This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| //Create same mol in 2 representations | |
| sam1=cdk.fromSMILES("CN(C)CCC1=CNC2=C1C=C(C=C2)CC1NC(=O)OC1"); | |
| sam2=cdk.fromSMILES("CN(C)CCC1=CNc2c1cc(cc2)CC1NC(=O)OC1"); | |
| js.print("\n==========\n==========\n") | |
| //Print out sybyl atom types (works fine) | |
| js.print("\n\nPerceive sybyl atom types on molecules directly:\n"); | |
| syb1=cdx.perceiveSybylAtomTypes(sam1) | |
| js.print(syb1); |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| //*************************************************************** | |
| // Script that iterates over an SDFile and adds precalculated values | |
| // from an external file as a property and saves as a new SDFile. | |
| // | |
| // The file with values have one value per row in same order as | |
| // the molecukes in the SDFile. | |
| // | |
| // Author: Ola Spjuth | |
| //**************************************************************** |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| //*************************************************************** | |
| // Script that iterates over a file, calculates properties | |
| // and stores all in a new SDFile. Requires Sample Data installed. | |
| // | |
| // Author: Ola Spjuth | |
| //**************************************************************** | |
| it = cdk.createMoleculeIterator("/Sample Data/SDF/Fragments2.sdf"); | |
| list=cdk.createMoleculeList(); |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| /******************************************************************************* | |
| * Script to predict the susceptibility of an HIV protease sequence for seven | |
| * drugs based on the proteochemometric model described in: | |
| * Lapins M, Eklund M, Spjuth O, Prusis P, Wikberg JE. | |
| * Proteochemometric modeling of HIV protease susceptibility, | |
| * BMC Bioinformatics. 2008 Apr 10;9:181. . | |
| * | |
| * Script accepts a 99 aa sequence as input and delivers susceptbiliy values | |
| * for the drugs Amprenavir, Atazanavir, Indinavir, Lopinavir, Nelfinavir, | |
| * Ritonavir, and Saquinavir. |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| /******************************************************************************* | |
| * Bioclipse-script to iteratively build a molecule in JChemPaint | |
| * Author: Ola Spjuth | |
| * Author: Egon Willighagen | |
| ******************************************************************************/ | |
| //Start with a carbon and open in JCP | |
| mol=cdk.fromSMILES("C") | |
| mol2=cdk.generate2dCoordinates(mol) | |
| ui.open(mol2) |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| /******************************************************************************* | |
| * Bioclipse-script to iteratively build a molecule in JChemPaint | |
| * Author: Ola Spjuth | |
| ******************************************************************************/ | |
| //Start with a carbon and open in JCP | |
| mol=cdk.fromSMILES("C") | |
| mol2=cdk.generate2dCoordinates(mol) | |
| ui.open(mol2) |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| //Demonstrates basic manipulation of multiple molecules in Bioclipse | |
| //Requires sample data installed in default location | |
| mols=cdk.loadMolecules("/Sample Data/SDF/Fragments2.sdf") | |
| mols.size() | |
| mol=mols.get(3) | |
| cdk.calculateSMILES(mols.get(4)) | |
| ui.open(mols) |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| //Download PDB via Web service at EBI and open in Jmol | |
| res=ws.queryPDB("1d66") | |
| ui.openFiles(res) | |
| //Execute some jmol script commands | |
| jmol.run("select all; spacefill 0; wireframe off; cartoon on;select none") | |
| jmol.run("select !dna; isosurface solvent; select none; color isosurface blue") | |
| jmol.spinOn() |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| /******************************************************************************* | |
| * Bioclipse-script to generate different coordinates on a list of molecules. | |
| * Author: Ola Spjuth | |
| ******************************************************************************/ | |
| //Create list of molecules | |
| mols=cdk.createMoleculeList(); | |
| mols.add(cdk.fromSMILES("CCC")); | |
| mols.add(cdk.fromSMILES("CCCNCC")); | |
| mols.add(cdk.fromSMILES("CCNCCOC(C)CC")); |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| /******************************************************************************* | |
| * Bioclipse script to calculate 2 descriptors for a molecule. | |
| * Requires the Chemoinformatics and QSAR features to be installed. | |
| * | |
| * Author: Ola Spjuth | |
| * | |
| ******************************************************************************/ | |
| mol=cdk.fromSMILES("C1CNCCC1CC(COC)CCNC"); | |
| descid="http://www.blueobelisk.org/ontologies/chemoinformatics-algorithms/#bpol"; | |
| descid2="http://www.blueobelisk.org/ontologies/chemoinformatics-algorithms/#hBondDonors"; |