Created
September 13, 2021 14:28
-
-
Save fangkuoyu/dc785218e5d4d94c752e80f1aaba4fad to your computer and use it in GitHub Desktop.
Converting RDKit to Networkx
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| # import library -------------------------------------------------------------- | |
| from rdkit import Chem | |
| import networkx as nx | |
| import matplotlib.pyplot as plt | |
| # define the smiles string and covert it into a molecule sturcture ------------ | |
| caffeine_smiles = 'CN1C=NC2=C1C(=O)N(C(=O)N2C)C' | |
| caffeine_mol = Chem.MolFromSmiles(caffeine_smiles) | |
| # define the function for coverting rdkit object to networkx object ----------- | |
| def mol_to_nx(mol): | |
| G = nx.Graph() | |
| for atom in mol.GetAtoms(): | |
| G.add_node(atom.GetIdx(), | |
| atomic_num=atom.GetAtomicNum(), | |
| is_aromatic=atom.GetIsAromatic(), | |
| atom_symbol=atom.GetSymbol()) | |
| for bond in mol.GetBonds(): | |
| G.add_edge(bond.GetBeginAtomIdx(), | |
| bond.GetEndAtomIdx(), | |
| bond_type=bond.GetBondType()) | |
| return G | |
| # conver rdkit object to networkx object -------------------------------------- | |
| caffeine_nx = mol_to_nx(caffeine_mol) | |
| caffeine_atom = nx.get_node_attributes(caffeine_nx, 'atom_symbol') | |
| color_map = {'C': 'cyan', | |
| 'O': 'orange', | |
| 'N': 'magenta'} | |
| caffeine_colors = [] | |
| for idx in caffeine_nx.nodes(): | |
| if (caffeine_nx.nodes[idx]['atom_symbol'] in color_map): | |
| caffeine_colors.append(color_map[caffeine_nx.nodes[idx]['atom_symbol']]) | |
| else: | |
| caffeine_colors.append('gray') | |
| nx.draw(caffeine_nx, | |
| labels=caffeine_atom, | |
| with_labels = True, | |
| node_color=caffeine_colors, | |
| node_size=800) | |
| plt.show() | |
| # print out the adjacency matrix ---------------------------------------------- | |
| matrix = nx.to_numpy_matrix(caffeine_nx) | |
| print(matrix) |
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment