Last active
May 24, 2018 08:18
-
-
Save baoilleach/98efabafc6f6ffe1de4f0bae9d6fa290 to your computer and use it in GitHub Desktop.
Very simple genetic algorithm that manipulates SMILES
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
import random | |
random.seed(1) | |
from collections import defaultdict | |
import pybel | |
ob = pybel.ob | |
ob.obErrorLog.StopLogging() | |
def CreateValencyTable(mol): | |
common_valencies = defaultdict(lambda:defaultdict(set)) | |
for atom in ob.OBMolAtomIter(mol.OBMol): | |
elem = atom.GetAtomicNum() | |
chg = atom.GetFormalCharge() | |
totalbonds = atom.BOSum() + atom.GetImplicitHCount() | |
common_valencies[elem][chg].add(totalbonds) | |
# Convert from defaultdict to dict | |
ans = {} | |
for x, y in common_valencies.items(): | |
ans[x] = dict(y) | |
return ans | |
abilifysmi = "Clc4cccc(N3CCN(CCCCOc2ccc1c(NC(=O)CC1)c2)CC3)c4Cl" | |
abilify = pybel.readstring("smi", abilifysmi) | |
common_valencies = CreateValencyTable(abilify) | |
print("The allowed elements, charge states and valencies are") | |
print(common_valencies) | |
def HasCommonValence(mol): | |
for atom in ob.OBMolAtomIter(mol): | |
elem = atom.GetAtomicNum() | |
if elem not in common_valencies: | |
return False # unusual elem | |
chg = atom.GetFormalCharge() | |
data = common_valencies[elem] | |
if chg not in data: | |
return False # unusual charge state | |
totalbonds = atom.BOSum() + atom.GetImplicitHCount() | |
if totalbonds not in data[chg]: | |
return False # unusual valence | |
return True | |
def create_mutants(A, B): | |
# Let's randomly choose a cross-over point in both A and B | |
# and generate four possible combinations | |
c1 = random.randint(0, len(A)) | |
c2 = random.randint(0, len(B)) | |
startA, endA = A[:c1], A[c1:] | |
startB, endB = B[:c2], B[c2:] | |
children = [ | |
startA+endB, startB+endA, # somewhat sensible | |
endA+startB, endB+startA, # less sensible | |
] | |
# Let's mutate a few characters by swapping nbors randomly | |
mutant_children = [] | |
for child in children: | |
mutant = "" | |
i = 0 | |
N = len(child) | |
while i < N: | |
if i+1 < N and random.random() > 0.66: # 1 in 3 chance | |
mutant += child[i+1] | |
mutant += child[i] | |
i += 1 # extra increment | |
else: | |
mutant += child[i] | |
i += 1 | |
mutant_children.append(mutant) | |
random.shuffle(mutant_children) # don't favour any of them | |
return mutant_children | |
def get_mutant(smiA, smiB): | |
for N in range(50): # try combining these 50 times | |
mutantsmis = create_mutants(smiA, smiB) | |
for mutantsmi in mutantsmis: | |
try: | |
mol = pybel.readstring("smi", mutantsmi) | |
except IOError: | |
continue # bad syntax | |
if HasCommonValence(mol.OBMol): | |
return mutantsmi, mol | |
return "", None | |
def CreateObjectiveFn(targetfp): | |
def objectivefn(smi): | |
return pybel.readstring("smi", smi).calcfp("ecfp4") | targetfp | |
return objectivefn | |
class GA: | |
def __init__(self, objectivefn, N): | |
self.objectivefn = objectivefn | |
self.N = N | |
def createInitialPop(self, db, targetlensmi): | |
# The population will always be in sorted order by decreasing | |
# objectivefn() (i.e. most similar first). This will simplify | |
# top-slicing and tournament selection. | |
pop = [] | |
while len(pop) < self.N: | |
smi = random.choice(db) | |
mol = pybel.readstring("smi", smi) | |
# Select molecules with a similar SMILES length but with a low value of the objectivefn | |
if HasCommonValence(mol.OBMol) and abs(targetlensmi - len(smi)) < 10 and self.objectivefn(smi) < 0.2: | |
mol.OBMol.SetTitle("") | |
pop.append(mol.write("smi", opt={"i":True}).rstrip()) # random order, leave out stereo | |
self.pop = sorted(pop, key=lambda x:self.objectivefn(x), reverse=True) | |
def createChildren(self): | |
# tournament selection of 2 smis | |
children = [] | |
mrange = range(self.N) | |
while len(children) < self.N: | |
chosenA = sorted(random.sample(mrange, 3))[0] | |
chosenB = chosenA | |
while chosenB == chosenA: | |
chosenB = sorted(random.sample(mrange, 3))[0] | |
# unleash the mutants | |
mutantsmi, mol = get_mutant(self.pop[chosenA], self.pop[chosenB]) | |
if not mol: | |
continue | |
children.append(mutantsmi) | |
self.children = sorted(children, key=lambda x:self.objectivefn(x), reverse=True) | |
def createNextGen(self): | |
# top-slice the existing population and the children | |
self.pop = sorted(self.pop[:int(self.N/2)] + self.children[:int(self.N/2)], | |
key=lambda x:self.objectivefn(x), reverse=True) | |
def report(self): | |
for p in self.pop[:10]: | |
print(p, self.objectivefn(p)) | |
print() | |
if __name__ == "__main__": | |
targetfp = abilify.calcfp("ecfp4") | |
objfn = CreateObjectiveFn(targetfp) | |
with open(r"D:\LargeData\ChEMBL\chembl_23.smi") as inp: | |
allchembl = inp.readlines() | |
N = 100 # no. of chromosomes | |
ga = GA(objfn, N) | |
ga.createInitialPop(allchembl, len(abilifysmi)) | |
ga.report() | |
iter = 0 | |
while True: | |
iter += 1 | |
print("Iter =", iter) | |
ga.createChildren() | |
ga.createNextGen() | |
ga.report() |
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment