocalStorage && LS_KEYS.REQUEST_EXAMPLE
  );
  return {
    requestExamples,
    requestExampleMutators
  };
}
function extendedExampleDataFactory({
  requestExamples,
  requestExampleMutators,
  requestMutators,
  requests
}) {
  const addRequestExample = (request, _name) => {
    const name2 = _name ?? iterateTitle(
      (request.summary ?? "Example") + " #1",
      (t2) => request.examples.some((uid2) => t2 === requestExamples[uid2].name)
    );
    const example = createExampleFromRequest(request, name2);
    requestExampleMutators.add(example);
    requestMutators.edit(request.uid, "examples", [
      ...request.examples,
      example.uid
    ]);
    return example;
  };
  const deleteRequestExample = (requestExample) => {
    requestMutators.edit(
      requestExample.requestUid,
      "examples",
      requests[requestExample.requestUid].examples.filter(
        (uid2) => uid2 !== requestExample.uid
      )
    );
    requestExampleMutators.delete(requestExample.uid);
  };
  return {
    addRequestExample,
    deleteRequestExample
  };
}
function createStoreRequests(useLocalStorage) {
  const requests = reactive({});
  const requestMutators = mutationFactory(
    requests,
    reactive({}),
    useLocalStorage && LS_KEYS.REQUEST
  );
  return {
    requests,
    requestMutators
  };
}
function extendedRequestDataFactory({
  requestExamples,
  requestExampleMutators,
  requestMutators,
  collectionMutators,
  collections,
  tags: tags2,
  tagMutators
}, addTag) {
  const addRequest = (payload, collectionUid) => {
    var _a2;
    const request = schemaModel(payload, requestSchema, false);
    if (!request) return console.error("INVALID REQUEST DATA", payload);
    const collection = collections[collectionUid];
    const example = createExampleFromRequest(
      request,
      iterateTitle(
        (request.summary ?? "Example") + " #1",
        (t2) => request.examples.some((uid2) => t2 === requestExamples[uid2].name)
      )
    );
    request.examples.push(example.uid);
    requestMutators.add(request);
    requestExampleMutators.add(example);
    collectionMutators.edit(collectionUid, "requests", [
      ...collection.requests,
      request.uid
    ]);
    if ((_a2 = request.tags) == null ? void 0 : _a2.length)
      request.tags.forEach((tagName2) => {
        const tagUid = collection.tags.find((uid2) => tags2[uid2].name === tagName2);
        if (tagUid)
          tagMutators.edit(tagUid, "children", [
            ...tags2[tagUid].children,
            request.uid
          ]);
        else addTag({ name: tagName2, children: [request.uid] }, collectionUid);
      });
    else
      collectionMutators.edit(collectionUid, "children", [
        ...collection.children,
        request.uid
      ]);
    return request;
  };
  const deleteRequest = (request, collectionUid) => {
    var _a2;
    const collection = collections[collectionUid];
    request.examples.forEach((uid2) => requestExampleMutators.delete(uid2));
    collectionMutators.edit(
      collectionUid,
      "requests",
      collection.requests.filter((r2) => r2 !== request.uid)
    );
    collectionMutators.edit(
      collectionUid,
      "children",
      collection.children.filter((r2) => r2 !== request.uid)
    );
    (_a2 = request.tags) == null ? void 0 : _a2.forEach((tagName2) => {
      const tagUid = collection.tags.find((uid2) => tags2[uid2].name === tagName2);
      if (!tagUid) return;
      tagMutators.edit(
        tagUid,
        "children",
        tags2[tagUid].children.filter((r2) => r2 !== request.uid)
      );
    });
    requestMutators.delete(request.uid);
  };
  return {
    addRequest,
    deleteRequest,
    findRequestParents: findRequestParentsFactory({ collections, tags: tags2 })
  };
}
function findRequestParentsFactory({
  collections,
  tags: tags2
}) {
  function findRequestParentss(r2) {
    const collection = Object.values(collections).find(
      (c2) => {
        var _a2;
        retu