|
<!DOCTYPE html> |
|
<html lang="en"> |
|
<head> |
|
<meta charset="utf-8"> |
|
<meta name="viewport" content="width=device-width, initial-scale=1.0" /> |
|
<title>PyScript Mol demo</title> |
|
<link rel="stylesheet" href="assets/styles/main.css"> |
|
<link rel="stylesheet" href="https://pyscript.net/latest/pyscript.css" /> |
|
<script defer src="https://pyscript.net/latest/pyscript.js"></script> |
|
<script src="https://unpkg.com/@rdkit/rdkit/dist/RDKit_minimal.js"></script> |
|
<!-- Instantiate the WASM module. The inline script below could live elsewhere inside your application code. --> |
|
</head> |
|
<script> |
|
initRDKitModule().then(function (instance) { |
|
RDKitModule = instance; |
|
console.log("version: " + RDKitModule.version()); |
|
}); |
|
</script> |
|
<body> |
|
<h1> PyScript demo with Ketcher and Rdkit.js</h1> |
|
<h2> Ketcher window</h2> |
|
<iframe id="ifKetcher" src="https://churnikov.github.io/demo/pyketch/ketcher/index.html" width="800" height="600"></iframe> |
|
<!-- <iframe id="ifKetcher" src="ketcher/index.html" width="800" height="600"></iframe> --> |
|
<script src="assets/scripts/main.js"></script> |
|
<h2> Access JavaScript elements from python</h2> |
|
<p> |
|
Run this cell to add molecule to the drawing board and get its smiles back |
|
To run cell, click on it and press Shift+Enter. |
|
<py-repl> |
|
import js |
|
import asyncio |
|
async def get_smiles(): |
|
ketcherFrame = js.document.getElementById('ifKetcher') |
|
ketcher = ketcherFrame.contentWindow.ketcher |
|
await ketcher.setMolecule("CN1C=NC2=C1C(=O)N(C(=O)N2C)C") |
|
return await ketcher.getSmiles() |
|
asyncio.ensure_future(get_smiles()) |
|
</py-repl> |
|
<py-repl> |
|
smiles = asyncio.ensure_future(get_smiles()) |
|
smiles |
|
</py-repl> |
|
</p> |
|
<p> |
|
Run this cell to convert ketcher smiles to rdkit smiles with rdkit.js |
|
<py-repl> |
|
mol = js.RDKitModule.get_mol(smiles.result()) |
|
mol.get_smiles() |
|
</py-repl> |
|
</p> |
|
<p> |
|
There are many more <a href="https://lifescience.opensource.epam.com/ketcher/index.html">Ketcher</a> and <a href="https://www.rdkitjs.com">Rdkit.js</a> javascript methods. Refer to their documentation for more info: |
|
<ul> |
|
<li><a href="https://lifescience.opensource.epam.com/ketcher/developers-manual.html">Ketcher JS docs</a></li> |
|
<li><a href="https://www.rdkitjs.com">Rdkit.js docs</a></li> |
|
</ul> |
|
</p> |
|
<h2>How it works</h2> |
|
<p> |
|
You can <a href="https://engineering.anaconda.com/2022/04/welcome-pyscript.html">read anacondas announcement </a> on what is PyScript. Essentially it's python that runs in the browser. Important that it's not python translated to javascript, but it's actual python compiled for browser. |
|
</p> |
|
<p> |
|
PyScript was created in such a way that you can easily use python functions in JavaScript and parts of JavaScript in python. |
|
</p> |
|
<p> |
|
In <a href="https://gist.github.com/churnikov/b38940f190efea1f6f13e3f29204ff88">this gist</a> you can find how to set up ketcher and PyScript for local development. |
|
</p> |
|
</body> |
|
</html> |