Created
May 20, 2011 13:13
-
-
Save aschreyer/982860 to your computer and use it in GitHub Desktop.
Credoscript example
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| In [ 1]: from credo.credoscript import * | |
| # Fetch a structure from a database with the corresponding adaptor | |
| In [ 2]: s = StructureAdaptor().fetch_by_pdb('3CS9') | |
| # Database columns are mapped as attributes | |
| In [ 3]: s.title | |
| Out[ 3]: 'Human ABL kinase in complex with nilotinib' | |
| # Relationships with other entities are mapped as attributes as well | |
| In [ 4]: s.Biomolecules | |
| Out[ 4]: | |
| {1: <Biomolecule(1)>, | |
| 2: <Biomolecule(2)>, | |
| 3: <Biomolecule(3)>, | |
| 4: <Biomolecule(4)>} | |
| # Shortcuts are supported | |
| In [ 5]: s[1]['A'][253]['CA'] | |
| Out[ 5]: <Atom(CA )> | |
| # Get the ligands of the first assembly of 3CS9 | |
| In [ 6]: s[1].Ligands | |
| Out[ 6]: [<Ligand(A 600 NIL)>] | |
| In [ 7]: l = s[1].Ligands[0] | |
| # Get the conformation-independent information | |
| In [ 8]: l.Components[0].ChemComp | |
| Out[ 8]: <ChemComp(NIL)> | |
| In [ 9]: nil = l.Components[0].ChemComp | |
| # Molecular properties (here: isomeric SMILES) | |
| In [10]: nil.ism | |
| Out[10]: | |
| 'Cc1ccc(cc1Nc2nccc(n2)c3cccnc3)C(=O)Nc4cc(cc(c4)n5cc(nc5)C)C(F)(F)F' |
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment