Created
January 9, 2019 18:23
-
-
Save marionebl/33bd179e614ebcb1b7d42ec6f4d07c49 to your computer and use it in GitHub Desktop.
Alva Pull Request Files
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| draft: false | |
| model: Project | |
| elements: | |
| - model: Element | |
| contentIds: | |
| - 4e7b5dc6-094d-4723-b3d8-4985038f6cfb | |
| dragged: false | |
| focused: false | |
| highlighted: false | |
| id: 9a74c44b-17c7-4061-b4d6-04307bf8b7d6 | |
| name: Page 1 | |
| open: true | |
| forcedOpen: false | |
| patternId: f539d7c9-3b3a-4cb1-887b-8be4dc496d77 | |
| placeholderHighlighted: none | |
| propertyValues: [] | |
| role: root | |
| selected: false | |
| - model: Element | |
| containerId: 4e7b5dc6-094d-4723-b3d8-4985038f6cfb | |
| contentIds: | |
| - 221f4ce0-9154-44dd-acbe-6bedd3079565 | |
| dragged: false | |
| focused: false | |
| highlighted: false | |
| id: ecf47122-4112-4530-8da2-0c5f0912f328 | |
| name: Button | |
| open: false | |
| forcedOpen: false | |
| patternId: 669d7465-625a-4508-8167-ff81ff873795 | |
| placeholderHighlighted: none | |
| propertyValues: | |
| - - b26f5304-5773-415a-9062-c07043a3dc48 | |
| - null | |
| - - ac983340-7614-40de-a4f2-7340e988b3e7 | |
| - button-primary | |
| - - e0681f3c-7ac3-4568-a8b9-e456ec09df79 | |
| - null | |
| - - 4767b4ed-3693-4dee-8842-6652268fb621 | |
| - null | |
| - - 7e03f2a8-d789-4290-a507-23355b3a7b9f | |
| - null | |
| - - 39bbb0cb-d446-4504-a3a0-b5c3c450221d | |
| - null | |
| - - 2f8b731d-7010-4190-97d6-a3314c02abec | |
| - null | |
| - - 4baf72fd-7aa4-478d-93d6-df2c2d63f6c5 | |
| - null | |
| - - 28c3b1dc-0c6b-42f7-be9c-57f239f9092a | |
| - null | |
| - - 250b7df7-139d-44c8-a76a-d01f1571c015 | |
| - null | |
| - - 831bc208-1362-462a-b128-6ff6155299b9 | |
| - null | |
| - - e5ecfdf7-e15c-456a-96a0-9bbf6cae2c03 | |
| - null | |
| - - 2ddc7442-d968-4e99-b7cd-055ee8005bf5 | |
| - null | |
| - - 63c935a7-6abd-4adb-8751-196f1376a402 | |
| - null | |
| - - 3180960c-2d94-4ca4-af99-65e88f184f29 | |
| - null | |
| - - c8a5929c-04fb-4831-b35d-fd3df4d6798e | |
| - null | |
| - - d7a78255-e555-480e-ad32-dde06f45ac7c | |
| - null | |
| - - e3ef8be4-7b08-47bc-abe6-8258efaa19bb | |
| - null | |
| - - f95b1e79-baab-437c-9da0-89d63c451ebe | |
| - null | |
| - - 7363b138-508e-4a6a-853f-9eed04688420 | |
| - null | |
| - - 5e41be59-6b0b-4f2a-8140-8b29d992be59 | |
| - null | |
| - - 38e88f60-9788-48c0-82e7-164d159c23a2 | |
| - null | |
| - - 360a3084-cf3f-417f-a780-f3e63bf32154 | |
| - null | |
| - - ca1c043f-4ee5-4a16-99e4-8853dbe729b3 | |
| - null | |
| - - 9fd5a263-0188-472e-a869-f55e1d57537a | |
| - null | |
| - - 3152efff-3f2a-4a68-bf54-ebfbfd4f22f8 | |
| - null | |
| - - 209283ad-d6a5-4bd1-9213-292874eea611 | |
| - null | |
| - - 92abcc7c-c71a-40fa-a88b-b7d149dba57d | |
| - null | |
| - - 8f914134-29f7-44b6-a9aa-3adc03ff1398 | |
| - null | |
| - - 3c094fec-b78a-4825-bd23-dd1a16c0ab55 | |
| - null | |
| - - 5ef7b29f-961a-40ba-8aaa-3383f09aa3c8 | |
| - null | |
| - - 030c5e1b-5228-497e-837d-fb64ed8edc67 | |
| - null | |
| - - 97151fd0-9d33-4c52-b4f5-299b8798466b | |
| - null | |
| - - 136a5088-f456-47d6-b7e0-e17ed7e07865 | |
| - null | |
| - - f770e063-482c-440b-baac-c574da215c9a | |
| - null | |
| - - f1daca4d-955c-4a49-ae1f-68cf556085f6 | |
| - null | |
| - - 28575da1-f030-4011-bcef-b58b27b320ec | |
| - null | |
| - - e526c83c-26e6-498f-b9c1-ce10658afd8e | |
| - null | |
| - - e386f866-57fd-4e5b-98dc-ece9dac1410a | |
| - null | |
| - - 36178f7b-77da-4572-b011-7cc3b7e1bbab | |
| - null | |
| - - c9d4d0f9-49c4-4b35-8cf6-ac45787cec7a | |
| - null | |
| - - c768fc7d-b4da-4651-8176-6a573cb9bdb4 | |
| - null | |
| - - a16b8bb9-6a25-43fb-a896-cfe2859c52f6 | |
| - null | |
| - - cadb9573-3ab6-443b-bb86-b004bcff773e | |
| - null | |
| - - a198eb1b-5b01-46da-a7c7-8f4f63ed21d9 | |
| - null | |
| - - 89f32df2-9310-4533-8a5f-da9fde0e2387 | |
| - null | |
| - - 2f28ee39-81e4-42f9-91a8-c683f3b8f81b | |
| - null | |
| - - a1091a38-cbba-4d2d-b088-ebd65653b530 | |
| - null | |
| - - dd77ab40-fe13-45cf-ac46-81ec9c76696a | |
| - null | |
| - - 438f5f1f-0edf-46c7-bfe6-133e009c96fa | |
| - null | |
| - - 8035af87-dc09-4efd-a924-02e825b85192 | |
| - null | |
| - - 4f330a12-0bdc-43d8-b21e-498777376677 | |
| - null | |
| - - 70bb0cae-8284-4352-bb9c-fc1e9c6b352b | |
| - null | |
| - - c5e59825-6f34-405a-a697-624967a2e811 | |
| - null | |
| - - 998a0730-bf7f-427e-b010-1dbb468062c7 | |
| - null | |
| - - 5092c7db-0f9b-4011-a53c-a32f8c902b3f | |
| - null | |
| - - a49b9658-1d3f-4f5b-a36b-673c01d4ec27 | |
| - null | |
| - - 5a725ee6-5751-4874-8db0-20f4ea990eb7 | |
| - null | |
| - - 4e333be2-e029-4787-a9a7-5929d4a65689 | |
| - null | |
| - - afa387e6-2daf-479c-bf81-3fb72e742979 | |
| - null | |
| - - ab888a83-21fa-46de-82a1-1fa7373cc620 | |
| - null | |
| - - fadddd62-2579-48d0-9894-29f962c62523 | |
| - null | |
| - - 8995a175-2676-4265-a4f1-033891a91e96 | |
| - null | |
| - - 5bce6246-4884-4f2e-9baa-962cdf9f121d | |
| - null | |
| - - 45a50e97-d78d-46ba-bdb1-1fa32290a171 | |
| - null | |
| - - c0008e5e-cdbf-49ba-ae96-7789418de5a4 | |
| - null | |
| - - 3fdea9b4-f6a3-4961-ba0a-95e8ad4cab5a | |
| - null | |
| - - 1fc70b6a-dbce-452d-9117-23e5a6439144 | |
| - null | |
| - - 8e542f05-0edd-47c3-b672-1aad93df9e9f | |
| - null | |
| - - f50c4e99-6dbe-454c-a673-d67766c1def7 | |
| - null | |
| - - 17137e22-3865-4b02-b477-a4b143450e8c | |
| - null | |
| - - 26cc315c-66e2-4a9f-83d0-497d81060dc7 | |
| - null | |
| - - 87a075c5-0ad9-42d4-8dd5-401be9d9af3f | |
| - null | |
| - - 600c6642-dad0-4ebd-8a47-e94b9516e0a8 | |
| - null | |
| - - 54af3505-0a97-4ba6-9974-bd666880fbd4 | |
| - null | |
| - - 4f3ff4bf-1098-4b97-8821-1fbb16bdd1f1 | |
| - null | |
| - - 734e9546-d8c3-4d8e-b4ef-c832a1f0fdba | |
| - null | |
| - - 9b75ff64-ba2c-46cb-a463-80e48e9f7fbc | |
| - null | |
| - - 56ffb9b9-f9e0-48a3-9495-cf5ed1ae00f8 | |
| - null | |
| - - 3e547e83-b8e1-415e-9554-f85ba0a2c1d6 | |
| - null | |
| - - 552a5d23-3e4a-4e18-8cf5-54dc3c67a300 | |
| - null | |
| - - 5db6ad6b-8dfe-4295-9bb4-06e7b7a8ba37 | |
| - null | |
| - - 1aa02e50-752e-420f-9793-d32b80bd43c3 | |
| - null | |
| - - 06e51203-ae4b-40b8-ad40-0d086da1e8e7 | |
| - null | |
| - - 5aa04946-fa3e-4d1f-8da6-b03f656d4038 | |
| - null | |
| - - d18a2591-0b6c-441a-a612-97408ae526a9 | |
| - null | |
| - - 132ab478-b418-4a3c-a21f-dfd0ddbcbd5f | |
| - null | |
| - - 7d2a497c-f097-47a8-bce3-1c0533d2dc9d | |
| - null | |
| - - 273757c5-ad75-426d-934c-6071d106a617 | |
| - null | |
| - - 0280c819-e17b-4324-ab05-7b0f3ad0f6dd | |
| - null | |
| - - f56953f5-c2ba-4d91-bf8b-48dc181f31ff | |
| - null | |
| - - 1d1ca0e7-cb66-4795-b5c2-8f4fef518644 | |
| - null | |
| - - 806f6bd0-a8a6-4871-a806-37b62371e53a | |
| - null | |
| - - 1dadd4ae-267d-436a-b8e1-2f1f0d4b2662 | |
| - null | |
| - - a38c1e4a-d059-46f4-84b6-378fc90fc40c | |
| - null | |
| - - 036df49e-d8b1-4413-8cfb-0e7c20c74950 | |
| - null | |
| - - 8a0de8f4-cb19-4e6f-b0c4-8ce9412fd9d4 | |
| - null | |
| - - 20cd5ea9-dd41-41b5-b9b3-1fba9df3f43b | |
| - null | |
| - - 421b505c-2f1d-4f4d-bbb0-15b03dab39a3 | |
| - null | |
| - - 3866d92a-c52e-4537-b638-47e45990e467 | |
| - null | |
| - - ec7f9086-4c2c-4a4b-b162-21bedcd79acd | |
| - null | |
| - - 254b74dd-0592-4e44-8219-00add9316b55 | |
| - null | |
| - - 800abf57-5390-40ba-a6be-8d089f090a2a | |
| - null | |
| - - 83cb74be-422b-4cde-b704-c9e8c2269448 | |
| - null | |
| - - b80a7d97-8d70-433c-901a-810a7c950b67 | |
| - null | |
| - - c3ac1f86-b10a-4807-8079-a8b6dda7c8a4 | |
| - '' | |
| - - 1801c709-4788-41f5-b35c-396520153d89 | |
| - null | |
| - - d63a0704-af97-4f67-b246-92e667963960 | |
| - null | |
| - - 844d78db-70fa-4e76-ac11-2d3997be0c2a | |
| - null | |
| - - 7a21ba34-0405-4aaf-a2fb-819f83b8ac68 | |
| - null | |
| - - 6a3f1cd2-20dd-48c3-860b-dbba46f381dc | |
| - null | |
| - - ed79cad6-50f1-4ecc-a7bc-492ba1b540cf | |
| - null | |
| - - dc4967c7-2ff0-44ac-9c47-256d22c1a810 | |
| - null | |
| - - 3d0242f3-c43d-4a1b-a0c2-1c9866591a47 | |
| - null | |
| - - 09df902a-dd2e-46a2-b373-e9659e24d409 | |
| - null | |
| - - 14a8035c-9f39-4585-8736-81d163f3bf95 | |
| - null | |
| - - 12f2f4d2-8eff-4e01-8551-051f7d2f05df | |
| - null | |
| - - 2ef01f69-d605-4e68-b486-9e56cd830857 | |
| - null | |
| - - df193705-3f92-4e81-8c7a-176bdd10f0e7 | |
| - null | |
| - - 347fc2b7-76dd-4d18-972b-bdadaec8ca7f | |
| - null | |
| - - 3dee1f95-2ab7-4bd9-8c1e-489384806a20 | |
| - null | |
| - - 102af8b4-f110-49c9-9752-ef8cabc784e9 | |
| - null | |
| - - 9314b354-f12e-48a6-909f-4226d7a0c2ed | |
| - null | |
| - - 1d2abc8b-42fd-402d-9e3d-c2dc270b75b7 | |
| - null | |
| - - 3fcafea6-f60d-42bb-a4d0-82bb6f3dcab2 | |
| - null | |
| - - 1029bc2c-1608-4478-b581-fdd402f7fe27 | |
| - null | |
| - - fd61fee7-f08c-4eab-946e-8ddce170dab3 | |
| - null | |
| - - b63c4571-7757-4bff-8fae-2c79cf60ca8d | |
| - null | |
| - - e7055b6d-bdc1-417d-8774-921d60169f06 | |
| - null | |
| - - 319601c0-d065-4255-8920-9caa836a27e2 | |
| - null | |
| - - 148fc29f-6af6-4d9b-a7b8-0a644135b2df | |
| - null | |
| - - 35ca7463-2529-4501-b0d3-ef0c3040d836 | |
| - null | |
| - - 1bccc39a-b27d-4dc8-b9d9-190ffb94ceab | |
| - null | |
| - - ad681994-1e50-423e-9003-c951cbb3415d | |
| - null | |
| - - 4738799d-2752-4923-8666-31c4d57cf36f | |
| - null | |
| - - c670b9dc-bb53-4991-ad3c-dce2f9bb705b | |
| - null | |
| - - f1d93bf1-295e-455b-9508-fe2370b9b3f8 | |
| - null | |
| - - 803c05f2-8468-4e42-985e-e7c4142a78f1 | |
| - null | |
| - - 4b10986d-8f34-4ebc-b934-c99bf8314e72 | |
| - null | |
| - - b6a52478-cb37-457a-be98-927756568ce0 | |
| - null | |
| - - 8d70585e-c8a8-49c0-8b56-5353a10abde8 | |
| - null | |
| - - c0aafa32-07dd-48c4-8bea-c8d612026532 | |
| - null | |
| - - c8a23734-36ff-469f-9b0f-945d59532df3 | |
| - null | |
| - - a3d32436-a5e2-4f91-a5b2-7f807bf8780e | |
| - null | |
| - - 77b82fe7-3aeb-42cf-b712-48342757e329 | |
| - null | |
| - - 0c0b9003-2ac5-412a-a237-e5738450d335 | |
| - null | |
| - - 07e0fd76-8e81-442a-ad15-4bcfd879fa63 | |
| - null | |
| - - 311ca64a-c382-4c74-8d68-ad15503cf589 | |
| - null | |
| - - cb4d42aa-475f-4549-ae9b-f64ab9386026 | |
| - null | |
| - - 12675c5a-e8b0-4d59-a471-2418122c3196 | |
| - null | |
| - - 6abd6865-bd3e-456c-879e-c0927eeb3e21 | |
| - null | |
| - - 211db50c-47a6-4c40-9d0d-366b45efa883 | |
| - null | |
| - - fd48ac24-ef78-4e49-893a-19c7085fa6d3 | |
| - null | |
| - - 08f1539c-769d-4cd2-981a-f438ea90b19a | |
| - null | |
| - - efeaaec1-e2b3-4d8c-8496-86836dd6a352 | |
| - null | |
| - - 37ec1907-3b51-476f-97cc-26ec8247c160 | |
| - null | |
| - - 45ae6833-4850-4e0a-a457-0a8c1c74b082 | |
| - null | |
| - - 2d4f0994-d143-4e11-b9d0-7e19715e8339 | |
| - null | |
| - - 9b1c36a5-ca0a-4486-97fa-fcb4d9c0bef6 | |
| - null | |
| - - fc2194bb-e365-4ca5-9228-5745046af6b9 | |
| - null | |
| - - 72e1eee0-6806-44c1-8db4-ce07082a5af7 | |
| - null | |
| - - 663ff1ae-e101-48b4-b6f4-f700e22dd77a | |
| - null | |
| - - 99af2a55-1f0b-48d2-ba08-c08fb8c16ed7 | |
| - null | |
| - - ff4cfe05-9994-4ce1-a9ff-98105bbba0fd | |
| - null | |
| - - 8e9b2cd7-ecd2-4b84-bee0-cde678787add | |
| - null | |
| - - e55ba4ae-1a47-4320-8eb0-e5056d77841a | |
| - null | |
| - - ac977bff-2727-4671-ae84-7b0a4834e875 | |
| - null | |
| - - 610a1216-9f9e-4ffc-9891-8c0a6a73674f | |
| - null | |
| - - a44a1b7a-43ed-4af2-9b8d-03fcd2304d89 | |
| - null | |
| - - 24a174dc-5c38-4e5b-a52c-7cf91ba19e5a | |
| - null | |
| - - dfe94128-c1a6-4689-af53-ad863bc3ff94 | |
| - null | |
| - - 48b9cd35-2c4a-48eb-a4e3-d29efb8fa286 | |
| - null | |
| - - 1a24004c-371c-4a90-814a-0ce8b68a4a48 | |
| - null | |
| - - 848543e5-f843-4f65-b0ce-6fab71127097 | |
| - null | |
| - - ff49d9ed-0958-4978-97ba-2c3c52a06648 | |
| - null | |
| - - 7b3706b2-9469-4b52-a174-c3ddb90ab4f0 | |
| - null | |
| - - df57e13d-cded-4ac3-8f7b-31db77fb1885 | |
| - null | |
| - - b1a0b817-a723-49ab-a653-89b6db60d62f | |
| - null | |
| - - 79caec21-969e-4fbb-bc08-c62cb434f1b4 | |
| - null | |
| - - 3d4c6ddf-59bf-4f70-93e8-3d46a76bae0c | |
| - null | |
| - - f2fed750-b02b-4e23-8899-bfd88925224d | |
| - null | |
| - - ea725e89-b8ea-4b0a-9639-b686256a43f3 | |
| - null | |
| - - c0c35611-2579-4d45-94b6-67fb386cca7c | |
| - null | |
| - - 5cf57ac9-777b-43fe-8cfe-e9dbdf7bb285 | |
| - null | |
| - - 6416444e-445d-44be-8794-fe8b8e361957 | |
| - null | |
| - - 47dc896f-e24e-4c25-9985-ce8fca34ceab | |
| - null | |
| - - 10c50c91-9c86-47cc-981f-291ee4b85dae | |
| - null | |
| - - 3719eabe-0f16-4e8f-ac26-0a1c02578e3f | |
| - null | |
| - - e4578d28-fd1b-49c6-8e21-e017d3fb4ebf | |
| - null | |
| - - f8b35d8e-93da-4f6a-9c51-affd4eda762c | |
| - null | |
| - - 2c995b9f-1648-476d-99a6-fe16c0e17169 | |
| - null | |
| - - 8fcc4503-9cdc-4077-af6d-d81eab88b231 | |
| - null | |
| - - 49647359-4a5e-42e6-a9a7-6c92bf961d9e | |
| - null | |
| - - fdad75b0-0862-440b-b50e-d5c73e47e01a | |
| - null | |
| - - 1fa9fdfe-66e9-465a-b061-184c4157eeef | |
| - null | |
| - - 3d78e979-9e73-43af-a5db-4fde3299ae35 | |
| - null | |
| - - 620e87cc-b015-4124-8aab-615863065887 | |
| - null | |
| - - 4502893a-c0fa-45b1-b659-f2bda55e606e | |
| - null | |
| - - a4f43298-8595-4e23-ac71-beec6b5352db | |
| - null | |
| - - e4d7720d-fc0f-4c5f-b2ae-d89452bba7c3 | |
| - null | |
| - - 59ba9f76-07b3-4b59-8b44-9007f544bea3 | |
| - null | |
| - - b3f3a552-da60-4807-a53f-84521b6b0fef | |
| - null | |
| - - 635b8c7c-c7be-4409-9db7-f2ec2b6a55cd | |
| - null | |
| - - a9cd7844-073d-4a2e-92a7-c3f0435c519b | |
| - null | |
| - - c1786a95-5e69-44c2-80b0-50f3a95f578d | |
| - null | |
| - - e8b6fad4-1a0f-44ff-b23e-f039d7b830bb | |
| - null | |
| - - be799a4f-7d3a-4302-8012-780eb0b81288 | |
| - null | |
| - - 5b6303b4-720f-4b5b-a3bf-e2c966c5adb7 | |
| - null | |
| - - 57658eaa-a49b-486e-b3dd-f65695215d2b | |
| - null | |
| - - 51feca8c-9560-404f-9bc1-cce76c382fd9 | |
| - null | |
| - - f91819a6-85bd-4a80-91e2-1913a4592b44 | |
| - null | |
| - - 92b75b80-25b7-41ff-9a6a-6cadca83de94 | |
| - null | |
| - - 077f8f00-b7ba-4714-abf4-82fcd456b8aa | |
| - null | |
| - - 2b86f9de-7a41-47e9-b8ab-6536a40362f2 | |
| - null | |
| - - e54d7d80-1022-48bf-9846-960fa64800d6 | |
| - null | |
| - - 8b829025-5890-4de2-9095-bc8743cf138d | |
| - null | |
| - - 75fb8b86-e6b3-4ef0-a108-57cee3dab0a5 | |
| - null | |
| - - 0fa9b79f-c117-42bc-9aea-f019f4b90cb5 | |
| - null | |
| - - fda7b5fd-768f-4e1f-9f88-4b1cc0d676b2 | |
| - null | |
| - - a412f3d7-be0c-42b7-af82-13fb63fd108c | |
| - null | |
| - - 4e603472-345c-42c1-b601-d8ec6e31ec9d | |
| - null | |
| - - 86a0b8b6-c6c6-4162-9ef4-559a3337603c | |
| - null | |
| - - 5b337e1b-c6f7-41ff-b0d7-4a981494290a | |
| - null | |
| - - 9a57e58d-512d-4e13-89a9-83d0aa4e1e0a | |
| - null | |
| - - 5b6b0a40-dd6c-4102-86ff-c8b55004dbd1 | |
| - null | |
| - - 4261f966-0577-490a-b059-119dfd87c24b | |
| - null | |
| - - ef9045e5-3b2e-4a36-88c2-c35ee6d261ac | |
| - null | |
| - - 39199628-fa3c-49a4-b5f0-339b6cc44f8a | |
| - null | |
| - - bfb22f86-b5d2-487d-8c6a-b241b960e807 | |
| - null | |
| - - c68fbabb-1509-4ff8-9aef-6a463af6ad46 | |
| - null | |
| - - a43665fa-076e-46fa-a7a0-62a6e16a304a | |
| - null | |
| - - dba10598-6f35-4acf-8d23-88f2ebf2f2af | |
| - null | |
| - - 8c0d11e9-d263-443d-97bd-848d1135737f | |
| - null | |
| - - 35558cbf-fc52-474c-9dc2-a75f33e58f98 | |
| - null | |
| - - a9fae104-9c7b-48d9-9c71-ac53806ded99 | |
| - null | |
| - - 466e4f3f-e436-40d0-ab12-aad6b786228e | |
| - null | |
| - - 9aa2c651-ef48-485b-8884-88f22a93c1d8 | |
| - null | |
| - - e05f598f-db3f-45be-84bc-46806ae78492 | |
| - null | |
| - - 864a4e0a-74df-46e4-8eba-570f9121462e | |
| - null | |
| - - 4f97bcc4-0073-40a9-b00f-50431def715f | |
| - null | |
| - - 80d1fe01-a680-4a7a-983f-fadf558d0029 | |
| - null | |
| - - 43d3082b-f554-4038-a35d-587fcc63b717 | |
| - null | |
| - - 1ada17dd-0327-404d-921d-1d74510a9ed4 | |
| - null | |
| - - 1f36b14a-597d-4458-a96a-a47554b73b87 | |
| - null | |
| - - de7934c8-9642-47cc-8831-278f49193068 | |
| - null | |
| - - 0ac7308e-49c0-4cbc-a54c-14912a4871d2 | |
| - null | |
| - - e5e41a28-31c9-4928-b22e-bc06f36acd69 | |
| - null | |
| - - 7ae4c3ad-dca2-4168-9c5d-4e163298a586 | |
| - null | |
| - - ea7231da-4195-42e9-a645-fbba0035e97d | |
| - null | |
| - - 7a6eaa0b-eaa2-4cf8-91eb-c20a78f296ea | |
| - null | |
| - - 220af4aa-06bb-44d6-81d8-01906b9ddeb5 | |
| - null | |
| - - da0c416e-e7d0-4bbc-95c4-766c79479a94 | |
| - null | |
| role: node | |
| selected: false | |
| - model: Element | |
| containerId: 221f4ce0-9154-44dd-acbe-6bedd3079565 | |
| contentIds: [] | |
| dragged: false | |
| focused: false | |
| highlighted: false | |
| id: 19ab569d-4c3d-4711-8e39-39a0e8aca31b | |
| name: Text | |
| open: false | |
| forcedOpen: false | |
| patternId: 2455fa5c-8944-4c92-9929-a70e1d3bc5f1 | |
| placeholderHighlighted: none | |
| propertyValues: | |
| - - 0b1dbfba-d5c7-428b-8aa6-9a42774cb818 | |
| - I am a button with an unsensible amount of properties. | |
| role: node | |
| selected: false | |
| elementActions: [] | |
| elementContents: | |
| - model: ElementContent | |
| elementIds: | |
| - ecf47122-4112-4530-8da2-0c5f0912f328 | |
| forcedOpen: true | |
| highlighted: false | |
| id: 4e7b5dc6-094d-4723-b3d8-4985038f6cfb | |
| open: false | |
| parentElementId: 9a74c44b-17c7-4061-b4d6-04307bf8b7d6 | |
| slotId: a9cf0445-ccc3-4aa8-82b9-be7a6d51b504 | |
| - model: ElementContent | |
| elementIds: | |
| - 19ab569d-4c3d-4711-8e39-39a0e8aca31b | |
| forcedOpen: false | |
| highlighted: false | |
| id: 221f4ce0-9154-44dd-acbe-6bedd3079565 | |
| open: false | |
| parentElementId: ecf47122-4112-4530-8da2-0c5f0912f328 | |
| slotId: 114230d5-7c56-4bf0-a046-d803ec16e226 | |
| id: b686591f-357b-4165-82cf-849eb83a10d2 | |
| name: pr-728 | |
| pages: | |
| - model: Page | |
| active: true | |
| focused: false | |
| id: 1a005c19-ee53-4715-967f-33febb43149e | |
| name: Page 1 | |
| rootId: 9a74c44b-17c7-4061-b4d6-04307bf8b7d6 | |
| pageList: | |
| - 1a005c19-ee53-4715-967f-33febb43149e | |
| path: /Users/marneb/Desktop/pr-728.alva | |
| patternLibraries: | |
| - model: PatternLibrary | |
| bundleId: '' | |
| bundle: '' | |
| description: Built-in components for basic layouts and logic | |
| id: 889cd6da-991e-4476-8059-62441557bd53 | |
| name: Essentials | |
| version: 1.0.0 | |
| origin: built-in | |
| patterns: | |
| - model: Pattern | |
| contextId: 'synthetic:page' | |
| description: '' | |
| exportName: default | |
| icon: '' | |
| id: f539d7c9-3b3a-4cb1-887b-8be4dc496d77 | |
| name: Page | |
| origin: built-in | |
| propertyIds: [] | |
| slots: | |
| - model: PatternSlot | |
| contextId: children | |
| description: '' | |
| example: '' | |
| hidden: false | |
| label: Children | |
| propertyName: children | |
| id: a9cf0445-ccc3-4aa8-82b9-be7a6d51b504 | |
| required: false | |
| type: children | |
| type: 'synthetic:page' | |
| - model: Pattern | |
| contextId: 'synthetic:text' | |
| description: 'for Headlines, Copy and more' | |
| exportName: default | |
| icon: Type | |
| id: 2455fa5c-8944-4c92-9929-a70e1d3bc5f1 | |
| name: Text | |
| origin: built-in | |
| propertyIds: | |
| - 0b1dbfba-d5c7-428b-8aa6-9a42774cb818 | |
| slots: [] | |
| type: 'synthetic:text' | |
| - model: Pattern | |
| contextId: 'synthetic:box' | |
| description: for Flexbox Layouts | |
| exportName: default | |
| icon: Box | |
| id: 084d859d-0bbb-4a81-8441-542e45c3cc12 | |
| name: Box | |
| origin: built-in | |
| propertyIds: | |
| - cc2a9fce-cc16-48ed-a9c7-37652ce7dd84 | |
| - 01d18a57-d7ac-4d0c-aacf-dd89d115f5cf | |
| - ce30d8a3-70ff-4817-a55c-c9823412d673 | |
| - f123680a-a9c8-4530-b2e0-b8bde733e4bd | |
| - b2194596-3d8f-4c01-8cdb-24f07d1bae98 | |
| - ceefb2d1-0aa2-4b98-b4c9-8d758e95592c | |
| - 980be004-6635-4dc7-ac94-1c9b99129be3 | |
| - 54b6a30f-f718-486e-a24d-6a788ac40375 | |
| - 488f385f-4d37-4336-b435-ba037a543b78 | |
| - 84ebd40e-9e18-400a-92c0-0ecaf56cb00a | |
| - fae1acd9-387c-462f-9be6-a251503ce2d4 | |
| slots: | |
| - model: PatternSlot | |
| contextId: children | |
| description: '' | |
| example: '' | |
| hidden: false | |
| label: Children | |
| propertyName: children | |
| id: 35a9bbe6-ff31-4dac-85ea-ac77d3b0a2fc | |
| required: false | |
| type: children | |
| type: 'synthetic:box' | |
| - model: Pattern | |
| contextId: 'synthetic:conditional' | |
| description: for Show and Hide Logic | |
| exportName: default | |
| icon: ToggleRight | |
| id: dc42be28-7fe9-4cb3-89c7-f63a419d5d76 | |
| name: Conditional | |
| origin: built-in | |
| propertyIds: | |
| - bee509d6-52d1-4c98-a99d-4360775cad6c | |
| slots: | |
| - model: PatternSlot | |
| contextId: truthy | |
| description: '' | |
| example: '' | |
| hidden: false | |
| label: If True | |
| propertyName: ifTrue | |
| id: 5c098731-caa8-4d1c-b981-c0e935fcd68b | |
| required: false | |
| type: property | |
| - model: PatternSlot | |
| contextId: falsy | |
| description: '' | |
| example: '' | |
| hidden: false | |
| label: If False | |
| propertyName: ifFalse | |
| id: cac7a506-d575-4d71-b341-0d2abbfac5dc | |
| required: false | |
| type: property | |
| type: 'synthetic:conditional' | |
| - model: Pattern | |
| contextId: 'synthetic:image' | |
| description: for Design Drafts | |
| exportName: default | |
| icon: Image | |
| id: b71b9a64-82bf-470a-a545-5e6ff92c1c6d | |
| name: Design | |
| origin: built-in | |
| propertyIds: | |
| - bac2cd8d-39d0-4f44-b0cb-2a5422e79cd7 | |
| - 457802c8-acbf-49f4-92b6-47be783aef39 | |
| - 541647c0-8c38-4831-99b0-3b39cefa8662 | |
| - 5954e9ad-4efe-4898-8993-a6059d1ea099 | |
| - fb0d6bdb-572c-4fc1-9ae3-1fe9634d4de2 | |
| - 2c94defe-8e49-4983-823f-5d223e53fbfe | |
| - 361b9476-26e1-45bd-9215-d90bc8b31aee | |
| - 3527da38-6b12-4294-a34b-739c205ca95a | |
| slots: [] | |
| type: 'synthetic:image' | |
| - model: Pattern | |
| contextId: 'synthetic:link' | |
| description: for Interaction | |
| exportName: default | |
| icon: ExternalLink | |
| id: be065881-fd15-4e60-8f4a-641cc3bf919d | |
| name: Link | |
| origin: built-in | |
| propertyIds: | |
| - 96484039-6f3f-4b20-b73d-8d943447941c | |
| slots: | |
| - model: PatternSlot | |
| contextId: children | |
| description: '' | |
| example: '' | |
| hidden: false | |
| label: Children | |
| propertyName: children | |
| id: 7da7bdcd-ac14-42ca-a347-9cfb31d9c64e | |
| required: false | |
| type: children | |
| type: 'synthetic:link' | |
| patternProperties: | |
| - model: PatternProperty | |
| contextId: src | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: bac2cd8d-39d0-4f44-b0cb-2a5422e79cd7 | |
| inputType: default | |
| label: Image | |
| origin: built-in | |
| propertyName: src | |
| required: false | |
| type: asset | |
| - model: PatternProperty | |
| contextId: width | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 457802c8-acbf-49f4-92b6-47be783aef39 | |
| inputType: default | |
| label: Width | |
| origin: built-in | |
| propertyName: width | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: height | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 541647c0-8c38-4831-99b0-3b39cefa8662 | |
| inputType: default | |
| label: Height | |
| origin: built-in | |
| propertyName: height | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: min-width | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 5954e9ad-4efe-4898-8993-a6059d1ea099 | |
| inputType: default | |
| label: Min Width | |
| origin: built-in | |
| propertyName: minWidth | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: min-height | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: fb0d6bdb-572c-4fc1-9ae3-1fe9634d4de2 | |
| inputType: default | |
| label: Min Height | |
| origin: built-in | |
| propertyName: minHeight | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: max-width | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 2c94defe-8e49-4983-823f-5d223e53fbfe | |
| inputType: default | |
| label: Max Width | |
| origin: built-in | |
| propertyName: maxWidth | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: max-height | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 361b9476-26e1-45bd-9215-d90bc8b31aee | |
| inputType: default | |
| label: Max Height | |
| origin: built-in | |
| propertyName: maxHeight | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: onClick | |
| description: You can set an interaction that happens on Click. | |
| event: | |
| type: MouseEvent | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 3527da38-6b12-4294-a34b-739c205ca95a | |
| inputType: default | |
| label: Interaction | |
| origin: built-in | |
| propertyName: onClick | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: text | |
| defaultValue: Text | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 0b1dbfba-d5c7-428b-8aa6-9a42774cb818 | |
| inputType: default | |
| label: Text | |
| origin: built-in | |
| propertyName: text | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: width | |
| defaultValue: auto | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: cc2a9fce-cc16-48ed-a9c7-37652ce7dd84 | |
| inputType: default | |
| label: Width | |
| origin: built-in | |
| propertyName: width | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: height | |
| defaultValue: auto | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 01d18a57-d7ac-4d0c-aacf-dd89d115f5cf | |
| inputType: default | |
| label: Height | |
| origin: built-in | |
| propertyName: height | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: flex | |
| defaultValue: true | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: ce30d8a3-70ff-4817-a55c-c9823412d673 | |
| inputType: default | |
| label: Flex | |
| origin: built-in | |
| propertyName: flex | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: flex-direction | |
| defaultOptionId: 0a7c4b40-efb2-426f-b90a-75e9de7b2d8e | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: f123680a-a9c8-4530-b2e0-b8bde733e4bd | |
| inputType: radio-group | |
| label: Direction | |
| propertyName: flexDirection | |
| options: | |
| - model: PatternEnumPropertyOption | |
| contextId: row | |
| id: 0a7c4b40-efb2-426f-b90a-75e9de7b2d8e | |
| name: Horizontal | |
| ordinal: '0' | |
| value: row | |
| - model: PatternEnumPropertyOption | |
| contextId: column | |
| id: 6d39fce9-26c6-45c9-a8f6-9ae1d5897327 | |
| name: Vertical | |
| ordinal: '1' | |
| value: column | |
| origin: built-in | |
| required: false | |
| type: enum | |
| - model: PatternProperty | |
| contextId: align-items | |
| defaultOptionId: df26d5d7-1f8b-437f-a139-dc92a09cf8ee | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: b2194596-3d8f-4c01-8cdb-24f07d1bae98 | |
| inputType: radio-group | |
| label: Align | |
| propertyName: alignItems | |
| options: | |
| - model: PatternEnumPropertyOption | |
| contextId: flex-start | |
| icon: 2 | |
| id: 5bba175d-f379-4beb-8e1e-a3b95d7d73a9 | |
| name: Start | |
| ordinal: '0' | |
| value: flex-start | |
| - model: PatternEnumPropertyOption | |
| contextId: center | |
| icon: 3 | |
| id: df26d5d7-1f8b-437f-a139-dc92a09cf8ee | |
| name: Center | |
| ordinal: '1' | |
| value: center | |
| - model: PatternEnumPropertyOption | |
| contextId: flex-end | |
| icon: 4 | |
| id: 0ec712e5-0d67-4683-b150-8bae43cac4e5 | |
| name: End | |
| ordinal: '2' | |
| value: flex-end | |
| - model: PatternEnumPropertyOption | |
| contextId: stretch | |
| icon: 5 | |
| id: 4aab0e9b-c31b-4611-a41d-712e2a806b38 | |
| name: Stretch | |
| ordinal: '3' | |
| value: stretch | |
| - model: PatternEnumPropertyOption | |
| contextId: baseline | |
| icon: 6 | |
| id: 4ab0064d-5c54-4cf7-b28d-344c098337e5 | |
| name: Baseline | |
| ordinal: '4' | |
| value: baseline | |
| origin: built-in | |
| required: false | |
| type: enum | |
| - model: PatternProperty | |
| contextId: justify-content | |
| defaultOptionId: 62f7c588-f72f-4e87-9c49-bb776e9fabc1 | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: ceefb2d1-0aa2-4b98-b4c9-8d758e95592c | |
| inputType: select | |
| label: Justify | |
| propertyName: justifyContent | |
| options: | |
| - model: PatternEnumPropertyOption | |
| contextId: flex-start | |
| id: 16226959-4b3f-44ac-90a2-6edffdc69da9 | |
| name: Start | |
| ordinal: '0' | |
| value: flex-start | |
| - model: PatternEnumPropertyOption | |
| contextId: flex-end | |
| id: f1f6bbc6-1d2a-4d24-b894-9eb88393b45a | |
| name: End | |
| ordinal: '1' | |
| value: flex-end | |
| - model: PatternEnumPropertyOption | |
| contextId: center | |
| id: 62f7c588-f72f-4e87-9c49-bb776e9fabc1 | |
| name: Center | |
| ordinal: '2' | |
| value: center | |
| - model: PatternEnumPropertyOption | |
| contextId: space-between | |
| id: d8967a7e-3648-4665-8d3a-f47d52375e7d | |
| name: Space Between | |
| ordinal: '3' | |
| value: space-between | |
| - model: PatternEnumPropertyOption | |
| contextId: space-around | |
| id: 0a99c244-187a-4dce-841e-939d4c57efed | |
| name: Space Around | |
| ordinal: '4' | |
| value: space-around | |
| - model: PatternEnumPropertyOption | |
| contextId: space-evenly | |
| id: ae6b985e-978a-40b9-9c92-214c8a41521d | |
| name: Space Evenly | |
| ordinal: '5' | |
| value: space-evenly | |
| origin: built-in | |
| required: false | |
| type: enum | |
| - model: PatternProperty | |
| contextId: flex-wrap | |
| defaultValue: false | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 980be004-6635-4dc7-ac94-1c9b99129be3 | |
| inputType: default | |
| label: Wrap | |
| origin: built-in | |
| propertyName: wrap | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: flex-grow | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 54b6a30f-f718-486e-a24d-6a788ac40375 | |
| inputType: default | |
| label: Grow | |
| origin: built-in | |
| propertyName: flexGrow | |
| required: false | |
| type: number | |
| - model: PatternProperty | |
| contextId: flex-shrink | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 488f385f-4d37-4336-b435-ba037a543b78 | |
| inputType: default | |
| label: Shrink | |
| origin: built-in | |
| propertyName: flexShrink | |
| required: false | |
| type: number | |
| - model: PatternProperty | |
| contextId: flex-basis | |
| defaultValue: auto | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 84ebd40e-9e18-400a-92c0-0ecaf56cb00a | |
| inputType: default | |
| label: Size | |
| origin: built-in | |
| propertyName: flexBasis | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: background-color | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: fae1acd9-387c-462f-9be6-a251503ce2d4 | |
| inputType: default | |
| label: Background Color | |
| origin: built-in | |
| propertyName: backgroundColor | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: condition | |
| defaultValue: true | |
| description: 'Show the "True" slot, disable to show the "False" slot' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: bee509d6-52d1-4c98-a99d-4360775cad6c | |
| inputType: default | |
| label: Condition | |
| origin: built-in | |
| propertyName: condition | |
| required: true | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: onClick | |
| description: You can set an interaction that happens on Click. | |
| event: | |
| type: MouseEvent | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 96484039-6f3f-4b20-b73d-8d943447941c | |
| inputType: default | |
| label: Interaction | |
| origin: built-in | |
| propertyName: onClick | |
| required: false | |
| type: EventHandler | |
| state: connected | |
| - model: PatternLibrary | |
| bundleId: 7af7f690-cc0b-4a3d-aecd-85617b238a1f | |
| bundle: "window[\"7af7f690-cc0b-4a3d-aecd-85617b238a1f\"] =\n/******/ (function(modules) { // webpackBootstrap\n/******/ \t// The module cache\n/******/ \tvar installedModules = {};\n/******/\n/******/ \t// The require function\n/******/ \tfunction __webpack_require__(moduleId) {\n/******/\n/******/ \t\t// Check if module is in cache\n/******/ \t\tif(installedModules[moduleId]) {\n/******/ \t\t\treturn installedModules[moduleId].exports;\n/******/ \t\t}\n/******/ \t\t// Create a new module (and put it into the cache)\n/******/ \t\tvar module = installedModules[moduleId] = {\n/******/ \t\t\ti: moduleId,\n/******/ \t\t\tl: false,\n/******/ \t\t\texports: {}\n/******/ \t\t};\n/******/\n/******/ \t\t// Execute the module function\n/******/ \t\tmodules[moduleId].call(module.exports, module, module.exports, __webpack_require__);\n/******/\n/******/ \t\t// Flag the module as loaded\n/******/ \t\tmodule.l = true;\n/******/\n/******/ \t\t// Return the exports of the module\n/******/ \t\treturn module.exports;\n/******/ \t}\n/******/\n/******/\n/******/ \t// expose the modules object (__webpack_modules__)\n/******/ \t__webpack_require__.m = modules;\n/******/\n/******/ \t// expose the module cache\n/******/ \t__webpack_require__.c = installedModules;\n/******/\n/******/ \t// define getter function for harmony exports\n/******/ \t__webpack_require__.d = function(exports, name, getter) {\n/******/ \t\tif(!__webpack_require__.o(exports, name)) {\n/******/ \t\t\tObject.defineProperty(exports, name, { enumerable: true, get: getter });\n/******/ \t\t}\n/******/ \t};\n/******/\n/******/ \t// define __esModule on exports\n/******/ \t__webpack_require__.r = function(exports) {\n/******/ \t\tif(typeof Symbol !== 'undefined' && Symbol.toStringTag) {\n/******/ \t\t\tObject.defineProperty(exports, Symbol.toStringTag, { value: 'Module' });\n/******/ \t\t}\n/******/ \t\tObject.defineProperty(exports, '__esModule', { value: true });\n/******/ \t};\n/******/\n/******/ \t// create a fake namespace object\n/******/ \t// mode & 1: value is a module id, require it\n/******/ \t// mode & 2: merge all properties of value into the ns\n/******/ \t// mode & 4: return value when already ns object\n/******/ \t// mode & 8|1: behave like require\n/******/ \t__webpack_require__.t = function(value, mode) {\n/******/ \t\tif(mode & 1) value = __webpack_require__(value);\n/******/ \t\tif(mode & 8) return value;\n/******/ \t\tif((mode & 4) && typeof value === 'object' && value && value.__esModule) return value;\n/******/ \t\tvar ns = Object.create(null);\n/******/ \t\t__webpack_require__.r(ns);\n/******/ \t\tObject.defineProperty(ns, 'default', { enumerable: true, value: value });\n/******/ \t\tif(mode & 2 && typeof value != 'string') for(var key in value) __webpack_require__.d(ns, key, function(key) { return value[key]; }.bind(null, key));\n/******/ \t\treturn ns;\n/******/ \t};\n/******/\n/******/ \t// getDefaultExport function for compatibility with non-harmony modules\n/******/ \t__webpack_require__.n = function(module) {\n/******/ \t\tvar getter = module && module.__esModule ?\n/******/ \t\t\tfunction getDefault() { return module['default']; } :\n/******/ \t\t\tfunction getModuleExports() { return module; };\n/******/ \t\t__webpack_require__.d(getter, 'a', getter);\n/******/ \t\treturn getter;\n/******/ \t};\n/******/\n/******/ \t// Object.prototype.hasOwnProperty.call\n/******/ \t__webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); };\n/******/\n/******/ \t// __webpack_public_path__\n/******/ \t__webpack_require__.p = \"\";\n/******/\n/******/\n/******/ \t// Load entry module and return exports\n/******/ \treturn __webpack_require__(__webpack_require__.s = \"../alva/packages/core/build/preview/preview-loader.js?cwd=%2FUsers%2Fmarneb%2FDocuments%2Falva%2Fdesignkit&components=%7B%22669d7465-625a-4508-8167-ff81ff873795%22%3A%22.%2Flib%2Fbutton%2Fbutton.js%22%2C%22e4e5bbbd-df5f-4751-89f3-a8fdb1e8bb37%22%3A%22.%2Flib%2Fcheckbox%2Fcheckbox.js%22%2C%221a4f0ad5-61d1-48e4-af6d-c34d3b92f066%22%3A%22.%2Flib%2Fcopy%2Fcopy.js%22%2C%22f212cacd-6f6f-49b4-8ca5-4d910d3d5e41%22%3A%22.%2Flib%2Fdropdown%2Fdropdown.js%22%2C%22b90a731c-486e-4b72-acde-c196b4ac6b3c%22%3A%22.%2Flib%2Fdropdown-item%2Fdropdown-item.js%22%2C%22f898c445-0e7c-4f93-9c3d-be79f21073f3%22%3A%22.%2Flib%2Ffeature%2Ffeature.js%22%2C%22c22fb434-3fd8-4bef-8ed7-f2390c5af337%22%3A%22.%2Flib%2Ffooter%2Ffooter.js%22%2C%22845a593a-2fa8-44bb-9aa0-39e70ee0743c%22%3A%22.%2Flib%2Fheadline%2Fheadline.js%22%2C%22f4b071e6-7f6b-46f9-89ef-9ddc6decf350%22%3A%22.%2Flib%2Ficons%2Ficons.js%22%2C%228227bbc8-8c56-4dc4-a6f5-f681bc5fe07e%22%3A%22.%2Flib%2Ficons%2Ficons.js%22%2C%220877a52b-a369-4bad-806f-104e727fe258%22%3A%22.%2Flib%2Fimage%2Fimage.js%22%2C%22a6f3b436-f2fa-4e59-b3a4-96a91463740a%22%3A%22.%2Flib%2Finput%2Finput.js%22%2C%22b5bf00ec-e094-4af7-80aa-85353fe02ae6%22%3A%22.%2Flib%2Flayout%2Flayout.js%22%2C%224f23949b-6784-4114-8a91-3b5a4ee24857%22%3A%22.%2Flib%2Flink%2Flink.js%22%2C%22fd0de579-30a1-4338-ac2d-48fbb2f045bd%22%3A%22.%2Flib%2Fmenu%2Fmenu.js%22%2C%2252518600-840c-44d4-b22d-0580e2a40322%22%3A%22.%2Flib%2Fmenu-item%2Fmenu-item.js%22%2C%22172cf2ff-92f4-4a70-8bcb-79adfd800165%22%3A%22.%2Flib%2Fradio%2Fradio.js%22%2C%224db1cdfc-c445-4b3b-a870-0a8b29c6e41a%22%3A%22.%2Flib%2Fsection%2Fsection.js%22%2C%22f3162a93-b80d-4464-8ed4-c90e13887535%22%3A%22.%2Flib%2Fspace%2Fspace.js%22%2C%2270076bd4-8bbe-4b67-93c4-2a8766fd9bf4%22%3A%22.%2Flib%2Fteaser%2Fteaser.js%22%7D!./\");\n/******/ })\n/************************************************************************/\n/******/ ({\n\n/***/ \"../alva/packages/core/build/preview/preview-loader.js?cwd=%2FUsers%2Fmarneb%2FDocuments%2Falva%2Fdesignkit&components=%7B%22669d7465-625a-4508-8167-ff81ff873795%22%3A%22.%2Flib%2Fbutton%2Fbutton.js%22%2C%22e4e5bbbd-df5f-4751-89f3-a8fdb1e8bb37%22%3A%22.%2Flib%2Fcheckbox%2Fcheckbox.js%22%2C%221a4f0ad5-61d1-48e4-af6d-c34d3b92f066%22%3A%22.%2Flib%2Fcopy%2Fcopy.js%22%2C%22f212cacd-6f6f-49b4-8ca5-4d910d3d5e41%22%3A%22.%2Flib%2Fdropdown%2Fdropdown.js%22%2C%22b90a731c-486e-4b72-acde-c196b4ac6b3c%22%3A%22.%2Flib%2Fdropdown-item%2Fdropdown-item.js%22%2C%22f898c445-0e7c-4f93-9c3d-be79f21073f3%22%3A%22.%2Flib%2Ffeature%2Ffeature.js%22%2C%22c22fb434-3fd8-4bef-8ed7-f2390c5af337%22%3A%22.%2Flib%2Ffooter%2Ffooter.js%22%2C%22845a593a-2fa8-44bb-9aa0-39e70ee0743c%22%3A%22.%2Flib%2Fheadline%2Fheadline.js%22%2C%22f4b071e6-7f6b-46f9-89ef-9ddc6decf350%22%3A%22.%2Flib%2Ficons%2Ficons.js%22%2C%228227bbc8-8c56-4dc4-a6f5-f681bc5fe07e%22%3A%22.%2Flib%2Ficons%2Ficons.js%22%2C%220877a52b-a369-4bad-806f-104e727fe258%22%3A%22.%2Flib%2Fimage%2Fimage.js%22%2C%22a6f3b436-f2fa-4e59-b3a4-96a91463740a%22%3A%22.%2Flib%2Finput%2Finput.js%22%2C%22b5bf00ec-e094-4af7-80aa-85353fe02ae6%22%3A%22.%2Flib%2Flayout%2Flayout.js%22%2C%224f23949b-6784-4114-8a91-3b5a4ee24857%22%3A%22.%2Flib%2Flink%2Flink.js%22%2C%22fd0de579-30a1-4338-ac2d-48fbb2f045bd%22%3A%22.%2Flib%2Fmenu%2Fmenu.js%22%2C%2252518600-840c-44d4-b22d-0580e2a40322%22%3A%22.%2Flib%2Fmenu-item%2Fmenu-item.js%22%2C%22172cf2ff-92f4-4a70-8bcb-79adfd800165%22%3A%22.%2Flib%2Fradio%2Fradio.js%22%2C%224db1cdfc-c445-4b3b-a870-0a8b29c6e41a%22%3A%22.%2Flib%2Fsection%2Fsection.js%22%2C%22f3162a93-b80d-4464-8ed4-c90e13887535%22%3A%22.%2Flib%2Fspace%2Fspace.js%22%2C%2270076bd4-8bbe-4b67-93c4-2a8766fd9bf4%22%3A%22.%2Flib%2Fteaser%2Fteaser.js%22%7D!./\":\n/*!*****************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************!*\\\n !*** ../alva/packages/core/build/preview/preview-loader.js?cwd=%2FUsers%2Fmarneb%2FDocuments%2Falva%2Fdesignkit&components=%7B%22669d7465-625a-4508-8167-ff81ff873795%22%3A%22.%2Flib%2Fbutton%2Fbutton.js%22%2C%22e4e5bbbd-df5f-4751-89f3-a8fdb1e8bb37%22%3A%22.%2Flib%2Fcheckbox%2Fcheckbox.js%22%2C%221a4f0ad5-61d1-48e4-af6d-c34d3b92f066%22%3A%22.%2Flib%2Fcopy%2Fcopy.js%22%2C%22f212cacd-6f6f-49b4-8ca5-4d910d3d5e41%22%3A%22.%2Flib%2Fdropdown%2Fdropdown.js%22%2C%22b90a731c-486e-4b72-acde-c196b4ac6b3c%22%3A%22.%2Flib%2Fdropdown-item%2Fdropdown-item.js%22%2C%22f898c445-0e7c-4f93-9c3d-be79f21073f3%22%3A%22.%2Flib%2Ffeature%2Ffeature.js%22%2C%22c22fb434-3fd8-4bef-8ed7-f2390c5af337%22%3A%22.%2Flib%2Ffooter%2Ffooter.js%22%2C%22845a593a-2fa8-44bb-9aa0-39e70ee0743c%22%3A%22.%2Flib%2Fheadline%2Fheadline.js%22%2C%22f4b071e6-7f6b-46f9-89ef-9ddc6decf350%22%3A%22.%2Flib%2Ficons%2Ficons.js%22%2C%228227bbc8-8c56-4dc4-a6f5-f681bc5fe07e%22%3A%22.%2Flib%2Ficons%2Ficons.js%22%2C%220877a52b-a369-4bad-806f-104e727fe258%22%3A%22.%2Flib%2Fimage%2Fimage.js%22%2C%22a6f3b436-f2fa-4e59-b3a4-96a91463740a%22%3A%22.%2Flib%2Finput%2Finput.js%22%2C%22b5bf00ec-e094-4af7-80aa-85353fe02ae6%22%3A%22.%2Flib%2Flayout%2Flayout.js%22%2C%224f23949b-6784-4114-8a91-3b5a4ee24857%22%3A%22.%2Flib%2Flink%2Flink.js%22%2C%22fd0de579-30a1-4338-ac2d-48fbb2f045bd%22%3A%22.%2Flib%2Fmenu%2Fmenu.js%22%2C%2252518600-840c-44d4-b22d-0580e2a40322%22%3A%22.%2Flib%2Fmenu-item%2Fmenu-item.js%22%2C%22172cf2ff-92f4-4a70-8bcb-79adfd800165%22%3A%22.%2Flib%2Fradio%2Fradio.js%22%2C%224db1cdfc-c445-4b3b-a870-0a8b29c6e41a%22%3A%22.%2Flib%2Fsection%2Fsection.js%22%2C%22f3162a93-b80d-4464-8ed4-c90e13887535%22%3A%22.%2Flib%2Fspace%2Fspace.js%22%2C%2270076bd4-8bbe-4b67-93c4-2a8766fd9bf4%22%3A%22.%2Flib%2Fteaser%2Fteaser.js%22%7D ***!\n \\*****************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\neval(\"module.exports[\\\"669d7465-625a-4508-8167-ff81ff873795\\\"] = __webpack_require__(/*! ./lib/button/button.js */ \\\"./lib/button/button.js\\\")\\nmodule.exports[\\\"e4e5bbbd-df5f-4751-89f3-a8fdb1e8bb37\\\"] = __webpack_require__(/*! ./lib/checkbox/checkbox.js */ \\\"./lib/checkbox/checkbox.js\\\")\\nmodule.exports[\\\"1a4f0ad5-61d1-48e4-af6d-c34d3b92f066\\\"] = __webpack_require__(/*! ./lib/copy/copy.js */ \\\"./lib/copy/copy.js\\\")\\nmodule.exports[\\\"f212cacd-6f6f-49b4-8ca5-4d910d3d5e41\\\"] = __webpack_require__(/*! ./lib/dropdown/dropdown.js */ \\\"./lib/dropdown/dropdown.js\\\")\\nmodule.exports[\\\"b90a731c-486e-4b72-acde-c196b4ac6b3c\\\"] = __webpack_require__(/*! ./lib/dropdown-item/dropdown-item.js */ \\\"./lib/dropdown-item/dropdown-item.js\\\")\\nmodule.exports[\\\"f898c445-0e7c-4f93-9c3d-be79f21073f3\\\"] = __webpack_require__(/*! ./lib/feature/feature.js */ \\\"./lib/feature/feature.js\\\")\\nmodule.exports[\\\"c22fb434-3fd8-4bef-8ed7-f2390c5af337\\\"] = __webpack_require__(/*! ./lib/footer/footer.js */ \\\"./lib/footer/footer.js\\\")\\nmodule.exports[\\\"845a593a-2fa8-44bb-9aa0-39e70ee0743c\\\"] = __webpack_require__(/*! ./lib/headline/headline.js */ \\\"./lib/headline/headline.js\\\")\\nmodule.exports[\\\"f4b071e6-7f6b-46f9-89ef-9ddc6decf350\\\"] = __webpack_require__(/*! ./lib/icons/icons.js */ \\\"./lib/icons/icons.js\\\")\\nmodule.exports[\\\"8227bbc8-8c56-4dc4-a6f5-f681bc5fe07e\\\"] = __webpack_require__(/*! ./lib/icons/icons.js */ \\\"./lib/icons/icons.js\\\")\\nmodule.exports[\\\"0877a52b-a369-4bad-806f-104e727fe258\\\"] = __webpack_require__(/*! ./lib/image/image.js */ \\\"./lib/image/image.js\\\")\\nmodule.exports[\\\"a6f3b436-f2fa-4e59-b3a4-96a91463740a\\\"] = __webpack_require__(/*! ./lib/input/input.js */ \\\"./lib/input/input.js\\\")\\nmodule.exports[\\\"b5bf00ec-e094-4af7-80aa-85353fe02ae6\\\"] = __webpack_require__(/*! ./lib/layout/layout.js */ \\\"./lib/layout/layout.js\\\")\\nmodule.exports[\\\"4f23949b-6784-4114-8a91-3b5a4ee24857\\\"] = __webpack_require__(/*! ./lib/link/link.js */ \\\"./lib/link/link.js\\\")\\nmodule.exports[\\\"fd0de579-30a1-4338-ac2d-48fbb2f045bd\\\"] = __webpack_require__(/*! ./lib/menu/menu.js */ \\\"./lib/menu/menu.js\\\")\\nmodule.exports[\\\"52518600-840c-44d4-b22d-0580e2a40322\\\"] = __webpack_require__(/*! ./lib/menu-item/menu-item.js */ \\\"./lib/menu-item/menu-item.js\\\")\\nmodule.exports[\\\"172cf2ff-92f4-4a70-8bcb-79adfd800165\\\"] = __webpack_require__(/*! ./lib/radio/radio.js */ \\\"./lib/radio/radio.js\\\")\\nmodule.exports[\\\"4db1cdfc-c445-4b3b-a870-0a8b29c6e41a\\\"] = __webpack_require__(/*! ./lib/section/section.js */ \\\"./lib/section/section.js\\\")\\nmodule.exports[\\\"f3162a93-b80d-4464-8ed4-c90e13887535\\\"] = __webpack_require__(/*! ./lib/space/space.js */ \\\"./lib/space/space.js\\\")\\nmodule.exports[\\\"70076bd4-8bbe-4b67-93c4-2a8766fd9bf4\\\"] = __webpack_require__(/*! ./lib/teaser/teaser.js */ \\\"./lib/teaser/teaser.js\\\")\\n\\n//# sourceURL=webpack://%5Bname%5D/../alva/packages/core/build/preview/preview-loader.js?\");\n\n/***/ }),\n\n/***/ \"./lib/button/button.js\":\n/*!******************************!*\\\n !*** ./lib/button/button.js ***!\n \\******************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar tslib_1 = __webpack_require__(/*! tslib */ \\\"./node_modules/tslib/tslib.es6.js\\\");\\nvar React = __webpack_require__(/*! react */ \\\"./node_modules/react/index.js\\\");\\nvar styled_1 = __webpack_require__(/*! @emotion/styled */ \\\"./node_modules/@emotion/styled/dist/styled.browser.esm.js\\\");\\nvar colors_1 = __webpack_require__(/*! ../colors */ \\\"./lib/colors/index.js\\\");\\nvar fonts_1 = __webpack_require__(/*! ../fonts */ \\\"./lib/fonts/index.js\\\");\\nvar ButtonOrder;\\n(function (ButtonOrder) {\\n ButtonOrder[\\\"Primary\\\"] = \\\"button-primary\\\";\\n ButtonOrder[\\\"Secondary\\\"] = \\\"button-secondary\\\";\\n})(ButtonOrder = exports.ButtonOrder || (exports.ButtonOrder = {}));\\nvar StyledButton = styled_1.default.div(templateObject_1 || (templateObject_1 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tpadding: 12px 20px;\\\\n\\\\tmin-width: 200px;\\\\n\\\\tfont-size: 18px;\\\\n\\\\tfont-family: \\\", \\\";\\\\n\\\\tborder-radius: 3px;\\\\n\\\\tbox-sizing: border-box;\\\\n\\\\tdisplay: inline-block;\\\\n\\\\twidth: fit-content;\\\\n\\\\tcursor: \\\", \\\";\\\\n\\\\n\\\\t@media screen and (min-width: 960px) {\\\\n\\\\t\\\\tpadding: 15px 30px;\\\\n\\\\t}\\\\n\\\"], [\\\"\\\\n\\\\tpadding: 12px 20px;\\\\n\\\\tmin-width: 200px;\\\\n\\\\tfont-size: 18px;\\\\n\\\\tfont-family: \\\", \\\";\\\\n\\\\tborder-radius: 3px;\\\\n\\\\tbox-sizing: border-box;\\\\n\\\\tdisplay: inline-block;\\\\n\\\\twidth: fit-content;\\\\n\\\\tcursor: \\\", \\\";\\\\n\\\\n\\\\t@media screen and (min-width: 960px) {\\\\n\\\\t\\\\tpadding: 15px 30px;\\\\n\\\\t}\\\\n\\\"])), fonts_1.fonts().NORMAL_FONT, function (props) { return (!props.disabled ? \\\"pointer\\\" : \\\"default\\\"); });\\nvar ButtonPrimary = styled_1.default.div(templateObject_2 || (templateObject_2 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tbackground: \\\", \\\";\\\\n\\\\tborder: none;\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\\tbackground-color: \\\", \\\";\\\\n\\\\t&:hover {\\\\n\\\\t\\\\tbackground-color: \\\", \\\";\\\\n\\\\t}\\\\n\\\"], [\\\"\\\\n\\\\tbackground: \\\", \\\";\\\\n\\\\tborder: none;\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\\tbackground-color: \\\", \\\";\\\\n\\\\t&:hover {\\\\n\\\\t\\\\tbackground-color: \\\", \\\";\\\\n\\\\t}\\\\n\\\"])), function (props) { return props.color || colors_1.Color.Pink; }, colors_1.Color.White, function (props) { return (props.disabled ? colors_1.Color.Grey70 : \\\"\\\"); }, function (props) { return (props.disabled ? colors_1.Color.Grey70 : colors_1.Color.PinkLight); });\\nvar ButtonSecondary = styled_1.default.div(templateObject_3 || (templateObject_3 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tborder: 1px solid \\\", \\\";\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\\tborder-color: \\\", \\\";\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\\t&:hover {\\\\n\\\\t\\\\tborder-color: \\\", \\\";\\\\n\\\\t\\\\tcolor: \\\", \\\";\\\\n\\\\t}\\\\n\\\"], [\\\"\\\\n\\\\tborder: 1px solid \\\", \\\";\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\\tborder-color: \\\", \\\";\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\\t&:hover {\\\\n\\\\t\\\\tborder-color: \\\", \\\";\\\\n\\\\t\\\\tcolor: \\\", \\\";\\\\n\\\\t}\\\\n\\\"])), function (props) { return props.color || colors_1.Color.Pink; }, function (props) { return props.color || colors_1.Color.Pink; }, function (props) { return (props.disabled ? colors_1.Color.Grey70 : \\\"\\\"); }, function (props) { return (props.disabled ? colors_1.Color.Grey70 : \\\"\\\"); }, function (props) { return props.disabled ? colors_1.Color.Grey70 : colors_1.Color.PinkLight; }, function (props) { return props.disabled ? colors_1.Color.Grey70 : colors_1.Color.PinkLight; });\\nexports.Button = function (props) {\\n var button = props.order === ButtonOrder.Primary ? ButtonPrimary : ButtonSecondary;\\n var Component = StyledButton.withComponent(button);\\n return React.createElement(Component, tslib_1.__assign({}, props), props.children);\\n};\\nvar templateObject_1, templateObject_2, templateObject_3;\\n//# sourceMappingURL=button.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/button/button.js?\");\n\n/***/ }),\n\n/***/ \"./lib/checkbox/checkbox.js\":\n/*!**********************************!*\\\n !*** ./lib/checkbox/checkbox.js ***!\n \\**********************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar tslib_1 = __webpack_require__(/*! tslib */ \\\"./node_modules/tslib/tslib.es6.js\\\");\\nvar React = __webpack_require__(/*! react */ \\\"./node_modules/react/index.js\\\");\\nvar styled_1 = __webpack_require__(/*! @emotion/styled */ \\\"./node_modules/@emotion/styled/dist/styled.browser.esm.js\\\");\\nvar colors_1 = __webpack_require__(/*! ../colors */ \\\"./lib/colors/index.js\\\");\\nvar copy_1 = __webpack_require__(/*! ../copy */ \\\"./lib/copy/index.js\\\");\\nvar StyledLabel = styled_1.default.label(templateObject_1 || (templateObject_1 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tdisplay: flex;\\\\n\\\\talign-items: center;\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\\n\\\\t\\\", \\\";\\\\n\\\"], [\\\"\\\\n\\\\tdisplay: flex;\\\\n\\\\talign-items: center;\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\\n\\\\t\\\", \\\";\\\\n\\\"])), colors_1.Color.Black, function (props) { return (props.disabled ? \\\"color: \\\" + colors_1.Color.Grey90 + \\\";\\\" : ''); });\\nvar StyledCheckboxInput = styled_1.default.input(templateObject_2 || (templateObject_2 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tposition: absolute;\\\\n\\\\tleft: -100vw;\\\\n\\\"], [\\\"\\\\n\\\\tposition: absolute;\\\\n\\\\tleft: -100vw;\\\\n\\\"])));\\nvar StyledCheckbox = styled_1.default.div(templateObject_3 || (templateObject_3 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tdisplay: inline-flex;\\\\n\\\\talign-items: center;\\\\n\\\\tjustify-content: center;\\\\n\\\\twidth: 34px;\\\\n\\\\theight: 34px;\\\\n\\\\tborder: 1px solid \\\", \\\";\\\\n\\\\tborder-radius: 3px;\\\\n\\\\n\\\\t\\\", \\\";\\\\n\\\"], [\\\"\\\\n\\\\tdisplay: inline-flex;\\\\n\\\\talign-items: center;\\\\n\\\\tjustify-content: center;\\\\n\\\\twidth: 34px;\\\\n\\\\theight: 34px;\\\\n\\\\tborder: 1px solid \\\", \\\";\\\\n\\\\tborder-radius: 3px;\\\\n\\\\n\\\\t\\\",\\n \\\";\\\\n\\\"])), colors_1.Color.Grey70, function (props) {\\n return props.disabled ? \\\"border-color: \\\" + colors_1.Color.Grey90 + \\\";\\\" : '';\\n});\\nvar SyledCheckmark = styled_1.default.svg(templateObject_4 || (templateObject_4 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\t\\\", \\\";\\\\n\\\\t\\\", \\\";\\\\n\\\"], [\\\"\\\\n\\\\t\\\", \\\";\\\\n\\\\t\\\",\\n \\\";\\\\n\\\"])), function (props) { return (props.checked ? 'display: block;' : 'display: none;'); }, function (props) {\\n return props.disabled ? \\\"fill: \\\" + colors_1.Color.Grey90 + \\\";\\\" : \\\"fill: \\\" + colors_1.Color.Green + \\\";\\\";\\n});\\nvar StyledLabelText = styled_1.default(copy_1.Copy)(templateObject_5 || (templateObject_5 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tpadding-left: 12px;\\\\n\\\"], [\\\"\\\\n\\\\tpadding-left: 12px;\\\\n\\\"])));\\nexports.Checkbox = function (props) {\\n var disabled = props.disabled, name = props.name, value = props.value, handleChange = props.handleChange, checked = props.checked, labelText = props.labelText;\\n return (React.createElement(StyledLabel, { disabled: disabled },\\n React.createElement(StyledCheckboxInput, { type: \\\"checkbox\\\", name: name, value: value, onChange: handleChange }),\\n React.createElement(StyledCheckbox, { disabled: disabled },\\n React.createElement(SyledCheckmark, { checked: checked, disabled: disabled, xmlns: \\\"http://www.w3.org/2000/svg\\\", width: \\\"34\\\", height: \\\"34\\\" },\\n React.createElement(\\\"path\\\", { d: \\\"M13.899495 23.33452l-6.717514-6.71751c-.585787-.58579-1.535534-.58579-2.121321 0-.585786.58579-.585786 1.53553 0 2.12132l7.778175 7.77817c.292893.2929.676776.43934 1.06066.43934.383883 0 .767767-.14644 1.06066-.43934l15.556349-15.55634c.585787-.58579.585787-1.53554 0-2.12133-.585786-.58578-1.535534-.58578-2.12132 0L13.899495 23.33452z\\\" }))),\\n labelText && React.createElement(StyledLabelText, null, labelText)));\\n};\\nvar templateObject_1, templateObject_2, templateObject_3, templateObject_4, templateObject_5;\\n//# sourceMappingURL=checkbox.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/checkbox/checkbox.js?\");\n\n/***/ }),\n\n/***/ \"./lib/colors/colors.js\":\n/*!******************************!*\\\n !*** ./lib/colors/colors.js ***!\n \\******************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar Color;\\n(function (Color) {\\n Color[\\\"Blue\\\"] = \\\"rgb(0, 112, 214)\\\";\\n Color[\\\"BlueLight\\\"] = \\\"rgb(0, 112, 214)\\\";\\n Color[\\\"GreenDark\\\"] = \\\"rgb(30, 205, 151)\\\";\\n Color[\\\"Green\\\"] = \\\"rgb(87, 218, 178)\\\";\\n Color[\\\"GreenLight\\\"] = \\\"rgb(123, 226, 195)\\\";\\n Color[\\\"Red\\\"] = \\\"rgb(215, 0, 82)\\\";\\n Color[\\\"Black\\\"] = \\\"rgb(0, 0, 0)\\\";\\n Color[\\\"Grey50\\\"] = \\\"rgb(127, 127, 127)\\\";\\n Color[\\\"Grey70\\\"] = \\\"rgb(179, 179, 179)\\\";\\n Color[\\\"Grey90\\\"] = \\\"rgb(227, 227, 227)\\\";\\n Color[\\\"Grey95\\\"] = \\\"rgb(242, 242, 242)\\\";\\n Color[\\\"White\\\"] = \\\"rgb(255, 255, 255)\\\";\\n Color[\\\"Pink\\\"] = \\\"rgb(236, 3, 97)\\\";\\n Color[\\\"PinkLight\\\"] = \\\"rgb(236, 52, 126)\\\";\\n Color[\\\"VioletDark\\\"] = \\\"rgb(81, 0, 77)\\\";\\n Color[\\\"Violet\\\"] = \\\"rgb(88, 2, 205)\\\";\\n})(Color = exports.Color || (exports.Color = {}));\\n//# sourceMappingURL=colors.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/colors/colors.js?\");\n\n/***/ }),\n\n/***/ \"./lib/colors/index.js\":\n/*!*****************************!*\\\n !*** ./lib/colors/index.js ***!\n \\*****************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar tslib_1 = __webpack_require__(/*! tslib */ \\\"./node_modules/tslib/tslib.es6.js\\\");\\ntslib_1.__exportStar(__webpack_require__(/*! ./colors */ \\\"./lib/colors/colors.js\\\"), exports);\\n//# sourceMappingURL=index.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/colors/index.js?\");\n\n/***/ }),\n\n/***/ \"./lib/copy/copy.js\":\n/*!**************************!*\\\n !*** ./lib/copy/copy.js ***!\n \\**************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar tslib_1 = __webpack_require__(/*! tslib */ \\\"./node_modules/tslib/tslib.es6.js\\\");\\nvar styled_1 = __webpack_require__(/*! @emotion/styled */ \\\"./node_modules/@emotion/styled/dist/styled.browser.esm.js\\\");\\nvar fonts_1 = __webpack_require__(/*! ../fonts */ \\\"./lib/fonts/index.js\\\");\\nvar types_1 = __webpack_require__(/*! ../types */ \\\"./lib/types.js\\\");\\nvar CopySize;\\n(function (CopySize) {\\n CopySize[\\\"Small\\\"] = \\\"copy-small\\\";\\n CopySize[\\\"Medium\\\"] = \\\"copy-medium\\\";\\n CopySize[\\\"Large\\\"] = \\\"copy-large\\\";\\n})(CopySize = exports.CopySize || (exports.CopySize = {}));\\nexports.Copy = styled_1.default.div(templateObject_1 || (templateObject_1 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tmargin: 0;\\\\n\\\\tfont-family: \\\", \\\";\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\\tline-height: 1.5;\\\\n\\\\n\\\\t\\\", \\\";\\\\n\\\\n\\\\t\\\", \\\";\\\\n\\\\n\\\\t\\\", \\\";\\\\n\\\"], [\\\"\\\\n\\\\tmargin: 0;\\\\n\\\\tfont-family: \\\", \\\";\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\\tline-height: 1.5;\\\\n\\\\n\\\\t\\\",\\n \\\";\\\\n\\\\n\\\\t\\\",\\n \\\";\\\\n\\\\n\\\\t\\\",\\n \\\";\\\\n\\\"])), fonts_1.fonts().NORMAL_FONT, function (props) { return props.color || 'inherit'; }, function (props) {\\n switch (props.size) {\\n case CopySize.Small:\\n return 'font-size: 12px;';\\n case CopySize.Medium:\\n default:\\n return 'font-size: 16px';\\n case CopySize.Large:\\n return \\\"\\\\n\\\\t\\\\t\\\\t\\\\t\\\\tfont-size: 18px;\\\\n\\\\n\\\\t\\\\t\\\\t\\\\t\\\\t@media screen and (min-width: 960px) {\\\\n\\\\t\\\\t\\\\t\\\\t\\\\t\\\\tfont-size: 24px;\\\\n\\\\t\\\\t\\\\t\\\\t\\\\t}\\\\n\\\\t\\\\t\\\\t\\\\t\\\";\\n }\\n}, function (props) {\\n switch (props.textAlign) {\\n case types_1.TextAlign.Center:\\n return \\\"text-align: center;\\\";\\n case types_1.TextAlign.Right:\\n return \\\"text-align: right;\\\";\\n case types_1.TextAlign.Left:\\n return \\\"text-align: left;\\\";\\n default:\\n return \\\"text-align: inherit\\\";\\n }\\n}, function (props) {\\n return props.uppercase\\n ? \\\"letter-spacing: 1px;\\\\n\\\\t\\\\t\\\\t\\\\ttext-transform: uppercase;\\\"\\n : '';\\n});\\nvar templateObject_1;\\n//# sourceMappingURL=copy.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/copy/copy.js?\");\n\n/***/ }),\n\n/***/ \"./lib/copy/index.js\":\n/*!***************************!*\\\n !*** ./lib/copy/index.js ***!\n \\***************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar tslib_1 = __webpack_require__(/*! tslib */ \\\"./node_modules/tslib/tslib.es6.js\\\");\\ntslib_1.__exportStar(__webpack_require__(/*! ./copy */ \\\"./lib/copy/copy.js\\\"), exports);\\n//# sourceMappingURL=index.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/copy/index.js?\");\n\n/***/ }),\n\n/***/ \"./lib/dropdown-item/dropdown-item.js\":\n/*!********************************************!*\\\n !*** ./lib/dropdown-item/dropdown-item.js ***!\n \\********************************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar tslib_1 = __webpack_require__(/*! tslib */ \\\"./node_modules/tslib/tslib.es6.js\\\");\\nvar React = __webpack_require__(/*! react */ \\\"./node_modules/react/index.js\\\");\\nvar styled_1 = __webpack_require__(/*! @emotion/styled */ \\\"./node_modules/@emotion/styled/dist/styled.browser.esm.js\\\");\\nvar colors_1 = __webpack_require__(/*! ../colors */ \\\"./lib/colors/index.js\\\");\\nvar fonts_1 = __webpack_require__(/*! ../fonts */ \\\"./lib/fonts/index.js\\\");\\nvar StyledDropdownItem = styled_1.default.div(templateObject_1 || (templateObject_1 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tdisplay: flex;\\\\n\\\\tpadding: 17px 22px;\\\\n\\\\tborder-top: 1px solid \\\", \\\";\\\\n\\\\tfont-family: \\\", \\\";\\\\n\\\\n\\\\t&:hover {\\\\n\\\\t\\\\tcolor: \\\", \\\";\\\\n\\\\t}\\\\n\\\"], [\\\"\\\\n\\\\tdisplay: flex;\\\\n\\\\tpadding: 17px 22px;\\\\n\\\\tborder-top: 1px solid \\\", \\\";\\\\n\\\\tfont-family: \\\", \\\";\\\\n\\\\n\\\\t&:hover {\\\\n\\\\t\\\\tcolor: \\\", \\\";\\\\n\\\\t}\\\\n\\\"])), colors_1.Color.Grey70.toString(), fonts_1.fonts().NORMAL_FONT, colors_1.Color.Black.toString());\\nexports.DropdownItem = function (props) {\\n return React.createElement(StyledDropdownItem, null, props.content);\\n};\\nvar templateObject_1;\\n//# sourceMappingURL=dropdown-item.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/dropdown-item/dropdown-item.js?\");\n\n/***/ }),\n\n/***/ \"./lib/dropdown/dropdown.js\":\n/*!**********************************!*\\\n !*** ./lib/dropdown/dropdown.js ***!\n \\**********************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar tslib_1 = __webpack_require__(/*! tslib */ \\\"./node_modules/tslib/tslib.es6.js\\\");\\nvar React = __webpack_require__(/*! react */ \\\"./node_modules/react/index.js\\\");\\nvar styled_1 = __webpack_require__(/*! @emotion/styled */ \\\"./node_modules/@emotion/styled/dist/styled.browser.esm.js\\\");\\n;\\nvar colors_1 = __webpack_require__(/*! ../colors */ \\\"./lib/colors/index.js\\\");\\nvar fonts_1 = __webpack_require__(/*! ../fonts */ \\\"./lib/fonts/index.js\\\");\\nvar icons_1 = __webpack_require__(/*! ../icons */ \\\"./lib/icons/index.js\\\");\\nvar StyledDropdown = styled_1.default.div(templateObject_1 || (templateObject_1 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tbox-sizing: border-box;\\\\n\\\\twidth: 100%;\\\\n\\\\tmax-width: 400px;\\\\n\\\\tborder: 1px solid \\\", \\\";\\\\n\\\\tborder-radius: 3px;\\\\n\\\\tcursor: pointer;\\\\n\\\\tbackground: \\\", \\\";\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\\tfont-family: \\\", \\\";\\\\n\\\\tfont-size: 16px;\\\\n\\\\tbox-shadow: 0px 2px 3px 0px rgba(0, 0, 0, 0.25);\\\\n\\\"], [\\\"\\\\n\\\\tbox-sizing: border-box;\\\\n\\\\twidth: 100%;\\\\n\\\\tmax-width: 400px;\\\\n\\\\tborder: 1px solid \\\", \\\";\\\\n\\\\tborder-radius: 3px;\\\\n\\\\tcursor: pointer;\\\\n\\\\tbackground: \\\", \\\";\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\\tfont-family: \\\", \\\";\\\\n\\\\tfont-size: 16px;\\\\n\\\\tbox-shadow: 0px 2px 3px 0px rgba(0, 0, 0, 0.25);\\\\n\\\"])), colors_1.Color.Grey70, colors_1.Color.White, colors_1.Color.Grey70, fonts_1.fonts().NORMAL_FONT);\\nvar StyledText = styled_1.default.div(templateObject_2 || (templateObject_2 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tdisplay: flex;\\\\n\\\\tjustify-content: space-between;\\\\n\\\\talign-items: center;\\\\n\\\\tpadding: 13px 22px;\\\\n\\\"], [\\\"\\\\n\\\\tdisplay: flex;\\\\n\\\\tjustify-content: space-between;\\\\n\\\\talign-items: center;\\\\n\\\\tpadding: 13px 22px;\\\\n\\\"])));\\nvar StyledIcon = styled_1.default(icons_1.Icon)(templateObject_3 || (templateObject_3 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tfill: \\\", \\\";\\\\n\\\\t\\\", \\\";\\\\n\\\"], [\\\"\\\\n\\\\tfill: \\\", \\\";\\\\n\\\\t\\\",\\n \\\";\\\\n\\\"])), colors_1.Color.GreenDark, function (props) {\\n return props.open ? \\\"transform: rotate(180deg);\\\" : \\\"transform: rotate(0deg);\\\";\\n});\\nvar StyledFlyout = styled_1.default.div(templateObject_4 || (templateObject_4 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\t\\\", \\\" flex-basis: 100%;\\\\n\\\\tflex-direction: column;\\\\n\\\"], [\\\"\\\\n\\\\t\\\",\\n \\\" flex-basis: 100%;\\\\n\\\\tflex-direction: column;\\\\n\\\"])), function (props) {\\n return props.open ? \\\"display: flex;\\\" : \\\"display: none;\\\";\\n});\\nexports.Dropdown = function (props) {\\n return (React.createElement(StyledDropdown, { onClick: props.onToggle },\\n React.createElement(StyledText, null,\\n props.text,\\n React.createElement(StyledIcon, { name: icons_1.IconName.ArrowDown, size: icons_1.IconSize.XS, open: props.open })),\\n React.createElement(StyledFlyout, { open: props.open }, props.children)));\\n};\\nvar templateObject_1, templateObject_2, templateObject_3, templateObject_4;\\n//# sourceMappingURL=dropdown.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/dropdown/dropdown.js?\");\n\n/***/ }),\n\n/***/ \"./lib/feature/app-frame.js\":\n/*!**********************************!*\\\n !*** ./lib/feature/app-frame.js ***!\n \\**********************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar tslib_1 = __webpack_require__(/*! tslib */ \\\"./node_modules/tslib/tslib.es6.js\\\");\\nvar styled_1 = __webpack_require__(/*! @emotion/styled */ \\\"./node_modules/@emotion/styled/dist/styled.browser.esm.js\\\");\\n;\\nexports.AppFrame = styled_1.default.div(templateObject_1 || (templateObject_1 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tbox-shadow: rgba(0, 0, 0, 0.2) 0 0 100px;\\\\n\\\\tposition: relative;\\\\n\\\\tz-index: 10;\\\\n\\\\tborder-radius: 6px;\\\\n\\\\tmargin: 0 auto;\\\\n\\\\ttext-align: center;\\\\n\\\\toverflow: hidden;\\\\n\\\"], [\\\"\\\\n\\\\tbox-shadow: rgba(0, 0, 0, 0.2) 0 0 100px;\\\\n\\\\tposition: relative;\\\\n\\\\tz-index: 10;\\\\n\\\\tborder-radius: 6px;\\\\n\\\\tmargin: 0 auto;\\\\n\\\\ttext-align: center;\\\\n\\\\toverflow: hidden;\\\\n\\\"])));\\nvar templateObject_1;\\n//# sourceMappingURL=app-frame.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/feature/app-frame.js?\");\n\n/***/ }),\n\n/***/ \"./lib/feature/feature.js\":\n/*!********************************!*\\\n !*** ./lib/feature/feature.js ***!\n \\********************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar tslib_1 = __webpack_require__(/*! tslib */ \\\"./node_modules/tslib/tslib.es6.js\\\");\\nvar React = __webpack_require__(/*! react */ \\\"./node_modules/react/index.js\\\");\\nvar styled_1 = __webpack_require__(/*! @emotion/styled */ \\\"./node_modules/@emotion/styled/dist/styled.browser.esm.js\\\");\\n;\\nvar colors_1 = __webpack_require__(/*! ../colors */ \\\"./lib/colors/index.js\\\");\\nvar copy_1 = __webpack_require__(/*! ../copy */ \\\"./lib/copy/index.js\\\");\\nvar headline_1 = __webpack_require__(/*! ../headline */ \\\"./lib/headline/index.js\\\");\\nvar space_1 = __webpack_require__(/*! ../space */ \\\"./lib/space/index.js\\\");\\nvar app_frame_1 = __webpack_require__(/*! ./app-frame */ \\\"./lib/feature/app-frame.js\\\");\\nvar FeatureLevel;\\n(function (FeatureLevel) {\\n FeatureLevel[\\\"Large\\\"] = \\\"feature-large\\\";\\n FeatureLevel[\\\"Medium\\\"] = \\\"feature-medium\\\";\\n})(FeatureLevel = exports.FeatureLevel || (exports.FeatureLevel = {}));\\nvar FeatureLayout;\\n(function (FeatureLayout) {\\n FeatureLayout[\\\"Left\\\"] = \\\"feature-left\\\";\\n FeatureLayout[\\\"Center\\\"] = \\\"feature-center\\\";\\n FeatureLayout[\\\"Right\\\"] = \\\"feature-right\\\";\\n})(FeatureLayout = exports.FeatureLayout || (exports.FeatureLayout = {}));\\nvar Wrapper = styled_1.default.div(templateObject_1 || (templateObject_1 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\twidth: 90%;\\\\n\\\\tmax-width: 1280px;\\\\n\\\\t\\\", \\\";\\\\n\\\\tmargin: 0 auto;\\\\n\\\\t\\\", \\\"\\\\n\\\\tposition: relative;\\\\n\\\"], [\\\"\\\\n\\\\twidth: 90%;\\\\n\\\\tmax-width: 1280px;\\\\n\\\\t\\\",\\n \\\";\\\\n\\\\tmargin: 0 auto;\\\\n\\\\t\\\", \\\"\\\\n\\\\tposition: relative;\\\\n\\\"])), function (props) { return (props.layout === FeatureLayout.Center) ? \\\"\\\\n\\\\t\\\\tdisplay: block;\\\\n\\\\t\\\" : \\\"\\\\n\\\\t\\\\tdisplay: block;\\\\n\\\\t\\\\t@media screen and (min-width: 960px) {\\\\n\\\\t\\\\t\\\\tdisplay: flex;\\\\n\\\\t\\\\t}\\\\n\\\\t\\\"; }, function (props) { return props.negativeTop && 'margin-top: -100px;' || ''; });\\nvar StyledAppFrame = styled_1.default(app_frame_1.AppFrame)(templateObject_2 || (templateObject_2 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\n\\\\t\\\", \\\";\\\\n\\\\n\\\\timg {\\\\n\\\\t\\\\twidth: 100%;\\\\n\\\\t}\\\\n\\\"], [\\\"\\\\n\\\\n\\\\t\\\",\\n \\\";\\\\n\\\\n\\\\timg {\\\\n\\\\t\\\\twidth: 100%;\\\\n\\\\t}\\\\n\\\"])), function (props) {\\n switch (props.layout) {\\n case FeatureLayout.Left: return \\\"\\\\n\\\\t\\\\t\\\\t\\\\t@media screen and (min-width: 960px) {\\\\n\\\\t\\\\t\\\\t\\\\t\\\\ttransform: translate(50%,0);\\\\n\\\\t\\\\t\\\\t\\\\t}\\\\n\\\\t\\\\t\\\\t\\\";\\n case FeatureLayout.Right: return \\\"\\\\n\\\\t\\\\t\\\\t\\\\t@media screen and (min-width: 960px) {\\\\n\\\\t\\\\t\\\\t\\\\t\\\\ttransform: translate(-50%,0);\\\\n\\\\t\\\\t\\\\t\\\\t}\\\\n\\\\t\\\\t\\\\t\\\";\\n default:\\n case FeatureLayout.Center: return '';\\n }\\n});\\nvar StyledBox = styled_1.default.div(templateObject_3 || (templateObject_3 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\twidth: 80%;\\\\n\\\\n\\\\t@media screen and (min-width: 960px) {\\\\n\\\\t\\\\twidth: 40%;\\\\n\\\\t}\\\\n\\\\n\\\\tpadding-top: 60px;\\\\n\\\\ttext-align: center;\\\\n\\\\n\\\\t\\\", \\\";\\\\n\\\\n\\\\t\\\", \\\";\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\\tmax-width: 480px;\\\\n\\\\tmargin: 0 auto;\\\\n\\\\n\\\"], [\\\"\\\\n\\\\twidth: 80%;\\\\n\\\\n\\\\t@media screen and (min-width: 960px) {\\\\n\\\\t\\\\twidth: 40%;\\\\n\\\\t}\\\\n\\\\n\\\\tpadding-top: 60px;\\\\n\\\\ttext-align: center;\\\\n\\\\n\\\\t\\\",\\n \\\";\\\\n\\\\n\\\\t\\\",\\n \\\";\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\\tmax-width: 480px;\\\\n\\\\tmargin: 0 auto;\\\\n\\\\n\\\"])), function (props) {\\n return props.layout === FeatureLayout.Center\\n ? \\\"\\\\n\\\\n\\\\n\\\\t\\\\t\\\" : \\\"\\\\n\\\\t\\\\t\\\\t@media screen and (min-width: 960px) {\\\\n\\\\t\\\\t\\\\t\\\\tposition: absolute;\\\\n\\\\t\\\\t\\\\t\\\\ttop: 50%;\\\\n\\\\t\\\\t\\\\t\\\\ttransform: translate(0,-50%);\\\\n\\\\t\\\\t\\\\t\\\\ttext-align: left;\\\\n\\\\t\\\\t\\\\t\\\\tpadding-top: 0;\\\\n\\\\t\\\\t\\\\t}\\\\n\\\\t\\\\t\\\";\\n}, function (props) { return (props.layout === FeatureLayout.Right) ? \\\"\\\\n\\\\t\\\\t@media screen and (min-width: 960px) {\\\\n\\\\t\\\\t\\\\tleft: 60%;\\\\n\\\\t\\\\t}\\\\n\\\\t\\\" : ''; }, colors_1.Color.Black);\\nvar StyledCopy = styled_1.default(copy_1.Copy)(templateObject_4 || (templateObject_4 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\"], [\\\"\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\"])), colors_1.Color.Grey50);\\nexports.Feature = function (props) {\\n return (React.createElement(\\\"div\\\", null,\\n React.createElement(Wrapper, tslib_1.__assign({}, props),\\n React.createElement(StyledAppFrame, tslib_1.__assign({}, props), props.frame),\\n React.createElement(StyledBox, tslib_1.__assign({}, props),\\n React.createElement(headline_1.Headline, { level: headline_1.HeadlineLevel.H3 }, props.headline),\\n React.createElement(space_1.Space, { size: space_1.SpaceSize.S }),\\n React.createElement(StyledCopy, { size: copy_1.CopySize.Medium },\\n props.copy,\\n React.createElement(space_1.Space, { size: space_1.SpaceSize.S }),\\n props.link)))));\\n};\\nvar templateObject_1, templateObject_2, templateObject_3, templateObject_4;\\n//# sourceMappingURL=feature.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/feature/feature.js?\");\n\n/***/ }),\n\n/***/ \"./lib/fonts/fonts.js\":\n/*!****************************!*\\\n !*** ./lib/fonts/fonts.js ***!\n \\****************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar NORMAL_FONT = '\\\"Graphik Web\\\", -apple-system, BlinkMacSystemFont, \\\"Segoe UI\\\", Roboto, Helvetica, Arial, sans-serif, \\\"Apple Color Emoji\\\", \\\"Segoe UI Emoji\\\", \\\"Segoe UI Symbol\\\";';\\nfunction noop() {\\n return null;\\n}\\nexports.default = noop;\\nfunction fonts() {\\n return {\\n NORMAL_FONT: NORMAL_FONT,\\n };\\n}\\nexports.fonts = fonts;\\n//# sourceMappingURL=fonts.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/fonts/fonts.js?\");\n\n/***/ }),\n\n/***/ \"./lib/fonts/index.js\":\n/*!****************************!*\\\n !*** ./lib/fonts/index.js ***!\n \\****************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar tslib_1 = __webpack_require__(/*! tslib */ \\\"./node_modules/tslib/tslib.es6.js\\\");\\ntslib_1.__exportStar(__webpack_require__(/*! ./fonts */ \\\"./lib/fonts/fonts.js\\\"), exports);\\n//# sourceMappingURL=index.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/fonts/index.js?\");\n\n/***/ }),\n\n/***/ \"./lib/footer/footer.js\":\n/*!******************************!*\\\n !*** ./lib/footer/footer.js ***!\n \\******************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar tslib_1 = __webpack_require__(/*! tslib */ \\\"./node_modules/tslib/tslib.es6.js\\\");\\nvar React = __webpack_require__(/*! react */ \\\"./node_modules/react/index.js\\\");\\nvar styled_1 = __webpack_require__(/*! @emotion/styled */ \\\"./node_modules/@emotion/styled/dist/styled.browser.esm.js\\\");\\nvar copy_1 = __webpack_require__(/*! ../copy */ \\\"./lib/copy/index.js\\\");\\nvar colors_1 = __webpack_require__(/*! ../colors */ \\\"./lib/colors/index.js\\\");\\nvar layout_1 = __webpack_require__(/*! ../layout */ \\\"./lib/layout/index.js\\\");\\nvar StyledFooter = styled_1.default.div(templateObject_1 || (templateObject_1 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tpadding: 20px 0;\\\\n\\\\tbox-sizing: border-box;\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\\tdisplay: flex;\\\\n\\\\tflex-wrap: wrap;\\\\n\\\"], [\\\"\\\\n\\\\tpadding: 20px 0;\\\\n\\\\tbox-sizing: border-box;\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\\tdisplay: flex;\\\\n\\\\tflex-wrap: wrap;\\\\n\\\"])), colors_1.Color.White);\\nexports.Footer = function (props) {\\n return (React.createElement(layout_1.Layout, { backgroundColor: colors_1.Color.Black },\\n React.createElement(layout_1.Layout, { width: \\\"80%\\\", maxWidth: \\\"960px\\\", center: true },\\n React.createElement(StyledFooter, tslib_1.__assign({}, props),\\n React.createElement(copy_1.Copy, { color: colors_1.Color.Grey50 }, props.copyright),\\n props.children))));\\n};\\nvar templateObject_1;\\n//# sourceMappingURL=footer.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/footer/footer.js?\");\n\n/***/ }),\n\n/***/ \"./lib/headline/headline.js\":\n/*!**********************************!*\\\n !*** ./lib/headline/headline.js ***!\n \\**********************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar tslib_1 = __webpack_require__(/*! tslib */ \\\"./node_modules/tslib/tslib.es6.js\\\");\\nvar React = __webpack_require__(/*! react */ \\\"./node_modules/react/index.js\\\");\\nvar styled_1 = __webpack_require__(/*! @emotion/styled */ \\\"./node_modules/@emotion/styled/dist/styled.browser.esm.js\\\");\\nvar fonts_1 = __webpack_require__(/*! ../fonts */ \\\"./lib/fonts/index.js\\\");\\nvar Types = __webpack_require__(/*! ../types */ \\\"./lib/types.js\\\");\\nvar colors_1 = __webpack_require__(/*! ../colors */ \\\"./lib/colors/index.js\\\");\\nvar HeadlineLevel;\\n(function (HeadlineLevel) {\\n HeadlineLevel[\\\"H1\\\"] = \\\"h1\\\";\\n HeadlineLevel[\\\"H2\\\"] = \\\"h2\\\";\\n HeadlineLevel[\\\"H3\\\"] = \\\"h3\\\";\\n})(HeadlineLevel = exports.HeadlineLevel || (exports.HeadlineLevel = {}));\\nvar StyledHeadline = styled_1.default.div(templateObject_1 || (templateObject_1 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tmargin: 0;\\\\n\\\\tfont-family: \\\", \\\";\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\\tline-height: 1.3;\\\\n\\\\n\\\\tu {\\\\n\\\\t\\\\ttext-decoration-color: \\\", \\\";\\\\n\\\\t}\\\\n\\\\n\\\\tb {\\\\n\\\\t\\\\tfont-weight: 500;\\\\n\\\\t}\\\\n\\\\n\\\\tfont-weight: \\\", \\\";\\\\n\\\\n\\\\t\\\", \\\";\\\\n\\\\n\\\\ttext-align: \\\", \\\";\\\\n\\\\n\\\\t\\\", \\\";\\\\n\\\"], [\\\"\\\\n\\\\tmargin: 0;\\\\n\\\\tfont-family: \\\", \\\";\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\\tline-height: 1.3;\\\\n\\\\n\\\\tu {\\\\n\\\\t\\\\ttext-decoration-color: \\\", \\\";\\\\n\\\\t}\\\\n\\\\n\\\\tb {\\\\n\\\\t\\\\tfont-weight: 500;\\\\n\\\\t}\\\\n\\\\n\\\\tfont-weight: \\\", \\\";\\\\n\\\\n\\\\t\\\",\\n \\\";\\\\n\\\\n\\\\ttext-align: \\\", \\\";\\\\n\\\\n\\\\t\\\",\\n \\\";\\\\n\\\"])), fonts_1.fonts().NORMAL_FONT, function (props) { return props.color || \\\"inherit\\\"; }, colors_1.Color.Red, function (props) { return props.fontWeight || Types.FontWeight.Bold; }, function (props) {\\n switch (props.level) {\\n case HeadlineLevel.H3:\\n return \\\"\\\\n\\\\t\\\\t\\\\t\\\\t\\\\tfont-size: 24px;\\\\n\\\\n\\\\t\\\\t\\\\t\\\\t\\\\t@media screen and (min-width: 960px) {\\\\n\\\\t\\\\t\\\\t\\\\t\\\\t\\\\tfont-size: 32px;\\\\n\\\\t\\\\t\\\\t\\\\t\\\\t}\\\\n\\\\t\\\\t\\\\t\\\\t\\\";\\n case HeadlineLevel.H2:\\n return \\\"\\\\n\\\\t\\\\t\\\\t\\\\t\\\\tfont-size: 32px;\\\\n\\\\n\\\\t\\\\t\\\\t\\\\t\\\\t@media screen and (min-width: 450px) {\\\\n\\\\t\\\\t\\\\t\\\\t\\\\t\\\\tfont-size: 48px;\\\\n\\\\t\\\\t\\\\t\\\\t\\\\t}\\\\n\\\\t\\\\t\\\\t\\\\t\\\\t@media screen and (min-width: 960px) {\\\\n\\\\t\\\\t\\\\t\\\\t\\\\t\\\\tfont-size: 54px;\\\\n\\\\t\\\\t\\\\t\\\\t\\\\t}\\\\n\\\\t\\\\t\\\\t\\\\t\\\";\\n case HeadlineLevel.H1:\\n default:\\n return \\\"\\\\n\\\\t\\\\t\\\\t\\\\t\\\\tfont-size: 48px;\\\\n\\\\n\\\\t\\\\t\\\\t\\\\t\\\\t@media screen and (min-width: 450px) {\\\\n\\\\t\\\\t\\\\t\\\\t\\\\t\\\\tfont-size: 64px;\\\\n\\\\t\\\\t\\\\t\\\\t\\\\t}\\\\n\\\\t\\\\t\\\\t\\\\t\\\\t@media screen and (min-width: 960px) {\\\\n\\\\t\\\\t\\\\t\\\\t\\\\t\\\\tfont-size: 96px;\\\\n\\\\t\\\\t\\\\t\\\\t\\\\t}\\\\n\\\\t\\\\t\\\\t\\\\t\\\";\\n }\\n}, function (props) { return props.textAlign || 'inherit'; }, function (props) {\\n return props.uppercase\\n ? \\\"letter-spacing: 1px;\\\\n\\\\t\\\\t\\\\t\\\\ttext-transform: uppercase;\\\"\\n : \\\"\\\";\\n});\\nexports.Headline = function (props) {\\n var as = props.level || 'h1';\\n var Component = StyledHeadline.withComponent(as);\\n return React.createElement(Component, tslib_1.__assign({}, props), props.children);\\n};\\nvar templateObject_1;\\n//# sourceMappingURL=headline.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/headline/headline.js?\");\n\n/***/ }),\n\n/***/ \"./lib/headline/index.js\":\n/*!*******************************!*\\\n !*** ./lib/headline/index.js ***!\n \\*******************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar tslib_1 = __webpack_require__(/*! tslib */ \\\"./node_modules/tslib/tslib.es6.js\\\");\\ntslib_1.__exportStar(__webpack_require__(/*! ./headline */ \\\"./lib/headline/headline.js\\\"), exports);\\n//# sourceMappingURL=index.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/headline/index.js?\");\n\n/***/ }),\n\n/***/ \"./lib/icons/icons.js\":\n/*!****************************!*\\\n !*** ./lib/icons/icons.js ***!\n \\****************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar tslib_1 = __webpack_require__(/*! tslib */ \\\"./node_modules/tslib/tslib.es6.js\\\");\\nvar _a;\\nvar React = __webpack_require__(/*! react */ \\\"./node_modules/react/index.js\\\");\\nvar styled_1 = __webpack_require__(/*! @emotion/styled */ \\\"./node_modules/@emotion/styled/dist/styled.browser.esm.js\\\");\\n;\\nvar IconName;\\n(function (IconName) {\\n IconName[IconName[\\\"ArrowDown\\\"] = 0] = \\\"ArrowDown\\\";\\n})(IconName = exports.IconName || (exports.IconName = {}));\\nvar IconSize;\\n(function (IconSize) {\\n IconSize[IconSize[\\\"XS\\\"] = 24] = \\\"XS\\\";\\n IconSize[IconSize[\\\"S\\\"] = 30] = \\\"S\\\";\\n IconSize[IconSize[\\\"M\\\"] = 48] = \\\"M\\\";\\n IconSize[IconSize[\\\"L\\\"] = 52] = \\\"L\\\";\\n})(IconSize = exports.IconSize || (exports.IconSize = {}));\\nvar icons = (_a = {},\\n _a[IconName.ArrowDown] = [\\n [React.createElement(\\\"path\\\", { key: \\\"arrow-down\\\", d: \\\"M12 15.5l6.06217783-7H5.93782217\\\" })],\\n [React.createElement(\\\"path\\\", { key: \\\"arrow-down\\\", d: \\\"M24 31l12.12435565-14h-24.2487113\\\" })]\\n ],\\n _a);\\nvar StyledIconRegistry = styled_1.default.svg(templateObject_1 || (templateObject_1 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tdisplay: none;\\\\n\\\"], [\\\"\\\\n\\\\tdisplay: none;\\\\n\\\"])));\\nvar StyledIcon = styled_1.default.svg(templateObject_2 || (templateObject_2 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\twidth: \\\", \\\"px;\\\\n\\\\theight: \\\", \\\"px;\\\\n\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\\tfill: currentColor;\\\\n\\\\tstroke: none;\\\\n\\\"], [\\\"\\\\n\\\\twidth: \\\", \\\"px;\\\\n\\\\theight: \\\", \\\"px;\\\\n\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\\tfill: currentColor;\\\\n\\\\tstroke: none;\\\\n\\\"])), function (props) { return props.size || IconSize.S; }, function (props) { return props.size || IconSize.S; }, function (props) { return (props.iconColor ? props.iconColor.toString() : \\\"inherit\\\"); });\\nvar IconRegistrySymbol = function (props) {\\n return (React.createElement(\\\"symbol\\\", { id: props.id + \\\"-\\\" + props.size, viewBox: props.size === \\\"small\\\" ? \\\"0 0 24 24\\\" : \\\"0 0 48 48\\\" }, props.children));\\n};\\nexports.IconRegistry = function (props) {\\n return (React.createElement(StyledIconRegistry, null, reduce(props.names, function (name, e) {\\n var _a = icons[e], small = _a[0], large = _a[1];\\n return [\\n React.createElement(IconRegistrySymbol, { id: name, key: name + \\\"-small\\\", size: \\\"small\\\" }, small),\\n React.createElement(IconRegistrySymbol, { id: name, key: name + \\\"-large\\\", size: \\\"large\\\" }, large || small)\\n ];\\n })));\\n};\\nfunction getIconRef(name, size) {\\n switch (size) {\\n case IconSize.XS:\\n case IconSize.S:\\n return \\\"#\\\" + name + \\\"-small\\\";\\n case IconSize.M:\\n case IconSize.L:\\n default:\\n return \\\"#\\\" + name + \\\"-large\\\";\\n }\\n}\\nexports.Icon = function (props) {\\n var icon = typeof props.name === \\\"number\\\" ? IconName[props.name] : null;\\n return (React.createElement(StyledIcon, { className: props.className, iconColor: props.color, size: props.size }, icon !== null && React.createElement(\\\"use\\\", { xlinkHref: getIconRef(icon, props.size || IconSize.S) })));\\n};\\nfunction reduce(e, cb) {\\n var results = [];\\n for (var n in e) {\\n if (isNaN(Number(n))) {\\n results.push.apply(results, cb(n, Number(e[n])));\\n }\\n }\\n return results;\\n}\\nexports.reduce = reduce;\\nvar templateObject_1, templateObject_2;\\n//# sourceMappingURL=icons.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/icons/icons.js?\");\n\n/***/ }),\n\n/***/ \"./lib/icons/index.js\":\n/*!****************************!*\\\n !*** ./lib/icons/index.js ***!\n \\****************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar tslib_1 = __webpack_require__(/*! tslib */ \\\"./node_modules/tslib/tslib.es6.js\\\");\\ntslib_1.__exportStar(__webpack_require__(/*! ./icons */ \\\"./lib/icons/icons.js\\\"), exports);\\n//# sourceMappingURL=index.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/icons/index.js?\");\n\n/***/ }),\n\n/***/ \"./lib/image/image.js\":\n/*!****************************!*\\\n !*** ./lib/image/image.js ***!\n \\****************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar tslib_1 = __webpack_require__(/*! tslib */ \\\"./node_modules/tslib/tslib.es6.js\\\");\\nvar React = __webpack_require__(/*! react */ \\\"./node_modules/react/index.js\\\");\\nvar styled_1 = __webpack_require__(/*! @emotion/styled */ \\\"./node_modules/@emotion/styled/dist/styled.browser.esm.js\\\");\\n;\\nvar StyledImage = styled_1.default.img(templateObject_1 || (templateObject_1 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tdisplay: block;\\\\n\\\\twidth: \\\", \\\";\\\\n\\\\tobject-fit: cover;\\\\n\\\"], [\\\"\\\\n\\\\tdisplay: block;\\\\n\\\\twidth: \\\", \\\";\\\\n\\\\tobject-fit: cover;\\\\n\\\"])), function (props) { return props.size || \\\"100%\\\"; });\\nexports.Image = function (props) {\\n return (React.createElement(StyledImage, { alt: props.alt, className: props.className, src: props.src, size: props.size }));\\n};\\nvar templateObject_1;\\n//# sourceMappingURL=image.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/image/image.js?\");\n\n/***/ }),\n\n/***/ \"./lib/image/index.js\":\n/*!****************************!*\\\n !*** ./lib/image/index.js ***!\n \\****************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar tslib_1 = __webpack_require__(/*! tslib */ \\\"./node_modules/tslib/tslib.es6.js\\\");\\ntslib_1.__exportStar(__webpack_require__(/*! ./image */ \\\"./lib/image/image.js\\\"), exports);\\n//# sourceMappingURL=index.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/image/index.js?\");\n\n/***/ }),\n\n/***/ \"./lib/input/input.js\":\n/*!****************************!*\\\n !*** ./lib/input/input.js ***!\n \\****************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar tslib_1 = __webpack_require__(/*! tslib */ \\\"./node_modules/tslib/tslib.es6.js\\\");\\nvar React = __webpack_require__(/*! react */ \\\"./node_modules/react/index.js\\\");\\nvar styled_1 = __webpack_require__(/*! @emotion/styled */ \\\"./node_modules/@emotion/styled/dist/styled.browser.esm.js\\\");\\n;\\nvar copy_1 = __webpack_require__(/*! ../copy */ \\\"./lib/copy/index.js\\\");\\nvar colors_1 = __webpack_require__(/*! ../colors */ \\\"./lib/colors/index.js\\\");\\nvar Type;\\n(function (Type) {\\n Type[\\\"Text\\\"] = \\\"text\\\";\\n Type[\\\"Number\\\"] = \\\"number\\\";\\n Type[\\\"Email\\\"] = \\\"email\\\";\\n})(Type = exports.Type || (exports.Type = {}));\\nvar StyledLabel = styled_1.default.label(templateObject_1 || (templateObject_1 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tdisplay: block;\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\"], [\\\"\\\\n\\\\tdisplay: block;\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\"])), colors_1.Color.Black);\\nvar StyledLabelText = styled_1.default(copy_1.Copy)(templateObject_2 || (templateObject_2 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tpadding: 0 3px 9px;\\\\n\\\"], [\\\"\\\\n\\\\tpadding: 0 3px 9px;\\\\n\\\"])));\\nvar StyledInput = styled_1.default.input(templateObject_3 || (templateObject_3 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tbox-sizing: border-box;\\\\n\\\\twidth: 100%;\\\\n\\\\tpadding: 12px;\\\\n\\\\tborder: 1px solid \\\", \\\";\\\\n\\\\tborder-radius: 3px;\\\\n\\\\tfont-size: 15px;\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\\n\\\\t\\\", \\\";\\\\n\\\\n\\\\t:focus {\\\\n\\\\t\\\\tborder-color: \\\", \\\";\\\\n\\\\t\\\\tbox-shadow: 0px 0px 2px 0px \\\", \\\";\\\\n\\\\t\\\\toutline: 0;\\\\n\\\\t}\\\\n\\\"], [\\\"\\\\n\\\\tbox-sizing: border-box;\\\\n\\\\twidth: 100%;\\\\n\\\\tpadding: 12px;\\\\n\\\\tborder: 1px solid \\\", \\\";\\\\n\\\\tborder-radius: 3px;\\\\n\\\\tfont-size: 15px;\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\\n\\\\t\\\", \\\";\\\\n\\\\n\\\\t:focus {\\\\n\\\\t\\\\tborder-color: \\\", \\\";\\\\n\\\\t\\\\tbox-shadow: 0px 0px 2px 0px \\\", \\\";\\\\n\\\\t\\\\toutline: 0;\\\\n\\\\t}\\\\n\\\"])), colors_1.Color.Grey70, colors_1.Color.Black, function (props) { return (props.errorText ? \\\"border-color: \\\" + colors_1.Color.Red + \\\";\\\" : \\\"\\\"); }, colors_1.Color.BlueLight, colors_1.Color.BlueLight);\\nvar StyledError = styled_1.default(copy_1.Copy)(templateObject_4 || (templateObject_4 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tpadding: 9px 3px 0;\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\"], [\\\"\\\\n\\\\tpadding: 9px 3px 0;\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\"])), colors_1.Color.Red);\\nexports.Input = function (props) {\\n var p = props;\\n return (React.createElement(StyledLabel, null,\\n p.labelText && (React.createElement(StyledLabelText, { size: copy_1.CopySize.Small, uppercase: true }, p.labelText)),\\n React.createElement(StyledInput, { type: p.type, value: p.value, name: p.name, placeholder: p.placeholder, readOnly: p.readOnly, disabled: p.disabled, errorText: p.errorText, onChange: p.handleChange }),\\n p.errorText && (React.createElement(StyledError, { size: copy_1.CopySize.Small }, p.errorText))));\\n};\\nvar templateObject_1, templateObject_2, templateObject_3, templateObject_4;\\n//# sourceMappingURL=input.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/input/input.js?\");\n\n/***/ }),\n\n/***/ \"./lib/layout/index.js\":\n/*!*****************************!*\\\n !*** ./lib/layout/index.js ***!\n \\*****************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar tslib_1 = __webpack_require__(/*! tslib */ \\\"./node_modules/tslib/tslib.es6.js\\\");\\ntslib_1.__exportStar(__webpack_require__(/*! ./layout */ \\\"./lib/layout/layout.js\\\"), exports);\\n//# sourceMappingURL=index.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/layout/index.js?\");\n\n/***/ }),\n\n/***/ \"./lib/layout/layout.js\":\n/*!******************************!*\\\n !*** ./lib/layout/layout.js ***!\n \\******************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar tslib_1 = __webpack_require__(/*! tslib */ \\\"./node_modules/tslib/tslib.es6.js\\\");\\nvar styled_1 = __webpack_require__(/*! @emotion/styled */ \\\"./node_modules/@emotion/styled/dist/styled.browser.esm.js\\\");\\nvar LayoutDirection;\\n(function (LayoutDirection) {\\n /** @name horizontal */ LayoutDirection[LayoutDirection[\\\"Horizontal\\\"] = 0] = \\\"Horizontal\\\";\\n /** @name vertical */ LayoutDirection[LayoutDirection[\\\"Vertical\\\"] = 1] = \\\"Vertical\\\";\\n})(LayoutDirection = exports.LayoutDirection || (exports.LayoutDirection = {}));\\nexports.Layout = styled_1.default.div(templateObject_1 || (templateObject_1 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tdisplay: flex;\\\\n\\\\tmargin: 0 \\\", \\\";\\\\n\\\\twidth: \\\", \\\";\\\\n\\\\tmax-width: \\\", \\\";\\\\n\\\\tbackground-color: \\\", \\\";\\\\n\\\\tflex-direction: \\\", \\\";\\\\n\\\"], [\\\"\\\\n\\\\tdisplay: flex;\\\\n\\\\tmargin: 0 \\\", \\\";\\\\n\\\\twidth: \\\", \\\";\\\\n\\\\tmax-width: \\\", \\\";\\\\n\\\\tbackground-color: \\\", \\\";\\\\n\\\\tflex-direction: \\\", \\\";\\\\n\\\"])), function (props) { return (props.center && \\\"auto\\\") || \\\"\\\"; }, function (props) { return props.width || \\\"auto\\\"; }, function (props) { return props.maxWidth || \\\"none\\\"; }, function (props) { return props.backgroundColor || \\\"none\\\"; }, function (props) { return (props.direction === LayoutDirection.Vertical ? \\\"column\\\" : \\\"row\\\"); });\\nvar templateObject_1;\\n//# sourceMappingURL=layout.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/layout/layout.js?\");\n\n/***/ }),\n\n/***/ \"./lib/link/link.js\":\n/*!**************************!*\\\n !*** ./lib/link/link.js ***!\n \\**************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar tslib_1 = __webpack_require__(/*! tslib */ \\\"./node_modules/tslib/tslib.es6.js\\\");\\nvar styled_1 = __webpack_require__(/*! @emotion/styled */ \\\"./node_modules/@emotion/styled/dist/styled.browser.esm.js\\\");\\n;\\nvar fonts_1 = __webpack_require__(/*! ../fonts */ \\\"./lib/fonts/index.js\\\");\\nexports.Link = styled_1.default.div(templateObject_1 || (templateObject_1 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tdisplay: inline-block;\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\\tfont-family: \\\", \\\";\\\\n\\\"], [\\\"\\\\n\\\\tdisplay: inline-block;\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\\tfont-family: \\\", \\\";\\\\n\\\"])), function (props) { return props.color || 'inherit'; }, fonts_1.fonts().NORMAL_FONT);\\nvar templateObject_1;\\n//# sourceMappingURL=link.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/link/link.js?\");\n\n/***/ }),\n\n/***/ \"./lib/menu-item/menu-item.js\":\n/*!************************************!*\\\n !*** ./lib/menu-item/menu-item.js ***!\n \\************************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar tslib_1 = __webpack_require__(/*! tslib */ \\\"./node_modules/tslib/tslib.es6.js\\\");\\nvar React = __webpack_require__(/*! react */ \\\"./node_modules/react/index.js\\\");\\nvar styled_1 = __webpack_require__(/*! @emotion/styled */ \\\"./node_modules/@emotion/styled/dist/styled.browser.esm.js\\\");\\n;\\nvar colors_1 = __webpack_require__(/*! ../colors */ \\\"./lib/colors/index.js\\\");\\nvar copy_1 = __webpack_require__(/*! ../copy */ \\\"./lib/copy/index.js\\\");\\nvar StyledMenuItem = styled_1.default(copy_1.Copy)(templateObject_1 || (templateObject_1 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tcursor: pointer;\\\\n\\\"], [\\\"\\\\n\\\\tcursor: pointer;\\\\n\\\"])));\\nexports.MenuItem = function (props) {\\n return (React.createElement(\\\"a\\\", { href: props.href, target: props.target, rel: props.rel, title: props.title, style: { textDecoration: \\\"none\\\", marginLeft: 32, color: colors_1.Color.White } },\\n React.createElement(StyledMenuItem, null, props.linkName)));\\n};\\nvar templateObject_1;\\n//# sourceMappingURL=menu-item.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/menu-item/menu-item.js?\");\n\n/***/ }),\n\n/***/ \"./lib/menu/menu.js\":\n/*!**************************!*\\\n !*** ./lib/menu/menu.js ***!\n \\**************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar tslib_1 = __webpack_require__(/*! tslib */ \\\"./node_modules/tslib/tslib.es6.js\\\");\\nvar React = __webpack_require__(/*! react */ \\\"./node_modules/react/index.js\\\");\\nvar styled_1 = __webpack_require__(/*! @emotion/styled */ \\\"./node_modules/@emotion/styled/dist/styled.browser.esm.js\\\");\\nvar colors_1 = __webpack_require__(/*! ../colors */ \\\"./lib/colors/index.js\\\");\\nvar image_1 = __webpack_require__(/*! ../image */ \\\"./lib/image/index.js\\\");\\nvar layout_1 = __webpack_require__(/*! ../layout */ \\\"./lib/layout/index.js\\\");\\nvar StyledWrapper = styled_1.default(layout_1.Layout)(templateObject_1 || (templateObject_1 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tposition: \\\", \\\";\\\\n\\\\ttop: 0;\\\\n\\\\tbackground-color: \\\", \\\";\\\\n\\\"], [\\\"\\\\n\\\\tposition: \\\", \\\";\\\\n\\\\ttop: 0;\\\\n\\\\tbackground-color: \\\", \\\";\\\\n\\\"])), function (props) { return (props.sticky ? \\\"sticky\\\" : \\\"static\\\"); }, function (props) { return props.backgroundColor; });\\nvar StyledMenu = styled_1.default.div(templateObject_2 || (templateObject_2 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tdisplay: flex;\\\\n\\\\twidth: 100%;\\\\n\\\\tjustify-content: space-between;\\\\n\\\\talign-items: center;\\\\n\\\\tpadding: 20px 0;\\\\n\\\\tbox-sizing: border-box;\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\"], [\\\"\\\\n\\\\tdisplay: flex;\\\\n\\\\twidth: 100%;\\\\n\\\\tjustify-content: space-between;\\\\n\\\\talign-items: center;\\\\n\\\\tpadding: 20px 0;\\\\n\\\\tbox-sizing: border-box;\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\"])), colors_1.Color.White);\\nvar StyledImage = styled_1.default(image_1.Image)(templateObject_3 || (templateObject_3 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tdisplay: block;\\\\n\\\\theight: 50px;\\\\n\\\"], [\\\"\\\\n\\\\tdisplay: block;\\\\n\\\\theight: 50px;\\\\n\\\"])));\\nvar StyledMenuInner = styled_1.default.div(templateObject_4 || (templateObject_4 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tdisplay: flex;\\\\n\\\\t> * {\\\\n\\\\t\\\\tdisplay: none;\\\\n\\\\t}\\\\n\\\\t> :nth-of-type(1) {\\\\n\\\\t\\\\tdisplay: block;\\\\n\\\\t}\\\\n\\\\t> :nth-of-type(2) {\\\\n\\\\t\\\\tdisplay: block;\\\\n\\\\t}\\\\n\\\\t@media screen and (min-width: 420px) {\\\\n\\\\t\\\\t> :nth-of-type(3) {\\\\n\\\\t\\\\t\\\\tdisplay: block;\\\\n\\\\t\\\\t}\\\\n\\\\t}\\\\n\\\\t@media screen and (min-width: 520px) {\\\\n\\\\t\\\\t> :nth-of-type(4) {\\\\n\\\\t\\\\t\\\\tdisplay: block;\\\\n\\\\t\\\\t}\\\\n\\\\t}\\\\n\\\\t@media screen and (min-width: 620px) {\\\\n\\\\t\\\\t> :nth-of-type(5) {\\\\n\\\\t\\\\t\\\\tdisplay: block;\\\\n\\\\t\\\\t}\\\\n\\\\t}\\\\n\\\\t@media screen and (min-width: 720px) {\\\\n\\\\t\\\\t> :nth-of-type(6) {\\\\n\\\\t\\\\t\\\\tdisplay: block;\\\\n\\\\t\\\\t}\\\\n\\\\t}\\\\n\\\"], [\\\"\\\\n\\\\tdisplay: flex;\\\\n\\\\t> * {\\\\n\\\\t\\\\tdisplay: none;\\\\n\\\\t}\\\\n\\\\t> :nth-of-type(1) {\\\\n\\\\t\\\\tdisplay: block;\\\\n\\\\t}\\\\n\\\\t> :nth-of-type(2) {\\\\n\\\\t\\\\tdisplay: block;\\\\n\\\\t}\\\\n\\\\t@media screen and (min-width: 420px) {\\\\n\\\\t\\\\t> :nth-of-type(3) {\\\\n\\\\t\\\\t\\\\tdisplay: block;\\\\n\\\\t\\\\t}\\\\n\\\\t}\\\\n\\\\t@media screen and (min-width: 520px) {\\\\n\\\\t\\\\t> :nth-of-type(4) {\\\\n\\\\t\\\\t\\\\tdisplay: block;\\\\n\\\\t\\\\t}\\\\n\\\\t}\\\\n\\\\t@media screen and (min-width: 620px) {\\\\n\\\\t\\\\t> :nth-of-type(5) {\\\\n\\\\t\\\\t\\\\tdisplay: block;\\\\n\\\\t\\\\t}\\\\n\\\\t}\\\\n\\\\t@media screen and (min-width: 720px) {\\\\n\\\\t\\\\t> :nth-of-type(6) {\\\\n\\\\t\\\\t\\\\tdisplay: block;\\\\n\\\\t\\\\t}\\\\n\\\\t}\\\\n\\\"])));\\nexports.Menu = function (props) {\\n return (React.createElement(StyledWrapper, { backgroundColor: colors_1.Color.Black, sticky: props.sticky },\\n React.createElement(layout_1.Layout, { width: \\\"80%\\\", maxWidth: \\\"960px\\\", center: true },\\n React.createElement(StyledMenu, tslib_1.__assign({}, props),\\n React.createElement(StyledImage, { size: \\\"50px\\\", src: props.logo }),\\n React.createElement(StyledMenuInner, null, props.children)))));\\n};\\nvar templateObject_1, templateObject_2, templateObject_3, templateObject_4;\\n//# sourceMappingURL=menu.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/menu/menu.js?\");\n\n/***/ }),\n\n/***/ \"./lib/radio/radio.js\":\n/*!****************************!*\\\n !*** ./lib/radio/radio.js ***!\n \\****************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar tslib_1 = __webpack_require__(/*! tslib */ \\\"./node_modules/tslib/tslib.es6.js\\\");\\nvar React = __webpack_require__(/*! react */ \\\"./node_modules/react/index.js\\\");\\nvar styled_1 = __webpack_require__(/*! @emotion/styled */ \\\"./node_modules/@emotion/styled/dist/styled.browser.esm.js\\\");\\n;\\nvar colors_1 = __webpack_require__(/*! ../colors */ \\\"./lib/colors/index.js\\\");\\nvar copy_1 = __webpack_require__(/*! ../copy */ \\\"./lib/copy/index.js\\\");\\nvar StyledRadioInput = styled_1.default.input(templateObject_1 || (templateObject_1 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tposition: absolute;\\\\n\\\\tleft: -100vw;\\\\n\\\"], [\\\"\\\\n\\\\tposition: absolute;\\\\n\\\\tleft: -100vw;\\\\n\\\"])));\\nvar StyledLabel = styled_1.default.label(templateObject_2 || (templateObject_2 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tdisplay: flex;\\\\n\\\\talign-items: center;\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\\n\\\\t\\\", \\\";\\\\n\\\"], [\\\"\\\\n\\\\tdisplay: flex;\\\\n\\\\talign-items: center;\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\\n\\\\t\\\", \\\";\\\\n\\\"])), colors_1.Color.Black, function (props) { return (props.disabled ? \\\"color: \\\" + colors_1.Color.Grey90 + \\\";\\\" : \\\"\\\"); });\\nvar StyledRadio = styled_1.default.div(templateObject_3 || (templateObject_3 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tdisplay: inline-flex;\\\\n\\\\talign-items: center;\\\\n\\\\tjustify-content: center;\\\\n\\\\twidth: 34px;\\\\n\\\\theight: 34px;\\\\n\\\\tborder: 1px solid \\\", \\\";\\\\n\\\\tborder-radius: 50%;\\\\n\\\\n\\\\t\\\", \\\";\\\\n\\\\n\\\\t/* RadioIndicator */\\\\n\\\\t::before {\\\\n\\\\t\\\\t\\\", \\\";\\\\n\\\\t\\\\tcontent: \\\\\\\"\\\\\\\";\\\\n\\\\t\\\\twidth: 18px;\\\\n\\\\t\\\\theight: 18px;\\\\n\\\\t\\\\tborder-radius: 50%;\\\\n\\\\t\\\\tbackground: \\\", \\\";\\\\n\\\\t}\\\\n\\\"], [\\\"\\\\n\\\\tdisplay: inline-flex;\\\\n\\\\talign-items: center;\\\\n\\\\tjustify-content: center;\\\\n\\\\twidth: 34px;\\\\n\\\\theight: 34px;\\\\n\\\\tborder: 1px solid \\\", \\\";\\\\n\\\\tborder-radius: 50%;\\\\n\\\\n\\\\t\\\", \\\";\\\\n\\\\n\\\\t/* RadioIndicator */\\\\n\\\\t::before {\\\\n\\\\t\\\\t\\\", \\\";\\\\n\\\\t\\\\tcontent: \\\\\\\"\\\\\\\";\\\\n\\\\t\\\\twidth: 18px;\\\\n\\\\t\\\\theight: 18px;\\\\n\\\\t\\\\tborder-radius: 50%;\\\\n\\\\t\\\\tbackground: \\\", \\\";\\\\n\\\\t}\\\\n\\\"])), colors_1.Color.Grey70, function (props) { return (props.disabled ? \\\"border-color: \\\" + colors_1.Color.Grey90 + \\\";\\\" : \\\"\\\"); }, function (props) { return (props.checked ? \\\"display: block;\\\" : \\\"display: none;\\\"); }, colors_1.Color.Green);\\nvar StyledLabelText = styled_1.default(copy_1.Copy)(templateObject_4 || (templateObject_4 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tpadding-left: 12px;\\\\n\\\"], [\\\"\\\\n\\\\tpadding-left: 12px;\\\\n\\\"])));\\nexports.Radio = function (props) {\\n var disabled = props.disabled, groupName = props.groupName, value = props.value, handleChange = props.handleChange, checked = props.checked, labelText = props.labelText;\\n return (React.createElement(StyledLabel, { disabled: disabled },\\n React.createElement(StyledRadioInput, { type: \\\"radio\\\", name: groupName, value: value, onChange: handleChange }),\\n React.createElement(StyledRadio, { checked: checked, disabled: disabled }),\\n labelText && React.createElement(StyledLabelText, null, labelText)));\\n};\\nvar templateObject_1, templateObject_2, templateObject_3, templateObject_4;\\n//# sourceMappingURL=radio.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/radio/radio.js?\");\n\n/***/ }),\n\n/***/ \"./lib/section/section.js\":\n/*!********************************!*\\\n !*** ./lib/section/section.js ***!\n \\********************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar tslib_1 = __webpack_require__(/*! tslib */ \\\"./node_modules/tslib/tslib.es6.js\\\");\\nvar colors_1 = __webpack_require__(/*! ../colors */ \\\"./lib/colors/index.js\\\");\\nvar layout_1 = __webpack_require__(/*! ../layout */ \\\"./lib/layout/index.js\\\");\\nvar React = __webpack_require__(/*! react */ \\\"./node_modules/react/index.js\\\");\\nvar styled_1 = __webpack_require__(/*! @emotion/styled */ \\\"./node_modules/@emotion/styled/dist/styled.browser.esm.js\\\");\\nvar StyledWrapper = styled_1.default.div(templateObject_1 || (templateObject_1 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tmargin: 0 auto;\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\\tpadding: 100px 0;\\\\n\\\\n\\\\t@media screen and (min-width: 960px) {\\\\n\\\\t\\\\tpadding: 200px 0;\\\\n\\\\t}\\\\n\\\"], [\\\"\\\\n\\\\tmargin: 0 auto;\\\\n\\\\tcolor: \\\", \\\";\\\\n\\\\tpadding: 100px 0;\\\\n\\\\n\\\\t@media screen and (min-width: 960px) {\\\\n\\\\t\\\\tpadding: 200px 0;\\\\n\\\\t}\\\\n\\\"])), function (props) { return props.textColor; });\\nexports.Section = function (props) {\\n return (React.createElement(layout_1.Layout, { backgroundColor: props.backgroundColor || colors_1.Color.White },\\n React.createElement(layout_1.Layout, { width: \\\"80%\\\", maxWidth: \\\"960px\\\", center: true },\\n React.createElement(StyledWrapper, { textColor: props.textColor || 'inherit' }, props.children))));\\n};\\nvar templateObject_1;\\n//# sourceMappingURL=section.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/section/section.js?\");\n\n/***/ }),\n\n/***/ \"./lib/space/index.js\":\n/*!****************************!*\\\n !*** ./lib/space/index.js ***!\n \\****************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar tslib_1 = __webpack_require__(/*! tslib */ \\\"./node_modules/tslib/tslib.es6.js\\\");\\ntslib_1.__exportStar(__webpack_require__(/*! ./space */ \\\"./lib/space/space.js\\\"), exports);\\n//# sourceMappingURL=index.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/space/index.js?\");\n\n/***/ }),\n\n/***/ \"./lib/space/space.js\":\n/*!****************************!*\\\n !*** ./lib/space/space.js ***!\n \\****************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar tslib_1 = __webpack_require__(/*! tslib */ \\\"./node_modules/tslib/tslib.es6.js\\\");\\nvar styled_1 = __webpack_require__(/*! @emotion/styled */ \\\"./node_modules/@emotion/styled/dist/styled.browser.esm.js\\\");\\nvar SpaceSize;\\n(function (SpaceSize) {\\n SpaceSize[SpaceSize[\\\"XS\\\"] = 8] = \\\"XS\\\";\\n SpaceSize[SpaceSize[\\\"S\\\"] = 16] = \\\"S\\\";\\n SpaceSize[SpaceSize[\\\"M\\\"] = 32] = \\\"M\\\";\\n SpaceSize[SpaceSize[\\\"L\\\"] = 64] = \\\"L\\\";\\n SpaceSize[SpaceSize[\\\"XL\\\"] = 128] = \\\"XL\\\";\\n})(SpaceSize = exports.SpaceSize || (exports.SpaceSize = {}));\\nexports.Space = styled_1.default.div(templateObject_1 || (templateObject_1 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tdisplay: block;\\\\n\\\\twidth: \\\", \\\"px;\\\\n\\\\theight: \\\", \\\"px;\\\\n\\\"], [\\\"\\\\n\\\\tdisplay: block;\\\\n\\\\twidth: \\\", \\\"px;\\\\n\\\\theight: \\\", \\\"px;\\\\n\\\"])), function (props) { return props.size; }, function (props) { return props.size; });\\nvar templateObject_1;\\n//# sourceMappingURL=space.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/space/space.js?\");\n\n/***/ }),\n\n/***/ \"./lib/teaser/teaser.js\":\n/*!******************************!*\\\n !*** ./lib/teaser/teaser.js ***!\n \\******************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar tslib_1 = __webpack_require__(/*! tslib */ \\\"./node_modules/tslib/tslib.es6.js\\\");\\nvar React = __webpack_require__(/*! react */ \\\"./node_modules/react/index.js\\\");\\nvar styled_1 = __webpack_require__(/*! @emotion/styled */ \\\"./node_modules/@emotion/styled/dist/styled.browser.esm.js\\\");\\n;\\nvar colors_1 = __webpack_require__(/*! ../colors */ \\\"./lib/colors/index.js\\\");\\nvar headline_1 = __webpack_require__(/*! ../headline */ \\\"./lib/headline/index.js\\\");\\nvar layout_1 = __webpack_require__(/*! ../layout */ \\\"./lib/layout/index.js\\\");\\nvar space_1 = __webpack_require__(/*! ../space */ \\\"./lib/space/index.js\\\");\\nvar StyledTeaser = styled_1.default.div(templateObject_1 || (templateObject_1 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tbackground-position: center;\\\\n\\\\tbackground-size: cover;\\\\n\\\\tbackground-image: url('\\\", \\\"');\\\\n\\\\twidth: 100%;\\\\n\\\\tdisplay: flex;\\\\n\\\\talign-items: center;\\\\n\\\\tposition: relative;\\\\n\\\\tpadding: 100px 0;\\\\n\\\\tbox-sizing: border-box;\\\\n\\\\n\\\\t@media screen and (min-width: 960px) {\\\\n\\\\t\\\\tpadding: 200px 0;\\\\n\\\\t}\\\\n\\\\n\\\\t&:after {\\\\n\\\\t\\\\tcontent: '';\\\\n\\\\t\\\\tposition: absolute;\\\\n\\\\t\\\\ttop: 0;\\\\n\\\\t\\\\tleft: 0;\\\\n\\\\t\\\\twidth: 100%;\\\\n\\\\t\\\\theight: 100%;\\\\n\\\\t\\\\tbackground: rgba(0,0,0,0.75);\\\\n\\\\t\\\\tz-index: 1;\\\\n\\\\t}\\\\n\\\"], [\\\"\\\\n\\\\tbackground-position: center;\\\\n\\\\tbackground-size: cover;\\\\n\\\\tbackground-image: url('\\\", \\\"');\\\\n\\\\twidth: 100%;\\\\n\\\\tdisplay: flex;\\\\n\\\\talign-items: center;\\\\n\\\\tposition: relative;\\\\n\\\\tpadding: 100px 0;\\\\n\\\\tbox-sizing: border-box;\\\\n\\\\n\\\\t@media screen and (min-width: 960px) {\\\\n\\\\t\\\\tpadding: 200px 0;\\\\n\\\\t}\\\\n\\\\n\\\\t&:after {\\\\n\\\\t\\\\tcontent: '';\\\\n\\\\t\\\\tposition: absolute;\\\\n\\\\t\\\\ttop: 0;\\\\n\\\\t\\\\tleft: 0;\\\\n\\\\t\\\\twidth: 100%;\\\\n\\\\t\\\\theight: 100%;\\\\n\\\\t\\\\tbackground: rgba(0,0,0,0.75);\\\\n\\\\t\\\\tz-index: 1;\\\\n\\\\t}\\\\n\\\"])), function (props) { return props.image || ''; });\\nvar StyledLayout = styled_1.default(layout_1.Layout)(templateObject_2 || (templateObject_2 = tslib_1.__makeTemplateObject([\\\"\\\\n\\\\tz-index: 2;\\\\n\\\"], [\\\"\\\\n\\\\tz-index: 2;\\\\n\\\"])));\\nexports.Teaser = function (props) {\\n return (React.createElement(StyledTeaser, tslib_1.__assign({}, props),\\n React.createElement(StyledLayout, { width: \\\"80%\\\", maxWidth: \\\"960px\\\", center: true },\\n React.createElement(layout_1.Layout, { maxWidth: \\\"480px\\\", direction: layout_1.LayoutDirection.Vertical },\\n React.createElement(\\\"svg\\\", { style: { marginBottom: space_1.SpaceSize.M }, width: \\\"60\\\", height: \\\"60\\\", xmlns: \\\"http://www.w3.org/2000/svg\\\" },\\n React.createElement(\\\"path\\\", { d: \\\"M30 60a30 30 0 1 1 0-60 30 30 0 0 1 0 60zm-4-37v15l12-7.5L26 23z\\\", fill: \\\"#FFF\\\", fillRule: \\\"evenodd\\\" })),\\n React.createElement(space_1.Space, { size: space_1.SpaceSize.M }),\\n React.createElement(headline_1.Headline, { level: headline_1.HeadlineLevel.H3, color: colors_1.Color.White }, props.headline),\\n React.createElement(space_1.Space, { size: space_1.SpaceSize.XL })),\\n props.children)));\\n};\\nvar templateObject_1, templateObject_2;\\n//# sourceMappingURL=teaser.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/teaser/teaser.js?\");\n\n/***/ }),\n\n/***/ \"./lib/types.js\":\n/*!**********************!*\\\n !*** ./lib/types.js ***!\n \\**********************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\nObject.defineProperty(exports, \\\"__esModule\\\", { value: true });\\nvar FontWeight;\\n(function (FontWeight) {\\n FontWeight[FontWeight[\\\"Light\\\"] = 100] = \\\"Light\\\";\\n FontWeight[FontWeight[\\\"Regular\\\"] = 300] = \\\"Regular\\\";\\n FontWeight[FontWeight[\\\"Bold\\\"] = 500] = \\\"Bold\\\";\\n})(FontWeight = exports.FontWeight || (exports.FontWeight = {}));\\nvar TextAlign;\\n(function (TextAlign) {\\n TextAlign[\\\"Left\\\"] = \\\"left\\\";\\n TextAlign[\\\"Center\\\"] = \\\"center\\\";\\n TextAlign[\\\"Right\\\"] = \\\"right\\\";\\n})(TextAlign = exports.TextAlign || (exports.TextAlign = {}));\\n//# sourceMappingURL=types.js.map\\n\\n//# sourceURL=webpack://%5Bname%5D/./lib/types.js?\");\n\n/***/ }),\n\n/***/ \"./node_modules/@emotion/cache/dist/cache.browser.esm.js\":\n/*!***************************************************************!*\\\n !*** ./node_modules/@emotion/cache/dist/cache.browser.esm.js ***!\n \\***************************************************************/\n/*! exports provided: default */\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\neval(\"__webpack_require__.r(__webpack_exports__);\\n/* harmony import */ var _emotion_sheet__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @emotion/sheet */ \\\"./node_modules/@emotion/sheet/dist/sheet.browser.esm.js\\\");\\n/* harmony import */ var _emotion_stylis__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! @emotion/stylis */ \\\"./node_modules/@emotion/stylis/dist/stylis.browser.esm.js\\\");\\n/* harmony import */ var _emotion_weak_memoize__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(/*! @emotion/weak-memoize */ \\\"./node_modules/@emotion/weak-memoize/dist/weak-memoize.browser.esm.js\\\");\\n\\n\\n\\n\\n// https://github.com/thysultan/stylis.js/tree/master/plugins/rule-sheet\\n// inlined to avoid umd wrapper and peerDep warnings/installing stylis\\n// since we use stylis after closure compiler\\nvar delimiter = '/*|*/';\\nvar needle = delimiter + '}';\\n\\nfunction toSheet(block) {\\n if (block) {\\n Sheet.current.insert(block + '}');\\n }\\n}\\n\\nvar Sheet = {\\n current: null\\n};\\nvar ruleSheet = function ruleSheet(context, content, selectors, parents, line, column, length, ns, depth, at) {\\n switch (context) {\\n // property\\n case 1:\\n {\\n switch (content.charCodeAt(0)) {\\n case 64:\\n {\\n // @import\\n Sheet.current.insert(content + ';');\\n return '';\\n }\\n // charcode for l\\n\\n case 108:\\n {\\n // charcode for b\\n // this ignores label\\n if (content.charCodeAt(2) === 98) {\\n return '';\\n }\\n }\\n }\\n\\n break;\\n }\\n // selector\\n\\n case 2:\\n {\\n if (ns === 0) return content + delimiter;\\n break;\\n }\\n // at-rule\\n\\n case 3:\\n {\\n switch (ns) {\\n // @font-face, @page\\n case 102:\\n case 112:\\n {\\n Sheet.current.insert(selectors[0] + content);\\n return '';\\n }\\n\\n default:\\n {\\n return content + (at === 0 ? delimiter : '');\\n }\\n }\\n }\\n\\n case -2:\\n {\\n content.split(needle).forEach(toSheet);\\n }\\n }\\n};\\n\\nvar createCache = function createCache(options) {\\n if (options === undefined) options = {};\\n var key = options.key || 'css';\\n var stylisOptions;\\n\\n if (options.prefix !== undefined) {\\n stylisOptions = {\\n prefix: options.prefix\\n };\\n }\\n\\n var stylis = new _emotion_stylis__WEBPACK_IMPORTED_MODULE_1__[\\\"default\\\"](stylisOptions);\\n\\n if (true) {\\n // $FlowFixMe\\n if (/[^a-z-]/.test(key)) {\\n throw new Error(\\\"Emotion key must only contain lower case alphabetical characters and - but \\\\\\\"\\\" + key + \\\"\\\\\\\" was passed\\\");\\n }\\n }\\n\\n var inserted = {}; // $FlowFixMe\\n\\n var container;\\n\\n {\\n container = options.container || document.head;\\n var nodes = document.querySelectorAll(\\\"style[data-emotion-\\\" + key + \\\"]\\\");\\n Array.prototype.forEach.call(nodes, function (node) {\\n var attrib = node.getAttribute(\\\"data-emotion-\\\" + key); // $FlowFixMe\\n\\n attrib.split(' ').forEach(function (id) {\\n inserted[id] = true;\\n });\\n\\n if (node.parentNode !== container) {\\n container.appendChild(node);\\n }\\n });\\n }\\n\\n var _insert;\\n\\n {\\n stylis.use(options.stylisPlugins)(ruleSheet);\\n\\n _insert = function insert(selector, serialized, sheet, shouldCache) {\\n var name = serialized.name;\\n Sheet.current = sheet;\\n\\n if ( true && serialized.map !== undefined) {\\n var map = serialized.map;\\n Sheet.current = {\\n insert: function insert(rule) {\\n sheet.insert(rule + map);\\n }\\n };\\n }\\n\\n stylis(selector, serialized.styles);\\n\\n if (shouldCache) {\\n cache.inserted[name] = true;\\n }\\n };\\n }\\n\\n if (true) {\\n // https://esbench.com/bench/5bf7371a4cd7e6009ef61d0a\\n var commentStart = /\\\\/\\\\*/g;\\n var commentEnd = /\\\\*\\\\//g;\\n stylis.use(function (context, content) {\\n switch (context) {\\n case -1:\\n {\\n while (commentStart.test(content)) {\\n commentEnd.lastIndex = commentStart.lastIndex;\\n\\n if (commentEnd.test(content)) {\\n commentStart.lastIndex = commentEnd.lastIndex;\\n continue;\\n }\\n\\n throw new Error('Your styles have an unterminated comment (\\\"/*\\\" without corresponding \\\"*/\\\").');\\n }\\n\\n commentStart.lastIndex = 0;\\n break;\\n }\\n }\\n });\\n stylis.use(function (context, content, selectors) {\\n switch (context) {\\n case 2:\\n {\\n for (var i = 0, len = selectors.length; len > i; i++) {\\n // :last-child isn't included here since it's safe\\n // because a style element will never be the last element\\n var match = selectors[i].match(/:(first|nth|nth-last)-child/);\\n\\n if (match !== null) {\\n console.error(\\\"The pseudo class \\\\\\\"\\\" + match[0] + \\\"\\\\\\\" is potentially unsafe when doing server-side rendering. Try changing it to \\\\\\\"\\\" + match[1] + \\\"-of-type\\\\\\\"\\\");\\n }\\n }\\n\\n break;\\n }\\n }\\n });\\n }\\n\\n var cache = {\\n key: key,\\n sheet: new _emotion_sheet__WEBPACK_IMPORTED_MODULE_0__[\\\"StyleSheet\\\"]({\\n key: key,\\n container: container,\\n nonce: options.nonce,\\n speedy: options.speedy\\n }),\\n nonce: options.nonce,\\n inserted: inserted,\\n registered: {},\\n insert: _insert\\n };\\n return cache;\\n};\\n\\n/* harmony default export */ __webpack_exports__[\\\"default\\\"] = (createCache);\\n\\n\\n//# sourceURL=webpack://%5Bname%5D/./node_modules/@emotion/cache/dist/cache.browser.esm.js?\");\n\n/***/ }),\n\n/***/ \"./node_modules/@emotion/core/dist/core.browser.esm.js\":\n/*!*************************************************************!*\\\n !*** ./node_modules/@emotion/core/dist/core.browser.esm.js ***!\n \\*************************************************************/\n/*! exports provided: css, withEmotionCache, CacheProvider, ThemeContext, jsx, Global, keyframes, ClassNames */\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\neval(\"__webpack_require__.r(__webpack_exports__);\\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \\\"withEmotionCache\\\", function() { return withEmotionCache; });\\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \\\"CacheProvider\\\", function() { return CacheProvider; });\\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \\\"ThemeContext\\\", function() { return ThemeContext; });\\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \\\"jsx\\\", function() { return jsx; });\\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \\\"Global\\\", function() { return Global; });\\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \\\"keyframes\\\", function() { return keyframes; });\\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \\\"ClassNames\\\", function() { return ClassNames; });\\n/* harmony import */ var react__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! react */ \\\"./node_modules/react/index.js\\\");\\n/* harmony import */ var react__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(react__WEBPACK_IMPORTED_MODULE_0__);\\n/* harmony import */ var _emotion_cache__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! @emotion/cache */ \\\"./node_modules/@emotion/cache/dist/cache.browser.esm.js\\\");\\n/* harmony import */ var _emotion_utils__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(/*! @emotion/utils */ \\\"./node_modules/@emotion/utils/dist/utils.browser.esm.js\\\");\\n/* harmony import */ var _emotion_serialize__WEBPACK_IMPORTED_MODULE_3__ = __webpack_require__(/*! @emotion/serialize */ \\\"./node_modules/@emotion/serialize/dist/serialize.browser.esm.js\\\");\\n/* harmony import */ var _emotion_sheet__WEBPACK_IMPORTED_MODULE_4__ = __webpack_require__(/*! @emotion/sheet */ \\\"./node_modules/@emotion/sheet/dist/sheet.browser.esm.js\\\");\\n/* harmony import */ var _emotion_css__WEBPACK_IMPORTED_MODULE_5__ = __webpack_require__(/*! @emotion/css */ \\\"./node_modules/@emotion/css/dist/css.browser.esm.js\\\");\\n/* harmony reexport (safe) */ __webpack_require__.d(__webpack_exports__, \\\"css\\\", function() { return _emotion_css__WEBPACK_IMPORTED_MODULE_5__[\\\"default\\\"]; });\\n\\n\\n\\n\\n\\n\\n\\n\\n\\nfunction _inheritsLoose(subClass, superClass) {\\n subClass.prototype = Object.create(superClass.prototype);\\n subClass.prototype.constructor = subClass;\\n subClass.__proto__ = superClass;\\n}\\n\\nvar EmotionCacheContext = Object(react__WEBPACK_IMPORTED_MODULE_0__[\\\"createContext\\\"])(Object(_emotion_cache__WEBPACK_IMPORTED_MODULE_1__[\\\"default\\\"])());\\nvar ThemeContext = Object(react__WEBPACK_IMPORTED_MODULE_0__[\\\"createContext\\\"])({});\\nvar CacheProvider = EmotionCacheContext.Provider;\\n\\nvar withEmotionCache = function withEmotionCache(func) {\\n var render = function render(props, ref) {\\n return Object(react__WEBPACK_IMPORTED_MODULE_0__[\\\"createElement\\\"])(EmotionCacheContext.Consumer, null, function ( // $FlowFixMe we know it won't be null\\n cache) {\\n return func(props, cache, ref);\\n });\\n }; // $FlowFixMe\\n\\n\\n return Object(react__WEBPACK_IMPORTED_MODULE_0__[\\\"forwardRef\\\"])(render);\\n};\\n\\nvar typePropName = '__EMOTION_TYPE_PLEASE_DO_NOT_USE__';\\nvar labelPropName = '__EMOTION_LABEL_PLEASE_DO_NOT_USE__';\\nvar hasOwnProperty = Object.prototype.hasOwnProperty;\\n\\nvar render = function render(cache, props, theme, ref) {\\n var type = props[typePropName];\\n var registeredStyles = [];\\n var className = '';\\n var cssProp = theme === null ? props.css : props.css(theme); // so that using `css` from `emotion` and passing the result to the css prop works\\n // not passing the registered cache to serializeStyles because it would\\n // make certain babel optimisations not possible\\n\\n if (typeof cssProp === 'string' && cache.registered[cssProp] !== undefined) {\\n cssProp = cache.registered[cssProp];\\n }\\n\\n registeredStyles.push(cssProp);\\n\\n if (props.className !== undefined) {\\n className = Object(_emotion_utils__WEBPACK_IMPORTED_MODULE_2__[\\\"getRegisteredStyles\\\"])(cache.registered, registeredStyles, props.className);\\n }\\n\\n var serialized = Object(_emotion_serialize__WEBPACK_IMPORTED_MODULE_3__[\\\"serializeStyles\\\"])(registeredStyles);\\n\\n if ( true && serialized.name.indexOf('-') === -1) {\\n var labelFromStack = props[labelPropName];\\n\\n if (labelFromStack) {\\n serialized = Object(_emotion_serialize__WEBPACK_IMPORTED_MODULE_3__[\\\"serializeStyles\\\"])([serialized, 'label:' + labelFromStack + ';']);\\n }\\n }\\n\\n var rules = Object(_emotion_utils__WEBPACK_IMPORTED_MODULE_2__[\\\"insertStyles\\\"])(cache, serialized, typeof type === 'string');\\n className += cache.key + \\\"-\\\" + serialized.name;\\n var newProps = {};\\n\\n for (var key in props) {\\n if (hasOwnProperty.call(props, key) && key !== 'css' && key !== typePropName && ( false || key !== labelPropName)) {\\n newProps[key] = props[key];\\n }\\n }\\n\\n newProps.ref = ref;\\n newProps.className = className;\\n var ele = Object(react__WEBPACK_IMPORTED_MODULE_0__[\\\"createElement\\\"])(type, newProps);\\n\\n return ele;\\n};\\n\\nvar Emotion = withEmotionCache(function (props, cache, ref) {\\n // use Context.read for the theme when it's stable\\n if (typeof props.css === 'function') {\\n return Object(react__WEBPACK_IMPORTED_MODULE_0__[\\\"createElement\\\"])(ThemeContext.Consumer, null, function (theme) {\\n return render(cache, props, theme, ref);\\n });\\n }\\n\\n return render(cache, props, null, ref);\\n}); // $FlowFixMe\\n\\nvar jsx = function jsx(type, props) {\\n var args = arguments;\\n\\n if (props == null || props.css == null) {\\n // $FlowFixMe\\n return react__WEBPACK_IMPORTED_MODULE_0__[\\\"createElement\\\"].apply(undefined, args);\\n }\\n\\n if ( true && typeof props.css === 'string' && // check if there is a css declaration\\n props.css.indexOf(':') !== -1) {\\n throw new Error(\\\"Strings are not allowed as css prop values, please wrap it in a css template literal from '@emotion/css' like this: css`\\\" + props.css + \\\"`\\\");\\n }\\n\\n var argsLength = args.length;\\n var createElementArgArray = new Array(argsLength);\\n createElementArgArray[0] = Emotion;\\n var newProps = {};\\n\\n for (var key in props) {\\n if (hasOwnProperty.call(props, key)) {\\n newProps[key] = props[key];\\n }\\n }\\n\\n newProps[typePropName] = type;\\n\\n if (true) {\\n var error = new Error();\\n\\n if (error.stack) {\\n // chrome\\n var match = error.stack.match(/at jsx.*\\\\n\\\\s+at ([A-Z][A-Za-z]+) /);\\n\\n if (!match) {\\n // safari and firefox\\n match = error.stack.match(/^.*\\\\n([A-Z][A-Za-z]+)@/);\\n }\\n\\n if (match) {\\n newProps[labelPropName] = match[1];\\n }\\n }\\n }\\n\\n createElementArgArray[1] = newProps;\\n\\n for (var i = 2; i < argsLength; i++) {\\n createElementArgArray[i] = args[i];\\n } // $FlowFixMe\\n\\n\\n return react__WEBPACK_IMPORTED_MODULE_0__[\\\"createElement\\\"].apply(null, createElementArgArray);\\n};\\n\\nvar warnedAboutCssPropForGlobal = false;\\nvar Global =\\n/* #__PURE__ */\\nwithEmotionCache(function (props, cache) {\\n if ( true && !warnedAboutCssPropForGlobal && ( // check for className as well since the user is\\n // probably using the custom createElement which\\n // means it will be turned into a className prop\\n // $FlowFixMe I don't really want to add it to the type since it shouldn't be used\\n props.className || props.css)) {\\n console.error(\\\"It looks like you're using the css prop on Global, did you mean to use the styles prop instead?\\\");\\n warnedAboutCssPropForGlobal = true;\\n }\\n\\n var styles = props.styles;\\n\\n if (typeof styles === 'function') {\\n return Object(react__WEBPACK_IMPORTED_MODULE_0__[\\\"createElement\\\"])(ThemeContext.Consumer, null, function (theme) {\\n var serialized = Object(_emotion_serialize__WEBPACK_IMPORTED_MODULE_3__[\\\"serializeStyles\\\"])([styles(theme)]);\\n return Object(react__WEBPACK_IMPORTED_MODULE_0__[\\\"createElement\\\"])(InnerGlobal, {\\n serialized: serialized,\\n cache: cache\\n });\\n });\\n }\\n\\n var serialized = Object(_emotion_serialize__WEBPACK_IMPORTED_MODULE_3__[\\\"serializeStyles\\\"])([styles]);\\n return Object(react__WEBPACK_IMPORTED_MODULE_0__[\\\"createElement\\\"])(InnerGlobal, {\\n serialized: serialized,\\n cache: cache\\n });\\n});\\n\\n// maintain place over rerenders.\\n// initial render from browser, insertBefore context.sheet.tags[0] or if a style hasn't been inserted there yet, appendChild\\n// initial client-side render from SSR, use place of hydrating tag\\nvar InnerGlobal =\\n/*#__PURE__*/\\nfunction (_React$Component) {\\n _inheritsLoose(InnerGlobal, _React$Component);\\n\\n function InnerGlobal(props, context, updater) {\\n return _React$Component.call(this, props, context, updater) || this;\\n }\\n\\n var _proto = InnerGlobal.prototype;\\n\\n _proto.componentDidMount = function componentDidMount() {\\n this.sheet = new _emotion_sheet__WEBPACK_IMPORTED_MODULE_4__[\\\"StyleSheet\\\"]({\\n key: this.props.cache.key + \\\"-global\\\",\\n nonce: this.props.cache.sheet.nonce,\\n container: this.props.cache.sheet.container\\n }); // $FlowFixMe\\n\\n var node = document.querySelector(\\\"style[data-emotion-\\\" + this.props.cache.key + \\\"=\\\\\\\"\\\" + this.props.serialized.name + \\\"\\\\\\\"]\\\");\\n\\n if (node !== null) {\\n this.sheet.tags.push(node);\\n }\\n\\n if (this.props.cache.sheet.tags.length) {\\n this.sheet.before = this.props.cache.sheet.tags[0];\\n }\\n\\n this.insertStyles();\\n };\\n\\n _proto.componentDidUpdate = function componentDidUpdate(prevProps) {\\n if (prevProps.serialized.name !== this.props.serialized.name) {\\n this.insertStyles();\\n }\\n };\\n\\n _proto.insertStyles = function insertStyles$$1() {\\n if (this.props.serialized.next !== undefined) {\\n // insert keyframes\\n Object(_emotion_utils__WEBPACK_IMPORTED_MODULE_2__[\\\"insertStyles\\\"])(this.props.cache, this.props.serialized.next, true);\\n }\\n\\n if (this.sheet.tags.length) {\\n // if this doesn't exist then it will be null so the style element will be appended\\n var element = this.sheet.tags[this.sheet.tags.length - 1].nextElementSibling;\\n this.sheet.before = element;\\n this.sheet.flush();\\n }\\n\\n this.props.cache.insert(\\\"\\\", this.props.serialized, this.sheet, false);\\n };\\n\\n _proto.componentWillUnmount = function componentWillUnmount() {\\n this.sheet.flush();\\n };\\n\\n _proto.render = function render() {\\n\\n return null;\\n };\\n\\n return InnerGlobal;\\n}(react__WEBPACK_IMPORTED_MODULE_0__[\\\"Component\\\"]);\\n\\nvar keyframes = function keyframes() {\\n var insertable = _emotion_css__WEBPACK_IMPORTED_MODULE_5__[\\\"default\\\"].apply(void 0, arguments);\\n var name = \\\"animation-\\\" + insertable.name; // $FlowFixMe\\n\\n return {\\n name: name,\\n styles: \\\"@keyframes \\\" + name + \\\"{\\\" + insertable.styles + \\\"}\\\",\\n anim: 1,\\n toString: function toString() {\\n return \\\"_EMO_\\\" + this.name + \\\"_\\\" + this.styles + \\\"_EMO_\\\";\\n }\\n };\\n};\\n\\nvar classnames = function classnames(args) {\\n var len = args.length;\\n var i = 0;\\n var cls = '';\\n\\n for (; i < len; i++) {\\n var arg = args[i];\\n if (arg == null) continue;\\n var toAdd = void 0;\\n\\n switch (typeof arg) {\\n case 'boolean':\\n break;\\n\\n case 'object':\\n {\\n if (Array.isArray(arg)) {\\n toAdd = classnames(arg);\\n } else {\\n toAdd = '';\\n\\n for (var k in arg) {\\n if (arg[k] && k) {\\n toAdd && (toAdd += ' ');\\n toAdd += k;\\n }\\n }\\n }\\n\\n break;\\n }\\n\\n default:\\n {\\n toAdd = arg;\\n }\\n }\\n\\n if (toAdd) {\\n cls && (cls += ' ');\\n cls += toAdd;\\n }\\n }\\n\\n return cls;\\n};\\n\\nfunction merge(registered, css$$1, className) {\\n var registeredStyles = [];\\n var rawClassName = Object(_emotion_utils__WEBPACK_IMPORTED_MODULE_2__[\\\"getRegisteredStyles\\\"])(registered, registeredStyles, className);\\n\\n if (registeredStyles.length < 2) {\\n return className;\\n }\\n\\n return rawClassName + css$$1(registeredStyles);\\n}\\n\\nvar ClassNames = withEmotionCache(function (props, context) {\\n return Object(react__WEBPACK_IMPORTED_MODULE_0__[\\\"createElement\\\"])(ThemeContext.Consumer, null, function (theme) {\\n var hasRendered = false;\\n\\n var css$$1 = function css$$1() {\\n if (hasRendered && \\\"development\\\" !== 'production') {\\n throw new Error('css can only be used during render');\\n }\\n\\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\\n args[_key] = arguments[_key];\\n }\\n\\n var serialized = Object(_emotion_serialize__WEBPACK_IMPORTED_MODULE_3__[\\\"serializeStyles\\\"])(args, context.registered);\\n\\n {\\n Object(_emotion_utils__WEBPACK_IMPORTED_MODULE_2__[\\\"insertStyles\\\"])(context, serialized, false);\\n }\\n\\n return context.key + \\\"-\\\" + serialized.name;\\n };\\n\\n var cx = function cx() {\\n if (hasRendered && \\\"development\\\" !== 'production') {\\n throw new Error('cx can only be used during render');\\n }\\n\\n for (var _len2 = arguments.length, args = new Array(_len2), _key2 = 0; _key2 < _len2; _key2++) {\\n args[_key2] = arguments[_key2];\\n }\\n\\n return merge(context.registered, css$$1, classnames(args));\\n };\\n\\n var content = {\\n css: css$$1,\\n cx: cx,\\n theme: theme\\n };\\n var ele = props.children(content);\\n hasRendered = true;\\n\\n return ele;\\n });\\n});\\n\\n\\n\\n\\n//# sourceURL=webpack://%5Bname%5D/./node_modules/@emotion/core/dist/core.browser.esm.js?\");\n\n/***/ }),\n\n/***/ \"./node_modules/@emotion/css/dist/css.browser.esm.js\":\n/*!***********************************************************!*\\\n !*** ./node_modules/@emotion/css/dist/css.browser.esm.js ***!\n \\***********************************************************/\n/*! exports provided: default */\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\neval(\"__webpack_require__.r(__webpack_exports__);\\n/* harmony import */ var _emotion_serialize__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @emotion/serialize */ \\\"./node_modules/@emotion/serialize/dist/serialize.browser.esm.js\\\");\\n\\n\\nfunction css() {\\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\\n args[_key] = arguments[_key];\\n }\\n\\n return Object(_emotion_serialize__WEBPACK_IMPORTED_MODULE_0__[\\\"serializeStyles\\\"])(args);\\n}\\n\\n/* harmony default export */ __webpack_exports__[\\\"default\\\"] = (css);\\n\\n\\n//# sourceURL=webpack://%5Bname%5D/./node_modules/@emotion/css/dist/css.browser.esm.js?\");\n\n/***/ }),\n\n/***/ \"./node_modules/@emotion/hash/dist/hash.browser.esm.js\":\n/*!*************************************************************!*\\\n !*** ./node_modules/@emotion/hash/dist/hash.browser.esm.js ***!\n \\*************************************************************/\n/*! exports provided: default */\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\neval(\"__webpack_require__.r(__webpack_exports__);\\n/* eslint-disable */\\n// murmurhash2 via https://github.com/garycourt/murmurhash-js/blob/master/murmurhash2_gc.js\\nfunction murmurhash2_32_gc(str) {\\n var l = str.length,\\n h = l ^ l,\\n i = 0,\\n k;\\n\\n while (l >= 4) {\\n k = str.charCodeAt(i) & 0xff | (str.charCodeAt(++i) & 0xff) << 8 | (str.charCodeAt(++i) & 0xff) << 16 | (str.charCodeAt(++i) & 0xff) << 24;\\n k = (k & 0xffff) * 0x5bd1e995 + (((k >>> 16) * 0x5bd1e995 & 0xffff) << 16);\\n k ^= k >>> 24;\\n k = (k & 0xffff) * 0x5bd1e995 + (((k >>> 16) * 0x5bd1e995 & 0xffff) << 16);\\n h = (h & 0xffff) * 0x5bd1e995 + (((h >>> 16) * 0x5bd1e995 & 0xffff) << 16) ^ k;\\n l -= 4;\\n ++i;\\n }\\n\\n switch (l) {\\n case 3:\\n h ^= (str.charCodeAt(i + 2) & 0xff) << 16;\\n\\n case 2:\\n h ^= (str.charCodeAt(i + 1) & 0xff) << 8;\\n\\n case 1:\\n h ^= str.charCodeAt(i) & 0xff;\\n h = (h & 0xffff) * 0x5bd1e995 + (((h >>> 16) * 0x5bd1e995 & 0xffff) << 16);\\n }\\n\\n h ^= h >>> 13;\\n h = (h & 0xffff) * 0x5bd1e995 + (((h >>> 16) * 0x5bd1e995 & 0xffff) << 16);\\n h ^= h >>> 15;\\n return (h >>> 0).toString(36);\\n}\\n\\n/* harmony default export */ __webpack_exports__[\\\"default\\\"] = (murmurhash2_32_gc);\\n\\n\\n//# sourceURL=webpack://%5Bname%5D/./node_modules/@emotion/hash/dist/hash.browser.esm.js?\");\n\n/***/ }),\n\n/***/ \"./node_modules/@emotion/is-prop-valid/dist/is-prop-valid.browser.esm.js\":\n/*!*******************************************************************************!*\\\n !*** ./node_modules/@emotion/is-prop-valid/dist/is-prop-valid.browser.esm.js ***!\n \\*******************************************************************************/\n/*! exports provided: default */\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\neval(\"__webpack_require__.r(__webpack_exports__);\\n/* harmony import */ var _emotion_memoize__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @emotion/memoize */ \\\"./node_modules/@emotion/memoize/dist/memoize.browser.esm.js\\\");\\n\\n\\nvar reactPropsRegex = /^((children|dangerouslySetInnerHTML|key|ref|autoFocus|defaultValue|defaultChecked|innerHTML|suppressContentEditableWarning|suppressHydrationWarning|valueLink|accept|acceptCharset|accessKey|action|allow|allowUserMedia|allowPaymentRequest|allowFullScreen|allowTransparency|alt|async|autoComplete|autoPlay|capture|cellPadding|cellSpacing|challenge|charSet|checked|cite|classID|className|cols|colSpan|content|contentEditable|contextMenu|controls|controlsList|coords|crossOrigin|data|dateTime|default|defer|dir|disabled|download|draggable|encType|form|formAction|formEncType|formMethod|formNoValidate|formTarget|frameBorder|headers|height|hidden|high|href|hrefLang|htmlFor|httpEquiv|id|inputMode|integrity|is|keyParams|keyType|kind|label|lang|list|loop|low|marginHeight|marginWidth|max|maxLength|media|mediaGroup|method|min|minLength|multiple|muted|name|nonce|noValidate|open|optimum|pattern|placeholder|playsInline|poster|preload|profile|radioGroup|readOnly|referrerPolicy|rel|required|reversed|role|rows|rowSpan|sandbox|scope|scoped|scrolling|seamless|selected|shape|size|sizes|slot|span|spellCheck|src|srcDoc|srcLang|srcSet|start|step|style|summary|tabIndex|target|title|type|useMap|value|width|wmode|wrap|about|datatype|inlist|prefix|property|resource|typeof|vocab|autoCapitalize|autoCorrect|autoSave|color|itemProp|itemScope|itemType|itemID|itemRef|results|security|unselectable|accentHeight|accumulate|additive|alignmentBaseline|allowReorder|alphabetic|amplitude|arabicForm|ascent|attributeName|attributeType|autoReverse|azimuth|baseFrequency|baselineShift|baseProfile|bbox|begin|bias|by|calcMode|capHeight|clip|clipPathUnits|clipPath|clipRule|colorInterpolation|colorInterpolationFilters|colorProfile|colorRendering|contentScriptType|contentStyleType|cursor|cx|cy|d|decelerate|descent|diffuseConstant|direction|display|divisor|dominantBaseline|dur|dx|dy|edgeMode|elevation|enableBackground|end|exponent|externalResourcesRequired|fill|fillOpacity|fillRule|filter|filterRes|filterUnits|floodColor|floodOpacity|focusable|fontFamily|fontSize|fontSizeAdjust|fontStretch|fontStyle|fontVariant|fontWeight|format|from|fr|fx|fy|g1|g2|glyphName|glyphOrientationHorizontal|glyphOrientationVertical|glyphRef|gradientTransform|gradientUnits|hanging|horizAdvX|horizOriginX|ideographic|imageRendering|in|in2|intercept|k|k1|k2|k3|k4|kernelMatrix|kernelUnitLength|kerning|keyPoints|keySplines|keyTimes|lengthAdjust|letterSpacing|lightingColor|limitingConeAngle|local|markerEnd|markerMid|markerStart|markerHeight|markerUnits|markerWidth|mask|maskContentUnits|maskUnits|mathematical|mode|numOctaves|offset|opacity|operator|order|orient|orientation|origin|overflow|overlinePosition|overlineThickness|panose1|paintOrder|pathLength|patternContentUnits|patternTransform|patternUnits|pointerEvents|points|pointsAtX|pointsAtY|pointsAtZ|preserveAlpha|preserveAspectRatio|primitiveUnits|r|radius|refX|refY|renderingIntent|repeatCount|repeatDur|requiredExtensions|requiredFeatures|restart|result|rotate|rx|ry|scale|seed|shapeRendering|slope|spacing|specularConstant|specularExponent|speed|spreadMethod|startOffset|stdDeviation|stemh|stemv|stitchTiles|stopColor|stopOpacity|strikethroughPosition|strikethroughThickness|string|stroke|strokeDasharray|strokeDashoffset|strokeLinecap|strokeLinejoin|strokeMiterlimit|strokeOpacity|strokeWidth|surfaceScale|systemLanguage|tableValues|targetX|targetY|textAnchor|textDecoration|textRendering|textLength|to|transform|u1|u2|underlinePosition|underlineThickness|unicode|unicodeBidi|unicodeRange|unitsPerEm|vAlphabetic|vHanging|vIdeographic|vMathematical|values|vectorEffect|version|vertAdvY|vertOriginX|vertOriginY|viewBox|viewTarget|visibility|widths|wordSpacing|writingMode|x|xHeight|x1|x2|xChannelSelector|xlinkActuate|xlinkArcrole|xlinkHref|xlinkRole|xlinkShow|xlinkTitle|xlinkType|xmlBase|xmlns|xmlnsXlink|xmlLang|xmlSpace|y|y1|y2|yChannelSelector|z|zoomAndPan|for|class|autofocus)|(([Dd][Aa][Tt][Aa]|[Aa][Rr][Ii][Aa]|x)-.*))$/; // https://esbench.com/bench/5bfee68a4cd7e6009ef61d23\\n\\nvar index = Object(_emotion_memoize__WEBPACK_IMPORTED_MODULE_0__[\\\"default\\\"])(function (prop) {\\n return reactPropsRegex.test(prop) || prop.charCodeAt(0) === 111\\n /* o */\\n && prop.charCodeAt(1) === 110\\n /* n */\\n && prop.charCodeAt(2) < 91;\\n}\\n/* Z+1 */\\n);\\n\\n/* harmony default export */ __webpack_exports__[\\\"default\\\"] = (index);\\n\\n\\n//# sourceURL=webpack://%5Bname%5D/./node_modules/@emotion/is-prop-valid/dist/is-prop-valid.browser.esm.js?\");\n\n/***/ }),\n\n/***/ \"./node_modules/@emotion/memoize/dist/memoize.browser.esm.js\":\n/*!*******************************************************************!*\\\n !*** ./node_modules/@emotion/memoize/dist/memoize.browser.esm.js ***!\n \\*******************************************************************/\n/*! exports provided: default */\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\neval(\"__webpack_require__.r(__webpack_exports__);\\nfunction memoize(fn) {\\n var cache = {};\\n return function (arg) {\\n if (cache[arg] === undefined) cache[arg] = fn(arg);\\n return cache[arg];\\n };\\n}\\n\\n/* harmony default export */ __webpack_exports__[\\\"default\\\"] = (memoize);\\n\\n\\n//# sourceURL=webpack://%5Bname%5D/./node_modules/@emotion/memoize/dist/memoize.browser.esm.js?\");\n\n/***/ }),\n\n/***/ \"./node_modules/@emotion/serialize/dist/serialize.browser.esm.js\":\n/*!***********************************************************************!*\\\n !*** ./node_modules/@emotion/serialize/dist/serialize.browser.esm.js ***!\n \\***********************************************************************/\n/*! exports provided: serializeStyles */\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\neval(\"__webpack_require__.r(__webpack_exports__);\\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \\\"serializeStyles\\\", function() { return serializeStyles; });\\n/* harmony import */ var _emotion_hash__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @emotion/hash */ \\\"./node_modules/@emotion/hash/dist/hash.browser.esm.js\\\");\\n/* harmony import */ var _emotion_unitless__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! @emotion/unitless */ \\\"./node_modules/@emotion/unitless/dist/unitless.browser.esm.js\\\");\\n/* harmony import */ var _emotion_memoize__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(/*! @emotion/memoize */ \\\"./node_modules/@emotion/memoize/dist/memoize.browser.esm.js\\\");\\n\\n\\n\\n\\nvar hyphenateRegex = /[A-Z]|^ms/g;\\nvar animationRegex = /_EMO_([^_]+?)_([^]*?)_EMO_/g;\\nvar processStyleName = Object(_emotion_memoize__WEBPACK_IMPORTED_MODULE_2__[\\\"default\\\"])(function (styleName) {\\n return styleName.replace(hyphenateRegex, '-$&').toLowerCase();\\n});\\n\\nvar processStyleValue = function processStyleValue(key, value) {\\n if (value == null || typeof value === 'boolean') {\\n return '';\\n }\\n\\n switch (key) {\\n case 'animation':\\n case 'animationName':\\n {\\n if (typeof value === 'string') {\\n value = value.replace(animationRegex, function (match, p1, p2) {\\n cursor = {\\n name: p1,\\n styles: p2,\\n next: cursor\\n };\\n return p1;\\n });\\n }\\n }\\n }\\n\\n if (_emotion_unitless__WEBPACK_IMPORTED_MODULE_1__[\\\"default\\\"][key] !== 1 && key.charCodeAt(1) !== 45 && // custom properties\\n typeof value === 'number' && value !== 0) {\\n return value + 'px';\\n }\\n\\n return value;\\n};\\n\\nif (true) {\\n var contentValuePattern = /(attr|calc|counters?|url)\\\\(/;\\n var contentValues = ['normal', 'none', 'counter', 'open-quote', 'close-quote', 'no-open-quote', 'no-close-quote', 'initial', 'inherit', 'unset'];\\n var oldProcessStyleValue = processStyleValue;\\n var msPattern = /^-ms-/;\\n var hyphenPattern = /-(.)/g;\\n var hyphenatedCache = {};\\n\\n processStyleValue = function processStyleValue(key, value) {\\n if (key === 'content') {\\n if (typeof value !== 'string' || contentValues.indexOf(value) === -1 && !contentValuePattern.test(value) && (value.charAt(0) !== value.charAt(value.length - 1) || value.charAt(0) !== '\\\"' && value.charAt(0) !== \\\"'\\\")) {\\n console.error(\\\"You seem to be using a value for 'content' without quotes, try replacing it with `content: '\\\\\\\"\\\" + value + \\\"\\\\\\\"'`\\\");\\n }\\n }\\n\\n if (key.charCodeAt(1) !== 45 && key.indexOf('-') !== -1 && hyphenatedCache[key] === undefined) {\\n hyphenatedCache[key] = true;\\n console.error(\\\"Using kebab-case for css properties in objects is not supported. Did you mean \\\" + key.replace(msPattern, 'ms-').replace(hyphenPattern, function (str, char) {\\n return char.toUpperCase();\\n }) + \\\"?\\\");\\n }\\n\\n return oldProcessStyleValue(key, value);\\n };\\n}\\n\\nvar shouldWarnAboutInterpolatingClassNameFromCss = true;\\n\\nfunction handleInterpolation(mergedProps, registered, interpolation, couldBeSelectorInterpolation) {\\n if (interpolation == null) {\\n return '';\\n }\\n\\n if (interpolation.__emotion_styles !== undefined) {\\n if ( true && interpolation.toString() === 'NO_COMPONENT_SELECTOR') {\\n throw new Error('Component selectors can only be used in conjunction with babel-plugin-emotion.');\\n }\\n\\n return interpolation;\\n }\\n\\n switch (typeof interpolation) {\\n case 'boolean':\\n {\\n return '';\\n }\\n\\n case 'object':\\n {\\n if (interpolation.anim === 1) {\\n cursor = {\\n name: interpolation.name,\\n styles: interpolation.styles,\\n next: cursor\\n };\\n return interpolation.name;\\n }\\n\\n if (interpolation.styles !== undefined) {\\n var next = interpolation.next;\\n\\n if (next !== undefined) {\\n // not the most efficient thing ever but this is a pretty rare case\\n // and there will be very few iterations of this generally\\n while (next !== undefined) {\\n cursor = {\\n name: next.name,\\n styles: next.styles,\\n next: cursor\\n };\\n next = next.next;\\n }\\n }\\n\\n var styles = interpolation.styles;\\n\\n if ( true && interpolation.map !== undefined) {\\n styles += interpolation.map;\\n }\\n\\n return styles;\\n }\\n\\n return createStringFromObject(mergedProps, registered, interpolation);\\n }\\n\\n case 'function':\\n {\\n if (mergedProps !== undefined) {\\n var previousCursor = cursor;\\n var result = interpolation(mergedProps);\\n cursor = previousCursor;\\n return handleInterpolation(mergedProps, registered, result, couldBeSelectorInterpolation);\\n } else if (true) {\\n console.error('Functions that are interpolated in css calls will be stringified.\\\\n' + 'If you want to have a css call based on props, create a function that returns a css call like this\\\\n' + 'let dynamicStyle = (props) => css`color: ${props.color}`\\\\n' + 'It can be called directly with props or interpolated in a styled call like this\\\\n' + \\\"let SomeComponent = styled('div')`${dynamicStyle}`\\\");\\n }\\n }\\n // eslint-disable-next-line no-fallthrough\\n\\n default:\\n {\\n if (registered == null) {\\n return interpolation;\\n }\\n\\n var cached = registered[interpolation];\\n\\n if ( true && couldBeSelectorInterpolation && shouldWarnAboutInterpolatingClassNameFromCss && cached !== undefined) {\\n console.error('Interpolating a className from css`` is not recommended and will cause problems with composition.\\\\n' + 'Interpolating a className from css`` will be completely unsupported in a future major version of Emotion');\\n shouldWarnAboutInterpolatingClassNameFromCss = false;\\n }\\n\\n return cached !== undefined && !couldBeSelectorInterpolation ? cached : interpolation;\\n }\\n }\\n}\\n\\nfunction createStringFromObject(mergedProps, registered, obj) {\\n var string = '';\\n\\n if (Array.isArray(obj)) {\\n for (var i = 0; i < obj.length; i++) {\\n string += handleInterpolation(mergedProps, registered, obj[i], false);\\n }\\n } else {\\n for (var _key in obj) {\\n var value = obj[_key];\\n\\n if (typeof value !== 'object') {\\n if (registered != null && registered[value] !== undefined) {\\n string += _key + \\\"{\\\" + registered[value] + \\\"}\\\";\\n } else {\\n string += processStyleName(_key) + \\\":\\\" + processStyleValue(_key, value) + \\\";\\\";\\n }\\n } else {\\n if (_key === 'NO_COMPONENT_SELECTOR' && \\\"development\\\" !== 'production') {\\n throw new Error('Component selectors can only be used in conjunction with babel-plugin-emotion.');\\n }\\n\\n if (Array.isArray(value) && typeof value[0] === 'string' && (registered == null || registered[value[0]] === undefined)) {\\n for (var _i = 0; _i < value.length; _i++) {\\n string += processStyleName(_key) + \\\":\\\" + processStyleValue(_key, value[_i]) + \\\";\\\";\\n }\\n } else {\\n string += _key + \\\"{\\\" + handleInterpolation(mergedProps, registered, value, false) + \\\"}\\\";\\n }\\n }\\n }\\n }\\n\\n return string;\\n}\\n\\nvar labelPattern = /label:\\\\s*([^\\\\s;\\\\n{]+)\\\\s*;/g;\\nvar sourceMapPattern;\\n\\nif (true) {\\n sourceMapPattern = /\\\\/\\\\*#\\\\ssourceMappingURL=data:application\\\\/json;\\\\S+\\\\s+\\\\*\\\\//;\\n} // this is the cursor for keyframes\\n// keyframes are stored on the SerializedStyles object as a linked list\\n\\n\\nvar cursor;\\nvar serializeStyles = function serializeStyles(args, registered, mergedProps) {\\n if (args.length === 1 && typeof args[0] === 'object' && args[0] !== null && args[0].styles !== undefined) {\\n return args[0];\\n }\\n\\n var stringMode = true;\\n var styles = '';\\n cursor = undefined;\\n var strings = args[0];\\n\\n if (strings == null || strings.raw === undefined) {\\n stringMode = false;\\n styles += handleInterpolation(mergedProps, registered, strings, false);\\n } else {\\n styles += strings[0];\\n } // we start at 1 since we've already handled the first arg\\n\\n\\n for (var i = 1; i < args.length; i++) {\\n styles += handleInterpolation(mergedProps, registered, args[i], styles.charCodeAt(styles.length - 1) === 46);\\n\\n if (stringMode) {\\n styles += strings[i];\\n }\\n }\\n\\n var sourceMap;\\n\\n if (true) {\\n styles = styles.replace(sourceMapPattern, function (match) {\\n sourceMap = match;\\n return '';\\n });\\n } // using a global regex with .exec is stateful so lastIndex has to be reset each time\\n\\n\\n labelPattern.lastIndex = 0;\\n var identifierName = '';\\n var match; // https://esbench.com/bench/5b809c2cf2949800a0f61fb5\\n\\n while ((match = labelPattern.exec(styles)) !== null) {\\n identifierName += '-' + // $FlowFixMe we know it's not null\\n match[1];\\n }\\n\\n var name = Object(_emotion_hash__WEBPACK_IMPORTED_MODULE_0__[\\\"default\\\"])(styles) + identifierName;\\n\\n if (true) {\\n return {\\n name: name,\\n styles: styles,\\n map: sourceMap,\\n next: cursor\\n };\\n }\\n\\n return {\\n name: name,\\n styles: styles,\\n next: cursor\\n };\\n};\\n\\n\\n\\n\\n//# sourceURL=webpack://%5Bname%5D/./node_modules/@emotion/serialize/dist/serialize.browser.esm.js?\");\n\n/***/ }),\n\n/***/ \"./node_modules/@emotion/sheet/dist/sheet.browser.esm.js\":\n/*!***************************************************************!*\\\n !*** ./node_modules/@emotion/sheet/dist/sheet.browser.esm.js ***!\n \\***************************************************************/\n/*! exports provided: StyleSheet */\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\neval(\"__webpack_require__.r(__webpack_exports__);\\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \\\"StyleSheet\\\", function() { return StyleSheet; });\\n/*\\n\\nBased off glamor's StyleSheet, thanks Sunil ❤️\\n\\nhigh performance StyleSheet for css-in-js systems\\n\\n- uses multiple style tags behind the scenes for millions of rules\\n- uses `insertRule` for appending in production for *much* faster performance\\n\\n// usage\\n\\nimport { StyleSheet } from '@emotion/sheet'\\n\\nlet styleSheet = new StyleSheet({ key: '', container: document.head })\\n\\nstyleSheet.insert('#box { border: 1px solid red; }')\\n- appends a css rule into the stylesheet\\n\\nstyleSheet.flush()\\n- empties the stylesheet of all its contents\\n\\n*/\\n// $FlowFixMe\\nfunction sheetForTag(tag) {\\n if (tag.sheet) {\\n // $FlowFixMe\\n return tag.sheet;\\n } // this weirdness brought to you by firefox\\n\\n /* istanbul ignore next */\\n\\n\\n for (var i = 0; i < document.styleSheets.length; i++) {\\n if (document.styleSheets[i].ownerNode === tag) {\\n // $FlowFixMe\\n return document.styleSheets[i];\\n }\\n }\\n}\\n\\nfunction createStyleElement(options) {\\n var tag = document.createElement('style');\\n tag.setAttribute('data-emotion', options.key);\\n\\n if (options.nonce !== undefined) {\\n tag.setAttribute('nonce', options.nonce);\\n }\\n\\n tag.appendChild(document.createTextNode(''));\\n return tag;\\n}\\n\\nvar StyleSheet =\\n/*#__PURE__*/\\nfunction () {\\n function StyleSheet(options) {\\n this.isSpeedy = options.speedy === undefined ? \\\"development\\\" === 'production' : options.speedy;\\n this.tags = [];\\n this.ctr = 0;\\n this.nonce = options.nonce; // key is the value of the data-emotion attribute, it's used to identify different sheets\\n\\n this.key = options.key;\\n this.container = options.container;\\n this.before = null;\\n }\\n\\n var _proto = StyleSheet.prototype;\\n\\n _proto.insert = function insert(rule) {\\n // the max length is how many rules we have per style tag, it's 65000 in speedy mode\\n // it's 1 in dev because we insert source maps that map a single rule to a location\\n // and you can only have one source map per style tag\\n if (this.ctr % (this.isSpeedy ? 65000 : 1) === 0) {\\n var _tag = createStyleElement(this);\\n\\n var before;\\n\\n if (this.tags.length === 0) {\\n before = this.before;\\n } else {\\n before = this.tags[this.tags.length - 1].nextSibling;\\n }\\n\\n this.container.insertBefore(_tag, before);\\n this.tags.push(_tag);\\n }\\n\\n var tag = this.tags[this.tags.length - 1];\\n\\n if (this.isSpeedy) {\\n var sheet = sheetForTag(tag);\\n\\n try {\\n // this is a really hot path\\n // we check the second character first because having \\\"i\\\"\\n // as the second character will happen less often than\\n // having \\\"@\\\" as the first character\\n var isImportRule = rule.charCodeAt(1) === 105 && rule.charCodeAt(0) === 64; // this is the ultrafast version, works across browsers\\n // the big drawback is that the css won't be editable in devtools\\n\\n sheet.insertRule(rule, // we need to insert @import rules before anything else\\n // otherwise there will be an error\\n // technically this means that the @import rules will\\n // _usually_(not always since there could be multiple style tags)\\n // be the first ones in prod and generally later in dev\\n // this shouldn't really matter in the real world though\\n // @import is generally only used for font faces from google fonts and etc.\\n // so while this could be technically correct then it would be slower and larger\\n // for a tiny bit of correctness that won't matter in the real world\\n isImportRule ? 0 : sheet.cssRules.length);\\n } catch (e) {\\n if (true) {\\n console.warn(\\\"There was a problem inserting the following rule: \\\\\\\"\\\" + rule + \\\"\\\\\\\"\\\", e);\\n }\\n }\\n } else {\\n tag.appendChild(document.createTextNode(rule));\\n }\\n\\n this.ctr++;\\n };\\n\\n _proto.flush = function flush() {\\n // $FlowFixMe\\n this.tags.forEach(function (tag) {\\n return tag.parentNode.removeChild(tag);\\n });\\n this.tags = [];\\n this.ctr = 0;\\n };\\n\\n return StyleSheet;\\n}();\\n\\n\\n\\n\\n//# sourceURL=webpack://%5Bname%5D/./node_modules/@emotion/sheet/dist/sheet.browser.esm.js?\");\n\n/***/ }),\n\n/***/ \"./node_modules/@emotion/styled-base/dist/styled-base.browser.esm.js\":\n/*!***************************************************************************!*\\\n !*** ./node_modules/@emotion/styled-base/dist/styled-base.browser.esm.js ***!\n \\***************************************************************************/\n/*! exports provided: default */\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\neval(\"__webpack_require__.r(__webpack_exports__);\\n/* harmony import */ var react__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! react */ \\\"./node_modules/react/index.js\\\");\\n/* harmony import */ var react__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(react__WEBPACK_IMPORTED_MODULE_0__);\\n/* harmony import */ var _emotion_is_prop_valid__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! @emotion/is-prop-valid */ \\\"./node_modules/@emotion/is-prop-valid/dist/is-prop-valid.browser.esm.js\\\");\\n/* harmony import */ var object_assign__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(/*! object-assign */ \\\"./node_modules/object-assign/index.js\\\");\\n/* harmony import */ var object_assign__WEBPACK_IMPORTED_MODULE_2___default = /*#__PURE__*/__webpack_require__.n(object_assign__WEBPACK_IMPORTED_MODULE_2__);\\n/* harmony import */ var _emotion_core__WEBPACK_IMPORTED_MODULE_3__ = __webpack_require__(/*! @emotion/core */ \\\"./node_modules/@emotion/core/dist/core.browser.esm.js\\\");\\n/* harmony import */ var _emotion_utils__WEBPACK_IMPORTED_MODULE_4__ = __webpack_require__(/*! @emotion/utils */ \\\"./node_modules/@emotion/utils/dist/utils.browser.esm.js\\\");\\n/* harmony import */ var _emotion_serialize__WEBPACK_IMPORTED_MODULE_5__ = __webpack_require__(/*! @emotion/serialize */ \\\"./node_modules/@emotion/serialize/dist/serialize.browser.esm.js\\\");\\n\\n\\n\\n\\n\\n\\n\\nvar testOmitPropsOnStringTag = _emotion_is_prop_valid__WEBPACK_IMPORTED_MODULE_1__[\\\"default\\\"];\\n\\nvar testOmitPropsOnComponent = function testOmitPropsOnComponent(key) {\\n return key !== 'theme' && key !== 'innerRef';\\n};\\n\\nvar getDefaultShouldForwardProp = function getDefaultShouldForwardProp(tag) {\\n return typeof tag === 'string' && // 96 is one less than the char code\\n // for \\\"a\\\" so this is checking that\\n // it's a lowercase character\\n tag.charCodeAt(0) > 96 ? testOmitPropsOnStringTag : testOmitPropsOnComponent;\\n};\\n\\nvar createStyled = function createStyled(tag, options) {\\n if (true) {\\n if (tag === undefined) {\\n throw new Error('You are trying to create a styled element with an undefined component.\\\\nYou may have forgotten to import it.');\\n }\\n }\\n\\n var identifierName;\\n var shouldForwardProp;\\n var targetClassName;\\n\\n if (options !== undefined) {\\n identifierName = options.label;\\n targetClassName = options.target;\\n shouldForwardProp = tag.__emotion_forwardProp && options.shouldForwardProp ? function (propName) {\\n return tag.__emotion_forwardProp(propName) && // $FlowFixMe\\n options.shouldForwardProp(propName);\\n } : options.shouldForwardProp;\\n }\\n\\n var isReal = tag.__emotion_real === tag;\\n var baseTag = isReal && tag.__emotion_base || tag;\\n\\n if (typeof shouldForwardProp !== 'function' && isReal) {\\n shouldForwardProp = tag.__emotion_forwardProp;\\n }\\n\\n var defaultShouldForwardProp = shouldForwardProp || getDefaultShouldForwardProp(baseTag);\\n var shouldUseAs = !defaultShouldForwardProp('as');\\n return function () {\\n var args = arguments;\\n var styles = isReal && tag.__emotion_styles !== undefined ? tag.__emotion_styles.slice(0) : [];\\n\\n if (identifierName !== undefined) {\\n styles.push(\\\"label:\\\" + identifierName + \\\";\\\");\\n }\\n\\n if (args[0] == null || args[0].raw === undefined) {\\n styles.push.apply(styles, args);\\n } else {\\n styles.push(args[0][0]);\\n var len = args.length;\\n var i = 1;\\n\\n for (; i < len; i++) {\\n styles.push(args[i], args[0][i]);\\n }\\n }\\n\\n var Styled = Object(_emotion_core__WEBPACK_IMPORTED_MODULE_3__[\\\"withEmotionCache\\\"])(function (props, context, ref) {\\n return Object(react__WEBPACK_IMPORTED_MODULE_0__[\\\"createElement\\\"])(_emotion_core__WEBPACK_IMPORTED_MODULE_3__[\\\"ThemeContext\\\"].Consumer, null, function (theme) {\\n var finalTag = shouldUseAs && props.as || baseTag;\\n var className = '';\\n var classInterpolations = [];\\n var mergedProps = props;\\n\\n if (props.theme == null) {\\n mergedProps = {};\\n\\n for (var key in props) {\\n mergedProps[key] = props[key];\\n }\\n\\n mergedProps.theme = theme;\\n }\\n\\n if (typeof props.className === 'string') {\\n className += Object(_emotion_utils__WEBPACK_IMPORTED_MODULE_4__[\\\"getRegisteredStyles\\\"])(context.registered, classInterpolations, props.className);\\n }\\n\\n var serialized = Object(_emotion_serialize__WEBPACK_IMPORTED_MODULE_5__[\\\"serializeStyles\\\"])(styles.concat(classInterpolations), context.registered, mergedProps);\\n var rules = Object(_emotion_utils__WEBPACK_IMPORTED_MODULE_4__[\\\"insertStyles\\\"])(context, serialized, typeof finalTag === 'string');\\n className += context.key + \\\"-\\\" + serialized.name;\\n\\n if (targetClassName !== undefined) {\\n className += \\\" \\\" + targetClassName;\\n }\\n\\n var finalShouldForwardProp = shouldUseAs && shouldForwardProp === undefined ? getDefaultShouldForwardProp(finalTag) : defaultShouldForwardProp;\\n var newProps = {};\\n\\n for (var _key in props) {\\n if (shouldUseAs && _key === 'as') continue;\\n\\n if ( // $FlowFixMe\\n finalShouldForwardProp(_key)) {\\n newProps[_key] = props[_key];\\n }\\n }\\n\\n newProps.className = className;\\n newProps.ref = ref || props.innerRef;\\n\\n if ( true && props.innerRef) {\\n console.error('`innerRef` is deprecated and will be removed in a future major version of Emotion, please use the `ref` prop instead' + (identifierName === undefined ? '' : \\\" in the usage of `\\\" + identifierName + \\\"`\\\"));\\n }\\n\\n var ele = Object(react__WEBPACK_IMPORTED_MODULE_0__[\\\"createElement\\\"])(finalTag, newProps);\\n\\n return ele;\\n });\\n });\\n Styled.displayName = identifierName !== undefined ? identifierName : \\\"Styled(\\\" + (typeof baseTag === 'string' ? baseTag : baseTag.displayName || baseTag.name || 'Component') + \\\")\\\";\\n Styled.defaultProps = tag.defaultProps;\\n Styled.__emotion_real = Styled;\\n Styled.__emotion_base = baseTag;\\n Styled.__emotion_styles = styles;\\n Styled.__emotion_forwardProp = shouldForwardProp;\\n Object.defineProperty(Styled, 'toString', {\\n value: function value() {\\n if (targetClassName === undefined && \\\"development\\\" !== 'production') {\\n return 'NO_COMPONENT_SELECTOR';\\n } // $FlowFixMe\\n\\n\\n return \\\".\\\" + targetClassName;\\n }\\n });\\n\\n Styled.withComponent = function (nextTag, nextOptions) {\\n return createStyled(nextTag, nextOptions !== undefined ? object_assign__WEBPACK_IMPORTED_MODULE_2___default()({}, options || {}, nextOptions) : options).apply(void 0, styles);\\n };\\n\\n return Styled;\\n };\\n};\\n\\n/* harmony default export */ __webpack_exports__[\\\"default\\\"] = (createStyled);\\n\\n\\n//# sourceURL=webpack://%5Bname%5D/./node_modules/@emotion/styled-base/dist/styled-base.browser.esm.js?\");\n\n/***/ }),\n\n/***/ \"./node_modules/@emotion/styled/dist/styled.browser.esm.js\":\n/*!*****************************************************************!*\\\n !*** ./node_modules/@emotion/styled/dist/styled.browser.esm.js ***!\n \\*****************************************************************/\n/*! exports provided: default */\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\neval(\"__webpack_require__.r(__webpack_exports__);\\n/* harmony import */ var _emotion_styled_base__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @emotion/styled-base */ \\\"./node_modules/@emotion/styled-base/dist/styled-base.browser.esm.js\\\");\\n\\n\\nvar tags = ['a', 'abbr', 'address', 'area', 'article', 'aside', 'audio', 'b', 'base', 'bdi', 'bdo', 'big', 'blockquote', 'body', 'br', 'button', 'canvas', 'caption', 'cite', 'code', 'col', 'colgroup', 'data', 'datalist', 'dd', 'del', 'details', 'dfn', 'dialog', 'div', 'dl', 'dt', 'em', 'embed', 'fieldset', 'figcaption', 'figure', 'footer', 'form', 'h1', 'h2', 'h3', 'h4', 'h5', 'h6', 'head', 'header', 'hgroup', 'hr', 'html', 'i', 'iframe', 'img', 'input', 'ins', 'kbd', 'keygen', 'label', 'legend', 'li', 'link', 'main', 'map', 'mark', 'marquee', 'menu', 'menuitem', 'meta', 'meter', 'nav', 'noscript', 'object', 'ol', 'optgroup', 'option', 'output', 'p', 'param', 'picture', 'pre', 'progress', 'q', 'rp', 'rt', 'ruby', 's', 'samp', 'script', 'section', 'select', 'small', 'source', 'span', 'strong', 'style', 'sub', 'summary', 'sup', 'table', 'tbody', 'td', 'textarea', 'tfoot', 'th', 'thead', 'time', 'title', 'tr', 'track', 'u', 'ul', 'var', 'video', 'wbr', // SVG\\n'circle', 'clipPath', 'defs', 'ellipse', 'foreignObject', 'g', 'image', 'line', 'linearGradient', 'mask', 'path', 'pattern', 'polygon', 'polyline', 'radialGradient', 'rect', 'stop', 'svg', 'text', 'tspan'];\\n\\nvar newStyled = _emotion_styled_base__WEBPACK_IMPORTED_MODULE_0__[\\\"default\\\"].bind();\\ntags.forEach(function (tagName) {\\n newStyled[tagName] = newStyled(tagName);\\n});\\n\\n/* harmony default export */ __webpack_exports__[\\\"default\\\"] = (newStyled);\\n\\n\\n//# sourceURL=webpack://%5Bname%5D/./node_modules/@emotion/styled/dist/styled.browser.esm.js?\");\n\n/***/ }),\n\n/***/ \"./node_modules/@emotion/stylis/dist/stylis.browser.esm.js\":\n/*!*****************************************************************!*\\\n !*** ./node_modules/@emotion/stylis/dist/stylis.browser.esm.js ***!\n \\*****************************************************************/\n/*! exports provided: default */\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\neval(\"__webpack_require__.r(__webpack_exports__);\\nfunction stylis_min (W) {\\n function M(d, c, e, h, a) {\\n for (var m = 0, b = 0, v = 0, n = 0, q, g, x = 0, K = 0, k, u = k = q = 0, l = 0, r = 0, I = 0, t = 0, B = e.length, J = B - 1, y, f = '', p = '', F = '', G = '', C; l < B;) {\\n g = e.charCodeAt(l);\\n l === J && 0 !== b + n + v + m && (0 !== b && (g = 47 === b ? 10 : 47), n = v = m = 0, B++, J++);\\n\\n if (0 === b + n + v + m) {\\n if (l === J && (0 < r && (f = f.replace(N, '')), 0 < f.trim().length)) {\\n switch (g) {\\n case 32:\\n case 9:\\n case 59:\\n case 13:\\n case 10:\\n break;\\n\\n default:\\n f += e.charAt(l);\\n }\\n\\n g = 59;\\n }\\n\\n switch (g) {\\n case 123:\\n f = f.trim();\\n q = f.charCodeAt(0);\\n k = 1;\\n\\n for (t = ++l; l < B;) {\\n switch (g = e.charCodeAt(l)) {\\n case 123:\\n k++;\\n break;\\n\\n case 125:\\n k--;\\n break;\\n\\n case 47:\\n switch (g = e.charCodeAt(l + 1)) {\\n case 42:\\n case 47:\\n a: {\\n for (u = l + 1; u < J; ++u) {\\n switch (e.charCodeAt(u)) {\\n case 47:\\n if (42 === g && 42 === e.charCodeAt(u - 1) && l + 2 !== u) {\\n l = u + 1;\\n break a;\\n }\\n\\n break;\\n\\n case 10:\\n if (47 === g) {\\n l = u + 1;\\n break a;\\n }\\n\\n }\\n }\\n\\n l = u;\\n }\\n\\n }\\n\\n break;\\n\\n case 91:\\n g++;\\n\\n case 40:\\n g++;\\n\\n case 34:\\n case 39:\\n for (; l++ < J && e.charCodeAt(l) !== g;) {\\n }\\n\\n }\\n\\n if (0 === k) break;\\n l++;\\n }\\n\\n k = e.substring(t, l);\\n 0 === q && (q = (f = f.replace(ca, '').trim()).charCodeAt(0));\\n\\n switch (q) {\\n case 64:\\n 0 < r && (f = f.replace(N, ''));\\n g = f.charCodeAt(1);\\n\\n switch (g) {\\n case 100:\\n case 109:\\n case 115:\\n case 45:\\n r = c;\\n break;\\n\\n default:\\n r = O;\\n }\\n\\n k = M(c, r, k, g, a + 1);\\n t = k.length;\\n 0 < A && (r = X(O, f, I), C = H(3, k, r, c, D, z, t, g, a, h), f = r.join(''), void 0 !== C && 0 === (t = (k = C.trim()).length) && (g = 0, k = ''));\\n if (0 < t) switch (g) {\\n case 115:\\n f = f.replace(da, ea);\\n\\n case 100:\\n case 109:\\n case 45:\\n k = f + '{' + k + '}';\\n break;\\n\\n case 107:\\n f = f.replace(fa, '$1 $2');\\n k = f + '{' + k + '}';\\n k = 1 === w || 2 === w && L('@' + k, 3) ? '@-webkit-' + k + '@' + k : '@' + k;\\n break;\\n\\n default:\\n k = f + k, 112 === h && (k = (p += k, ''));\\n } else k = '';\\n break;\\n\\n default:\\n k = M(c, X(c, f, I), k, h, a + 1);\\n }\\n\\n F += k;\\n k = I = r = u = q = 0;\\n f = '';\\n g = e.charCodeAt(++l);\\n break;\\n\\n case 125:\\n case 59:\\n f = (0 < r ? f.replace(N, '') : f).trim();\\n if (1 < (t = f.length)) switch (0 === u && (q = f.charCodeAt(0), 45 === q || 96 < q && 123 > q) && (t = (f = f.replace(' ', ':')).length), 0 < A && void 0 !== (C = H(1, f, c, d, D, z, p.length, h, a, h)) && 0 === (t = (f = C.trim()).length) && (f = '\\\\x00\\\\x00'), q = f.charCodeAt(0), g = f.charCodeAt(1), q) {\\n case 0:\\n break;\\n\\n case 64:\\n if (105 === g || 99 === g) {\\n G += f + e.charAt(l);\\n break;\\n }\\n\\n default:\\n 58 !== f.charCodeAt(t - 1) && (p += P(f, q, g, f.charCodeAt(2)));\\n }\\n I = r = u = q = 0;\\n f = '';\\n g = e.charCodeAt(++l);\\n }\\n }\\n\\n switch (g) {\\n case 13:\\n case 10:\\n 47 === b ? b = 0 : 0 === 1 + q && 107 !== h && 0 < f.length && (r = 1, f += '\\\\x00');\\n 0 < A * Y && H(0, f, c, d, D, z, p.length, h, a, h);\\n z = 1;\\n D++;\\n break;\\n\\n case 59:\\n case 125:\\n if (0 === b + n + v + m) {\\n z++;\\n break;\\n }\\n\\n default:\\n z++;\\n y = e.charAt(l);\\n\\n switch (g) {\\n case 9:\\n case 32:\\n if (0 === n + m + b) switch (x) {\\n case 44:\\n case 58:\\n case 9:\\n case 32:\\n y = '';\\n break;\\n\\n default:\\n 32 !== g && (y = ' ');\\n }\\n break;\\n\\n case 0:\\n y = '\\\\\\\\0';\\n break;\\n\\n case 12:\\n y = '\\\\\\\\f';\\n break;\\n\\n case 11:\\n y = '\\\\\\\\v';\\n break;\\n\\n case 38:\\n 0 === n + b + m && (r = I = 1, y = '\\\\f' + y);\\n break;\\n\\n case 108:\\n if (0 === n + b + m + E && 0 < u) switch (l - u) {\\n case 2:\\n 112 === x && 58 === e.charCodeAt(l - 3) && (E = x);\\n\\n case 8:\\n 111 === K && (E = K);\\n }\\n break;\\n\\n case 58:\\n 0 === n + b + m && (u = l);\\n break;\\n\\n case 44:\\n 0 === b + v + n + m && (r = 1, y += '\\\\r');\\n break;\\n\\n case 34:\\n case 39:\\n 0 === b && (n = n === g ? 0 : 0 === n ? g : n);\\n break;\\n\\n case 91:\\n 0 === n + b + v && m++;\\n break;\\n\\n case 93:\\n 0 === n + b + v && m--;\\n break;\\n\\n case 41:\\n 0 === n + b + m && v--;\\n break;\\n\\n case 40:\\n if (0 === n + b + m) {\\n if (0 === q) switch (2 * x + 3 * K) {\\n case 533:\\n break;\\n\\n default:\\n q = 1;\\n }\\n v++;\\n }\\n\\n break;\\n\\n case 64:\\n 0 === b + v + n + m + u + k && (k = 1);\\n break;\\n\\n case 42:\\n case 47:\\n if (!(0 < n + m + v)) switch (b) {\\n case 0:\\n switch (2 * g + 3 * e.charCodeAt(l + 1)) {\\n case 235:\\n b = 47;\\n break;\\n\\n case 220:\\n t = l, b = 42;\\n }\\n\\n break;\\n\\n case 42:\\n 47 === g && 42 === x && t + 2 !== l && (33 === e.charCodeAt(t + 2) && (p += e.substring(t, l + 1)), y = '', b = 0);\\n }\\n }\\n\\n 0 === b && (f += y);\\n }\\n\\n K = x;\\n x = g;\\n l++;\\n }\\n\\n t = p.length;\\n\\n if (0 < t) {\\n r = c;\\n if (0 < A && (C = H(2, p, r, d, D, z, t, h, a, h), void 0 !== C && 0 === (p = C).length)) return G + p + F;\\n p = r.join(',') + '{' + p + '}';\\n\\n if (0 !== w * E) {\\n 2 !== w || L(p, 2) || (E = 0);\\n\\n switch (E) {\\n case 111:\\n p = p.replace(ha, ':-moz-$1') + p;\\n break;\\n\\n case 112:\\n p = p.replace(Q, '::-webkit-input-$1') + p.replace(Q, '::-moz-$1') + p.replace(Q, ':-ms-input-$1') + p;\\n }\\n\\n E = 0;\\n }\\n }\\n\\n return G + p + F;\\n }\\n\\n function X(d, c, e) {\\n var h = c.trim().split(ia);\\n c = h;\\n var a = h.length,\\n m = d.length;\\n\\n switch (m) {\\n case 0:\\n case 1:\\n var b = 0;\\n\\n for (d = 0 === m ? '' : d[0] + ' '; b < a; ++b) {\\n c[b] = Z(d, c[b], e, m).trim();\\n }\\n\\n break;\\n\\n default:\\n var v = b = 0;\\n\\n for (c = []; b < a; ++b) {\\n for (var n = 0; n < m; ++n) {\\n c[v++] = Z(d[n] + ' ', h[b], e, m).trim();\\n }\\n }\\n\\n }\\n\\n return c;\\n }\\n\\n function Z(d, c, e) {\\n var h = c.charCodeAt(0);\\n 33 > h && (h = (c = c.trim()).charCodeAt(0));\\n\\n switch (h) {\\n case 38:\\n return c.replace(F, '$1' + d.trim());\\n\\n case 58:\\n return d.trim() + c.replace(F, '$1' + d.trim());\\n\\n default:\\n if (0 < 1 * e && 0 < c.indexOf('\\\\f')) return c.replace(F, (58 === d.charCodeAt(0) ? '' : '$1') + d.trim());\\n }\\n\\n return d + c;\\n }\\n\\n function P(d, c, e, h) {\\n var a = d + ';',\\n m = 2 * c + 3 * e + 4 * h;\\n\\n if (944 === m) {\\n d = a.indexOf(':', 9) + 1;\\n var b = a.substring(d, a.length - 1).trim();\\n b = a.substring(0, d).trim() + b + ';';\\n return 1 === w || 2 === w && L(b, 1) ? '-webkit-' + b + b : b;\\n }\\n\\n if (0 === w || 2 === w && !L(a, 1)) return a;\\n\\n switch (m) {\\n case 1015:\\n return 97 === a.charCodeAt(10) ? '-webkit-' + a + a : a;\\n\\n case 951:\\n return 116 === a.charCodeAt(3) ? '-webkit-' + a + a : a;\\n\\n case 963:\\n return 110 === a.charCodeAt(5) ? '-webkit-' + a + a : a;\\n\\n case 1009:\\n if (100 !== a.charCodeAt(4)) break;\\n\\n case 969:\\n case 942:\\n return '-webkit-' + a + a;\\n\\n case 978:\\n return '-webkit-' + a + '-moz-' + a + a;\\n\\n case 1019:\\n case 983:\\n return '-webkit-' + a + '-moz-' + a + '-ms-' + a + a;\\n\\n case 883:\\n if (45 === a.charCodeAt(8)) return '-webkit-' + a + a;\\n if (0 < a.indexOf('image-set(', 11)) return a.replace(ja, '$1-webkit-$2') + a;\\n break;\\n\\n case 932:\\n if (45 === a.charCodeAt(4)) switch (a.charCodeAt(5)) {\\n case 103:\\n return '-webkit-box-' + a.replace('-grow', '') + '-webkit-' + a + '-ms-' + a.replace('grow', 'positive') + a;\\n\\n case 115:\\n return '-webkit-' + a + '-ms-' + a.replace('shrink', 'negative') + a;\\n\\n case 98:\\n return '-webkit-' + a + '-ms-' + a.replace('basis', 'preferred-size') + a;\\n }\\n return '-webkit-' + a + '-ms-' + a + a;\\n\\n case 964:\\n return '-webkit-' + a + '-ms-flex-' + a + a;\\n\\n case 1023:\\n if (99 !== a.charCodeAt(8)) break;\\n b = a.substring(a.indexOf(':', 15)).replace('flex-', '').replace('space-between', 'justify');\\n return '-webkit-box-pack' + b + '-webkit-' + a + '-ms-flex-pack' + b + a;\\n\\n case 1005:\\n return ka.test(a) ? a.replace(aa, ':-webkit-') + a.replace(aa, ':-moz-') + a : a;\\n\\n case 1e3:\\n b = a.substring(13).trim();\\n c = b.indexOf('-') + 1;\\n\\n switch (b.charCodeAt(0) + b.charCodeAt(c)) {\\n case 226:\\n b = a.replace(G, 'tb');\\n break;\\n\\n case 232:\\n b = a.replace(G, 'tb-rl');\\n break;\\n\\n case 220:\\n b = a.replace(G, 'lr');\\n break;\\n\\n default:\\n return a;\\n }\\n\\n return '-webkit-' + a + '-ms-' + b + a;\\n\\n case 1017:\\n if (-1 === a.indexOf('sticky', 9)) break;\\n\\n case 975:\\n c = (a = d).length - 10;\\n b = (33 === a.charCodeAt(c) ? a.substring(0, c) : a).substring(d.indexOf(':', 7) + 1).trim();\\n\\n switch (m = b.charCodeAt(0) + (b.charCodeAt(7) | 0)) {\\n case 203:\\n if (111 > b.charCodeAt(8)) break;\\n\\n case 115:\\n a = a.replace(b, '-webkit-' + b) + ';' + a;\\n break;\\n\\n case 207:\\n case 102:\\n a = a.replace(b, '-webkit-' + (102 < m ? 'inline-' : '') + 'box') + ';' + a.replace(b, '-webkit-' + b) + ';' + a.replace(b, '-ms-' + b + 'box') + ';' + a;\\n }\\n\\n return a + ';';\\n\\n case 938:\\n if (45 === a.charCodeAt(5)) switch (a.charCodeAt(6)) {\\n case 105:\\n return b = a.replace('-items', ''), '-webkit-' + a + '-webkit-box-' + b + '-ms-flex-' + b + a;\\n\\n case 115:\\n return '-webkit-' + a + '-ms-flex-item-' + a.replace(ba, '') + a;\\n\\n default:\\n return '-webkit-' + a + '-ms-flex-line-pack' + a.replace('align-content', '').replace(ba, '') + a;\\n }\\n break;\\n\\n case 973:\\n case 989:\\n if (45 !== a.charCodeAt(3) || 122 === a.charCodeAt(4)) break;\\n\\n case 931:\\n case 953:\\n if (!0 === la.test(d)) return 115 === (b = d.substring(d.indexOf(':') + 1)).charCodeAt(0) ? P(d.replace('stretch', 'fill-available'), c, e, h).replace(':fill-available', ':stretch') : a.replace(b, '-webkit-' + b) + a.replace(b, '-moz-' + b.replace('fill-', '')) + a;\\n break;\\n\\n case 962:\\n if (a = '-webkit-' + a + (102 === a.charCodeAt(5) ? '-ms-' + a : '') + a, 211 === e + h && 105 === a.charCodeAt(13) && 0 < a.indexOf('transform', 10)) return a.substring(0, a.indexOf(';', 27) + 1).replace(ma, '$1-webkit-$2') + a;\\n }\\n\\n return a;\\n }\\n\\n function L(d, c) {\\n var e = d.indexOf(1 === c ? ':' : '{'),\\n h = d.substring(0, 3 !== c ? e : 10);\\n e = d.substring(e + 1, d.length - 1);\\n return R(2 !== c ? h : h.replace(na, '$1'), e, c);\\n }\\n\\n function ea(d, c) {\\n var e = P(c, c.charCodeAt(0), c.charCodeAt(1), c.charCodeAt(2));\\n return e !== c + ';' ? e.replace(oa, ' or ($1)').substring(4) : '(' + c + ')';\\n }\\n\\n function H(d, c, e, h, a, m, b, v, n, q) {\\n for (var g = 0, x = c, w; g < A; ++g) {\\n switch (w = S[g].call(B, d, x, e, h, a, m, b, v, n, q)) {\\n case void 0:\\n case !1:\\n case !0:\\n case null:\\n break;\\n\\n default:\\n x = w;\\n }\\n }\\n\\n if (x !== c) return x;\\n }\\n\\n function T(d) {\\n switch (d) {\\n case void 0:\\n case null:\\n A = S.length = 0;\\n break;\\n\\n default:\\n if ('function' === typeof d) S[A++] = d;else if ('object' === typeof d) for (var c = 0, e = d.length; c < e; ++c) {\\n T(d[c]);\\n } else Y = !!d | 0;\\n }\\n\\n return T;\\n }\\n\\n function U(d) {\\n d = d.prefix;\\n void 0 !== d && (R = null, d ? 'function' !== typeof d ? w = 1 : (w = 2, R = d) : w = 0);\\n return U;\\n }\\n\\n function B(d, c) {\\n var e = d;\\n 33 > e.charCodeAt(0) && (e = e.trim());\\n V = e;\\n e = [V];\\n\\n if (0 < A) {\\n var h = H(-1, c, e, e, D, z, 0, 0, 0, 0);\\n void 0 !== h && 'string' === typeof h && (c = h);\\n }\\n\\n var a = M(O, e, c, 0, 0);\\n 0 < A && (h = H(-2, a, e, e, D, z, a.length, 0, 0, 0), void 0 !== h && (a = h));\\n V = '';\\n E = 0;\\n z = D = 1;\\n return a;\\n }\\n\\n var ca = /^\\\\0+/g,\\n N = /[\\\\0\\\\r\\\\f]/g,\\n aa = /: */g,\\n ka = /zoo|gra/,\\n ma = /([,: ])(transform)/g,\\n ia = /,\\\\r+?/g,\\n F = /([\\\\t\\\\r\\\\n ])*\\\\f?&/g,\\n fa = /@(k\\\\w+)\\\\s*(\\\\S*)\\\\s*/,\\n Q = /::(place)/g,\\n ha = /:(read-only)/g,\\n G = /[svh]\\\\w+-[tblr]{2}/,\\n da = /\\\\(\\\\s*(.*)\\\\s*\\\\)/g,\\n oa = /([\\\\s\\\\S]*?);/g,\\n ba = /-self|flex-/g,\\n na = /[^]*?(:[rp][el]a[\\\\w-]+)[^]*/,\\n la = /stretch|:\\\\s*\\\\w+\\\\-(?:conte|avail)/,\\n ja = /([^-])(image-set\\\\()/,\\n z = 1,\\n D = 1,\\n E = 0,\\n w = 1,\\n O = [],\\n S = [],\\n A = 0,\\n R = null,\\n Y = 0,\\n V = '';\\n B.use = T;\\n B.set = U;\\n void 0 !== W && U(W);\\n return B;\\n}\\n\\n/* harmony default export */ __webpack_exports__[\\\"default\\\"] = (stylis_min);\\n\\n\\n//# sourceURL=webpack://%5Bname%5D/./node_modules/@emotion/stylis/dist/stylis.browser.esm.js?\");\n\n/***/ }),\n\n/***/ \"./node_modules/@emotion/unitless/dist/unitless.browser.esm.js\":\n/*!*********************************************************************!*\\\n !*** ./node_modules/@emotion/unitless/dist/unitless.browser.esm.js ***!\n \\*********************************************************************/\n/*! exports provided: default */\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\neval(\"__webpack_require__.r(__webpack_exports__);\\nvar unitlessKeys = {\\n animationIterationCount: 1,\\n borderImageOutset: 1,\\n borderImageSlice: 1,\\n borderImageWidth: 1,\\n boxFlex: 1,\\n boxFlexGroup: 1,\\n boxOrdinalGroup: 1,\\n columnCount: 1,\\n columns: 1,\\n flex: 1,\\n flexGrow: 1,\\n flexPositive: 1,\\n flexShrink: 1,\\n flexNegative: 1,\\n flexOrder: 1,\\n gridRow: 1,\\n gridRowEnd: 1,\\n gridRowSpan: 1,\\n gridRowStart: 1,\\n gridColumn: 1,\\n gridColumnEnd: 1,\\n gridColumnSpan: 1,\\n gridColumnStart: 1,\\n msGridRow: 1,\\n msGridRowSpan: 1,\\n msGridColumn: 1,\\n msGridColumnSpan: 1,\\n fontWeight: 1,\\n lineHeight: 1,\\n opacity: 1,\\n order: 1,\\n orphans: 1,\\n tabSize: 1,\\n widows: 1,\\n zIndex: 1,\\n zoom: 1,\\n WebkitLineClamp: 1,\\n // SVG-related properties\\n fillOpacity: 1,\\n floodOpacity: 1,\\n stopOpacity: 1,\\n strokeDasharray: 1,\\n strokeDashoffset: 1,\\n strokeMiterlimit: 1,\\n strokeOpacity: 1,\\n strokeWidth: 1\\n};\\n\\n/* harmony default export */ __webpack_exports__[\\\"default\\\"] = (unitlessKeys);\\n\\n\\n//# sourceURL=webpack://%5Bname%5D/./node_modules/@emotion/unitless/dist/unitless.browser.esm.js?\");\n\n/***/ }),\n\n/***/ \"./node_modules/@emotion/utils/dist/utils.browser.esm.js\":\n/*!***************************************************************!*\\\n !*** ./node_modules/@emotion/utils/dist/utils.browser.esm.js ***!\n \\***************************************************************/\n/*! exports provided: getRegisteredStyles, insertStyles */\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\neval(\"__webpack_require__.r(__webpack_exports__);\\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \\\"getRegisteredStyles\\\", function() { return getRegisteredStyles; });\\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \\\"insertStyles\\\", function() { return insertStyles; });\\nvar isBrowser = \\\"object\\\" !== 'undefined';\\nfunction getRegisteredStyles(registered, registeredStyles, classNames) {\\n var rawClassName = '';\\n classNames.split(' ').forEach(function (className) {\\n if (registered[className] !== undefined) {\\n registeredStyles.push(registered[className]);\\n } else {\\n rawClassName += className + \\\" \\\";\\n }\\n });\\n return rawClassName;\\n}\\nvar insertStyles = function insertStyles(cache, serialized, isStringTag) {\\n var className = cache.key + \\\"-\\\" + serialized.name;\\n\\n if ( // we only need to add the styles to the registered cache if the\\n // class name could be used further down\\n // the tree but if it's a string tag, we know it won't\\n // so we don't have to add it to registered cache.\\n // this improves memory usage since we can avoid storing the whole style string\\n (isStringTag === false || // we need to always store it if we're in compat mode and\\n // in node since emotion-server relies on whether a style is in\\n // the registered cache to know whether a style is global or not\\n // also, note that this check will be dead code eliminated in the browser\\n isBrowser === false && cache.compat !== undefined) && cache.registered[className] === undefined) {\\n cache.registered[className] = serialized.styles;\\n }\\n\\n if (cache.inserted[serialized.name] === undefined) {\\n var current = serialized;\\n\\n do {\\n var maybeStyles = cache.insert(\\\".\\\" + className, current, cache.sheet, true);\\n\\n current = current.next;\\n } while (current !== undefined);\\n }\\n};\\n\\n\\n\\n\\n//# sourceURL=webpack://%5Bname%5D/./node_modules/@emotion/utils/dist/utils.browser.esm.js?\");\n\n/***/ }),\n\n/***/ \"./node_modules/@emotion/weak-memoize/dist/weak-memoize.browser.esm.js\":\n/*!*****************************************************************************!*\\\n !*** ./node_modules/@emotion/weak-memoize/dist/weak-memoize.browser.esm.js ***!\n \\*****************************************************************************/\n/*! exports provided: default */\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\neval(\"__webpack_require__.r(__webpack_exports__);\\nvar weakMemoize = function weakMemoize(func) {\\n // $FlowFixMe flow doesn't include all non-primitive types as allowed for weakmaps\\n var cache = new WeakMap();\\n return function (arg) {\\n if (cache.has(arg)) {\\n // $FlowFixMe\\n return cache.get(arg);\\n }\\n\\n var ret = func(arg);\\n cache.set(arg, ret);\\n return ret;\\n };\\n};\\n\\n/* harmony default export */ __webpack_exports__[\\\"default\\\"] = (weakMemoize);\\n\\n\\n//# sourceURL=webpack://%5Bname%5D/./node_modules/@emotion/weak-memoize/dist/weak-memoize.browser.esm.js?\");\n\n/***/ }),\n\n/***/ \"./node_modules/object-assign/index.js\":\n/*!*********************************************!*\\\n !*** ./node_modules/object-assign/index.js ***!\n \\*********************************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"/*\\nobject-assign\\n(c) Sindre Sorhus\\n@license MIT\\n*/\\n\\n\\n/* eslint-disable no-unused-vars */\\nvar getOwnPropertySymbols = Object.getOwnPropertySymbols;\\nvar hasOwnProperty = Object.prototype.hasOwnProperty;\\nvar propIsEnumerable = Object.prototype.propertyIsEnumerable;\\n\\nfunction toObject(val) {\\n\\tif (val === null || val === undefined) {\\n\\t\\tthrow new TypeError('Object.assign cannot be called with null or undefined');\\n\\t}\\n\\n\\treturn Object(val);\\n}\\n\\nfunction shouldUseNative() {\\n\\ttry {\\n\\t\\tif (!Object.assign) {\\n\\t\\t\\treturn false;\\n\\t\\t}\\n\\n\\t\\t// Detect buggy property enumeration order in older V8 versions.\\n\\n\\t\\t// https://bugs.chromium.org/p/v8/issues/detail?id=4118\\n\\t\\tvar test1 = new String('abc'); // eslint-disable-line no-new-wrappers\\n\\t\\ttest1[5] = 'de';\\n\\t\\tif (Object.getOwnPropertyNames(test1)[0] === '5') {\\n\\t\\t\\treturn false;\\n\\t\\t}\\n\\n\\t\\t// https://bugs.chromium.org/p/v8/issues/detail?id=3056\\n\\t\\tvar test2 = {};\\n\\t\\tfor (var i = 0; i < 10; i++) {\\n\\t\\t\\ttest2['_' + String.fromCharCode(i)] = i;\\n\\t\\t}\\n\\t\\tvar order2 = Object.getOwnPropertyNames(test2).map(function (n) {\\n\\t\\t\\treturn test2[n];\\n\\t\\t});\\n\\t\\tif (order2.join('') !== '0123456789') {\\n\\t\\t\\treturn false;\\n\\t\\t}\\n\\n\\t\\t// https://bugs.chromium.org/p/v8/issues/detail?id=3056\\n\\t\\tvar test3 = {};\\n\\t\\t'abcdefghijklmnopqrst'.split('').forEach(function (letter) {\\n\\t\\t\\ttest3[letter] = letter;\\n\\t\\t});\\n\\t\\tif (Object.keys(Object.assign({}, test3)).join('') !==\\n\\t\\t\\t\\t'abcdefghijklmnopqrst') {\\n\\t\\t\\treturn false;\\n\\t\\t}\\n\\n\\t\\treturn true;\\n\\t} catch (err) {\\n\\t\\t// We don't expect any of the above to throw, but better to be safe.\\n\\t\\treturn false;\\n\\t}\\n}\\n\\nmodule.exports = shouldUseNative() ? Object.assign : function (target, source) {\\n\\tvar from;\\n\\tvar to = toObject(target);\\n\\tvar symbols;\\n\\n\\tfor (var s = 1; s < arguments.length; s++) {\\n\\t\\tfrom = Object(arguments[s]);\\n\\n\\t\\tfor (var key in from) {\\n\\t\\t\\tif (hasOwnProperty.call(from, key)) {\\n\\t\\t\\t\\tto[key] = from[key];\\n\\t\\t\\t}\\n\\t\\t}\\n\\n\\t\\tif (getOwnPropertySymbols) {\\n\\t\\t\\tsymbols = getOwnPropertySymbols(from);\\n\\t\\t\\tfor (var i = 0; i < symbols.length; i++) {\\n\\t\\t\\t\\tif (propIsEnumerable.call(from, symbols[i])) {\\n\\t\\t\\t\\t\\tto[symbols[i]] = from[symbols[i]];\\n\\t\\t\\t\\t}\\n\\t\\t\\t}\\n\\t\\t}\\n\\t}\\n\\n\\treturn to;\\n};\\n\\n\\n//# sourceURL=webpack://%5Bname%5D/./node_modules/object-assign/index.js?\");\n\n/***/ }),\n\n/***/ \"./node_modules/prop-types/checkPropTypes.js\":\n/*!***************************************************!*\\\n !*** ./node_modules/prop-types/checkPropTypes.js ***!\n \\***************************************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"/**\\n * Copyright (c) 2013-present, Facebook, Inc.\\n *\\n * This source code is licensed under the MIT license found in the\\n * LICENSE file in the root directory of this source tree.\\n */\\n\\n\\n\\nvar printWarning = function() {};\\n\\nif (true) {\\n var ReactPropTypesSecret = __webpack_require__(/*! ./lib/ReactPropTypesSecret */ \\\"./node_modules/prop-types/lib/ReactPropTypesSecret.js\\\");\\n var loggedTypeFailures = {};\\n\\n printWarning = function(text) {\\n var message = 'Warning: ' + text;\\n if (typeof console !== 'undefined') {\\n console.error(message);\\n }\\n try {\\n // --- Welcome to debugging React ---\\n // This error was thrown as a convenience so that you can use this stack\\n // to find the callsite that caused this warning to fire.\\n throw new Error(message);\\n } catch (x) {}\\n };\\n}\\n\\n/**\\n * Assert that the values match with the type specs.\\n * Error messages are memorized and will only be shown once.\\n *\\n * @param {object} typeSpecs Map of name to a ReactPropType\\n * @param {object} values Runtime values that need to be type-checked\\n * @param {string} location e.g. \\\"prop\\\", \\\"context\\\", \\\"child context\\\"\\n * @param {string} componentName Name of the component for error messages.\\n * @param {?Function} getStack Returns the component stack.\\n * @private\\n */\\nfunction checkPropTypes(typeSpecs, values, location, componentName, getStack) {\\n if (true) {\\n for (var typeSpecName in typeSpecs) {\\n if (typeSpecs.hasOwnProperty(typeSpecName)) {\\n var error;\\n // Prop type validation may throw. In case they do, we don't want to\\n // fail the render phase where it didn't fail before. So we log it.\\n // After these have been cleaned up, we'll let them throw.\\n try {\\n // This is intentionally an invariant that gets caught. It's the same\\n // behavior as without this statement except with a better message.\\n if (typeof typeSpecs[typeSpecName] !== 'function') {\\n var err = Error(\\n (componentName || 'React class') + ': ' + location + ' type `' + typeSpecName + '` is invalid; ' +\\n 'it must be a function, usually from the `prop-types` package, but received `' + typeof typeSpecs[typeSpecName] + '`.'\\n );\\n err.name = 'Invariant Violation';\\n throw err;\\n }\\n error = typeSpecs[typeSpecName](values, typeSpecName, componentName, location, null, ReactPropTypesSecret);\\n } catch (ex) {\\n error = ex;\\n }\\n if (error && !(error instanceof Error)) {\\n printWarning(\\n (componentName || 'React class') + ': type specification of ' +\\n location + ' `' + typeSpecName + '` is invalid; the type checker ' +\\n 'function must return `null` or an `Error` but returned a ' + typeof error + '. ' +\\n 'You may have forgotten to pass an argument to the type checker ' +\\n 'creator (arrayOf, instanceOf, objectOf, oneOf, oneOfType, and ' +\\n 'shape all require an argument).'\\n )\\n\\n }\\n if (error instanceof Error && !(error.message in loggedTypeFailures)) {\\n // Only monitor this failure once because there tends to be a lot of the\\n // same error.\\n loggedTypeFailures[error.message] = true;\\n\\n var stack = getStack ? getStack() : '';\\n\\n printWarning(\\n 'Failed ' + location + ' type: ' + error.message + (stack != null ? stack : '')\\n );\\n }\\n }\\n }\\n }\\n}\\n\\nmodule.exports = checkPropTypes;\\n\\n\\n//# sourceURL=webpack://%5Bname%5D/./node_modules/prop-types/checkPropTypes.js?\");\n\n/***/ }),\n\n/***/ \"./node_modules/prop-types/lib/ReactPropTypesSecret.js\":\n/*!*************************************************************!*\\\n !*** ./node_modules/prop-types/lib/ReactPropTypesSecret.js ***!\n \\*************************************************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"/**\\n * Copyright (c) 2013-present, Facebook, Inc.\\n *\\n * This source code is licensed under the MIT license found in the\\n * LICENSE file in the root directory of this source tree.\\n */\\n\\n\\n\\nvar ReactPropTypesSecret = 'SECRET_DO_NOT_PASS_THIS_OR_YOU_WILL_BE_FIRED';\\n\\nmodule.exports = ReactPropTypesSecret;\\n\\n\\n//# sourceURL=webpack://%5Bname%5D/./node_modules/prop-types/lib/ReactPropTypesSecret.js?\");\n\n/***/ }),\n\n/***/ \"./node_modules/react/cjs/react.development.js\":\n/*!*****************************************************!*\\\n !*** ./node_modules/react/cjs/react.development.js ***!\n \\*****************************************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"/** @license React v16.7.0\\n * react.development.js\\n *\\n * Copyright (c) Facebook, Inc. and its affiliates.\\n *\\n * This source code is licensed under the MIT license found in the\\n * LICENSE file in the root directory of this source tree.\\n */\\n\\n\\n\\n\\n\\nif (true) {\\n (function() {\\n'use strict';\\n\\nvar _assign = __webpack_require__(/*! object-assign */ \\\"./node_modules/object-assign/index.js\\\");\\nvar checkPropTypes = __webpack_require__(/*! prop-types/checkPropTypes */ \\\"./node_modules/prop-types/checkPropTypes.js\\\");\\n\\n// TODO: this is special because it gets imported during build.\\n\\nvar ReactVersion = '16.7.0';\\n\\n// The Symbol used to tag the ReactElement-like types. If there is no native Symbol\\n// nor polyfill, then a plain number is used for performance.\\nvar hasSymbol = typeof Symbol === 'function' && Symbol.for;\\n\\nvar REACT_ELEMENT_TYPE = hasSymbol ? Symbol.for('react.element') : 0xeac7;\\nvar REACT_PORTAL_TYPE = hasSymbol ? Symbol.for('react.portal') : 0xeaca;\\nvar REACT_FRAGMENT_TYPE = hasSymbol ? Symbol.for('react.fragment') : 0xeacb;\\nvar REACT_STRICT_MODE_TYPE = hasSymbol ? Symbol.for('react.strict_mode') : 0xeacc;\\nvar REACT_PROFILER_TYPE = hasSymbol ? Symbol.for('react.profiler') : 0xead2;\\nvar REACT_PROVIDER_TYPE = hasSymbol ? Symbol.for('react.provider') : 0xeacd;\\nvar REACT_CONTEXT_TYPE = hasSymbol ? Symbol.for('react.context') : 0xeace;\\n\\nvar REACT_CONCURRENT_MODE_TYPE = hasSymbol ? Symbol.for('react.concurrent_mode') : 0xeacf;\\nvar REACT_FORWARD_REF_TYPE = hasSymbol ? Symbol.for('react.forward_ref') : 0xead0;\\nvar REACT_SUSPENSE_TYPE = hasSymbol ? Symbol.for('react.suspense') : 0xead1;\\nvar REACT_MEMO_TYPE = hasSymbol ? Symbol.for('react.memo') : 0xead3;\\nvar REACT_LAZY_TYPE = hasSymbol ? Symbol.for('react.lazy') : 0xead4;\\n\\nvar MAYBE_ITERATOR_SYMBOL = typeof Symbol === 'function' && Symbol.iterator;\\nvar FAUX_ITERATOR_SYMBOL = '@@iterator';\\n\\nfunction getIteratorFn(maybeIterable) {\\n if (maybeIterable === null || typeof maybeIterable !== 'object') {\\n return null;\\n }\\n var maybeIterator = MAYBE_ITERATOR_SYMBOL && maybeIterable[MAYBE_ITERATOR_SYMBOL] || maybeIterable[FAUX_ITERATOR_SYMBOL];\\n if (typeof maybeIterator === 'function') {\\n return maybeIterator;\\n }\\n return null;\\n}\\n\\nvar enableHooks = false;\\n// Helps identify side effects in begin-phase lifecycle hooks and setState reducers:\\n\\n\\n// In some cases, StrictMode should also double-render lifecycles.\\n// This can be confusing for tests though,\\n// And it can be bad for performance in production.\\n// This feature flag can be used to control the behavior:\\n\\n\\n// To preserve the \\\"Pause on caught exceptions\\\" behavior of the debugger, we\\n// replay the begin phase of a failed component inside invokeGuardedCallback.\\n\\n\\n// Warn about deprecated, async-unsafe lifecycles; relates to RFC #6:\\n\\n\\n// Gather advanced timing metrics for Profiler subtrees.\\n\\n\\n// Trace which interactions trigger each commit.\\n\\n\\n// Only used in www builds.\\n // TODO: true? Here it might just be false.\\n\\n// Only used in www builds.\\n\\n\\n// Only used in www builds.\\n\\n\\n// React Fire: prevent the value and checked attributes from syncing\\n// with their related DOM properties\\n\\n\\n// These APIs will no longer be \\\"unstable\\\" in the upcoming 16.7 release,\\n// Control this behavior with a flag to support 16.6 minor releases in the meanwhile.\\nvar enableStableConcurrentModeAPIs = false;\\n\\n/**\\n * Use invariant() to assert state which your program assumes to be true.\\n *\\n * Provide sprintf-style format (only %s is supported) and arguments\\n * to provide information about what broke and what you were\\n * expecting.\\n *\\n * The invariant message will be stripped in production, but the invariant\\n * will remain to ensure logic does not differ in production.\\n */\\n\\nvar validateFormat = function () {};\\n\\n{\\n validateFormat = function (format) {\\n if (format === undefined) {\\n throw new Error('invariant requires an error message argument');\\n }\\n };\\n}\\n\\nfunction invariant(condition, format, a, b, c, d, e, f) {\\n validateFormat(format);\\n\\n if (!condition) {\\n var error = void 0;\\n if (format === undefined) {\\n error = new Error('Minified exception occurred; use the non-minified dev environment ' + 'for the full error message and additional helpful warnings.');\\n } else {\\n var args = [a, b, c, d, e, f];\\n var argIndex = 0;\\n error = new Error(format.replace(/%s/g, function () {\\n return args[argIndex++];\\n }));\\n error.name = 'Invariant Violation';\\n }\\n\\n error.framesToPop = 1; // we don't care about invariant's own frame\\n throw error;\\n }\\n}\\n\\n// Relying on the `invariant()` implementation lets us\\n// preserve the format and params in the www builds.\\n\\n/**\\n * Forked from fbjs/warning:\\n * https://github.com/facebook/fbjs/blob/e66ba20ad5be433eb54423f2b097d829324d9de6/packages/fbjs/src/__forks__/warning.js\\n *\\n * Only change is we use console.warn instead of console.error,\\n * and do nothing when 'console' is not supported.\\n * This really simplifies the code.\\n * ---\\n * Similar to invariant but only logs a warning if the condition is not met.\\n * This can be used to log issues in development environments in critical\\n * paths. Removing the logging code for production environments will keep the\\n * same logic and follow the same code paths.\\n */\\n\\nvar lowPriorityWarning = function () {};\\n\\n{\\n var printWarning = function (format) {\\n for (var _len = arguments.length, args = Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) {\\n args[_key - 1] = arguments[_key];\\n }\\n\\n var argIndex = 0;\\n var message = 'Warning: ' + format.replace(/%s/g, function () {\\n return args[argIndex++];\\n });\\n if (typeof console !== 'undefined') {\\n console.warn(message);\\n }\\n try {\\n // --- Welcome to debugging React ---\\n // This error was thrown as a convenience so that you can use this stack\\n // to find the callsite that caused this warning to fire.\\n throw new Error(message);\\n } catch (x) {}\\n };\\n\\n lowPriorityWarning = function (condition, format) {\\n if (format === undefined) {\\n throw new Error('`lowPriorityWarning(condition, format, ...args)` requires a warning ' + 'message argument');\\n }\\n if (!condition) {\\n for (var _len2 = arguments.length, args = Array(_len2 > 2 ? _len2 - 2 : 0), _key2 = 2; _key2 < _len2; _key2++) {\\n args[_key2 - 2] = arguments[_key2];\\n }\\n\\n printWarning.apply(undefined, [format].concat(args));\\n }\\n };\\n}\\n\\nvar lowPriorityWarning$1 = lowPriorityWarning;\\n\\n/**\\n * Similar to invariant but only logs a warning if the condition is not met.\\n * This can be used to log issues in development environments in critical\\n * paths. Removing the logging code for production environments will keep the\\n * same logic and follow the same code paths.\\n */\\n\\nvar warningWithoutStack = function () {};\\n\\n{\\n warningWithoutStack = function (condition, format) {\\n for (var _len = arguments.length, args = Array(_len > 2 ? _len - 2 : 0), _key = 2; _key < _len; _key++) {\\n args[_key - 2] = arguments[_key];\\n }\\n\\n if (format === undefined) {\\n throw new Error('`warningWithoutStack(condition, format, ...args)` requires a warning ' + 'message argument');\\n }\\n if (args.length > 8) {\\n // Check before the condition to catch violations early.\\n throw new Error('warningWithoutStack() currently supports at most 8 arguments.');\\n }\\n if (condition) {\\n return;\\n }\\n if (typeof console !== 'undefined') {\\n var argsWithFormat = args.map(function (item) {\\n return '' + item;\\n });\\n argsWithFormat.unshift('Warning: ' + format);\\n\\n // We intentionally don't use spread (or .apply) directly because it\\n // breaks IE9: https://github.com/facebook/react/issues/13610\\n Function.prototype.apply.call(console.error, console, argsWithFormat);\\n }\\n try {\\n // --- Welcome to debugging React ---\\n // This error was thrown as a convenience so that you can use this stack\\n // to find the callsite that caused this warning to fire.\\n var argIndex = 0;\\n var message = 'Warning: ' + format.replace(/%s/g, function () {\\n return args[argIndex++];\\n });\\n throw new Error(message);\\n } catch (x) {}\\n };\\n}\\n\\nvar warningWithoutStack$1 = warningWithoutStack;\\n\\nvar didWarnStateUpdateForUnmountedComponent = {};\\n\\nfunction warnNoop(publicInstance, callerName) {\\n {\\n var _constructor = publicInstance.constructor;\\n var componentName = _constructor && (_constructor.displayName || _constructor.name) || 'ReactClass';\\n var warningKey = componentName + '.' + callerName;\\n if (didWarnStateUpdateForUnmountedComponent[warningKey]) {\\n return;\\n }\\n warningWithoutStack$1(false, \\\"Can't call %s on a component that is not yet mounted. \\\" + 'This is a no-op, but it might indicate a bug in your application. ' + 'Instead, assign to `this.state` directly or define a `state = {};` ' + 'class property with the desired state in the %s component.', callerName, componentName);\\n didWarnStateUpdateForUnmountedComponent[warningKey] = true;\\n }\\n}\\n\\n/**\\n * This is the abstract API for an update queue.\\n */\\nvar ReactNoopUpdateQueue = {\\n /**\\n * Checks whether or not this composite component is mounted.\\n * @param {ReactClass} publicInstance The instance we want to test.\\n * @return {boolean} True if mounted, false otherwise.\\n * @protected\\n * @final\\n */\\n isMounted: function (publicInstance) {\\n return false;\\n },\\n\\n /**\\n * Forces an update. This should only be invoked when it is known with\\n * certainty that we are **not** in a DOM transaction.\\n *\\n * You may want to call this when you know that some deeper aspect of the\\n * component's state has changed but `setState` was not called.\\n *\\n * This will not invoke `shouldComponentUpdate`, but it will invoke\\n * `componentWillUpdate` and `componentDidUpdate`.\\n *\\n * @param {ReactClass} publicInstance The instance that should rerender.\\n * @param {?function} callback Called after component is updated.\\n * @param {?string} callerName name of the calling function in the public API.\\n * @internal\\n */\\n enqueueForceUpdate: function (publicInstance, callback, callerName) {\\n warnNoop(publicInstance, 'forceUpdate');\\n },\\n\\n /**\\n * Replaces all of the state. Always use this or `setState` to mutate state.\\n * You should treat `this.state` as immutable.\\n *\\n * There is no guarantee that `this.state` will be immediately updated, so\\n * accessing `this.state` after calling this method may return the old value.\\n *\\n * @param {ReactClass} publicInstance The instance that should rerender.\\n * @param {object} completeState Next state.\\n * @param {?function} callback Called after component is updated.\\n * @param {?string} callerName name of the calling function in the public API.\\n * @internal\\n */\\n enqueueReplaceState: function (publicInstance, completeState, callback, callerName) {\\n warnNoop(publicInstance, 'replaceState');\\n },\\n\\n /**\\n * Sets a subset of the state. This only exists because _pendingState is\\n * internal. This provides a merging strategy that is not available to deep\\n * properties which is confusing. TODO: Expose pendingState or don't use it\\n * during the merge.\\n *\\n * @param {ReactClass} publicInstance The instance that should rerender.\\n * @param {object} partialState Next partial state to be merged with state.\\n * @param {?function} callback Called after component is updated.\\n * @param {?string} Name of the calling function in the public API.\\n * @internal\\n */\\n enqueueSetState: function (publicInstance, partialState, callback, callerName) {\\n warnNoop(publicInstance, 'setState');\\n }\\n};\\n\\nvar emptyObject = {};\\n{\\n Object.freeze(emptyObject);\\n}\\n\\n/**\\n * Base class helpers for the updating state of a component.\\n */\\nfunction Component(props, context, updater) {\\n this.props = props;\\n this.context = context;\\n // If a component has string refs, we will assign a different object later.\\n this.refs = emptyObject;\\n // We initialize the default updater but the real one gets injected by the\\n // renderer.\\n this.updater = updater || ReactNoopUpdateQueue;\\n}\\n\\nComponent.prototype.isReactComponent = {};\\n\\n/**\\n * Sets a subset of the state. Always use this to mutate\\n * state. You should treat `this.state` as immutable.\\n *\\n * There is no guarantee that `this.state` will be immediately updated, so\\n * accessing `this.state` after calling this method may return the old value.\\n *\\n * There is no guarantee that calls to `setState` will run synchronously,\\n * as they may eventually be batched together. You can provide an optional\\n * callback that will be executed when the call to setState is actually\\n * completed.\\n *\\n * When a function is provided to setState, it will be called at some point in\\n * the future (not synchronously). It will be called with the up to date\\n * component arguments (state, props, context). These values can be different\\n * from this.* because your function may be called after receiveProps but before\\n * shouldComponentUpdate, and this new state, props, and context will not yet be\\n * assigned to this.\\n *\\n * @param {object|function} partialState Next partial state or function to\\n * produce next partial state to be merged with current state.\\n * @param {?function} callback Called after state is updated.\\n * @final\\n * @protected\\n */\\nComponent.prototype.setState = function (partialState, callback) {\\n !(typeof partialState === 'object' || typeof partialState === 'function' || partialState == null) ? invariant(false, 'setState(...): takes an object of state variables to update or a function which returns an object of state variables.') : void 0;\\n this.updater.enqueueSetState(this, partialState, callback, 'setState');\\n};\\n\\n/**\\n * Forces an update. This should only be invoked when it is known with\\n * certainty that we are **not** in a DOM transaction.\\n *\\n * You may want to call this when you know that some deeper aspect of the\\n * component's state has changed but `setState` was not called.\\n *\\n * This will not invoke `shouldComponentUpdate`, but it will invoke\\n * `componentWillUpdate` and `componentDidUpdate`.\\n *\\n * @param {?function} callback Called after update is complete.\\n * @final\\n * @protected\\n */\\nComponent.prototype.forceUpdate = function (callback) {\\n this.updater.enqueueForceUpdate(this, callback, 'forceUpdate');\\n};\\n\\n/**\\n * Deprecated APIs. These APIs used to exist on classic React classes but since\\n * we would like to deprecate them, we're not going to move them over to this\\n * modern base class. Instead, we define a getter that warns if it's accessed.\\n */\\n{\\n var deprecatedAPIs = {\\n isMounted: ['isMounted', 'Instead, make sure to clean up subscriptions and pending requests in ' + 'componentWillUnmount to prevent memory leaks.'],\\n replaceState: ['replaceState', 'Refactor your code to use setState instead (see ' + 'https://github.com/facebook/react/issues/3236).']\\n };\\n var defineDeprecationWarning = function (methodName, info) {\\n Object.defineProperty(Component.prototype, methodName, {\\n get: function () {\\n lowPriorityWarning$1(false, '%s(...) is deprecated in plain JavaScript React classes. %s', info[0], info[1]);\\n return undefined;\\n }\\n });\\n };\\n for (var fnName in deprecatedAPIs) {\\n if (deprecatedAPIs.hasOwnProperty(fnName)) {\\n defineDeprecationWarning(fnName, deprecatedAPIs[fnName]);\\n }\\n }\\n}\\n\\nfunction ComponentDummy() {}\\nComponentDummy.prototype = Component.prototype;\\n\\n/**\\n * Convenience component with default shallow equality check for sCU.\\n */\\nfunction PureComponent(props, context, updater) {\\n this.props = props;\\n this.context = context;\\n // If a component has string refs, we will assign a different object later.\\n this.refs = emptyObject;\\n this.updater = updater || ReactNoopUpdateQueue;\\n}\\n\\nvar pureComponentPrototype = PureComponent.prototype = new ComponentDummy();\\npureComponentPrototype.constructor = PureComponent;\\n// Avoid an extra prototype jump for these methods.\\n_assign(pureComponentPrototype, Component.prototype);\\npureComponentPrototype.isPureReactComponent = true;\\n\\n// an immutable object with a single mutable value\\nfunction createRef() {\\n var refObject = {\\n current: null\\n };\\n {\\n Object.seal(refObject);\\n }\\n return refObject;\\n}\\n\\n/**\\n * Keeps track of the current owner.\\n *\\n * The current owner is the component who should own any components that are\\n * currently being constructed.\\n */\\nvar ReactCurrentOwner = {\\n /**\\n * @internal\\n * @type {ReactComponent}\\n */\\n current: null,\\n currentDispatcher: null\\n};\\n\\nvar BEFORE_SLASH_RE = /^(.*)[\\\\\\\\\\\\/]/;\\n\\nvar describeComponentFrame = function (name, source, ownerName) {\\n var sourceInfo = '';\\n if (source) {\\n var path = source.fileName;\\n var fileName = path.replace(BEFORE_SLASH_RE, '');\\n {\\n // In DEV, include code for a common special case:\\n // prefer \\\"folder/index.js\\\" instead of just \\\"index.js\\\".\\n if (/^index\\\\./.test(fileName)) {\\n var match = path.match(BEFORE_SLASH_RE);\\n if (match) {\\n var pathBeforeSlash = match[1];\\n if (pathBeforeSlash) {\\n var folderName = pathBeforeSlash.replace(BEFORE_SLASH_RE, '');\\n fileName = folderName + '/' + fileName;\\n }\\n }\\n }\\n }\\n sourceInfo = ' (at ' + fileName + ':' + source.lineNumber + ')';\\n } else if (ownerName) {\\n sourceInfo = ' (created by ' + ownerName + ')';\\n }\\n return '\\\\n in ' + (name || 'Unknown') + sourceInfo;\\n};\\n\\nvar Resolved = 1;\\n\\n\\nfunction refineResolvedLazyComponent(lazyComponent) {\\n return lazyComponent._status === Resolved ? lazyComponent._result : null;\\n}\\n\\nfunction getWrappedName(outerType, innerType, wrapperName) {\\n var functionName = innerType.displayName || innerType.name || '';\\n return outerType.displayName || (functionName !== '' ? wrapperName + '(' + functionName + ')' : wrapperName);\\n}\\n\\nfunction getComponentName(type) {\\n if (type == null) {\\n // Host root, text node or just invalid type.\\n return null;\\n }\\n {\\n if (typeof type.tag === 'number') {\\n warningWithoutStack$1(false, 'Received an unexpected object in getComponentName(). ' + 'This is likely a bug in React. Please file an issue.');\\n }\\n }\\n if (typeof type === 'function') {\\n return type.displayName || type.name || null;\\n }\\n if (typeof type === 'string') {\\n return type;\\n }\\n switch (type) {\\n case REACT_CONCURRENT_MODE_TYPE:\\n return 'ConcurrentMode';\\n case REACT_FRAGMENT_TYPE:\\n return 'Fragment';\\n case REACT_PORTAL_TYPE:\\n return 'Portal';\\n case REACT_PROFILER_TYPE:\\n return 'Profiler';\\n case REACT_STRICT_MODE_TYPE:\\n return 'StrictMode';\\n case REACT_SUSPENSE_TYPE:\\n return 'Suspense';\\n }\\n if (typeof type === 'object') {\\n switch (type.$$typeof) {\\n case REACT_CONTEXT_TYPE:\\n return 'Context.Consumer';\\n case REACT_PROVIDER_TYPE:\\n return 'Context.Provider';\\n case REACT_FORWARD_REF_TYPE:\\n return getWrappedName(type, type.render, 'ForwardRef');\\n case REACT_MEMO_TYPE:\\n return getComponentName(type.type);\\n case REACT_LAZY_TYPE:\\n {\\n var thenable = type;\\n var resolvedThenable = refineResolvedLazyComponent(thenable);\\n if (resolvedThenable) {\\n return getComponentName(resolvedThenable);\\n }\\n }\\n }\\n }\\n return null;\\n}\\n\\nvar ReactDebugCurrentFrame = {};\\n\\nvar currentlyValidatingElement = null;\\n\\nfunction setCurrentlyValidatingElement(element) {\\n {\\n currentlyValidatingElement = element;\\n }\\n}\\n\\n{\\n // Stack implementation injected by the current renderer.\\n ReactDebugCurrentFrame.getCurrentStack = null;\\n\\n ReactDebugCurrentFrame.getStackAddendum = function () {\\n var stack = '';\\n\\n // Add an extra top frame while an element is being validated\\n if (currentlyValidatingElement) {\\n var name = getComponentName(currentlyValidatingElement.type);\\n var owner = currentlyValidatingElement._owner;\\n stack += describeComponentFrame(name, currentlyValidatingElement._source, owner && getComponentName(owner.type));\\n }\\n\\n // Delegate to the injected renderer-specific implementation\\n var impl = ReactDebugCurrentFrame.getCurrentStack;\\n if (impl) {\\n stack += impl() || '';\\n }\\n\\n return stack;\\n };\\n}\\n\\nvar ReactSharedInternals = {\\n ReactCurrentOwner: ReactCurrentOwner,\\n // Used by renderers to avoid bundling object-assign twice in UMD bundles:\\n assign: _assign\\n};\\n\\n{\\n _assign(ReactSharedInternals, {\\n // These should not be included in production.\\n ReactDebugCurrentFrame: ReactDebugCurrentFrame,\\n // Shim for React DOM 16.0.0 which still destructured (but not used) this.\\n // TODO: remove in React 17.0.\\n ReactComponentTreeHook: {}\\n });\\n}\\n\\n/**\\n * Similar to invariant but only logs a warning if the condition is not met.\\n * This can be used to log issues in development environments in critical\\n * paths. Removing the logging code for production environments will keep the\\n * same logic and follow the same code paths.\\n */\\n\\nvar warning = warningWithoutStack$1;\\n\\n{\\n warning = function (condition, format) {\\n if (condition) {\\n return;\\n }\\n var ReactDebugCurrentFrame = ReactSharedInternals.ReactDebugCurrentFrame;\\n var stack = ReactDebugCurrentFrame.getStackAddendum();\\n // eslint-disable-next-line react-internal/warning-and-invariant-args\\n\\n for (var _len = arguments.length, args = Array(_len > 2 ? _len - 2 : 0), _key = 2; _key < _len; _key++) {\\n args[_key - 2] = arguments[_key];\\n }\\n\\n warningWithoutStack$1.apply(undefined, [false, format + '%s'].concat(args, [stack]));\\n };\\n}\\n\\nvar warning$1 = warning;\\n\\nvar hasOwnProperty = Object.prototype.hasOwnProperty;\\n\\nvar RESERVED_PROPS = {\\n key: true,\\n ref: true,\\n __self: true,\\n __source: true\\n};\\n\\nvar specialPropKeyWarningShown = void 0;\\nvar specialPropRefWarningShown = void 0;\\n\\nfunction hasValidRef(config) {\\n {\\n if (hasOwnProperty.call(config, 'ref')) {\\n var getter = Object.getOwnPropertyDescriptor(config, 'ref').get;\\n if (getter && getter.isReactWarning) {\\n return false;\\n }\\n }\\n }\\n return config.ref !== undefined;\\n}\\n\\nfunction hasValidKey(config) {\\n {\\n if (hasOwnProperty.call(config, 'key')) {\\n var getter = Object.getOwnPropertyDescriptor(config, 'key').get;\\n if (getter && getter.isReactWarning) {\\n return false;\\n }\\n }\\n }\\n return config.key !== undefined;\\n}\\n\\nfunction defineKeyPropWarningGetter(props, displayName) {\\n var warnAboutAccessingKey = function () {\\n if (!specialPropKeyWarningShown) {\\n specialPropKeyWarningShown = true;\\n warningWithoutStack$1(false, '%s: `key` is not a prop. Trying to access it will result ' + 'in `undefined` being returned. If you need to access the same ' + 'value within the child component, you should pass it as a different ' + 'prop. (https://fb.me/react-special-props)', displayName);\\n }\\n };\\n warnAboutAccessingKey.isReactWarning = true;\\n Object.defineProperty(props, 'key', {\\n get: warnAboutAccessingKey,\\n configurable: true\\n });\\n}\\n\\nfunction defineRefPropWarningGetter(props, displayName) {\\n var warnAboutAccessingRef = function () {\\n if (!specialPropRefWarningShown) {\\n specialPropRefWarningShown = true;\\n warningWithoutStack$1(false, '%s: `ref` is not a prop. Trying to access it will result ' + 'in `undefined` being returned. If you need to access the same ' + 'value within the child component, you should pass it as a different ' + 'prop. (https://fb.me/react-special-props)', displayName);\\n }\\n };\\n warnAboutAccessingRef.isReactWarning = true;\\n Object.defineProperty(props, 'ref', {\\n get: warnAboutAccessingRef,\\n configurable: true\\n });\\n}\\n\\n/**\\n * Factory method to create a new React element. This no longer adheres to\\n * the class pattern, so do not use new to call it. Also, no instanceof check\\n * will work. Instead test $$typeof field against Symbol.for('react.element') to check\\n * if something is a React Element.\\n *\\n * @param {*} type\\n * @param {*} key\\n * @param {string|object} ref\\n * @param {*} self A *temporary* helper to detect places where `this` is\\n * different from the `owner` when React.createElement is called, so that we\\n * can warn. We want to get rid of owner and replace string `ref`s with arrow\\n * functions, and as long as `this` and owner are the same, there will be no\\n * change in behavior.\\n * @param {*} source An annotation object (added by a transpiler or otherwise)\\n * indicating filename, line number, and/or other information.\\n * @param {*} owner\\n * @param {*} props\\n * @internal\\n */\\nvar ReactElement = function (type, key, ref, self, source, owner, props) {\\n var element = {\\n // This tag allows us to uniquely identify this as a React Element\\n $$typeof: REACT_ELEMENT_TYPE,\\n\\n // Built-in properties that belong on the element\\n type: type,\\n key: key,\\n ref: ref,\\n props: props,\\n\\n // Record the component responsible for creating this element.\\n _owner: owner\\n };\\n\\n {\\n // The validation flag is currently mutative. We put it on\\n // an external backing store so that we can freeze the whole object.\\n // This can be replaced with a WeakMap once they are implemented in\\n // commonly used development environments.\\n element._store = {};\\n\\n // To make comparing ReactElements easier for testing purposes, we make\\n // the validation flag non-enumerable (where possible, which should\\n // include every environment we run tests in), so the test framework\\n // ignores it.\\n Object.defineProperty(element._store, 'validated', {\\n configurable: false,\\n enumerable: false,\\n writable: true,\\n value: false\\n });\\n // self and source are DEV only properties.\\n Object.defineProperty(element, '_self', {\\n configurable: false,\\n enumerable: false,\\n writable: false,\\n value: self\\n });\\n // Two elements created in two different places should be considered\\n // equal for testing purposes and therefore we hide it from enumeration.\\n Object.defineProperty(element, '_source', {\\n configurable: false,\\n enumerable: false,\\n writable: false,\\n value: source\\n });\\n if (Object.freeze) {\\n Object.freeze(element.props);\\n Object.freeze(element);\\n }\\n }\\n\\n return element;\\n};\\n\\n/**\\n * Create and return a new ReactElement of the given type.\\n * See https://reactjs.org/docs/react-api.html#createelement\\n */\\nfunction createElement(type, config, children) {\\n var propName = void 0;\\n\\n // Reserved names are extracted\\n var props = {};\\n\\n var key = null;\\n var ref = null;\\n var self = null;\\n var source = null;\\n\\n if (config != null) {\\n if (hasValidRef(config)) {\\n ref = config.ref;\\n }\\n if (hasValidKey(config)) {\\n key = '' + config.key;\\n }\\n\\n self = config.__self === undefined ? null : config.__self;\\n source = config.__source === undefined ? null : config.__source;\\n // Remaining properties are added to a new props object\\n for (propName in config) {\\n if (hasOwnProperty.call(config, propName) && !RESERVED_PROPS.hasOwnProperty(propName)) {\\n props[propName] = config[propName];\\n }\\n }\\n }\\n\\n // Children can be more than one argument, and those are transferred onto\\n // the newly allocated props object.\\n var childrenLength = arguments.length - 2;\\n if (childrenLength === 1) {\\n props.children = children;\\n } else if (childrenLength > 1) {\\n var childArray = Array(childrenLength);\\n for (var i = 0; i < childrenLength; i++) {\\n childArray[i] = arguments[i + 2];\\n }\\n {\\n if (Object.freeze) {\\n Object.freeze(childArray);\\n }\\n }\\n props.children = childArray;\\n }\\n\\n // Resolve default props\\n if (type && type.defaultProps) {\\n var defaultProps = type.defaultProps;\\n for (propName in defaultProps) {\\n if (props[propName] === undefined) {\\n props[propName] = defaultProps[propName];\\n }\\n }\\n }\\n {\\n if (key || ref) {\\n var displayName = typeof type === 'function' ? type.displayName || type.name || 'Unknown' : type;\\n if (key) {\\n defineKeyPropWarningGetter(props, displayName);\\n }\\n if (ref) {\\n defineRefPropWarningGetter(props, displayName);\\n }\\n }\\n }\\n return ReactElement(type, key, ref, self, source, ReactCurrentOwner.current, props);\\n}\\n\\n/**\\n * Return a function that produces ReactElements of a given type.\\n * See https://reactjs.org/docs/react-api.html#createfactory\\n */\\n\\n\\nfunction cloneAndReplaceKey(oldElement, newKey) {\\n var newElement = ReactElement(oldElement.type, newKey, oldElement.ref, oldElement._self, oldElement._source, oldElement._owner, oldElement.props);\\n\\n return newElement;\\n}\\n\\n/**\\n * Clone and return a new ReactElement using element as the starting point.\\n * See https://reactjs.org/docs/react-api.html#cloneelement\\n */\\nfunction cloneElement(element, config, children) {\\n !!(element === null || element === undefined) ? invariant(false, 'React.cloneElement(...): The argument must be a React element, but you passed %s.', element) : void 0;\\n\\n var propName = void 0;\\n\\n // Original props are copied\\n var props = _assign({}, element.props);\\n\\n // Reserved names are extracted\\n var key = element.key;\\n var ref = element.ref;\\n // Self is preserved since the owner is preserved.\\n var self = element._self;\\n // Source is preserved since cloneElement is unlikely to be targeted by a\\n // transpiler, and the original source is probably a better indicator of the\\n // true owner.\\n var source = element._source;\\n\\n // Owner will be preserved, unless ref is overridden\\n var owner = element._owner;\\n\\n if (config != null) {\\n if (hasValidRef(config)) {\\n // Silently steal the ref from the parent.\\n ref = config.ref;\\n owner = ReactCurrentOwner.current;\\n }\\n if (hasValidKey(config)) {\\n key = '' + config.key;\\n }\\n\\n // Remaining properties override existing props\\n var defaultProps = void 0;\\n if (element.type && element.type.defaultProps) {\\n defaultProps = element.type.defaultProps;\\n }\\n for (propName in config) {\\n if (hasOwnProperty.call(config, propName) && !RESERVED_PROPS.hasOwnProperty(propName)) {\\n if (config[propName] === undefined && defaultProps !== undefined) {\\n // Resolve default props\\n props[propName] = defaultProps[propName];\\n } else {\\n props[propName] = config[propName];\\n }\\n }\\n }\\n }\\n\\n // Children can be more than one argument, and those are transferred onto\\n // the newly allocated props object.\\n var childrenLength = arguments.length - 2;\\n if (childrenLength === 1) {\\n props.children = children;\\n } else if (childrenLength > 1) {\\n var childArray = Array(childrenLength);\\n for (var i = 0; i < childrenLength; i++) {\\n childArray[i] = arguments[i + 2];\\n }\\n props.children = childArray;\\n }\\n\\n return ReactElement(element.type, key, ref, self, source, owner, props);\\n}\\n\\n/**\\n * Verifies the object is a ReactElement.\\n * See https://reactjs.org/docs/react-api.html#isvalidelement\\n * @param {?object} object\\n * @return {boolean} True if `object` is a ReactElement.\\n * @final\\n */\\nfunction isValidElement(object) {\\n return typeof object === 'object' && object !== null && object.$$typeof === REACT_ELEMENT_TYPE;\\n}\\n\\nvar SEPARATOR = '.';\\nvar SUBSEPARATOR = ':';\\n\\n/**\\n * Escape and wrap key so it is safe to use as a reactid\\n *\\n * @param {string} key to be escaped.\\n * @return {string} the escaped key.\\n */\\nfunction escape(key) {\\n var escapeRegex = /[=:]/g;\\n var escaperLookup = {\\n '=': '=0',\\n ':': '=2'\\n };\\n var escapedString = ('' + key).replace(escapeRegex, function (match) {\\n return escaperLookup[match];\\n });\\n\\n return '$' + escapedString;\\n}\\n\\n/**\\n * TODO: Test that a single child and an array with one item have the same key\\n * pattern.\\n */\\n\\nvar didWarnAboutMaps = false;\\n\\nvar userProvidedKeyEscapeRegex = /\\\\/+/g;\\nfunction escapeUserProvidedKey(text) {\\n return ('' + text).replace(userProvidedKeyEscapeRegex, '$&/');\\n}\\n\\nvar POOL_SIZE = 10;\\nvar traverseContextPool = [];\\nfunction getPooledTraverseContext(mapResult, keyPrefix, mapFunction, mapContext) {\\n if (traverseContextPool.length) {\\n var traverseContext = traverseContextPool.pop();\\n traverseContext.result = mapResult;\\n traverseContext.keyPrefix = keyPrefix;\\n traverseContext.func = mapFunction;\\n traverseContext.context = mapContext;\\n traverseContext.count = 0;\\n return traverseContext;\\n } else {\\n return {\\n result: mapResult,\\n keyPrefix: keyPrefix,\\n func: mapFunction,\\n context: mapContext,\\n count: 0\\n };\\n }\\n}\\n\\nfunction releaseTraverseContext(traverseContext) {\\n traverseContext.result = null;\\n traverseContext.keyPrefix = null;\\n traverseContext.func = null;\\n traverseContext.context = null;\\n traverseContext.count = 0;\\n if (traverseContextPool.length < POOL_SIZE) {\\n traverseContextPool.push(traverseContext);\\n }\\n}\\n\\n/**\\n * @param {?*} children Children tree container.\\n * @param {!string} nameSoFar Name of the key path so far.\\n * @param {!function} callback Callback to invoke with each child found.\\n * @param {?*} traverseContext Used to pass information throughout the traversal\\n * process.\\n * @return {!number} The number of children in this subtree.\\n */\\nfunction traverseAllChildrenImpl(children, nameSoFar, callback, traverseContext) {\\n var type = typeof children;\\n\\n if (type === 'undefined' || type === 'boolean') {\\n // All of the above are perceived as null.\\n children = null;\\n }\\n\\n var invokeCallback = false;\\n\\n if (children === null) {\\n invokeCallback = true;\\n } else {\\n switch (type) {\\n case 'string':\\n case 'number':\\n invokeCallback = true;\\n break;\\n case 'object':\\n switch (children.$$typeof) {\\n case REACT_ELEMENT_TYPE:\\n case REACT_PORTAL_TYPE:\\n invokeCallback = true;\\n }\\n }\\n }\\n\\n if (invokeCallback) {\\n callback(traverseContext, children,\\n // If it's the only child, treat the name as if it was wrapped in an array\\n // so that it's consistent if the number of children grows.\\n nameSoFar === '' ? SEPARATOR + getComponentKey(children, 0) : nameSoFar);\\n return 1;\\n }\\n\\n var child = void 0;\\n var nextName = void 0;\\n var subtreeCount = 0; // Count of children found in the current subtree.\\n var nextNamePrefix = nameSoFar === '' ? SEPARATOR : nameSoFar + SUBSEPARATOR;\\n\\n if (Array.isArray(children)) {\\n for (var i = 0; i < children.length; i++) {\\n child = children[i];\\n nextName = nextNamePrefix + getComponentKey(child, i);\\n subtreeCount += traverseAllChildrenImpl(child, nextName, callback, traverseContext);\\n }\\n } else {\\n var iteratorFn = getIteratorFn(children);\\n if (typeof iteratorFn === 'function') {\\n {\\n // Warn about using Maps as children\\n if (iteratorFn === children.entries) {\\n !didWarnAboutMaps ? warning$1(false, 'Using Maps as children is unsupported and will likely yield ' + 'unexpected results. Convert it to a sequence/iterable of keyed ' + 'ReactElements instead.') : void 0;\\n didWarnAboutMaps = true;\\n }\\n }\\n\\n var iterator = iteratorFn.call(children);\\n var step = void 0;\\n var ii = 0;\\n while (!(step = iterator.next()).done) {\\n child = step.value;\\n nextName = nextNamePrefix + getComponentKey(child, ii++);\\n subtreeCount += traverseAllChildrenImpl(child, nextName, callback, traverseContext);\\n }\\n } else if (type === 'object') {\\n var addendum = '';\\n {\\n addendum = ' If you meant to render a collection of children, use an array ' + 'instead.' + ReactDebugCurrentFrame.getStackAddendum();\\n }\\n var childrenString = '' + children;\\n invariant(false, 'Objects are not valid as a React child (found: %s).%s', childrenString === '[object Object]' ? 'object with keys {' + Object.keys(children).join(', ') + '}' : childrenString, addendum);\\n }\\n }\\n\\n return subtreeCount;\\n}\\n\\n/**\\n * Traverses children that are typically specified as `props.children`, but\\n * might also be specified through attributes:\\n *\\n * - `traverseAllChildren(this.props.children, ...)`\\n * - `traverseAllChildren(this.props.leftPanelChildren, ...)`\\n *\\n * The `traverseContext` is an optional argument that is passed through the\\n * entire traversal. It can be used to store accumulations or anything else that\\n * the callback might find relevant.\\n *\\n * @param {?*} children Children tree object.\\n * @param {!function} callback To invoke upon traversing each child.\\n * @param {?*} traverseContext Context for traversal.\\n * @return {!number} The number of children in this subtree.\\n */\\nfunction traverseAllChildren(children, callback, traverseContext) {\\n if (children == null) {\\n return 0;\\n }\\n\\n return traverseAllChildrenImpl(children, '', callback, traverseContext);\\n}\\n\\n/**\\n * Generate a key string that identifies a component within a set.\\n *\\n * @param {*} component A component that could contain a manual key.\\n * @param {number} index Index that is used if a manual key is not provided.\\n * @return {string}\\n */\\nfunction getComponentKey(component, index) {\\n // Do some typechecking here since we call this blindly. We want to ensure\\n // that we don't block potential future ES APIs.\\n if (typeof component === 'object' && component !== null && component.key != null) {\\n // Explicit key\\n return escape(component.key);\\n }\\n // Implicit key determined by the index in the set\\n return index.toString(36);\\n}\\n\\nfunction forEachSingleChild(bookKeeping, child, name) {\\n var func = bookKeeping.func,\\n context = bookKeeping.context;\\n\\n func.call(context, child, bookKeeping.count++);\\n}\\n\\n/**\\n * Iterates through children that are typically specified as `props.children`.\\n *\\n * See https://reactjs.org/docs/react-api.html#reactchildrenforeach\\n *\\n * The provided forEachFunc(child, index) will be called for each\\n * leaf child.\\n *\\n * @param {?*} children Children tree container.\\n * @param {function(*, int)} forEachFunc\\n * @param {*} forEachContext Context for forEachContext.\\n */\\nfunction forEachChildren(children, forEachFunc, forEachContext) {\\n if (children == null) {\\n return children;\\n }\\n var traverseContext = getPooledTraverseContext(null, null, forEachFunc, forEachContext);\\n traverseAllChildren(children, forEachSingleChild, traverseContext);\\n releaseTraverseContext(traverseContext);\\n}\\n\\nfunction mapSingleChildIntoContext(bookKeeping, child, childKey) {\\n var result = bookKeeping.result,\\n keyPrefix = bookKeeping.keyPrefix,\\n func = bookKeeping.func,\\n context = bookKeeping.context;\\n\\n\\n var mappedChild = func.call(context, child, bookKeeping.count++);\\n if (Array.isArray(mappedChild)) {\\n mapIntoWithKeyPrefixInternal(mappedChild, result, childKey, function (c) {\\n return c;\\n });\\n } else if (mappedChild != null) {\\n if (isValidElement(mappedChild)) {\\n mappedChild = cloneAndReplaceKey(mappedChild,\\n // Keep both the (mapped) and old keys if they differ, just as\\n // traverseAllChildren used to do for objects as children\\n keyPrefix + (mappedChild.key && (!child || child.key !== mappedChild.key) ? escapeUserProvidedKey(mappedChild.key) + '/' : '') + childKey);\\n }\\n result.push(mappedChild);\\n }\\n}\\n\\nfunction mapIntoWithKeyPrefixInternal(children, array, prefix, func, context) {\\n var escapedPrefix = '';\\n if (prefix != null) {\\n escapedPrefix = escapeUserProvidedKey(prefix) + '/';\\n }\\n var traverseContext = getPooledTraverseContext(array, escapedPrefix, func, context);\\n traverseAllChildren(children, mapSingleChildIntoContext, traverseContext);\\n releaseTraverseContext(traverseContext);\\n}\\n\\n/**\\n * Maps children that are typically specified as `props.children`.\\n *\\n * See https://reactjs.org/docs/react-api.html#reactchildrenmap\\n *\\n * The provided mapFunction(child, key, index) will be called for each\\n * leaf child.\\n *\\n * @param {?*} children Children tree container.\\n * @param {function(*, int)} func The map function.\\n * @param {*} context Context for mapFunction.\\n * @return {object} Object containing the ordered map of results.\\n */\\nfunction mapChildren(children, func, context) {\\n if (children == null) {\\n return children;\\n }\\n var result = [];\\n mapIntoWithKeyPrefixInternal(children, result, null, func, context);\\n return result;\\n}\\n\\n/**\\n * Count the number of children that are typically specified as\\n * `props.children`.\\n *\\n * See https://reactjs.org/docs/react-api.html#reactchildrencount\\n *\\n * @param {?*} children Children tree container.\\n * @return {number} The number of children.\\n */\\nfunction countChildren(children) {\\n return traverseAllChildren(children, function () {\\n return null;\\n }, null);\\n}\\n\\n/**\\n * Flatten a children object (typically specified as `props.children`) and\\n * return an array with appropriately re-keyed children.\\n *\\n * See https://reactjs.org/docs/react-api.html#reactchildrentoarray\\n */\\nfunction toArray(children) {\\n var result = [];\\n mapIntoWithKeyPrefixInternal(children, result, null, function (child) {\\n return child;\\n });\\n return result;\\n}\\n\\n/**\\n * Returns the first child in a collection of children and verifies that there\\n * is only one child in the collection.\\n *\\n * See https://reactjs.org/docs/react-api.html#reactchildrenonly\\n *\\n * The current implementation of this function assumes that a single child gets\\n * passed without a wrapper, but the purpose of this helper function is to\\n * abstract away the particular structure of children.\\n *\\n * @param {?object} children Child collection structure.\\n * @return {ReactElement} The first and only `ReactElement` contained in the\\n * structure.\\n */\\nfunction onlyChild(children) {\\n !isValidElement(children) ? invariant(false, 'React.Children.only expected to receive a single React element child.') : void 0;\\n return children;\\n}\\n\\nfunction createContext(defaultValue, calculateChangedBits) {\\n if (calculateChangedBits === undefined) {\\n calculateChangedBits = null;\\n } else {\\n {\\n !(calculateChangedBits === null || typeof calculateChangedBits === 'function') ? warningWithoutStack$1(false, 'createContext: Expected the optional second argument to be a ' + 'function. Instead received: %s', calculateChangedBits) : void 0;\\n }\\n }\\n\\n var context = {\\n $$typeof: REACT_CONTEXT_TYPE,\\n _calculateChangedBits: calculateChangedBits,\\n // As a workaround to support multiple concurrent renderers, we categorize\\n // some renderers as primary and others as secondary. We only expect\\n // there to be two concurrent renderers at most: React Native (primary) and\\n // Fabric (secondary); React DOM (primary) and React ART (secondary).\\n // Secondary renderers store their context values on separate fields.\\n _currentValue: defaultValue,\\n _currentValue2: defaultValue,\\n // Used to track how many concurrent renderers this context currently\\n // supports within in a single renderer. Such as parallel server rendering.\\n _threadCount: 0,\\n // These are circular\\n Provider: null,\\n Consumer: null\\n };\\n\\n context.Provider = {\\n $$typeof: REACT_PROVIDER_TYPE,\\n _context: context\\n };\\n\\n var hasWarnedAboutUsingNestedContextConsumers = false;\\n var hasWarnedAboutUsingConsumerProvider = false;\\n\\n {\\n // A separate object, but proxies back to the original context object for\\n // backwards compatibility. It has a different $$typeof, so we can properly\\n // warn for the incorrect usage of Context as a Consumer.\\n var Consumer = {\\n $$typeof: REACT_CONTEXT_TYPE,\\n _context: context,\\n _calculateChangedBits: context._calculateChangedBits\\n };\\n // $FlowFixMe: Flow complains about not setting a value, which is intentional here\\n Object.defineProperties(Consumer, {\\n Provider: {\\n get: function () {\\n if (!hasWarnedAboutUsingConsumerProvider) {\\n hasWarnedAboutUsingConsumerProvider = true;\\n warning$1(false, 'Rendering <Context.Consumer.Provider> is not supported and will be removed in ' + 'a future major release. Did you mean to render <Context.Provider> instead?');\\n }\\n return context.Provider;\\n },\\n set: function (_Provider) {\\n context.Provider = _Provider;\\n }\\n },\\n _currentValue: {\\n get: function () {\\n return context._currentValue;\\n },\\n set: function (_currentValue) {\\n context._currentValue = _currentValue;\\n }\\n },\\n _currentValue2: {\\n get: function () {\\n return context._currentValue2;\\n },\\n set: function (_currentValue2) {\\n context._currentValue2 = _currentValue2;\\n }\\n },\\n _threadCount: {\\n get: function () {\\n return context._threadCount;\\n },\\n set: function (_threadCount) {\\n context._threadCount = _threadCount;\\n }\\n },\\n Consumer: {\\n get: function () {\\n if (!hasWarnedAboutUsingNestedContextConsumers) {\\n hasWarnedAboutUsingNestedContextConsumers = true;\\n warning$1(false, 'Rendering <Context.Consumer.Consumer> is not supported and will be removed in ' + 'a future major release. Did you mean to render <Context.Consumer> instead?');\\n }\\n return context.Consumer;\\n }\\n }\\n });\\n // $FlowFixMe: Flow complains about missing properties because it doesn't understand defineProperty\\n context.Consumer = Consumer;\\n }\\n\\n {\\n context._currentRenderer = null;\\n context._currentRenderer2 = null;\\n }\\n\\n return context;\\n}\\n\\nfunction lazy(ctor) {\\n var lazyType = {\\n $$typeof: REACT_LAZY_TYPE,\\n _ctor: ctor,\\n // React uses these fields to store the result.\\n _status: -1,\\n _result: null\\n };\\n\\n {\\n // In production, this would just set it on the object.\\n var defaultProps = void 0;\\n var propTypes = void 0;\\n Object.defineProperties(lazyType, {\\n defaultProps: {\\n configurable: true,\\n get: function () {\\n return defaultProps;\\n },\\n set: function (newDefaultProps) {\\n warning$1(false, 'React.lazy(...): It is not supported to assign `defaultProps` to ' + 'a lazy component import. Either specify them where the component ' + 'is defined, or create a wrapping component around it.');\\n defaultProps = newDefaultProps;\\n // Match production behavior more closely:\\n Object.defineProperty(lazyType, 'defaultProps', {\\n enumerable: true\\n });\\n }\\n },\\n propTypes: {\\n configurable: true,\\n get: function () {\\n return propTypes;\\n },\\n set: function (newPropTypes) {\\n warning$1(false, 'React.lazy(...): It is not supported to assign `propTypes` to ' + 'a lazy component import. Either specify them where the component ' + 'is defined, or create a wrapping component around it.');\\n propTypes = newPropTypes;\\n // Match production behavior more closely:\\n Object.defineProperty(lazyType, 'propTypes', {\\n enumerable: true\\n });\\n }\\n }\\n });\\n }\\n\\n return lazyType;\\n}\\n\\nfunction forwardRef(render) {\\n {\\n if (render != null && render.$$typeof === REACT_MEMO_TYPE) {\\n warningWithoutStack$1(false, 'forwardRef requires a render function but received a `memo` ' + 'component. Instead of forwardRef(memo(...)), use ' + 'memo(forwardRef(...)).');\\n } else if (typeof render !== 'function') {\\n warningWithoutStack$1(false, 'forwardRef requires a render function but was given %s.', render === null ? 'null' : typeof render);\\n } else {\\n !(\\n // Do not warn for 0 arguments because it could be due to usage of the 'arguments' object\\n render.length === 0 || render.length === 2) ? warningWithoutStack$1(false, 'forwardRef render functions accept exactly two parameters: props and ref. %s', render.length === 1 ? 'Did you forget to use the ref parameter?' : 'Any additional parameter will be undefined.') : void 0;\\n }\\n\\n if (render != null) {\\n !(render.defaultProps == null && render.propTypes == null) ? warningWithoutStack$1(false, 'forwardRef render functions do not support propTypes or defaultProps. ' + 'Did you accidentally pass a React component?') : void 0;\\n }\\n }\\n\\n return {\\n $$typeof: REACT_FORWARD_REF_TYPE,\\n render: render\\n };\\n}\\n\\nfunction isValidElementType(type) {\\n return typeof type === 'string' || typeof type === 'function' ||\\n // Note: its typeof might be other than 'symbol' or 'number' if it's a polyfill.\\n type === REACT_FRAGMENT_TYPE || type === REACT_CONCURRENT_MODE_TYPE || type === REACT_PROFILER_TYPE || type === REACT_STRICT_MODE_TYPE || type === REACT_SUSPENSE_TYPE || typeof type === 'object' && type !== null && (type.$$typeof === REACT_LAZY_TYPE || type.$$typeof === REACT_MEMO_TYPE || type.$$typeof === REACT_PROVIDER_TYPE || type.$$typeof === REACT_CONTEXT_TYPE || type.$$typeof === REACT_FORWARD_REF_TYPE);\\n}\\n\\nfunction memo(type, compare) {\\n {\\n if (!isValidElementType(type)) {\\n warningWithoutStack$1(false, 'memo: The first argument must be a component. Instead ' + 'received: %s', type === null ? 'null' : typeof type);\\n }\\n }\\n return {\\n $$typeof: REACT_MEMO_TYPE,\\n type: type,\\n compare: compare === undefined ? null : compare\\n };\\n}\\n\\nfunction resolveDispatcher() {\\n var dispatcher = ReactCurrentOwner.currentDispatcher;\\n !(dispatcher !== null) ? invariant(false, 'Hooks can only be called inside the body of a function component.') : void 0;\\n return dispatcher;\\n}\\n\\nfunction useContext(Context, observedBits) {\\n var dispatcher = resolveDispatcher();\\n {\\n // TODO: add a more generic warning for invalid values.\\n if (Context._context !== undefined) {\\n var realContext = Context._context;\\n // Don't deduplicate because this legitimately causes bugs\\n // and nobody should be using this in existing code.\\n if (realContext.Consumer === Context) {\\n warning$1(false, 'Calling useContext(Context.Consumer) is not supported, may cause bugs, and will be ' + 'removed in a future major release. Did you mean to call useContext(Context) instead?');\\n } else if (realContext.Provider === Context) {\\n warning$1(false, 'Calling useContext(Context.Provider) is not supported. ' + 'Did you mean to call useContext(Context) instead?');\\n }\\n }\\n }\\n return dispatcher.useContext(Context, observedBits);\\n}\\n\\nfunction useState(initialState) {\\n var dispatcher = resolveDispatcher();\\n return dispatcher.useState(initialState);\\n}\\n\\nfunction useReducer(reducer, initialState, initialAction) {\\n var dispatcher = resolveDispatcher();\\n return dispatcher.useReducer(reducer, initialState, initialAction);\\n}\\n\\nfunction useRef(initialValue) {\\n var dispatcher = resolveDispatcher();\\n return dispatcher.useRef(initialValue);\\n}\\n\\nfunction useEffect(create, inputs) {\\n var dispatcher = resolveDispatcher();\\n return dispatcher.useEffect(create, inputs);\\n}\\n\\nfunction useLayoutEffect(create, inputs) {\\n var dispatcher = resolveDispatcher();\\n return dispatcher.useLayoutEffect(create, inputs);\\n}\\n\\nfunction useCallback(callback, inputs) {\\n var dispatcher = resolveDispatcher();\\n return dispatcher.useCallback(callback, inputs);\\n}\\n\\nfunction useMemo(create, inputs) {\\n var dispatcher = resolveDispatcher();\\n return dispatcher.useMemo(create, inputs);\\n}\\n\\nfunction useImperativeMethods(ref, create, inputs) {\\n var dispatcher = resolveDispatcher();\\n return dispatcher.useImperativeMethods(ref, create, inputs);\\n}\\n\\n/**\\n * ReactElementValidator provides a wrapper around a element factory\\n * which validates the props passed to the element. This is intended to be\\n * used only in DEV and could be replaced by a static type checker for languages\\n * that support it.\\n */\\n\\nvar propTypesMisspellWarningShown = void 0;\\n\\n{\\n propTypesMisspellWarningShown = false;\\n}\\n\\nfunction getDeclarationErrorAddendum() {\\n if (ReactCurrentOwner.current) {\\n var name = getComponentName(ReactCurrentOwner.current.type);\\n if (name) {\\n return '\\\\n\\\\nCheck the render method of `' + name + '`.';\\n }\\n }\\n return '';\\n}\\n\\nfunction getSourceInfoErrorAddendum(elementProps) {\\n if (elementProps !== null && elementProps !== undefined && elementProps.__source !== undefined) {\\n var source = elementProps.__source;\\n var fileName = source.fileName.replace(/^.*[\\\\\\\\\\\\/]/, '');\\n var lineNumber = source.lineNumber;\\n return '\\\\n\\\\nCheck your code at ' + fileName + ':' + lineNumber + '.';\\n }\\n return '';\\n}\\n\\n/**\\n * Warn if there's no key explicitly set on dynamic arrays of children or\\n * object keys are not valid. This allows us to keep track of children between\\n * updates.\\n */\\nvar ownerHasKeyUseWarning = {};\\n\\nfunction getCurrentComponentErrorInfo(parentType) {\\n var info = getDeclarationErrorAddendum();\\n\\n if (!info) {\\n var parentName = typeof parentType === 'string' ? parentType : parentType.displayName || parentType.name;\\n if (parentName) {\\n info = '\\\\n\\\\nCheck the top-level render call using <' + parentName + '>.';\\n }\\n }\\n return info;\\n}\\n\\n/**\\n * Warn if the element doesn't have an explicit key assigned to it.\\n * This element is in an array. The array could grow and shrink or be\\n * reordered. All children that haven't already been validated are required to\\n * have a \\\"key\\\" property assigned to it. Error statuses are cached so a warning\\n * will only be shown once.\\n *\\n * @internal\\n * @param {ReactElement} element Element that requires a key.\\n * @param {*} parentType element's parent's type.\\n */\\nfunction validateExplicitKey(element, parentType) {\\n if (!element._store || element._store.validated || element.key != null) {\\n return;\\n }\\n element._store.validated = true;\\n\\n var currentComponentErrorInfo = getCurrentComponentErrorInfo(parentType);\\n if (ownerHasKeyUseWarning[currentComponentErrorInfo]) {\\n return;\\n }\\n ownerHasKeyUseWarning[currentComponentErrorInfo] = true;\\n\\n // Usually the current owner is the offender, but if it accepts children as a\\n // property, it may be the creator of the child that's responsible for\\n // assigning it a key.\\n var childOwner = '';\\n if (element && element._owner && element._owner !== ReactCurrentOwner.current) {\\n // Give the component that originally created this child.\\n childOwner = ' It was passed a child from ' + getComponentName(element._owner.type) + '.';\\n }\\n\\n setCurrentlyValidatingElement(element);\\n {\\n warning$1(false, 'Each child in an array or iterator should have a unique \\\"key\\\" prop.' + '%s%s See https://fb.me/react-warning-keys for more information.', currentComponentErrorInfo, childOwner);\\n }\\n setCurrentlyValidatingElement(null);\\n}\\n\\n/**\\n * Ensure that every element either is passed in a static location, in an\\n * array with an explicit keys property defined, or in an object literal\\n * with valid key property.\\n *\\n * @internal\\n * @param {ReactNode} node Statically passed child of any type.\\n * @param {*} parentType node's parent's type.\\n */\\nfunction validateChildKeys(node, parentType) {\\n if (typeof node !== 'object') {\\n return;\\n }\\n if (Array.isArray(node)) {\\n for (var i = 0; i < node.length; i++) {\\n var child = node[i];\\n if (isValidElement(child)) {\\n validateExplicitKey(child, parentType);\\n }\\n }\\n } else if (isValidElement(node)) {\\n // This element was passed in a valid location.\\n if (node._store) {\\n node._store.validated = true;\\n }\\n } else if (node) {\\n var iteratorFn = getIteratorFn(node);\\n if (typeof iteratorFn === 'function') {\\n // Entry iterators used to provide implicit keys,\\n // but now we print a separate warning for them later.\\n if (iteratorFn !== node.entries) {\\n var iterator = iteratorFn.call(node);\\n var step = void 0;\\n while (!(step = iterator.next()).done) {\\n if (isValidElement(step.value)) {\\n validateExplicitKey(step.value, parentType);\\n }\\n }\\n }\\n }\\n }\\n}\\n\\n/**\\n * Given an element, validate that its props follow the propTypes definition,\\n * provided by the type.\\n *\\n * @param {ReactElement} element\\n */\\nfunction validatePropTypes(element) {\\n var type = element.type;\\n if (type === null || type === undefined || typeof type === 'string') {\\n return;\\n }\\n var name = getComponentName(type);\\n var propTypes = void 0;\\n if (typeof type === 'function') {\\n propTypes = type.propTypes;\\n } else if (typeof type === 'object' && (type.$$typeof === REACT_FORWARD_REF_TYPE ||\\n // Note: Memo only checks outer props here.\\n // Inner props are checked in the reconciler.\\n type.$$typeof === REACT_MEMO_TYPE)) {\\n propTypes = type.propTypes;\\n } else {\\n return;\\n }\\n if (propTypes) {\\n setCurrentlyValidatingElement(element);\\n checkPropTypes(propTypes, element.props, 'prop', name, ReactDebugCurrentFrame.getStackAddendum);\\n setCurrentlyValidatingElement(null);\\n } else if (type.PropTypes !== undefined && !propTypesMisspellWarningShown) {\\n propTypesMisspellWarningShown = true;\\n warningWithoutStack$1(false, 'Component %s declared `PropTypes` instead of `propTypes`. Did you misspell the property assignment?', name || 'Unknown');\\n }\\n if (typeof type.getDefaultProps === 'function') {\\n !type.getDefaultProps.isReactClassApproved ? warningWithoutStack$1(false, 'getDefaultProps is only used on classic React.createClass ' + 'definitions. Use a static property named `defaultProps` instead.') : void 0;\\n }\\n}\\n\\n/**\\n * Given a fragment, validate that it can only be provided with fragment props\\n * @param {ReactElement} fragment\\n */\\nfunction validateFragmentProps(fragment) {\\n setCurrentlyValidatingElement(fragment);\\n\\n var keys = Object.keys(fragment.props);\\n for (var i = 0; i < keys.length; i++) {\\n var key = keys[i];\\n if (key !== 'children' && key !== 'key') {\\n warning$1(false, 'Invalid prop `%s` supplied to `React.Fragment`. ' + 'React.Fragment can only have `key` and `children` props.', key);\\n break;\\n }\\n }\\n\\n if (fragment.ref !== null) {\\n warning$1(false, 'Invalid attribute `ref` supplied to `React.Fragment`.');\\n }\\n\\n setCurrentlyValidatingElement(null);\\n}\\n\\nfunction createElementWithValidation(type, props, children) {\\n var validType = isValidElementType(type);\\n\\n // We warn in this case but don't throw. We expect the element creation to\\n // succeed and there will likely be errors in render.\\n if (!validType) {\\n var info = '';\\n if (type === undefined || typeof type === 'object' && type !== null && Object.keys(type).length === 0) {\\n info += ' You likely forgot to export your component from the file ' + \\\"it's defined in, or you might have mixed up default and named imports.\\\";\\n }\\n\\n var sourceInfo = getSourceInfoErrorAddendum(props);\\n if (sourceInfo) {\\n info += sourceInfo;\\n } else {\\n info += getDeclarationErrorAddendum();\\n }\\n\\n var typeString = void 0;\\n if (type === null) {\\n typeString = 'null';\\n } else if (Array.isArray(type)) {\\n typeString = 'array';\\n } else if (type !== undefined && type.$$typeof === REACT_ELEMENT_TYPE) {\\n typeString = '<' + (getComponentName(type.type) || 'Unknown') + ' />';\\n info = ' Did you accidentally export a JSX literal instead of a component?';\\n } else {\\n typeString = typeof type;\\n }\\n\\n warning$1(false, 'React.createElement: type is invalid -- expected a string (for ' + 'built-in components) or a class/function (for composite ' + 'components) but got: %s.%s', typeString, info);\\n }\\n\\n var element = createElement.apply(this, arguments);\\n\\n // The result can be nullish if a mock or a custom function is used.\\n // TODO: Drop this when these are no longer allowed as the type argument.\\n if (element == null) {\\n return element;\\n }\\n\\n // Skip key warning if the type isn't valid since our key validation logic\\n // doesn't expect a non-string/function type and can throw confusing errors.\\n // We don't want exception behavior to differ between dev and prod.\\n // (Rendering will throw with a helpful message and as soon as the type is\\n // fixed, the key warnings will appear.)\\n if (validType) {\\n for (var i = 2; i < arguments.length; i++) {\\n validateChildKeys(arguments[i], type);\\n }\\n }\\n\\n if (type === REACT_FRAGMENT_TYPE) {\\n validateFragmentProps(element);\\n } else {\\n validatePropTypes(element);\\n }\\n\\n return element;\\n}\\n\\nfunction createFactoryWithValidation(type) {\\n var validatedFactory = createElementWithValidation.bind(null, type);\\n validatedFactory.type = type;\\n // Legacy hook: remove it\\n {\\n Object.defineProperty(validatedFactory, 'type', {\\n enumerable: false,\\n get: function () {\\n lowPriorityWarning$1(false, 'Factory.type is deprecated. Access the class directly ' + 'before passing it to createFactory.');\\n Object.defineProperty(this, 'type', {\\n value: type\\n });\\n return type;\\n }\\n });\\n }\\n\\n return validatedFactory;\\n}\\n\\nfunction cloneElementWithValidation(element, props, children) {\\n var newElement = cloneElement.apply(this, arguments);\\n for (var i = 2; i < arguments.length; i++) {\\n validateChildKeys(arguments[i], newElement.type);\\n }\\n validatePropTypes(newElement);\\n return newElement;\\n}\\n\\nvar React = {\\n Children: {\\n map: mapChildren,\\n forEach: forEachChildren,\\n count: countChildren,\\n toArray: toArray,\\n only: onlyChild\\n },\\n\\n createRef: createRef,\\n Component: Component,\\n PureComponent: PureComponent,\\n\\n createContext: createContext,\\n forwardRef: forwardRef,\\n lazy: lazy,\\n memo: memo,\\n\\n Fragment: REACT_FRAGMENT_TYPE,\\n StrictMode: REACT_STRICT_MODE_TYPE,\\n Suspense: REACT_SUSPENSE_TYPE,\\n\\n createElement: createElementWithValidation,\\n cloneElement: cloneElementWithValidation,\\n createFactory: createFactoryWithValidation,\\n isValidElement: isValidElement,\\n\\n version: ReactVersion,\\n\\n unstable_ConcurrentMode: REACT_CONCURRENT_MODE_TYPE,\\n unstable_Profiler: REACT_PROFILER_TYPE,\\n\\n __SECRET_INTERNALS_DO_NOT_USE_OR_YOU_WILL_BE_FIRED: ReactSharedInternals\\n};\\n\\n// Note: some APIs are added with feature flags.\\n// Make sure that stable builds for open source\\n// don't modify the React object to avoid deopts.\\n// Also let's not expose their names in stable builds.\\n\\nif (enableStableConcurrentModeAPIs) {\\n React.ConcurrentMode = REACT_CONCURRENT_MODE_TYPE;\\n React.Profiler = REACT_PROFILER_TYPE;\\n React.unstable_ConcurrentMode = undefined;\\n React.unstable_Profiler = undefined;\\n}\\n\\nif (enableHooks) {\\n React.useCallback = useCallback;\\n React.useContext = useContext;\\n React.useEffect = useEffect;\\n React.useImperativeMethods = useImperativeMethods;\\n React.useLayoutEffect = useLayoutEffect;\\n React.useMemo = useMemo;\\n React.useReducer = useReducer;\\n React.useRef = useRef;\\n React.useState = useState;\\n}\\n\\n\\n\\nvar React$2 = Object.freeze({\\n\\tdefault: React\\n});\\n\\nvar React$3 = ( React$2 && React ) || React$2;\\n\\n// TODO: decide on the top-level export form.\\n// This is hacky but makes it work with both Rollup and Jest.\\nvar react = React$3.default || React$3;\\n\\nmodule.exports = react;\\n })();\\n}\\n\\n\\n//# sourceURL=webpack://%5Bname%5D/./node_modules/react/cjs/react.development.js?\");\n\n/***/ }),\n\n/***/ \"./node_modules/react/index.js\":\n/*!*************************************!*\\\n !*** ./node_modules/react/index.js ***!\n \\*************************************/\n/*! no static exports found */\n/***/ (function(module, exports, __webpack_require__) {\n\n\"use strict\";\neval(\"\\n\\nif (false) {} else {\\n module.exports = __webpack_require__(/*! ./cjs/react.development.js */ \\\"./node_modules/react/cjs/react.development.js\\\");\\n}\\n\\n\\n//# sourceURL=webpack://%5Bname%5D/./node_modules/react/index.js?\");\n\n/***/ }),\n\n/***/ \"./node_modules/tslib/tslib.es6.js\":\n/*!*****************************************!*\\\n !*** ./node_modules/tslib/tslib.es6.js ***!\n \\*****************************************/\n/*! exports provided: __extends, __assign, __rest, __decorate, __param, __metadata, __awaiter, __generator, __exportStar, __values, __read, __spread, __await, __asyncGenerator, __asyncDelegator, __asyncValues, __makeTemplateObject, __importStar, __importDefault */\n/***/ (function(module, __webpack_exports__, __webpack_require__) {\n\n\"use strict\";\neval(\"__webpack_require__.r(__webpack_exports__);\\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \\\"__extends\\\", function() { return __extends; });\\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \\\"__assign\\\", function() { return __assign; });\\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \\\"__rest\\\", function() { return __rest; });\\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \\\"__decorate\\\", function() { return __decorate; });\\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \\\"__param\\\", function() { return __param; });\\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \\\"__metadata\\\", function() { return __metadata; });\\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \\\"__awaiter\\\", function() { return __awaiter; });\\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \\\"__generator\\\", function() { return __generator; });\\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \\\"__exportStar\\\", function() { return __exportStar; });\\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \\\"__values\\\", function() { return __values; });\\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \\\"__read\\\", function() { return __read; });\\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \\\"__spread\\\", function() { return __spread; });\\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \\\"__await\\\", function() { return __await; });\\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \\\"__asyncGenerator\\\", function() { return __asyncGenerator; });\\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \\\"__asyncDelegator\\\", function() { return __asyncDelegator; });\\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \\\"__asyncValues\\\", function() { return __asyncValues; });\\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \\\"__makeTemplateObject\\\", function() { return __makeTemplateObject; });\\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \\\"__importStar\\\", function() { return __importStar; });\\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \\\"__importDefault\\\", function() { return __importDefault; });\\n/*! *****************************************************************************\\r\\nCopyright (c) Microsoft Corporation. All rights reserved.\\r\\nLicensed under the Apache License, Version 2.0 (the \\\"License\\\"); you may not use\\r\\nthis file except in compliance with the License. You may obtain a copy of the\\r\\nLicense at http://www.apache.org/licenses/LICENSE-2.0\\r\\n\\r\\nTHIS CODE IS PROVIDED ON AN *AS IS* BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY\\r\\nKIND, EITHER EXPRESS OR IMPLIED, INCLUDING WITHOUT LIMITATION ANY IMPLIED\\r\\nWARRANTIES OR CONDITIONS OF TITLE, FITNESS FOR A PARTICULAR PURPOSE,\\r\\nMERCHANTABLITY OR NON-INFRINGEMENT.\\r\\n\\r\\nSee the Apache Version 2.0 License for specific language governing permissions\\r\\nand limitations under the License.\\r\\n***************************************************************************** */\\r\\n/* global Reflect, Promise */\\r\\n\\r\\nvar extendStatics = function(d, b) {\\r\\n extendStatics = Object.setPrototypeOf ||\\r\\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\\r\\n function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\\r\\n return extendStatics(d, b);\\r\\n};\\r\\n\\r\\nfunction __extends(d, b) {\\r\\n extendStatics(d, b);\\r\\n function __() { this.constructor = d; }\\r\\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\\r\\n}\\r\\n\\r\\nvar __assign = function() {\\r\\n __assign = Object.assign || function __assign(t) {\\r\\n for (var s, i = 1, n = arguments.length; i < n; i++) {\\r\\n s = arguments[i];\\r\\n for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p];\\r\\n }\\r\\n return t;\\r\\n }\\r\\n return __assign.apply(this, arguments);\\r\\n}\\r\\n\\r\\nfunction __rest(s, e) {\\r\\n var t = {};\\r\\n for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0)\\r\\n t[p] = s[p];\\r\\n if (s != null && typeof Object.getOwnPropertySymbols === \\\"function\\\")\\r\\n for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) if (e.indexOf(p[i]) < 0)\\r\\n t[p[i]] = s[p[i]];\\r\\n return t;\\r\\n}\\r\\n\\r\\nfunction __decorate(decorators, target, key, desc) {\\r\\n var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d;\\r\\n if (typeof Reflect === \\\"object\\\" && typeof Reflect.decorate === \\\"function\\\") r = Reflect.decorate(decorators, target, key, desc);\\r\\n else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r;\\r\\n return c > 3 && r && Object.defineProperty(target, key, r), r;\\r\\n}\\r\\n\\r\\nfunction __param(paramIndex, decorator) {\\r\\n return function (target, key) { decorator(target, key, paramIndex); }\\r\\n}\\r\\n\\r\\nfunction __metadata(metadataKey, metadataValue) {\\r\\n if (typeof Reflect === \\\"object\\\" && typeof Reflect.metadata === \\\"function\\\") return Reflect.metadata(metadataKey, metadataValue);\\r\\n}\\r\\n\\r\\nfunction __awaiter(thisArg, _arguments, P, generator) {\\r\\n return new (P || (P = Promise))(function (resolve, reject) {\\r\\n function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }\\r\\n function rejected(value) { try { step(generator[\\\"throw\\\"](value)); } catch (e) { reject(e); } }\\r\\n function step(result) { result.done ? resolve(result.value) : new P(function (resolve) { resolve(result.value); }).then(fulfilled, rejected); }\\r\\n step((generator = generator.apply(thisArg, _arguments || [])).next());\\r\\n });\\r\\n}\\r\\n\\r\\nfunction __generator(thisArg, body) {\\r\\n var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g;\\r\\n return g = { next: verb(0), \\\"throw\\\": verb(1), \\\"return\\\": verb(2) }, typeof Symbol === \\\"function\\\" && (g[Symbol.iterator] = function() { return this; }), g;\\r\\n function verb(n) { return function (v) { return step([n, v]); }; }\\r\\n function step(op) {\\r\\n if (f) throw new TypeError(\\\"Generator is already executing.\\\");\\r\\n while (_) try {\\r\\n if (f = 1, y && (t = op[0] & 2 ? y[\\\"return\\\"] : op[0] ? y[\\\"throw\\\"] || ((t = y[\\\"return\\\"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t;\\r\\n if (y = 0, t) op = [op[0] & 2, t.value];\\r\\n switch (op[0]) {\\r\\n case 0: case 1: t = op; break;\\r\\n case 4: _.label++; return { value: op[1], done: false };\\r\\n case 5: _.label++; y = op[1]; op = [0]; continue;\\r\\n case 7: op = _.ops.pop(); _.trys.pop(); continue;\\r\\n default:\\r\\n if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; }\\r\\n if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; }\\r\\n if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; }\\r\\n if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; }\\r\\n if (t[2]) _.ops.pop();\\r\\n _.trys.pop(); continue;\\r\\n }\\r\\n op = body.call(thisArg, _);\\r\\n } catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; }\\r\\n if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true };\\r\\n }\\r\\n}\\r\\n\\r\\nfunction __exportStar(m, exports) {\\r\\n for (var p in m) if (!exports.hasOwnProperty(p)) exports[p] = m[p];\\r\\n}\\r\\n\\r\\nfunction __values(o) {\\r\\n var m = typeof Symbol === \\\"function\\\" && o[Symbol.iterator], i = 0;\\r\\n if (m) return m.call(o);\\r\\n return {\\r\\n next: function () {\\r\\n if (o && i >= o.length) o = void 0;\\r\\n return { value: o && o[i++], done: !o };\\r\\n }\\r\\n };\\r\\n}\\r\\n\\r\\nfunction __read(o, n) {\\r\\n var m = typeof Symbol === \\\"function\\\" && o[Symbol.iterator];\\r\\n if (!m) return o;\\r\\n var i = m.call(o), r, ar = [], e;\\r\\n try {\\r\\n while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value);\\r\\n }\\r\\n catch (error) { e = { error: error }; }\\r\\n finally {\\r\\n try {\\r\\n if (r && !r.done && (m = i[\\\"return\\\"])) m.call(i);\\r\\n }\\r\\n finally { if (e) throw e.error; }\\r\\n }\\r\\n return ar;\\r\\n}\\r\\n\\r\\nfunction __spread() {\\r\\n for (var ar = [], i = 0; i < arguments.length; i++)\\r\\n ar = ar.concat(__read(arguments[i]));\\r\\n return ar;\\r\\n}\\r\\n\\r\\nfunction __await(v) {\\r\\n return this instanceof __await ? (this.v = v, this) : new __await(v);\\r\\n}\\r\\n\\r\\nfunction __asyncGenerator(thisArg, _arguments, generator) {\\r\\n if (!Symbol.asyncIterator) throw new TypeError(\\\"Symbol.asyncIterator is not defined.\\\");\\r\\n var g = generator.apply(thisArg, _arguments || []), i, q = [];\\r\\n return i = {}, verb(\\\"next\\\"), verb(\\\"throw\\\"), verb(\\\"return\\\"), i[Symbol.asyncIterator] = function () { return this; }, i;\\r\\n function verb(n) { if (g[n]) i[n] = function (v) { return new Promise(function (a, b) { q.push([n, v, a, b]) > 1 || resume(n, v); }); }; }\\r\\n function resume(n, v) { try { step(g[n](v)); } catch (e) { settle(q[0][3], e); } }\\r\\n function step(r) { r.value instanceof __await ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); }\\r\\n function fulfill(value) { resume(\\\"next\\\", value); }\\r\\n function reject(value) { resume(\\\"throw\\\", value); }\\r\\n function settle(f, v) { if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); }\\r\\n}\\r\\n\\r\\nfunction __asyncDelegator(o) {\\r\\n var i, p;\\r\\n return i = {}, verb(\\\"next\\\"), verb(\\\"throw\\\", function (e) { throw e; }), verb(\\\"return\\\"), i[Symbol.iterator] = function () { return this; }, i;\\r\\n function verb(n, f) { i[n] = o[n] ? function (v) { return (p = !p) ? { value: __await(o[n](v)), done: n === \\\"return\\\" } : f ? f(v) : v; } : f; }\\r\\n}\\r\\n\\r\\nfunction __asyncValues(o) {\\r\\n if (!Symbol.asyncIterator) throw new TypeError(\\\"Symbol.asyncIterator is not defined.\\\");\\r\\n var m = o[Symbol.asyncIterator], i;\\r\\n return m ? m.call(o) : (o = typeof __values === \\\"function\\\" ? __values(o) : o[Symbol.iterator](), i = {}, verb(\\\"next\\\"), verb(\\\"throw\\\"), verb(\\\"return\\\"), i[Symbol.asyncIterator] = function () { return this; }, i);\\r\\n function verb(n) { i[n] = o[n] && function (v) { return new Promise(function (resolve, reject) { v = o[n](v), settle(resolve, reject, v.done, v.value); }); }; }\\r\\n function settle(resolve, reject, d, v) { Promise.resolve(v).then(function(v) { resolve({ value: v, done: d }); }, reject); }\\r\\n}\\r\\n\\r\\nfunction __makeTemplateObject(cooked, raw) {\\r\\n if (Object.defineProperty) { Object.defineProperty(cooked, \\\"raw\\\", { value: raw }); } else { cooked.raw = raw; }\\r\\n return cooked;\\r\\n};\\r\\n\\r\\nfunction __importStar(mod) {\\r\\n if (mod && mod.__esModule) return mod;\\r\\n var result = {};\\r\\n if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k];\\r\\n result.default = mod;\\r\\n return result;\\r\\n}\\r\\n\\r\\nfunction __importDefault(mod) {\\r\\n return (mod && mod.__esModule) ? mod : { default: mod };\\r\\n}\\r\\n\\n\\n//# sourceURL=webpack://%5Bname%5D/./node_modules/tslib/tslib.es6.js?\");\n\n/***/ })\n\n/******/ });" | |
| description: '' | |
| id: 36b0087d-a101-43d0-8d7c-707c94a50cbb | |
| name: '@meetalva/designkit' | |
| version: 1.0.0 | |
| origin: user-provided | |
| patterns: | |
| - model: Pattern | |
| contextId: 'lib/button/button.d.ts:Button' | |
| description: '' | |
| exportName: Button | |
| icon: '' | |
| id: 669d7465-625a-4508-8167-ff81ff873795 | |
| name: Button | |
| origin: user-provided | |
| propertyIds: | |
| - b26f5304-5773-415a-9062-c07043a3dc48 | |
| - ac983340-7614-40de-a4f2-7340e988b3e7 | |
| - e0681f3c-7ac3-4568-a8b9-e456ec09df79 | |
| - 4767b4ed-3693-4dee-8842-6652268fb621 | |
| - 7e03f2a8-d789-4290-a507-23355b3a7b9f | |
| - 39bbb0cb-d446-4504-a3a0-b5c3c450221d | |
| - 2f8b731d-7010-4190-97d6-a3314c02abec | |
| - 4baf72fd-7aa4-478d-93d6-df2c2d63f6c5 | |
| - 28c3b1dc-0c6b-42f7-be9c-57f239f9092a | |
| - 250b7df7-139d-44c8-a76a-d01f1571c015 | |
| - 831bc208-1362-462a-b128-6ff6155299b9 | |
| - e5ecfdf7-e15c-456a-96a0-9bbf6cae2c03 | |
| - 2ddc7442-d968-4e99-b7cd-055ee8005bf5 | |
| - 63c935a7-6abd-4adb-8751-196f1376a402 | |
| - 3180960c-2d94-4ca4-af99-65e88f184f29 | |
| - c8a5929c-04fb-4831-b35d-fd3df4d6798e | |
| - d7a78255-e555-480e-ad32-dde06f45ac7c | |
| - e3ef8be4-7b08-47bc-abe6-8258efaa19bb | |
| - f95b1e79-baab-437c-9da0-89d63c451ebe | |
| - 7363b138-508e-4a6a-853f-9eed04688420 | |
| - 5e41be59-6b0b-4f2a-8140-8b29d992be59 | |
| - 38e88f60-9788-48c0-82e7-164d159c23a2 | |
| - 360a3084-cf3f-417f-a780-f3e63bf32154 | |
| - ca1c043f-4ee5-4a16-99e4-8853dbe729b3 | |
| - 9fd5a263-0188-472e-a869-f55e1d57537a | |
| - 3152efff-3f2a-4a68-bf54-ebfbfd4f22f8 | |
| - 209283ad-d6a5-4bd1-9213-292874eea611 | |
| - 92abcc7c-c71a-40fa-a88b-b7d149dba57d | |
| - 8f914134-29f7-44b6-a9aa-3adc03ff1398 | |
| - 3c094fec-b78a-4825-bd23-dd1a16c0ab55 | |
| - 5ef7b29f-961a-40ba-8aaa-3383f09aa3c8 | |
| - 030c5e1b-5228-497e-837d-fb64ed8edc67 | |
| - 97151fd0-9d33-4c52-b4f5-299b8798466b | |
| - 136a5088-f456-47d6-b7e0-e17ed7e07865 | |
| - f770e063-482c-440b-baac-c574da215c9a | |
| - f1daca4d-955c-4a49-ae1f-68cf556085f6 | |
| - 28575da1-f030-4011-bcef-b58b27b320ec | |
| - e526c83c-26e6-498f-b9c1-ce10658afd8e | |
| - e386f866-57fd-4e5b-98dc-ece9dac1410a | |
| - 36178f7b-77da-4572-b011-7cc3b7e1bbab | |
| - c9d4d0f9-49c4-4b35-8cf6-ac45787cec7a | |
| - c768fc7d-b4da-4651-8176-6a573cb9bdb4 | |
| - a16b8bb9-6a25-43fb-a896-cfe2859c52f6 | |
| - cadb9573-3ab6-443b-bb86-b004bcff773e | |
| - a198eb1b-5b01-46da-a7c7-8f4f63ed21d9 | |
| - 89f32df2-9310-4533-8a5f-da9fde0e2387 | |
| - 2f28ee39-81e4-42f9-91a8-c683f3b8f81b | |
| - a1091a38-cbba-4d2d-b088-ebd65653b530 | |
| - dd77ab40-fe13-45cf-ac46-81ec9c76696a | |
| - 438f5f1f-0edf-46c7-bfe6-133e009c96fa | |
| - 8035af87-dc09-4efd-a924-02e825b85192 | |
| - 4f330a12-0bdc-43d8-b21e-498777376677 | |
| - 70bb0cae-8284-4352-bb9c-fc1e9c6b352b | |
| - c5e59825-6f34-405a-a697-624967a2e811 | |
| - 998a0730-bf7f-427e-b010-1dbb468062c7 | |
| - 5092c7db-0f9b-4011-a53c-a32f8c902b3f | |
| - a49b9658-1d3f-4f5b-a36b-673c01d4ec27 | |
| - 5a725ee6-5751-4874-8db0-20f4ea990eb7 | |
| - 4e333be2-e029-4787-a9a7-5929d4a65689 | |
| - afa387e6-2daf-479c-bf81-3fb72e742979 | |
| - ab888a83-21fa-46de-82a1-1fa7373cc620 | |
| - fadddd62-2579-48d0-9894-29f962c62523 | |
| - 8995a175-2676-4265-a4f1-033891a91e96 | |
| - 5bce6246-4884-4f2e-9baa-962cdf9f121d | |
| - 45a50e97-d78d-46ba-bdb1-1fa32290a171 | |
| - c0008e5e-cdbf-49ba-ae96-7789418de5a4 | |
| - 3fdea9b4-f6a3-4961-ba0a-95e8ad4cab5a | |
| - 1fc70b6a-dbce-452d-9117-23e5a6439144 | |
| - 8e542f05-0edd-47c3-b672-1aad93df9e9f | |
| - f50c4e99-6dbe-454c-a673-d67766c1def7 | |
| - 17137e22-3865-4b02-b477-a4b143450e8c | |
| - 26cc315c-66e2-4a9f-83d0-497d81060dc7 | |
| - 87a075c5-0ad9-42d4-8dd5-401be9d9af3f | |
| - 600c6642-dad0-4ebd-8a47-e94b9516e0a8 | |
| - 54af3505-0a97-4ba6-9974-bd666880fbd4 | |
| - 4f3ff4bf-1098-4b97-8821-1fbb16bdd1f1 | |
| - 734e9546-d8c3-4d8e-b4ef-c832a1f0fdba | |
| - 9b75ff64-ba2c-46cb-a463-80e48e9f7fbc | |
| - 56ffb9b9-f9e0-48a3-9495-cf5ed1ae00f8 | |
| - 3e547e83-b8e1-415e-9554-f85ba0a2c1d6 | |
| - 552a5d23-3e4a-4e18-8cf5-54dc3c67a300 | |
| - 5db6ad6b-8dfe-4295-9bb4-06e7b7a8ba37 | |
| - 1aa02e50-752e-420f-9793-d32b80bd43c3 | |
| - 06e51203-ae4b-40b8-ad40-0d086da1e8e7 | |
| - 5aa04946-fa3e-4d1f-8da6-b03f656d4038 | |
| - d18a2591-0b6c-441a-a612-97408ae526a9 | |
| - 132ab478-b418-4a3c-a21f-dfd0ddbcbd5f | |
| - 7d2a497c-f097-47a8-bce3-1c0533d2dc9d | |
| - 273757c5-ad75-426d-934c-6071d106a617 | |
| - 0280c819-e17b-4324-ab05-7b0f3ad0f6dd | |
| - f56953f5-c2ba-4d91-bf8b-48dc181f31ff | |
| - 1d1ca0e7-cb66-4795-b5c2-8f4fef518644 | |
| - 806f6bd0-a8a6-4871-a806-37b62371e53a | |
| - 1dadd4ae-267d-436a-b8e1-2f1f0d4b2662 | |
| - a38c1e4a-d059-46f4-84b6-378fc90fc40c | |
| - 036df49e-d8b1-4413-8cfb-0e7c20c74950 | |
| - 8a0de8f4-cb19-4e6f-b0c4-8ce9412fd9d4 | |
| - 20cd5ea9-dd41-41b5-b9b3-1fba9df3f43b | |
| - 421b505c-2f1d-4f4d-bbb0-15b03dab39a3 | |
| - 3866d92a-c52e-4537-b638-47e45990e467 | |
| - ec7f9086-4c2c-4a4b-b162-21bedcd79acd | |
| - 254b74dd-0592-4e44-8219-00add9316b55 | |
| - 800abf57-5390-40ba-a6be-8d089f090a2a | |
| - 83cb74be-422b-4cde-b704-c9e8c2269448 | |
| - b80a7d97-8d70-433c-901a-810a7c950b67 | |
| - c3ac1f86-b10a-4807-8079-a8b6dda7c8a4 | |
| - 1801c709-4788-41f5-b35c-396520153d89 | |
| - d63a0704-af97-4f67-b246-92e667963960 | |
| - 844d78db-70fa-4e76-ac11-2d3997be0c2a | |
| - 7a21ba34-0405-4aaf-a2fb-819f83b8ac68 | |
| - 6a3f1cd2-20dd-48c3-860b-dbba46f381dc | |
| - ed79cad6-50f1-4ecc-a7bc-492ba1b540cf | |
| - dc4967c7-2ff0-44ac-9c47-256d22c1a810 | |
| - 3d0242f3-c43d-4a1b-a0c2-1c9866591a47 | |
| - 09df902a-dd2e-46a2-b373-e9659e24d409 | |
| - 14a8035c-9f39-4585-8736-81d163f3bf95 | |
| - 12f2f4d2-8eff-4e01-8551-051f7d2f05df | |
| - 2ef01f69-d605-4e68-b486-9e56cd830857 | |
| - df193705-3f92-4e81-8c7a-176bdd10f0e7 | |
| - 347fc2b7-76dd-4d18-972b-bdadaec8ca7f | |
| - 3dee1f95-2ab7-4bd9-8c1e-489384806a20 | |
| - 102af8b4-f110-49c9-9752-ef8cabc784e9 | |
| - 9314b354-f12e-48a6-909f-4226d7a0c2ed | |
| - 1d2abc8b-42fd-402d-9e3d-c2dc270b75b7 | |
| - 3fcafea6-f60d-42bb-a4d0-82bb6f3dcab2 | |
| - 1029bc2c-1608-4478-b581-fdd402f7fe27 | |
| - fd61fee7-f08c-4eab-946e-8ddce170dab3 | |
| - b63c4571-7757-4bff-8fae-2c79cf60ca8d | |
| - e7055b6d-bdc1-417d-8774-921d60169f06 | |
| - 319601c0-d065-4255-8920-9caa836a27e2 | |
| - 148fc29f-6af6-4d9b-a7b8-0a644135b2df | |
| - 35ca7463-2529-4501-b0d3-ef0c3040d836 | |
| - 1bccc39a-b27d-4dc8-b9d9-190ffb94ceab | |
| - ad681994-1e50-423e-9003-c951cbb3415d | |
| - 4738799d-2752-4923-8666-31c4d57cf36f | |
| - c670b9dc-bb53-4991-ad3c-dce2f9bb705b | |
| - f1d93bf1-295e-455b-9508-fe2370b9b3f8 | |
| - 803c05f2-8468-4e42-985e-e7c4142a78f1 | |
| - 4b10986d-8f34-4ebc-b934-c99bf8314e72 | |
| - b6a52478-cb37-457a-be98-927756568ce0 | |
| - 8d70585e-c8a8-49c0-8b56-5353a10abde8 | |
| - c0aafa32-07dd-48c4-8bea-c8d612026532 | |
| - c8a23734-36ff-469f-9b0f-945d59532df3 | |
| - a3d32436-a5e2-4f91-a5b2-7f807bf8780e | |
| - 77b82fe7-3aeb-42cf-b712-48342757e329 | |
| - 0c0b9003-2ac5-412a-a237-e5738450d335 | |
| - 07e0fd76-8e81-442a-ad15-4bcfd879fa63 | |
| - 311ca64a-c382-4c74-8d68-ad15503cf589 | |
| - cb4d42aa-475f-4549-ae9b-f64ab9386026 | |
| - 12675c5a-e8b0-4d59-a471-2418122c3196 | |
| - 6abd6865-bd3e-456c-879e-c0927eeb3e21 | |
| - 211db50c-47a6-4c40-9d0d-366b45efa883 | |
| - fd48ac24-ef78-4e49-893a-19c7085fa6d3 | |
| - 08f1539c-769d-4cd2-981a-f438ea90b19a | |
| - efeaaec1-e2b3-4d8c-8496-86836dd6a352 | |
| - 37ec1907-3b51-476f-97cc-26ec8247c160 | |
| - 45ae6833-4850-4e0a-a457-0a8c1c74b082 | |
| - 2d4f0994-d143-4e11-b9d0-7e19715e8339 | |
| - 9b1c36a5-ca0a-4486-97fa-fcb4d9c0bef6 | |
| - fc2194bb-e365-4ca5-9228-5745046af6b9 | |
| - 72e1eee0-6806-44c1-8db4-ce07082a5af7 | |
| - 663ff1ae-e101-48b4-b6f4-f700e22dd77a | |
| - 99af2a55-1f0b-48d2-ba08-c08fb8c16ed7 | |
| - ff4cfe05-9994-4ce1-a9ff-98105bbba0fd | |
| - 8e9b2cd7-ecd2-4b84-bee0-cde678787add | |
| - e55ba4ae-1a47-4320-8eb0-e5056d77841a | |
| - ac977bff-2727-4671-ae84-7b0a4834e875 | |
| - 610a1216-9f9e-4ffc-9891-8c0a6a73674f | |
| - a44a1b7a-43ed-4af2-9b8d-03fcd2304d89 | |
| - 24a174dc-5c38-4e5b-a52c-7cf91ba19e5a | |
| - dfe94128-c1a6-4689-af53-ad863bc3ff94 | |
| - 48b9cd35-2c4a-48eb-a4e3-d29efb8fa286 | |
| - 1a24004c-371c-4a90-814a-0ce8b68a4a48 | |
| - 848543e5-f843-4f65-b0ce-6fab71127097 | |
| - ff49d9ed-0958-4978-97ba-2c3c52a06648 | |
| - 7b3706b2-9469-4b52-a174-c3ddb90ab4f0 | |
| - df57e13d-cded-4ac3-8f7b-31db77fb1885 | |
| - b1a0b817-a723-49ab-a653-89b6db60d62f | |
| - 79caec21-969e-4fbb-bc08-c62cb434f1b4 | |
| - 3d4c6ddf-59bf-4f70-93e8-3d46a76bae0c | |
| - f2fed750-b02b-4e23-8899-bfd88925224d | |
| - ea725e89-b8ea-4b0a-9639-b686256a43f3 | |
| - c0c35611-2579-4d45-94b6-67fb386cca7c | |
| - 5cf57ac9-777b-43fe-8cfe-e9dbdf7bb285 | |
| - 6416444e-445d-44be-8794-fe8b8e361957 | |
| - 47dc896f-e24e-4c25-9985-ce8fca34ceab | |
| - 10c50c91-9c86-47cc-981f-291ee4b85dae | |
| - 3719eabe-0f16-4e8f-ac26-0a1c02578e3f | |
| - e4578d28-fd1b-49c6-8e21-e017d3fb4ebf | |
| - f8b35d8e-93da-4f6a-9c51-affd4eda762c | |
| - 2c995b9f-1648-476d-99a6-fe16c0e17169 | |
| - 8fcc4503-9cdc-4077-af6d-d81eab88b231 | |
| - 49647359-4a5e-42e6-a9a7-6c92bf961d9e | |
| - fdad75b0-0862-440b-b50e-d5c73e47e01a | |
| - 1fa9fdfe-66e9-465a-b061-184c4157eeef | |
| - 3d78e979-9e73-43af-a5db-4fde3299ae35 | |
| - 620e87cc-b015-4124-8aab-615863065887 | |
| - 4502893a-c0fa-45b1-b659-f2bda55e606e | |
| - a4f43298-8595-4e23-ac71-beec6b5352db | |
| - e4d7720d-fc0f-4c5f-b2ae-d89452bba7c3 | |
| - 59ba9f76-07b3-4b59-8b44-9007f544bea3 | |
| - b3f3a552-da60-4807-a53f-84521b6b0fef | |
| - 635b8c7c-c7be-4409-9db7-f2ec2b6a55cd | |
| - a9cd7844-073d-4a2e-92a7-c3f0435c519b | |
| - c1786a95-5e69-44c2-80b0-50f3a95f578d | |
| - e8b6fad4-1a0f-44ff-b23e-f039d7b830bb | |
| - be799a4f-7d3a-4302-8012-780eb0b81288 | |
| - 5b6303b4-720f-4b5b-a3bf-e2c966c5adb7 | |
| - 57658eaa-a49b-486e-b3dd-f65695215d2b | |
| - 51feca8c-9560-404f-9bc1-cce76c382fd9 | |
| - f91819a6-85bd-4a80-91e2-1913a4592b44 | |
| - 92b75b80-25b7-41ff-9a6a-6cadca83de94 | |
| - 077f8f00-b7ba-4714-abf4-82fcd456b8aa | |
| - 2b86f9de-7a41-47e9-b8ab-6536a40362f2 | |
| - e54d7d80-1022-48bf-9846-960fa64800d6 | |
| - 8b829025-5890-4de2-9095-bc8743cf138d | |
| - 75fb8b86-e6b3-4ef0-a108-57cee3dab0a5 | |
| - 0fa9b79f-c117-42bc-9aea-f019f4b90cb5 | |
| - fda7b5fd-768f-4e1f-9f88-4b1cc0d676b2 | |
| - a412f3d7-be0c-42b7-af82-13fb63fd108c | |
| - 4e603472-345c-42c1-b601-d8ec6e31ec9d | |
| - 86a0b8b6-c6c6-4162-9ef4-559a3337603c | |
| - 5b337e1b-c6f7-41ff-b0d7-4a981494290a | |
| - 9a57e58d-512d-4e13-89a9-83d0aa4e1e0a | |
| - 5b6b0a40-dd6c-4102-86ff-c8b55004dbd1 | |
| - 4261f966-0577-490a-b059-119dfd87c24b | |
| - ef9045e5-3b2e-4a36-88c2-c35ee6d261ac | |
| - 39199628-fa3c-49a4-b5f0-339b6cc44f8a | |
| - bfb22f86-b5d2-487d-8c6a-b241b960e807 | |
| - c68fbabb-1509-4ff8-9aef-6a463af6ad46 | |
| - a43665fa-076e-46fa-a7a0-62a6e16a304a | |
| - dba10598-6f35-4acf-8d23-88f2ebf2f2af | |
| - 8c0d11e9-d263-443d-97bd-848d1135737f | |
| - 35558cbf-fc52-474c-9dc2-a75f33e58f98 | |
| - a9fae104-9c7b-48d9-9c71-ac53806ded99 | |
| - 466e4f3f-e436-40d0-ab12-aad6b786228e | |
| - 9aa2c651-ef48-485b-8884-88f22a93c1d8 | |
| - e05f598f-db3f-45be-84bc-46806ae78492 | |
| - 864a4e0a-74df-46e4-8eba-570f9121462e | |
| - 4f97bcc4-0073-40a9-b00f-50431def715f | |
| - 80d1fe01-a680-4a7a-983f-fadf558d0029 | |
| - 43d3082b-f554-4038-a35d-587fcc63b717 | |
| - 1ada17dd-0327-404d-921d-1d74510a9ed4 | |
| - 1f36b14a-597d-4458-a96a-a47554b73b87 | |
| - de7934c8-9642-47cc-8831-278f49193068 | |
| - 0ac7308e-49c0-4cbc-a54c-14912a4871d2 | |
| - e5e41a28-31c9-4928-b22e-bc06f36acd69 | |
| - 7ae4c3ad-dca2-4168-9c5d-4e163298a586 | |
| - ea7231da-4195-42e9-a645-fbba0035e97d | |
| - 7a6eaa0b-eaa2-4cf8-91eb-c20a78f296ea | |
| - 220af4aa-06bb-44d6-81d8-01906b9ddeb5 | |
| - da0c416e-e7d0-4bbc-95c4-766c79479a94 | |
| slots: | |
| - model: PatternSlot | |
| contextId: children | |
| description: '' | |
| example: '' | |
| hidden: false | |
| label: children | |
| propertyName: children | |
| id: 114230d5-7c56-4bf0-a046-d803ec16e226 | |
| required: false | |
| type: children | |
| type: pattern | |
| - model: Pattern | |
| contextId: 'lib/checkbox/checkbox.d.ts:Checkbox' | |
| description: '' | |
| exportName: Checkbox | |
| icon: '' | |
| id: e4e5bbbd-df5f-4751-89f3-a8fdb1e8bb37 | |
| name: Checkbox | |
| origin: user-provided | |
| propertyIds: | |
| - afb57f16-a537-4f37-a1fd-fdd6b5ce03c8 | |
| - e82a58c9-894b-4df6-9633-4e0f7c257087 | |
| - 3d9929e1-37dd-4526-9eab-2d1ae7eeabcc | |
| - 59be3d3e-cbe4-465f-9780-6d09c1fb8865 | |
| - 4fd29361-0f77-49db-99d2-82543edb0010 | |
| - a683e59e-fa4c-4573-8a33-488b06a36aea | |
| slots: [] | |
| type: pattern | |
| - model: Pattern | |
| contextId: 'lib/copy/copy.d.ts:Copy' | |
| description: '' | |
| exportName: Copy | |
| icon: '' | |
| id: 1a4f0ad5-61d1-48e4-af6d-c34d3b92f066 | |
| name: Copy | |
| origin: user-provided | |
| propertyIds: | |
| - 2e991bf6-a263-4fdc-812c-3812c2907405 | |
| slots: [] | |
| type: pattern | |
| - model: Pattern | |
| contextId: 'lib/dropdown/dropdown.d.ts:Dropdown' | |
| description: '' | |
| exportName: Dropdown | |
| icon: '' | |
| id: f212cacd-6f6f-49b4-8ca5-4d910d3d5e41 | |
| name: Dropdown | |
| origin: user-provided | |
| propertyIds: | |
| - 314ab543-7d56-43b8-b095-752a024cf471 | |
| - 087b024a-9cb2-4a3c-9cc0-6fcf73fd92df | |
| - 5ed7e42d-2949-4ab2-8276-a67d853d4501 | |
| slots: | |
| - model: PatternSlot | |
| contextId: children | |
| description: '' | |
| example: '' | |
| hidden: false | |
| label: children | |
| propertyName: children | |
| id: 47f52e7e-5e21-4a87-8b9c-32f5291e948a | |
| required: true | |
| type: children | |
| type: pattern | |
| - model: Pattern | |
| contextId: 'lib/dropdown-item/dropdown-item.d.ts:DropdownItem' | |
| description: '' | |
| exportName: DropdownItem | |
| icon: '' | |
| id: b90a731c-486e-4b72-acde-c196b4ac6b3c | |
| name: Dropdown item | |
| origin: user-provided | |
| propertyIds: | |
| - 01f47fbb-f39f-44a6-80e9-af4c39cd2ce6 | |
| slots: [] | |
| type: pattern | |
| - model: Pattern | |
| contextId: 'lib/feature/feature.d.ts:Feature' | |
| description: '' | |
| exportName: Feature | |
| icon: '' | |
| id: f898c445-0e7c-4f93-9c3d-be79f21073f3 | |
| name: Feature | |
| origin: user-provided | |
| propertyIds: | |
| - 60948e0a-3ee5-475c-9d48-6020c30910c3 | |
| - 1e27870a-7d6c-4165-ab9a-4ae8e4ed9047 | |
| - f6178e51-fd61-4e24-892d-98fefb144947 | |
| - 9a524bb4-e41b-44e2-8796-32b1abfef624 | |
| - b33b1d2b-cd5d-4cb7-9603-05ecc1e3c9b8 | |
| slots: | |
| - model: PatternSlot | |
| contextId: frame | |
| description: '' | |
| example: '' | |
| hidden: false | |
| label: Frame | |
| propertyName: frame | |
| id: cf0142f6-39e4-47c9-ac9e-cf5f6297734c | |
| required: false | |
| type: property | |
| - model: PatternSlot | |
| contextId: link | |
| description: '' | |
| example: '' | |
| hidden: false | |
| label: Link | |
| propertyName: link | |
| id: 8d16067a-e4d9-4417-babc-665507964489 | |
| required: false | |
| type: property | |
| - model: PatternSlot | |
| contextId: children | |
| description: '' | |
| example: '' | |
| hidden: false | |
| label: children | |
| propertyName: children | |
| id: 4bc8dfad-0e15-49b2-b2df-32713208bae9 | |
| required: false | |
| type: children | |
| type: pattern | |
| - model: Pattern | |
| contextId: 'lib/footer/footer.d.ts:Footer' | |
| description: '' | |
| exportName: Footer | |
| icon: '' | |
| id: c22fb434-3fd8-4bef-8ed7-f2390c5af337 | |
| name: Footer | |
| origin: user-provided | |
| propertyIds: | |
| - 2edd3df1-54fd-4b8c-b611-05d3ed2992a6 | |
| slots: | |
| - model: PatternSlot | |
| contextId: children | |
| description: '' | |
| example: '' | |
| hidden: false | |
| label: children | |
| propertyName: children | |
| id: 3efd167e-b905-468d-879b-19e409b7d56f | |
| required: true | |
| type: children | |
| type: pattern | |
| - model: Pattern | |
| contextId: 'lib/headline/headline.d.ts:Headline' | |
| description: '' | |
| exportName: Headline | |
| icon: '' | |
| id: 845a593a-2fa8-44bb-9aa0-39e70ee0743c | |
| name: Headline | |
| origin: user-provided | |
| propertyIds: | |
| - 2aca344f-286c-4c41-ba8f-4a588fc73aea | |
| - 037165e6-5e67-4938-b60d-78973c63d79d | |
| - ddbe8ec8-5834-448a-99fa-68516f20348c | |
| - 22970c73-4306-4b41-b3f1-c747da98bc47 | |
| - 3cc7d684-2299-44ae-bbbd-5b9620d8f022 | |
| - d45f01a4-bd83-4fc9-9ff6-8109f350c136 | |
| slots: | |
| - model: PatternSlot | |
| contextId: children | |
| description: '' | |
| example: '' | |
| hidden: false | |
| label: children | |
| propertyName: children | |
| id: beeae7b1-164f-4237-a08d-dcd6679537ca | |
| required: false | |
| type: children | |
| type: pattern | |
| - model: Pattern | |
| contextId: 'lib/icons/icons.d.ts:IconRegistry' | |
| description: '' | |
| exportName: IconRegistry | |
| icon: '' | |
| id: f4b071e6-7f6b-46f9-89ef-9ddc6decf350 | |
| name: Icon registry | |
| origin: user-provided | |
| propertyIds: | |
| - de16c3ce-3aea-4438-aca1-35d6bec81343 | |
| slots: [] | |
| type: pattern | |
| - model: Pattern | |
| contextId: 'lib/icons/icons.d.ts:Icon' | |
| description: '' | |
| exportName: Icon | |
| icon: '' | |
| id: 8227bbc8-8c56-4dc4-a6f5-f681bc5fe07e | |
| name: Icon | |
| origin: user-provided | |
| propertyIds: | |
| - 2e59ae09-afda-43f7-9a56-e6a55f575d9d | |
| - f8699952-72ce-4476-b061-61a23d72e738 | |
| - b3010abd-2dcf-4313-b4c8-af0a85bf2e70 | |
| - 905ed8c3-8ecd-4c15-aeb7-c43717baeaab | |
| slots: [] | |
| type: pattern | |
| - model: Pattern | |
| contextId: 'lib/image/image.d.ts:Image' | |
| description: '' | |
| exportName: Image | |
| icon: '' | |
| id: 0877a52b-a369-4bad-806f-104e727fe258 | |
| name: Image | |
| origin: user-provided | |
| propertyIds: | |
| - b19c9463-9cee-4873-aee0-026a44eb0ada | |
| - de718020-d0ef-46f7-9e7a-62a1da260e0f | |
| - c4f41be0-34cd-4cd0-820b-eaaf72700ad3 | |
| - c0252057-b821-425e-a0c3-71e0600cb090 | |
| slots: [] | |
| type: pattern | |
| - model: Pattern | |
| contextId: 'lib/input/input.d.ts:Input' | |
| description: '' | |
| exportName: Input | |
| icon: '' | |
| id: a6f3b436-f2fa-4e59-b3a4-96a91463740a | |
| name: Input | |
| origin: user-provided | |
| propertyIds: | |
| - bd3558ce-67fc-4c88-8d44-9e5e97842d28 | |
| - ece6d7cd-67fa-4c6b-98dc-ea616b2d082f | |
| - acfac3d5-8ce3-4694-8da3-b069e0653996 | |
| - 6bfa3c0d-099b-4c4f-bc2b-67ffd83cd216 | |
| - bd2cf7f5-fc49-412b-aa28-045a747f7728 | |
| - 2f0f6bfd-b354-4ca8-9628-93b00f1d2ac8 | |
| - 3bdc088e-58d9-4339-ad2d-8e9a28a41edf | |
| - 58a18f62-08c1-4a2e-8a38-eef4c6dfc2c2 | |
| - 6e769295-737e-4255-af84-2ea10cf84ef1 | |
| slots: [] | |
| type: pattern | |
| - model: Pattern | |
| contextId: 'lib/layout/layout.d.ts:Layout' | |
| description: '' | |
| exportName: Layout | |
| icon: '' | |
| id: b5bf00ec-e094-4af7-80aa-85353fe02ae6 | |
| name: Layout | |
| origin: user-provided | |
| propertyIds: | |
| - 4955900a-048f-46fa-9a10-2c7ab97adcfa | |
| slots: [] | |
| type: pattern | |
| - model: Pattern | |
| contextId: 'lib/link/link.d.ts:Link' | |
| description: '' | |
| exportName: Link | |
| icon: '' | |
| id: 4f23949b-6784-4114-8a91-3b5a4ee24857 | |
| name: Link | |
| origin: user-provided | |
| propertyIds: | |
| - 0b3c73a5-1556-4517-9e4e-39e8a6358227 | |
| slots: [] | |
| type: pattern | |
| - model: Pattern | |
| contextId: 'lib/menu/menu.d.ts:Menu' | |
| description: '' | |
| exportName: Menu | |
| icon: '' | |
| id: fd0de579-30a1-4338-ac2d-48fbb2f045bd | |
| name: Menu | |
| origin: user-provided | |
| propertyIds: | |
| - 2a91222c-e15d-4b5a-bb35-41e342f92980 | |
| - 3481f5d5-a51b-414a-995f-42141b06bb02 | |
| slots: | |
| - model: PatternSlot | |
| contextId: children | |
| description: '' | |
| example: '' | |
| hidden: false | |
| label: children | |
| propertyName: children | |
| id: d19528be-6346-46be-a16a-c85d736c1bc7 | |
| required: false | |
| type: children | |
| type: pattern | |
| - model: Pattern | |
| contextId: 'lib/menu-item/menu-item.d.ts:MenuItem' | |
| description: '' | |
| exportName: MenuItem | |
| icon: '' | |
| id: 52518600-840c-44d4-b22d-0580e2a40322 | |
| name: Menu item | |
| origin: user-provided | |
| propertyIds: | |
| - 557d1308-ebfd-469d-8820-1774c541db96 | |
| - 307acb83-8bd7-4edb-8f49-d29219eb04c8 | |
| - 2e1014fe-8c35-4313-9c02-30e4ab57fbcd | |
| - 10d4d847-9345-416f-804a-6dc639328f73 | |
| - 36ab9783-a40a-4486-979a-4ab9e7049350 | |
| - 1e21c00b-86c9-44b6-bd93-8f688818c223 | |
| slots: [] | |
| type: pattern | |
| - model: Pattern | |
| contextId: 'lib/radio/radio.d.ts:Radio' | |
| description: '' | |
| exportName: Radio | |
| icon: '' | |
| id: 172cf2ff-92f4-4a70-8bcb-79adfd800165 | |
| name: Radio | |
| origin: user-provided | |
| propertyIds: | |
| - 5352449b-d6cf-4cb4-a3e8-3a463e2a27c0 | |
| - adfd118d-4858-4d3a-9157-60b61ef5fe16 | |
| - 5eb70d7e-60da-4001-8650-78d42d5aa3d9 | |
| - 36276fd0-56f0-4a85-974d-5e66e0090b8c | |
| - a55c4fb1-8f2b-4ffd-819c-317ad150ed8a | |
| - f2cc1d21-f57b-481c-adfb-03c691391fae | |
| slots: [] | |
| type: pattern | |
| - model: Pattern | |
| contextId: 'lib/section/section.d.ts:Section' | |
| description: '' | |
| exportName: Section | |
| icon: '' | |
| id: 4db1cdfc-c445-4b3b-a870-0a8b29c6e41a | |
| name: Section | |
| origin: user-provided | |
| propertyIds: | |
| - f3f4b161-cbb4-4fbb-ad5f-69d043cf4152 | |
| - 9540a254-7e70-4234-a350-6d7244936752 | |
| slots: | |
| - model: PatternSlot | |
| contextId: children | |
| description: '' | |
| example: '' | |
| hidden: false | |
| label: children | |
| propertyName: children | |
| id: 45fe9d67-d344-41f7-8380-cb8464d6e2d0 | |
| required: false | |
| type: children | |
| type: pattern | |
| - model: Pattern | |
| contextId: 'lib/space/space.d.ts:Space' | |
| description: '' | |
| exportName: Space | |
| icon: '' | |
| id: f3162a93-b80d-4464-8ed4-c90e13887535 | |
| name: Space | |
| origin: user-provided | |
| propertyIds: | |
| - 16843f88-c73c-43df-9656-0478df90fef0 | |
| slots: [] | |
| type: pattern | |
| - model: Pattern | |
| contextId: 'lib/teaser/teaser.d.ts:Teaser' | |
| description: '' | |
| exportName: Teaser | |
| icon: '' | |
| id: 70076bd4-8bbe-4b67-93c4-2a8766fd9bf4 | |
| name: Teaser | |
| origin: user-provided | |
| propertyIds: | |
| - 3778c5ce-be95-4708-9d84-58a70d1a1962 | |
| - d35062f0-f8d6-45b0-b71f-b2c79a65308c | |
| slots: | |
| - model: PatternSlot | |
| contextId: children | |
| description: Element that render inside this element | |
| example: '' | |
| hidden: false | |
| label: children | |
| propertyName: children | |
| id: dac2671d-82c1-4555-9551-62f8d5833a7c | |
| required: false | |
| type: children | |
| type: pattern | |
| patternProperties: | |
| - model: PatternProperty | |
| contextId: disabled | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: b26f5304-5773-415a-9062-c07043a3dc48 | |
| inputType: default | |
| label: Disabled | |
| origin: user-provided | |
| propertyName: disabled | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: order | |
| example: '' | |
| description: '' | |
| group: '' | |
| hidden: false | |
| id: ac983340-7614-40de-a4f2-7340e988b3e7 | |
| inputType: default | |
| label: Order | |
| propertyName: order | |
| options: | |
| - model: PatternEnumPropertyOption | |
| contextId: Primary | |
| id: 8dfb2e95-61d4-450e-a68b-fa5413964666 | |
| name: Primary | |
| ordinal: '"button-primary"' | |
| value: button-primary | |
| - model: PatternEnumPropertyOption | |
| contextId: Secondary | |
| id: 5d641e24-895c-4642-9ba9-bfbbf17c9d7b | |
| name: Secondary | |
| ordinal: '"button-secondary"' | |
| value: button-secondary | |
| origin: user-provided | |
| required: false | |
| type: enum | |
| - model: PatternProperty | |
| contextId: color | |
| example: '' | |
| description: '' | |
| group: '' | |
| hidden: false | |
| id: e0681f3c-7ac3-4568-a8b9-e456ec09df79 | |
| inputType: default | |
| label: Color | |
| propertyName: color | |
| options: | |
| - model: PatternEnumPropertyOption | |
| contextId: Blue | |
| id: 5b6682a9-1dd0-4d8b-8f37-632881c4a763 | |
| name: Blue | |
| ordinal: '"rgb(0, 112, 214)"' | |
| value: 'rgb(0, 112, 214)' | |
| - model: PatternEnumPropertyOption | |
| contextId: BlueLight | |
| id: 90c2e561-9f12-492d-bd79-483a6b495dde | |
| name: BlueLight | |
| ordinal: '"rgb(0, 112, 214)"' | |
| value: 'rgb(0, 112, 214)' | |
| - model: PatternEnumPropertyOption | |
| contextId: GreenDark | |
| id: a1dac7c2-44ea-4cc5-b801-7e7e9e5a7eb2 | |
| name: GreenDark | |
| ordinal: '"rgb(30, 205, 151)"' | |
| value: 'rgb(30, 205, 151)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Green | |
| id: 30976f38-d2f9-4398-99f3-ac9e46dcc790 | |
| name: Green | |
| ordinal: '"rgb(87, 218, 178)"' | |
| value: 'rgb(87, 218, 178)' | |
| - model: PatternEnumPropertyOption | |
| contextId: GreenLight | |
| id: a5a45f86-f503-404c-b798-48a2cd2a1ad5 | |
| name: GreenLight | |
| ordinal: '"rgb(123, 226, 195)"' | |
| value: 'rgb(123, 226, 195)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Red | |
| id: c09c6add-5cc5-44ad-9238-5550b16cca09 | |
| name: Red | |
| ordinal: '"rgb(215, 0, 82)"' | |
| value: 'rgb(215, 0, 82)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Black | |
| id: 9b81ea2b-1967-4f45-9fac-b5ee7726d3c8 | |
| name: Black | |
| ordinal: '"rgb(0, 0, 0)"' | |
| value: 'rgb(0, 0, 0)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Grey50 | |
| id: 02deab4c-3ee1-4abc-ab50-0f82e43bfdbd | |
| name: Grey50 | |
| ordinal: '"rgb(127, 127, 127)"' | |
| value: 'rgb(127, 127, 127)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Grey70 | |
| id: 665bf515-a664-4fb0-9e2a-e38c0dd8b2d4 | |
| name: Grey70 | |
| ordinal: '"rgb(179, 179, 179)"' | |
| value: 'rgb(179, 179, 179)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Grey90 | |
| id: 7e9eb843-232a-4527-b366-cd372e90a7ab | |
| name: Grey90 | |
| ordinal: '"rgb(227, 227, 227)"' | |
| value: 'rgb(227, 227, 227)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Grey95 | |
| id: 212b8580-8636-488e-a058-578e0eb4b0e8 | |
| name: Grey95 | |
| ordinal: '"rgb(242, 242, 242)"' | |
| value: 'rgb(242, 242, 242)' | |
| - model: PatternEnumPropertyOption | |
| contextId: White | |
| id: 292400ea-9636-4361-b8f6-39ba59c899c1 | |
| name: White | |
| ordinal: '"rgb(255, 255, 255)"' | |
| value: 'rgb(255, 255, 255)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Pink | |
| id: 3013220c-69a8-4147-9ff4-a94c0e7ddf23 | |
| name: Pink | |
| ordinal: '"rgb(236, 3, 97)"' | |
| value: 'rgb(236, 3, 97)' | |
| - model: PatternEnumPropertyOption | |
| contextId: PinkLight | |
| id: a2334eb5-c2fa-41b0-a0e1-fe965327f2dc | |
| name: PinkLight | |
| ordinal: '"rgb(236, 52, 126)"' | |
| value: 'rgb(236, 52, 126)' | |
| - model: PatternEnumPropertyOption | |
| contextId: VioletDark | |
| id: 3660b360-963a-4b66-9819-df3aa23886da | |
| name: VioletDark | |
| ordinal: '"rgb(81, 0, 77)"' | |
| value: 'rgb(81, 0, 77)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Violet | |
| id: 956551c7-425a-4b23-9c2f-7e6f48af11ff | |
| name: Violet | |
| ordinal: '"rgb(88, 2, 205)"' | |
| value: 'rgb(88, 2, 205)' | |
| origin: user-provided | |
| required: false | |
| type: enum | |
| - model: PatternProperty | |
| contextId: defaultChecked | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 4767b4ed-3693-4dee-8842-6652268fb621 | |
| inputType: default | |
| label: defaultChecked | |
| origin: user-provided | |
| propertyName: defaultChecked | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: defaultValue | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 7e03f2a8-d789-4290-a507-23355b3a7b9f | |
| inputType: default | |
| label: defaultValue | |
| origin: user-provided | |
| propertyName: defaultValue | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: suppressContentEditableWarning | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 39bbb0cb-d446-4504-a3a0-b5c3c450221d | |
| inputType: default | |
| label: suppressContentEditableWarning | |
| origin: user-provided | |
| propertyName: suppressContentEditableWarning | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: suppressHydrationWarning | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 2f8b731d-7010-4190-97d6-a3314c02abec | |
| inputType: default | |
| label: suppressHydrationWarning | |
| origin: user-provided | |
| propertyName: suppressHydrationWarning | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: accessKey | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 4baf72fd-7aa4-478d-93d6-df2c2d63f6c5 | |
| inputType: default | |
| label: accessKey | |
| origin: user-provided | |
| propertyName: accessKey | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: className | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 28c3b1dc-0c6b-42f7-be9c-57f239f9092a | |
| inputType: default | |
| label: className | |
| origin: user-provided | |
| propertyName: className | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: contentEditable | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 250b7df7-139d-44c8-a76a-d01f1571c015 | |
| inputType: default | |
| label: contentEditable | |
| origin: user-provided | |
| propertyName: contentEditable | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: contextMenu | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 831bc208-1362-462a-b128-6ff6155299b9 | |
| inputType: default | |
| label: contextMenu | |
| origin: user-provided | |
| propertyName: contextMenu | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: dir | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: e5ecfdf7-e15c-456a-96a0-9bbf6cae2c03 | |
| inputType: default | |
| label: dir | |
| origin: user-provided | |
| propertyName: dir | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: draggable | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 2ddc7442-d968-4e99-b7cd-055ee8005bf5 | |
| inputType: default | |
| label: draggable | |
| origin: user-provided | |
| propertyName: draggable | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: hidden | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 63c935a7-6abd-4adb-8751-196f1376a402 | |
| inputType: default | |
| label: hidden | |
| origin: user-provided | |
| propertyName: hidden | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: id | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 3180960c-2d94-4ca4-af99-65e88f184f29 | |
| inputType: default | |
| label: id | |
| origin: user-provided | |
| propertyName: id | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: lang | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: c8a5929c-04fb-4831-b35d-fd3df4d6798e | |
| inputType: default | |
| label: lang | |
| origin: user-provided | |
| propertyName: lang | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: placeholder | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: d7a78255-e555-480e-ad32-dde06f45ac7c | |
| inputType: default | |
| label: placeholder | |
| origin: user-provided | |
| propertyName: placeholder | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: slot | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: e3ef8be4-7b08-47bc-abe6-8258efaa19bb | |
| inputType: default | |
| label: slot | |
| origin: user-provided | |
| propertyName: slot | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: spellCheck | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: f95b1e79-baab-437c-9da0-89d63c451ebe | |
| inputType: default | |
| label: spellCheck | |
| origin: user-provided | |
| propertyName: spellCheck | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: style | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 7363b138-508e-4a6a-853f-9eed04688420 | |
| inputType: default | |
| label: style | |
| origin: user-provided | |
| propertyName: style | |
| required: false | |
| type: unknown | |
| typeText: 'style?: CSSProperties;' | |
| - model: PatternProperty | |
| contextId: tabIndex | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 5e41be59-6b0b-4f2a-8140-8b29d992be59 | |
| inputType: default | |
| label: tabIndex | |
| origin: user-provided | |
| propertyName: tabIndex | |
| required: false | |
| type: number | |
| - model: PatternProperty | |
| contextId: title | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 38e88f60-9788-48c0-82e7-164d159c23a2 | |
| inputType: default | |
| label: title | |
| origin: user-provided | |
| propertyName: title | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: inputMode | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 360a3084-cf3f-417f-a780-f3e63bf32154 | |
| inputType: default | |
| label: inputMode | |
| origin: user-provided | |
| propertyName: inputMode | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: is | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: ca1c043f-4ee5-4a16-99e4-8853dbe729b3 | |
| inputType: default | |
| label: is | |
| origin: user-provided | |
| propertyName: is | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: radioGroup | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 9fd5a263-0188-472e-a869-f55e1d57537a | |
| inputType: default | |
| label: radioGroup | |
| origin: user-provided | |
| propertyName: radioGroup | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: role | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 3152efff-3f2a-4a68-bf54-ebfbfd4f22f8 | |
| inputType: default | |
| label: role | |
| origin: user-provided | |
| propertyName: role | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: about | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 209283ad-d6a5-4bd1-9213-292874eea611 | |
| inputType: default | |
| label: about | |
| origin: user-provided | |
| propertyName: about | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: datatype | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 92abcc7c-c71a-40fa-a88b-b7d149dba57d | |
| inputType: default | |
| label: datatype | |
| origin: user-provided | |
| propertyName: datatype | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: inlist | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 8f914134-29f7-44b6-a9aa-3adc03ff1398 | |
| inputType: default | |
| label: inlist | |
| origin: user-provided | |
| propertyName: inlist | |
| required: false | |
| type: unknown | |
| typeText: 'inlist?: any;' | |
| - model: PatternProperty | |
| contextId: prefix | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 3c094fec-b78a-4825-bd23-dd1a16c0ab55 | |
| inputType: default | |
| label: prefix | |
| origin: user-provided | |
| propertyName: prefix | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: property | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 5ef7b29f-961a-40ba-8aaa-3383f09aa3c8 | |
| inputType: default | |
| label: property | |
| origin: user-provided | |
| propertyName: property | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: resource | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 030c5e1b-5228-497e-837d-fb64ed8edc67 | |
| inputType: default | |
| label: resource | |
| origin: user-provided | |
| propertyName: resource | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: typeof | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 97151fd0-9d33-4c52-b4f5-299b8798466b | |
| inputType: default | |
| label: typeof | |
| origin: user-provided | |
| propertyName: typeof | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: vocab | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 136a5088-f456-47d6-b7e0-e17ed7e07865 | |
| inputType: default | |
| label: vocab | |
| origin: user-provided | |
| propertyName: vocab | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: autoCapitalize | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: f770e063-482c-440b-baac-c574da215c9a | |
| inputType: default | |
| label: autoCapitalize | |
| origin: user-provided | |
| propertyName: autoCapitalize | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: autoCorrect | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: f1daca4d-955c-4a49-ae1f-68cf556085f6 | |
| inputType: default | |
| label: autoCorrect | |
| origin: user-provided | |
| propertyName: autoCorrect | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: autoSave | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 28575da1-f030-4011-bcef-b58b27b320ec | |
| inputType: default | |
| label: autoSave | |
| origin: user-provided | |
| propertyName: autoSave | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: itemProp | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: e526c83c-26e6-498f-b9c1-ce10658afd8e | |
| inputType: default | |
| label: itemProp | |
| origin: user-provided | |
| propertyName: itemProp | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: itemScope | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: e386f866-57fd-4e5b-98dc-ece9dac1410a | |
| inputType: default | |
| label: itemScope | |
| origin: user-provided | |
| propertyName: itemScope | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: itemType | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 36178f7b-77da-4572-b011-7cc3b7e1bbab | |
| inputType: default | |
| label: itemType | |
| origin: user-provided | |
| propertyName: itemType | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: itemID | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: c9d4d0f9-49c4-4b35-8cf6-ac45787cec7a | |
| inputType: default | |
| label: itemID | |
| origin: user-provided | |
| propertyName: itemID | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: itemRef | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: c768fc7d-b4da-4651-8176-6a573cb9bdb4 | |
| inputType: default | |
| label: itemRef | |
| origin: user-provided | |
| propertyName: itemRef | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: results | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: a16b8bb9-6a25-43fb-a896-cfe2859c52f6 | |
| inputType: default | |
| label: results | |
| origin: user-provided | |
| propertyName: results | |
| required: false | |
| type: number | |
| - model: PatternProperty | |
| contextId: security | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: cadb9573-3ab6-443b-bb86-b004bcff773e | |
| inputType: default | |
| label: security | |
| origin: user-provided | |
| propertyName: security | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: unselectable | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: a198eb1b-5b01-46da-a7c7-8f4f63ed21d9 | |
| inputType: default | |
| label: unselectable | |
| origin: user-provided | |
| propertyName: unselectable | |
| required: false | |
| type: unknown | |
| typeText: 'unselectable?: ''on'' | ''off'';' | |
| - model: PatternProperty | |
| contextId: aria-activedescendant | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 89f32df2-9310-4533-8a5f-da9fde0e2387 | |
| inputType: default | |
| label: aria-activedescendant | |
| origin: user-provided | |
| propertyName: aria-activedescendant | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: aria-atomic | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 2f28ee39-81e4-42f9-91a8-c683f3b8f81b | |
| inputType: default | |
| label: aria-atomic | |
| origin: user-provided | |
| propertyName: aria-atomic | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: aria-autocomplete | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: a1091a38-cbba-4d2d-b088-ebd65653b530 | |
| inputType: default | |
| label: aria-autocomplete | |
| origin: user-provided | |
| propertyName: aria-autocomplete | |
| required: false | |
| type: unknown | |
| typeText: '''aria-autocomplete''?: ''none'' | ''inline'' | ''list'' | ''both'';' | |
| - model: PatternProperty | |
| contextId: aria-busy | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: dd77ab40-fe13-45cf-ac46-81ec9c76696a | |
| inputType: default | |
| label: aria-busy | |
| origin: user-provided | |
| propertyName: aria-busy | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: aria-checked | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 438f5f1f-0edf-46c7-bfe6-133e009c96fa | |
| inputType: default | |
| label: aria-checked | |
| origin: user-provided | |
| propertyName: aria-checked | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: aria-colcount | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 8035af87-dc09-4efd-a924-02e825b85192 | |
| inputType: default | |
| label: aria-colcount | |
| origin: user-provided | |
| propertyName: aria-colcount | |
| required: false | |
| type: number | |
| - model: PatternProperty | |
| contextId: aria-colindex | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 4f330a12-0bdc-43d8-b21e-498777376677 | |
| inputType: default | |
| label: aria-colindex | |
| origin: user-provided | |
| propertyName: aria-colindex | |
| required: false | |
| type: number | |
| - model: PatternProperty | |
| contextId: aria-colspan | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 70bb0cae-8284-4352-bb9c-fc1e9c6b352b | |
| inputType: default | |
| label: aria-colspan | |
| origin: user-provided | |
| propertyName: aria-colspan | |
| required: false | |
| type: number | |
| - model: PatternProperty | |
| contextId: aria-controls | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: c5e59825-6f34-405a-a697-624967a2e811 | |
| inputType: default | |
| label: aria-controls | |
| origin: user-provided | |
| propertyName: aria-controls | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: aria-current | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 998a0730-bf7f-427e-b010-1dbb468062c7 | |
| inputType: default | |
| label: aria-current | |
| origin: user-provided | |
| propertyName: aria-current | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: aria-describedby | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 5092c7db-0f9b-4011-a53c-a32f8c902b3f | |
| inputType: default | |
| label: aria-describedby | |
| origin: user-provided | |
| propertyName: aria-describedby | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: aria-details | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: a49b9658-1d3f-4f5b-a36b-673c01d4ec27 | |
| inputType: default | |
| label: aria-details | |
| origin: user-provided | |
| propertyName: aria-details | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: aria-disabled | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 5a725ee6-5751-4874-8db0-20f4ea990eb7 | |
| inputType: default | |
| label: aria-disabled | |
| origin: user-provided | |
| propertyName: aria-disabled | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: aria-dropeffect | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 4e333be2-e029-4787-a9a7-5929d4a65689 | |
| inputType: default | |
| label: aria-dropeffect | |
| origin: user-provided | |
| propertyName: aria-dropeffect | |
| required: false | |
| type: unknown | |
| typeText: >- | |
| 'aria-dropeffect'?: 'none' | 'copy' | 'execute' | 'link' | 'move' | | |
| 'popup'; | |
| - model: PatternProperty | |
| contextId: aria-errormessage | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: afa387e6-2daf-479c-bf81-3fb72e742979 | |
| inputType: default | |
| label: aria-errormessage | |
| origin: user-provided | |
| propertyName: aria-errormessage | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: aria-expanded | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: ab888a83-21fa-46de-82a1-1fa7373cc620 | |
| inputType: default | |
| label: aria-expanded | |
| origin: user-provided | |
| propertyName: aria-expanded | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: aria-flowto | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: fadddd62-2579-48d0-9894-29f962c62523 | |
| inputType: default | |
| label: aria-flowto | |
| origin: user-provided | |
| propertyName: aria-flowto | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: aria-grabbed | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 8995a175-2676-4265-a4f1-033891a91e96 | |
| inputType: default | |
| label: aria-grabbed | |
| origin: user-provided | |
| propertyName: aria-grabbed | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: aria-haspopup | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 5bce6246-4884-4f2e-9baa-962cdf9f121d | |
| inputType: default | |
| label: aria-haspopup | |
| origin: user-provided | |
| propertyName: aria-haspopup | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: aria-hidden | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 45a50e97-d78d-46ba-bdb1-1fa32290a171 | |
| inputType: default | |
| label: aria-hidden | |
| origin: user-provided | |
| propertyName: aria-hidden | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: aria-invalid | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: c0008e5e-cdbf-49ba-ae96-7789418de5a4 | |
| inputType: default | |
| label: aria-invalid | |
| origin: user-provided | |
| propertyName: aria-invalid | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: aria-keyshortcuts | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 3fdea9b4-f6a3-4961-ba0a-95e8ad4cab5a | |
| inputType: default | |
| label: aria-keyshortcuts | |
| origin: user-provided | |
| propertyName: aria-keyshortcuts | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: aria-label | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 1fc70b6a-dbce-452d-9117-23e5a6439144 | |
| inputType: default | |
| label: aria-label | |
| origin: user-provided | |
| propertyName: aria-label | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: aria-labelledby | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 8e542f05-0edd-47c3-b672-1aad93df9e9f | |
| inputType: default | |
| label: aria-labelledby | |
| origin: user-provided | |
| propertyName: aria-labelledby | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: aria-level | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: f50c4e99-6dbe-454c-a673-d67766c1def7 | |
| inputType: default | |
| label: aria-level | |
| origin: user-provided | |
| propertyName: aria-level | |
| required: false | |
| type: number | |
| - model: PatternProperty | |
| contextId: aria-live | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 17137e22-3865-4b02-b477-a4b143450e8c | |
| inputType: default | |
| label: aria-live | |
| origin: user-provided | |
| propertyName: aria-live | |
| required: false | |
| type: unknown | |
| typeText: '''aria-live''?: ''off'' | ''assertive'' | ''polite'';' | |
| - model: PatternProperty | |
| contextId: aria-modal | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 26cc315c-66e2-4a9f-83d0-497d81060dc7 | |
| inputType: default | |
| label: aria-modal | |
| origin: user-provided | |
| propertyName: aria-modal | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: aria-multiline | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 87a075c5-0ad9-42d4-8dd5-401be9d9af3f | |
| inputType: default | |
| label: aria-multiline | |
| origin: user-provided | |
| propertyName: aria-multiline | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: aria-multiselectable | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 600c6642-dad0-4ebd-8a47-e94b9516e0a8 | |
| inputType: default | |
| label: aria-multiselectable | |
| origin: user-provided | |
| propertyName: aria-multiselectable | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: aria-orientation | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 54af3505-0a97-4ba6-9974-bd666880fbd4 | |
| inputType: default | |
| label: aria-orientation | |
| origin: user-provided | |
| propertyName: aria-orientation | |
| required: false | |
| type: unknown | |
| typeText: '''aria-orientation''?: ''horizontal'' | ''vertical'';' | |
| - model: PatternProperty | |
| contextId: aria-owns | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 4f3ff4bf-1098-4b97-8821-1fbb16bdd1f1 | |
| inputType: default | |
| label: aria-owns | |
| origin: user-provided | |
| propertyName: aria-owns | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: aria-placeholder | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 734e9546-d8c3-4d8e-b4ef-c832a1f0fdba | |
| inputType: default | |
| label: aria-placeholder | |
| origin: user-provided | |
| propertyName: aria-placeholder | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: aria-posinset | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 9b75ff64-ba2c-46cb-a463-80e48e9f7fbc | |
| inputType: default | |
| label: aria-posinset | |
| origin: user-provided | |
| propertyName: aria-posinset | |
| required: false | |
| type: number | |
| - model: PatternProperty | |
| contextId: aria-pressed | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 56ffb9b9-f9e0-48a3-9495-cf5ed1ae00f8 | |
| inputType: default | |
| label: aria-pressed | |
| origin: user-provided | |
| propertyName: aria-pressed | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: aria-readonly | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 3e547e83-b8e1-415e-9554-f85ba0a2c1d6 | |
| inputType: default | |
| label: aria-readonly | |
| origin: user-provided | |
| propertyName: aria-readonly | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: aria-relevant | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 552a5d23-3e4a-4e18-8cf5-54dc3c67a300 | |
| inputType: default | |
| label: aria-relevant | |
| origin: user-provided | |
| propertyName: aria-relevant | |
| required: false | |
| type: unknown | |
| typeText: >- | |
| 'aria-relevant'?: 'additions' | 'additions text' | 'all' | 'removals' | |
| | 'text'; | |
| - model: PatternProperty | |
| contextId: aria-required | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 5db6ad6b-8dfe-4295-9bb4-06e7b7a8ba37 | |
| inputType: default | |
| label: aria-required | |
| origin: user-provided | |
| propertyName: aria-required | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: aria-roledescription | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 1aa02e50-752e-420f-9793-d32b80bd43c3 | |
| inputType: default | |
| label: aria-roledescription | |
| origin: user-provided | |
| propertyName: aria-roledescription | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: aria-rowcount | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 06e51203-ae4b-40b8-ad40-0d086da1e8e7 | |
| inputType: default | |
| label: aria-rowcount | |
| origin: user-provided | |
| propertyName: aria-rowcount | |
| required: false | |
| type: number | |
| - model: PatternProperty | |
| contextId: aria-rowindex | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 5aa04946-fa3e-4d1f-8da6-b03f656d4038 | |
| inputType: default | |
| label: aria-rowindex | |
| origin: user-provided | |
| propertyName: aria-rowindex | |
| required: false | |
| type: number | |
| - model: PatternProperty | |
| contextId: aria-rowspan | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: d18a2591-0b6c-441a-a612-97408ae526a9 | |
| inputType: default | |
| label: aria-rowspan | |
| origin: user-provided | |
| propertyName: aria-rowspan | |
| required: false | |
| type: number | |
| - model: PatternProperty | |
| contextId: aria-selected | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 132ab478-b418-4a3c-a21f-dfd0ddbcbd5f | |
| inputType: default | |
| label: aria-selected | |
| origin: user-provided | |
| propertyName: aria-selected | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: aria-setsize | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 7d2a497c-f097-47a8-bce3-1c0533d2dc9d | |
| inputType: default | |
| label: aria-setsize | |
| origin: user-provided | |
| propertyName: aria-setsize | |
| required: false | |
| type: number | |
| - model: PatternProperty | |
| contextId: aria-sort | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 273757c5-ad75-426d-934c-6071d106a617 | |
| inputType: default | |
| label: aria-sort | |
| origin: user-provided | |
| propertyName: aria-sort | |
| required: false | |
| type: unknown | |
| typeText: '''aria-sort''?: ''none'' | ''ascending'' | ''descending'' | ''other'';' | |
| - model: PatternProperty | |
| contextId: aria-valuemax | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 0280c819-e17b-4324-ab05-7b0f3ad0f6dd | |
| inputType: default | |
| label: aria-valuemax | |
| origin: user-provided | |
| propertyName: aria-valuemax | |
| required: false | |
| type: number | |
| - model: PatternProperty | |
| contextId: aria-valuemin | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: f56953f5-c2ba-4d91-bf8b-48dc181f31ff | |
| inputType: default | |
| label: aria-valuemin | |
| origin: user-provided | |
| propertyName: aria-valuemin | |
| required: false | |
| type: number | |
| - model: PatternProperty | |
| contextId: aria-valuenow | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 1d1ca0e7-cb66-4795-b5c2-8f4fef518644 | |
| inputType: default | |
| label: aria-valuenow | |
| origin: user-provided | |
| propertyName: aria-valuenow | |
| required: false | |
| type: number | |
| - model: PatternProperty | |
| contextId: aria-valuetext | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 806f6bd0-a8a6-4871-a806-37b62371e53a | |
| inputType: default | |
| label: aria-valuetext | |
| origin: user-provided | |
| propertyName: aria-valuetext | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: dangerouslySetInnerHTML | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 1dadd4ae-267d-436a-b8e1-2f1f0d4b2662 | |
| inputType: default | |
| label: dangerouslySetInnerHTML | |
| origin: user-provided | |
| propertyName: dangerouslySetInnerHTML | |
| required: false | |
| type: unknown | |
| typeText: |- | |
| dangerouslySetInnerHTML?: { | |
| __html: string; | |
| }; | |
| - model: PatternProperty | |
| contextId: onCopy | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: a38c1e4a-d059-46f4-84b6-378fc90fc40c | |
| inputType: default | |
| label: onCopy | |
| origin: user-provided | |
| propertyName: onCopy | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onCopyCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 036df49e-d8b1-4413-8cfb-0e7c20c74950 | |
| inputType: default | |
| label: onCopyCapture | |
| origin: user-provided | |
| propertyName: onCopyCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onCut | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 8a0de8f4-cb19-4e6f-b0c4-8ce9412fd9d4 | |
| inputType: default | |
| label: onCut | |
| origin: user-provided | |
| propertyName: onCut | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onCutCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 20cd5ea9-dd41-41b5-b9b3-1fba9df3f43b | |
| inputType: default | |
| label: onCutCapture | |
| origin: user-provided | |
| propertyName: onCutCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onPaste | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 421b505c-2f1d-4f4d-bbb0-15b03dab39a3 | |
| inputType: default | |
| label: onPaste | |
| origin: user-provided | |
| propertyName: onPaste | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onPasteCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 3866d92a-c52e-4537-b638-47e45990e467 | |
| inputType: default | |
| label: onPasteCapture | |
| origin: user-provided | |
| propertyName: onPasteCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onCompositionEnd | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: ec7f9086-4c2c-4a4b-b162-21bedcd79acd | |
| inputType: default | |
| label: onCompositionEnd | |
| origin: user-provided | |
| propertyName: onCompositionEnd | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onCompositionEndCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 254b74dd-0592-4e44-8219-00add9316b55 | |
| inputType: default | |
| label: onCompositionEndCapture | |
| origin: user-provided | |
| propertyName: onCompositionEndCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onCompositionStart | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 800abf57-5390-40ba-a6be-8d089f090a2a | |
| inputType: default | |
| label: onCompositionStart | |
| origin: user-provided | |
| propertyName: onCompositionStart | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onCompositionStartCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 83cb74be-422b-4cde-b704-c9e8c2269448 | |
| inputType: default | |
| label: onCompositionStartCapture | |
| origin: user-provided | |
| propertyName: onCompositionStartCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onCompositionUpdate | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: b80a7d97-8d70-433c-901a-810a7c950b67 | |
| inputType: default | |
| label: onCompositionUpdate | |
| origin: user-provided | |
| propertyName: onCompositionUpdate | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onCompositionUpdateCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: c3ac1f86-b10a-4807-8079-a8b6dda7c8a4 | |
| inputType: default | |
| label: onCompositionUpdateCapture | |
| origin: user-provided | |
| propertyName: onCompositionUpdateCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onFocus | |
| description: '' | |
| event: | |
| type: FocusEvent | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 1801c709-4788-41f5-b35c-396520153d89 | |
| inputType: default | |
| label: onFocus | |
| origin: user-provided | |
| propertyName: onFocus | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onFocusCapture | |
| description: '' | |
| event: | |
| type: FocusEvent | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: d63a0704-af97-4f67-b246-92e667963960 | |
| inputType: default | |
| label: onFocusCapture | |
| origin: user-provided | |
| propertyName: onFocusCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onBlur | |
| description: '' | |
| event: | |
| type: FocusEvent | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 844d78db-70fa-4e76-ac11-2d3997be0c2a | |
| inputType: default | |
| label: onBlur | |
| origin: user-provided | |
| propertyName: onBlur | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onBlurCapture | |
| description: '' | |
| event: | |
| type: FocusEvent | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 7a21ba34-0405-4aaf-a2fb-819f83b8ac68 | |
| inputType: default | |
| label: onBlurCapture | |
| origin: user-provided | |
| propertyName: onBlurCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onChange | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 6a3f1cd2-20dd-48c3-860b-dbba46f381dc | |
| inputType: default | |
| label: onChange | |
| origin: user-provided | |
| propertyName: onChange | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onChangeCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: ed79cad6-50f1-4ecc-a7bc-492ba1b540cf | |
| inputType: default | |
| label: onChangeCapture | |
| origin: user-provided | |
| propertyName: onChangeCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onBeforeInput | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: dc4967c7-2ff0-44ac-9c47-256d22c1a810 | |
| inputType: default | |
| label: onBeforeInput | |
| origin: user-provided | |
| propertyName: onBeforeInput | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onBeforeInputCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 3d0242f3-c43d-4a1b-a0c2-1c9866591a47 | |
| inputType: default | |
| label: onBeforeInputCapture | |
| origin: user-provided | |
| propertyName: onBeforeInputCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onInput | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 09df902a-dd2e-46a2-b373-e9659e24d409 | |
| inputType: default | |
| label: onInput | |
| origin: user-provided | |
| propertyName: onInput | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onInputCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 14a8035c-9f39-4585-8736-81d163f3bf95 | |
| inputType: default | |
| label: onInputCapture | |
| origin: user-provided | |
| propertyName: onInputCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onReset | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 12f2f4d2-8eff-4e01-8551-051f7d2f05df | |
| inputType: default | |
| label: onReset | |
| origin: user-provided | |
| propertyName: onReset | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onResetCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 2ef01f69-d605-4e68-b486-9e56cd830857 | |
| inputType: default | |
| label: onResetCapture | |
| origin: user-provided | |
| propertyName: onResetCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onSubmit | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: df193705-3f92-4e81-8c7a-176bdd10f0e7 | |
| inputType: default | |
| label: onSubmit | |
| origin: user-provided | |
| propertyName: onSubmit | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onSubmitCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 347fc2b7-76dd-4d18-972b-bdadaec8ca7f | |
| inputType: default | |
| label: onSubmitCapture | |
| origin: user-provided | |
| propertyName: onSubmitCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onInvalid | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 3dee1f95-2ab7-4bd9-8c1e-489384806a20 | |
| inputType: default | |
| label: onInvalid | |
| origin: user-provided | |
| propertyName: onInvalid | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onInvalidCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 102af8b4-f110-49c9-9752-ef8cabc784e9 | |
| inputType: default | |
| label: onInvalidCapture | |
| origin: user-provided | |
| propertyName: onInvalidCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onLoad | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 9314b354-f12e-48a6-909f-4226d7a0c2ed | |
| inputType: default | |
| label: onLoad | |
| origin: user-provided | |
| propertyName: onLoad | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onLoadCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 1d2abc8b-42fd-402d-9e3d-c2dc270b75b7 | |
| inputType: default | |
| label: onLoadCapture | |
| origin: user-provided | |
| propertyName: onLoadCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onError | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 3fcafea6-f60d-42bb-a4d0-82bb6f3dcab2 | |
| inputType: default | |
| label: onError | |
| origin: user-provided | |
| propertyName: onError | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onErrorCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 1029bc2c-1608-4478-b581-fdd402f7fe27 | |
| inputType: default | |
| label: onErrorCapture | |
| origin: user-provided | |
| propertyName: onErrorCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onKeyDown | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: fd61fee7-f08c-4eab-946e-8ddce170dab3 | |
| inputType: default | |
| label: onKeyDown | |
| origin: user-provided | |
| propertyName: onKeyDown | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onKeyDownCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: b63c4571-7757-4bff-8fae-2c79cf60ca8d | |
| inputType: default | |
| label: onKeyDownCapture | |
| origin: user-provided | |
| propertyName: onKeyDownCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onKeyPress | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: e7055b6d-bdc1-417d-8774-921d60169f06 | |
| inputType: default | |
| label: onKeyPress | |
| origin: user-provided | |
| propertyName: onKeyPress | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onKeyPressCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 319601c0-d065-4255-8920-9caa836a27e2 | |
| inputType: default | |
| label: onKeyPressCapture | |
| origin: user-provided | |
| propertyName: onKeyPressCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onKeyUp | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 148fc29f-6af6-4d9b-a7b8-0a644135b2df | |
| inputType: default | |
| label: onKeyUp | |
| origin: user-provided | |
| propertyName: onKeyUp | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onKeyUpCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 35ca7463-2529-4501-b0d3-ef0c3040d836 | |
| inputType: default | |
| label: onKeyUpCapture | |
| origin: user-provided | |
| propertyName: onKeyUpCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onAbort | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 1bccc39a-b27d-4dc8-b9d9-190ffb94ceab | |
| inputType: default | |
| label: onAbort | |
| origin: user-provided | |
| propertyName: onAbort | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onAbortCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: ad681994-1e50-423e-9003-c951cbb3415d | |
| inputType: default | |
| label: onAbortCapture | |
| origin: user-provided | |
| propertyName: onAbortCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onCanPlay | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 4738799d-2752-4923-8666-31c4d57cf36f | |
| inputType: default | |
| label: onCanPlay | |
| origin: user-provided | |
| propertyName: onCanPlay | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onCanPlayCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: c670b9dc-bb53-4991-ad3c-dce2f9bb705b | |
| inputType: default | |
| label: onCanPlayCapture | |
| origin: user-provided | |
| propertyName: onCanPlayCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onCanPlayThrough | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: f1d93bf1-295e-455b-9508-fe2370b9b3f8 | |
| inputType: default | |
| label: onCanPlayThrough | |
| origin: user-provided | |
| propertyName: onCanPlayThrough | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onCanPlayThroughCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 803c05f2-8468-4e42-985e-e7c4142a78f1 | |
| inputType: default | |
| label: onCanPlayThroughCapture | |
| origin: user-provided | |
| propertyName: onCanPlayThroughCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onDurationChange | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 4b10986d-8f34-4ebc-b934-c99bf8314e72 | |
| inputType: default | |
| label: onDurationChange | |
| origin: user-provided | |
| propertyName: onDurationChange | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onDurationChangeCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: b6a52478-cb37-457a-be98-927756568ce0 | |
| inputType: default | |
| label: onDurationChangeCapture | |
| origin: user-provided | |
| propertyName: onDurationChangeCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onEmptied | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 8d70585e-c8a8-49c0-8b56-5353a10abde8 | |
| inputType: default | |
| label: onEmptied | |
| origin: user-provided | |
| propertyName: onEmptied | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onEmptiedCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: c0aafa32-07dd-48c4-8bea-c8d612026532 | |
| inputType: default | |
| label: onEmptiedCapture | |
| origin: user-provided | |
| propertyName: onEmptiedCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onEncrypted | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: c8a23734-36ff-469f-9b0f-945d59532df3 | |
| inputType: default | |
| label: onEncrypted | |
| origin: user-provided | |
| propertyName: onEncrypted | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onEncryptedCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: a3d32436-a5e2-4f91-a5b2-7f807bf8780e | |
| inputType: default | |
| label: onEncryptedCapture | |
| origin: user-provided | |
| propertyName: onEncryptedCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onEnded | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 77b82fe7-3aeb-42cf-b712-48342757e329 | |
| inputType: default | |
| label: onEnded | |
| origin: user-provided | |
| propertyName: onEnded | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onEndedCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 0c0b9003-2ac5-412a-a237-e5738450d335 | |
| inputType: default | |
| label: onEndedCapture | |
| origin: user-provided | |
| propertyName: onEndedCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onLoadedData | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 07e0fd76-8e81-442a-ad15-4bcfd879fa63 | |
| inputType: default | |
| label: onLoadedData | |
| origin: user-provided | |
| propertyName: onLoadedData | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onLoadedDataCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 311ca64a-c382-4c74-8d68-ad15503cf589 | |
| inputType: default | |
| label: onLoadedDataCapture | |
| origin: user-provided | |
| propertyName: onLoadedDataCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onLoadedMetadata | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: cb4d42aa-475f-4549-ae9b-f64ab9386026 | |
| inputType: default | |
| label: onLoadedMetadata | |
| origin: user-provided | |
| propertyName: onLoadedMetadata | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onLoadedMetadataCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 12675c5a-e8b0-4d59-a471-2418122c3196 | |
| inputType: default | |
| label: onLoadedMetadataCapture | |
| origin: user-provided | |
| propertyName: onLoadedMetadataCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onLoadStart | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 6abd6865-bd3e-456c-879e-c0927eeb3e21 | |
| inputType: default | |
| label: onLoadStart | |
| origin: user-provided | |
| propertyName: onLoadStart | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onLoadStartCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 211db50c-47a6-4c40-9d0d-366b45efa883 | |
| inputType: default | |
| label: onLoadStartCapture | |
| origin: user-provided | |
| propertyName: onLoadStartCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onPause | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: fd48ac24-ef78-4e49-893a-19c7085fa6d3 | |
| inputType: default | |
| label: onPause | |
| origin: user-provided | |
| propertyName: onPause | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onPauseCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 08f1539c-769d-4cd2-981a-f438ea90b19a | |
| inputType: default | |
| label: onPauseCapture | |
| origin: user-provided | |
| propertyName: onPauseCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onPlay | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: efeaaec1-e2b3-4d8c-8496-86836dd6a352 | |
| inputType: default | |
| label: onPlay | |
| origin: user-provided | |
| propertyName: onPlay | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onPlayCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 37ec1907-3b51-476f-97cc-26ec8247c160 | |
| inputType: default | |
| label: onPlayCapture | |
| origin: user-provided | |
| propertyName: onPlayCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onPlaying | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 45ae6833-4850-4e0a-a457-0a8c1c74b082 | |
| inputType: default | |
| label: onPlaying | |
| origin: user-provided | |
| propertyName: onPlaying | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onPlayingCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 2d4f0994-d143-4e11-b9d0-7e19715e8339 | |
| inputType: default | |
| label: onPlayingCapture | |
| origin: user-provided | |
| propertyName: onPlayingCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onProgress | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 9b1c36a5-ca0a-4486-97fa-fcb4d9c0bef6 | |
| inputType: default | |
| label: onProgress | |
| origin: user-provided | |
| propertyName: onProgress | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onProgressCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: fc2194bb-e365-4ca5-9228-5745046af6b9 | |
| inputType: default | |
| label: onProgressCapture | |
| origin: user-provided | |
| propertyName: onProgressCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onRateChange | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 72e1eee0-6806-44c1-8db4-ce07082a5af7 | |
| inputType: default | |
| label: onRateChange | |
| origin: user-provided | |
| propertyName: onRateChange | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onRateChangeCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 663ff1ae-e101-48b4-b6f4-f700e22dd77a | |
| inputType: default | |
| label: onRateChangeCapture | |
| origin: user-provided | |
| propertyName: onRateChangeCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onSeeked | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 99af2a55-1f0b-48d2-ba08-c08fb8c16ed7 | |
| inputType: default | |
| label: onSeeked | |
| origin: user-provided | |
| propertyName: onSeeked | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onSeekedCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: ff4cfe05-9994-4ce1-a9ff-98105bbba0fd | |
| inputType: default | |
| label: onSeekedCapture | |
| origin: user-provided | |
| propertyName: onSeekedCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onSeeking | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 8e9b2cd7-ecd2-4b84-bee0-cde678787add | |
| inputType: default | |
| label: onSeeking | |
| origin: user-provided | |
| propertyName: onSeeking | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onSeekingCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: e55ba4ae-1a47-4320-8eb0-e5056d77841a | |
| inputType: default | |
| label: onSeekingCapture | |
| origin: user-provided | |
| propertyName: onSeekingCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onStalled | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: ac977bff-2727-4671-ae84-7b0a4834e875 | |
| inputType: default | |
| label: onStalled | |
| origin: user-provided | |
| propertyName: onStalled | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onStalledCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 610a1216-9f9e-4ffc-9891-8c0a6a73674f | |
| inputType: default | |
| label: onStalledCapture | |
| origin: user-provided | |
| propertyName: onStalledCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onSuspend | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: a44a1b7a-43ed-4af2-9b8d-03fcd2304d89 | |
| inputType: default | |
| label: onSuspend | |
| origin: user-provided | |
| propertyName: onSuspend | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onSuspendCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 24a174dc-5c38-4e5b-a52c-7cf91ba19e5a | |
| inputType: default | |
| label: onSuspendCapture | |
| origin: user-provided | |
| propertyName: onSuspendCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onTimeUpdate | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: dfe94128-c1a6-4689-af53-ad863bc3ff94 | |
| inputType: default | |
| label: onTimeUpdate | |
| origin: user-provided | |
| propertyName: onTimeUpdate | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onTimeUpdateCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 48b9cd35-2c4a-48eb-a4e3-d29efb8fa286 | |
| inputType: default | |
| label: onTimeUpdateCapture | |
| origin: user-provided | |
| propertyName: onTimeUpdateCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onVolumeChange | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 1a24004c-371c-4a90-814a-0ce8b68a4a48 | |
| inputType: default | |
| label: onVolumeChange | |
| origin: user-provided | |
| propertyName: onVolumeChange | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onVolumeChangeCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 848543e5-f843-4f65-b0ce-6fab71127097 | |
| inputType: default | |
| label: onVolumeChangeCapture | |
| origin: user-provided | |
| propertyName: onVolumeChangeCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onWaiting | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: ff49d9ed-0958-4978-97ba-2c3c52a06648 | |
| inputType: default | |
| label: onWaiting | |
| origin: user-provided | |
| propertyName: onWaiting | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onWaitingCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 7b3706b2-9469-4b52-a174-c3ddb90ab4f0 | |
| inputType: default | |
| label: onWaitingCapture | |
| origin: user-provided | |
| propertyName: onWaitingCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onClick | |
| description: '' | |
| event: | |
| type: MouseEvent | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: df57e13d-cded-4ac3-8f7b-31db77fb1885 | |
| inputType: default | |
| label: onClick | |
| origin: user-provided | |
| propertyName: onClick | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onClickCapture | |
| description: '' | |
| event: | |
| type: MouseEvent | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: b1a0b817-a723-49ab-a653-89b6db60d62f | |
| inputType: default | |
| label: onClickCapture | |
| origin: user-provided | |
| propertyName: onClickCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onContextMenu | |
| description: '' | |
| event: | |
| type: MouseEvent | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 79caec21-969e-4fbb-bc08-c62cb434f1b4 | |
| inputType: default | |
| label: onContextMenu | |
| origin: user-provided | |
| propertyName: onContextMenu | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onContextMenuCapture | |
| description: '' | |
| event: | |
| type: MouseEvent | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 3d4c6ddf-59bf-4f70-93e8-3d46a76bae0c | |
| inputType: default | |
| label: onContextMenuCapture | |
| origin: user-provided | |
| propertyName: onContextMenuCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onDoubleClick | |
| description: '' | |
| event: | |
| type: MouseEvent | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: f2fed750-b02b-4e23-8899-bfd88925224d | |
| inputType: default | |
| label: onDoubleClick | |
| origin: user-provided | |
| propertyName: onDoubleClick | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onDoubleClickCapture | |
| description: '' | |
| event: | |
| type: MouseEvent | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: ea725e89-b8ea-4b0a-9639-b686256a43f3 | |
| inputType: default | |
| label: onDoubleClickCapture | |
| origin: user-provided | |
| propertyName: onDoubleClickCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onDrag | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: c0c35611-2579-4d45-94b6-67fb386cca7c | |
| inputType: default | |
| label: onDrag | |
| origin: user-provided | |
| propertyName: onDrag | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onDragCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 5cf57ac9-777b-43fe-8cfe-e9dbdf7bb285 | |
| inputType: default | |
| label: onDragCapture | |
| origin: user-provided | |
| propertyName: onDragCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onDragEnd | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 6416444e-445d-44be-8794-fe8b8e361957 | |
| inputType: default | |
| label: onDragEnd | |
| origin: user-provided | |
| propertyName: onDragEnd | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onDragEndCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 47dc896f-e24e-4c25-9985-ce8fca34ceab | |
| inputType: default | |
| label: onDragEndCapture | |
| origin: user-provided | |
| propertyName: onDragEndCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onDragEnter | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 10c50c91-9c86-47cc-981f-291ee4b85dae | |
| inputType: default | |
| label: onDragEnter | |
| origin: user-provided | |
| propertyName: onDragEnter | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onDragEnterCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 3719eabe-0f16-4e8f-ac26-0a1c02578e3f | |
| inputType: default | |
| label: onDragEnterCapture | |
| origin: user-provided | |
| propertyName: onDragEnterCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onDragExit | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: e4578d28-fd1b-49c6-8e21-e017d3fb4ebf | |
| inputType: default | |
| label: onDragExit | |
| origin: user-provided | |
| propertyName: onDragExit | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onDragExitCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: f8b35d8e-93da-4f6a-9c51-affd4eda762c | |
| inputType: default | |
| label: onDragExitCapture | |
| origin: user-provided | |
| propertyName: onDragExitCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onDragLeave | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 2c995b9f-1648-476d-99a6-fe16c0e17169 | |
| inputType: default | |
| label: onDragLeave | |
| origin: user-provided | |
| propertyName: onDragLeave | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onDragLeaveCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 8fcc4503-9cdc-4077-af6d-d81eab88b231 | |
| inputType: default | |
| label: onDragLeaveCapture | |
| origin: user-provided | |
| propertyName: onDragLeaveCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onDragOver | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 49647359-4a5e-42e6-a9a7-6c92bf961d9e | |
| inputType: default | |
| label: onDragOver | |
| origin: user-provided | |
| propertyName: onDragOver | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onDragOverCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: fdad75b0-0862-440b-b50e-d5c73e47e01a | |
| inputType: default | |
| label: onDragOverCapture | |
| origin: user-provided | |
| propertyName: onDragOverCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onDragStart | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 1fa9fdfe-66e9-465a-b061-184c4157eeef | |
| inputType: default | |
| label: onDragStart | |
| origin: user-provided | |
| propertyName: onDragStart | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onDragStartCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 3d78e979-9e73-43af-a5db-4fde3299ae35 | |
| inputType: default | |
| label: onDragStartCapture | |
| origin: user-provided | |
| propertyName: onDragStartCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onDrop | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 620e87cc-b015-4124-8aab-615863065887 | |
| inputType: default | |
| label: onDrop | |
| origin: user-provided | |
| propertyName: onDrop | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onDropCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 4502893a-c0fa-45b1-b659-f2bda55e606e | |
| inputType: default | |
| label: onDropCapture | |
| origin: user-provided | |
| propertyName: onDropCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onMouseDown | |
| description: '' | |
| event: | |
| type: MouseEvent | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: a4f43298-8595-4e23-ac71-beec6b5352db | |
| inputType: default | |
| label: onMouseDown | |
| origin: user-provided | |
| propertyName: onMouseDown | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onMouseDownCapture | |
| description: '' | |
| event: | |
| type: MouseEvent | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: e4d7720d-fc0f-4c5f-b2ae-d89452bba7c3 | |
| inputType: default | |
| label: onMouseDownCapture | |
| origin: user-provided | |
| propertyName: onMouseDownCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onMouseEnter | |
| description: '' | |
| event: | |
| type: MouseEvent | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 59ba9f76-07b3-4b59-8b44-9007f544bea3 | |
| inputType: default | |
| label: onMouseEnter | |
| origin: user-provided | |
| propertyName: onMouseEnter | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onMouseLeave | |
| description: '' | |
| event: | |
| type: MouseEvent | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: b3f3a552-da60-4807-a53f-84521b6b0fef | |
| inputType: default | |
| label: onMouseLeave | |
| origin: user-provided | |
| propertyName: onMouseLeave | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onMouseMove | |
| description: '' | |
| event: | |
| type: MouseEvent | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 635b8c7c-c7be-4409-9db7-f2ec2b6a55cd | |
| inputType: default | |
| label: onMouseMove | |
| origin: user-provided | |
| propertyName: onMouseMove | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onMouseMoveCapture | |
| description: '' | |
| event: | |
| type: MouseEvent | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: a9cd7844-073d-4a2e-92a7-c3f0435c519b | |
| inputType: default | |
| label: onMouseMoveCapture | |
| origin: user-provided | |
| propertyName: onMouseMoveCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onMouseOut | |
| description: '' | |
| event: | |
| type: MouseEvent | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: c1786a95-5e69-44c2-80b0-50f3a95f578d | |
| inputType: default | |
| label: onMouseOut | |
| origin: user-provided | |
| propertyName: onMouseOut | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onMouseOutCapture | |
| description: '' | |
| event: | |
| type: MouseEvent | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: e8b6fad4-1a0f-44ff-b23e-f039d7b830bb | |
| inputType: default | |
| label: onMouseOutCapture | |
| origin: user-provided | |
| propertyName: onMouseOutCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onMouseOver | |
| description: '' | |
| event: | |
| type: MouseEvent | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: be799a4f-7d3a-4302-8012-780eb0b81288 | |
| inputType: default | |
| label: onMouseOver | |
| origin: user-provided | |
| propertyName: onMouseOver | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onMouseOverCapture | |
| description: '' | |
| event: | |
| type: MouseEvent | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 5b6303b4-720f-4b5b-a3bf-e2c966c5adb7 | |
| inputType: default | |
| label: onMouseOverCapture | |
| origin: user-provided | |
| propertyName: onMouseOverCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onMouseUp | |
| description: '' | |
| event: | |
| type: MouseEvent | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 57658eaa-a49b-486e-b3dd-f65695215d2b | |
| inputType: default | |
| label: onMouseUp | |
| origin: user-provided | |
| propertyName: onMouseUp | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onMouseUpCapture | |
| description: '' | |
| event: | |
| type: MouseEvent | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 51feca8c-9560-404f-9bc1-cce76c382fd9 | |
| inputType: default | |
| label: onMouseUpCapture | |
| origin: user-provided | |
| propertyName: onMouseUpCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onSelect | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: f91819a6-85bd-4a80-91e2-1913a4592b44 | |
| inputType: default | |
| label: onSelect | |
| origin: user-provided | |
| propertyName: onSelect | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onSelectCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 92b75b80-25b7-41ff-9a6a-6cadca83de94 | |
| inputType: default | |
| label: onSelectCapture | |
| origin: user-provided | |
| propertyName: onSelectCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onTouchCancel | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 077f8f00-b7ba-4714-abf4-82fcd456b8aa | |
| inputType: default | |
| label: onTouchCancel | |
| origin: user-provided | |
| propertyName: onTouchCancel | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onTouchCancelCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 2b86f9de-7a41-47e9-b8ab-6536a40362f2 | |
| inputType: default | |
| label: onTouchCancelCapture | |
| origin: user-provided | |
| propertyName: onTouchCancelCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onTouchEnd | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: e54d7d80-1022-48bf-9846-960fa64800d6 | |
| inputType: default | |
| label: onTouchEnd | |
| origin: user-provided | |
| propertyName: onTouchEnd | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onTouchEndCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 8b829025-5890-4de2-9095-bc8743cf138d | |
| inputType: default | |
| label: onTouchEndCapture | |
| origin: user-provided | |
| propertyName: onTouchEndCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onTouchMove | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 75fb8b86-e6b3-4ef0-a108-57cee3dab0a5 | |
| inputType: default | |
| label: onTouchMove | |
| origin: user-provided | |
| propertyName: onTouchMove | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onTouchMoveCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 0fa9b79f-c117-42bc-9aea-f019f4b90cb5 | |
| inputType: default | |
| label: onTouchMoveCapture | |
| origin: user-provided | |
| propertyName: onTouchMoveCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onTouchStart | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: fda7b5fd-768f-4e1f-9f88-4b1cc0d676b2 | |
| inputType: default | |
| label: onTouchStart | |
| origin: user-provided | |
| propertyName: onTouchStart | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onTouchStartCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: a412f3d7-be0c-42b7-af82-13fb63fd108c | |
| inputType: default | |
| label: onTouchStartCapture | |
| origin: user-provided | |
| propertyName: onTouchStartCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onPointerDown | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 4e603472-345c-42c1-b601-d8ec6e31ec9d | |
| inputType: default | |
| label: onPointerDown | |
| origin: user-provided | |
| propertyName: onPointerDown | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onPointerDownCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 86a0b8b6-c6c6-4162-9ef4-559a3337603c | |
| inputType: default | |
| label: onPointerDownCapture | |
| origin: user-provided | |
| propertyName: onPointerDownCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onPointerMove | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 5b337e1b-c6f7-41ff-b0d7-4a981494290a | |
| inputType: default | |
| label: onPointerMove | |
| origin: user-provided | |
| propertyName: onPointerMove | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onPointerMoveCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 9a57e58d-512d-4e13-89a9-83d0aa4e1e0a | |
| inputType: default | |
| label: onPointerMoveCapture | |
| origin: user-provided | |
| propertyName: onPointerMoveCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onPointerUp | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 5b6b0a40-dd6c-4102-86ff-c8b55004dbd1 | |
| inputType: default | |
| label: onPointerUp | |
| origin: user-provided | |
| propertyName: onPointerUp | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onPointerUpCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 4261f966-0577-490a-b059-119dfd87c24b | |
| inputType: default | |
| label: onPointerUpCapture | |
| origin: user-provided | |
| propertyName: onPointerUpCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onPointerCancel | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: ef9045e5-3b2e-4a36-88c2-c35ee6d261ac | |
| inputType: default | |
| label: onPointerCancel | |
| origin: user-provided | |
| propertyName: onPointerCancel | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onPointerCancelCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 39199628-fa3c-49a4-b5f0-339b6cc44f8a | |
| inputType: default | |
| label: onPointerCancelCapture | |
| origin: user-provided | |
| propertyName: onPointerCancelCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onPointerEnter | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: bfb22f86-b5d2-487d-8c6a-b241b960e807 | |
| inputType: default | |
| label: onPointerEnter | |
| origin: user-provided | |
| propertyName: onPointerEnter | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onPointerEnterCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: c68fbabb-1509-4ff8-9aef-6a463af6ad46 | |
| inputType: default | |
| label: onPointerEnterCapture | |
| origin: user-provided | |
| propertyName: onPointerEnterCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onPointerLeave | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: a43665fa-076e-46fa-a7a0-62a6e16a304a | |
| inputType: default | |
| label: onPointerLeave | |
| origin: user-provided | |
| propertyName: onPointerLeave | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onPointerLeaveCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: dba10598-6f35-4acf-8d23-88f2ebf2f2af | |
| inputType: default | |
| label: onPointerLeaveCapture | |
| origin: user-provided | |
| propertyName: onPointerLeaveCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onPointerOver | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 8c0d11e9-d263-443d-97bd-848d1135737f | |
| inputType: default | |
| label: onPointerOver | |
| origin: user-provided | |
| propertyName: onPointerOver | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onPointerOverCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 35558cbf-fc52-474c-9dc2-a75f33e58f98 | |
| inputType: default | |
| label: onPointerOverCapture | |
| origin: user-provided | |
| propertyName: onPointerOverCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onPointerOut | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: a9fae104-9c7b-48d9-9c71-ac53806ded99 | |
| inputType: default | |
| label: onPointerOut | |
| origin: user-provided | |
| propertyName: onPointerOut | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onPointerOutCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 466e4f3f-e436-40d0-ab12-aad6b786228e | |
| inputType: default | |
| label: onPointerOutCapture | |
| origin: user-provided | |
| propertyName: onPointerOutCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onGotPointerCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 9aa2c651-ef48-485b-8884-88f22a93c1d8 | |
| inputType: default | |
| label: onGotPointerCapture | |
| origin: user-provided | |
| propertyName: onGotPointerCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onGotPointerCaptureCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: e05f598f-db3f-45be-84bc-46806ae78492 | |
| inputType: default | |
| label: onGotPointerCaptureCapture | |
| origin: user-provided | |
| propertyName: onGotPointerCaptureCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onLostPointerCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 864a4e0a-74df-46e4-8eba-570f9121462e | |
| inputType: default | |
| label: onLostPointerCapture | |
| origin: user-provided | |
| propertyName: onLostPointerCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onLostPointerCaptureCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 4f97bcc4-0073-40a9-b00f-50431def715f | |
| inputType: default | |
| label: onLostPointerCaptureCapture | |
| origin: user-provided | |
| propertyName: onLostPointerCaptureCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onScroll | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 80d1fe01-a680-4a7a-983f-fadf558d0029 | |
| inputType: default | |
| label: onScroll | |
| origin: user-provided | |
| propertyName: onScroll | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onScrollCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 43d3082b-f554-4038-a35d-587fcc63b717 | |
| inputType: default | |
| label: onScrollCapture | |
| origin: user-provided | |
| propertyName: onScrollCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onWheel | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 1ada17dd-0327-404d-921d-1d74510a9ed4 | |
| inputType: default | |
| label: onWheel | |
| origin: user-provided | |
| propertyName: onWheel | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onWheelCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 1f36b14a-597d-4458-a96a-a47554b73b87 | |
| inputType: default | |
| label: onWheelCapture | |
| origin: user-provided | |
| propertyName: onWheelCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onAnimationStart | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: de7934c8-9642-47cc-8831-278f49193068 | |
| inputType: default | |
| label: onAnimationStart | |
| origin: user-provided | |
| propertyName: onAnimationStart | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onAnimationStartCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 0ac7308e-49c0-4cbc-a54c-14912a4871d2 | |
| inputType: default | |
| label: onAnimationStartCapture | |
| origin: user-provided | |
| propertyName: onAnimationStartCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onAnimationEnd | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: e5e41a28-31c9-4928-b22e-bc06f36acd69 | |
| inputType: default | |
| label: onAnimationEnd | |
| origin: user-provided | |
| propertyName: onAnimationEnd | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onAnimationEndCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 7ae4c3ad-dca2-4168-9c5d-4e163298a586 | |
| inputType: default | |
| label: onAnimationEndCapture | |
| origin: user-provided | |
| propertyName: onAnimationEndCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onAnimationIteration | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: ea7231da-4195-42e9-a645-fbba0035e97d | |
| inputType: default | |
| label: onAnimationIteration | |
| origin: user-provided | |
| propertyName: onAnimationIteration | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onAnimationIterationCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 7a6eaa0b-eaa2-4cf8-91eb-c20a78f296ea | |
| inputType: default | |
| label: onAnimationIterationCapture | |
| origin: user-provided | |
| propertyName: onAnimationIterationCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onTransitionEnd | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 220af4aa-06bb-44d6-81d8-01906b9ddeb5 | |
| inputType: default | |
| label: onTransitionEnd | |
| origin: user-provided | |
| propertyName: onTransitionEnd | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: onTransitionEndCapture | |
| description: '' | |
| event: | |
| type: Event | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: da0c416e-e7d0-4bbc-95c4-766c79479a94 | |
| inputType: default | |
| label: onTransitionEndCapture | |
| origin: user-provided | |
| propertyName: onTransitionEndCapture | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: labelText | |
| defaultValue: Lorem Ipsum | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: afb57f16-a537-4f37-a1fd-fdd6b5ce03c8 | |
| inputType: default | |
| label: Label Text | |
| origin: user-provided | |
| propertyName: labelText | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: name | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: true | |
| id: e82a58c9-894b-4df6-9633-4e0f7c257087 | |
| inputType: default | |
| label: Name | |
| origin: user-provided | |
| propertyName: name | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: value | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: true | |
| id: 3d9929e1-37dd-4526-9eab-2d1ae7eeabcc | |
| inputType: default | |
| label: Value | |
| origin: user-provided | |
| propertyName: value | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: checked | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 59be3d3e-cbe4-465f-9780-6d09c1fb8865 | |
| inputType: default | |
| label: Checked | |
| origin: user-provided | |
| propertyName: checked | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: disabled | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 4fd29361-0f77-49db-99d2-82543edb0010 | |
| inputType: default | |
| label: Disabled | |
| origin: user-provided | |
| propertyName: disabled | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: handleChange | |
| description: '' | |
| event: | |
| type: ChangeEvent | |
| example: '' | |
| group: '' | |
| hidden: true | |
| id: a683e59e-fa4c-4573-8a33-488b06a36aea | |
| inputType: default | |
| label: Handle Change | |
| origin: user-provided | |
| propertyName: handleChange | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: theme | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 2e991bf6-a263-4fdc-812c-3812c2907405 | |
| inputType: default | |
| label: theme | |
| origin: user-provided | |
| propertyName: theme | |
| required: false | |
| type: unknown | |
| typeText: 'theme?: Theme;' | |
| - model: PatternProperty | |
| contextId: open | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 314ab543-7d56-43b8-b095-752a024cf471 | |
| inputType: default | |
| label: Open | |
| origin: user-provided | |
| propertyName: open | |
| required: true | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: text | |
| defaultValue: '' | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 087b024a-9cb2-4a3c-9cc0-6fcf73fd92df | |
| inputType: default | |
| label: Text | |
| origin: user-provided | |
| propertyName: text | |
| required: true | |
| type: string | |
| - model: PatternProperty | |
| contextId: onToggle | |
| description: '' | |
| event: | |
| type: MouseEvent | |
| example: '' | |
| group: '' | |
| hidden: true | |
| id: 5ed7e42d-2949-4ab2-8276-a67d853d4501 | |
| inputType: default | |
| label: onToggle | |
| origin: user-provided | |
| propertyName: onToggle | |
| required: true | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: content | |
| defaultValue: Dropdown Item | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 01f47fbb-f39f-44a6-80e9-af4c39cd2ce6 | |
| inputType: default | |
| label: Content text | |
| origin: user-provided | |
| propertyName: content | |
| required: true | |
| type: string | |
| - model: PatternProperty | |
| contextId: layout | |
| example: '' | |
| description: '' | |
| group: '' | |
| hidden: false | |
| id: 60948e0a-3ee5-475c-9d48-6020c30910c3 | |
| inputType: default | |
| label: Layout | |
| propertyName: layout | |
| options: | |
| - model: PatternEnumPropertyOption | |
| contextId: Left | |
| id: f5a2a2ae-a340-4dd8-aa0c-8c86e79dba2a | |
| name: Left | |
| ordinal: '"feature-left"' | |
| value: feature-left | |
| - model: PatternEnumPropertyOption | |
| contextId: Center | |
| id: 65557656-4fdf-4882-a2c9-63e58ef4ec7a | |
| name: Center | |
| ordinal: '"feature-center"' | |
| value: feature-center | |
| - model: PatternEnumPropertyOption | |
| contextId: Right | |
| id: 2eef15e0-0e01-452c-8c73-1c6aa802db1a | |
| name: Right | |
| ordinal: '"feature-right"' | |
| value: feature-right | |
| origin: user-provided | |
| required: false | |
| type: enum | |
| - model: PatternProperty | |
| contextId: featureLevel | |
| example: '' | |
| description: '' | |
| group: '' | |
| hidden: false | |
| id: 1e27870a-7d6c-4165-ab9a-4ae8e4ed9047 | |
| inputType: default | |
| label: Feature level | |
| propertyName: featureLevel | |
| options: | |
| - model: PatternEnumPropertyOption | |
| contextId: Large | |
| id: 20d6f6f4-966c-42ad-b59c-906657af919f | |
| name: Large | |
| ordinal: '"feature-large"' | |
| value: feature-large | |
| - model: PatternEnumPropertyOption | |
| contextId: Medium | |
| id: f37eb357-486c-4f05-a606-7a76bb96b20b | |
| name: Medium | |
| ordinal: '"feature-medium"' | |
| value: feature-medium | |
| origin: user-provided | |
| required: true | |
| type: enum | |
| - model: PatternProperty | |
| contextId: headline | |
| defaultValue: '' | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: f6178e51-fd61-4e24-892d-98fefb144947 | |
| inputType: default | |
| label: Headline | |
| origin: user-provided | |
| propertyName: headline | |
| required: true | |
| type: string | |
| - model: PatternProperty | |
| contextId: copy | |
| defaultValue: '' | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 9a524bb4-e41b-44e2-8796-32b1abfef624 | |
| inputType: default | |
| label: Copy | |
| origin: user-provided | |
| propertyName: copy | |
| required: true | |
| type: string | |
| - model: PatternProperty | |
| contextId: negativeTop | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: b33b1d2b-cd5d-4cb7-9603-05ecc1e3c9b8 | |
| inputType: default | |
| label: NegativeTop | |
| origin: user-provided | |
| propertyName: negativeTop | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: copyright | |
| defaultValue: '' | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 2edd3df1-54fd-4b8c-b611-05d3ed2992a6 | |
| inputType: default | |
| label: Copyright | |
| origin: user-provided | |
| propertyName: copyright | |
| required: true | |
| type: string | |
| - model: PatternProperty | |
| contextId: className | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: true | |
| id: 2aca344f-286c-4c41-ba8f-4a588fc73aea | |
| inputType: default | |
| label: CSS class | |
| origin: user-provided | |
| propertyName: className | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: level | |
| defaultOptionId: 41b244a8-1397-4572-aff9-576df7587360 | |
| example: '' | |
| description: '' | |
| group: '' | |
| hidden: false | |
| id: 037165e6-5e67-4938-b60d-78973c63d79d | |
| inputType: default | |
| label: Level | |
| propertyName: level | |
| options: | |
| - model: PatternEnumPropertyOption | |
| contextId: H1 | |
| id: 41b244a8-1397-4572-aff9-576df7587360 | |
| name: H1 | |
| ordinal: '"h1"' | |
| value: h1 | |
| - model: PatternEnumPropertyOption | |
| contextId: H2 | |
| id: c3f2f4e7-4a85-4aec-918e-ede2ae0518c8 | |
| name: H2 | |
| ordinal: '"h2"' | |
| value: h2 | |
| - model: PatternEnumPropertyOption | |
| contextId: H3 | |
| id: 10a0fa2f-7fa1-4409-9e6b-cd6a5f58b488 | |
| name: H3 | |
| ordinal: '"h3"' | |
| value: h3 | |
| origin: user-provided | |
| required: true | |
| type: enum | |
| - model: PatternProperty | |
| contextId: textAlign | |
| defaultOptionId: 94521ada-1668-47e1-9226-07b2735bb804 | |
| example: '' | |
| description: '' | |
| group: '' | |
| hidden: false | |
| id: ddbe8ec8-5834-448a-99fa-68516f20348c | |
| inputType: default | |
| label: Text align | |
| propertyName: textAlign | |
| options: | |
| - model: PatternEnumPropertyOption | |
| contextId: Left | |
| id: 94521ada-1668-47e1-9226-07b2735bb804 | |
| name: Left | |
| ordinal: '"left"' | |
| value: left | |
| - model: PatternEnumPropertyOption | |
| contextId: Center | |
| id: 384780e4-cc61-4283-9b00-6dc0a9ab97ba | |
| name: Center | |
| ordinal: '"center"' | |
| value: center | |
| - model: PatternEnumPropertyOption | |
| contextId: Right | |
| id: 0e9ffc1b-3aa9-4170-b142-6c6191a2b6a2 | |
| name: Right | |
| ordinal: '"right"' | |
| value: right | |
| origin: user-provided | |
| required: false | |
| type: enum | |
| - model: PatternProperty | |
| contextId: color | |
| defaultValue: '#000000' | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 22970c73-4306-4b41-b3f1-c747da98bc47 | |
| inputType: default | |
| label: Color | |
| origin: user-provided | |
| propertyName: color | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: uppercase | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 3cc7d684-2299-44ae-bbbd-5b9620d8f022 | |
| inputType: default | |
| label: Uppercase | |
| origin: user-provided | |
| propertyName: uppercase | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: fontWeight | |
| example: '' | |
| description: '' | |
| group: '' | |
| hidden: false | |
| id: d45f01a4-bd83-4fc9-9ff6-8109f350c136 | |
| inputType: default | |
| label: Weight | |
| propertyName: fontWeight | |
| options: | |
| - model: PatternEnumPropertyOption | |
| contextId: Light | |
| id: a6ef3e9c-6050-45ff-bc64-395de7b2fa37 | |
| name: Light | |
| ordinal: '100' | |
| value: 100 | |
| - model: PatternEnumPropertyOption | |
| contextId: Regular | |
| id: cc6f698c-2dfe-46a7-89cc-b2ffe7745f27 | |
| name: Regular | |
| ordinal: '300' | |
| value: 300 | |
| - model: PatternEnumPropertyOption | |
| contextId: Bold | |
| id: 70d7c0f3-9b5d-4a19-8159-ebfcd317ee01 | |
| name: Bold | |
| ordinal: '500' | |
| value: 500 | |
| origin: user-provided | |
| required: false | |
| type: enum | |
| - model: PatternProperty | |
| contextId: names | |
| defaultValue: '' | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: de16c3ce-3aea-4438-aca1-35d6bec81343 | |
| inputType: default | |
| label: names | |
| origin: user-provided | |
| propertyName: names | |
| required: true | |
| type: unknown | |
| typeText: 'names: typeof IconName;' | |
| - model: PatternProperty | |
| contextId: className | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 2e59ae09-afda-43f7-9a56-e6a55f575d9d | |
| inputType: default | |
| label: className | |
| origin: user-provided | |
| propertyName: className | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: color | |
| example: '' | |
| description: '' | |
| group: '' | |
| hidden: false | |
| id: f8699952-72ce-4476-b061-61a23d72e738 | |
| inputType: default | |
| label: color | |
| propertyName: color | |
| options: | |
| - model: PatternEnumPropertyOption | |
| contextId: Blue | |
| id: e9a43cb5-dc44-4ed3-837e-a155d0220423 | |
| name: Blue | |
| ordinal: '"rgb(0, 112, 214)"' | |
| value: 'rgb(0, 112, 214)' | |
| - model: PatternEnumPropertyOption | |
| contextId: BlueLight | |
| id: 4a530d0d-9831-4d65-be02-17ca0ec56005 | |
| name: BlueLight | |
| ordinal: '"rgb(0, 112, 214)"' | |
| value: 'rgb(0, 112, 214)' | |
| - model: PatternEnumPropertyOption | |
| contextId: GreenDark | |
| id: 253d9ab4-1ec7-4946-a234-294a6e67c4e2 | |
| name: GreenDark | |
| ordinal: '"rgb(30, 205, 151)"' | |
| value: 'rgb(30, 205, 151)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Green | |
| id: 60a6e721-92d8-4135-b787-6f70548e4667 | |
| name: Green | |
| ordinal: '"rgb(87, 218, 178)"' | |
| value: 'rgb(87, 218, 178)' | |
| - model: PatternEnumPropertyOption | |
| contextId: GreenLight | |
| id: 70483e30-2e0c-49f1-958a-5de308e22aac | |
| name: GreenLight | |
| ordinal: '"rgb(123, 226, 195)"' | |
| value: 'rgb(123, 226, 195)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Red | |
| id: 73ff72bb-634e-4c90-af91-5aed48773360 | |
| name: Red | |
| ordinal: '"rgb(215, 0, 82)"' | |
| value: 'rgb(215, 0, 82)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Black | |
| id: f05cf008-ff9b-421d-a39f-f0ee28bbbb48 | |
| name: Black | |
| ordinal: '"rgb(0, 0, 0)"' | |
| value: 'rgb(0, 0, 0)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Grey50 | |
| id: 1e96085c-98ef-4f25-9c76-d45f480e1ae8 | |
| name: Grey50 | |
| ordinal: '"rgb(127, 127, 127)"' | |
| value: 'rgb(127, 127, 127)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Grey70 | |
| id: 09eb926b-8f53-41aa-bd34-40a44430788f | |
| name: Grey70 | |
| ordinal: '"rgb(179, 179, 179)"' | |
| value: 'rgb(179, 179, 179)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Grey90 | |
| id: 8f2cc625-463f-4b60-ae4e-96f7ab20173c | |
| name: Grey90 | |
| ordinal: '"rgb(227, 227, 227)"' | |
| value: 'rgb(227, 227, 227)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Grey95 | |
| id: f6de5372-4071-4f8d-afcb-7595ef9be0b8 | |
| name: Grey95 | |
| ordinal: '"rgb(242, 242, 242)"' | |
| value: 'rgb(242, 242, 242)' | |
| - model: PatternEnumPropertyOption | |
| contextId: White | |
| id: 177bae2d-63f0-423b-8889-026848b6fdac | |
| name: White | |
| ordinal: '"rgb(255, 255, 255)"' | |
| value: 'rgb(255, 255, 255)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Pink | |
| id: 222c4ede-5992-4839-aa15-8587f3d577e5 | |
| name: Pink | |
| ordinal: '"rgb(236, 3, 97)"' | |
| value: 'rgb(236, 3, 97)' | |
| - model: PatternEnumPropertyOption | |
| contextId: PinkLight | |
| id: c645fec6-3e91-4077-b281-06680663b133 | |
| name: PinkLight | |
| ordinal: '"rgb(236, 52, 126)"' | |
| value: 'rgb(236, 52, 126)' | |
| - model: PatternEnumPropertyOption | |
| contextId: VioletDark | |
| id: c19e9a62-abcb-42b8-8d4a-a7ecf86c99ec | |
| name: VioletDark | |
| ordinal: '"rgb(81, 0, 77)"' | |
| value: 'rgb(81, 0, 77)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Violet | |
| id: 425ca121-45f5-4ad7-b74c-291179349ec4 | |
| name: Violet | |
| ordinal: '"rgb(88, 2, 205)"' | |
| value: 'rgb(88, 2, 205)' | |
| origin: user-provided | |
| required: false | |
| type: enum | |
| - model: PatternProperty | |
| contextId: name | |
| example: '' | |
| description: '' | |
| group: '' | |
| hidden: false | |
| id: b3010abd-2dcf-4313-b4c8-af0a85bf2e70 | |
| inputType: default | |
| label: name | |
| propertyName: name | |
| options: | |
| - model: PatternEnumPropertyOption | |
| contextId: ArrowDown | |
| id: 17752183-6d47-40da-aa72-226d9c91406d | |
| name: ArrowDown | |
| ordinal: '0' | |
| value: 0 | |
| origin: user-provided | |
| required: false | |
| type: enum | |
| - model: PatternProperty | |
| contextId: size | |
| example: '' | |
| description: '' | |
| group: '' | |
| hidden: false | |
| id: 905ed8c3-8ecd-4c15-aeb7-c43717baeaab | |
| inputType: default | |
| label: size | |
| propertyName: size | |
| options: | |
| - model: PatternEnumPropertyOption | |
| contextId: XS | |
| id: 9ecd0db0-4212-4b41-8da5-a6586f13caa5 | |
| name: XS | |
| ordinal: '24' | |
| value: 24 | |
| - model: PatternEnumPropertyOption | |
| contextId: S | |
| id: 184c190e-7b2a-48eb-8003-3b2282ef04a1 | |
| name: S | |
| ordinal: '30' | |
| value: 30 | |
| - model: PatternEnumPropertyOption | |
| contextId: M | |
| id: 529dd9fc-b091-449c-a007-71a752bb2f27 | |
| name: M | |
| ordinal: '48' | |
| value: 48 | |
| - model: PatternEnumPropertyOption | |
| contextId: L | |
| id: f646d70c-d978-420c-ac83-9faad9790234 | |
| name: L | |
| ordinal: '52' | |
| value: 52 | |
| origin: user-provided | |
| required: false | |
| type: enum | |
| - model: PatternProperty | |
| contextId: alt | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: b19c9463-9cee-4873-aee0-026a44eb0ada | |
| inputType: default | |
| label: alt | |
| origin: user-provided | |
| propertyName: alt | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: className | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: de718020-d0ef-46f7-9e7a-62a1da260e0f | |
| inputType: default | |
| label: className | |
| origin: user-provided | |
| propertyName: className | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: src | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: c4f41be0-34cd-4cd0-820b-eaaf72700ad3 | |
| inputType: default | |
| label: src | |
| origin: user-provided | |
| propertyName: src | |
| required: false | |
| type: asset | |
| - model: PatternProperty | |
| contextId: size | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: c0252057-b821-425e-a0c3-71e0600cb090 | |
| inputType: default | |
| label: size | |
| origin: user-provided | |
| propertyName: size | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: type | |
| defaultOptionId: 48daa7c5-2d9f-437b-9e65-f0996e3fe57d | |
| example: '' | |
| description: '' | |
| group: '' | |
| hidden: false | |
| id: bd3558ce-67fc-4c88-8d44-9e5e97842d28 | |
| inputType: default | |
| label: Type | |
| propertyName: type | |
| options: | |
| - model: PatternEnumPropertyOption | |
| contextId: Text | |
| id: 48daa7c5-2d9f-437b-9e65-f0996e3fe57d | |
| name: Text | |
| ordinal: '"text"' | |
| value: text | |
| - model: PatternEnumPropertyOption | |
| contextId: Number | |
| id: 209b59e3-0eae-4dbb-a0c1-fb6c78815419 | |
| name: Number | |
| ordinal: '"number"' | |
| value: number | |
| - model: PatternEnumPropertyOption | |
| contextId: Email | |
| id: 7a6d74c2-6192-44bc-8430-01c49592cff0 | |
| name: Email | |
| ordinal: '"email"' | |
| value: email | |
| origin: user-provided | |
| required: false | |
| type: enum | |
| - model: PatternProperty | |
| contextId: disabled | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: ece6d7cd-67fa-4c6b-98dc-ea616b2d082f | |
| inputType: default | |
| label: Disabled | |
| origin: user-provided | |
| propertyName: disabled | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: labelText | |
| defaultValue: Lorem Ipsum | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: acfac3d5-8ce3-4694-8da3-b069e0653996 | |
| inputType: default | |
| label: Label Text | |
| origin: user-provided | |
| propertyName: labelText | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: name | |
| defaultValue: Lorem Ipsum | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 6bfa3c0d-099b-4c4f-bc2b-67ffd83cd216 | |
| inputType: default | |
| label: Name | |
| origin: user-provided | |
| propertyName: name | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: value | |
| defaultValue: Lorem Ipsum | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: bd2cf7f5-fc49-412b-aa28-045a747f7728 | |
| inputType: default | |
| label: Value | |
| origin: user-provided | |
| propertyName: value | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: errorText | |
| defaultValue: Error Ipsum | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 2f0f6bfd-b354-4ca8-9628-93b00f1d2ac8 | |
| inputType: default | |
| label: Error Text | |
| origin: user-provided | |
| propertyName: errorText | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: placeholder | |
| defaultValue: Lorem Ipsum | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 3bdc088e-58d9-4339-ad2d-8e9a28a41edf | |
| inputType: default | |
| label: Placeholder | |
| origin: user-provided | |
| propertyName: placeholder | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: readOnly | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 58a18f62-08c1-4a2e-8a38-eef4c6dfc2c2 | |
| inputType: default | |
| label: readOnly | |
| origin: user-provided | |
| propertyName: readOnly | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: handleChange | |
| description: >- | |
| Add an interaction when the input value changes. Remember to connect | |
| the value above to the variable, too. | |
| event: | |
| type: ChangeEvent | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 6e769295-737e-4255-af84-2ea10cf84ef1 | |
| inputType: default | |
| label: Handle Change | |
| origin: user-provided | |
| propertyName: handleChange | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: theme | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 4955900a-048f-46fa-9a10-2c7ab97adcfa | |
| inputType: default | |
| label: theme | |
| origin: user-provided | |
| propertyName: theme | |
| required: false | |
| type: unknown | |
| typeText: 'theme?: Theme;' | |
| - model: PatternProperty | |
| contextId: theme | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 0b3c73a5-1556-4517-9e4e-39e8a6358227 | |
| inputType: default | |
| label: theme | |
| origin: user-provided | |
| propertyName: theme | |
| required: false | |
| type: unknown | |
| typeText: 'theme?: Theme;' | |
| - model: PatternProperty | |
| contextId: logo | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 2a91222c-e15d-4b5a-bb35-41e342f92980 | |
| inputType: default | |
| label: Logo | |
| origin: user-provided | |
| propertyName: logo | |
| required: false | |
| type: asset | |
| - model: PatternProperty | |
| contextId: sticky | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 3481f5d5-a51b-414a-995f-42141b06bb02 | |
| inputType: default | |
| label: Sticky | |
| origin: user-provided | |
| propertyName: sticky | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: linkName | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 557d1308-ebfd-469d-8820-1774c541db96 | |
| inputType: default | |
| label: Copy | |
| origin: user-provided | |
| propertyName: linkName | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: onClick | |
| description: '' | |
| event: | |
| type: MouseEvent | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 307acb83-8bd7-4edb-8f49-d29219eb04c8 | |
| inputType: default | |
| label: Link | |
| origin: user-provided | |
| propertyName: onClick | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: href | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 2e1014fe-8c35-4313-9c02-30e4ab57fbcd | |
| inputType: default | |
| label: href | |
| origin: user-provided | |
| propertyName: href | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: target | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 10d4d847-9345-416f-804a-6dc639328f73 | |
| inputType: default | |
| label: target | |
| origin: user-provided | |
| propertyName: target | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: rel | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 36ab9783-a40a-4486-979a-4ab9e7049350 | |
| inputType: default | |
| label: rel | |
| origin: user-provided | |
| propertyName: rel | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: title | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 1e21c00b-86c9-44b6-bd93-8f688818c223 | |
| inputType: default | |
| label: title | |
| origin: user-provided | |
| propertyName: title | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: labelText | |
| defaultValue: Lorem Ipsum | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 5352449b-d6cf-4cb4-a3e8-3a463e2a27c0 | |
| inputType: default | |
| label: Label Text | |
| origin: user-provided | |
| propertyName: labelText | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: groupName | |
| defaultValue: radio1 | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: adfd118d-4858-4d3a-9157-60b61ef5fe16 | |
| inputType: default | |
| label: Group Name | |
| origin: user-provided | |
| propertyName: groupName | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: value | |
| defaultValue: value | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 5eb70d7e-60da-4001-8650-78d42d5aa3d9 | |
| inputType: default | |
| label: Value | |
| origin: user-provided | |
| propertyName: value | |
| required: false | |
| type: string | |
| - model: PatternProperty | |
| contextId: checked | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 36276fd0-56f0-4a85-974d-5e66e0090b8c | |
| inputType: default | |
| label: Checked | |
| origin: user-provided | |
| propertyName: checked | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: disabled | |
| defaultValue: false | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: a55c4fb1-8f2b-4ffd-819c-317ad150ed8a | |
| inputType: default | |
| label: Disabled | |
| origin: user-provided | |
| propertyName: disabled | |
| required: false | |
| type: boolean | |
| - model: PatternProperty | |
| contextId: handleChange | |
| description: '' | |
| event: | |
| type: ChangeEvent | |
| example: '' | |
| group: '' | |
| hidden: true | |
| id: f2cc1d21-f57b-481c-adfb-03c691391fae | |
| inputType: default | |
| label: Handle Change | |
| origin: user-provided | |
| propertyName: handleChange | |
| required: false | |
| type: EventHandler | |
| - model: PatternProperty | |
| contextId: backgroundColor | |
| example: '' | |
| description: '' | |
| group: '' | |
| hidden: false | |
| id: f3f4b161-cbb4-4fbb-ad5f-69d043cf4152 | |
| inputType: default | |
| label: Background Color | |
| propertyName: backgroundColor | |
| options: | |
| - model: PatternEnumPropertyOption | |
| contextId: Blue | |
| id: b219b7ec-f59d-4bf2-a888-3788842c6bff | |
| name: Blue | |
| ordinal: '"rgb(0, 112, 214)"' | |
| value: 'rgb(0, 112, 214)' | |
| - model: PatternEnumPropertyOption | |
| contextId: BlueLight | |
| id: 5da8b56f-c4b9-4554-a51e-136505284224 | |
| name: BlueLight | |
| ordinal: '"rgb(0, 112, 214)"' | |
| value: 'rgb(0, 112, 214)' | |
| - model: PatternEnumPropertyOption | |
| contextId: GreenDark | |
| id: 6247c23c-4bdc-4853-849a-1f690ea9efc9 | |
| name: GreenDark | |
| ordinal: '"rgb(30, 205, 151)"' | |
| value: 'rgb(30, 205, 151)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Green | |
| id: a4276427-0c98-4d01-8789-ef296891b8f3 | |
| name: Green | |
| ordinal: '"rgb(87, 218, 178)"' | |
| value: 'rgb(87, 218, 178)' | |
| - model: PatternEnumPropertyOption | |
| contextId: GreenLight | |
| id: 140b054b-7dd9-4422-a1ed-6d06330dbb32 | |
| name: GreenLight | |
| ordinal: '"rgb(123, 226, 195)"' | |
| value: 'rgb(123, 226, 195)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Red | |
| id: 93db85b6-6a0c-46f8-aa40-ea0a977be373 | |
| name: Red | |
| ordinal: '"rgb(215, 0, 82)"' | |
| value: 'rgb(215, 0, 82)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Black | |
| id: 350556c7-4498-4df0-b837-491024559b08 | |
| name: Black | |
| ordinal: '"rgb(0, 0, 0)"' | |
| value: 'rgb(0, 0, 0)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Grey50 | |
| id: aafd8b9f-4717-412b-bd09-4f581f59e047 | |
| name: Grey50 | |
| ordinal: '"rgb(127, 127, 127)"' | |
| value: 'rgb(127, 127, 127)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Grey70 | |
| id: 9f18816e-e8b6-4020-9d84-45b972415a4b | |
| name: Grey70 | |
| ordinal: '"rgb(179, 179, 179)"' | |
| value: 'rgb(179, 179, 179)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Grey90 | |
| id: 5190e35f-9a0b-4323-9251-7095b3304f11 | |
| name: Grey90 | |
| ordinal: '"rgb(227, 227, 227)"' | |
| value: 'rgb(227, 227, 227)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Grey95 | |
| id: 2631c37d-ecd0-46e3-9122-a7e720b43668 | |
| name: Grey95 | |
| ordinal: '"rgb(242, 242, 242)"' | |
| value: 'rgb(242, 242, 242)' | |
| - model: PatternEnumPropertyOption | |
| contextId: White | |
| id: c52af618-804b-415a-ad8b-a73975509a6d | |
| name: White | |
| ordinal: '"rgb(255, 255, 255)"' | |
| value: 'rgb(255, 255, 255)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Pink | |
| id: f18bc80b-894d-4038-a4c1-036e16222083 | |
| name: Pink | |
| ordinal: '"rgb(236, 3, 97)"' | |
| value: 'rgb(236, 3, 97)' | |
| - model: PatternEnumPropertyOption | |
| contextId: PinkLight | |
| id: 208dcdd7-698d-40d7-8c2f-d40266a79b1b | |
| name: PinkLight | |
| ordinal: '"rgb(236, 52, 126)"' | |
| value: 'rgb(236, 52, 126)' | |
| - model: PatternEnumPropertyOption | |
| contextId: VioletDark | |
| id: 4c37ac8e-2946-4c3f-9ecd-aafefd7b6f16 | |
| name: VioletDark | |
| ordinal: '"rgb(81, 0, 77)"' | |
| value: 'rgb(81, 0, 77)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Violet | |
| id: 47f087b8-3cd4-4de8-9def-a32c7e017b66 | |
| name: Violet | |
| ordinal: '"rgb(88, 2, 205)"' | |
| value: 'rgb(88, 2, 205)' | |
| origin: user-provided | |
| required: false | |
| type: enum | |
| - model: PatternProperty | |
| contextId: textColor | |
| example: '' | |
| description: '' | |
| group: '' | |
| hidden: false | |
| id: 9540a254-7e70-4234-a350-6d7244936752 | |
| inputType: default | |
| label: Text Color | |
| propertyName: textColor | |
| options: | |
| - model: PatternEnumPropertyOption | |
| contextId: Blue | |
| id: a4367d30-cb6c-4acc-828f-7bc20378864c | |
| name: Blue | |
| ordinal: '"rgb(0, 112, 214)"' | |
| value: 'rgb(0, 112, 214)' | |
| - model: PatternEnumPropertyOption | |
| contextId: BlueLight | |
| id: 9c387da1-32c4-4030-81d6-b92ad7d58cb6 | |
| name: BlueLight | |
| ordinal: '"rgb(0, 112, 214)"' | |
| value: 'rgb(0, 112, 214)' | |
| - model: PatternEnumPropertyOption | |
| contextId: GreenDark | |
| id: 6a33cdea-b28c-4038-9f25-c9e1d475a8fc | |
| name: GreenDark | |
| ordinal: '"rgb(30, 205, 151)"' | |
| value: 'rgb(30, 205, 151)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Green | |
| id: 6016af89-d2c0-4329-be68-0831e81c3130 | |
| name: Green | |
| ordinal: '"rgb(87, 218, 178)"' | |
| value: 'rgb(87, 218, 178)' | |
| - model: PatternEnumPropertyOption | |
| contextId: GreenLight | |
| id: aa1c91a1-fbd6-43b9-803e-f9a8d500ec43 | |
| name: GreenLight | |
| ordinal: '"rgb(123, 226, 195)"' | |
| value: 'rgb(123, 226, 195)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Red | |
| id: d1301774-ae91-468c-a1f3-508ec97b755e | |
| name: Red | |
| ordinal: '"rgb(215, 0, 82)"' | |
| value: 'rgb(215, 0, 82)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Black | |
| id: 3295c21f-21a5-4701-8539-e28461019808 | |
| name: Black | |
| ordinal: '"rgb(0, 0, 0)"' | |
| value: 'rgb(0, 0, 0)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Grey50 | |
| id: cb439a95-2fed-4e73-bc0f-0575c9fc807d | |
| name: Grey50 | |
| ordinal: '"rgb(127, 127, 127)"' | |
| value: 'rgb(127, 127, 127)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Grey70 | |
| id: 7e5ea7da-eca8-4c13-9d4d-ab977fbf8c83 | |
| name: Grey70 | |
| ordinal: '"rgb(179, 179, 179)"' | |
| value: 'rgb(179, 179, 179)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Grey90 | |
| id: 2884790a-a920-4ad4-a4be-91f7db997d29 | |
| name: Grey90 | |
| ordinal: '"rgb(227, 227, 227)"' | |
| value: 'rgb(227, 227, 227)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Grey95 | |
| id: fbc0f797-79f1-4fad-bfd2-39b6d11531b7 | |
| name: Grey95 | |
| ordinal: '"rgb(242, 242, 242)"' | |
| value: 'rgb(242, 242, 242)' | |
| - model: PatternEnumPropertyOption | |
| contextId: White | |
| id: 14522cd9-178f-435b-a6b2-8f5ba351d390 | |
| name: White | |
| ordinal: '"rgb(255, 255, 255)"' | |
| value: 'rgb(255, 255, 255)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Pink | |
| id: e7083670-b503-4a32-b7bd-f7db293f569c | |
| name: Pink | |
| ordinal: '"rgb(236, 3, 97)"' | |
| value: 'rgb(236, 3, 97)' | |
| - model: PatternEnumPropertyOption | |
| contextId: PinkLight | |
| id: 900db358-95ce-4a5b-b99e-b5dbb5f45bc4 | |
| name: PinkLight | |
| ordinal: '"rgb(236, 52, 126)"' | |
| value: 'rgb(236, 52, 126)' | |
| - model: PatternEnumPropertyOption | |
| contextId: VioletDark | |
| id: 07382e29-1fb7-4795-995f-4c9004f8e933 | |
| name: VioletDark | |
| ordinal: '"rgb(81, 0, 77)"' | |
| value: 'rgb(81, 0, 77)' | |
| - model: PatternEnumPropertyOption | |
| contextId: Violet | |
| id: b58f8e57-ab6a-4794-a7a6-97eb54f4331f | |
| name: Violet | |
| ordinal: '"rgb(88, 2, 205)"' | |
| value: 'rgb(88, 2, 205)' | |
| origin: user-provided | |
| required: false | |
| type: enum | |
| - model: PatternProperty | |
| contextId: theme | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 16843f88-c73c-43df-9656-0478df90fef0 | |
| inputType: default | |
| label: theme | |
| origin: user-provided | |
| propertyName: theme | |
| required: false | |
| type: unknown | |
| typeText: 'theme?: Theme;' | |
| - model: PatternProperty | |
| contextId: headline | |
| defaultValue: '' | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: 3778c5ce-be95-4708-9d84-58a70d1a1962 | |
| inputType: default | |
| label: Headline | |
| origin: user-provided | |
| propertyName: headline | |
| required: true | |
| type: string | |
| - model: PatternProperty | |
| contextId: image | |
| description: '' | |
| example: '' | |
| group: '' | |
| hidden: false | |
| id: d35062f0-f8d6-45b0-b71f-b2c79a65308c | |
| inputType: default | |
| label: Image | |
| origin: user-provided | |
| propertyName: image | |
| required: false | |
| type: string | |
| state: connected | |
| userStore: | |
| model: UserStore | |
| actions: | |
| - model: UserStoreAction | |
| acceptsProperty: false | |
| id: 78bb91a2-e581-4db0-a052-264b9b6297cd | |
| name: No Interaction | |
| type: noop | |
| - model: UserStoreAction | |
| acceptsProperty: false | |
| id: 13b98be9-53d0-41df-9fee-4ce522cdb777 | |
| name: Switch Page | |
| storePropertyId: 7e8f4199-6149-4ba5-9a38-a350a8ca2b7f | |
| type: set | |
| - model: UserStoreAction | |
| acceptsProperty: false | |
| id: 00f430c3-167a-455f-97c0-9f7d9e77b4eb | |
| name: Navigate | |
| type: open-external | |
| - model: UserStoreAction | |
| acceptsProperty: true | |
| id: aa738c94-6049-46c3-9277-543049a08931 | |
| name: Set Variable | |
| type: set | |
| currentPageProperty: | |
| model: UserStoreProperty | |
| id: 7e8f4199-6149-4ba5-9a38-a350a8ca2b7f | |
| name: Current Page | |
| concreteValue: 1a005c19-ee53-4715-967f-33febb43149e | |
| initialValue: '' | |
| type: concrete | |
| valueType: page | |
| enhancer: | |
| model: UserStoreEnhancer | |
| id: aa9e76cc-d387-4bb2-a20d-fa390f7f57ea | |
| typeScript: "import * as Alva from 'alva';\n\nexport function onStoreCreate(store: Alva.DesignTimeUserStore): Alva.DesignTimeUserStore {\n\t// Add properties to your store here, e.g.:\n\t// store.defineProperty('hello', { value: 'Hello' });\n\t// store.defineProperty('world', { value: 'World' });\n\t// store.defineProperty('helloWorld', { get: () => store.getProperty('hello').getValue() + ' ' + store.getProperty('world').getValue() });\n\treturn store;\n}\n" | |
| javaScript: 'exports.onStoreCreate = function onStoreCreate(store) { return store; }' | |
| id: 8cd01443-4aa3-42d3-a652-89ba08a80822 | |
| properties: [] | |
| references: [] |
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment