Created
September 14, 2011 15:33
-
-
Save aschreyer/1216888 to your computer and use it in GitHub Desktop.
ChEMBL extension in credoscript
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| from credoscript.extensions import chembl | |
| m = ma.fetch_by_molregno(410891) | |
| # get all activity cliffs of this molecule | |
| m.get_activity_cliffs(chembl.ActivityCliff.sali>10) | |
| >>> [<ActivityCliff(455590, 2030543, 2030536)>, | |
| <ActivityCliff(455592, 2030585, 2030582)>, | |
| <ActivityCliff(455594, 2030630, 2030623)>, | |
| <ActivityCliff(455591, 2030571, 2030564)>, | |
| <ActivityCliff(455590, 2030543, 2030535)>, | |
| <ActivityCliff(455592, 2030585, 2030581)>, | |
| <ActivityCliff(455591, 2030571, 2030563)>] | |
| # get the activity cliff with the highest SALI index | |
| cliff = m.get_activity_cliffs(chembl.ActivityCliff.sali>10)[0] | |
| cliff.delta_activity, cliff.delta_tanimoto, cliff.sali | |
| >>> (1.44235914846045, 0.0517241379310345, 27.8856102035687) | |
| cliff.ActivityBgn.standard_value, cliff.ActivityBgn.standard_units | |
| >>> (13.0, 'nM') | |
| cliff.ActivityEnd.standard_value, cliff.ActivityEnd.standard_units | |
| >>> (360.0, 'nM') | |
| cliff.MoleculeBgn.Structure.canonical_smiles, cliff.MoleculeEnd.Structure.canonical_smiles | |
| >>> ('CCNC(=O)N1CCC(CC1)Nc2ncc(Cl)c(n2)c3c[nH]c4ccccc34', | |
| 'CCNC(=O)N1CCC(C1)Nc2ncc(Cl)c(n2)c3c[nH]c4ccccc34') | |
| # PDB structures linked to this assay | |
| cliff.Assay.Structures | |
| >>> [<Structure(2P33)>] |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| from credoscript.extensions import chembl | |
| pa = chembl.ProductAdaptor() | |
| products = pa.fetch_all_by_trade_name('GLEEVEC') | |
| for product in products: | |
| for f in product.Formulations: | |
| print f.Molecule, f.Molecule.pref_name | |
| >>> <Molecule(485100)> IMATINIB MESYLATE | |
| <Molecule(485100)> IMATINIB MESYLATE | |
| <Molecule(485100)> IMATINIB MESYLATE | |
| <Molecule(485100)> IMATINIB MESYLATE | |
| m = products[0].Formulations[0].Molecule | |
| m.Hierarchy.Active | |
| >>> <Molecule(88797)> | |
| a = m.Hierarchy.Active | |
| # ligands in CREDO | |
| a.Ligands | |
| >>> [<Ligand(A 3 STI)>, | |
| <Ligand(A 1 STI)>, | |
| <Ligand(A 600 STI)>, | |
| <Ligand(B 600 STI)>, | |
| <Ligand(C 600 STI)>, | |
| <Ligand(D 600 STI)>, | |
| <Ligand(A 233 STI)>, | |
| <Ligand(B 233 STI)>] |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| from credoscript import * | |
| from credoscript.extensions import chembl | |
| ca = ChemCompAdaptor() | |
| j07 = ca.fetch_by_het_id('J07') | |
| ma = chembl.MoleculeAdaptor() | |
| # fetch compounds from ChEMBL using circular fingerprints and tanimoto similarity | |
| ma.fetch_all_by_sim(j07.ism, fp='circular', threshold=0.8) | |
| >>> [(<Molecule(410891)>, 1.0), | |
| (<Molecule(410898)>, 0.948275862068966), | |
| (<Molecule(410900)>, 0.868852459016393), | |
| (<Molecule(410902)>, 0.868852459016393), | |
| (<Molecule(410899)>, 0.85), | |
| (<Molecule(410892)>, 0.819672131147541), | |
| (<Molecule(410905)>, 0.80952380952381), | |
| (<Molecule(410907)>, 0.806451612903226)] | |
| # fetch compounds by substructure | |
| ma.fetch_all_by_substruct(j07.ism) | |
| >>> [<Molecule(410907)>, <Molecule(410911)>, <Molecule(410891)>] |
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment