Attention: the list was moved to
https://github.com/dypsilon/frontend-dev-bookmarks
This page is not maintained anymore, please update your bookmarks.
| #!/bin/sh -x | |
| # Alot of these configs have been taken from the various places | |
| # on the web, most from here | |
| # https://github.com/mathiasbynens/dotfiles/blob/master/.osx | |
| # Set the colours you can use | |
| black='\033[0;30m' | |
| white='\033[0;37m' | |
| red='\033[0;31m' |
| String smiles = "c1cccn1c2cccn2"; | |
| String smiles = "[H]c2c([H])c(c1c(nc(n1([H]))C(F)(F)F)c2Cl)Cl"; | |
| String smiles = "COC(=O)c2ccc3n([H])c1ccccc1c3(c2)"; | |
| String smiles = "c2cc1cccn1cc2"; | |
| String smiles = "c1c(c23)ccc(c34)ccc4ccc2c1"; | |
| String smiles = "Cc1cccc2sc3nncn3c12"; | |
| String smiles = "O=n1ccccc1"; | |
| String smiles = "[O-][n+]1ccccc1"; | |
| String smiles = "[Cl+3]([O-])([O-])([O-])[O-].[P+]([O-])(c1ccccc1)(c1ccccc1)c1cc([nH0+](C)c(c1)c1ccccc1)c1ccccc1"; | |
| String smiles = "c1(Cl)cc2c3cc(Cl)c(Cl)cc3c2cc1Cl"; |
Attention: the list was moved to
https://github.com/dypsilon/frontend-dev-bookmarks
This page is not maintained anymore, please update your bookmarks.
| [user] | |
| name = Pavan Gupta | |
| email = [email protected] | |
| [core] | |
| editor = vi | |
| excludesfile = ~/.gitignore | |
| attributesfile = ~/.gitattributes | |
npm, which is the node package manager we are using in the next commands.
| -server | |
| -Xms2G | |
| -Xmx4G | |
| -XX:NewSize=512m | |
| -XX:MaxNewSize=512m | |
| -XX:PermSize=512m | |
| -XX:MaxPermSize=512m | |
| -XX:+UseParNewGC | |
| -XX:ParallelGCThreads=4 | |
| -XX:MaxTenuringThreshold=1 |
| /Library/Java/JavaVirtualMachines/jdk1.8.0_60.jdk/Contents/Home/bin/java -agentlib:jdwp=transport=dt_socket,address=127.0.0.1:62396,suspend=y,server=n -Dfile.encoding=UTF-8 -classpath "/Library/Java/JavaVirtualMachines/jdk1.8.0_60.jdk/Contents/Home/lib/ant-javafx.jar:/Library/Java/JavaVirtualMachines/jdk1.8.0_60.jdk/Contents/Home/lib/dt.jar:/Library/Java/JavaVirtualMachines/jdk1.8.0_60.jdk/Contents/Home/lib/javafx-mx.jar:/Library/Java/JavaVirtualMachines/jdk1.8.0_60.jdk/Contents/Home/lib/jconsole.jar:/Library/Java/JavaVirtualMachines/jdk1.8.0_60.jdk/Contents/Home/lib/packager.jar:/Library/Java/JavaVirtualMachines/jdk1.8.0_60.jdk/Contents/Home/lib/sa-jdi.jar:/Library/Java/JavaVirtualMachines/jdk1.8.0_60.jdk/Contents/Home/lib/tools.jar:/Library/Java/JavaVirtualMachines/jdk1.8.0_60.jdk/Contents/Home/jre/lib/charsets.jar:/Library/Java/JavaVirtualMachines/jdk1.8.0_60.jdk/Contents/Home/jre/lib/deploy.jar:/Library/Java/JavaVirtualMachines/jdk1.8.0_60.jdk/Contents/Home/jre/lib/javaws.jar:/Library/Java/JavaVirtualMach |
| #!/bin/sh | |
| while true; | |
| do | |
| cputemp=$(($(cat /sys/class/hwmon/hwmon2/temp1_input)/1000)); | |
| ddrtemp=$(($(cat /sys/class/hwmon/hwmon1/temp1_input)/1000)); | |
| wifitemp=$(($(cat /sys/class/hwmon/hwmon1/temp2_input)/1000)); | |
| date=$(date +"%H:%M:%S"); | |
| fan_val=$(cat /sys/devices/pwm_fan/hwmon/hwmon0/pwm1); | |
| echo $date cputemp=$cputemp" "ddrtemp=$ddrtemp" "wifitemp=$wifitemp fanstatus=$fan_val; | |
| sleep 1; |
| aBrandNewMolecule.add("SMILES",smiles); | |
| aBrandNewMolecule.add("InChI",igf.getInChIGenerator(molecule).getInchi()); | |
| aBrandNewMolecule.add("MOL",swriter.toString()); | |
| aBrandNewMolecule.add("MDLV3000",mdlv3000); | |
| aBrandNewMolecule.add("MDLV2000",mdlv2000); | |
| aBrandNewMolecule.add("SDF",sdf); |
| package gov.epa.ctstestapi.service; | |
| import com.codahale.metrics.annotation.Timed; | |
| import com.google.common.collect.ImmutableList; | |
| import com.google.common.collect.ImmutableListMultimap; | |
| import com.google.common.collect.ImmutableSet; | |
| import java.io.IOException; | |
| import javax.annotation.PostConstruct; | |
| import javax.inject.Inject; | |
| import org.slf4j.Logger; |