Last active
June 16, 2019 18:36
-
-
Save ptosco/2bc42766a1672f61135d7d7dcce72223 to your computer and use it in GitHub Desktop.
O3A example (HTML version)
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
<!DOCTYPE html> | |
<html> | |
<head><meta charset="utf-8" /> | |
<title>o3a</title> | |
<script src="https://cdnjs.cloudflare.com/ajax/libs/require.js/2.1.10/require.min.js"></script> | |
<script src="https://cdnjs.cloudflare.com/ajax/libs/jquery/2.0.3/jquery.min.js"></script> | |
<style type="text/css"> | |
/*! | |
* | |
* Twitter Bootstrap | |
* | |
*/ | |
/*! | |
* Bootstrap v3.3.7 (http://getbootstrap.com) | |
* Copyright 2011-2016 Twitter, Inc. | |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) | |
*/ | |
/*! normalize.css v3.0.3 | MIT License | github.com/necolas/normalize.css */ | |
html { | |
font-family: sans-serif; | |
-ms-text-size-adjust: 100%; | |
-webkit-text-size-adjust: 100%; | |
} | |
body { | |
margin: 0; | |
} | |
article, | |
aside, | |
details, | |
figcaption, | |
figure, | |
footer, | |
header, | |
hgroup, | |
main, | |
menu, | |
nav, | |
section, | |
summary { | |
display: block; | |
} | |
audio, | |
canvas, | |
progress, | |
video { | |
display: inline-block; | |
vertical-align: baseline; | |
} | |
audio:not([controls]) { | |
display: none; | |
height: 0; | |
} | |
[hidden], | |
template { | |
display: none; | |
} | |
a { | |
background-color: transparent; | |
} | |
a:active, | |
a:hover { | |
outline: 0; | |
} | |
abbr[title] { | |
border-bottom: 1px dotted; | |
} | |
b, | |
strong { | |
font-weight: bold; | |
} | |
dfn { | |
font-style: italic; | |
} | |
h1 { | |
font-size: 2em; | |
margin: 0.67em 0; | |
} | |
mark { | |
background: #ff0; | |
color: #000; | |
} | |
small { | |
font-size: 80%; | |
} | |
sub, | |
sup { | |
font-size: 75%; | |
line-height: 0; | |
position: relative; | |
vertical-align: baseline; | |
} | |
sup { | |
top: -0.5em; | |
} | |
sub { | |
bottom: -0.25em; | |
} | |
img { | |
border: 0; | |
} | |
svg:not(:root) { | |
overflow: hidden; | |
} | |
figure { | |
margin: 1em 40px; | |
} | |
hr { | |
box-sizing: content-box; | |
height: 0; | |
} | |
pre { | |
overflow: auto; | |
} | |
code, | |
kbd, | |
pre, | |
samp { | |
font-family: monospace, monospace; | |
font-size: 1em; | |
} | |
button, | |
input, | |
optgroup, | |
select, | |
textarea { | |
color: inherit; | |
font: inherit; | |
margin: 0; | |
} | |
button { | |
overflow: visible; | |
} | |
button, | |
select { | |
text-transform: none; | |
} | |
button, | |
html input[type="button"], | |
input[type="reset"], | |
input[type="submit"] { | |
-webkit-appearance: button; | |
cursor: pointer; | |
} | |
button[disabled], | |
html input[disabled] { | |
cursor: default; | |
} | |
button::-moz-focus-inner, | |
input::-moz-focus-inner { | |
border: 0; | |
padding: 0; | |
} | |
input { | |
line-height: normal; | |
} | |
input[type="checkbox"], | |
input[type="radio"] { | |
box-sizing: border-box; | |
padding: 0; | |
} | |
input[type="number"]::-webkit-inner-spin-button, | |
input[type="number"]::-webkit-outer-spin-button { | |
height: auto; | |
} | |
input[type="search"] { | |
-webkit-appearance: textfield; | |
box-sizing: content-box; | |
} | |
input[type="search"]::-webkit-search-cancel-button, | |
input[type="search"]::-webkit-search-decoration { | |
-webkit-appearance: none; | |
} | |
fieldset { | |
border: 1px solid #c0c0c0; | |
margin: 0 2px; | |
padding: 0.35em 0.625em 0.75em; | |
} | |
legend { | |
border: 0; | |
padding: 0; | |
} | |
textarea { | |
overflow: auto; | |
} | |
optgroup { | |
font-weight: bold; | |
} | |
table { | |
border-collapse: collapse; | |
border-spacing: 0; | |
} | |
td, | |
th { | |
padding: 0; | |
} | |
/*! Source: https://github.com/h5bp/html5-boilerplate/blob/master/src/css/main.css */ | |
@media print { | |
*, | |
*:before, | |
*:after { | |
background: transparent !important; | |
box-shadow: none !important; | |
text-shadow: none !important; | |
} | |
a, | |
a:visited { | |
text-decoration: underline; | |
} | |
a[href]:after { | |
content: " (" attr(href) ")"; | |
} | |
abbr[title]:after { | |
content: " (" attr(title) ")"; | |
} | |
a[href^="#"]:after, | |
a[href^="javascript:"]:after { | |
content: ""; | |
} | |
pre, | |
blockquote { | |
border: 1px solid #999; | |
page-break-inside: avoid; | |
} | |
thead { | |
display: table-header-group; | |
} | |
tr, | |
img { | |
page-break-inside: avoid; | |
} | |
img { | |
max-width: 100% !important; | |
} | |
p, | |
h2, | |
h3 { | |
orphans: 3; | |
widows: 3; | |
} | |
h2, | |
h3 { | |
page-break-after: avoid; | |
} | |
.navbar { | |
display: none; | |
} | |
.btn > .caret, | |
.dropup > .btn > .caret { | |
border-top-color: #000 !important; | |
} | |
.label { | |
border: 1px solid #000; | |
} | |
.table { | |
border-collapse: collapse !important; | |
} | |
.table td, | |
.table th { | |
background-color: #fff !important; | |
} | |
.table-bordered th, | |
.table-bordered td { | |
border: 1px solid #ddd !important; | |
} | |
} | |
@font-face { | |
font-family: 'Glyphicons Halflings'; | |
src: url('../components/bootstrap/fonts/glyphicons-halflings-regular.eot'); | |
src: url('../components/bootstrap/fonts/glyphicons-halflings-regular.eot?#iefix') format('embedded-opentype'), url('../components/bootstrap/fonts/glyphicons-halflings-regular.woff2') format('woff2'), url('../components/bootstrap/fonts/glyphicons-halflings-regular.woff') format('woff'), url('../components/bootstrap/fonts/glyphicons-halflings-regular.ttf') format('truetype'), url('../components/bootstrap/fonts/glyphicons-halflings-regular.svg#glyphicons_halflingsregular') format('svg'); | |
} | |
.glyphicon { | |
position: relative; | |
top: 1px; | |
display: inline-block; | |
font-family: 'Glyphicons Halflings'; | |
font-style: normal; | |
font-weight: normal; | |
line-height: 1; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
} | |
.glyphicon-asterisk:before { | |
content: "\002a"; | |
} | |
.glyphicon-plus:before { | |
content: "\002b"; | |
} | |
.glyphicon-euro:before, | |
.glyphicon-eur:before { | |
content: "\20ac"; | |
} | |
.glyphicon-minus:before { | |
content: "\2212"; | |
} | |
.glyphicon-cloud:before { | |
content: "\2601"; | |
} | |
.glyphicon-envelope:before { | |
content: "\2709"; | |
} | |
.glyphicon-pencil:before { | |
content: "\270f"; | |
} | |
.glyphicon-glass:before { | |
content: "\e001"; | |
} | |
.glyphicon-music:before { | |
content: "\e002"; | |
} | |
.glyphicon-search:before { | |
content: "\e003"; | |
} | |
.glyphicon-heart:before { | |
content: "\e005"; | |
} | |
.glyphicon-star:before { | |
content: "\e006"; | |
} | |
.glyphicon-star-empty:before { | |
content: "\e007"; | |
} | |
.glyphicon-user:before { | |
content: "\e008"; | |
} | |
.glyphicon-film:before { | |
content: "\e009"; | |
} | |
.glyphicon-th-large:before { | |
content: "\e010"; | |
} | |
.glyphicon-th:before { | |
content: "\e011"; | |
} | |
.glyphicon-th-list:before { | |
content: "\e012"; | |
} | |
.glyphicon-ok:before { | |
content: "\e013"; | |
} | |
.glyphicon-remove:before { | |
content: "\e014"; | |
} | |
.glyphicon-zoom-in:before { | |
content: "\e015"; | |
} | |
.glyphicon-zoom-out:before { | |
content: "\e016"; | |
} | |
.glyphicon-off:before { | |
content: "\e017"; | |
} | |
.glyphicon-signal:before { | |
content: "\e018"; | |
} | |
.glyphicon-cog:before { | |
content: "\e019"; | |
} | |
.glyphicon-trash:before { | |
content: "\e020"; | |
} | |
.glyphicon-home:before { | |
content: "\e021"; | |
} | |
.glyphicon-file:before { | |
content: "\e022"; | |
} | |
.glyphicon-time:before { | |
content: "\e023"; | |
} | |
.glyphicon-road:before { | |
content: "\e024"; | |
} | |
.glyphicon-download-alt:before { | |
content: "\e025"; | |
} | |
.glyphicon-download:before { | |
content: "\e026"; | |
} | |
.glyphicon-upload:before { | |
content: "\e027"; | |
} | |
.glyphicon-inbox:before { | |
content: "\e028"; | |
} | |
.glyphicon-play-circle:before { | |
content: "\e029"; | |
} | |
.glyphicon-repeat:before { | |
content: "\e030"; | |
} | |
.glyphicon-refresh:before { | |
content: "\e031"; | |
} | |
.glyphicon-list-alt:before { | |
content: "\e032"; | |
} | |
.glyphicon-lock:before { | |
content: "\e033"; | |
} | |
.glyphicon-flag:before { | |
content: "\e034"; | |
} | |
.glyphicon-headphones:before { | |
content: "\e035"; | |
} | |
.glyphicon-volume-off:before { | |
content: "\e036"; | |
} | |
.glyphicon-volume-down:before { | |
content: "\e037"; | |
} | |
.glyphicon-volume-up:before { | |
content: "\e038"; | |
} | |
.glyphicon-qrcode:before { | |
content: "\e039"; | |
} | |
.glyphicon-barcode:before { | |
content: "\e040"; | |
} | |
.glyphicon-tag:before { | |
content: "\e041"; | |
} | |
.glyphicon-tags:before { | |
content: "\e042"; | |
} | |
.glyphicon-book:before { | |
content: "\e043"; | |
} | |
.glyphicon-bookmark:before { | |
content: "\e044"; | |
} | |
.glyphicon-print:before { | |
content: "\e045"; | |
} | |
.glyphicon-camera:before { | |
content: "\e046"; | |
} | |
.glyphicon-font:before { | |
content: "\e047"; | |
} | |
.glyphicon-bold:before { | |
content: "\e048"; | |
} | |
.glyphicon-italic:before { | |
content: "\e049"; | |
} | |
.glyphicon-text-height:before { | |
content: "\e050"; | |
} | |
.glyphicon-text-width:before { | |
content: "\e051"; | |
} | |
.glyphicon-align-left:before { | |
content: "\e052"; | |
} | |
.glyphicon-align-center:before { | |
content: "\e053"; | |
} | |
.glyphicon-align-right:before { | |
content: "\e054"; | |
} | |
.glyphicon-align-justify:before { | |
content: "\e055"; | |
} | |
.glyphicon-list:before { | |
content: "\e056"; | |
} | |
.glyphicon-indent-left:before { | |
content: "\e057"; | |
} | |
.glyphicon-indent-right:before { | |
content: "\e058"; | |
} | |
.glyphicon-facetime-video:before { | |
content: "\e059"; | |
} | |
.glyphicon-picture:before { | |
content: "\e060"; | |
} | |
.glyphicon-map-marker:before { | |
content: "\e062"; | |
} | |
.glyphicon-adjust:before { | |
content: "\e063"; | |
} | |
.glyphicon-tint:before { | |
content: "\e064"; | |
} | |
.glyphicon-edit:before { | |
content: "\e065"; | |
} | |
.glyphicon-share:before { | |
content: "\e066"; | |
} | |
.glyphicon-check:before { | |
content: "\e067"; | |
} | |
.glyphicon-move:before { | |
content: "\e068"; | |
} | |
.glyphicon-step-backward:before { | |
content: "\e069"; | |
} | |
.glyphicon-fast-backward:before { | |
content: "\e070"; | |
} | |
.glyphicon-backward:before { | |
content: "\e071"; | |
} | |
.glyphicon-play:before { | |
content: "\e072"; | |
} | |
.glyphicon-pause:before { | |
content: "\e073"; | |
} | |
.glyphicon-stop:before { | |
content: "\e074"; | |
} | |
.glyphicon-forward:before { | |
content: "\e075"; | |
} | |
.glyphicon-fast-forward:before { | |
content: "\e076"; | |
} | |
.glyphicon-step-forward:before { | |
content: "\e077"; | |
} | |
.glyphicon-eject:before { | |
content: "\e078"; | |
} | |
.glyphicon-chevron-left:before { | |
content: "\e079"; | |
} | |
.glyphicon-chevron-right:before { | |
content: "\e080"; | |
} | |
.glyphicon-plus-sign:before { | |
content: "\e081"; | |
} | |
.glyphicon-minus-sign:before { | |
content: "\e082"; | |
} | |
.glyphicon-remove-sign:before { | |
content: "\e083"; | |
} | |
.glyphicon-ok-sign:before { | |
content: "\e084"; | |
} | |
.glyphicon-question-sign:before { | |
content: "\e085"; | |
} | |
.glyphicon-info-sign:before { | |
content: "\e086"; | |
} | |
.glyphicon-screenshot:before { | |
content: "\e087"; | |
} | |
.glyphicon-remove-circle:before { | |
content: "\e088"; | |
} | |
.glyphicon-ok-circle:before { | |
content: "\e089"; | |
} | |
.glyphicon-ban-circle:before { | |
content: "\e090"; | |
} | |
.glyphicon-arrow-left:before { | |
content: "\e091"; | |
} | |
.glyphicon-arrow-right:before { | |
content: "\e092"; | |
} | |
.glyphicon-arrow-up:before { | |
content: "\e093"; | |
} | |
.glyphicon-arrow-down:before { | |
content: "\e094"; | |
} | |
.glyphicon-share-alt:before { | |
content: "\e095"; | |
} | |
.glyphicon-resize-full:before { | |
content: "\e096"; | |
} | |
.glyphicon-resize-small:before { | |
content: "\e097"; | |
} | |
.glyphicon-exclamation-sign:before { | |
content: "\e101"; | |
} | |
.glyphicon-gift:before { | |
content: "\e102"; | |
} | |
.glyphicon-leaf:before { | |
content: "\e103"; | |
} | |
.glyphicon-fire:before { | |
content: "\e104"; | |
} | |
.glyphicon-eye-open:before { | |
content: "\e105"; | |
} | |
.glyphicon-eye-close:before { | |
content: "\e106"; | |
} | |
.glyphicon-warning-sign:before { | |
content: "\e107"; | |
} | |
.glyphicon-plane:before { | |
content: "\e108"; | |
} | |
.glyphicon-calendar:before { | |
content: "\e109"; | |
} | |
.glyphicon-random:before { | |
content: "\e110"; | |
} | |
.glyphicon-comment:before { | |
content: "\e111"; | |
} | |
.glyphicon-magnet:before { | |
content: "\e112"; | |
} | |
.glyphicon-chevron-up:before { | |
content: "\e113"; | |
} | |
.glyphicon-chevron-down:before { | |
content: "\e114"; | |
} | |
.glyphicon-retweet:before { | |
content: "\e115"; | |
} | |
.glyphicon-shopping-cart:before { | |
content: "\e116"; | |
} | |
.glyphicon-folder-close:before { | |
content: "\e117"; | |
} | |
.glyphicon-folder-open:before { | |
content: "\e118"; | |
} | |
.glyphicon-resize-vertical:before { | |
content: "\e119"; | |
} | |
.glyphicon-resize-horizontal:before { | |
content: "\e120"; | |
} | |
.glyphicon-hdd:before { | |
content: "\e121"; | |
} | |
.glyphicon-bullhorn:before { | |
content: "\e122"; | |
} | |
.glyphicon-bell:before { | |
content: "\e123"; | |
} | |
.glyphicon-certificate:before { | |
content: "\e124"; | |
} | |
.glyphicon-thumbs-up:before { | |
content: "\e125"; | |
} | |
.glyphicon-thumbs-down:before { | |
content: "\e126"; | |
} | |
.glyphicon-hand-right:before { | |
content: "\e127"; | |
} | |
.glyphicon-hand-left:before { | |
content: "\e128"; | |
} | |
.glyphicon-hand-up:before { | |
content: "\e129"; | |
} | |
.glyphicon-hand-down:before { | |
content: "\e130"; | |
} | |
.glyphicon-circle-arrow-right:before { | |
content: "\e131"; | |
} | |
.glyphicon-circle-arrow-left:before { | |
content: "\e132"; | |
} | |
.glyphicon-circle-arrow-up:before { | |
content: "\e133"; | |
} | |
.glyphicon-circle-arrow-down:before { | |
content: "\e134"; | |
} | |
.glyphicon-globe:before { | |
content: "\e135"; | |
} | |
.glyphicon-wrench:before { | |
content: "\e136"; | |
} | |
.glyphicon-tasks:before { | |
content: "\e137"; | |
} | |
.glyphicon-filter:before { | |
content: "\e138"; | |
} | |
.glyphicon-briefcase:before { | |
content: "\e139"; | |
} | |
.glyphicon-fullscreen:before { | |
content: "\e140"; | |
} | |
.glyphicon-dashboard:before { | |
content: "\e141"; | |
} | |
.glyphicon-paperclip:before { | |
content: "\e142"; | |
} | |
.glyphicon-heart-empty:before { | |
content: "\e143"; | |
} | |
.glyphicon-link:before { | |
content: "\e144"; | |
} | |
.glyphicon-phone:before { | |
content: "\e145"; | |
} | |
.glyphicon-pushpin:before { | |
content: "\e146"; | |
} | |
.glyphicon-usd:before { | |
content: "\e148"; | |
} | |
.glyphicon-gbp:before { | |
content: "\e149"; | |
} | |
.glyphicon-sort:before { | |
content: "\e150"; | |
} | |
.glyphicon-sort-by-alphabet:before { | |
content: "\e151"; | |
} | |
.glyphicon-sort-by-alphabet-alt:before { | |
content: "\e152"; | |
} | |
.glyphicon-sort-by-order:before { | |
content: "\e153"; | |
} | |
.glyphicon-sort-by-order-alt:before { | |
content: "\e154"; | |
} | |
.glyphicon-sort-by-attributes:before { | |
content: "\e155"; | |
} | |
.glyphicon-sort-by-attributes-alt:before { | |
content: "\e156"; | |
} | |
.glyphicon-unchecked:before { | |
content: "\e157"; | |
} | |
.glyphicon-expand:before { | |
content: "\e158"; | |
} | |
.glyphicon-collapse-down:before { | |
content: "\e159"; | |
} | |
.glyphicon-collapse-up:before { | |
content: "\e160"; | |
} | |
.glyphicon-log-in:before { | |
content: "\e161"; | |
} | |
.glyphicon-flash:before { | |
content: "\e162"; | |
} | |
.glyphicon-log-out:before { | |
content: "\e163"; | |
} | |
.glyphicon-new-window:before { | |
content: "\e164"; | |
} | |
.glyphicon-record:before { | |
content: "\e165"; | |
} | |
.glyphicon-save:before { | |
content: "\e166"; | |
} | |
.glyphicon-open:before { | |
content: "\e167"; | |
} | |
.glyphicon-saved:before { | |
content: "\e168"; | |
} | |
.glyphicon-import:before { | |
content: "\e169"; | |
} | |
.glyphicon-export:before { | |
content: "\e170"; | |
} | |
.glyphicon-send:before { | |
content: "\e171"; | |
} | |
.glyphicon-floppy-disk:before { | |
content: "\e172"; | |
} | |
.glyphicon-floppy-saved:before { | |
content: "\e173"; | |
} | |
.glyphicon-floppy-remove:before { | |
content: "\e174"; | |
} | |
.glyphicon-floppy-save:before { | |
content: "\e175"; | |
} | |
.glyphicon-floppy-open:before { | |
content: "\e176"; | |
} | |
.glyphicon-credit-card:before { | |
content: "\e177"; | |
} | |
.glyphicon-transfer:before { | |
content: "\e178"; | |
} | |
.glyphicon-cutlery:before { | |
content: "\e179"; | |
} | |
.glyphicon-header:before { | |
content: "\e180"; | |
} | |
.glyphicon-compressed:before { | |
content: "\e181"; | |
} | |
.glyphicon-earphone:before { | |
content: "\e182"; | |
} | |
.glyphicon-phone-alt:before { | |
content: "\e183"; | |
} | |
.glyphicon-tower:before { | |
content: "\e184"; | |
} | |
.glyphicon-stats:before { | |
content: "\e185"; | |
} | |
.glyphicon-sd-video:before { | |
content: "\e186"; | |
} | |
.glyphicon-hd-video:before { | |
content: "\e187"; | |
} | |
.glyphicon-subtitles:before { | |
content: "\e188"; | |
} | |
.glyphicon-sound-stereo:before { | |
content: "\e189"; | |
} | |
.glyphicon-sound-dolby:before { | |
content: "\e190"; | |
} | |
.glyphicon-sound-5-1:before { | |
content: "\e191"; | |
} | |
.glyphicon-sound-6-1:before { | |
content: "\e192"; | |
} | |
.glyphicon-sound-7-1:before { | |
content: "\e193"; | |
} | |
.glyphicon-copyright-mark:before { | |
content: "\e194"; | |
} | |
.glyphicon-registration-mark:before { | |
content: "\e195"; | |
} | |
.glyphicon-cloud-download:before { | |
content: "\e197"; | |
} | |
.glyphicon-cloud-upload:before { | |
content: "\e198"; | |
} | |
.glyphicon-tree-conifer:before { | |
content: "\e199"; | |
} | |
.glyphicon-tree-deciduous:before { | |
content: "\e200"; | |
} | |
.glyphicon-cd:before { | |
content: "\e201"; | |
} | |
.glyphicon-save-file:before { | |
content: "\e202"; | |
} | |
.glyphicon-open-file:before { | |
content: "\e203"; | |
} | |
.glyphicon-level-up:before { | |
content: "\e204"; | |
} | |
.glyphicon-copy:before { | |
content: "\e205"; | |
} | |
.glyphicon-paste:before { | |
content: "\e206"; | |
} | |
.glyphicon-alert:before { | |
content: "\e209"; | |
} | |
.glyphicon-equalizer:before { | |
content: "\e210"; | |
} | |
.glyphicon-king:before { | |
content: "\e211"; | |
} | |
.glyphicon-queen:before { | |
content: "\e212"; | |
} | |
.glyphicon-pawn:before { | |
content: "\e213"; | |
} | |
.glyphicon-bishop:before { | |
content: "\e214"; | |
} | |
.glyphicon-knight:before { | |
content: "\e215"; | |
} | |
.glyphicon-baby-formula:before { | |
content: "\e216"; | |
} | |
.glyphicon-tent:before { | |
content: "\26fa"; | |
} | |
.glyphicon-blackboard:before { | |
content: "\e218"; | |
} | |
.glyphicon-bed:before { | |
content: "\e219"; | |
} | |
.glyphicon-apple:before { | |
content: "\f8ff"; | |
} | |
.glyphicon-erase:before { | |
content: "\e221"; | |
} | |
.glyphicon-hourglass:before { | |
content: "\231b"; | |
} | |
.glyphicon-lamp:before { | |
content: "\e223"; | |
} | |
.glyphicon-duplicate:before { | |
content: "\e224"; | |
} | |
.glyphicon-piggy-bank:before { | |
content: "\e225"; | |
} | |
.glyphicon-scissors:before { | |
content: "\e226"; | |
} | |
.glyphicon-bitcoin:before { | |
content: "\e227"; | |
} | |
.glyphicon-btc:before { | |
content: "\e227"; | |
} | |
.glyphicon-xbt:before { | |
content: "\e227"; | |
} | |
.glyphicon-yen:before { | |
content: "\00a5"; | |
} | |
.glyphicon-jpy:before { | |
content: "\00a5"; | |
} | |
.glyphicon-ruble:before { | |
content: "\20bd"; | |
} | |
.glyphicon-rub:before { | |
content: "\20bd"; | |
} | |
.glyphicon-scale:before { | |
content: "\e230"; | |
} | |
.glyphicon-ice-lolly:before { | |
content: "\e231"; | |
} | |
.glyphicon-ice-lolly-tasted:before { | |
content: "\e232"; | |
} | |
.glyphicon-education:before { | |
content: "\e233"; | |
} | |
.glyphicon-option-horizontal:before { | |
content: "\e234"; | |
} | |
.glyphicon-option-vertical:before { | |
content: "\e235"; | |
} | |
.glyphicon-menu-hamburger:before { | |
content: "\e236"; | |
} | |
.glyphicon-modal-window:before { | |
content: "\e237"; | |
} | |
.glyphicon-oil:before { | |
content: "\e238"; | |
} | |
.glyphicon-grain:before { | |
content: "\e239"; | |
} | |
.glyphicon-sunglasses:before { | |
content: "\e240"; | |
} | |
.glyphicon-text-size:before { | |
content: "\e241"; | |
} | |
.glyphicon-text-color:before { | |
content: "\e242"; | |
} | |
.glyphicon-text-background:before { | |
content: "\e243"; | |
} | |
.glyphicon-object-align-top:before { | |
content: "\e244"; | |
} | |
.glyphicon-object-align-bottom:before { | |
content: "\e245"; | |
} | |
.glyphicon-object-align-horizontal:before { | |
content: "\e246"; | |
} | |
.glyphicon-object-align-left:before { | |
content: "\e247"; | |
} | |
.glyphicon-object-align-vertical:before { | |
content: "\e248"; | |
} | |
.glyphicon-object-align-right:before { | |
content: "\e249"; | |
} | |
.glyphicon-triangle-right:before { | |
content: "\e250"; | |
} | |
.glyphicon-triangle-left:before { | |
content: "\e251"; | |
} | |
.glyphicon-triangle-bottom:before { | |
content: "\e252"; | |
} | |
.glyphicon-triangle-top:before { | |
content: "\e253"; | |
} | |
.glyphicon-console:before { | |
content: "\e254"; | |
} | |
.glyphicon-superscript:before { | |
content: "\e255"; | |
} | |
.glyphicon-subscript:before { | |
content: "\e256"; | |
} | |
.glyphicon-menu-left:before { | |
content: "\e257"; | |
} | |
.glyphicon-menu-right:before { | |
content: "\e258"; | |
} | |
.glyphicon-menu-down:before { | |
content: "\e259"; | |
} | |
.glyphicon-menu-up:before { | |
content: "\e260"; | |
} | |
* { | |
-webkit-box-sizing: border-box; | |
-moz-box-sizing: border-box; | |
box-sizing: border-box; | |
} | |
*:before, | |
*:after { | |
-webkit-box-sizing: border-box; | |
-moz-box-sizing: border-box; | |
box-sizing: border-box; | |
} | |
html { | |
font-size: 10px; | |
-webkit-tap-highlight-color: rgba(0, 0, 0, 0); | |
} | |
body { | |
font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; | |
font-size: 13px; | |
line-height: 1.42857143; | |
color: #000; | |
background-color: #fff; | |
} | |
input, | |
button, | |
select, | |
textarea { | |
font-family: inherit; | |
font-size: inherit; | |
line-height: inherit; | |
} | |
a { | |
color: #337ab7; | |
text-decoration: none; | |
} | |
a:hover, | |
a:focus { | |
color: #23527c; | |
text-decoration: underline; | |
} | |
a:focus { | |
outline: 5px auto -webkit-focus-ring-color; | |
outline-offset: -2px; | |
} | |
figure { | |
margin: 0; | |
} | |
img { | |
vertical-align: middle; | |
} | |
.img-responsive, | |
.thumbnail > img, | |
.thumbnail a > img, | |
.carousel-inner > .item > img, | |
.carousel-inner > .item > a > img { | |
display: block; | |
max-width: 100%; | |
height: auto; | |
} | |
.img-rounded { | |
border-radius: 3px; | |
} | |
.img-thumbnail { | |
padding: 4px; | |
line-height: 1.42857143; | |
background-color: #fff; | |
border: 1px solid #ddd; | |
border-radius: 2px; | |
-webkit-transition: all 0.2s ease-in-out; | |
-o-transition: all 0.2s ease-in-out; | |
transition: all 0.2s ease-in-out; | |
display: inline-block; | |
max-width: 100%; | |
height: auto; | |
} | |
.img-circle { | |
border-radius: 50%; | |
} | |
hr { | |
margin-top: 18px; | |
margin-bottom: 18px; | |
border: 0; | |
border-top: 1px solid #eeeeee; | |
} | |
.sr-only { | |
position: absolute; | |
width: 1px; | |
height: 1px; | |
margin: -1px; | |
padding: 0; | |
overflow: hidden; | |
clip: rect(0, 0, 0, 0); | |
border: 0; | |
} | |
.sr-only-focusable:active, | |
.sr-only-focusable:focus { | |
position: static; | |
width: auto; | |
height: auto; | |
margin: 0; | |
overflow: visible; | |
clip: auto; | |
} | |
[role="button"] { | |
cursor: pointer; | |
} | |
h1, | |
h2, | |
h3, | |
h4, | |
h5, | |
h6, | |
.h1, | |
.h2, | |
.h3, | |
.h4, | |
.h5, | |
.h6 { | |
font-family: inherit; | |
font-weight: 500; | |
line-height: 1.1; | |
color: inherit; | |
} | |
h1 small, | |
h2 small, | |
h3 small, | |
h4 small, | |
h5 small, | |
h6 small, | |
.h1 small, | |
.h2 small, | |
.h3 small, | |
.h4 small, | |
.h5 small, | |
.h6 small, | |
h1 .small, | |
h2 .small, | |
h3 .small, | |
h4 .small, | |
h5 .small, | |
h6 .small, | |
.h1 .small, | |
.h2 .small, | |
.h3 .small, | |
.h4 .small, | |
.h5 .small, | |
.h6 .small { | |
font-weight: normal; | |
line-height: 1; | |
color: #777777; | |
} | |
h1, | |
.h1, | |
h2, | |
.h2, | |
h3, | |
.h3 { | |
margin-top: 18px; | |
margin-bottom: 9px; | |
} | |
h1 small, | |
.h1 small, | |
h2 small, | |
.h2 small, | |
h3 small, | |
.h3 small, | |
h1 .small, | |
.h1 .small, | |
h2 .small, | |
.h2 .small, | |
h3 .small, | |
.h3 .small { | |
font-size: 65%; | |
} | |
h4, | |
.h4, | |
h5, | |
.h5, | |
h6, | |
.h6 { | |
margin-top: 9px; | |
margin-bottom: 9px; | |
} | |
h4 small, | |
.h4 small, | |
h5 small, | |
.h5 small, | |
h6 small, | |
.h6 small, | |
h4 .small, | |
.h4 .small, | |
h5 .small, | |
.h5 .small, | |
h6 .small, | |
.h6 .small { | |
font-size: 75%; | |
} | |
h1, | |
.h1 { | |
font-size: 33px; | |
} | |
h2, | |
.h2 { | |
font-size: 27px; | |
} | |
h3, | |
.h3 { | |
font-size: 23px; | |
} | |
h4, | |
.h4 { | |
font-size: 17px; | |
} | |
h5, | |
.h5 { | |
font-size: 13px; | |
} | |
h6, | |
.h6 { | |
font-size: 12px; | |
} | |
p { | |
margin: 0 0 9px; | |
} | |
.lead { | |
margin-bottom: 18px; | |
font-size: 14px; | |
font-weight: 300; | |
line-height: 1.4; | |
} | |
@media (min-width: 768px) { | |
.lead { | |
font-size: 19.5px; | |
} | |
} | |
small, | |
.small { | |
font-size: 92%; | |
} | |
mark, | |
.mark { | |
background-color: #fcf8e3; | |
padding: .2em; | |
} | |
.text-left { | |
text-align: left; | |
} | |
.text-right { | |
text-align: right; | |
} | |
.text-center { | |
text-align: center; | |
} | |
.text-justify { | |
text-align: justify; | |
} | |
.text-nowrap { | |
white-space: nowrap; | |
} | |
.text-lowercase { | |
text-transform: lowercase; | |
} | |
.text-uppercase { | |
text-transform: uppercase; | |
} | |
.text-capitalize { | |
text-transform: capitalize; | |
} | |
.text-muted { | |
color: #777777; | |
} | |
.text-primary { | |
color: #337ab7; | |
} | |
a.text-primary:hover, | |
a.text-primary:focus { | |
color: #286090; | |
} | |
.text-success { | |
color: #3c763d; | |
} | |
a.text-success:hover, | |
a.text-success:focus { | |
color: #2b542c; | |
} | |
.text-info { | |
color: #31708f; | |
} | |
a.text-info:hover, | |
a.text-info:focus { | |
color: #245269; | |
} | |
.text-warning { | |
color: #8a6d3b; | |
} | |
a.text-warning:hover, | |
a.text-warning:focus { | |
color: #66512c; | |
} | |
.text-danger { | |
color: #a94442; | |
} | |
a.text-danger:hover, | |
a.text-danger:focus { | |
color: #843534; | |
} | |
.bg-primary { | |
color: #fff; | |
background-color: #337ab7; | |
} | |
a.bg-primary:hover, | |
a.bg-primary:focus { | |
background-color: #286090; | |
} | |
.bg-success { | |
background-color: #dff0d8; | |
} | |
a.bg-success:hover, | |
a.bg-success:focus { | |
background-color: #c1e2b3; | |
} | |
.bg-info { | |
background-color: #d9edf7; | |
} | |
a.bg-info:hover, | |
a.bg-info:focus { | |
background-color: #afd9ee; | |
} | |
.bg-warning { | |
background-color: #fcf8e3; | |
} | |
a.bg-warning:hover, | |
a.bg-warning:focus { | |
background-color: #f7ecb5; | |
} | |
.bg-danger { | |
background-color: #f2dede; | |
} | |
a.bg-danger:hover, | |
a.bg-danger:focus { | |
background-color: #e4b9b9; | |
} | |
.page-header { | |
padding-bottom: 8px; | |
margin: 36px 0 18px; | |
border-bottom: 1px solid #eeeeee; | |
} | |
ul, | |
ol { | |
margin-top: 0; | |
margin-bottom: 9px; | |
} | |
ul ul, | |
ol ul, | |
ul ol, | |
ol ol { | |
margin-bottom: 0; | |
} | |
.list-unstyled { | |
padding-left: 0; | |
list-style: none; | |
} | |
.list-inline { | |
padding-left: 0; | |
list-style: none; | |
margin-left: -5px; | |
} | |
.list-inline > li { | |
display: inline-block; | |
padding-left: 5px; | |
padding-right: 5px; | |
} | |
dl { | |
margin-top: 0; | |
margin-bottom: 18px; | |
} | |
dt, | |
dd { | |
line-height: 1.42857143; | |
} | |
dt { | |
font-weight: bold; | |
} | |
dd { | |
margin-left: 0; | |
} | |
@media (min-width: 541px) { | |
.dl-horizontal dt { | |
float: left; | |
width: 160px; | |
clear: left; | |
text-align: right; | |
overflow: hidden; | |
text-overflow: ellipsis; | |
white-space: nowrap; | |
} | |
.dl-horizontal dd { | |
margin-left: 180px; | |
} | |
} | |
abbr[title], | |
abbr[data-original-title] { | |
cursor: help; | |
border-bottom: 1px dotted #777777; | |
} | |
.initialism { | |
font-size: 90%; | |
text-transform: uppercase; | |
} | |
blockquote { | |
padding: 9px 18px; | |
margin: 0 0 18px; | |
font-size: inherit; | |
border-left: 5px solid #eeeeee; | |
} | |
blockquote p:last-child, | |
blockquote ul:last-child, | |
blockquote ol:last-child { | |
margin-bottom: 0; | |
} | |
blockquote footer, | |
blockquote small, | |
blockquote .small { | |
display: block; | |
font-size: 80%; | |
line-height: 1.42857143; | |
color: #777777; | |
} | |
blockquote footer:before, | |
blockquote small:before, | |
blockquote .small:before { | |
content: '\2014 \00A0'; | |
} | |
.blockquote-reverse, | |
blockquote.pull-right { | |
padding-right: 15px; | |
padding-left: 0; | |
border-right: 5px solid #eeeeee; | |
border-left: 0; | |
text-align: right; | |
} | |
.blockquote-reverse footer:before, | |
blockquote.pull-right footer:before, | |
.blockquote-reverse small:before, | |
blockquote.pull-right small:before, | |
.blockquote-reverse .small:before, | |
blockquote.pull-right .small:before { | |
content: ''; | |
} | |
.blockquote-reverse footer:after, | |
blockquote.pull-right footer:after, | |
.blockquote-reverse small:after, | |
blockquote.pull-right small:after, | |
.blockquote-reverse .small:after, | |
blockquote.pull-right .small:after { | |
content: '\00A0 \2014'; | |
} | |
address { | |
margin-bottom: 18px; | |
font-style: normal; | |
line-height: 1.42857143; | |
} | |
code, | |
kbd, | |
pre, | |
samp { | |
font-family: monospace; | |
} | |
code { | |
padding: 2px 4px; | |
font-size: 90%; | |
color: #c7254e; | |
background-color: #f9f2f4; | |
border-radius: 2px; | |
} | |
kbd { | |
padding: 2px 4px; | |
font-size: 90%; | |
color: #888; | |
background-color: transparent; | |
border-radius: 1px; | |
box-shadow: inset 0 -1px 0 rgba(0, 0, 0, 0.25); | |
} | |
kbd kbd { | |
padding: 0; | |
font-size: 100%; | |
font-weight: bold; | |
box-shadow: none; | |
} | |
pre { | |
display: block; | |
padding: 8.5px; | |
margin: 0 0 9px; | |
font-size: 12px; | |
line-height: 1.42857143; | |
word-break: break-all; | |
word-wrap: break-word; | |
color: #333333; | |
background-color: #f5f5f5; | |
border: 1px solid #ccc; | |
border-radius: 2px; | |
} | |
pre code { | |
padding: 0; | |
font-size: inherit; | |
color: inherit; | |
white-space: pre-wrap; | |
background-color: transparent; | |
border-radius: 0; | |
} | |
.pre-scrollable { | |
max-height: 340px; | |
overflow-y: scroll; | |
} | |
.container { | |
margin-right: auto; | |
margin-left: auto; | |
padding-left: 0px; | |
padding-right: 0px; | |
} | |
@media (min-width: 768px) { | |
.container { | |
width: 768px; | |
} | |
} | |
@media (min-width: 992px) { | |
.container { | |
width: 940px; | |
} | |
} | |
@media (min-width: 1200px) { | |
.container { | |
width: 1140px; | |
} | |
} | |
.container-fluid { | |
margin-right: auto; | |
margin-left: auto; | |
padding-left: 0px; | |
padding-right: 0px; | |
} | |
.row { | |
margin-left: 0px; | |
margin-right: 0px; | |
} | |
.col-xs-1, .col-sm-1, .col-md-1, .col-lg-1, .col-xs-2, .col-sm-2, .col-md-2, .col-lg-2, .col-xs-3, .col-sm-3, .col-md-3, .col-lg-3, .col-xs-4, .col-sm-4, .col-md-4, .col-lg-4, .col-xs-5, .col-sm-5, .col-md-5, .col-lg-5, .col-xs-6, .col-sm-6, .col-md-6, .col-lg-6, .col-xs-7, .col-sm-7, .col-md-7, .col-lg-7, .col-xs-8, .col-sm-8, .col-md-8, .col-lg-8, .col-xs-9, .col-sm-9, .col-md-9, .col-lg-9, .col-xs-10, .col-sm-10, .col-md-10, .col-lg-10, .col-xs-11, .col-sm-11, .col-md-11, .col-lg-11, .col-xs-12, .col-sm-12, .col-md-12, .col-lg-12 { | |
position: relative; | |
min-height: 1px; | |
padding-left: 0px; | |
padding-right: 0px; | |
} | |
.col-xs-1, .col-xs-2, .col-xs-3, .col-xs-4, .col-xs-5, .col-xs-6, .col-xs-7, .col-xs-8, .col-xs-9, .col-xs-10, .col-xs-11, .col-xs-12 { | |
float: left; | |
} | |
.col-xs-12 { | |
width: 100%; | |
} | |
.col-xs-11 { | |
width: 91.66666667%; | |
} | |
.col-xs-10 { | |
width: 83.33333333%; | |
} | |
.col-xs-9 { | |
width: 75%; | |
} | |
.col-xs-8 { | |
width: 66.66666667%; | |
} | |
.col-xs-7 { | |
width: 58.33333333%; | |
} | |
.col-xs-6 { | |
width: 50%; | |
} | |
.col-xs-5 { | |
width: 41.66666667%; | |
} | |
.col-xs-4 { | |
width: 33.33333333%; | |
} | |
.col-xs-3 { | |
width: 25%; | |
} | |
.col-xs-2 { | |
width: 16.66666667%; | |
} | |
.col-xs-1 { | |
width: 8.33333333%; | |
} | |
.col-xs-pull-12 { | |
right: 100%; | |
} | |
.col-xs-pull-11 { | |
right: 91.66666667%; | |
} | |
.col-xs-pull-10 { | |
right: 83.33333333%; | |
} | |
.col-xs-pull-9 { | |
right: 75%; | |
} | |
.col-xs-pull-8 { | |
right: 66.66666667%; | |
} | |
.col-xs-pull-7 { | |
right: 58.33333333%; | |
} | |
.col-xs-pull-6 { | |
right: 50%; | |
} | |
.col-xs-pull-5 { | |
right: 41.66666667%; | |
} | |
.col-xs-pull-4 { | |
right: 33.33333333%; | |
} | |
.col-xs-pull-3 { | |
right: 25%; | |
} | |
.col-xs-pull-2 { | |
right: 16.66666667%; | |
} | |
.col-xs-pull-1 { | |
right: 8.33333333%; | |
} | |
.col-xs-pull-0 { | |
right: auto; | |
} | |
.col-xs-push-12 { | |
left: 100%; | |
} | |
.col-xs-push-11 { | |
left: 91.66666667%; | |
} | |
.col-xs-push-10 { | |
left: 83.33333333%; | |
} | |
.col-xs-push-9 { | |
left: 75%; | |
} | |
.col-xs-push-8 { | |
left: 66.66666667%; | |
} | |
.col-xs-push-7 { | |
left: 58.33333333%; | |
} | |
.col-xs-push-6 { | |
left: 50%; | |
} | |
.col-xs-push-5 { | |
left: 41.66666667%; | |
} | |
.col-xs-push-4 { | |
left: 33.33333333%; | |
} | |
.col-xs-push-3 { | |
left: 25%; | |
} | |
.col-xs-push-2 { | |
left: 16.66666667%; | |
} | |
.col-xs-push-1 { | |
left: 8.33333333%; | |
} | |
.col-xs-push-0 { | |
left: auto; | |
} | |
.col-xs-offset-12 { | |
margin-left: 100%; | |
} | |
.col-xs-offset-11 { | |
margin-left: 91.66666667%; | |
} | |
.col-xs-offset-10 { | |
margin-left: 83.33333333%; | |
} | |
.col-xs-offset-9 { | |
margin-left: 75%; | |
} | |
.col-xs-offset-8 { | |
margin-left: 66.66666667%; | |
} | |
.col-xs-offset-7 { | |
margin-left: 58.33333333%; | |
} | |
.col-xs-offset-6 { | |
margin-left: 50%; | |
} | |
.col-xs-offset-5 { | |
margin-left: 41.66666667%; | |
} | |
.col-xs-offset-4 { | |
margin-left: 33.33333333%; | |
} | |
.col-xs-offset-3 { | |
margin-left: 25%; | |
} | |
.col-xs-offset-2 { | |
margin-left: 16.66666667%; | |
} | |
.col-xs-offset-1 { | |
margin-left: 8.33333333%; | |
} | |
.col-xs-offset-0 { | |
margin-left: 0%; | |
} | |
@media (min-width: 768px) { | |
.col-sm-1, .col-sm-2, .col-sm-3, .col-sm-4, .col-sm-5, .col-sm-6, .col-sm-7, .col-sm-8, .col-sm-9, .col-sm-10, .col-sm-11, .col-sm-12 { | |
float: left; | |
} | |
.col-sm-12 { | |
width: 100%; | |
} | |
.col-sm-11 { | |
width: 91.66666667%; | |
} | |
.col-sm-10 { | |
width: 83.33333333%; | |
} | |
.col-sm-9 { | |
width: 75%; | |
} | |
.col-sm-8 { | |
width: 66.66666667%; | |
} | |
.col-sm-7 { | |
width: 58.33333333%; | |
} | |
.col-sm-6 { | |
width: 50%; | |
} | |
.col-sm-5 { | |
width: 41.66666667%; | |
} | |
.col-sm-4 { | |
width: 33.33333333%; | |
} | |
.col-sm-3 { | |
width: 25%; | |
} | |
.col-sm-2 { | |
width: 16.66666667%; | |
} | |
.col-sm-1 { | |
width: 8.33333333%; | |
} | |
.col-sm-pull-12 { | |
right: 100%; | |
} | |
.col-sm-pull-11 { | |
right: 91.66666667%; | |
} | |
.col-sm-pull-10 { | |
right: 83.33333333%; | |
} | |
.col-sm-pull-9 { | |
right: 75%; | |
} | |
.col-sm-pull-8 { | |
right: 66.66666667%; | |
} | |
.col-sm-pull-7 { | |
right: 58.33333333%; | |
} | |
.col-sm-pull-6 { | |
right: 50%; | |
} | |
.col-sm-pull-5 { | |
right: 41.66666667%; | |
} | |
.col-sm-pull-4 { | |
right: 33.33333333%; | |
} | |
.col-sm-pull-3 { | |
right: 25%; | |
} | |
.col-sm-pull-2 { | |
right: 16.66666667%; | |
} | |
.col-sm-pull-1 { | |
right: 8.33333333%; | |
} | |
.col-sm-pull-0 { | |
right: auto; | |
} | |
.col-sm-push-12 { | |
left: 100%; | |
} | |
.col-sm-push-11 { | |
left: 91.66666667%; | |
} | |
.col-sm-push-10 { | |
left: 83.33333333%; | |
} | |
.col-sm-push-9 { | |
left: 75%; | |
} | |
.col-sm-push-8 { | |
left: 66.66666667%; | |
} | |
.col-sm-push-7 { | |
left: 58.33333333%; | |
} | |
.col-sm-push-6 { | |
left: 50%; | |
} | |
.col-sm-push-5 { | |
left: 41.66666667%; | |
} | |
.col-sm-push-4 { | |
left: 33.33333333%; | |
} | |
.col-sm-push-3 { | |
left: 25%; | |
} | |
.col-sm-push-2 { | |
left: 16.66666667%; | |
} | |
.col-sm-push-1 { | |
left: 8.33333333%; | |
} | |
.col-sm-push-0 { | |
left: auto; | |
} | |
.col-sm-offset-12 { | |
margin-left: 100%; | |
} | |
.col-sm-offset-11 { | |
margin-left: 91.66666667%; | |
} | |
.col-sm-offset-10 { | |
margin-left: 83.33333333%; | |
} | |
.col-sm-offset-9 { | |
margin-left: 75%; | |
} | |
.col-sm-offset-8 { | |
margin-left: 66.66666667%; | |
} | |
.col-sm-offset-7 { | |
margin-left: 58.33333333%; | |
} | |
.col-sm-offset-6 { | |
margin-left: 50%; | |
} | |
.col-sm-offset-5 { | |
margin-left: 41.66666667%; | |
} | |
.col-sm-offset-4 { | |
margin-left: 33.33333333%; | |
} | |
.col-sm-offset-3 { | |
margin-left: 25%; | |
} | |
.col-sm-offset-2 { | |
margin-left: 16.66666667%; | |
} | |
.col-sm-offset-1 { | |
margin-left: 8.33333333%; | |
} | |
.col-sm-offset-0 { | |
margin-left: 0%; | |
} | |
} | |
@media (min-width: 992px) { | |
.col-md-1, .col-md-2, .col-md-3, .col-md-4, .col-md-5, .col-md-6, .col-md-7, .col-md-8, .col-md-9, .col-md-10, .col-md-11, .col-md-12 { | |
float: left; | |
} | |
.col-md-12 { | |
width: 100%; | |
} | |
.col-md-11 { | |
width: 91.66666667%; | |
} | |
.col-md-10 { | |
width: 83.33333333%; | |
} | |
.col-md-9 { | |
width: 75%; | |
} | |
.col-md-8 { | |
width: 66.66666667%; | |
} | |
.col-md-7 { | |
width: 58.33333333%; | |
} | |
.col-md-6 { | |
width: 50%; | |
} | |
.col-md-5 { | |
width: 41.66666667%; | |
} | |
.col-md-4 { | |
width: 33.33333333%; | |
} | |
.col-md-3 { | |
width: 25%; | |
} | |
.col-md-2 { | |
width: 16.66666667%; | |
} | |
.col-md-1 { | |
width: 8.33333333%; | |
} | |
.col-md-pull-12 { | |
right: 100%; | |
} | |
.col-md-pull-11 { | |
right: 91.66666667%; | |
} | |
.col-md-pull-10 { | |
right: 83.33333333%; | |
} | |
.col-md-pull-9 { | |
right: 75%; | |
} | |
.col-md-pull-8 { | |
right: 66.66666667%; | |
} | |
.col-md-pull-7 { | |
right: 58.33333333%; | |
} | |
.col-md-pull-6 { | |
right: 50%; | |
} | |
.col-md-pull-5 { | |
right: 41.66666667%; | |
} | |
.col-md-pull-4 { | |
right: 33.33333333%; | |
} | |
.col-md-pull-3 { | |
right: 25%; | |
} | |
.col-md-pull-2 { | |
right: 16.66666667%; | |
} | |
.col-md-pull-1 { | |
right: 8.33333333%; | |
} | |
.col-md-pull-0 { | |
right: auto; | |
} | |
.col-md-push-12 { | |
left: 100%; | |
} | |
.col-md-push-11 { | |
left: 91.66666667%; | |
} | |
.col-md-push-10 { | |
left: 83.33333333%; | |
} | |
.col-md-push-9 { | |
left: 75%; | |
} | |
.col-md-push-8 { | |
left: 66.66666667%; | |
} | |
.col-md-push-7 { | |
left: 58.33333333%; | |
} | |
.col-md-push-6 { | |
left: 50%; | |
} | |
.col-md-push-5 { | |
left: 41.66666667%; | |
} | |
.col-md-push-4 { | |
left: 33.33333333%; | |
} | |
.col-md-push-3 { | |
left: 25%; | |
} | |
.col-md-push-2 { | |
left: 16.66666667%; | |
} | |
.col-md-push-1 { | |
left: 8.33333333%; | |
} | |
.col-md-push-0 { | |
left: auto; | |
} | |
.col-md-offset-12 { | |
margin-left: 100%; | |
} | |
.col-md-offset-11 { | |
margin-left: 91.66666667%; | |
} | |
.col-md-offset-10 { | |
margin-left: 83.33333333%; | |
} | |
.col-md-offset-9 { | |
margin-left: 75%; | |
} | |
.col-md-offset-8 { | |
margin-left: 66.66666667%; | |
} | |
.col-md-offset-7 { | |
margin-left: 58.33333333%; | |
} | |
.col-md-offset-6 { | |
margin-left: 50%; | |
} | |
.col-md-offset-5 { | |
margin-left: 41.66666667%; | |
} | |
.col-md-offset-4 { | |
margin-left: 33.33333333%; | |
} | |
.col-md-offset-3 { | |
margin-left: 25%; | |
} | |
.col-md-offset-2 { | |
margin-left: 16.66666667%; | |
} | |
.col-md-offset-1 { | |
margin-left: 8.33333333%; | |
} | |
.col-md-offset-0 { | |
margin-left: 0%; | |
} | |
} | |
@media (min-width: 1200px) { | |
.col-lg-1, .col-lg-2, .col-lg-3, .col-lg-4, .col-lg-5, .col-lg-6, .col-lg-7, .col-lg-8, .col-lg-9, .col-lg-10, .col-lg-11, .col-lg-12 { | |
float: left; | |
} | |
.col-lg-12 { | |
width: 100%; | |
} | |
.col-lg-11 { | |
width: 91.66666667%; | |
} | |
.col-lg-10 { | |
width: 83.33333333%; | |
} | |
.col-lg-9 { | |
width: 75%; | |
} | |
.col-lg-8 { | |
width: 66.66666667%; | |
} | |
.col-lg-7 { | |
width: 58.33333333%; | |
} | |
.col-lg-6 { | |
width: 50%; | |
} | |
.col-lg-5 { | |
width: 41.66666667%; | |
} | |
.col-lg-4 { | |
width: 33.33333333%; | |
} | |
.col-lg-3 { | |
width: 25%; | |
} | |
.col-lg-2 { | |
width: 16.66666667%; | |
} | |
.col-lg-1 { | |
width: 8.33333333%; | |
} | |
.col-lg-pull-12 { | |
right: 100%; | |
} | |
.col-lg-pull-11 { | |
right: 91.66666667%; | |
} | |
.col-lg-pull-10 { | |
right: 83.33333333%; | |
} | |
.col-lg-pull-9 { | |
right: 75%; | |
} | |
.col-lg-pull-8 { | |
right: 66.66666667%; | |
} | |
.col-lg-pull-7 { | |
right: 58.33333333%; | |
} | |
.col-lg-pull-6 { | |
right: 50%; | |
} | |
.col-lg-pull-5 { | |
right: 41.66666667%; | |
} | |
.col-lg-pull-4 { | |
right: 33.33333333%; | |
} | |
.col-lg-pull-3 { | |
right: 25%; | |
} | |
.col-lg-pull-2 { | |
right: 16.66666667%; | |
} | |
.col-lg-pull-1 { | |
right: 8.33333333%; | |
} | |
.col-lg-pull-0 { | |
right: auto; | |
} | |
.col-lg-push-12 { | |
left: 100%; | |
} | |
.col-lg-push-11 { | |
left: 91.66666667%; | |
} | |
.col-lg-push-10 { | |
left: 83.33333333%; | |
} | |
.col-lg-push-9 { | |
left: 75%; | |
} | |
.col-lg-push-8 { | |
left: 66.66666667%; | |
} | |
.col-lg-push-7 { | |
left: 58.33333333%; | |
} | |
.col-lg-push-6 { | |
left: 50%; | |
} | |
.col-lg-push-5 { | |
left: 41.66666667%; | |
} | |
.col-lg-push-4 { | |
left: 33.33333333%; | |
} | |
.col-lg-push-3 { | |
left: 25%; | |
} | |
.col-lg-push-2 { | |
left: 16.66666667%; | |
} | |
.col-lg-push-1 { | |
left: 8.33333333%; | |
} | |
.col-lg-push-0 { | |
left: auto; | |
} | |
.col-lg-offset-12 { | |
margin-left: 100%; | |
} | |
.col-lg-offset-11 { | |
margin-left: 91.66666667%; | |
} | |
.col-lg-offset-10 { | |
margin-left: 83.33333333%; | |
} | |
.col-lg-offset-9 { | |
margin-left: 75%; | |
} | |
.col-lg-offset-8 { | |
margin-left: 66.66666667%; | |
} | |
.col-lg-offset-7 { | |
margin-left: 58.33333333%; | |
} | |
.col-lg-offset-6 { | |
margin-left: 50%; | |
} | |
.col-lg-offset-5 { | |
margin-left: 41.66666667%; | |
} | |
.col-lg-offset-4 { | |
margin-left: 33.33333333%; | |
} | |
.col-lg-offset-3 { | |
margin-left: 25%; | |
} | |
.col-lg-offset-2 { | |
margin-left: 16.66666667%; | |
} | |
.col-lg-offset-1 { | |
margin-left: 8.33333333%; | |
} | |
.col-lg-offset-0 { | |
margin-left: 0%; | |
} | |
} | |
table { | |
background-color: transparent; | |
} | |
caption { | |
padding-top: 8px; | |
padding-bottom: 8px; | |
color: #777777; | |
text-align: left; | |
} | |
th { | |
text-align: left; | |
} | |
.table { | |
width: 100%; | |
max-width: 100%; | |
margin-bottom: 18px; | |
} | |
.table > thead > tr > th, | |
.table > tbody > tr > th, | |
.table > tfoot > tr > th, | |
.table > thead > tr > td, | |
.table > tbody > tr > td, | |
.table > tfoot > tr > td { | |
padding: 8px; | |
line-height: 1.42857143; | |
vertical-align: top; | |
border-top: 1px solid #ddd; | |
} | |
.table > thead > tr > th { | |
vertical-align: bottom; | |
border-bottom: 2px solid #ddd; | |
} | |
.table > caption + thead > tr:first-child > th, | |
.table > colgroup + thead > tr:first-child > th, | |
.table > thead:first-child > tr:first-child > th, | |
.table > caption + thead > tr:first-child > td, | |
.table > colgroup + thead > tr:first-child > td, | |
.table > thead:first-child > tr:first-child > td { | |
border-top: 0; | |
} | |
.table > tbody + tbody { | |
border-top: 2px solid #ddd; | |
} | |
.table .table { | |
background-color: #fff; | |
} | |
.table-condensed > thead > tr > th, | |
.table-condensed > tbody > tr > th, | |
.table-condensed > tfoot > tr > th, | |
.table-condensed > thead > tr > td, | |
.table-condensed > tbody > tr > td, | |
.table-condensed > tfoot > tr > td { | |
padding: 5px; | |
} | |
.table-bordered { | |
border: 1px solid #ddd; | |
} | |
.table-bordered > thead > tr > th, | |
.table-bordered > tbody > tr > th, | |
.table-bordered > tfoot > tr > th, | |
.table-bordered > thead > tr > td, | |
.table-bordered > tbody > tr > td, | |
.table-bordered > tfoot > tr > td { | |
border: 1px solid #ddd; | |
} | |
.table-bordered > thead > tr > th, | |
.table-bordered > thead > tr > td { | |
border-bottom-width: 2px; | |
} | |
.table-striped > tbody > tr:nth-of-type(odd) { | |
background-color: #f9f9f9; | |
} | |
.table-hover > tbody > tr:hover { | |
background-color: #f5f5f5; | |
} | |
table col[class*="col-"] { | |
position: static; | |
float: none; | |
display: table-column; | |
} | |
table td[class*="col-"], | |
table th[class*="col-"] { | |
position: static; | |
float: none; | |
display: table-cell; | |
} | |
.table > thead > tr > td.active, | |
.table > tbody > tr > td.active, | |
.table > tfoot > tr > td.active, | |
.table > thead > tr > th.active, | |
.table > tbody > tr > th.active, | |
.table > tfoot > tr > th.active, | |
.table > thead > tr.active > td, | |
.table > tbody > tr.active > td, | |
.table > tfoot > tr.active > td, | |
.table > thead > tr.active > th, | |
.table > tbody > tr.active > th, | |
.table > tfoot > tr.active > th { | |
background-color: #f5f5f5; | |
} | |
.table-hover > tbody > tr > td.active:hover, | |
.table-hover > tbody > tr > th.active:hover, | |
.table-hover > tbody > tr.active:hover > td, | |
.table-hover > tbody > tr:hover > .active, | |
.table-hover > tbody > tr.active:hover > th { | |
background-color: #e8e8e8; | |
} | |
.table > thead > tr > td.success, | |
.table > tbody > tr > td.success, | |
.table > tfoot > tr > td.success, | |
.table > thead > tr > th.success, | |
.table > tbody > tr > th.success, | |
.table > tfoot > tr > th.success, | |
.table > thead > tr.success > td, | |
.table > tbody > tr.success > td, | |
.table > tfoot > tr.success > td, | |
.table > thead > tr.success > th, | |
.table > tbody > tr.success > th, | |
.table > tfoot > tr.success > th { | |
background-color: #dff0d8; | |
} | |
.table-hover > tbody > tr > td.success:hover, | |
.table-hover > tbody > tr > th.success:hover, | |
.table-hover > tbody > tr.success:hover > td, | |
.table-hover > tbody > tr:hover > .success, | |
.table-hover > tbody > tr.success:hover > th { | |
background-color: #d0e9c6; | |
} | |
.table > thead > tr > td.info, | |
.table > tbody > tr > td.info, | |
.table > tfoot > tr > td.info, | |
.table > thead > tr > th.info, | |
.table > tbody > tr > th.info, | |
.table > tfoot > tr > th.info, | |
.table > thead > tr.info > td, | |
.table > tbody > tr.info > td, | |
.table > tfoot > tr.info > td, | |
.table > thead > tr.info > th, | |
.table > tbody > tr.info > th, | |
.table > tfoot > tr.info > th { | |
background-color: #d9edf7; | |
} | |
.table-hover > tbody > tr > td.info:hover, | |
.table-hover > tbody > tr > th.info:hover, | |
.table-hover > tbody > tr.info:hover > td, | |
.table-hover > tbody > tr:hover > .info, | |
.table-hover > tbody > tr.info:hover > th { | |
background-color: #c4e3f3; | |
} | |
.table > thead > tr > td.warning, | |
.table > tbody > tr > td.warning, | |
.table > tfoot > tr > td.warning, | |
.table > thead > tr > th.warning, | |
.table > tbody > tr > th.warning, | |
.table > tfoot > tr > th.warning, | |
.table > thead > tr.warning > td, | |
.table > tbody > tr.warning > td, | |
.table > tfoot > tr.warning > td, | |
.table > thead > tr.warning > th, | |
.table > tbody > tr.warning > th, | |
.table > tfoot > tr.warning > th { | |
background-color: #fcf8e3; | |
} | |
.table-hover > tbody > tr > td.warning:hover, | |
.table-hover > tbody > tr > th.warning:hover, | |
.table-hover > tbody > tr.warning:hover > td, | |
.table-hover > tbody > tr:hover > .warning, | |
.table-hover > tbody > tr.warning:hover > th { | |
background-color: #faf2cc; | |
} | |
.table > thead > tr > td.danger, | |
.table > tbody > tr > td.danger, | |
.table > tfoot > tr > td.danger, | |
.table > thead > tr > th.danger, | |
.table > tbody > tr > th.danger, | |
.table > tfoot > tr > th.danger, | |
.table > thead > tr.danger > td, | |
.table > tbody > tr.danger > td, | |
.table > tfoot > tr.danger > td, | |
.table > thead > tr.danger > th, | |
.table > tbody > tr.danger > th, | |
.table > tfoot > tr.danger > th { | |
background-color: #f2dede; | |
} | |
.table-hover > tbody > tr > td.danger:hover, | |
.table-hover > tbody > tr > th.danger:hover, | |
.table-hover > tbody > tr.danger:hover > td, | |
.table-hover > tbody > tr:hover > .danger, | |
.table-hover > tbody > tr.danger:hover > th { | |
background-color: #ebcccc; | |
} | |
.table-responsive { | |
overflow-x: auto; | |
min-height: 0.01%; | |
} | |
@media screen and (max-width: 767px) { | |
.table-responsive { | |
width: 100%; | |
margin-bottom: 13.5px; | |
overflow-y: hidden; | |
-ms-overflow-style: -ms-autohiding-scrollbar; | |
border: 1px solid #ddd; | |
} | |
.table-responsive > .table { | |
margin-bottom: 0; | |
} | |
.table-responsive > .table > thead > tr > th, | |
.table-responsive > .table > tbody > tr > th, | |
.table-responsive > .table > tfoot > tr > th, | |
.table-responsive > .table > thead > tr > td, | |
.table-responsive > .table > tbody > tr > td, | |
.table-responsive > .table > tfoot > tr > td { | |
white-space: nowrap; | |
} | |
.table-responsive > .table-bordered { | |
border: 0; | |
} | |
.table-responsive > .table-bordered > thead > tr > th:first-child, | |
.table-responsive > .table-bordered > tbody > tr > th:first-child, | |
.table-responsive > .table-bordered > tfoot > tr > th:first-child, | |
.table-responsive > .table-bordered > thead > tr > td:first-child, | |
.table-responsive > .table-bordered > tbody > tr > td:first-child, | |
.table-responsive > .table-bordered > tfoot > tr > td:first-child { | |
border-left: 0; | |
} | |
.table-responsive > .table-bordered > thead > tr > th:last-child, | |
.table-responsive > .table-bordered > tbody > tr > th:last-child, | |
.table-responsive > .table-bordered > tfoot > tr > th:last-child, | |
.table-responsive > .table-bordered > thead > tr > td:last-child, | |
.table-responsive > .table-bordered > tbody > tr > td:last-child, | |
.table-responsive > .table-bordered > tfoot > tr > td:last-child { | |
border-right: 0; | |
} | |
.table-responsive > .table-bordered > tbody > tr:last-child > th, | |
.table-responsive > .table-bordered > tfoot > tr:last-child > th, | |
.table-responsive > .table-bordered > tbody > tr:last-child > td, | |
.table-responsive > .table-bordered > tfoot > tr:last-child > td { | |
border-bottom: 0; | |
} | |
} | |
fieldset { | |
padding: 0; | |
margin: 0; | |
border: 0; | |
min-width: 0; | |
} | |
legend { | |
display: block; | |
width: 100%; | |
padding: 0; | |
margin-bottom: 18px; | |
font-size: 19.5px; | |
line-height: inherit; | |
color: #333333; | |
border: 0; | |
border-bottom: 1px solid #e5e5e5; | |
} | |
label { | |
display: inline-block; | |
max-width: 100%; | |
margin-bottom: 5px; | |
font-weight: bold; | |
} | |
input[type="search"] { | |
-webkit-box-sizing: border-box; | |
-moz-box-sizing: border-box; | |
box-sizing: border-box; | |
} | |
input[type="radio"], | |
input[type="checkbox"] { | |
margin: 4px 0 0; | |
margin-top: 1px \9; | |
line-height: normal; | |
} | |
input[type="file"] { | |
display: block; | |
} | |
input[type="range"] { | |
display: block; | |
width: 100%; | |
} | |
select[multiple], | |
select[size] { | |
height: auto; | |
} | |
input[type="file"]:focus, | |
input[type="radio"]:focus, | |
input[type="checkbox"]:focus { | |
outline: 5px auto -webkit-focus-ring-color; | |
outline-offset: -2px; | |
} | |
output { | |
display: block; | |
padding-top: 7px; | |
font-size: 13px; | |
line-height: 1.42857143; | |
color: #555555; | |
} | |
.form-control { | |
display: block; | |
width: 100%; | |
height: 32px; | |
padding: 6px 12px; | |
font-size: 13px; | |
line-height: 1.42857143; | |
color: #555555; | |
background-color: #fff; | |
background-image: none; | |
border: 1px solid #ccc; | |
border-radius: 2px; | |
-webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); | |
box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); | |
-webkit-transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s; | |
-o-transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s; | |
transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s; | |
} | |
.form-control:focus { | |
border-color: #66afe9; | |
outline: 0; | |
-webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 8px rgba(102, 175, 233, 0.6); | |
box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 8px rgba(102, 175, 233, 0.6); | |
} | |
.form-control::-moz-placeholder { | |
color: #999; | |
opacity: 1; | |
} | |
.form-control:-ms-input-placeholder { | |
color: #999; | |
} | |
.form-control::-webkit-input-placeholder { | |
color: #999; | |
} | |
.form-control::-ms-expand { | |
border: 0; | |
background-color: transparent; | |
} | |
.form-control[disabled], | |
.form-control[readonly], | |
fieldset[disabled] .form-control { | |
background-color: #eeeeee; | |
opacity: 1; | |
} | |
.form-control[disabled], | |
fieldset[disabled] .form-control { | |
cursor: not-allowed; | |
} | |
textarea.form-control { | |
height: auto; | |
} | |
input[type="search"] { | |
-webkit-appearance: none; | |
} | |
@media screen and (-webkit-min-device-pixel-ratio: 0) { | |
input[type="date"].form-control, | |
input[type="time"].form-control, | |
input[type="datetime-local"].form-control, | |
input[type="month"].form-control { | |
line-height: 32px; | |
} | |
input[type="date"].input-sm, | |
input[type="time"].input-sm, | |
input[type="datetime-local"].input-sm, | |
input[type="month"].input-sm, | |
.input-group-sm input[type="date"], | |
.input-group-sm input[type="time"], | |
.input-group-sm input[type="datetime-local"], | |
.input-group-sm input[type="month"] { | |
line-height: 30px; | |
} | |
input[type="date"].input-lg, | |
input[type="time"].input-lg, | |
input[type="datetime-local"].input-lg, | |
input[type="month"].input-lg, | |
.input-group-lg input[type="date"], | |
.input-group-lg input[type="time"], | |
.input-group-lg input[type="datetime-local"], | |
.input-group-lg input[type="month"] { | |
line-height: 45px; | |
} | |
} | |
.form-group { | |
margin-bottom: 15px; | |
} | |
.radio, | |
.checkbox { | |
position: relative; | |
display: block; | |
margin-top: 10px; | |
margin-bottom: 10px; | |
} | |
.radio label, | |
.checkbox label { | |
min-height: 18px; | |
padding-left: 20px; | |
margin-bottom: 0; | |
font-weight: normal; | |
cursor: pointer; | |
} | |
.radio input[type="radio"], | |
.radio-inline input[type="radio"], | |
.checkbox input[type="checkbox"], | |
.checkbox-inline input[type="checkbox"] { | |
position: absolute; | |
margin-left: -20px; | |
margin-top: 4px \9; | |
} | |
.radio + .radio, | |
.checkbox + .checkbox { | |
margin-top: -5px; | |
} | |
.radio-inline, | |
.checkbox-inline { | |
position: relative; | |
display: inline-block; | |
padding-left: 20px; | |
margin-bottom: 0; | |
vertical-align: middle; | |
font-weight: normal; | |
cursor: pointer; | |
} | |
.radio-inline + .radio-inline, | |
.checkbox-inline + .checkbox-inline { | |
margin-top: 0; | |
margin-left: 10px; | |
} | |
input[type="radio"][disabled], | |
input[type="checkbox"][disabled], | |
input[type="radio"].disabled, | |
input[type="checkbox"].disabled, | |
fieldset[disabled] input[type="radio"], | |
fieldset[disabled] input[type="checkbox"] { | |
cursor: not-allowed; | |
} | |
.radio-inline.disabled, | |
.checkbox-inline.disabled, | |
fieldset[disabled] .radio-inline, | |
fieldset[disabled] .checkbox-inline { | |
cursor: not-allowed; | |
} | |
.radio.disabled label, | |
.checkbox.disabled label, | |
fieldset[disabled] .radio label, | |
fieldset[disabled] .checkbox label { | |
cursor: not-allowed; | |
} | |
.form-control-static { | |
padding-top: 7px; | |
padding-bottom: 7px; | |
margin-bottom: 0; | |
min-height: 31px; | |
} | |
.form-control-static.input-lg, | |
.form-control-static.input-sm { | |
padding-left: 0; | |
padding-right: 0; | |
} | |
.input-sm { | |
height: 30px; | |
padding: 5px 10px; | |
font-size: 12px; | |
line-height: 1.5; | |
border-radius: 1px; | |
} | |
select.input-sm { | |
height: 30px; | |
line-height: 30px; | |
} | |
textarea.input-sm, | |
select[multiple].input-sm { | |
height: auto; | |
} | |
.form-group-sm .form-control { | |
height: 30px; | |
padding: 5px 10px; | |
font-size: 12px; | |
line-height: 1.5; | |
border-radius: 1px; | |
} | |
.form-group-sm select.form-control { | |
height: 30px; | |
line-height: 30px; | |
} | |
.form-group-sm textarea.form-control, | |
.form-group-sm select[multiple].form-control { | |
height: auto; | |
} | |
.form-group-sm .form-control-static { | |
height: 30px; | |
min-height: 30px; | |
padding: 6px 10px; | |
font-size: 12px; | |
line-height: 1.5; | |
} | |
.input-lg { | |
height: 45px; | |
padding: 10px 16px; | |
font-size: 17px; | |
line-height: 1.3333333; | |
border-radius: 3px; | |
} | |
select.input-lg { | |
height: 45px; | |
line-height: 45px; | |
} | |
textarea.input-lg, | |
select[multiple].input-lg { | |
height: auto; | |
} | |
.form-group-lg .form-control { | |
height: 45px; | |
padding: 10px 16px; | |
font-size: 17px; | |
line-height: 1.3333333; | |
border-radius: 3px; | |
} | |
.form-group-lg select.form-control { | |
height: 45px; | |
line-height: 45px; | |
} | |
.form-group-lg textarea.form-control, | |
.form-group-lg select[multiple].form-control { | |
height: auto; | |
} | |
.form-group-lg .form-control-static { | |
height: 45px; | |
min-height: 35px; | |
padding: 11px 16px; | |
font-size: 17px; | |
line-height: 1.3333333; | |
} | |
.has-feedback { | |
position: relative; | |
} | |
.has-feedback .form-control { | |
padding-right: 40px; | |
} | |
.form-control-feedback { | |
position: absolute; | |
top: 0; | |
right: 0; | |
z-index: 2; | |
display: block; | |
width: 32px; | |
height: 32px; | |
line-height: 32px; | |
text-align: center; | |
pointer-events: none; | |
} | |
.input-lg + .form-control-feedback, | |
.input-group-lg + .form-control-feedback, | |
.form-group-lg .form-control + .form-control-feedback { | |
width: 45px; | |
height: 45px; | |
line-height: 45px; | |
} | |
.input-sm + .form-control-feedback, | |
.input-group-sm + .form-control-feedback, | |
.form-group-sm .form-control + .form-control-feedback { | |
width: 30px; | |
height: 30px; | |
line-height: 30px; | |
} | |
.has-success .help-block, | |
.has-success .control-label, | |
.has-success .radio, | |
.has-success .checkbox, | |
.has-success .radio-inline, | |
.has-success .checkbox-inline, | |
.has-success.radio label, | |
.has-success.checkbox label, | |
.has-success.radio-inline label, | |
.has-success.checkbox-inline label { | |
color: #3c763d; | |
} | |
.has-success .form-control { | |
border-color: #3c763d; | |
-webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); | |
box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); | |
} | |
.has-success .form-control:focus { | |
border-color: #2b542c; | |
-webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #67b168; | |
box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #67b168; | |
} | |
.has-success .input-group-addon { | |
color: #3c763d; | |
border-color: #3c763d; | |
background-color: #dff0d8; | |
} | |
.has-success .form-control-feedback { | |
color: #3c763d; | |
} | |
.has-warning .help-block, | |
.has-warning .control-label, | |
.has-warning .radio, | |
.has-warning .checkbox, | |
.has-warning .radio-inline, | |
.has-warning .checkbox-inline, | |
.has-warning.radio label, | |
.has-warning.checkbox label, | |
.has-warning.radio-inline label, | |
.has-warning.checkbox-inline label { | |
color: #8a6d3b; | |
} | |
.has-warning .form-control { | |
border-color: #8a6d3b; | |
-webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); | |
box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); | |
} | |
.has-warning .form-control:focus { | |
border-color: #66512c; | |
-webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #c0a16b; | |
box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #c0a16b; | |
} | |
.has-warning .input-group-addon { | |
color: #8a6d3b; | |
border-color: #8a6d3b; | |
background-color: #fcf8e3; | |
} | |
.has-warning .form-control-feedback { | |
color: #8a6d3b; | |
} | |
.has-error .help-block, | |
.has-error .control-label, | |
.has-error .radio, | |
.has-error .checkbox, | |
.has-error .radio-inline, | |
.has-error .checkbox-inline, | |
.has-error.radio label, | |
.has-error.checkbox label, | |
.has-error.radio-inline label, | |
.has-error.checkbox-inline label { | |
color: #a94442; | |
} | |
.has-error .form-control { | |
border-color: #a94442; | |
-webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); | |
box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); | |
} | |
.has-error .form-control:focus { | |
border-color: #843534; | |
-webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #ce8483; | |
box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #ce8483; | |
} | |
.has-error .input-group-addon { | |
color: #a94442; | |
border-color: #a94442; | |
background-color: #f2dede; | |
} | |
.has-error .form-control-feedback { | |
color: #a94442; | |
} | |
.has-feedback label ~ .form-control-feedback { | |
top: 23px; | |
} | |
.has-feedback label.sr-only ~ .form-control-feedback { | |
top: 0; | |
} | |
.help-block { | |
display: block; | |
margin-top: 5px; | |
margin-bottom: 10px; | |
color: #404040; | |
} | |
@media (min-width: 768px) { | |
.form-inline .form-group { | |
display: inline-block; | |
margin-bottom: 0; | |
vertical-align: middle; | |
} | |
.form-inline .form-control { | |
display: inline-block; | |
width: auto; | |
vertical-align: middle; | |
} | |
.form-inline .form-control-static { | |
display: inline-block; | |
} | |
.form-inline .input-group { | |
display: inline-table; | |
vertical-align: middle; | |
} | |
.form-inline .input-group .input-group-addon, | |
.form-inline .input-group .input-group-btn, | |
.form-inline .input-group .form-control { | |
width: auto; | |
} | |
.form-inline .input-group > .form-control { | |
width: 100%; | |
} | |
.form-inline .control-label { | |
margin-bottom: 0; | |
vertical-align: middle; | |
} | |
.form-inline .radio, | |
.form-inline .checkbox { | |
display: inline-block; | |
margin-top: 0; | |
margin-bottom: 0; | |
vertical-align: middle; | |
} | |
.form-inline .radio label, | |
.form-inline .checkbox label { | |
padding-left: 0; | |
} | |
.form-inline .radio input[type="radio"], | |
.form-inline .checkbox input[type="checkbox"] { | |
position: relative; | |
margin-left: 0; | |
} | |
.form-inline .has-feedback .form-control-feedback { | |
top: 0; | |
} | |
} | |
.form-horizontal .radio, | |
.form-horizontal .checkbox, | |
.form-horizontal .radio-inline, | |
.form-horizontal .checkbox-inline { | |
margin-top: 0; | |
margin-bottom: 0; | |
padding-top: 7px; | |
} | |
.form-horizontal .radio, | |
.form-horizontal .checkbox { | |
min-height: 25px; | |
} | |
.form-horizontal .form-group { | |
margin-left: 0px; | |
margin-right: 0px; | |
} | |
@media (min-width: 768px) { | |
.form-horizontal .control-label { | |
text-align: right; | |
margin-bottom: 0; | |
padding-top: 7px; | |
} | |
} | |
.form-horizontal .has-feedback .form-control-feedback { | |
right: 0px; | |
} | |
@media (min-width: 768px) { | |
.form-horizontal .form-group-lg .control-label { | |
padding-top: 11px; | |
font-size: 17px; | |
} | |
} | |
@media (min-width: 768px) { | |
.form-horizontal .form-group-sm .control-label { | |
padding-top: 6px; | |
font-size: 12px; | |
} | |
} | |
.btn { | |
display: inline-block; | |
margin-bottom: 0; | |
font-weight: normal; | |
text-align: center; | |
vertical-align: middle; | |
touch-action: manipulation; | |
cursor: pointer; | |
background-image: none; | |
border: 1px solid transparent; | |
white-space: nowrap; | |
padding: 6px 12px; | |
font-size: 13px; | |
line-height: 1.42857143; | |
border-radius: 2px; | |
-webkit-user-select: none; | |
-moz-user-select: none; | |
-ms-user-select: none; | |
user-select: none; | |
} | |
.btn:focus, | |
.btn:active:focus, | |
.btn.active:focus, | |
.btn.focus, | |
.btn:active.focus, | |
.btn.active.focus { | |
outline: 5px auto -webkit-focus-ring-color; | |
outline-offset: -2px; | |
} | |
.btn:hover, | |
.btn:focus, | |
.btn.focus { | |
color: #333; | |
text-decoration: none; | |
} | |
.btn:active, | |
.btn.active { | |
outline: 0; | |
background-image: none; | |
-webkit-box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); | |
box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); | |
} | |
.btn.disabled, | |
.btn[disabled], | |
fieldset[disabled] .btn { | |
cursor: not-allowed; | |
opacity: 0.65; | |
filter: alpha(opacity=65); | |
-webkit-box-shadow: none; | |
box-shadow: none; | |
} | |
a.btn.disabled, | |
fieldset[disabled] a.btn { | |
pointer-events: none; | |
} | |
.btn-default { | |
color: #333; | |
background-color: #fff; | |
border-color: #ccc; | |
} | |
.btn-default:focus, | |
.btn-default.focus { | |
color: #333; | |
background-color: #e6e6e6; | |
border-color: #8c8c8c; | |
} | |
.btn-default:hover { | |
color: #333; | |
background-color: #e6e6e6; | |
border-color: #adadad; | |
} | |
.btn-default:active, | |
.btn-default.active, | |
.open > .dropdown-toggle.btn-default { | |
color: #333; | |
background-color: #e6e6e6; | |
border-color: #adadad; | |
} | |
.btn-default:active:hover, | |
.btn-default.active:hover, | |
.open > .dropdown-toggle.btn-default:hover, | |
.btn-default:active:focus, | |
.btn-default.active:focus, | |
.open > .dropdown-toggle.btn-default:focus, | |
.btn-default:active.focus, | |
.btn-default.active.focus, | |
.open > .dropdown-toggle.btn-default.focus { | |
color: #333; | |
background-color: #d4d4d4; | |
border-color: #8c8c8c; | |
} | |
.btn-default:active, | |
.btn-default.active, | |
.open > .dropdown-toggle.btn-default { | |
background-image: none; | |
} | |
.btn-default.disabled:hover, | |
.btn-default[disabled]:hover, | |
fieldset[disabled] .btn-default:hover, | |
.btn-default.disabled:focus, | |
.btn-default[disabled]:focus, | |
fieldset[disabled] .btn-default:focus, | |
.btn-default.disabled.focus, | |
.btn-default[disabled].focus, | |
fieldset[disabled] .btn-default.focus { | |
background-color: #fff; | |
border-color: #ccc; | |
} | |
.btn-default .badge { | |
color: #fff; | |
background-color: #333; | |
} | |
.btn-primary { | |
color: #fff; | |
background-color: #337ab7; | |
border-color: #2e6da4; | |
} | |
.btn-primary:focus, | |
.btn-primary.focus { | |
color: #fff; | |
background-color: #286090; | |
border-color: #122b40; | |
} | |
.btn-primary:hover { | |
color: #fff; | |
background-color: #286090; | |
border-color: #204d74; | |
} | |
.btn-primary:active, | |
.btn-primary.active, | |
.open > .dropdown-toggle.btn-primary { | |
color: #fff; | |
background-color: #286090; | |
border-color: #204d74; | |
} | |
.btn-primary:active:hover, | |
.btn-primary.active:hover, | |
.open > .dropdown-toggle.btn-primary:hover, | |
.btn-primary:active:focus, | |
.btn-primary.active:focus, | |
.open > .dropdown-toggle.btn-primary:focus, | |
.btn-primary:active.focus, | |
.btn-primary.active.focus, | |
.open > .dropdown-toggle.btn-primary.focus { | |
color: #fff; | |
background-color: #204d74; | |
border-color: #122b40; | |
} | |
.btn-primary:active, | |
.btn-primary.active, | |
.open > .dropdown-toggle.btn-primary { | |
background-image: none; | |
} | |
.btn-primary.disabled:hover, | |
.btn-primary[disabled]:hover, | |
fieldset[disabled] .btn-primary:hover, | |
.btn-primary.disabled:focus, | |
.btn-primary[disabled]:focus, | |
fieldset[disabled] .btn-primary:focus, | |
.btn-primary.disabled.focus, | |
.btn-primary[disabled].focus, | |
fieldset[disabled] .btn-primary.focus { | |
background-color: #337ab7; | |
border-color: #2e6da4; | |
} | |
.btn-primary .badge { | |
color: #337ab7; | |
background-color: #fff; | |
} | |
.btn-success { | |
color: #fff; | |
background-color: #5cb85c; | |
border-color: #4cae4c; | |
} | |
.btn-success:focus, | |
.btn-success.focus { | |
color: #fff; | |
background-color: #449d44; | |
border-color: #255625; | |
} | |
.btn-success:hover { | |
color: #fff; | |
background-color: #449d44; | |
border-color: #398439; | |
} | |
.btn-success:active, | |
.btn-success.active, | |
.open > .dropdown-toggle.btn-success { | |
color: #fff; | |
background-color: #449d44; | |
border-color: #398439; | |
} | |
.btn-success:active:hover, | |
.btn-success.active:hover, | |
.open > .dropdown-toggle.btn-success:hover, | |
.btn-success:active:focus, | |
.btn-success.active:focus, | |
.open > .dropdown-toggle.btn-success:focus, | |
.btn-success:active.focus, | |
.btn-success.active.focus, | |
.open > .dropdown-toggle.btn-success.focus { | |
color: #fff; | |
background-color: #398439; | |
border-color: #255625; | |
} | |
.btn-success:active, | |
.btn-success.active, | |
.open > .dropdown-toggle.btn-success { | |
background-image: none; | |
} | |
.btn-success.disabled:hover, | |
.btn-success[disabled]:hover, | |
fieldset[disabled] .btn-success:hover, | |
.btn-success.disabled:focus, | |
.btn-success[disabled]:focus, | |
fieldset[disabled] .btn-success:focus, | |
.btn-success.disabled.focus, | |
.btn-success[disabled].focus, | |
fieldset[disabled] .btn-success.focus { | |
background-color: #5cb85c; | |
border-color: #4cae4c; | |
} | |
.btn-success .badge { | |
color: #5cb85c; | |
background-color: #fff; | |
} | |
.btn-info { | |
color: #fff; | |
background-color: #5bc0de; | |
border-color: #46b8da; | |
} | |
.btn-info:focus, | |
.btn-info.focus { | |
color: #fff; | |
background-color: #31b0d5; | |
border-color: #1b6d85; | |
} | |
.btn-info:hover { | |
color: #fff; | |
background-color: #31b0d5; | |
border-color: #269abc; | |
} | |
.btn-info:active, | |
.btn-info.active, | |
.open > .dropdown-toggle.btn-info { | |
color: #fff; | |
background-color: #31b0d5; | |
border-color: #269abc; | |
} | |
.btn-info:active:hover, | |
.btn-info.active:hover, | |
.open > .dropdown-toggle.btn-info:hover, | |
.btn-info:active:focus, | |
.btn-info.active:focus, | |
.open > .dropdown-toggle.btn-info:focus, | |
.btn-info:active.focus, | |
.btn-info.active.focus, | |
.open > .dropdown-toggle.btn-info.focus { | |
color: #fff; | |
background-color: #269abc; | |
border-color: #1b6d85; | |
} | |
.btn-info:active, | |
.btn-info.active, | |
.open > .dropdown-toggle.btn-info { | |
background-image: none; | |
} | |
.btn-info.disabled:hover, | |
.btn-info[disabled]:hover, | |
fieldset[disabled] .btn-info:hover, | |
.btn-info.disabled:focus, | |
.btn-info[disabled]:focus, | |
fieldset[disabled] .btn-info:focus, | |
.btn-info.disabled.focus, | |
.btn-info[disabled].focus, | |
fieldset[disabled] .btn-info.focus { | |
background-color: #5bc0de; | |
border-color: #46b8da; | |
} | |
.btn-info .badge { | |
color: #5bc0de; | |
background-color: #fff; | |
} | |
.btn-warning { | |
color: #fff; | |
background-color: #f0ad4e; | |
border-color: #eea236; | |
} | |
.btn-warning:focus, | |
.btn-warning.focus { | |
color: #fff; | |
background-color: #ec971f; | |
border-color: #985f0d; | |
} | |
.btn-warning:hover { | |
color: #fff; | |
background-color: #ec971f; | |
border-color: #d58512; | |
} | |
.btn-warning:active, | |
.btn-warning.active, | |
.open > .dropdown-toggle.btn-warning { | |
color: #fff; | |
background-color: #ec971f; | |
border-color: #d58512; | |
} | |
.btn-warning:active:hover, | |
.btn-warning.active:hover, | |
.open > .dropdown-toggle.btn-warning:hover, | |
.btn-warning:active:focus, | |
.btn-warning.active:focus, | |
.open > .dropdown-toggle.btn-warning:focus, | |
.btn-warning:active.focus, | |
.btn-warning.active.focus, | |
.open > .dropdown-toggle.btn-warning.focus { | |
color: #fff; | |
background-color: #d58512; | |
border-color: #985f0d; | |
} | |
.btn-warning:active, | |
.btn-warning.active, | |
.open > .dropdown-toggle.btn-warning { | |
background-image: none; | |
} | |
.btn-warning.disabled:hover, | |
.btn-warning[disabled]:hover, | |
fieldset[disabled] .btn-warning:hover, | |
.btn-warning.disabled:focus, | |
.btn-warning[disabled]:focus, | |
fieldset[disabled] .btn-warning:focus, | |
.btn-warning.disabled.focus, | |
.btn-warning[disabled].focus, | |
fieldset[disabled] .btn-warning.focus { | |
background-color: #f0ad4e; | |
border-color: #eea236; | |
} | |
.btn-warning .badge { | |
color: #f0ad4e; | |
background-color: #fff; | |
} | |
.btn-danger { | |
color: #fff; | |
background-color: #d9534f; | |
border-color: #d43f3a; | |
} | |
.btn-danger:focus, | |
.btn-danger.focus { | |
color: #fff; | |
background-color: #c9302c; | |
border-color: #761c19; | |
} | |
.btn-danger:hover { | |
color: #fff; | |
background-color: #c9302c; | |
border-color: #ac2925; | |
} | |
.btn-danger:active, | |
.btn-danger.active, | |
.open > .dropdown-toggle.btn-danger { | |
color: #fff; | |
background-color: #c9302c; | |
border-color: #ac2925; | |
} | |
.btn-danger:active:hover, | |
.btn-danger.active:hover, | |
.open > .dropdown-toggle.btn-danger:hover, | |
.btn-danger:active:focus, | |
.btn-danger.active:focus, | |
.open > .dropdown-toggle.btn-danger:focus, | |
.btn-danger:active.focus, | |
.btn-danger.active.focus, | |
.open > .dropdown-toggle.btn-danger.focus { | |
color: #fff; | |
background-color: #ac2925; | |
border-color: #761c19; | |
} | |
.btn-danger:active, | |
.btn-danger.active, | |
.open > .dropdown-toggle.btn-danger { | |
background-image: none; | |
} | |
.btn-danger.disabled:hover, | |
.btn-danger[disabled]:hover, | |
fieldset[disabled] .btn-danger:hover, | |
.btn-danger.disabled:focus, | |
.btn-danger[disabled]:focus, | |
fieldset[disabled] .btn-danger:focus, | |
.btn-danger.disabled.focus, | |
.btn-danger[disabled].focus, | |
fieldset[disabled] .btn-danger.focus { | |
background-color: #d9534f; | |
border-color: #d43f3a; | |
} | |
.btn-danger .badge { | |
color: #d9534f; | |
background-color: #fff; | |
} | |
.btn-link { | |
color: #337ab7; | |
font-weight: normal; | |
border-radius: 0; | |
} | |
.btn-link, | |
.btn-link:active, | |
.btn-link.active, | |
.btn-link[disabled], | |
fieldset[disabled] .btn-link { | |
background-color: transparent; | |
-webkit-box-shadow: none; | |
box-shadow: none; | |
} | |
.btn-link, | |
.btn-link:hover, | |
.btn-link:focus, | |
.btn-link:active { | |
border-color: transparent; | |
} | |
.btn-link:hover, | |
.btn-link:focus { | |
color: #23527c; | |
text-decoration: underline; | |
background-color: transparent; | |
} | |
.btn-link[disabled]:hover, | |
fieldset[disabled] .btn-link:hover, | |
.btn-link[disabled]:focus, | |
fieldset[disabled] .btn-link:focus { | |
color: #777777; | |
text-decoration: none; | |
} | |
.btn-lg, | |
.btn-group-lg > .btn { | |
padding: 10px 16px; | |
font-size: 17px; | |
line-height: 1.3333333; | |
border-radius: 3px; | |
} | |
.btn-sm, | |
.btn-group-sm > .btn { | |
padding: 5px 10px; | |
font-size: 12px; | |
line-height: 1.5; | |
border-radius: 1px; | |
} | |
.btn-xs, | |
.btn-group-xs > .btn { | |
padding: 1px 5px; | |
font-size: 12px; | |
line-height: 1.5; | |
border-radius: 1px; | |
} | |
.btn-block { | |
display: block; | |
width: 100%; | |
} | |
.btn-block + .btn-block { | |
margin-top: 5px; | |
} | |
input[type="submit"].btn-block, | |
input[type="reset"].btn-block, | |
input[type="button"].btn-block { | |
width: 100%; | |
} | |
.fade { | |
opacity: 0; | |
-webkit-transition: opacity 0.15s linear; | |
-o-transition: opacity 0.15s linear; | |
transition: opacity 0.15s linear; | |
} | |
.fade.in { | |
opacity: 1; | |
} | |
.collapse { | |
display: none; | |
} | |
.collapse.in { | |
display: block; | |
} | |
tr.collapse.in { | |
display: table-row; | |
} | |
tbody.collapse.in { | |
display: table-row-group; | |
} | |
.collapsing { | |
position: relative; | |
height: 0; | |
overflow: hidden; | |
-webkit-transition-property: height, visibility; | |
transition-property: height, visibility; | |
-webkit-transition-duration: 0.35s; | |
transition-duration: 0.35s; | |
-webkit-transition-timing-function: ease; | |
transition-timing-function: ease; | |
} | |
.caret { | |
display: inline-block; | |
width: 0; | |
height: 0; | |
margin-left: 2px; | |
vertical-align: middle; | |
border-top: 4px dashed; | |
border-top: 4px solid \9; | |
border-right: 4px solid transparent; | |
border-left: 4px solid transparent; | |
} | |
.dropup, | |
.dropdown { | |
position: relative; | |
} | |
.dropdown-toggle:focus { | |
outline: 0; | |
} | |
.dropdown-menu { | |
position: absolute; | |
top: 100%; | |
left: 0; | |
z-index: 1000; | |
display: none; | |
float: left; | |
min-width: 160px; | |
padding: 5px 0; | |
margin: 2px 0 0; | |
list-style: none; | |
font-size: 13px; | |
text-align: left; | |
background-color: #fff; | |
border: 1px solid #ccc; | |
border: 1px solid rgba(0, 0, 0, 0.15); | |
border-radius: 2px; | |
-webkit-box-shadow: 0 6px 12px rgba(0, 0, 0, 0.175); | |
box-shadow: 0 6px 12px rgba(0, 0, 0, 0.175); | |
background-clip: padding-box; | |
} | |
.dropdown-menu.pull-right { | |
right: 0; | |
left: auto; | |
} | |
.dropdown-menu .divider { | |
height: 1px; | |
margin: 8px 0; | |
overflow: hidden; | |
background-color: #e5e5e5; | |
} | |
.dropdown-menu > li > a { | |
display: block; | |
padding: 3px 20px; | |
clear: both; | |
font-weight: normal; | |
line-height: 1.42857143; | |
color: #333333; | |
white-space: nowrap; | |
} | |
.dropdown-menu > li > a:hover, | |
.dropdown-menu > li > a:focus { | |
text-decoration: none; | |
color: #262626; | |
background-color: #f5f5f5; | |
} | |
.dropdown-menu > .active > a, | |
.dropdown-menu > .active > a:hover, | |
.dropdown-menu > .active > a:focus { | |
color: #fff; | |
text-decoration: none; | |
outline: 0; | |
background-color: #337ab7; | |
} | |
.dropdown-menu > .disabled > a, | |
.dropdown-menu > .disabled > a:hover, | |
.dropdown-menu > .disabled > a:focus { | |
color: #777777; | |
} | |
.dropdown-menu > .disabled > a:hover, | |
.dropdown-menu > .disabled > a:focus { | |
text-decoration: none; | |
background-color: transparent; | |
background-image: none; | |
filter: progid:DXImageTransform.Microsoft.gradient(enabled = false); | |
cursor: not-allowed; | |
} | |
.open > .dropdown-menu { | |
display: block; | |
} | |
.open > a { | |
outline: 0; | |
} | |
.dropdown-menu-right { | |
left: auto; | |
right: 0; | |
} | |
.dropdown-menu-left { | |
left: 0; | |
right: auto; | |
} | |
.dropdown-header { | |
display: block; | |
padding: 3px 20px; | |
font-size: 12px; | |
line-height: 1.42857143; | |
color: #777777; | |
white-space: nowrap; | |
} | |
.dropdown-backdrop { | |
position: fixed; | |
left: 0; | |
right: 0; | |
bottom: 0; | |
top: 0; | |
z-index: 990; | |
} | |
.pull-right > .dropdown-menu { | |
right: 0; | |
left: auto; | |
} | |
.dropup .caret, | |
.navbar-fixed-bottom .dropdown .caret { | |
border-top: 0; | |
border-bottom: 4px dashed; | |
border-bottom: 4px solid \9; | |
content: ""; | |
} | |
.dropup .dropdown-menu, | |
.navbar-fixed-bottom .dropdown .dropdown-menu { | |
top: auto; | |
bottom: 100%; | |
margin-bottom: 2px; | |
} | |
@media (min-width: 541px) { | |
.navbar-right .dropdown-menu { | |
left: auto; | |
right: 0; | |
} | |
.navbar-right .dropdown-menu-left { | |
left: 0; | |
right: auto; | |
} | |
} | |
.btn-group, | |
.btn-group-vertical { | |
position: relative; | |
display: inline-block; | |
vertical-align: middle; | |
} | |
.btn-group > .btn, | |
.btn-group-vertical > .btn { | |
position: relative; | |
float: left; | |
} | |
.btn-group > .btn:hover, | |
.btn-group-vertical > .btn:hover, | |
.btn-group > .btn:focus, | |
.btn-group-vertical > .btn:focus, | |
.btn-group > .btn:active, | |
.btn-group-vertical > .btn:active, | |
.btn-group > .btn.active, | |
.btn-group-vertical > .btn.active { | |
z-index: 2; | |
} | |
.btn-group .btn + .btn, | |
.btn-group .btn + .btn-group, | |
.btn-group .btn-group + .btn, | |
.btn-group .btn-group + .btn-group { | |
margin-left: -1px; | |
} | |
.btn-toolbar { | |
margin-left: -5px; | |
} | |
.btn-toolbar .btn, | |
.btn-toolbar .btn-group, | |
.btn-toolbar .input-group { | |
float: left; | |
} | |
.btn-toolbar > .btn, | |
.btn-toolbar > .btn-group, | |
.btn-toolbar > .input-group { | |
margin-left: 5px; | |
} | |
.btn-group > .btn:not(:first-child):not(:last-child):not(.dropdown-toggle) { | |
border-radius: 0; | |
} | |
.btn-group > .btn:first-child { | |
margin-left: 0; | |
} | |
.btn-group > .btn:first-child:not(:last-child):not(.dropdown-toggle) { | |
border-bottom-right-radius: 0; | |
border-top-right-radius: 0; | |
} | |
.btn-group > .btn:last-child:not(:first-child), | |
.btn-group > .dropdown-toggle:not(:first-child) { | |
border-bottom-left-radius: 0; | |
border-top-left-radius: 0; | |
} | |
.btn-group > .btn-group { | |
float: left; | |
} | |
.btn-group > .btn-group:not(:first-child):not(:last-child) > .btn { | |
border-radius: 0; | |
} | |
.btn-group > .btn-group:first-child:not(:last-child) > .btn:last-child, | |
.btn-group > .btn-group:first-child:not(:last-child) > .dropdown-toggle { | |
border-bottom-right-radius: 0; | |
border-top-right-radius: 0; | |
} | |
.btn-group > .btn-group:last-child:not(:first-child) > .btn:first-child { | |
border-bottom-left-radius: 0; | |
border-top-left-radius: 0; | |
} | |
.btn-group .dropdown-toggle:active, | |
.btn-group.open .dropdown-toggle { | |
outline: 0; | |
} | |
.btn-group > .btn + .dropdown-toggle { | |
padding-left: 8px; | |
padding-right: 8px; | |
} | |
.btn-group > .btn-lg + .dropdown-toggle { | |
padding-left: 12px; | |
padding-right: 12px; | |
} | |
.btn-group.open .dropdown-toggle { | |
-webkit-box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); | |
box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); | |
} | |
.btn-group.open .dropdown-toggle.btn-link { | |
-webkit-box-shadow: none; | |
box-shadow: none; | |
} | |
.btn .caret { | |
margin-left: 0; | |
} | |
.btn-lg .caret { | |
border-width: 5px 5px 0; | |
border-bottom-width: 0; | |
} | |
.dropup .btn-lg .caret { | |
border-width: 0 5px 5px; | |
} | |
.btn-group-vertical > .btn, | |
.btn-group-vertical > .btn-group, | |
.btn-group-vertical > .btn-group > .btn { | |
display: block; | |
float: none; | |
width: 100%; | |
max-width: 100%; | |
} | |
.btn-group-vertical > .btn-group > .btn { | |
float: none; | |
} | |
.btn-group-vertical > .btn + .btn, | |
.btn-group-vertical > .btn + .btn-group, | |
.btn-group-vertical > .btn-group + .btn, | |
.btn-group-vertical > .btn-group + .btn-group { | |
margin-top: -1px; | |
margin-left: 0; | |
} | |
.btn-group-vertical > .btn:not(:first-child):not(:last-child) { | |
border-radius: 0; | |
} | |
.btn-group-vertical > .btn:first-child:not(:last-child) { | |
border-top-right-radius: 2px; | |
border-top-left-radius: 2px; | |
border-bottom-right-radius: 0; | |
border-bottom-left-radius: 0; | |
} | |
.btn-group-vertical > .btn:last-child:not(:first-child) { | |
border-top-right-radius: 0; | |
border-top-left-radius: 0; | |
border-bottom-right-radius: 2px; | |
border-bottom-left-radius: 2px; | |
} | |
.btn-group-vertical > .btn-group:not(:first-child):not(:last-child) > .btn { | |
border-radius: 0; | |
} | |
.btn-group-vertical > .btn-group:first-child:not(:last-child) > .btn:last-child, | |
.btn-group-vertical > .btn-group:first-child:not(:last-child) > .dropdown-toggle { | |
border-bottom-right-radius: 0; | |
border-bottom-left-radius: 0; | |
} | |
.btn-group-vertical > .btn-group:last-child:not(:first-child) > .btn:first-child { | |
border-top-right-radius: 0; | |
border-top-left-radius: 0; | |
} | |
.btn-group-justified { | |
display: table; | |
width: 100%; | |
table-layout: fixed; | |
border-collapse: separate; | |
} | |
.btn-group-justified > .btn, | |
.btn-group-justified > .btn-group { | |
float: none; | |
display: table-cell; | |
width: 1%; | |
} | |
.btn-group-justified > .btn-group .btn { | |
width: 100%; | |
} | |
.btn-group-justified > .btn-group .dropdown-menu { | |
left: auto; | |
} | |
[data-toggle="buttons"] > .btn input[type="radio"], | |
[data-toggle="buttons"] > .btn-group > .btn input[type="radio"], | |
[data-toggle="buttons"] > .btn input[type="checkbox"], | |
[data-toggle="buttons"] > .btn-group > .btn input[type="checkbox"] { | |
position: absolute; | |
clip: rect(0, 0, 0, 0); | |
pointer-events: none; | |
} | |
.input-group { | |
position: relative; | |
display: table; | |
border-collapse: separate; | |
} | |
.input-group[class*="col-"] { | |
float: none; | |
padding-left: 0; | |
padding-right: 0; | |
} | |
.input-group .form-control { | |
position: relative; | |
z-index: 2; | |
float: left; | |
width: 100%; | |
margin-bottom: 0; | |
} | |
.input-group .form-control:focus { | |
z-index: 3; | |
} | |
.input-group-lg > .form-control, | |
.input-group-lg > .input-group-addon, | |
.input-group-lg > .input-group-btn > .btn { | |
height: 45px; | |
padding: 10px 16px; | |
font-size: 17px; | |
line-height: 1.3333333; | |
border-radius: 3px; | |
} | |
select.input-group-lg > .form-control, | |
select.input-group-lg > .input-group-addon, | |
select.input-group-lg > .input-group-btn > .btn { | |
height: 45px; | |
line-height: 45px; | |
} | |
textarea.input-group-lg > .form-control, | |
textarea.input-group-lg > .input-group-addon, | |
textarea.input-group-lg > .input-group-btn > .btn, | |
select[multiple].input-group-lg > .form-control, | |
select[multiple].input-group-lg > .input-group-addon, | |
select[multiple].input-group-lg > .input-group-btn > .btn { | |
height: auto; | |
} | |
.input-group-sm > .form-control, | |
.input-group-sm > .input-group-addon, | |
.input-group-sm > .input-group-btn > .btn { | |
height: 30px; | |
padding: 5px 10px; | |
font-size: 12px; | |
line-height: 1.5; | |
border-radius: 1px; | |
} | |
select.input-group-sm > .form-control, | |
select.input-group-sm > .input-group-addon, | |
select.input-group-sm > .input-group-btn > .btn { | |
height: 30px; | |
line-height: 30px; | |
} | |
textarea.input-group-sm > .form-control, | |
textarea.input-group-sm > .input-group-addon, | |
textarea.input-group-sm > .input-group-btn > .btn, | |
select[multiple].input-group-sm > .form-control, | |
select[multiple].input-group-sm > .input-group-addon, | |
select[multiple].input-group-sm > .input-group-btn > .btn { | |
height: auto; | |
} | |
.input-group-addon, | |
.input-group-btn, | |
.input-group .form-control { | |
display: table-cell; | |
} | |
.input-group-addon:not(:first-child):not(:last-child), | |
.input-group-btn:not(:first-child):not(:last-child), | |
.input-group .form-control:not(:first-child):not(:last-child) { | |
border-radius: 0; | |
} | |
.input-group-addon, | |
.input-group-btn { | |
width: 1%; | |
white-space: nowrap; | |
vertical-align: middle; | |
} | |
.input-group-addon { | |
padding: 6px 12px; | |
font-size: 13px; | |
font-weight: normal; | |
line-height: 1; | |
color: #555555; | |
text-align: center; | |
background-color: #eeeeee; | |
border: 1px solid #ccc; | |
border-radius: 2px; | |
} | |
.input-group-addon.input-sm { | |
padding: 5px 10px; | |
font-size: 12px; | |
border-radius: 1px; | |
} | |
.input-group-addon.input-lg { | |
padding: 10px 16px; | |
font-size: 17px; | |
border-radius: 3px; | |
} | |
.input-group-addon input[type="radio"], | |
.input-group-addon input[type="checkbox"] { | |
margin-top: 0; | |
} | |
.input-group .form-control:first-child, | |
.input-group-addon:first-child, | |
.input-group-btn:first-child > .btn, | |
.input-group-btn:first-child > .btn-group > .btn, | |
.input-group-btn:first-child > .dropdown-toggle, | |
.input-group-btn:last-child > .btn:not(:last-child):not(.dropdown-toggle), | |
.input-group-btn:last-child > .btn-group:not(:last-child) > .btn { | |
border-bottom-right-radius: 0; | |
border-top-right-radius: 0; | |
} | |
.input-group-addon:first-child { | |
border-right: 0; | |
} | |
.input-group .form-control:last-child, | |
.input-group-addon:last-child, | |
.input-group-btn:last-child > .btn, | |
.input-group-btn:last-child > .btn-group > .btn, | |
.input-group-btn:last-child > .dropdown-toggle, | |
.input-group-btn:first-child > .btn:not(:first-child), | |
.input-group-btn:first-child > .btn-group:not(:first-child) > .btn { | |
border-bottom-left-radius: 0; | |
border-top-left-radius: 0; | |
} | |
.input-group-addon:last-child { | |
border-left: 0; | |
} | |
.input-group-btn { | |
position: relative; | |
font-size: 0; | |
white-space: nowrap; | |
} | |
.input-group-btn > .btn { | |
position: relative; | |
} | |
.input-group-btn > .btn + .btn { | |
margin-left: -1px; | |
} | |
.input-group-btn > .btn:hover, | |
.input-group-btn > .btn:focus, | |
.input-group-btn > .btn:active { | |
z-index: 2; | |
} | |
.input-group-btn:first-child > .btn, | |
.input-group-btn:first-child > .btn-group { | |
margin-right: -1px; | |
} | |
.input-group-btn:last-child > .btn, | |
.input-group-btn:last-child > .btn-group { | |
z-index: 2; | |
margin-left: -1px; | |
} | |
.nav { | |
margin-bottom: 0; | |
padding-left: 0; | |
list-style: none; | |
} | |
.nav > li { | |
position: relative; | |
display: block; | |
} | |
.nav > li > a { | |
position: relative; | |
display: block; | |
padding: 10px 15px; | |
} | |
.nav > li > a:hover, | |
.nav > li > a:focus { | |
text-decoration: none; | |
background-color: #eeeeee; | |
} | |
.nav > li.disabled > a { | |
color: #777777; | |
} | |
.nav > li.disabled > a:hover, | |
.nav > li.disabled > a:focus { | |
color: #777777; | |
text-decoration: none; | |
background-color: transparent; | |
cursor: not-allowed; | |
} | |
.nav .open > a, | |
.nav .open > a:hover, | |
.nav .open > a:focus { | |
background-color: #eeeeee; | |
border-color: #337ab7; | |
} | |
.nav .nav-divider { | |
height: 1px; | |
margin: 8px 0; | |
overflow: hidden; | |
background-color: #e5e5e5; | |
} | |
.nav > li > a > img { | |
max-width: none; | |
} | |
.nav-tabs { | |
border-bottom: 1px solid #ddd; | |
} | |
.nav-tabs > li { | |
float: left; | |
margin-bottom: -1px; | |
} | |
.nav-tabs > li > a { | |
margin-right: 2px; | |
line-height: 1.42857143; | |
border: 1px solid transparent; | |
border-radius: 2px 2px 0 0; | |
} | |
.nav-tabs > li > a:hover { | |
border-color: #eeeeee #eeeeee #ddd; | |
} | |
.nav-tabs > li.active > a, | |
.nav-tabs > li.active > a:hover, | |
.nav-tabs > li.active > a:focus { | |
color: #555555; | |
background-color: #fff; | |
border: 1px solid #ddd; | |
border-bottom-color: transparent; | |
cursor: default; | |
} | |
.nav-tabs.nav-justified { | |
width: 100%; | |
border-bottom: 0; | |
} | |
.nav-tabs.nav-justified > li { | |
float: none; | |
} | |
.nav-tabs.nav-justified > li > a { | |
text-align: center; | |
margin-bottom: 5px; | |
} | |
.nav-tabs.nav-justified > .dropdown .dropdown-menu { | |
top: auto; | |
left: auto; | |
} | |
@media (min-width: 768px) { | |
.nav-tabs.nav-justified > li { | |
display: table-cell; | |
width: 1%; | |
} | |
.nav-tabs.nav-justified > li > a { | |
margin-bottom: 0; | |
} | |
} | |
.nav-tabs.nav-justified > li > a { | |
margin-right: 0; | |
border-radius: 2px; | |
} | |
.nav-tabs.nav-justified > .active > a, | |
.nav-tabs.nav-justified > .active > a:hover, | |
.nav-tabs.nav-justified > .active > a:focus { | |
border: 1px solid #ddd; | |
} | |
@media (min-width: 768px) { | |
.nav-tabs.nav-justified > li > a { | |
border-bottom: 1px solid #ddd; | |
border-radius: 2px 2px 0 0; | |
} | |
.nav-tabs.nav-justified > .active > a, | |
.nav-tabs.nav-justified > .active > a:hover, | |
.nav-tabs.nav-justified > .active > a:focus { | |
border-bottom-color: #fff; | |
} | |
} | |
.nav-pills > li { | |
float: left; | |
} | |
.nav-pills > li > a { | |
border-radius: 2px; | |
} | |
.nav-pills > li + li { | |
margin-left: 2px; | |
} | |
.nav-pills > li.active > a, | |
.nav-pills > li.active > a:hover, | |
.nav-pills > li.active > a:focus { | |
color: #fff; | |
background-color: #337ab7; | |
} | |
.nav-stacked > li { | |
float: none; | |
} | |
.nav-stacked > li + li { | |
margin-top: 2px; | |
margin-left: 0; | |
} | |
.nav-justified { | |
width: 100%; | |
} | |
.nav-justified > li { | |
float: none; | |
} | |
.nav-justified > li > a { | |
text-align: center; | |
margin-bottom: 5px; | |
} | |
.nav-justified > .dropdown .dropdown-menu { | |
top: auto; | |
left: auto; | |
} | |
@media (min-width: 768px) { | |
.nav-justified > li { | |
display: table-cell; | |
width: 1%; | |
} | |
.nav-justified > li > a { | |
margin-bottom: 0; | |
} | |
} | |
.nav-tabs-justified { | |
border-bottom: 0; | |
} | |
.nav-tabs-justified > li > a { | |
margin-right: 0; | |
border-radius: 2px; | |
} | |
.nav-tabs-justified > .active > a, | |
.nav-tabs-justified > .active > a:hover, | |
.nav-tabs-justified > .active > a:focus { | |
border: 1px solid #ddd; | |
} | |
@media (min-width: 768px) { | |
.nav-tabs-justified > li > a { | |
border-bottom: 1px solid #ddd; | |
border-radius: 2px 2px 0 0; | |
} | |
.nav-tabs-justified > .active > a, | |
.nav-tabs-justified > .active > a:hover, | |
.nav-tabs-justified > .active > a:focus { | |
border-bottom-color: #fff; | |
} | |
} | |
.tab-content > .tab-pane { | |
display: none; | |
} | |
.tab-content > .active { | |
display: block; | |
} | |
.nav-tabs .dropdown-menu { | |
margin-top: -1px; | |
border-top-right-radius: 0; | |
border-top-left-radius: 0; | |
} | |
.navbar { | |
position: relative; | |
min-height: 30px; | |
margin-bottom: 18px; | |
border: 1px solid transparent; | |
} | |
@media (min-width: 541px) { | |
.navbar { | |
border-radius: 2px; | |
} | |
} | |
@media (min-width: 541px) { | |
.navbar-header { | |
float: left; | |
} | |
} | |
.navbar-collapse { | |
overflow-x: visible; | |
padding-right: 0px; | |
padding-left: 0px; | |
border-top: 1px solid transparent; | |
box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.1); | |
-webkit-overflow-scrolling: touch; | |
} | |
.navbar-collapse.in { | |
overflow-y: auto; | |
} | |
@media (min-width: 541px) { | |
.navbar-collapse { | |
width: auto; | |
border-top: 0; | |
box-shadow: none; | |
} | |
.navbar-collapse.collapse { | |
display: block !important; | |
height: auto !important; | |
padding-bottom: 0; | |
overflow: visible !important; | |
} | |
.navbar-collapse.in { | |
overflow-y: visible; | |
} | |
.navbar-fixed-top .navbar-collapse, | |
.navbar-static-top .navbar-collapse, | |
.navbar-fixed-bottom .navbar-collapse { | |
padding-left: 0; | |
padding-right: 0; | |
} | |
} | |
.navbar-fixed-top .navbar-collapse, | |
.navbar-fixed-bottom .navbar-collapse { | |
max-height: 340px; | |
} | |
@media (max-device-width: 540px) and (orientation: landscape) { | |
.navbar-fixed-top .navbar-collapse, | |
.navbar-fixed-bottom .navbar-collapse { | |
max-height: 200px; | |
} | |
} | |
.container > .navbar-header, | |
.container-fluid > .navbar-header, | |
.container > .navbar-collapse, | |
.container-fluid > .navbar-collapse { | |
margin-right: 0px; | |
margin-left: 0px; | |
} | |
@media (min-width: 541px) { | |
.container > .navbar-header, | |
.container-fluid > .navbar-header, | |
.container > .navbar-collapse, | |
.container-fluid > .navbar-collapse { | |
margin-right: 0; | |
margin-left: 0; | |
} | |
} | |
.navbar-static-top { | |
z-index: 1000; | |
border-width: 0 0 1px; | |
} | |
@media (min-width: 541px) { | |
.navbar-static-top { | |
border-radius: 0; | |
} | |
} | |
.navbar-fixed-top, | |
.navbar-fixed-bottom { | |
position: fixed; | |
right: 0; | |
left: 0; | |
z-index: 1030; | |
} | |
@media (min-width: 541px) { | |
.navbar-fixed-top, | |
.navbar-fixed-bottom { | |
border-radius: 0; | |
} | |
} | |
.navbar-fixed-top { | |
top: 0; | |
border-width: 0 0 1px; | |
} | |
.navbar-fixed-bottom { | |
bottom: 0; | |
margin-bottom: 0; | |
border-width: 1px 0 0; | |
} | |
.navbar-brand { | |
float: left; | |
padding: 6px 0px; | |
font-size: 17px; | |
line-height: 18px; | |
height: 30px; | |
} | |
.navbar-brand:hover, | |
.navbar-brand:focus { | |
text-decoration: none; | |
} | |
.navbar-brand > img { | |
display: block; | |
} | |
@media (min-width: 541px) { | |
.navbar > .container .navbar-brand, | |
.navbar > .container-fluid .navbar-brand { | |
margin-left: 0px; | |
} | |
} | |
.navbar-toggle { | |
position: relative; | |
float: right; | |
margin-right: 0px; | |
padding: 9px 10px; | |
margin-top: -2px; | |
margin-bottom: -2px; | |
background-color: transparent; | |
background-image: none; | |
border: 1px solid transparent; | |
border-radius: 2px; | |
} | |
.navbar-toggle:focus { | |
outline: 0; | |
} | |
.navbar-toggle .icon-bar { | |
display: block; | |
width: 22px; | |
height: 2px; | |
border-radius: 1px; | |
} | |
.navbar-toggle .icon-bar + .icon-bar { | |
margin-top: 4px; | |
} | |
@media (min-width: 541px) { | |
.navbar-toggle { | |
display: none; | |
} | |
} | |
.navbar-nav { | |
margin: 3px 0px; | |
} | |
.navbar-nav > li > a { | |
padding-top: 10px; | |
padding-bottom: 10px; | |
line-height: 18px; | |
} | |
@media (max-width: 540px) { | |
.navbar-nav .open .dropdown-menu { | |
position: static; | |
float: none; | |
width: auto; | |
margin-top: 0; | |
background-color: transparent; | |
border: 0; | |
box-shadow: none; | |
} | |
.navbar-nav .open .dropdown-menu > li > a, | |
.navbar-nav .open .dropdown-menu .dropdown-header { | |
padding: 5px 15px 5px 25px; | |
} | |
.navbar-nav .open .dropdown-menu > li > a { | |
line-height: 18px; | |
} | |
.navbar-nav .open .dropdown-menu > li > a:hover, | |
.navbar-nav .open .dropdown-menu > li > a:focus { | |
background-image: none; | |
} | |
} | |
@media (min-width: 541px) { | |
.navbar-nav { | |
float: left; | |
margin: 0; | |
} | |
.navbar-nav > li { | |
float: left; | |
} | |
.navbar-nav > li > a { | |
padding-top: 6px; | |
padding-bottom: 6px; | |
} | |
} | |
.navbar-form { | |
margin-left: 0px; | |
margin-right: 0px; | |
padding: 10px 0px; | |
border-top: 1px solid transparent; | |
border-bottom: 1px solid transparent; | |
-webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.1), 0 1px 0 rgba(255, 255, 255, 0.1); | |
box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.1), 0 1px 0 rgba(255, 255, 255, 0.1); | |
margin-top: -1px; | |
margin-bottom: -1px; | |
} | |
@media (min-width: 768px) { | |
.navbar-form .form-group { | |
display: inline-block; | |
margin-bottom: 0; | |
vertical-align: middle; | |
} | |
.navbar-form .form-control { | |
display: inline-block; | |
width: auto; | |
vertical-align: middle; | |
} | |
.navbar-form .form-control-static { | |
display: inline-block; | |
} | |
.navbar-form .input-group { | |
display: inline-table; | |
vertical-align: middle; | |
} | |
.navbar-form .input-group .input-group-addon, | |
.navbar-form .input-group .input-group-btn, | |
.navbar-form .input-group .form-control { | |
width: auto; | |
} | |
.navbar-form .input-group > .form-control { | |
width: 100%; | |
} | |
.navbar-form .control-label { | |
margin-bottom: 0; | |
vertical-align: middle; | |
} | |
.navbar-form .radio, | |
.navbar-form .checkbox { | |
display: inline-block; | |
margin-top: 0; | |
margin-bottom: 0; | |
vertical-align: middle; | |
} | |
.navbar-form .radio label, | |
.navbar-form .checkbox label { | |
padding-left: 0; | |
} | |
.navbar-form .radio input[type="radio"], | |
.navbar-form .checkbox input[type="checkbox"] { | |
position: relative; | |
margin-left: 0; | |
} | |
.navbar-form .has-feedback .form-control-feedback { | |
top: 0; | |
} | |
} | |
@media (max-width: 540px) { | |
.navbar-form .form-group { | |
margin-bottom: 5px; | |
} | |
.navbar-form .form-group:last-child { | |
margin-bottom: 0; | |
} | |
} | |
@media (min-width: 541px) { | |
.navbar-form { | |
width: auto; | |
border: 0; | |
margin-left: 0; | |
margin-right: 0; | |
padding-top: 0; | |
padding-bottom: 0; | |
-webkit-box-shadow: none; | |
box-shadow: none; | |
} | |
} | |
.navbar-nav > li > .dropdown-menu { | |
margin-top: 0; | |
border-top-right-radius: 0; | |
border-top-left-radius: 0; | |
} | |
.navbar-fixed-bottom .navbar-nav > li > .dropdown-menu { | |
margin-bottom: 0; | |
border-top-right-radius: 2px; | |
border-top-left-radius: 2px; | |
border-bottom-right-radius: 0; | |
border-bottom-left-radius: 0; | |
} | |
.navbar-btn { | |
margin-top: -1px; | |
margin-bottom: -1px; | |
} | |
.navbar-btn.btn-sm { | |
margin-top: 0px; | |
margin-bottom: 0px; | |
} | |
.navbar-btn.btn-xs { | |
margin-top: 4px; | |
margin-bottom: 4px; | |
} | |
.navbar-text { | |
margin-top: 6px; | |
margin-bottom: 6px; | |
} | |
@media (min-width: 541px) { | |
.navbar-text { | |
float: left; | |
margin-left: 0px; | |
margin-right: 0px; | |
} | |
} | |
@media (min-width: 541px) { | |
.navbar-left { | |
float: left !important; | |
float: left; | |
} | |
.navbar-right { | |
float: right !important; | |
float: right; | |
margin-right: 0px; | |
} | |
.navbar-right ~ .navbar-right { | |
margin-right: 0; | |
} | |
} | |
.navbar-default { | |
background-color: #f8f8f8; | |
border-color: #e7e7e7; | |
} | |
.navbar-default .navbar-brand { | |
color: #777; | |
} | |
.navbar-default .navbar-brand:hover, | |
.navbar-default .navbar-brand:focus { | |
color: #5e5e5e; | |
background-color: transparent; | |
} | |
.navbar-default .navbar-text { | |
color: #777; | |
} | |
.navbar-default .navbar-nav > li > a { | |
color: #777; | |
} | |
.navbar-default .navbar-nav > li > a:hover, | |
.navbar-default .navbar-nav > li > a:focus { | |
color: #333; | |
background-color: transparent; | |
} | |
.navbar-default .navbar-nav > .active > a, | |
.navbar-default .navbar-nav > .active > a:hover, | |
.navbar-default .navbar-nav > .active > a:focus { | |
color: #555; | |
background-color: #e7e7e7; | |
} | |
.navbar-default .navbar-nav > .disabled > a, | |
.navbar-default .navbar-nav > .disabled > a:hover, | |
.navbar-default .navbar-nav > .disabled > a:focus { | |
color: #ccc; | |
background-color: transparent; | |
} | |
.navbar-default .navbar-toggle { | |
border-color: #ddd; | |
} | |
.navbar-default .navbar-toggle:hover, | |
.navbar-default .navbar-toggle:focus { | |
background-color: #ddd; | |
} | |
.navbar-default .navbar-toggle .icon-bar { | |
background-color: #888; | |
} | |
.navbar-default .navbar-collapse, | |
.navbar-default .navbar-form { | |
border-color: #e7e7e7; | |
} | |
.navbar-default .navbar-nav > .open > a, | |
.navbar-default .navbar-nav > .open > a:hover, | |
.navbar-default .navbar-nav > .open > a:focus { | |
background-color: #e7e7e7; | |
color: #555; | |
} | |
@media (max-width: 540px) { | |
.navbar-default .navbar-nav .open .dropdown-menu > li > a { | |
color: #777; | |
} | |
.navbar-default .navbar-nav .open .dropdown-menu > li > a:hover, | |
.navbar-default .navbar-nav .open .dropdown-menu > li > a:focus { | |
color: #333; | |
background-color: transparent; | |
} | |
.navbar-default .navbar-nav .open .dropdown-menu > .active > a, | |
.navbar-default .navbar-nav .open .dropdown-menu > .active > a:hover, | |
.navbar-default .navbar-nav .open .dropdown-menu > .active > a:focus { | |
color: #555; | |
background-color: #e7e7e7; | |
} | |
.navbar-default .navbar-nav .open .dropdown-menu > .disabled > a, | |
.navbar-default .navbar-nav .open .dropdown-menu > .disabled > a:hover, | |
.navbar-default .navbar-nav .open .dropdown-menu > .disabled > a:focus { | |
color: #ccc; | |
background-color: transparent; | |
} | |
} | |
.navbar-default .navbar-link { | |
color: #777; | |
} | |
.navbar-default .navbar-link:hover { | |
color: #333; | |
} | |
.navbar-default .btn-link { | |
color: #777; | |
} | |
.navbar-default .btn-link:hover, | |
.navbar-default .btn-link:focus { | |
color: #333; | |
} | |
.navbar-default .btn-link[disabled]:hover, | |
fieldset[disabled] .navbar-default .btn-link:hover, | |
.navbar-default .btn-link[disabled]:focus, | |
fieldset[disabled] .navbar-default .btn-link:focus { | |
color: #ccc; | |
} | |
.navbar-inverse { | |
background-color: #222; | |
border-color: #080808; | |
} | |
.navbar-inverse .navbar-brand { | |
color: #9d9d9d; | |
} | |
.navbar-inverse .navbar-brand:hover, | |
.navbar-inverse .navbar-brand:focus { | |
color: #fff; | |
background-color: transparent; | |
} | |
.navbar-inverse .navbar-text { | |
color: #9d9d9d; | |
} | |
.navbar-inverse .navbar-nav > li > a { | |
color: #9d9d9d; | |
} | |
.navbar-inverse .navbar-nav > li > a:hover, | |
.navbar-inverse .navbar-nav > li > a:focus { | |
color: #fff; | |
background-color: transparent; | |
} | |
.navbar-inverse .navbar-nav > .active > a, | |
.navbar-inverse .navbar-nav > .active > a:hover, | |
.navbar-inverse .navbar-nav > .active > a:focus { | |
color: #fff; | |
background-color: #080808; | |
} | |
.navbar-inverse .navbar-nav > .disabled > a, | |
.navbar-inverse .navbar-nav > .disabled > a:hover, | |
.navbar-inverse .navbar-nav > .disabled > a:focus { | |
color: #444; | |
background-color: transparent; | |
} | |
.navbar-inverse .navbar-toggle { | |
border-color: #333; | |
} | |
.navbar-inverse .navbar-toggle:hover, | |
.navbar-inverse .navbar-toggle:focus { | |
background-color: #333; | |
} | |
.navbar-inverse .navbar-toggle .icon-bar { | |
background-color: #fff; | |
} | |
.navbar-inverse .navbar-collapse, | |
.navbar-inverse .navbar-form { | |
border-color: #101010; | |
} | |
.navbar-inverse .navbar-nav > .open > a, | |
.navbar-inverse .navbar-nav > .open > a:hover, | |
.navbar-inverse .navbar-nav > .open > a:focus { | |
background-color: #080808; | |
color: #fff; | |
} | |
@media (max-width: 540px) { | |
.navbar-inverse .navbar-nav .open .dropdown-menu > .dropdown-header { | |
border-color: #080808; | |
} | |
.navbar-inverse .navbar-nav .open .dropdown-menu .divider { | |
background-color: #080808; | |
} | |
.navbar-inverse .navbar-nav .open .dropdown-menu > li > a { | |
color: #9d9d9d; | |
} | |
.navbar-inverse .navbar-nav .open .dropdown-menu > li > a:hover, | |
.navbar-inverse .navbar-nav .open .dropdown-menu > li > a:focus { | |
color: #fff; | |
background-color: transparent; | |
} | |
.navbar-inverse .navbar-nav .open .dropdown-menu > .active > a, | |
.navbar-inverse .navbar-nav .open .dropdown-menu > .active > a:hover, | |
.navbar-inverse .navbar-nav .open .dropdown-menu > .active > a:focus { | |
color: #fff; | |
background-color: #080808; | |
} | |
.navbar-inverse .navbar-nav .open .dropdown-menu > .disabled > a, | |
.navbar-inverse .navbar-nav .open .dropdown-menu > .disabled > a:hover, | |
.navbar-inverse .navbar-nav .open .dropdown-menu > .disabled > a:focus { | |
color: #444; | |
background-color: transparent; | |
} | |
} | |
.navbar-inverse .navbar-link { | |
color: #9d9d9d; | |
} | |
.navbar-inverse .navbar-link:hover { | |
color: #fff; | |
} | |
.navbar-inverse .btn-link { | |
color: #9d9d9d; | |
} | |
.navbar-inverse .btn-link:hover, | |
.navbar-inverse .btn-link:focus { | |
color: #fff; | |
} | |
.navbar-inverse .btn-link[disabled]:hover, | |
fieldset[disabled] .navbar-inverse .btn-link:hover, | |
.navbar-inverse .btn-link[disabled]:focus, | |
fieldset[disabled] .navbar-inverse .btn-link:focus { | |
color: #444; | |
} | |
.breadcrumb { | |
padding: 8px 15px; | |
margin-bottom: 18px; | |
list-style: none; | |
background-color: #f5f5f5; | |
border-radius: 2px; | |
} | |
.breadcrumb > li { | |
display: inline-block; | |
} | |
.breadcrumb > li + li:before { | |
content: "/\00a0"; | |
padding: 0 5px; | |
color: #5e5e5e; | |
} | |
.breadcrumb > .active { | |
color: #777777; | |
} | |
.pagination { | |
display: inline-block; | |
padding-left: 0; | |
margin: 18px 0; | |
border-radius: 2px; | |
} | |
.pagination > li { | |
display: inline; | |
} | |
.pagination > li > a, | |
.pagination > li > span { | |
position: relative; | |
float: left; | |
padding: 6px 12px; | |
line-height: 1.42857143; | |
text-decoration: none; | |
color: #337ab7; | |
background-color: #fff; | |
border: 1px solid #ddd; | |
margin-left: -1px; | |
} | |
.pagination > li:first-child > a, | |
.pagination > li:first-child > span { | |
margin-left: 0; | |
border-bottom-left-radius: 2px; | |
border-top-left-radius: 2px; | |
} | |
.pagination > li:last-child > a, | |
.pagination > li:last-child > span { | |
border-bottom-right-radius: 2px; | |
border-top-right-radius: 2px; | |
} | |
.pagination > li > a:hover, | |
.pagination > li > span:hover, | |
.pagination > li > a:focus, | |
.pagination > li > span:focus { | |
z-index: 2; | |
color: #23527c; | |
background-color: #eeeeee; | |
border-color: #ddd; | |
} | |
.pagination > .active > a, | |
.pagination > .active > span, | |
.pagination > .active > a:hover, | |
.pagination > .active > span:hover, | |
.pagination > .active > a:focus, | |
.pagination > .active > span:focus { | |
z-index: 3; | |
color: #fff; | |
background-color: #337ab7; | |
border-color: #337ab7; | |
cursor: default; | |
} | |
.pagination > .disabled > span, | |
.pagination > .disabled > span:hover, | |
.pagination > .disabled > span:focus, | |
.pagination > .disabled > a, | |
.pagination > .disabled > a:hover, | |
.pagination > .disabled > a:focus { | |
color: #777777; | |
background-color: #fff; | |
border-color: #ddd; | |
cursor: not-allowed; | |
} | |
.pagination-lg > li > a, | |
.pagination-lg > li > span { | |
padding: 10px 16px; | |
font-size: 17px; | |
line-height: 1.3333333; | |
} | |
.pagination-lg > li:first-child > a, | |
.pagination-lg > li:first-child > span { | |
border-bottom-left-radius: 3px; | |
border-top-left-radius: 3px; | |
} | |
.pagination-lg > li:last-child > a, | |
.pagination-lg > li:last-child > span { | |
border-bottom-right-radius: 3px; | |
border-top-right-radius: 3px; | |
} | |
.pagination-sm > li > a, | |
.pagination-sm > li > span { | |
padding: 5px 10px; | |
font-size: 12px; | |
line-height: 1.5; | |
} | |
.pagination-sm > li:first-child > a, | |
.pagination-sm > li:first-child > span { | |
border-bottom-left-radius: 1px; | |
border-top-left-radius: 1px; | |
} | |
.pagination-sm > li:last-child > a, | |
.pagination-sm > li:last-child > span { | |
border-bottom-right-radius: 1px; | |
border-top-right-radius: 1px; | |
} | |
.pager { | |
padding-left: 0; | |
margin: 18px 0; | |
list-style: none; | |
text-align: center; | |
} | |
.pager li { | |
display: inline; | |
} | |
.pager li > a, | |
.pager li > span { | |
display: inline-block; | |
padding: 5px 14px; | |
background-color: #fff; | |
border: 1px solid #ddd; | |
border-radius: 15px; | |
} | |
.pager li > a:hover, | |
.pager li > a:focus { | |
text-decoration: none; | |
background-color: #eeeeee; | |
} | |
.pager .next > a, | |
.pager .next > span { | |
float: right; | |
} | |
.pager .previous > a, | |
.pager .previous > span { | |
float: left; | |
} | |
.pager .disabled > a, | |
.pager .disabled > a:hover, | |
.pager .disabled > a:focus, | |
.pager .disabled > span { | |
color: #777777; | |
background-color: #fff; | |
cursor: not-allowed; | |
} | |
.label { | |
display: inline; | |
padding: .2em .6em .3em; | |
font-size: 75%; | |
font-weight: bold; | |
line-height: 1; | |
color: #fff; | |
text-align: center; | |
white-space: nowrap; | |
vertical-align: baseline; | |
border-radius: .25em; | |
} | |
a.label:hover, | |
a.label:focus { | |
color: #fff; | |
text-decoration: none; | |
cursor: pointer; | |
} | |
.label:empty { | |
display: none; | |
} | |
.btn .label { | |
position: relative; | |
top: -1px; | |
} | |
.label-default { | |
background-color: #777777; | |
} | |
.label-default[href]:hover, | |
.label-default[href]:focus { | |
background-color: #5e5e5e; | |
} | |
.label-primary { | |
background-color: #337ab7; | |
} | |
.label-primary[href]:hover, | |
.label-primary[href]:focus { | |
background-color: #286090; | |
} | |
.label-success { | |
background-color: #5cb85c; | |
} | |
.label-success[href]:hover, | |
.label-success[href]:focus { | |
background-color: #449d44; | |
} | |
.label-info { | |
background-color: #5bc0de; | |
} | |
.label-info[href]:hover, | |
.label-info[href]:focus { | |
background-color: #31b0d5; | |
} | |
.label-warning { | |
background-color: #f0ad4e; | |
} | |
.label-warning[href]:hover, | |
.label-warning[href]:focus { | |
background-color: #ec971f; | |
} | |
.label-danger { | |
background-color: #d9534f; | |
} | |
.label-danger[href]:hover, | |
.label-danger[href]:focus { | |
background-color: #c9302c; | |
} | |
.badge { | |
display: inline-block; | |
min-width: 10px; | |
padding: 3px 7px; | |
font-size: 12px; | |
font-weight: bold; | |
color: #fff; | |
line-height: 1; | |
vertical-align: middle; | |
white-space: nowrap; | |
text-align: center; | |
background-color: #777777; | |
border-radius: 10px; | |
} | |
.badge:empty { | |
display: none; | |
} | |
.btn .badge { | |
position: relative; | |
top: -1px; | |
} | |
.btn-xs .badge, | |
.btn-group-xs > .btn .badge { | |
top: 0; | |
padding: 1px 5px; | |
} | |
a.badge:hover, | |
a.badge:focus { | |
color: #fff; | |
text-decoration: none; | |
cursor: pointer; | |
} | |
.list-group-item.active > .badge, | |
.nav-pills > .active > a > .badge { | |
color: #337ab7; | |
background-color: #fff; | |
} | |
.list-group-item > .badge { | |
float: right; | |
} | |
.list-group-item > .badge + .badge { | |
margin-right: 5px; | |
} | |
.nav-pills > li > a > .badge { | |
margin-left: 3px; | |
} | |
.jumbotron { | |
padding-top: 30px; | |
padding-bottom: 30px; | |
margin-bottom: 30px; | |
color: inherit; | |
background-color: #eeeeee; | |
} | |
.jumbotron h1, | |
.jumbotron .h1 { | |
color: inherit; | |
} | |
.jumbotron p { | |
margin-bottom: 15px; | |
font-size: 20px; | |
font-weight: 200; | |
} | |
.jumbotron > hr { | |
border-top-color: #d5d5d5; | |
} | |
.container .jumbotron, | |
.container-fluid .jumbotron { | |
border-radius: 3px; | |
padding-left: 0px; | |
padding-right: 0px; | |
} | |
.jumbotron .container { | |
max-width: 100%; | |
} | |
@media screen and (min-width: 768px) { | |
.jumbotron { | |
padding-top: 48px; | |
padding-bottom: 48px; | |
} | |
.container .jumbotron, | |
.container-fluid .jumbotron { | |
padding-left: 60px; | |
padding-right: 60px; | |
} | |
.jumbotron h1, | |
.jumbotron .h1 { | |
font-size: 59px; | |
} | |
} | |
.thumbnail { | |
display: block; | |
padding: 4px; | |
margin-bottom: 18px; | |
line-height: 1.42857143; | |
background-color: #fff; | |
border: 1px solid #ddd; | |
border-radius: 2px; | |
-webkit-transition: border 0.2s ease-in-out; | |
-o-transition: border 0.2s ease-in-out; | |
transition: border 0.2s ease-in-out; | |
} | |
.thumbnail > img, | |
.thumbnail a > img { | |
margin-left: auto; | |
margin-right: auto; | |
} | |
a.thumbnail:hover, | |
a.thumbnail:focus, | |
a.thumbnail.active { | |
border-color: #337ab7; | |
} | |
.thumbnail .caption { | |
padding: 9px; | |
color: #000; | |
} | |
.alert { | |
padding: 15px; | |
margin-bottom: 18px; | |
border: 1px solid transparent; | |
border-radius: 2px; | |
} | |
.alert h4 { | |
margin-top: 0; | |
color: inherit; | |
} | |
.alert .alert-link { | |
font-weight: bold; | |
} | |
.alert > p, | |
.alert > ul { | |
margin-bottom: 0; | |
} | |
.alert > p + p { | |
margin-top: 5px; | |
} | |
.alert-dismissable, | |
.alert-dismissible { | |
padding-right: 35px; | |
} | |
.alert-dismissable .close, | |
.alert-dismissible .close { | |
position: relative; | |
top: -2px; | |
right: -21px; | |
color: inherit; | |
} | |
.alert-success { | |
background-color: #dff0d8; | |
border-color: #d6e9c6; | |
color: #3c763d; | |
} | |
.alert-success hr { | |
border-top-color: #c9e2b3; | |
} | |
.alert-success .alert-link { | |
color: #2b542c; | |
} | |
.alert-info { | |
background-color: #d9edf7; | |
border-color: #bce8f1; | |
color: #31708f; | |
} | |
.alert-info hr { | |
border-top-color: #a6e1ec; | |
} | |
.alert-info .alert-link { | |
color: #245269; | |
} | |
.alert-warning { | |
background-color: #fcf8e3; | |
border-color: #faebcc; | |
color: #8a6d3b; | |
} | |
.alert-warning hr { | |
border-top-color: #f7e1b5; | |
} | |
.alert-warning .alert-link { | |
color: #66512c; | |
} | |
.alert-danger { | |
background-color: #f2dede; | |
border-color: #ebccd1; | |
color: #a94442; | |
} | |
.alert-danger hr { | |
border-top-color: #e4b9c0; | |
} | |
.alert-danger .alert-link { | |
color: #843534; | |
} | |
@-webkit-keyframes progress-bar-stripes { | |
from { | |
background-position: 40px 0; | |
} | |
to { | |
background-position: 0 0; | |
} | |
} | |
@keyframes progress-bar-stripes { | |
from { | |
background-position: 40px 0; | |
} | |
to { | |
background-position: 0 0; | |
} | |
} | |
.progress { | |
overflow: hidden; | |
height: 18px; | |
margin-bottom: 18px; | |
background-color: #f5f5f5; | |
border-radius: 2px; | |
-webkit-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1); | |
box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1); | |
} | |
.progress-bar { | |
float: left; | |
width: 0%; | |
height: 100%; | |
font-size: 12px; | |
line-height: 18px; | |
color: #fff; | |
text-align: center; | |
background-color: #337ab7; | |
-webkit-box-shadow: inset 0 -1px 0 rgba(0, 0, 0, 0.15); | |
box-shadow: inset 0 -1px 0 rgba(0, 0, 0, 0.15); | |
-webkit-transition: width 0.6s ease; | |
-o-transition: width 0.6s ease; | |
transition: width 0.6s ease; | |
} | |
.progress-striped .progress-bar, | |
.progress-bar-striped { | |
background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); | |
background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); | |
background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); | |
background-size: 40px 40px; | |
} | |
.progress.active .progress-bar, | |
.progress-bar.active { | |
-webkit-animation: progress-bar-stripes 2s linear infinite; | |
-o-animation: progress-bar-stripes 2s linear infinite; | |
animation: progress-bar-stripes 2s linear infinite; | |
} | |
.progress-bar-success { | |
background-color: #5cb85c; | |
} | |
.progress-striped .progress-bar-success { | |
background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); | |
background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); | |
background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); | |
} | |
.progress-bar-info { | |
background-color: #5bc0de; | |
} | |
.progress-striped .progress-bar-info { | |
background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); | |
background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); | |
background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); | |
} | |
.progress-bar-warning { | |
background-color: #f0ad4e; | |
} | |
.progress-striped .progress-bar-warning { | |
background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); | |
background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); | |
background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); | |
} | |
.progress-bar-danger { | |
background-color: #d9534f; | |
} | |
.progress-striped .progress-bar-danger { | |
background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); | |
background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); | |
background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); | |
} | |
.media { | |
margin-top: 15px; | |
} | |
.media:first-child { | |
margin-top: 0; | |
} | |
.media, | |
.media-body { | |
zoom: 1; | |
overflow: hidden; | |
} | |
.media-body { | |
width: 10000px; | |
} | |
.media-object { | |
display: block; | |
} | |
.media-object.img-thumbnail { | |
max-width: none; | |
} | |
.media-right, | |
.media > .pull-right { | |
padding-left: 10px; | |
} | |
.media-left, | |
.media > .pull-left { | |
padding-right: 10px; | |
} | |
.media-left, | |
.media-right, | |
.media-body { | |
display: table-cell; | |
vertical-align: top; | |
} | |
.media-middle { | |
vertical-align: middle; | |
} | |
.media-bottom { | |
vertical-align: bottom; | |
} | |
.media-heading { | |
margin-top: 0; | |
margin-bottom: 5px; | |
} | |
.media-list { | |
padding-left: 0; | |
list-style: none; | |
} | |
.list-group { | |
margin-bottom: 20px; | |
padding-left: 0; | |
} | |
.list-group-item { | |
position: relative; | |
display: block; | |
padding: 10px 15px; | |
margin-bottom: -1px; | |
background-color: #fff; | |
border: 1px solid #ddd; | |
} | |
.list-group-item:first-child { | |
border-top-right-radius: 2px; | |
border-top-left-radius: 2px; | |
} | |
.list-group-item:last-child { | |
margin-bottom: 0; | |
border-bottom-right-radius: 2px; | |
border-bottom-left-radius: 2px; | |
} | |
a.list-group-item, | |
button.list-group-item { | |
color: #555; | |
} | |
a.list-group-item .list-group-item-heading, | |
button.list-group-item .list-group-item-heading { | |
color: #333; | |
} | |
a.list-group-item:hover, | |
button.list-group-item:hover, | |
a.list-group-item:focus, | |
button.list-group-item:focus { | |
text-decoration: none; | |
color: #555; | |
background-color: #f5f5f5; | |
} | |
button.list-group-item { | |
width: 100%; | |
text-align: left; | |
} | |
.list-group-item.disabled, | |
.list-group-item.disabled:hover, | |
.list-group-item.disabled:focus { | |
background-color: #eeeeee; | |
color: #777777; | |
cursor: not-allowed; | |
} | |
.list-group-item.disabled .list-group-item-heading, | |
.list-group-item.disabled:hover .list-group-item-heading, | |
.list-group-item.disabled:focus .list-group-item-heading { | |
color: inherit; | |
} | |
.list-group-item.disabled .list-group-item-text, | |
.list-group-item.disabled:hover .list-group-item-text, | |
.list-group-item.disabled:focus .list-group-item-text { | |
color: #777777; | |
} | |
.list-group-item.active, | |
.list-group-item.active:hover, | |
.list-group-item.active:focus { | |
z-index: 2; | |
color: #fff; | |
background-color: #337ab7; | |
border-color: #337ab7; | |
} | |
.list-group-item.active .list-group-item-heading, | |
.list-group-item.active:hover .list-group-item-heading, | |
.list-group-item.active:focus .list-group-item-heading, | |
.list-group-item.active .list-group-item-heading > small, | |
.list-group-item.active:hover .list-group-item-heading > small, | |
.list-group-item.active:focus .list-group-item-heading > small, | |
.list-group-item.active .list-group-item-heading > .small, | |
.list-group-item.active:hover .list-group-item-heading > .small, | |
.list-group-item.active:focus .list-group-item-heading > .small { | |
color: inherit; | |
} | |
.list-group-item.active .list-group-item-text, | |
.list-group-item.active:hover .list-group-item-text, | |
.list-group-item.active:focus .list-group-item-text { | |
color: #c7ddef; | |
} | |
.list-group-item-success { | |
color: #3c763d; | |
background-color: #dff0d8; | |
} | |
a.list-group-item-success, | |
button.list-group-item-success { | |
color: #3c763d; | |
} | |
a.list-group-item-success .list-group-item-heading, | |
button.list-group-item-success .list-group-item-heading { | |
color: inherit; | |
} | |
a.list-group-item-success:hover, | |
button.list-group-item-success:hover, | |
a.list-group-item-success:focus, | |
button.list-group-item-success:focus { | |
color: #3c763d; | |
background-color: #d0e9c6; | |
} | |
a.list-group-item-success.active, | |
button.list-group-item-success.active, | |
a.list-group-item-success.active:hover, | |
button.list-group-item-success.active:hover, | |
a.list-group-item-success.active:focus, | |
button.list-group-item-success.active:focus { | |
color: #fff; | |
background-color: #3c763d; | |
border-color: #3c763d; | |
} | |
.list-group-item-info { | |
color: #31708f; | |
background-color: #d9edf7; | |
} | |
a.list-group-item-info, | |
button.list-group-item-info { | |
color: #31708f; | |
} | |
a.list-group-item-info .list-group-item-heading, | |
button.list-group-item-info .list-group-item-heading { | |
color: inherit; | |
} | |
a.list-group-item-info:hover, | |
button.list-group-item-info:hover, | |
a.list-group-item-info:focus, | |
button.list-group-item-info:focus { | |
color: #31708f; | |
background-color: #c4e3f3; | |
} | |
a.list-group-item-info.active, | |
button.list-group-item-info.active, | |
a.list-group-item-info.active:hover, | |
button.list-group-item-info.active:hover, | |
a.list-group-item-info.active:focus, | |
button.list-group-item-info.active:focus { | |
color: #fff; | |
background-color: #31708f; | |
border-color: #31708f; | |
} | |
.list-group-item-warning { | |
color: #8a6d3b; | |
background-color: #fcf8e3; | |
} | |
a.list-group-item-warning, | |
button.list-group-item-warning { | |
color: #8a6d3b; | |
} | |
a.list-group-item-warning .list-group-item-heading, | |
button.list-group-item-warning .list-group-item-heading { | |
color: inherit; | |
} | |
a.list-group-item-warning:hover, | |
button.list-group-item-warning:hover, | |
a.list-group-item-warning:focus, | |
button.list-group-item-warning:focus { | |
color: #8a6d3b; | |
background-color: #faf2cc; | |
} | |
a.list-group-item-warning.active, | |
button.list-group-item-warning.active, | |
a.list-group-item-warning.active:hover, | |
button.list-group-item-warning.active:hover, | |
a.list-group-item-warning.active:focus, | |
button.list-group-item-warning.active:focus { | |
color: #fff; | |
background-color: #8a6d3b; | |
border-color: #8a6d3b; | |
} | |
.list-group-item-danger { | |
color: #a94442; | |
background-color: #f2dede; | |
} | |
a.list-group-item-danger, | |
button.list-group-item-danger { | |
color: #a94442; | |
} | |
a.list-group-item-danger .list-group-item-heading, | |
button.list-group-item-danger .list-group-item-heading { | |
color: inherit; | |
} | |
a.list-group-item-danger:hover, | |
button.list-group-item-danger:hover, | |
a.list-group-item-danger:focus, | |
button.list-group-item-danger:focus { | |
color: #a94442; | |
background-color: #ebcccc; | |
} | |
a.list-group-item-danger.active, | |
button.list-group-item-danger.active, | |
a.list-group-item-danger.active:hover, | |
button.list-group-item-danger.active:hover, | |
a.list-group-item-danger.active:focus, | |
button.list-group-item-danger.active:focus { | |
color: #fff; | |
background-color: #a94442; | |
border-color: #a94442; | |
} | |
.list-group-item-heading { | |
margin-top: 0; | |
margin-bottom: 5px; | |
} | |
.list-group-item-text { | |
margin-bottom: 0; | |
line-height: 1.3; | |
} | |
.panel { | |
margin-bottom: 18px; | |
background-color: #fff; | |
border: 1px solid transparent; | |
border-radius: 2px; | |
-webkit-box-shadow: 0 1px 1px rgba(0, 0, 0, 0.05); | |
box-shadow: 0 1px 1px rgba(0, 0, 0, 0.05); | |
} | |
.panel-body { | |
padding: 15px; | |
} | |
.panel-heading { | |
padding: 10px 15px; | |
border-bottom: 1px solid transparent; | |
border-top-right-radius: 1px; | |
border-top-left-radius: 1px; | |
} | |
.panel-heading > .dropdown .dropdown-toggle { | |
color: inherit; | |
} | |
.panel-title { | |
margin-top: 0; | |
margin-bottom: 0; | |
font-size: 15px; | |
color: inherit; | |
} | |
.panel-title > a, | |
.panel-title > small, | |
.panel-title > .small, | |
.panel-title > small > a, | |
.panel-title > .small > a { | |
color: inherit; | |
} | |
.panel-footer { | |
padding: 10px 15px; | |
background-color: #f5f5f5; | |
border-top: 1px solid #ddd; | |
border-bottom-right-radius: 1px; | |
border-bottom-left-radius: 1px; | |
} | |
.panel > .list-group, | |
.panel > .panel-collapse > .list-group { | |
margin-bottom: 0; | |
} | |
.panel > .list-group .list-group-item, | |
.panel > .panel-collapse > .list-group .list-group-item { | |
border-width: 1px 0; | |
border-radius: 0; | |
} | |
.panel > .list-group:first-child .list-group-item:first-child, | |
.panel > .panel-collapse > .list-group:first-child .list-group-item:first-child { | |
border-top: 0; | |
border-top-right-radius: 1px; | |
border-top-left-radius: 1px; | |
} | |
.panel > .list-group:last-child .list-group-item:last-child, | |
.panel > .panel-collapse > .list-group:last-child .list-group-item:last-child { | |
border-bottom: 0; | |
border-bottom-right-radius: 1px; | |
border-bottom-left-radius: 1px; | |
} | |
.panel > .panel-heading + .panel-collapse > .list-group .list-group-item:first-child { | |
border-top-right-radius: 0; | |
border-top-left-radius: 0; | |
} | |
.panel-heading + .list-group .list-group-item:first-child { | |
border-top-width: 0; | |
} | |
.list-group + .panel-footer { | |
border-top-width: 0; | |
} | |
.panel > .table, | |
.panel > .table-responsive > .table, | |
.panel > .panel-collapse > .table { | |
margin-bottom: 0; | |
} | |
.panel > .table caption, | |
.panel > .table-responsive > .table caption, | |
.panel > .panel-collapse > .table caption { | |
padding-left: 15px; | |
padding-right: 15px; | |
} | |
.panel > .table:first-child, | |
.panel > .table-responsive:first-child > .table:first-child { | |
border-top-right-radius: 1px; | |
border-top-left-radius: 1px; | |
} | |
.panel > .table:first-child > thead:first-child > tr:first-child, | |
.panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child, | |
.panel > .table:first-child > tbody:first-child > tr:first-child, | |
.panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child { | |
border-top-left-radius: 1px; | |
border-top-right-radius: 1px; | |
} | |
.panel > .table:first-child > thead:first-child > tr:first-child td:first-child, | |
.panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child td:first-child, | |
.panel > .table:first-child > tbody:first-child > tr:first-child td:first-child, | |
.panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child td:first-child, | |
.panel > .table:first-child > thead:first-child > tr:first-child th:first-child, | |
.panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child th:first-child, | |
.panel > .table:first-child > tbody:first-child > tr:first-child th:first-child, | |
.panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child th:first-child { | |
border-top-left-radius: 1px; | |
} | |
.panel > .table:first-child > thead:first-child > tr:first-child td:last-child, | |
.panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child td:last-child, | |
.panel > .table:first-child > tbody:first-child > tr:first-child td:last-child, | |
.panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child td:last-child, | |
.panel > .table:first-child > thead:first-child > tr:first-child th:last-child, | |
.panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child th:last-child, | |
.panel > .table:first-child > tbody:first-child > tr:first-child th:last-child, | |
.panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child th:last-child { | |
border-top-right-radius: 1px; | |
} | |
.panel > .table:last-child, | |
.panel > .table-responsive:last-child > .table:last-child { | |
border-bottom-right-radius: 1px; | |
border-bottom-left-radius: 1px; | |
} | |
.panel > .table:last-child > tbody:last-child > tr:last-child, | |
.panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child, | |
.panel > .table:last-child > tfoot:last-child > tr:last-child, | |
.panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child { | |
border-bottom-left-radius: 1px; | |
border-bottom-right-radius: 1px; | |
} | |
.panel > .table:last-child > tbody:last-child > tr:last-child td:first-child, | |
.panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child td:first-child, | |
.panel > .table:last-child > tfoot:last-child > tr:last-child td:first-child, | |
.panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child td:first-child, | |
.panel > .table:last-child > tbody:last-child > tr:last-child th:first-child, | |
.panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child th:first-child, | |
.panel > .table:last-child > tfoot:last-child > tr:last-child th:first-child, | |
.panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child th:first-child { | |
border-bottom-left-radius: 1px; | |
} | |
.panel > .table:last-child > tbody:last-child > tr:last-child td:last-child, | |
.panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child td:last-child, | |
.panel > .table:last-child > tfoot:last-child > tr:last-child td:last-child, | |
.panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child td:last-child, | |
.panel > .table:last-child > tbody:last-child > tr:last-child th:last-child, | |
.panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child th:last-child, | |
.panel > .table:last-child > tfoot:last-child > tr:last-child th:last-child, | |
.panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child th:last-child { | |
border-bottom-right-radius: 1px; | |
} | |
.panel > .panel-body + .table, | |
.panel > .panel-body + .table-responsive, | |
.panel > .table + .panel-body, | |
.panel > .table-responsive + .panel-body { | |
border-top: 1px solid #ddd; | |
} | |
.panel > .table > tbody:first-child > tr:first-child th, | |
.panel > .table > tbody:first-child > tr:first-child td { | |
border-top: 0; | |
} | |
.panel > .table-bordered, | |
.panel > .table-responsive > .table-bordered { | |
border: 0; | |
} | |
.panel > .table-bordered > thead > tr > th:first-child, | |
.panel > .table-responsive > .table-bordered > thead > tr > th:first-child, | |
.panel > .table-bordered > tbody > tr > th:first-child, | |
.panel > .table-responsive > .table-bordered > tbody > tr > th:first-child, | |
.panel > .table-bordered > tfoot > tr > th:first-child, | |
.panel > .table-responsive > .table-bordered > tfoot > tr > th:first-child, | |
.panel > .table-bordered > thead > tr > td:first-child, | |
.panel > .table-responsive > .table-bordered > thead > tr > td:first-child, | |
.panel > .table-bordered > tbody > tr > td:first-child, | |
.panel > .table-responsive > .table-bordered > tbody > tr > td:first-child, | |
.panel > .table-bordered > tfoot > tr > td:first-child, | |
.panel > .table-responsive > .table-bordered > tfoot > tr > td:first-child { | |
border-left: 0; | |
} | |
.panel > .table-bordered > thead > tr > th:last-child, | |
.panel > .table-responsive > .table-bordered > thead > tr > th:last-child, | |
.panel > .table-bordered > tbody > tr > th:last-child, | |
.panel > .table-responsive > .table-bordered > tbody > tr > th:last-child, | |
.panel > .table-bordered > tfoot > tr > th:last-child, | |
.panel > .table-responsive > .table-bordered > tfoot > tr > th:last-child, | |
.panel > .table-bordered > thead > tr > td:last-child, | |
.panel > .table-responsive > .table-bordered > thead > tr > td:last-child, | |
.panel > .table-bordered > tbody > tr > td:last-child, | |
.panel > .table-responsive > .table-bordered > tbody > tr > td:last-child, | |
.panel > .table-bordered > tfoot > tr > td:last-child, | |
.panel > .table-responsive > .table-bordered > tfoot > tr > td:last-child { | |
border-right: 0; | |
} | |
.panel > .table-bordered > thead > tr:first-child > td, | |
.panel > .table-responsive > .table-bordered > thead > tr:first-child > td, | |
.panel > .table-bordered > tbody > tr:first-child > td, | |
.panel > .table-responsive > .table-bordered > tbody > tr:first-child > td, | |
.panel > .table-bordered > thead > tr:first-child > th, | |
.panel > .table-responsive > .table-bordered > thead > tr:first-child > th, | |
.panel > .table-bordered > tbody > tr:first-child > th, | |
.panel > .table-responsive > .table-bordered > tbody > tr:first-child > th { | |
border-bottom: 0; | |
} | |
.panel > .table-bordered > tbody > tr:last-child > td, | |
.panel > .table-responsive > .table-bordered > tbody > tr:last-child > td, | |
.panel > .table-bordered > tfoot > tr:last-child > td, | |
.panel > .table-responsive > .table-bordered > tfoot > tr:last-child > td, | |
.panel > .table-bordered > tbody > tr:last-child > th, | |
.panel > .table-responsive > .table-bordered > tbody > tr:last-child > th, | |
.panel > .table-bordered > tfoot > tr:last-child > th, | |
.panel > .table-responsive > .table-bordered > tfoot > tr:last-child > th { | |
border-bottom: 0; | |
} | |
.panel > .table-responsive { | |
border: 0; | |
margin-bottom: 0; | |
} | |
.panel-group { | |
margin-bottom: 18px; | |
} | |
.panel-group .panel { | |
margin-bottom: 0; | |
border-radius: 2px; | |
} | |
.panel-group .panel + .panel { | |
margin-top: 5px; | |
} | |
.panel-group .panel-heading { | |
border-bottom: 0; | |
} | |
.panel-group .panel-heading + .panel-collapse > .panel-body, | |
.panel-group .panel-heading + .panel-collapse > .list-group { | |
border-top: 1px solid #ddd; | |
} | |
.panel-group .panel-footer { | |
border-top: 0; | |
} | |
.panel-group .panel-footer + .panel-collapse .panel-body { | |
border-bottom: 1px solid #ddd; | |
} | |
.panel-default { | |
border-color: #ddd; | |
} | |
.panel-default > .panel-heading { | |
color: #333333; | |
background-color: #f5f5f5; | |
border-color: #ddd; | |
} | |
.panel-default > .panel-heading + .panel-collapse > .panel-body { | |
border-top-color: #ddd; | |
} | |
.panel-default > .panel-heading .badge { | |
color: #f5f5f5; | |
background-color: #333333; | |
} | |
.panel-default > .panel-footer + .panel-collapse > .panel-body { | |
border-bottom-color: #ddd; | |
} | |
.panel-primary { | |
border-color: #337ab7; | |
} | |
.panel-primary > .panel-heading { | |
color: #fff; | |
background-color: #337ab7; | |
border-color: #337ab7; | |
} | |
.panel-primary > .panel-heading + .panel-collapse > .panel-body { | |
border-top-color: #337ab7; | |
} | |
.panel-primary > .panel-heading .badge { | |
color: #337ab7; | |
background-color: #fff; | |
} | |
.panel-primary > .panel-footer + .panel-collapse > .panel-body { | |
border-bottom-color: #337ab7; | |
} | |
.panel-success { | |
border-color: #d6e9c6; | |
} | |
.panel-success > .panel-heading { | |
color: #3c763d; | |
background-color: #dff0d8; | |
border-color: #d6e9c6; | |
} | |
.panel-success > .panel-heading + .panel-collapse > .panel-body { | |
border-top-color: #d6e9c6; | |
} | |
.panel-success > .panel-heading .badge { | |
color: #dff0d8; | |
background-color: #3c763d; | |
} | |
.panel-success > .panel-footer + .panel-collapse > .panel-body { | |
border-bottom-color: #d6e9c6; | |
} | |
.panel-info { | |
border-color: #bce8f1; | |
} | |
.panel-info > .panel-heading { | |
color: #31708f; | |
background-color: #d9edf7; | |
border-color: #bce8f1; | |
} | |
.panel-info > .panel-heading + .panel-collapse > .panel-body { | |
border-top-color: #bce8f1; | |
} | |
.panel-info > .panel-heading .badge { | |
color: #d9edf7; | |
background-color: #31708f; | |
} | |
.panel-info > .panel-footer + .panel-collapse > .panel-body { | |
border-bottom-color: #bce8f1; | |
} | |
.panel-warning { | |
border-color: #faebcc; | |
} | |
.panel-warning > .panel-heading { | |
color: #8a6d3b; | |
background-color: #fcf8e3; | |
border-color: #faebcc; | |
} | |
.panel-warning > .panel-heading + .panel-collapse > .panel-body { | |
border-top-color: #faebcc; | |
} | |
.panel-warning > .panel-heading .badge { | |
color: #fcf8e3; | |
background-color: #8a6d3b; | |
} | |
.panel-warning > .panel-footer + .panel-collapse > .panel-body { | |
border-bottom-color: #faebcc; | |
} | |
.panel-danger { | |
border-color: #ebccd1; | |
} | |
.panel-danger > .panel-heading { | |
color: #a94442; | |
background-color: #f2dede; | |
border-color: #ebccd1; | |
} | |
.panel-danger > .panel-heading + .panel-collapse > .panel-body { | |
border-top-color: #ebccd1; | |
} | |
.panel-danger > .panel-heading .badge { | |
color: #f2dede; | |
background-color: #a94442; | |
} | |
.panel-danger > .panel-footer + .panel-collapse > .panel-body { | |
border-bottom-color: #ebccd1; | |
} | |
.embed-responsive { | |
position: relative; | |
display: block; | |
height: 0; | |
padding: 0; | |
overflow: hidden; | |
} | |
.embed-responsive .embed-responsive-item, | |
.embed-responsive iframe, | |
.embed-responsive embed, | |
.embed-responsive object, | |
.embed-responsive video { | |
position: absolute; | |
top: 0; | |
left: 0; | |
bottom: 0; | |
height: 100%; | |
width: 100%; | |
border: 0; | |
} | |
.embed-responsive-16by9 { | |
padding-bottom: 56.25%; | |
} | |
.embed-responsive-4by3 { | |
padding-bottom: 75%; | |
} | |
.well { | |
min-height: 20px; | |
padding: 19px; | |
margin-bottom: 20px; | |
background-color: #f5f5f5; | |
border: 1px solid #e3e3e3; | |
border-radius: 2px; | |
-webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.05); | |
box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.05); | |
} | |
.well blockquote { | |
border-color: #ddd; | |
border-color: rgba(0, 0, 0, 0.15); | |
} | |
.well-lg { | |
padding: 24px; | |
border-radius: 3px; | |
} | |
.well-sm { | |
padding: 9px; | |
border-radius: 1px; | |
} | |
.close { | |
float: right; | |
font-size: 19.5px; | |
font-weight: bold; | |
line-height: 1; | |
color: #000; | |
text-shadow: 0 1px 0 #fff; | |
opacity: 0.2; | |
filter: alpha(opacity=20); | |
} | |
.close:hover, | |
.close:focus { | |
color: #000; | |
text-decoration: none; | |
cursor: pointer; | |
opacity: 0.5; | |
filter: alpha(opacity=50); | |
} | |
button.close { | |
padding: 0; | |
cursor: pointer; | |
background: transparent; | |
border: 0; | |
-webkit-appearance: none; | |
} | |
.modal-open { | |
overflow: hidden; | |
} | |
.modal { | |
display: none; | |
overflow: hidden; | |
position: fixed; | |
top: 0; | |
right: 0; | |
bottom: 0; | |
left: 0; | |
z-index: 1050; | |
-webkit-overflow-scrolling: touch; | |
outline: 0; | |
} | |
.modal.fade .modal-dialog { | |
-webkit-transform: translate(0, -25%); | |
-ms-transform: translate(0, -25%); | |
-o-transform: translate(0, -25%); | |
transform: translate(0, -25%); | |
-webkit-transition: -webkit-transform 0.3s ease-out; | |
-moz-transition: -moz-transform 0.3s ease-out; | |
-o-transition: -o-transform 0.3s ease-out; | |
transition: transform 0.3s ease-out; | |
} | |
.modal.in .modal-dialog { | |
-webkit-transform: translate(0, 0); | |
-ms-transform: translate(0, 0); | |
-o-transform: translate(0, 0); | |
transform: translate(0, 0); | |
} | |
.modal-open .modal { | |
overflow-x: hidden; | |
overflow-y: auto; | |
} | |
.modal-dialog { | |
position: relative; | |
width: auto; | |
margin: 10px; | |
} | |
.modal-content { | |
position: relative; | |
background-color: #fff; | |
border: 1px solid #999; | |
border: 1px solid rgba(0, 0, 0, 0.2); | |
border-radius: 3px; | |
-webkit-box-shadow: 0 3px 9px rgba(0, 0, 0, 0.5); | |
box-shadow: 0 3px 9px rgba(0, 0, 0, 0.5); | |
background-clip: padding-box; | |
outline: 0; | |
} | |
.modal-backdrop { | |
position: fixed; | |
top: 0; | |
right: 0; | |
bottom: 0; | |
left: 0; | |
z-index: 1040; | |
background-color: #000; | |
} | |
.modal-backdrop.fade { | |
opacity: 0; | |
filter: alpha(opacity=0); | |
} | |
.modal-backdrop.in { | |
opacity: 0.5; | |
filter: alpha(opacity=50); | |
} | |
.modal-header { | |
padding: 15px; | |
border-bottom: 1px solid #e5e5e5; | |
} | |
.modal-header .close { | |
margin-top: -2px; | |
} | |
.modal-title { | |
margin: 0; | |
line-height: 1.42857143; | |
} | |
.modal-body { | |
position: relative; | |
padding: 15px; | |
} | |
.modal-footer { | |
padding: 15px; | |
text-align: right; | |
border-top: 1px solid #e5e5e5; | |
} | |
.modal-footer .btn + .btn { | |
margin-left: 5px; | |
margin-bottom: 0; | |
} | |
.modal-footer .btn-group .btn + .btn { | |
margin-left: -1px; | |
} | |
.modal-footer .btn-block + .btn-block { | |
margin-left: 0; | |
} | |
.modal-scrollbar-measure { | |
position: absolute; | |
top: -9999px; | |
width: 50px; | |
height: 50px; | |
overflow: scroll; | |
} | |
@media (min-width: 768px) { | |
.modal-dialog { | |
width: 600px; | |
margin: 30px auto; | |
} | |
.modal-content { | |
-webkit-box-shadow: 0 5px 15px rgba(0, 0, 0, 0.5); | |
box-shadow: 0 5px 15px rgba(0, 0, 0, 0.5); | |
} | |
.modal-sm { | |
width: 300px; | |
} | |
} | |
@media (min-width: 992px) { | |
.modal-lg { | |
width: 900px; | |
} | |
} | |
.tooltip { | |
position: absolute; | |
z-index: 1070; | |
display: block; | |
font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; | |
font-style: normal; | |
font-weight: normal; | |
letter-spacing: normal; | |
line-break: auto; | |
line-height: 1.42857143; | |
text-align: left; | |
text-align: start; | |
text-decoration: none; | |
text-shadow: none; | |
text-transform: none; | |
white-space: normal; | |
word-break: normal; | |
word-spacing: normal; | |
word-wrap: normal; | |
font-size: 12px; | |
opacity: 0; | |
filter: alpha(opacity=0); | |
} | |
.tooltip.in { | |
opacity: 0.9; | |
filter: alpha(opacity=90); | |
} | |
.tooltip.top { | |
margin-top: -3px; | |
padding: 5px 0; | |
} | |
.tooltip.right { | |
margin-left: 3px; | |
padding: 0 5px; | |
} | |
.tooltip.bottom { | |
margin-top: 3px; | |
padding: 5px 0; | |
} | |
.tooltip.left { | |
margin-left: -3px; | |
padding: 0 5px; | |
} | |
.tooltip-inner { | |
max-width: 200px; | |
padding: 3px 8px; | |
color: #fff; | |
text-align: center; | |
background-color: #000; | |
border-radius: 2px; | |
} | |
.tooltip-arrow { | |
position: absolute; | |
width: 0; | |
height: 0; | |
border-color: transparent; | |
border-style: solid; | |
} | |
.tooltip.top .tooltip-arrow { | |
bottom: 0; | |
left: 50%; | |
margin-left: -5px; | |
border-width: 5px 5px 0; | |
border-top-color: #000; | |
} | |
.tooltip.top-left .tooltip-arrow { | |
bottom: 0; | |
right: 5px; | |
margin-bottom: -5px; | |
border-width: 5px 5px 0; | |
border-top-color: #000; | |
} | |
.tooltip.top-right .tooltip-arrow { | |
bottom: 0; | |
left: 5px; | |
margin-bottom: -5px; | |
border-width: 5px 5px 0; | |
border-top-color: #000; | |
} | |
.tooltip.right .tooltip-arrow { | |
top: 50%; | |
left: 0; | |
margin-top: -5px; | |
border-width: 5px 5px 5px 0; | |
border-right-color: #000; | |
} | |
.tooltip.left .tooltip-arrow { | |
top: 50%; | |
right: 0; | |
margin-top: -5px; | |
border-width: 5px 0 5px 5px; | |
border-left-color: #000; | |
} | |
.tooltip.bottom .tooltip-arrow { | |
top: 0; | |
left: 50%; | |
margin-left: -5px; | |
border-width: 0 5px 5px; | |
border-bottom-color: #000; | |
} | |
.tooltip.bottom-left .tooltip-arrow { | |
top: 0; | |
right: 5px; | |
margin-top: -5px; | |
border-width: 0 5px 5px; | |
border-bottom-color: #000; | |
} | |
.tooltip.bottom-right .tooltip-arrow { | |
top: 0; | |
left: 5px; | |
margin-top: -5px; | |
border-width: 0 5px 5px; | |
border-bottom-color: #000; | |
} | |
.popover { | |
position: absolute; | |
top: 0; | |
left: 0; | |
z-index: 1060; | |
display: none; | |
max-width: 276px; | |
padding: 1px; | |
font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; | |
font-style: normal; | |
font-weight: normal; | |
letter-spacing: normal; | |
line-break: auto; | |
line-height: 1.42857143; | |
text-align: left; | |
text-align: start; | |
text-decoration: none; | |
text-shadow: none; | |
text-transform: none; | |
white-space: normal; | |
word-break: normal; | |
word-spacing: normal; | |
word-wrap: normal; | |
font-size: 13px; | |
background-color: #fff; | |
background-clip: padding-box; | |
border: 1px solid #ccc; | |
border: 1px solid rgba(0, 0, 0, 0.2); | |
border-radius: 3px; | |
-webkit-box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2); | |
box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2); | |
} | |
.popover.top { | |
margin-top: -10px; | |
} | |
.popover.right { | |
margin-left: 10px; | |
} | |
.popover.bottom { | |
margin-top: 10px; | |
} | |
.popover.left { | |
margin-left: -10px; | |
} | |
.popover-title { | |
margin: 0; | |
padding: 8px 14px; | |
font-size: 13px; | |
background-color: #f7f7f7; | |
border-bottom: 1px solid #ebebeb; | |
border-radius: 2px 2px 0 0; | |
} | |
.popover-content { | |
padding: 9px 14px; | |
} | |
.popover > .arrow, | |
.popover > .arrow:after { | |
position: absolute; | |
display: block; | |
width: 0; | |
height: 0; | |
border-color: transparent; | |
border-style: solid; | |
} | |
.popover > .arrow { | |
border-width: 11px; | |
} | |
.popover > .arrow:after { | |
border-width: 10px; | |
content: ""; | |
} | |
.popover.top > .arrow { | |
left: 50%; | |
margin-left: -11px; | |
border-bottom-width: 0; | |
border-top-color: #999999; | |
border-top-color: rgba(0, 0, 0, 0.25); | |
bottom: -11px; | |
} | |
.popover.top > .arrow:after { | |
content: " "; | |
bottom: 1px; | |
margin-left: -10px; | |
border-bottom-width: 0; | |
border-top-color: #fff; | |
} | |
.popover.right > .arrow { | |
top: 50%; | |
left: -11px; | |
margin-top: -11px; | |
border-left-width: 0; | |
border-right-color: #999999; | |
border-right-color: rgba(0, 0, 0, 0.25); | |
} | |
.popover.right > .arrow:after { | |
content: " "; | |
left: 1px; | |
bottom: -10px; | |
border-left-width: 0; | |
border-right-color: #fff; | |
} | |
.popover.bottom > .arrow { | |
left: 50%; | |
margin-left: -11px; | |
border-top-width: 0; | |
border-bottom-color: #999999; | |
border-bottom-color: rgba(0, 0, 0, 0.25); | |
top: -11px; | |
} | |
.popover.bottom > .arrow:after { | |
content: " "; | |
top: 1px; | |
margin-left: -10px; | |
border-top-width: 0; | |
border-bottom-color: #fff; | |
} | |
.popover.left > .arrow { | |
top: 50%; | |
right: -11px; | |
margin-top: -11px; | |
border-right-width: 0; | |
border-left-color: #999999; | |
border-left-color: rgba(0, 0, 0, 0.25); | |
} | |
.popover.left > .arrow:after { | |
content: " "; | |
right: 1px; | |
border-right-width: 0; | |
border-left-color: #fff; | |
bottom: -10px; | |
} | |
.carousel { | |
position: relative; | |
} | |
.carousel-inner { | |
position: relative; | |
overflow: hidden; | |
width: 100%; | |
} | |
.carousel-inner > .item { | |
display: none; | |
position: relative; | |
-webkit-transition: 0.6s ease-in-out left; | |
-o-transition: 0.6s ease-in-out left; | |
transition: 0.6s ease-in-out left; | |
} | |
.carousel-inner > .item > img, | |
.carousel-inner > .item > a > img { | |
line-height: 1; | |
} | |
@media all and (transform-3d), (-webkit-transform-3d) { | |
.carousel-inner > .item { | |
-webkit-transition: -webkit-transform 0.6s ease-in-out; | |
-moz-transition: -moz-transform 0.6s ease-in-out; | |
-o-transition: -o-transform 0.6s ease-in-out; | |
transition: transform 0.6s ease-in-out; | |
-webkit-backface-visibility: hidden; | |
-moz-backface-visibility: hidden; | |
backface-visibility: hidden; | |
-webkit-perspective: 1000px; | |
-moz-perspective: 1000px; | |
perspective: 1000px; | |
} | |
.carousel-inner > .item.next, | |
.carousel-inner > .item.active.right { | |
-webkit-transform: translate3d(100%, 0, 0); | |
transform: translate3d(100%, 0, 0); | |
left: 0; | |
} | |
.carousel-inner > .item.prev, | |
.carousel-inner > .item.active.left { | |
-webkit-transform: translate3d(-100%, 0, 0); | |
transform: translate3d(-100%, 0, 0); | |
left: 0; | |
} | |
.carousel-inner > .item.next.left, | |
.carousel-inner > .item.prev.right, | |
.carousel-inner > .item.active { | |
-webkit-transform: translate3d(0, 0, 0); | |
transform: translate3d(0, 0, 0); | |
left: 0; | |
} | |
} | |
.carousel-inner > .active, | |
.carousel-inner > .next, | |
.carousel-inner > .prev { | |
display: block; | |
} | |
.carousel-inner > .active { | |
left: 0; | |
} | |
.carousel-inner > .next, | |
.carousel-inner > .prev { | |
position: absolute; | |
top: 0; | |
width: 100%; | |
} | |
.carousel-inner > .next { | |
left: 100%; | |
} | |
.carousel-inner > .prev { | |
left: -100%; | |
} | |
.carousel-inner > .next.left, | |
.carousel-inner > .prev.right { | |
left: 0; | |
} | |
.carousel-inner > .active.left { | |
left: -100%; | |
} | |
.carousel-inner > .active.right { | |
left: 100%; | |
} | |
.carousel-control { | |
position: absolute; | |
top: 0; | |
left: 0; | |
bottom: 0; | |
width: 15%; | |
opacity: 0.5; | |
filter: alpha(opacity=50); | |
font-size: 20px; | |
color: #fff; | |
text-align: center; | |
text-shadow: 0 1px 2px rgba(0, 0, 0, 0.6); | |
background-color: rgba(0, 0, 0, 0); | |
} | |
.carousel-control.left { | |
background-image: -webkit-linear-gradient(left, rgba(0, 0, 0, 0.5) 0%, rgba(0, 0, 0, 0.0001) 100%); | |
background-image: -o-linear-gradient(left, rgba(0, 0, 0, 0.5) 0%, rgba(0, 0, 0, 0.0001) 100%); | |
background-image: linear-gradient(to right, rgba(0, 0, 0, 0.5) 0%, rgba(0, 0, 0, 0.0001) 100%); | |
background-repeat: repeat-x; | |
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#80000000', endColorstr='#00000000', GradientType=1); | |
} | |
.carousel-control.right { | |
left: auto; | |
right: 0; | |
background-image: -webkit-linear-gradient(left, rgba(0, 0, 0, 0.0001) 0%, rgba(0, 0, 0, 0.5) 100%); | |
background-image: -o-linear-gradient(left, rgba(0, 0, 0, 0.0001) 0%, rgba(0, 0, 0, 0.5) 100%); | |
background-image: linear-gradient(to right, rgba(0, 0, 0, 0.0001) 0%, rgba(0, 0, 0, 0.5) 100%); | |
background-repeat: repeat-x; | |
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#00000000', endColorstr='#80000000', GradientType=1); | |
} | |
.carousel-control:hover, | |
.carousel-control:focus { | |
outline: 0; | |
color: #fff; | |
text-decoration: none; | |
opacity: 0.9; | |
filter: alpha(opacity=90); | |
} | |
.carousel-control .icon-prev, | |
.carousel-control .icon-next, | |
.carousel-control .glyphicon-chevron-left, | |
.carousel-control .glyphicon-chevron-right { | |
position: absolute; | |
top: 50%; | |
margin-top: -10px; | |
z-index: 5; | |
display: inline-block; | |
} | |
.carousel-control .icon-prev, | |
.carousel-control .glyphicon-chevron-left { | |
left: 50%; | |
margin-left: -10px; | |
} | |
.carousel-control .icon-next, | |
.carousel-control .glyphicon-chevron-right { | |
right: 50%; | |
margin-right: -10px; | |
} | |
.carousel-control .icon-prev, | |
.carousel-control .icon-next { | |
width: 20px; | |
height: 20px; | |
line-height: 1; | |
font-family: serif; | |
} | |
.carousel-control .icon-prev:before { | |
content: '\2039'; | |
} | |
.carousel-control .icon-next:before { | |
content: '\203a'; | |
} | |
.carousel-indicators { | |
position: absolute; | |
bottom: 10px; | |
left: 50%; | |
z-index: 15; | |
width: 60%; | |
margin-left: -30%; | |
padding-left: 0; | |
list-style: none; | |
text-align: center; | |
} | |
.carousel-indicators li { | |
display: inline-block; | |
width: 10px; | |
height: 10px; | |
margin: 1px; | |
text-indent: -999px; | |
border: 1px solid #fff; | |
border-radius: 10px; | |
cursor: pointer; | |
background-color: #000 \9; | |
background-color: rgba(0, 0, 0, 0); | |
} | |
.carousel-indicators .active { | |
margin: 0; | |
width: 12px; | |
height: 12px; | |
background-color: #fff; | |
} | |
.carousel-caption { | |
position: absolute; | |
left: 15%; | |
right: 15%; | |
bottom: 20px; | |
z-index: 10; | |
padding-top: 20px; | |
padding-bottom: 20px; | |
color: #fff; | |
text-align: center; | |
text-shadow: 0 1px 2px rgba(0, 0, 0, 0.6); | |
} | |
.carousel-caption .btn { | |
text-shadow: none; | |
} | |
@media screen and (min-width: 768px) { | |
.carousel-control .glyphicon-chevron-left, | |
.carousel-control .glyphicon-chevron-right, | |
.carousel-control .icon-prev, | |
.carousel-control .icon-next { | |
width: 30px; | |
height: 30px; | |
margin-top: -10px; | |
font-size: 30px; | |
} | |
.carousel-control .glyphicon-chevron-left, | |
.carousel-control .icon-prev { | |
margin-left: -10px; | |
} | |
.carousel-control .glyphicon-chevron-right, | |
.carousel-control .icon-next { | |
margin-right: -10px; | |
} | |
.carousel-caption { | |
left: 20%; | |
right: 20%; | |
padding-bottom: 30px; | |
} | |
.carousel-indicators { | |
bottom: 20px; | |
} | |
} | |
.clearfix:before, | |
.clearfix:after, | |
.dl-horizontal dd:before, | |
.dl-horizontal dd:after, | |
.container:before, | |
.container:after, | |
.container-fluid:before, | |
.container-fluid:after, | |
.row:before, | |
.row:after, | |
.form-horizontal .form-group:before, | |
.form-horizontal .form-group:after, | |
.btn-toolbar:before, | |
.btn-toolbar:after, | |
.btn-group-vertical > .btn-group:before, | |
.btn-group-vertical > .btn-group:after, | |
.nav:before, | |
.nav:after, | |
.navbar:before, | |
.navbar:after, | |
.navbar-header:before, | |
.navbar-header:after, | |
.navbar-collapse:before, | |
.navbar-collapse:after, | |
.pager:before, | |
.pager:after, | |
.panel-body:before, | |
.panel-body:after, | |
.modal-header:before, | |
.modal-header:after, | |
.modal-footer:before, | |
.modal-footer:after, | |
.item_buttons:before, | |
.item_buttons:after { | |
content: " "; | |
display: table; | |
} | |
.clearfix:after, | |
.dl-horizontal dd:after, | |
.container:after, | |
.container-fluid:after, | |
.row:after, | |
.form-horizontal .form-group:after, | |
.btn-toolbar:after, | |
.btn-group-vertical > .btn-group:after, | |
.nav:after, | |
.navbar:after, | |
.navbar-header:after, | |
.navbar-collapse:after, | |
.pager:after, | |
.panel-body:after, | |
.modal-header:after, | |
.modal-footer:after, | |
.item_buttons:after { | |
clear: both; | |
} | |
.center-block { | |
display: block; | |
margin-left: auto; | |
margin-right: auto; | |
} | |
.pull-right { | |
float: right !important; | |
} | |
.pull-left { | |
float: left !important; | |
} | |
.hide { | |
display: none !important; | |
} | |
.show { | |
display: block !important; | |
} | |
.invisible { | |
visibility: hidden; | |
} | |
.text-hide { | |
font: 0/0 a; | |
color: transparent; | |
text-shadow: none; | |
background-color: transparent; | |
border: 0; | |
} | |
.hidden { | |
display: none !important; | |
} | |
.affix { | |
position: fixed; | |
} | |
@-ms-viewport { | |
width: device-width; | |
} | |
.visible-xs, | |
.visible-sm, | |
.visible-md, | |
.visible-lg { | |
display: none !important; | |
} | |
.visible-xs-block, | |
.visible-xs-inline, | |
.visible-xs-inline-block, | |
.visible-sm-block, | |
.visible-sm-inline, | |
.visible-sm-inline-block, | |
.visible-md-block, | |
.visible-md-inline, | |
.visible-md-inline-block, | |
.visible-lg-block, | |
.visible-lg-inline, | |
.visible-lg-inline-block { | |
display: none !important; | |
} | |
@media (max-width: 767px) { | |
.visible-xs { | |
display: block !important; | |
} | |
table.visible-xs { | |
display: table !important; | |
} | |
tr.visible-xs { | |
display: table-row !important; | |
} | |
th.visible-xs, | |
td.visible-xs { | |
display: table-cell !important; | |
} | |
} | |
@media (max-width: 767px) { | |
.visible-xs-block { | |
display: block !important; | |
} | |
} | |
@media (max-width: 767px) { | |
.visible-xs-inline { | |
display: inline !important; | |
} | |
} | |
@media (max-width: 767px) { | |
.visible-xs-inline-block { | |
display: inline-block !important; | |
} | |
} | |
@media (min-width: 768px) and (max-width: 991px) { | |
.visible-sm { | |
display: block !important; | |
} | |
table.visible-sm { | |
display: table !important; | |
} | |
tr.visible-sm { | |
display: table-row !important; | |
} | |
th.visible-sm, | |
td.visible-sm { | |
display: table-cell !important; | |
} | |
} | |
@media (min-width: 768px) and (max-width: 991px) { | |
.visible-sm-block { | |
display: block !important; | |
} | |
} | |
@media (min-width: 768px) and (max-width: 991px) { | |
.visible-sm-inline { | |
display: inline !important; | |
} | |
} | |
@media (min-width: 768px) and (max-width: 991px) { | |
.visible-sm-inline-block { | |
display: inline-block !important; | |
} | |
} | |
@media (min-width: 992px) and (max-width: 1199px) { | |
.visible-md { | |
display: block !important; | |
} | |
table.visible-md { | |
display: table !important; | |
} | |
tr.visible-md { | |
display: table-row !important; | |
} | |
th.visible-md, | |
td.visible-md { | |
display: table-cell !important; | |
} | |
} | |
@media (min-width: 992px) and (max-width: 1199px) { | |
.visible-md-block { | |
display: block !important; | |
} | |
} | |
@media (min-width: 992px) and (max-width: 1199px) { | |
.visible-md-inline { | |
display: inline !important; | |
} | |
} | |
@media (min-width: 992px) and (max-width: 1199px) { | |
.visible-md-inline-block { | |
display: inline-block !important; | |
} | |
} | |
@media (min-width: 1200px) { | |
.visible-lg { | |
display: block !important; | |
} | |
table.visible-lg { | |
display: table !important; | |
} | |
tr.visible-lg { | |
display: table-row !important; | |
} | |
th.visible-lg, | |
td.visible-lg { | |
display: table-cell !important; | |
} | |
} | |
@media (min-width: 1200px) { | |
.visible-lg-block { | |
display: block !important; | |
} | |
} | |
@media (min-width: 1200px) { | |
.visible-lg-inline { | |
display: inline !important; | |
} | |
} | |
@media (min-width: 1200px) { | |
.visible-lg-inline-block { | |
display: inline-block !important; | |
} | |
} | |
@media (max-width: 767px) { | |
.hidden-xs { | |
display: none !important; | |
} | |
} | |
@media (min-width: 768px) and (max-width: 991px) { | |
.hidden-sm { | |
display: none !important; | |
} | |
} | |
@media (min-width: 992px) and (max-width: 1199px) { | |
.hidden-md { | |
display: none !important; | |
} | |
} | |
@media (min-width: 1200px) { | |
.hidden-lg { | |
display: none !important; | |
} | |
} | |
.visible-print { | |
display: none !important; | |
} | |
@media print { | |
.visible-print { | |
display: block !important; | |
} | |
table.visible-print { | |
display: table !important; | |
} | |
tr.visible-print { | |
display: table-row !important; | |
} | |
th.visible-print, | |
td.visible-print { | |
display: table-cell !important; | |
} | |
} | |
.visible-print-block { | |
display: none !important; | |
} | |
@media print { | |
.visible-print-block { | |
display: block !important; | |
} | |
} | |
.visible-print-inline { | |
display: none !important; | |
} | |
@media print { | |
.visible-print-inline { | |
display: inline !important; | |
} | |
} | |
.visible-print-inline-block { | |
display: none !important; | |
} | |
@media print { | |
.visible-print-inline-block { | |
display: inline-block !important; | |
} | |
} | |
@media print { | |
.hidden-print { | |
display: none !important; | |
} | |
} | |
/*! | |
* | |
* Font Awesome | |
* | |
*/ | |
/*! | |
* Font Awesome 4.7.0 by @davegandy - http://fontawesome.io - @fontawesome | |
* License - http://fontawesome.io/license (Font: SIL OFL 1.1, CSS: MIT License) | |
*/ | |
/* FONT PATH | |
* -------------------------- */ | |
@font-face { | |
font-family: 'FontAwesome'; | |
src: url('../components/font-awesome/fonts/fontawesome-webfont.eot?v=4.7.0'); | |
src: url('../components/font-awesome/fonts/fontawesome-webfont.eot?#iefix&v=4.7.0') format('embedded-opentype'), url('../components/font-awesome/fonts/fontawesome-webfont.woff2?v=4.7.0') format('woff2'), url('../components/font-awesome/fonts/fontawesome-webfont.woff?v=4.7.0') format('woff'), url('../components/font-awesome/fonts/fontawesome-webfont.ttf?v=4.7.0') format('truetype'), url('../components/font-awesome/fonts/fontawesome-webfont.svg?v=4.7.0#fontawesomeregular') format('svg'); | |
font-weight: normal; | |
font-style: normal; | |
} | |
.fa { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
} | |
/* makes the font 33% larger relative to the icon container */ | |
.fa-lg { | |
font-size: 1.33333333em; | |
line-height: 0.75em; | |
vertical-align: -15%; | |
} | |
.fa-2x { | |
font-size: 2em; | |
} | |
.fa-3x { | |
font-size: 3em; | |
} | |
.fa-4x { | |
font-size: 4em; | |
} | |
.fa-5x { | |
font-size: 5em; | |
} | |
.fa-fw { | |
width: 1.28571429em; | |
text-align: center; | |
} | |
.fa-ul { | |
padding-left: 0; | |
margin-left: 2.14285714em; | |
list-style-type: none; | |
} | |
.fa-ul > li { | |
position: relative; | |
} | |
.fa-li { | |
position: absolute; | |
left: -2.14285714em; | |
width: 2.14285714em; | |
top: 0.14285714em; | |
text-align: center; | |
} | |
.fa-li.fa-lg { | |
left: -1.85714286em; | |
} | |
.fa-border { | |
padding: .2em .25em .15em; | |
border: solid 0.08em #eee; | |
border-radius: .1em; | |
} | |
.fa-pull-left { | |
float: left; | |
} | |
.fa-pull-right { | |
float: right; | |
} | |
.fa.fa-pull-left { | |
margin-right: .3em; | |
} | |
.fa.fa-pull-right { | |
margin-left: .3em; | |
} | |
/* Deprecated as of 4.4.0 */ | |
.pull-right { | |
float: right; | |
} | |
.pull-left { | |
float: left; | |
} | |
.fa.pull-left { | |
margin-right: .3em; | |
} | |
.fa.pull-right { | |
margin-left: .3em; | |
} | |
.fa-spin { | |
-webkit-animation: fa-spin 2s infinite linear; | |
animation: fa-spin 2s infinite linear; | |
} | |
.fa-pulse { | |
-webkit-animation: fa-spin 1s infinite steps(8); | |
animation: fa-spin 1s infinite steps(8); | |
} | |
@-webkit-keyframes fa-spin { | |
0% { | |
-webkit-transform: rotate(0deg); | |
transform: rotate(0deg); | |
} | |
100% { | |
-webkit-transform: rotate(359deg); | |
transform: rotate(359deg); | |
} | |
} | |
@keyframes fa-spin { | |
0% { | |
-webkit-transform: rotate(0deg); | |
transform: rotate(0deg); | |
} | |
100% { | |
-webkit-transform: rotate(359deg); | |
transform: rotate(359deg); | |
} | |
} | |
.fa-rotate-90 { | |
-ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=1)"; | |
-webkit-transform: rotate(90deg); | |
-ms-transform: rotate(90deg); | |
transform: rotate(90deg); | |
} | |
.fa-rotate-180 { | |
-ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=2)"; | |
-webkit-transform: rotate(180deg); | |
-ms-transform: rotate(180deg); | |
transform: rotate(180deg); | |
} | |
.fa-rotate-270 { | |
-ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=3)"; | |
-webkit-transform: rotate(270deg); | |
-ms-transform: rotate(270deg); | |
transform: rotate(270deg); | |
} | |
.fa-flip-horizontal { | |
-ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=0, mirror=1)"; | |
-webkit-transform: scale(-1, 1); | |
-ms-transform: scale(-1, 1); | |
transform: scale(-1, 1); | |
} | |
.fa-flip-vertical { | |
-ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)"; | |
-webkit-transform: scale(1, -1); | |
-ms-transform: scale(1, -1); | |
transform: scale(1, -1); | |
} | |
:root .fa-rotate-90, | |
:root .fa-rotate-180, | |
:root .fa-rotate-270, | |
:root .fa-flip-horizontal, | |
:root .fa-flip-vertical { | |
filter: none; | |
} | |
.fa-stack { | |
position: relative; | |
display: inline-block; | |
width: 2em; | |
height: 2em; | |
line-height: 2em; | |
vertical-align: middle; | |
} | |
.fa-stack-1x, | |
.fa-stack-2x { | |
position: absolute; | |
left: 0; | |
width: 100%; | |
text-align: center; | |
} | |
.fa-stack-1x { | |
line-height: inherit; | |
} | |
.fa-stack-2x { | |
font-size: 2em; | |
} | |
.fa-inverse { | |
color: #fff; | |
} | |
/* Font Awesome uses the Unicode Private Use Area (PUA) to ensure screen | |
readers do not read off random characters that represent icons */ | |
.fa-glass:before { | |
content: "\f000"; | |
} | |
.fa-music:before { | |
content: "\f001"; | |
} | |
.fa-search:before { | |
content: "\f002"; | |
} | |
.fa-envelope-o:before { | |
content: "\f003"; | |
} | |
.fa-heart:before { | |
content: "\f004"; | |
} | |
.fa-star:before { | |
content: "\f005"; | |
} | |
.fa-star-o:before { | |
content: "\f006"; | |
} | |
.fa-user:before { | |
content: "\f007"; | |
} | |
.fa-film:before { | |
content: "\f008"; | |
} | |
.fa-th-large:before { | |
content: "\f009"; | |
} | |
.fa-th:before { | |
content: "\f00a"; | |
} | |
.fa-th-list:before { | |
content: "\f00b"; | |
} | |
.fa-check:before { | |
content: "\f00c"; | |
} | |
.fa-remove:before, | |
.fa-close:before, | |
.fa-times:before { | |
content: "\f00d"; | |
} | |
.fa-search-plus:before { | |
content: "\f00e"; | |
} | |
.fa-search-minus:before { | |
content: "\f010"; | |
} | |
.fa-power-off:before { | |
content: "\f011"; | |
} | |
.fa-signal:before { | |
content: "\f012"; | |
} | |
.fa-gear:before, | |
.fa-cog:before { | |
content: "\f013"; | |
} | |
.fa-trash-o:before { | |
content: "\f014"; | |
} | |
.fa-home:before { | |
content: "\f015"; | |
} | |
.fa-file-o:before { | |
content: "\f016"; | |
} | |
.fa-clock-o:before { | |
content: "\f017"; | |
} | |
.fa-road:before { | |
content: "\f018"; | |
} | |
.fa-download:before { | |
content: "\f019"; | |
} | |
.fa-arrow-circle-o-down:before { | |
content: "\f01a"; | |
} | |
.fa-arrow-circle-o-up:before { | |
content: "\f01b"; | |
} | |
.fa-inbox:before { | |
content: "\f01c"; | |
} | |
.fa-play-circle-o:before { | |
content: "\f01d"; | |
} | |
.fa-rotate-right:before, | |
.fa-repeat:before { | |
content: "\f01e"; | |
} | |
.fa-refresh:before { | |
content: "\f021"; | |
} | |
.fa-list-alt:before { | |
content: "\f022"; | |
} | |
.fa-lock:before { | |
content: "\f023"; | |
} | |
.fa-flag:before { | |
content: "\f024"; | |
} | |
.fa-headphones:before { | |
content: "\f025"; | |
} | |
.fa-volume-off:before { | |
content: "\f026"; | |
} | |
.fa-volume-down:before { | |
content: "\f027"; | |
} | |
.fa-volume-up:before { | |
content: "\f028"; | |
} | |
.fa-qrcode:before { | |
content: "\f029"; | |
} | |
.fa-barcode:before { | |
content: "\f02a"; | |
} | |
.fa-tag:before { | |
content: "\f02b"; | |
} | |
.fa-tags:before { | |
content: "\f02c"; | |
} | |
.fa-book:before { | |
content: "\f02d"; | |
} | |
.fa-bookmark:before { | |
content: "\f02e"; | |
} | |
.fa-print:before { | |
content: "\f02f"; | |
} | |
.fa-camera:before { | |
content: "\f030"; | |
} | |
.fa-font:before { | |
content: "\f031"; | |
} | |
.fa-bold:before { | |
content: "\f032"; | |
} | |
.fa-italic:before { | |
content: "\f033"; | |
} | |
.fa-text-height:before { | |
content: "\f034"; | |
} | |
.fa-text-width:before { | |
content: "\f035"; | |
} | |
.fa-align-left:before { | |
content: "\f036"; | |
} | |
.fa-align-center:before { | |
content: "\f037"; | |
} | |
.fa-align-right:before { | |
content: "\f038"; | |
} | |
.fa-align-justify:before { | |
content: "\f039"; | |
} | |
.fa-list:before { | |
content: "\f03a"; | |
} | |
.fa-dedent:before, | |
.fa-outdent:before { | |
content: "\f03b"; | |
} | |
.fa-indent:before { | |
content: "\f03c"; | |
} | |
.fa-video-camera:before { | |
content: "\f03d"; | |
} | |
.fa-photo:before, | |
.fa-image:before, | |
.fa-picture-o:before { | |
content: "\f03e"; | |
} | |
.fa-pencil:before { | |
content: "\f040"; | |
} | |
.fa-map-marker:before { | |
content: "\f041"; | |
} | |
.fa-adjust:before { | |
content: "\f042"; | |
} | |
.fa-tint:before { | |
content: "\f043"; | |
} | |
.fa-edit:before, | |
.fa-pencil-square-o:before { | |
content: "\f044"; | |
} | |
.fa-share-square-o:before { | |
content: "\f045"; | |
} | |
.fa-check-square-o:before { | |
content: "\f046"; | |
} | |
.fa-arrows:before { | |
content: "\f047"; | |
} | |
.fa-step-backward:before { | |
content: "\f048"; | |
} | |
.fa-fast-backward:before { | |
content: "\f049"; | |
} | |
.fa-backward:before { | |
content: "\f04a"; | |
} | |
.fa-play:before { | |
content: "\f04b"; | |
} | |
.fa-pause:before { | |
content: "\f04c"; | |
} | |
.fa-stop:before { | |
content: "\f04d"; | |
} | |
.fa-forward:before { | |
content: "\f04e"; | |
} | |
.fa-fast-forward:before { | |
content: "\f050"; | |
} | |
.fa-step-forward:before { | |
content: "\f051"; | |
} | |
.fa-eject:before { | |
content: "\f052"; | |
} | |
.fa-chevron-left:before { | |
content: "\f053"; | |
} | |
.fa-chevron-right:before { | |
content: "\f054"; | |
} | |
.fa-plus-circle:before { | |
content: "\f055"; | |
} | |
.fa-minus-circle:before { | |
content: "\f056"; | |
} | |
.fa-times-circle:before { | |
content: "\f057"; | |
} | |
.fa-check-circle:before { | |
content: "\f058"; | |
} | |
.fa-question-circle:before { | |
content: "\f059"; | |
} | |
.fa-info-circle:before { | |
content: "\f05a"; | |
} | |
.fa-crosshairs:before { | |
content: "\f05b"; | |
} | |
.fa-times-circle-o:before { | |
content: "\f05c"; | |
} | |
.fa-check-circle-o:before { | |
content: "\f05d"; | |
} | |
.fa-ban:before { | |
content: "\f05e"; | |
} | |
.fa-arrow-left:before { | |
content: "\f060"; | |
} | |
.fa-arrow-right:before { | |
content: "\f061"; | |
} | |
.fa-arrow-up:before { | |
content: "\f062"; | |
} | |
.fa-arrow-down:before { | |
content: "\f063"; | |
} | |
.fa-mail-forward:before, | |
.fa-share:before { | |
content: "\f064"; | |
} | |
.fa-expand:before { | |
content: "\f065"; | |
} | |
.fa-compress:before { | |
content: "\f066"; | |
} | |
.fa-plus:before { | |
content: "\f067"; | |
} | |
.fa-minus:before { | |
content: "\f068"; | |
} | |
.fa-asterisk:before { | |
content: "\f069"; | |
} | |
.fa-exclamation-circle:before { | |
content: "\f06a"; | |
} | |
.fa-gift:before { | |
content: "\f06b"; | |
} | |
.fa-leaf:before { | |
content: "\f06c"; | |
} | |
.fa-fire:before { | |
content: "\f06d"; | |
} | |
.fa-eye:before { | |
content: "\f06e"; | |
} | |
.fa-eye-slash:before { | |
content: "\f070"; | |
} | |
.fa-warning:before, | |
.fa-exclamation-triangle:before { | |
content: "\f071"; | |
} | |
.fa-plane:before { | |
content: "\f072"; | |
} | |
.fa-calendar:before { | |
content: "\f073"; | |
} | |
.fa-random:before { | |
content: "\f074"; | |
} | |
.fa-comment:before { | |
content: "\f075"; | |
} | |
.fa-magnet:before { | |
content: "\f076"; | |
} | |
.fa-chevron-up:before { | |
content: "\f077"; | |
} | |
.fa-chevron-down:before { | |
content: "\f078"; | |
} | |
.fa-retweet:before { | |
content: "\f079"; | |
} | |
.fa-shopping-cart:before { | |
content: "\f07a"; | |
} | |
.fa-folder:before { | |
content: "\f07b"; | |
} | |
.fa-folder-open:before { | |
content: "\f07c"; | |
} | |
.fa-arrows-v:before { | |
content: "\f07d"; | |
} | |
.fa-arrows-h:before { | |
content: "\f07e"; | |
} | |
.fa-bar-chart-o:before, | |
.fa-bar-chart:before { | |
content: "\f080"; | |
} | |
.fa-twitter-square:before { | |
content: "\f081"; | |
} | |
.fa-facebook-square:before { | |
content: "\f082"; | |
} | |
.fa-camera-retro:before { | |
content: "\f083"; | |
} | |
.fa-key:before { | |
content: "\f084"; | |
} | |
.fa-gears:before, | |
.fa-cogs:before { | |
content: "\f085"; | |
} | |
.fa-comments:before { | |
content: "\f086"; | |
} | |
.fa-thumbs-o-up:before { | |
content: "\f087"; | |
} | |
.fa-thumbs-o-down:before { | |
content: "\f088"; | |
} | |
.fa-star-half:before { | |
content: "\f089"; | |
} | |
.fa-heart-o:before { | |
content: "\f08a"; | |
} | |
.fa-sign-out:before { | |
content: "\f08b"; | |
} | |
.fa-linkedin-square:before { | |
content: "\f08c"; | |
} | |
.fa-thumb-tack:before { | |
content: "\f08d"; | |
} | |
.fa-external-link:before { | |
content: "\f08e"; | |
} | |
.fa-sign-in:before { | |
content: "\f090"; | |
} | |
.fa-trophy:before { | |
content: "\f091"; | |
} | |
.fa-github-square:before { | |
content: "\f092"; | |
} | |
.fa-upload:before { | |
content: "\f093"; | |
} | |
.fa-lemon-o:before { | |
content: "\f094"; | |
} | |
.fa-phone:before { | |
content: "\f095"; | |
} | |
.fa-square-o:before { | |
content: "\f096"; | |
} | |
.fa-bookmark-o:before { | |
content: "\f097"; | |
} | |
.fa-phone-square:before { | |
content: "\f098"; | |
} | |
.fa-twitter:before { | |
content: "\f099"; | |
} | |
.fa-facebook-f:before, | |
.fa-facebook:before { | |
content: "\f09a"; | |
} | |
.fa-github:before { | |
content: "\f09b"; | |
} | |
.fa-unlock:before { | |
content: "\f09c"; | |
} | |
.fa-credit-card:before { | |
content: "\f09d"; | |
} | |
.fa-feed:before, | |
.fa-rss:before { | |
content: "\f09e"; | |
} | |
.fa-hdd-o:before { | |
content: "\f0a0"; | |
} | |
.fa-bullhorn:before { | |
content: "\f0a1"; | |
} | |
.fa-bell:before { | |
content: "\f0f3"; | |
} | |
.fa-certificate:before { | |
content: "\f0a3"; | |
} | |
.fa-hand-o-right:before { | |
content: "\f0a4"; | |
} | |
.fa-hand-o-left:before { | |
content: "\f0a5"; | |
} | |
.fa-hand-o-up:before { | |
content: "\f0a6"; | |
} | |
.fa-hand-o-down:before { | |
content: "\f0a7"; | |
} | |
.fa-arrow-circle-left:before { | |
content: "\f0a8"; | |
} | |
.fa-arrow-circle-right:before { | |
content: "\f0a9"; | |
} | |
.fa-arrow-circle-up:before { | |
content: "\f0aa"; | |
} | |
.fa-arrow-circle-down:before { | |
content: "\f0ab"; | |
} | |
.fa-globe:before { | |
content: "\f0ac"; | |
} | |
.fa-wrench:before { | |
content: "\f0ad"; | |
} | |
.fa-tasks:before { | |
content: "\f0ae"; | |
} | |
.fa-filter:before { | |
content: "\f0b0"; | |
} | |
.fa-briefcase:before { | |
content: "\f0b1"; | |
} | |
.fa-arrows-alt:before { | |
content: "\f0b2"; | |
} | |
.fa-group:before, | |
.fa-users:before { | |
content: "\f0c0"; | |
} | |
.fa-chain:before, | |
.fa-link:before { | |
content: "\f0c1"; | |
} | |
.fa-cloud:before { | |
content: "\f0c2"; | |
} | |
.fa-flask:before { | |
content: "\f0c3"; | |
} | |
.fa-cut:before, | |
.fa-scissors:before { | |
content: "\f0c4"; | |
} | |
.fa-copy:before, | |
.fa-files-o:before { | |
content: "\f0c5"; | |
} | |
.fa-paperclip:before { | |
content: "\f0c6"; | |
} | |
.fa-save:before, | |
.fa-floppy-o:before { | |
content: "\f0c7"; | |
} | |
.fa-square:before { | |
content: "\f0c8"; | |
} | |
.fa-navicon:before, | |
.fa-reorder:before, | |
.fa-bars:before { | |
content: "\f0c9"; | |
} | |
.fa-list-ul:before { | |
content: "\f0ca"; | |
} | |
.fa-list-ol:before { | |
content: "\f0cb"; | |
} | |
.fa-strikethrough:before { | |
content: "\f0cc"; | |
} | |
.fa-underline:before { | |
content: "\f0cd"; | |
} | |
.fa-table:before { | |
content: "\f0ce"; | |
} | |
.fa-magic:before { | |
content: "\f0d0"; | |
} | |
.fa-truck:before { | |
content: "\f0d1"; | |
} | |
.fa-pinterest:before { | |
content: "\f0d2"; | |
} | |
.fa-pinterest-square:before { | |
content: "\f0d3"; | |
} | |
.fa-google-plus-square:before { | |
content: "\f0d4"; | |
} | |
.fa-google-plus:before { | |
content: "\f0d5"; | |
} | |
.fa-money:before { | |
content: "\f0d6"; | |
} | |
.fa-caret-down:before { | |
content: "\f0d7"; | |
} | |
.fa-caret-up:before { | |
content: "\f0d8"; | |
} | |
.fa-caret-left:before { | |
content: "\f0d9"; | |
} | |
.fa-caret-right:before { | |
content: "\f0da"; | |
} | |
.fa-columns:before { | |
content: "\f0db"; | |
} | |
.fa-unsorted:before, | |
.fa-sort:before { | |
content: "\f0dc"; | |
} | |
.fa-sort-down:before, | |
.fa-sort-desc:before { | |
content: "\f0dd"; | |
} | |
.fa-sort-up:before, | |
.fa-sort-asc:before { | |
content: "\f0de"; | |
} | |
.fa-envelope:before { | |
content: "\f0e0"; | |
} | |
.fa-linkedin:before { | |
content: "\f0e1"; | |
} | |
.fa-rotate-left:before, | |
.fa-undo:before { | |
content: "\f0e2"; | |
} | |
.fa-legal:before, | |
.fa-gavel:before { | |
content: "\f0e3"; | |
} | |
.fa-dashboard:before, | |
.fa-tachometer:before { | |
content: "\f0e4"; | |
} | |
.fa-comment-o:before { | |
content: "\f0e5"; | |
} | |
.fa-comments-o:before { | |
content: "\f0e6"; | |
} | |
.fa-flash:before, | |
.fa-bolt:before { | |
content: "\f0e7"; | |
} | |
.fa-sitemap:before { | |
content: "\f0e8"; | |
} | |
.fa-umbrella:before { | |
content: "\f0e9"; | |
} | |
.fa-paste:before, | |
.fa-clipboard:before { | |
content: "\f0ea"; | |
} | |
.fa-lightbulb-o:before { | |
content: "\f0eb"; | |
} | |
.fa-exchange:before { | |
content: "\f0ec"; | |
} | |
.fa-cloud-download:before { | |
content: "\f0ed"; | |
} | |
.fa-cloud-upload:before { | |
content: "\f0ee"; | |
} | |
.fa-user-md:before { | |
content: "\f0f0"; | |
} | |
.fa-stethoscope:before { | |
content: "\f0f1"; | |
} | |
.fa-suitcase:before { | |
content: "\f0f2"; | |
} | |
.fa-bell-o:before { | |
content: "\f0a2"; | |
} | |
.fa-coffee:before { | |
content: "\f0f4"; | |
} | |
.fa-cutlery:before { | |
content: "\f0f5"; | |
} | |
.fa-file-text-o:before { | |
content: "\f0f6"; | |
} | |
.fa-building-o:before { | |
content: "\f0f7"; | |
} | |
.fa-hospital-o:before { | |
content: "\f0f8"; | |
} | |
.fa-ambulance:before { | |
content: "\f0f9"; | |
} | |
.fa-medkit:before { | |
content: "\f0fa"; | |
} | |
.fa-fighter-jet:before { | |
content: "\f0fb"; | |
} | |
.fa-beer:before { | |
content: "\f0fc"; | |
} | |
.fa-h-square:before { | |
content: "\f0fd"; | |
} | |
.fa-plus-square:before { | |
content: "\f0fe"; | |
} | |
.fa-angle-double-left:before { | |
content: "\f100"; | |
} | |
.fa-angle-double-right:before { | |
content: "\f101"; | |
} | |
.fa-angle-double-up:before { | |
content: "\f102"; | |
} | |
.fa-angle-double-down:before { | |
content: "\f103"; | |
} | |
.fa-angle-left:before { | |
content: "\f104"; | |
} | |
.fa-angle-right:before { | |
content: "\f105"; | |
} | |
.fa-angle-up:before { | |
content: "\f106"; | |
} | |
.fa-angle-down:before { | |
content: "\f107"; | |
} | |
.fa-desktop:before { | |
content: "\f108"; | |
} | |
.fa-laptop:before { | |
content: "\f109"; | |
} | |
.fa-tablet:before { | |
content: "\f10a"; | |
} | |
.fa-mobile-phone:before, | |
.fa-mobile:before { | |
content: "\f10b"; | |
} | |
.fa-circle-o:before { | |
content: "\f10c"; | |
} | |
.fa-quote-left:before { | |
content: "\f10d"; | |
} | |
.fa-quote-right:before { | |
content: "\f10e"; | |
} | |
.fa-spinner:before { | |
content: "\f110"; | |
} | |
.fa-circle:before { | |
content: "\f111"; | |
} | |
.fa-mail-reply:before, | |
.fa-reply:before { | |
content: "\f112"; | |
} | |
.fa-github-alt:before { | |
content: "\f113"; | |
} | |
.fa-folder-o:before { | |
content: "\f114"; | |
} | |
.fa-folder-open-o:before { | |
content: "\f115"; | |
} | |
.fa-smile-o:before { | |
content: "\f118"; | |
} | |
.fa-frown-o:before { | |
content: "\f119"; | |
} | |
.fa-meh-o:before { | |
content: "\f11a"; | |
} | |
.fa-gamepad:before { | |
content: "\f11b"; | |
} | |
.fa-keyboard-o:before { | |
content: "\f11c"; | |
} | |
.fa-flag-o:before { | |
content: "\f11d"; | |
} | |
.fa-flag-checkered:before { | |
content: "\f11e"; | |
} | |
.fa-terminal:before { | |
content: "\f120"; | |
} | |
.fa-code:before { | |
content: "\f121"; | |
} | |
.fa-mail-reply-all:before, | |
.fa-reply-all:before { | |
content: "\f122"; | |
} | |
.fa-star-half-empty:before, | |
.fa-star-half-full:before, | |
.fa-star-half-o:before { | |
content: "\f123"; | |
} | |
.fa-location-arrow:before { | |
content: "\f124"; | |
} | |
.fa-crop:before { | |
content: "\f125"; | |
} | |
.fa-code-fork:before { | |
content: "\f126"; | |
} | |
.fa-unlink:before, | |
.fa-chain-broken:before { | |
content: "\f127"; | |
} | |
.fa-question:before { | |
content: "\f128"; | |
} | |
.fa-info:before { | |
content: "\f129"; | |
} | |
.fa-exclamation:before { | |
content: "\f12a"; | |
} | |
.fa-superscript:before { | |
content: "\f12b"; | |
} | |
.fa-subscript:before { | |
content: "\f12c"; | |
} | |
.fa-eraser:before { | |
content: "\f12d"; | |
} | |
.fa-puzzle-piece:before { | |
content: "\f12e"; | |
} | |
.fa-microphone:before { | |
content: "\f130"; | |
} | |
.fa-microphone-slash:before { | |
content: "\f131"; | |
} | |
.fa-shield:before { | |
content: "\f132"; | |
} | |
.fa-calendar-o:before { | |
content: "\f133"; | |
} | |
.fa-fire-extinguisher:before { | |
content: "\f134"; | |
} | |
.fa-rocket:before { | |
content: "\f135"; | |
} | |
.fa-maxcdn:before { | |
content: "\f136"; | |
} | |
.fa-chevron-circle-left:before { | |
content: "\f137"; | |
} | |
.fa-chevron-circle-right:before { | |
content: "\f138"; | |
} | |
.fa-chevron-circle-up:before { | |
content: "\f139"; | |
} | |
.fa-chevron-circle-down:before { | |
content: "\f13a"; | |
} | |
.fa-html5:before { | |
content: "\f13b"; | |
} | |
.fa-css3:before { | |
content: "\f13c"; | |
} | |
.fa-anchor:before { | |
content: "\f13d"; | |
} | |
.fa-unlock-alt:before { | |
content: "\f13e"; | |
} | |
.fa-bullseye:before { | |
content: "\f140"; | |
} | |
.fa-ellipsis-h:before { | |
content: "\f141"; | |
} | |
.fa-ellipsis-v:before { | |
content: "\f142"; | |
} | |
.fa-rss-square:before { | |
content: "\f143"; | |
} | |
.fa-play-circle:before { | |
content: "\f144"; | |
} | |
.fa-ticket:before { | |
content: "\f145"; | |
} | |
.fa-minus-square:before { | |
content: "\f146"; | |
} | |
.fa-minus-square-o:before { | |
content: "\f147"; | |
} | |
.fa-level-up:before { | |
content: "\f148"; | |
} | |
.fa-level-down:before { | |
content: "\f149"; | |
} | |
.fa-check-square:before { | |
content: "\f14a"; | |
} | |
.fa-pencil-square:before { | |
content: "\f14b"; | |
} | |
.fa-external-link-square:before { | |
content: "\f14c"; | |
} | |
.fa-share-square:before { | |
content: "\f14d"; | |
} | |
.fa-compass:before { | |
content: "\f14e"; | |
} | |
.fa-toggle-down:before, | |
.fa-caret-square-o-down:before { | |
content: "\f150"; | |
} | |
.fa-toggle-up:before, | |
.fa-caret-square-o-up:before { | |
content: "\f151"; | |
} | |
.fa-toggle-right:before, | |
.fa-caret-square-o-right:before { | |
content: "\f152"; | |
} | |
.fa-euro:before, | |
.fa-eur:before { | |
content: "\f153"; | |
} | |
.fa-gbp:before { | |
content: "\f154"; | |
} | |
.fa-dollar:before, | |
.fa-usd:before { | |
content: "\f155"; | |
} | |
.fa-rupee:before, | |
.fa-inr:before { | |
content: "\f156"; | |
} | |
.fa-cny:before, | |
.fa-rmb:before, | |
.fa-yen:before, | |
.fa-jpy:before { | |
content: "\f157"; | |
} | |
.fa-ruble:before, | |
.fa-rouble:before, | |
.fa-rub:before { | |
content: "\f158"; | |
} | |
.fa-won:before, | |
.fa-krw:before { | |
content: "\f159"; | |
} | |
.fa-bitcoin:before, | |
.fa-btc:before { | |
content: "\f15a"; | |
} | |
.fa-file:before { | |
content: "\f15b"; | |
} | |
.fa-file-text:before { | |
content: "\f15c"; | |
} | |
.fa-sort-alpha-asc:before { | |
content: "\f15d"; | |
} | |
.fa-sort-alpha-desc:before { | |
content: "\f15e"; | |
} | |
.fa-sort-amount-asc:before { | |
content: "\f160"; | |
} | |
.fa-sort-amount-desc:before { | |
content: "\f161"; | |
} | |
.fa-sort-numeric-asc:before { | |
content: "\f162"; | |
} | |
.fa-sort-numeric-desc:before { | |
content: "\f163"; | |
} | |
.fa-thumbs-up:before { | |
content: "\f164"; | |
} | |
.fa-thumbs-down:before { | |
content: "\f165"; | |
} | |
.fa-youtube-square:before { | |
content: "\f166"; | |
} | |
.fa-youtube:before { | |
content: "\f167"; | |
} | |
.fa-xing:before { | |
content: "\f168"; | |
} | |
.fa-xing-square:before { | |
content: "\f169"; | |
} | |
.fa-youtube-play:before { | |
content: "\f16a"; | |
} | |
.fa-dropbox:before { | |
content: "\f16b"; | |
} | |
.fa-stack-overflow:before { | |
content: "\f16c"; | |
} | |
.fa-instagram:before { | |
content: "\f16d"; | |
} | |
.fa-flickr:before { | |
content: "\f16e"; | |
} | |
.fa-adn:before { | |
content: "\f170"; | |
} | |
.fa-bitbucket:before { | |
content: "\f171"; | |
} | |
.fa-bitbucket-square:before { | |
content: "\f172"; | |
} | |
.fa-tumblr:before { | |
content: "\f173"; | |
} | |
.fa-tumblr-square:before { | |
content: "\f174"; | |
} | |
.fa-long-arrow-down:before { | |
content: "\f175"; | |
} | |
.fa-long-arrow-up:before { | |
content: "\f176"; | |
} | |
.fa-long-arrow-left:before { | |
content: "\f177"; | |
} | |
.fa-long-arrow-right:before { | |
content: "\f178"; | |
} | |
.fa-apple:before { | |
content: "\f179"; | |
} | |
.fa-windows:before { | |
content: "\f17a"; | |
} | |
.fa-android:before { | |
content: "\f17b"; | |
} | |
.fa-linux:before { | |
content: "\f17c"; | |
} | |
.fa-dribbble:before { | |
content: "\f17d"; | |
} | |
.fa-skype:before { | |
content: "\f17e"; | |
} | |
.fa-foursquare:before { | |
content: "\f180"; | |
} | |
.fa-trello:before { | |
content: "\f181"; | |
} | |
.fa-female:before { | |
content: "\f182"; | |
} | |
.fa-male:before { | |
content: "\f183"; | |
} | |
.fa-gittip:before, | |
.fa-gratipay:before { | |
content: "\f184"; | |
} | |
.fa-sun-o:before { | |
content: "\f185"; | |
} | |
.fa-moon-o:before { | |
content: "\f186"; | |
} | |
.fa-archive:before { | |
content: "\f187"; | |
} | |
.fa-bug:before { | |
content: "\f188"; | |
} | |
.fa-vk:before { | |
content: "\f189"; | |
} | |
.fa-weibo:before { | |
content: "\f18a"; | |
} | |
.fa-renren:before { | |
content: "\f18b"; | |
} | |
.fa-pagelines:before { | |
content: "\f18c"; | |
} | |
.fa-stack-exchange:before { | |
content: "\f18d"; | |
} | |
.fa-arrow-circle-o-right:before { | |
content: "\f18e"; | |
} | |
.fa-arrow-circle-o-left:before { | |
content: "\f190"; | |
} | |
.fa-toggle-left:before, | |
.fa-caret-square-o-left:before { | |
content: "\f191"; | |
} | |
.fa-dot-circle-o:before { | |
content: "\f192"; | |
} | |
.fa-wheelchair:before { | |
content: "\f193"; | |
} | |
.fa-vimeo-square:before { | |
content: "\f194"; | |
} | |
.fa-turkish-lira:before, | |
.fa-try:before { | |
content: "\f195"; | |
} | |
.fa-plus-square-o:before { | |
content: "\f196"; | |
} | |
.fa-space-shuttle:before { | |
content: "\f197"; | |
} | |
.fa-slack:before { | |
content: "\f198"; | |
} | |
.fa-envelope-square:before { | |
content: "\f199"; | |
} | |
.fa-wordpress:before { | |
content: "\f19a"; | |
} | |
.fa-openid:before { | |
content: "\f19b"; | |
} | |
.fa-institution:before, | |
.fa-bank:before, | |
.fa-university:before { | |
content: "\f19c"; | |
} | |
.fa-mortar-board:before, | |
.fa-graduation-cap:before { | |
content: "\f19d"; | |
} | |
.fa-yahoo:before { | |
content: "\f19e"; | |
} | |
.fa-google:before { | |
content: "\f1a0"; | |
} | |
.fa-reddit:before { | |
content: "\f1a1"; | |
} | |
.fa-reddit-square:before { | |
content: "\f1a2"; | |
} | |
.fa-stumbleupon-circle:before { | |
content: "\f1a3"; | |
} | |
.fa-stumbleupon:before { | |
content: "\f1a4"; | |
} | |
.fa-delicious:before { | |
content: "\f1a5"; | |
} | |
.fa-digg:before { | |
content: "\f1a6"; | |
} | |
.fa-pied-piper-pp:before { | |
content: "\f1a7"; | |
} | |
.fa-pied-piper-alt:before { | |
content: "\f1a8"; | |
} | |
.fa-drupal:before { | |
content: "\f1a9"; | |
} | |
.fa-joomla:before { | |
content: "\f1aa"; | |
} | |
.fa-language:before { | |
content: "\f1ab"; | |
} | |
.fa-fax:before { | |
content: "\f1ac"; | |
} | |
.fa-building:before { | |
content: "\f1ad"; | |
} | |
.fa-child:before { | |
content: "\f1ae"; | |
} | |
.fa-paw:before { | |
content: "\f1b0"; | |
} | |
.fa-spoon:before { | |
content: "\f1b1"; | |
} | |
.fa-cube:before { | |
content: "\f1b2"; | |
} | |
.fa-cubes:before { | |
content: "\f1b3"; | |
} | |
.fa-behance:before { | |
content: "\f1b4"; | |
} | |
.fa-behance-square:before { | |
content: "\f1b5"; | |
} | |
.fa-steam:before { | |
content: "\f1b6"; | |
} | |
.fa-steam-square:before { | |
content: "\f1b7"; | |
} | |
.fa-recycle:before { | |
content: "\f1b8"; | |
} | |
.fa-automobile:before, | |
.fa-car:before { | |
content: "\f1b9"; | |
} | |
.fa-cab:before, | |
.fa-taxi:before { | |
content: "\f1ba"; | |
} | |
.fa-tree:before { | |
content: "\f1bb"; | |
} | |
.fa-spotify:before { | |
content: "\f1bc"; | |
} | |
.fa-deviantart:before { | |
content: "\f1bd"; | |
} | |
.fa-soundcloud:before { | |
content: "\f1be"; | |
} | |
.fa-database:before { | |
content: "\f1c0"; | |
} | |
.fa-file-pdf-o:before { | |
content: "\f1c1"; | |
} | |
.fa-file-word-o:before { | |
content: "\f1c2"; | |
} | |
.fa-file-excel-o:before { | |
content: "\f1c3"; | |
} | |
.fa-file-powerpoint-o:before { | |
content: "\f1c4"; | |
} | |
.fa-file-photo-o:before, | |
.fa-file-picture-o:before, | |
.fa-file-image-o:before { | |
content: "\f1c5"; | |
} | |
.fa-file-zip-o:before, | |
.fa-file-archive-o:before { | |
content: "\f1c6"; | |
} | |
.fa-file-sound-o:before, | |
.fa-file-audio-o:before { | |
content: "\f1c7"; | |
} | |
.fa-file-movie-o:before, | |
.fa-file-video-o:before { | |
content: "\f1c8"; | |
} | |
.fa-file-code-o:before { | |
content: "\f1c9"; | |
} | |
.fa-vine:before { | |
content: "\f1ca"; | |
} | |
.fa-codepen:before { | |
content: "\f1cb"; | |
} | |
.fa-jsfiddle:before { | |
content: "\f1cc"; | |
} | |
.fa-life-bouy:before, | |
.fa-life-buoy:before, | |
.fa-life-saver:before, | |
.fa-support:before, | |
.fa-life-ring:before { | |
content: "\f1cd"; | |
} | |
.fa-circle-o-notch:before { | |
content: "\f1ce"; | |
} | |
.fa-ra:before, | |
.fa-resistance:before, | |
.fa-rebel:before { | |
content: "\f1d0"; | |
} | |
.fa-ge:before, | |
.fa-empire:before { | |
content: "\f1d1"; | |
} | |
.fa-git-square:before { | |
content: "\f1d2"; | |
} | |
.fa-git:before { | |
content: "\f1d3"; | |
} | |
.fa-y-combinator-square:before, | |
.fa-yc-square:before, | |
.fa-hacker-news:before { | |
content: "\f1d4"; | |
} | |
.fa-tencent-weibo:before { | |
content: "\f1d5"; | |
} | |
.fa-qq:before { | |
content: "\f1d6"; | |
} | |
.fa-wechat:before, | |
.fa-weixin:before { | |
content: "\f1d7"; | |
} | |
.fa-send:before, | |
.fa-paper-plane:before { | |
content: "\f1d8"; | |
} | |
.fa-send-o:before, | |
.fa-paper-plane-o:before { | |
content: "\f1d9"; | |
} | |
.fa-history:before { | |
content: "\f1da"; | |
} | |
.fa-circle-thin:before { | |
content: "\f1db"; | |
} | |
.fa-header:before { | |
content: "\f1dc"; | |
} | |
.fa-paragraph:before { | |
content: "\f1dd"; | |
} | |
.fa-sliders:before { | |
content: "\f1de"; | |
} | |
.fa-share-alt:before { | |
content: "\f1e0"; | |
} | |
.fa-share-alt-square:before { | |
content: "\f1e1"; | |
} | |
.fa-bomb:before { | |
content: "\f1e2"; | |
} | |
.fa-soccer-ball-o:before, | |
.fa-futbol-o:before { | |
content: "\f1e3"; | |
} | |
.fa-tty:before { | |
content: "\f1e4"; | |
} | |
.fa-binoculars:before { | |
content: "\f1e5"; | |
} | |
.fa-plug:before { | |
content: "\f1e6"; | |
} | |
.fa-slideshare:before { | |
content: "\f1e7"; | |
} | |
.fa-twitch:before { | |
content: "\f1e8"; | |
} | |
.fa-yelp:before { | |
content: "\f1e9"; | |
} | |
.fa-newspaper-o:before { | |
content: "\f1ea"; | |
} | |
.fa-wifi:before { | |
content: "\f1eb"; | |
} | |
.fa-calculator:before { | |
content: "\f1ec"; | |
} | |
.fa-paypal:before { | |
content: "\f1ed"; | |
} | |
.fa-google-wallet:before { | |
content: "\f1ee"; | |
} | |
.fa-cc-visa:before { | |
content: "\f1f0"; | |
} | |
.fa-cc-mastercard:before { | |
content: "\f1f1"; | |
} | |
.fa-cc-discover:before { | |
content: "\f1f2"; | |
} | |
.fa-cc-amex:before { | |
content: "\f1f3"; | |
} | |
.fa-cc-paypal:before { | |
content: "\f1f4"; | |
} | |
.fa-cc-stripe:before { | |
content: "\f1f5"; | |
} | |
.fa-bell-slash:before { | |
content: "\f1f6"; | |
} | |
.fa-bell-slash-o:before { | |
content: "\f1f7"; | |
} | |
.fa-trash:before { | |
content: "\f1f8"; | |
} | |
.fa-copyright:before { | |
content: "\f1f9"; | |
} | |
.fa-at:before { | |
content: "\f1fa"; | |
} | |
.fa-eyedropper:before { | |
content: "\f1fb"; | |
} | |
.fa-paint-brush:before { | |
content: "\f1fc"; | |
} | |
.fa-birthday-cake:before { | |
content: "\f1fd"; | |
} | |
.fa-area-chart:before { | |
content: "\f1fe"; | |
} | |
.fa-pie-chart:before { | |
content: "\f200"; | |
} | |
.fa-line-chart:before { | |
content: "\f201"; | |
} | |
.fa-lastfm:before { | |
content: "\f202"; | |
} | |
.fa-lastfm-square:before { | |
content: "\f203"; | |
} | |
.fa-toggle-off:before { | |
content: "\f204"; | |
} | |
.fa-toggle-on:before { | |
content: "\f205"; | |
} | |
.fa-bicycle:before { | |
content: "\f206"; | |
} | |
.fa-bus:before { | |
content: "\f207"; | |
} | |
.fa-ioxhost:before { | |
content: "\f208"; | |
} | |
.fa-angellist:before { | |
content: "\f209"; | |
} | |
.fa-cc:before { | |
content: "\f20a"; | |
} | |
.fa-shekel:before, | |
.fa-sheqel:before, | |
.fa-ils:before { | |
content: "\f20b"; | |
} | |
.fa-meanpath:before { | |
content: "\f20c"; | |
} | |
.fa-buysellads:before { | |
content: "\f20d"; | |
} | |
.fa-connectdevelop:before { | |
content: "\f20e"; | |
} | |
.fa-dashcube:before { | |
content: "\f210"; | |
} | |
.fa-forumbee:before { | |
content: "\f211"; | |
} | |
.fa-leanpub:before { | |
content: "\f212"; | |
} | |
.fa-sellsy:before { | |
content: "\f213"; | |
} | |
.fa-shirtsinbulk:before { | |
content: "\f214"; | |
} | |
.fa-simplybuilt:before { | |
content: "\f215"; | |
} | |
.fa-skyatlas:before { | |
content: "\f216"; | |
} | |
.fa-cart-plus:before { | |
content: "\f217"; | |
} | |
.fa-cart-arrow-down:before { | |
content: "\f218"; | |
} | |
.fa-diamond:before { | |
content: "\f219"; | |
} | |
.fa-ship:before { | |
content: "\f21a"; | |
} | |
.fa-user-secret:before { | |
content: "\f21b"; | |
} | |
.fa-motorcycle:before { | |
content: "\f21c"; | |
} | |
.fa-street-view:before { | |
content: "\f21d"; | |
} | |
.fa-heartbeat:before { | |
content: "\f21e"; | |
} | |
.fa-venus:before { | |
content: "\f221"; | |
} | |
.fa-mars:before { | |
content: "\f222"; | |
} | |
.fa-mercury:before { | |
content: "\f223"; | |
} | |
.fa-intersex:before, | |
.fa-transgender:before { | |
content: "\f224"; | |
} | |
.fa-transgender-alt:before { | |
content: "\f225"; | |
} | |
.fa-venus-double:before { | |
content: "\f226"; | |
} | |
.fa-mars-double:before { | |
content: "\f227"; | |
} | |
.fa-venus-mars:before { | |
content: "\f228"; | |
} | |
.fa-mars-stroke:before { | |
content: "\f229"; | |
} | |
.fa-mars-stroke-v:before { | |
content: "\f22a"; | |
} | |
.fa-mars-stroke-h:before { | |
content: "\f22b"; | |
} | |
.fa-neuter:before { | |
content: "\f22c"; | |
} | |
.fa-genderless:before { | |
content: "\f22d"; | |
} | |
.fa-facebook-official:before { | |
content: "\f230"; | |
} | |
.fa-pinterest-p:before { | |
content: "\f231"; | |
} | |
.fa-whatsapp:before { | |
content: "\f232"; | |
} | |
.fa-server:before { | |
content: "\f233"; | |
} | |
.fa-user-plus:before { | |
content: "\f234"; | |
} | |
.fa-user-times:before { | |
content: "\f235"; | |
} | |
.fa-hotel:before, | |
.fa-bed:before { | |
content: "\f236"; | |
} | |
.fa-viacoin:before { | |
content: "\f237"; | |
} | |
.fa-train:before { | |
content: "\f238"; | |
} | |
.fa-subway:before { | |
content: "\f239"; | |
} | |
.fa-medium:before { | |
content: "\f23a"; | |
} | |
.fa-yc:before, | |
.fa-y-combinator:before { | |
content: "\f23b"; | |
} | |
.fa-optin-monster:before { | |
content: "\f23c"; | |
} | |
.fa-opencart:before { | |
content: "\f23d"; | |
} | |
.fa-expeditedssl:before { | |
content: "\f23e"; | |
} | |
.fa-battery-4:before, | |
.fa-battery:before, | |
.fa-battery-full:before { | |
content: "\f240"; | |
} | |
.fa-battery-3:before, | |
.fa-battery-three-quarters:before { | |
content: "\f241"; | |
} | |
.fa-battery-2:before, | |
.fa-battery-half:before { | |
content: "\f242"; | |
} | |
.fa-battery-1:before, | |
.fa-battery-quarter:before { | |
content: "\f243"; | |
} | |
.fa-battery-0:before, | |
.fa-battery-empty:before { | |
content: "\f244"; | |
} | |
.fa-mouse-pointer:before { | |
content: "\f245"; | |
} | |
.fa-i-cursor:before { | |
content: "\f246"; | |
} | |
.fa-object-group:before { | |
content: "\f247"; | |
} | |
.fa-object-ungroup:before { | |
content: "\f248"; | |
} | |
.fa-sticky-note:before { | |
content: "\f249"; | |
} | |
.fa-sticky-note-o:before { | |
content: "\f24a"; | |
} | |
.fa-cc-jcb:before { | |
content: "\f24b"; | |
} | |
.fa-cc-diners-club:before { | |
content: "\f24c"; | |
} | |
.fa-clone:before { | |
content: "\f24d"; | |
} | |
.fa-balance-scale:before { | |
content: "\f24e"; | |
} | |
.fa-hourglass-o:before { | |
content: "\f250"; | |
} | |
.fa-hourglass-1:before, | |
.fa-hourglass-start:before { | |
content: "\f251"; | |
} | |
.fa-hourglass-2:before, | |
.fa-hourglass-half:before { | |
content: "\f252"; | |
} | |
.fa-hourglass-3:before, | |
.fa-hourglass-end:before { | |
content: "\f253"; | |
} | |
.fa-hourglass:before { | |
content: "\f254"; | |
} | |
.fa-hand-grab-o:before, | |
.fa-hand-rock-o:before { | |
content: "\f255"; | |
} | |
.fa-hand-stop-o:before, | |
.fa-hand-paper-o:before { | |
content: "\f256"; | |
} | |
.fa-hand-scissors-o:before { | |
content: "\f257"; | |
} | |
.fa-hand-lizard-o:before { | |
content: "\f258"; | |
} | |
.fa-hand-spock-o:before { | |
content: "\f259"; | |
} | |
.fa-hand-pointer-o:before { | |
content: "\f25a"; | |
} | |
.fa-hand-peace-o:before { | |
content: "\f25b"; | |
} | |
.fa-trademark:before { | |
content: "\f25c"; | |
} | |
.fa-registered:before { | |
content: "\f25d"; | |
} | |
.fa-creative-commons:before { | |
content: "\f25e"; | |
} | |
.fa-gg:before { | |
content: "\f260"; | |
} | |
.fa-gg-circle:before { | |
content: "\f261"; | |
} | |
.fa-tripadvisor:before { | |
content: "\f262"; | |
} | |
.fa-odnoklassniki:before { | |
content: "\f263"; | |
} | |
.fa-odnoklassniki-square:before { | |
content: "\f264"; | |
} | |
.fa-get-pocket:before { | |
content: "\f265"; | |
} | |
.fa-wikipedia-w:before { | |
content: "\f266"; | |
} | |
.fa-safari:before { | |
content: "\f267"; | |
} | |
.fa-chrome:before { | |
content: "\f268"; | |
} | |
.fa-firefox:before { | |
content: "\f269"; | |
} | |
.fa-opera:before { | |
content: "\f26a"; | |
} | |
.fa-internet-explorer:before { | |
content: "\f26b"; | |
} | |
.fa-tv:before, | |
.fa-television:before { | |
content: "\f26c"; | |
} | |
.fa-contao:before { | |
content: "\f26d"; | |
} | |
.fa-500px:before { | |
content: "\f26e"; | |
} | |
.fa-amazon:before { | |
content: "\f270"; | |
} | |
.fa-calendar-plus-o:before { | |
content: "\f271"; | |
} | |
.fa-calendar-minus-o:before { | |
content: "\f272"; | |
} | |
.fa-calendar-times-o:before { | |
content: "\f273"; | |
} | |
.fa-calendar-check-o:before { | |
content: "\f274"; | |
} | |
.fa-industry:before { | |
content: "\f275"; | |
} | |
.fa-map-pin:before { | |
content: "\f276"; | |
} | |
.fa-map-signs:before { | |
content: "\f277"; | |
} | |
.fa-map-o:before { | |
content: "\f278"; | |
} | |
.fa-map:before { | |
content: "\f279"; | |
} | |
.fa-commenting:before { | |
content: "\f27a"; | |
} | |
.fa-commenting-o:before { | |
content: "\f27b"; | |
} | |
.fa-houzz:before { | |
content: "\f27c"; | |
} | |
.fa-vimeo:before { | |
content: "\f27d"; | |
} | |
.fa-black-tie:before { | |
content: "\f27e"; | |
} | |
.fa-fonticons:before { | |
content: "\f280"; | |
} | |
.fa-reddit-alien:before { | |
content: "\f281"; | |
} | |
.fa-edge:before { | |
content: "\f282"; | |
} | |
.fa-credit-card-alt:before { | |
content: "\f283"; | |
} | |
.fa-codiepie:before { | |
content: "\f284"; | |
} | |
.fa-modx:before { | |
content: "\f285"; | |
} | |
.fa-fort-awesome:before { | |
content: "\f286"; | |
} | |
.fa-usb:before { | |
content: "\f287"; | |
} | |
.fa-product-hunt:before { | |
content: "\f288"; | |
} | |
.fa-mixcloud:before { | |
content: "\f289"; | |
} | |
.fa-scribd:before { | |
content: "\f28a"; | |
} | |
.fa-pause-circle:before { | |
content: "\f28b"; | |
} | |
.fa-pause-circle-o:before { | |
content: "\f28c"; | |
} | |
.fa-stop-circle:before { | |
content: "\f28d"; | |
} | |
.fa-stop-circle-o:before { | |
content: "\f28e"; | |
} | |
.fa-shopping-bag:before { | |
content: "\f290"; | |
} | |
.fa-shopping-basket:before { | |
content: "\f291"; | |
} | |
.fa-hashtag:before { | |
content: "\f292"; | |
} | |
.fa-bluetooth:before { | |
content: "\f293"; | |
} | |
.fa-bluetooth-b:before { | |
content: "\f294"; | |
} | |
.fa-percent:before { | |
content: "\f295"; | |
} | |
.fa-gitlab:before { | |
content: "\f296"; | |
} | |
.fa-wpbeginner:before { | |
content: "\f297"; | |
} | |
.fa-wpforms:before { | |
content: "\f298"; | |
} | |
.fa-envira:before { | |
content: "\f299"; | |
} | |
.fa-universal-access:before { | |
content: "\f29a"; | |
} | |
.fa-wheelchair-alt:before { | |
content: "\f29b"; | |
} | |
.fa-question-circle-o:before { | |
content: "\f29c"; | |
} | |
.fa-blind:before { | |
content: "\f29d"; | |
} | |
.fa-audio-description:before { | |
content: "\f29e"; | |
} | |
.fa-volume-control-phone:before { | |
content: "\f2a0"; | |
} | |
.fa-braille:before { | |
content: "\f2a1"; | |
} | |
.fa-assistive-listening-systems:before { | |
content: "\f2a2"; | |
} | |
.fa-asl-interpreting:before, | |
.fa-american-sign-language-interpreting:before { | |
content: "\f2a3"; | |
} | |
.fa-deafness:before, | |
.fa-hard-of-hearing:before, | |
.fa-deaf:before { | |
content: "\f2a4"; | |
} | |
.fa-glide:before { | |
content: "\f2a5"; | |
} | |
.fa-glide-g:before { | |
content: "\f2a6"; | |
} | |
.fa-signing:before, | |
.fa-sign-language:before { | |
content: "\f2a7"; | |
} | |
.fa-low-vision:before { | |
content: "\f2a8"; | |
} | |
.fa-viadeo:before { | |
content: "\f2a9"; | |
} | |
.fa-viadeo-square:before { | |
content: "\f2aa"; | |
} | |
.fa-snapchat:before { | |
content: "\f2ab"; | |
} | |
.fa-snapchat-ghost:before { | |
content: "\f2ac"; | |
} | |
.fa-snapchat-square:before { | |
content: "\f2ad"; | |
} | |
.fa-pied-piper:before { | |
content: "\f2ae"; | |
} | |
.fa-first-order:before { | |
content: "\f2b0"; | |
} | |
.fa-yoast:before { | |
content: "\f2b1"; | |
} | |
.fa-themeisle:before { | |
content: "\f2b2"; | |
} | |
.fa-google-plus-circle:before, | |
.fa-google-plus-official:before { | |
content: "\f2b3"; | |
} | |
.fa-fa:before, | |
.fa-font-awesome:before { | |
content: "\f2b4"; | |
} | |
.fa-handshake-o:before { | |
content: "\f2b5"; | |
} | |
.fa-envelope-open:before { | |
content: "\f2b6"; | |
} | |
.fa-envelope-open-o:before { | |
content: "\f2b7"; | |
} | |
.fa-linode:before { | |
content: "\f2b8"; | |
} | |
.fa-address-book:before { | |
content: "\f2b9"; | |
} | |
.fa-address-book-o:before { | |
content: "\f2ba"; | |
} | |
.fa-vcard:before, | |
.fa-address-card:before { | |
content: "\f2bb"; | |
} | |
.fa-vcard-o:before, | |
.fa-address-card-o:before { | |
content: "\f2bc"; | |
} | |
.fa-user-circle:before { | |
content: "\f2bd"; | |
} | |
.fa-user-circle-o:before { | |
content: "\f2be"; | |
} | |
.fa-user-o:before { | |
content: "\f2c0"; | |
} | |
.fa-id-badge:before { | |
content: "\f2c1"; | |
} | |
.fa-drivers-license:before, | |
.fa-id-card:before { | |
content: "\f2c2"; | |
} | |
.fa-drivers-license-o:before, | |
.fa-id-card-o:before { | |
content: "\f2c3"; | |
} | |
.fa-quora:before { | |
content: "\f2c4"; | |
} | |
.fa-free-code-camp:before { | |
content: "\f2c5"; | |
} | |
.fa-telegram:before { | |
content: "\f2c6"; | |
} | |
.fa-thermometer-4:before, | |
.fa-thermometer:before, | |
.fa-thermometer-full:before { | |
content: "\f2c7"; | |
} | |
.fa-thermometer-3:before, | |
.fa-thermometer-three-quarters:before { | |
content: "\f2c8"; | |
} | |
.fa-thermometer-2:before, | |
.fa-thermometer-half:before { | |
content: "\f2c9"; | |
} | |
.fa-thermometer-1:before, | |
.fa-thermometer-quarter:before { | |
content: "\f2ca"; | |
} | |
.fa-thermometer-0:before, | |
.fa-thermometer-empty:before { | |
content: "\f2cb"; | |
} | |
.fa-shower:before { | |
content: "\f2cc"; | |
} | |
.fa-bathtub:before, | |
.fa-s15:before, | |
.fa-bath:before { | |
content: "\f2cd"; | |
} | |
.fa-podcast:before { | |
content: "\f2ce"; | |
} | |
.fa-window-maximize:before { | |
content: "\f2d0"; | |
} | |
.fa-window-minimize:before { | |
content: "\f2d1"; | |
} | |
.fa-window-restore:before { | |
content: "\f2d2"; | |
} | |
.fa-times-rectangle:before, | |
.fa-window-close:before { | |
content: "\f2d3"; | |
} | |
.fa-times-rectangle-o:before, | |
.fa-window-close-o:before { | |
content: "\f2d4"; | |
} | |
.fa-bandcamp:before { | |
content: "\f2d5"; | |
} | |
.fa-grav:before { | |
content: "\f2d6"; | |
} | |
.fa-etsy:before { | |
content: "\f2d7"; | |
} | |
.fa-imdb:before { | |
content: "\f2d8"; | |
} | |
.fa-ravelry:before { | |
content: "\f2d9"; | |
} | |
.fa-eercast:before { | |
content: "\f2da"; | |
} | |
.fa-microchip:before { | |
content: "\f2db"; | |
} | |
.fa-snowflake-o:before { | |
content: "\f2dc"; | |
} | |
.fa-superpowers:before { | |
content: "\f2dd"; | |
} | |
.fa-wpexplorer:before { | |
content: "\f2de"; | |
} | |
.fa-meetup:before { | |
content: "\f2e0"; | |
} | |
.sr-only { | |
position: absolute; | |
width: 1px; | |
height: 1px; | |
padding: 0; | |
margin: -1px; | |
overflow: hidden; | |
clip: rect(0, 0, 0, 0); | |
border: 0; | |
} | |
.sr-only-focusable:active, | |
.sr-only-focusable:focus { | |
position: static; | |
width: auto; | |
height: auto; | |
margin: 0; | |
overflow: visible; | |
clip: auto; | |
} | |
.sr-only-focusable:active, | |
.sr-only-focusable:focus { | |
position: static; | |
width: auto; | |
height: auto; | |
margin: 0; | |
overflow: visible; | |
clip: auto; | |
} | |
/*! | |
* | |
* IPython base | |
* | |
*/ | |
.modal.fade .modal-dialog { | |
-webkit-transform: translate(0, 0); | |
-ms-transform: translate(0, 0); | |
-o-transform: translate(0, 0); | |
transform: translate(0, 0); | |
} | |
code { | |
color: #000; | |
} | |
pre { | |
font-size: inherit; | |
line-height: inherit; | |
} | |
label { | |
font-weight: normal; | |
} | |
/* Make the page background atleast 100% the height of the view port */ | |
/* Make the page itself atleast 70% the height of the view port */ | |
.border-box-sizing { | |
box-sizing: border-box; | |
-moz-box-sizing: border-box; | |
-webkit-box-sizing: border-box; | |
} | |
.corner-all { | |
border-radius: 2px; | |
} | |
.no-padding { | |
padding: 0px; | |
} | |
/* Flexible box model classes */ | |
/* Taken from Alex Russell http://infrequently.org/2009/08/css-3-progress/ */ | |
/* This file is a compatability layer. It allows the usage of flexible box | |
model layouts accross multiple browsers, including older browsers. The newest, | |
universal implementation of the flexible box model is used when available (see | |
`Modern browsers` comments below). Browsers that are known to implement this | |
new spec completely include: | |
Firefox 28.0+ | |
Chrome 29.0+ | |
Internet Explorer 11+ | |
Opera 17.0+ | |
Browsers not listed, including Safari, are supported via the styling under the | |
`Old browsers` comments below. | |
*/ | |
.hbox { | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: horizontal; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: horizontal; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: horizontal; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: row; | |
align-items: stretch; | |
} | |
.hbox > * { | |
/* Old browsers */ | |
-webkit-box-flex: 0; | |
-moz-box-flex: 0; | |
box-flex: 0; | |
/* Modern browsers */ | |
flex: none; | |
} | |
.vbox { | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: vertical; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: vertical; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: vertical; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: column; | |
align-items: stretch; | |
} | |
.vbox > * { | |
/* Old browsers */ | |
-webkit-box-flex: 0; | |
-moz-box-flex: 0; | |
box-flex: 0; | |
/* Modern browsers */ | |
flex: none; | |
} | |
.hbox.reverse, | |
.vbox.reverse, | |
.reverse { | |
/* Old browsers */ | |
-webkit-box-direction: reverse; | |
-moz-box-direction: reverse; | |
box-direction: reverse; | |
/* Modern browsers */ | |
flex-direction: row-reverse; | |
} | |
.hbox.box-flex0, | |
.vbox.box-flex0, | |
.box-flex0 { | |
/* Old browsers */ | |
-webkit-box-flex: 0; | |
-moz-box-flex: 0; | |
box-flex: 0; | |
/* Modern browsers */ | |
flex: none; | |
width: auto; | |
} | |
.hbox.box-flex1, | |
.vbox.box-flex1, | |
.box-flex1 { | |
/* Old browsers */ | |
-webkit-box-flex: 1; | |
-moz-box-flex: 1; | |
box-flex: 1; | |
/* Modern browsers */ | |
flex: 1; | |
} | |
.hbox.box-flex, | |
.vbox.box-flex, | |
.box-flex { | |
/* Old browsers */ | |
/* Old browsers */ | |
-webkit-box-flex: 1; | |
-moz-box-flex: 1; | |
box-flex: 1; | |
/* Modern browsers */ | |
flex: 1; | |
} | |
.hbox.box-flex2, | |
.vbox.box-flex2, | |
.box-flex2 { | |
/* Old browsers */ | |
-webkit-box-flex: 2; | |
-moz-box-flex: 2; | |
box-flex: 2; | |
/* Modern browsers */ | |
flex: 2; | |
} | |
.box-group1 { | |
/* Deprecated */ | |
-webkit-box-flex-group: 1; | |
-moz-box-flex-group: 1; | |
box-flex-group: 1; | |
} | |
.box-group2 { | |
/* Deprecated */ | |
-webkit-box-flex-group: 2; | |
-moz-box-flex-group: 2; | |
box-flex-group: 2; | |
} | |
.hbox.start, | |
.vbox.start, | |
.start { | |
/* Old browsers */ | |
-webkit-box-pack: start; | |
-moz-box-pack: start; | |
box-pack: start; | |
/* Modern browsers */ | |
justify-content: flex-start; | |
} | |
.hbox.end, | |
.vbox.end, | |
.end { | |
/* Old browsers */ | |
-webkit-box-pack: end; | |
-moz-box-pack: end; | |
box-pack: end; | |
/* Modern browsers */ | |
justify-content: flex-end; | |
} | |
.hbox.center, | |
.vbox.center, | |
.center { | |
/* Old browsers */ | |
-webkit-box-pack: center; | |
-moz-box-pack: center; | |
box-pack: center; | |
/* Modern browsers */ | |
justify-content: center; | |
} | |
.hbox.baseline, | |
.vbox.baseline, | |
.baseline { | |
/* Old browsers */ | |
-webkit-box-pack: baseline; | |
-moz-box-pack: baseline; | |
box-pack: baseline; | |
/* Modern browsers */ | |
justify-content: baseline; | |
} | |
.hbox.stretch, | |
.vbox.stretch, | |
.stretch { | |
/* Old browsers */ | |
-webkit-box-pack: stretch; | |
-moz-box-pack: stretch; | |
box-pack: stretch; | |
/* Modern browsers */ | |
justify-content: stretch; | |
} | |
.hbox.align-start, | |
.vbox.align-start, | |
.align-start { | |
/* Old browsers */ | |
-webkit-box-align: start; | |
-moz-box-align: start; | |
box-align: start; | |
/* Modern browsers */ | |
align-items: flex-start; | |
} | |
.hbox.align-end, | |
.vbox.align-end, | |
.align-end { | |
/* Old browsers */ | |
-webkit-box-align: end; | |
-moz-box-align: end; | |
box-align: end; | |
/* Modern browsers */ | |
align-items: flex-end; | |
} | |
.hbox.align-center, | |
.vbox.align-center, | |
.align-center { | |
/* Old browsers */ | |
-webkit-box-align: center; | |
-moz-box-align: center; | |
box-align: center; | |
/* Modern browsers */ | |
align-items: center; | |
} | |
.hbox.align-baseline, | |
.vbox.align-baseline, | |
.align-baseline { | |
/* Old browsers */ | |
-webkit-box-align: baseline; | |
-moz-box-align: baseline; | |
box-align: baseline; | |
/* Modern browsers */ | |
align-items: baseline; | |
} | |
.hbox.align-stretch, | |
.vbox.align-stretch, | |
.align-stretch { | |
/* Old browsers */ | |
-webkit-box-align: stretch; | |
-moz-box-align: stretch; | |
box-align: stretch; | |
/* Modern browsers */ | |
align-items: stretch; | |
} | |
div.error { | |
margin: 2em; | |
text-align: center; | |
} | |
div.error > h1 { | |
font-size: 500%; | |
line-height: normal; | |
} | |
div.error > p { | |
font-size: 200%; | |
line-height: normal; | |
} | |
div.traceback-wrapper { | |
text-align: left; | |
max-width: 800px; | |
margin: auto; | |
} | |
div.traceback-wrapper pre.traceback { | |
max-height: 600px; | |
overflow: auto; | |
} | |
/** | |
* Primary styles | |
* | |
* Author: Jupyter Development Team | |
*/ | |
body { | |
background-color: #fff; | |
/* This makes sure that the body covers the entire window and needs to | |
be in a different element than the display: box in wrapper below */ | |
position: absolute; | |
left: 0px; | |
right: 0px; | |
top: 0px; | |
bottom: 0px; | |
overflow: visible; | |
} | |
body > #header { | |
/* Initially hidden to prevent FLOUC */ | |
display: none; | |
background-color: #fff; | |
/* Display over codemirror */ | |
position: relative; | |
z-index: 100; | |
} | |
body > #header #header-container { | |
display: flex; | |
flex-direction: row; | |
justify-content: space-between; | |
padding: 5px; | |
padding-bottom: 5px; | |
padding-top: 5px; | |
box-sizing: border-box; | |
-moz-box-sizing: border-box; | |
-webkit-box-sizing: border-box; | |
} | |
body > #header .header-bar { | |
width: 100%; | |
height: 1px; | |
background: #e7e7e7; | |
margin-bottom: -1px; | |
} | |
@media print { | |
body > #header { | |
display: none !important; | |
} | |
} | |
#header-spacer { | |
width: 100%; | |
visibility: hidden; | |
} | |
@media print { | |
#header-spacer { | |
display: none; | |
} | |
} | |
#ipython_notebook { | |
padding-left: 0px; | |
padding-top: 1px; | |
padding-bottom: 1px; | |
} | |
[dir="rtl"] #ipython_notebook { | |
margin-right: 10px; | |
margin-left: 0; | |
} | |
[dir="rtl"] #ipython_notebook.pull-left { | |
float: right !important; | |
float: right; | |
} | |
.flex-spacer { | |
flex: 1; | |
} | |
#noscript { | |
width: auto; | |
padding-top: 16px; | |
padding-bottom: 16px; | |
text-align: center; | |
font-size: 22px; | |
color: red; | |
font-weight: bold; | |
} | |
#ipython_notebook img { | |
height: 28px; | |
} | |
#site { | |
width: 100%; | |
display: none; | |
box-sizing: border-box; | |
-moz-box-sizing: border-box; | |
-webkit-box-sizing: border-box; | |
overflow: auto; | |
} | |
@media print { | |
#site { | |
height: auto !important; | |
} | |
} | |
/* Smaller buttons */ | |
.ui-button .ui-button-text { | |
padding: 0.2em 0.8em; | |
font-size: 77%; | |
} | |
input.ui-button { | |
padding: 0.3em 0.9em; | |
} | |
span#kernel_logo_widget { | |
margin: 0 10px; | |
} | |
span#login_widget { | |
float: right; | |
} | |
[dir="rtl"] span#login_widget { | |
float: left; | |
} | |
span#login_widget > .button, | |
#logout { | |
color: #333; | |
background-color: #fff; | |
border-color: #ccc; | |
} | |
span#login_widget > .button:focus, | |
#logout:focus, | |
span#login_widget > .button.focus, | |
#logout.focus { | |
color: #333; | |
background-color: #e6e6e6; | |
border-color: #8c8c8c; | |
} | |
span#login_widget > .button:hover, | |
#logout:hover { | |
color: #333; | |
background-color: #e6e6e6; | |
border-color: #adadad; | |
} | |
span#login_widget > .button:active, | |
#logout:active, | |
span#login_widget > .button.active, | |
#logout.active, | |
.open > .dropdown-togglespan#login_widget > .button, | |
.open > .dropdown-toggle#logout { | |
color: #333; | |
background-color: #e6e6e6; | |
border-color: #adadad; | |
} | |
span#login_widget > .button:active:hover, | |
#logout:active:hover, | |
span#login_widget > .button.active:hover, | |
#logout.active:hover, | |
.open > .dropdown-togglespan#login_widget > .button:hover, | |
.open > .dropdown-toggle#logout:hover, | |
span#login_widget > .button:active:focus, | |
#logout:active:focus, | |
span#login_widget > .button.active:focus, | |
#logout.active:focus, | |
.open > .dropdown-togglespan#login_widget > .button:focus, | |
.open > .dropdown-toggle#logout:focus, | |
span#login_widget > .button:active.focus, | |
#logout:active.focus, | |
span#login_widget > .button.active.focus, | |
#logout.active.focus, | |
.open > .dropdown-togglespan#login_widget > .button.focus, | |
.open > .dropdown-toggle#logout.focus { | |
color: #333; | |
background-color: #d4d4d4; | |
border-color: #8c8c8c; | |
} | |
span#login_widget > .button:active, | |
#logout:active, | |
span#login_widget > .button.active, | |
#logout.active, | |
.open > .dropdown-togglespan#login_widget > .button, | |
.open > .dropdown-toggle#logout { | |
background-image: none; | |
} | |
span#login_widget > .button.disabled:hover, | |
#logout.disabled:hover, | |
span#login_widget > .button[disabled]:hover, | |
#logout[disabled]:hover, | |
fieldset[disabled] span#login_widget > .button:hover, | |
fieldset[disabled] #logout:hover, | |
span#login_widget > .button.disabled:focus, | |
#logout.disabled:focus, | |
span#login_widget > .button[disabled]:focus, | |
#logout[disabled]:focus, | |
fieldset[disabled] span#login_widget > .button:focus, | |
fieldset[disabled] #logout:focus, | |
span#login_widget > .button.disabled.focus, | |
#logout.disabled.focus, | |
span#login_widget > .button[disabled].focus, | |
#logout[disabled].focus, | |
fieldset[disabled] span#login_widget > .button.focus, | |
fieldset[disabled] #logout.focus { | |
background-color: #fff; | |
border-color: #ccc; | |
} | |
span#login_widget > .button .badge, | |
#logout .badge { | |
color: #fff; | |
background-color: #333; | |
} | |
.nav-header { | |
text-transform: none; | |
} | |
#header > span { | |
margin-top: 10px; | |
} | |
.modal_stretch .modal-dialog { | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: vertical; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: vertical; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: vertical; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: column; | |
align-items: stretch; | |
min-height: 80vh; | |
} | |
.modal_stretch .modal-dialog .modal-body { | |
max-height: calc(100vh - 200px); | |
overflow: auto; | |
flex: 1; | |
} | |
.modal-header { | |
cursor: move; | |
} | |
@media (min-width: 768px) { | |
.modal .modal-dialog { | |
width: 700px; | |
} | |
} | |
@media (min-width: 768px) { | |
select.form-control { | |
margin-left: 12px; | |
margin-right: 12px; | |
} | |
} | |
/*! | |
* | |
* IPython auth | |
* | |
*/ | |
.center-nav { | |
display: inline-block; | |
margin-bottom: -4px; | |
} | |
[dir="rtl"] .center-nav form.pull-left { | |
float: right !important; | |
float: right; | |
} | |
[dir="rtl"] .center-nav .navbar-text { | |
float: right; | |
} | |
[dir="rtl"] .navbar-inner { | |
text-align: right; | |
} | |
[dir="rtl"] div.text-left { | |
text-align: right; | |
} | |
/*! | |
* | |
* IPython tree view | |
* | |
*/ | |
/* We need an invisible input field on top of the sentense*/ | |
/* "Drag file onto the list ..." */ | |
.alternate_upload { | |
background-color: none; | |
display: inline; | |
} | |
.alternate_upload.form { | |
padding: 0; | |
margin: 0; | |
} | |
.alternate_upload input.fileinput { | |
position: absolute; | |
display: block; | |
width: 100%; | |
height: 100%; | |
overflow: hidden; | |
cursor: pointer; | |
opacity: 0; | |
z-index: 2; | |
} | |
.alternate_upload .btn-xs > input.fileinput { | |
margin: -1px -5px; | |
} | |
.alternate_upload .btn-upload { | |
position: relative; | |
height: 22px; | |
} | |
::-webkit-file-upload-button { | |
cursor: pointer; | |
} | |
/** | |
* Primary styles | |
* | |
* Author: Jupyter Development Team | |
*/ | |
ul#tabs { | |
margin-bottom: 4px; | |
} | |
ul#tabs a { | |
padding-top: 6px; | |
padding-bottom: 4px; | |
} | |
[dir="rtl"] ul#tabs.nav-tabs > li { | |
float: right; | |
} | |
[dir="rtl"] ul#tabs.nav.nav-tabs { | |
padding-right: 0; | |
} | |
ul.breadcrumb a:focus, | |
ul.breadcrumb a:hover { | |
text-decoration: none; | |
} | |
ul.breadcrumb i.icon-home { | |
font-size: 16px; | |
margin-right: 4px; | |
} | |
ul.breadcrumb span { | |
color: #5e5e5e; | |
} | |
.list_toolbar { | |
padding: 4px 0 4px 0; | |
vertical-align: middle; | |
} | |
.list_toolbar .tree-buttons { | |
padding-top: 1px; | |
} | |
[dir="rtl"] .list_toolbar .tree-buttons .pull-right { | |
float: left !important; | |
float: left; | |
} | |
[dir="rtl"] .list_toolbar .col-sm-4, | |
[dir="rtl"] .list_toolbar .col-sm-8 { | |
float: right; | |
} | |
.dynamic-buttons { | |
padding-top: 3px; | |
display: inline-block; | |
} | |
.list_toolbar [class*="span"] { | |
min-height: 24px; | |
} | |
.list_header { | |
font-weight: bold; | |
background-color: #EEE; | |
} | |
.list_placeholder { | |
font-weight: bold; | |
padding-top: 4px; | |
padding-bottom: 4px; | |
padding-left: 7px; | |
padding-right: 7px; | |
} | |
.list_container { | |
margin-top: 4px; | |
margin-bottom: 20px; | |
border: 1px solid #ddd; | |
border-radius: 2px; | |
} | |
.list_container > div { | |
border-bottom: 1px solid #ddd; | |
} | |
.list_container > div:hover .list-item { | |
background-color: red; | |
} | |
.list_container > div:last-child { | |
border: none; | |
} | |
.list_item:hover .list_item { | |
background-color: #ddd; | |
} | |
.list_item a { | |
text-decoration: none; | |
} | |
.list_item:hover { | |
background-color: #fafafa; | |
} | |
.list_header > div, | |
.list_item > div { | |
padding-top: 4px; | |
padding-bottom: 4px; | |
padding-left: 7px; | |
padding-right: 7px; | |
line-height: 22px; | |
} | |
.list_header > div input, | |
.list_item > div input { | |
margin-right: 7px; | |
margin-left: 14px; | |
vertical-align: text-bottom; | |
line-height: 22px; | |
position: relative; | |
top: -1px; | |
} | |
.list_header > div .item_link, | |
.list_item > div .item_link { | |
margin-left: -1px; | |
vertical-align: baseline; | |
line-height: 22px; | |
} | |
[dir="rtl"] .list_item > div input { | |
margin-right: 0; | |
} | |
.new-file input[type=checkbox] { | |
visibility: hidden; | |
} | |
.item_name { | |
line-height: 22px; | |
height: 24px; | |
} | |
.item_icon { | |
font-size: 14px; | |
color: #5e5e5e; | |
margin-right: 7px; | |
margin-left: 7px; | |
line-height: 22px; | |
vertical-align: baseline; | |
} | |
.item_modified { | |
margin-right: 7px; | |
margin-left: 7px; | |
} | |
[dir="rtl"] .item_modified.pull-right { | |
float: left !important; | |
float: left; | |
} | |
.item_buttons { | |
line-height: 1em; | |
margin-left: -5px; | |
} | |
.item_buttons .btn, | |
.item_buttons .btn-group, | |
.item_buttons .input-group { | |
float: left; | |
} | |
.item_buttons > .btn, | |
.item_buttons > .btn-group, | |
.item_buttons > .input-group { | |
margin-left: 5px; | |
} | |
.item_buttons .btn { | |
min-width: 13ex; | |
} | |
.item_buttons .running-indicator { | |
padding-top: 4px; | |
color: #5cb85c; | |
} | |
.item_buttons .kernel-name { | |
padding-top: 4px; | |
color: #5bc0de; | |
margin-right: 7px; | |
float: left; | |
} | |
[dir="rtl"] .item_buttons.pull-right { | |
float: left !important; | |
float: left; | |
} | |
[dir="rtl"] .item_buttons .kernel-name { | |
margin-left: 7px; | |
float: right; | |
} | |
.toolbar_info { | |
height: 24px; | |
line-height: 24px; | |
} | |
.list_item input:not([type=checkbox]) { | |
padding-top: 3px; | |
padding-bottom: 3px; | |
height: 22px; | |
line-height: 14px; | |
margin: 0px; | |
} | |
.highlight_text { | |
color: blue; | |
} | |
#project_name { | |
display: inline-block; | |
padding-left: 7px; | |
margin-left: -2px; | |
} | |
#project_name > .breadcrumb { | |
padding: 0px; | |
margin-bottom: 0px; | |
background-color: transparent; | |
font-weight: bold; | |
} | |
.sort_button { | |
display: inline-block; | |
padding-left: 7px; | |
} | |
[dir="rtl"] .sort_button.pull-right { | |
float: left !important; | |
float: left; | |
} | |
#tree-selector { | |
padding-right: 0px; | |
} | |
#button-select-all { | |
min-width: 50px; | |
} | |
[dir="rtl"] #button-select-all.btn { | |
float: right ; | |
} | |
#select-all { | |
margin-left: 7px; | |
margin-right: 2px; | |
margin-top: 2px; | |
height: 16px; | |
} | |
[dir="rtl"] #select-all.pull-left { | |
float: right !important; | |
float: right; | |
} | |
.menu_icon { | |
margin-right: 2px; | |
} | |
.tab-content .row { | |
margin-left: 0px; | |
margin-right: 0px; | |
} | |
.folder_icon:before { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
content: "\f114"; | |
} | |
.folder_icon:before.fa-pull-left { | |
margin-right: .3em; | |
} | |
.folder_icon:before.fa-pull-right { | |
margin-left: .3em; | |
} | |
.folder_icon:before.pull-left { | |
margin-right: .3em; | |
} | |
.folder_icon:before.pull-right { | |
margin-left: .3em; | |
} | |
.notebook_icon:before { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
content: "\f02d"; | |
position: relative; | |
top: -1px; | |
} | |
.notebook_icon:before.fa-pull-left { | |
margin-right: .3em; | |
} | |
.notebook_icon:before.fa-pull-right { | |
margin-left: .3em; | |
} | |
.notebook_icon:before.pull-left { | |
margin-right: .3em; | |
} | |
.notebook_icon:before.pull-right { | |
margin-left: .3em; | |
} | |
.running_notebook_icon:before { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
content: "\f02d"; | |
position: relative; | |
top: -1px; | |
color: #5cb85c; | |
} | |
.running_notebook_icon:before.fa-pull-left { | |
margin-right: .3em; | |
} | |
.running_notebook_icon:before.fa-pull-right { | |
margin-left: .3em; | |
} | |
.running_notebook_icon:before.pull-left { | |
margin-right: .3em; | |
} | |
.running_notebook_icon:before.pull-right { | |
margin-left: .3em; | |
} | |
.file_icon:before { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
content: "\f016"; | |
position: relative; | |
top: -2px; | |
} | |
.file_icon:before.fa-pull-left { | |
margin-right: .3em; | |
} | |
.file_icon:before.fa-pull-right { | |
margin-left: .3em; | |
} | |
.file_icon:before.pull-left { | |
margin-right: .3em; | |
} | |
.file_icon:before.pull-right { | |
margin-left: .3em; | |
} | |
#notebook_toolbar .pull-right { | |
padding-top: 0px; | |
margin-right: -1px; | |
} | |
ul#new-menu { | |
left: auto; | |
right: 0; | |
} | |
#new-menu .dropdown-header { | |
font-size: 10px; | |
border-bottom: 1px solid #e5e5e5; | |
padding: 0 0 3px; | |
margin: -3px 20px 0; | |
} | |
.kernel-menu-icon { | |
padding-right: 12px; | |
width: 24px; | |
content: "\f096"; | |
} | |
.kernel-menu-icon:before { | |
content: "\f096"; | |
} | |
.kernel-menu-icon-current:before { | |
content: "\f00c"; | |
} | |
#tab_content { | |
padding-top: 20px; | |
} | |
#running .panel-group .panel { | |
margin-top: 3px; | |
margin-bottom: 1em; | |
} | |
#running .panel-group .panel .panel-heading { | |
background-color: #EEE; | |
padding-top: 4px; | |
padding-bottom: 4px; | |
padding-left: 7px; | |
padding-right: 7px; | |
line-height: 22px; | |
} | |
#running .panel-group .panel .panel-heading a:focus, | |
#running .panel-group .panel .panel-heading a:hover { | |
text-decoration: none; | |
} | |
#running .panel-group .panel .panel-body { | |
padding: 0px; | |
} | |
#running .panel-group .panel .panel-body .list_container { | |
margin-top: 0px; | |
margin-bottom: 0px; | |
border: 0px; | |
border-radius: 0px; | |
} | |
#running .panel-group .panel .panel-body .list_container .list_item { | |
border-bottom: 1px solid #ddd; | |
} | |
#running .panel-group .panel .panel-body .list_container .list_item:last-child { | |
border-bottom: 0px; | |
} | |
.delete-button { | |
display: none; | |
} | |
.duplicate-button { | |
display: none; | |
} | |
.rename-button { | |
display: none; | |
} | |
.move-button { | |
display: none; | |
} | |
.download-button { | |
display: none; | |
} | |
.shutdown-button { | |
display: none; | |
} | |
.dynamic-instructions { | |
display: inline-block; | |
padding-top: 4px; | |
} | |
/*! | |
* | |
* IPython text editor webapp | |
* | |
*/ | |
.selected-keymap i.fa { | |
padding: 0px 5px; | |
} | |
.selected-keymap i.fa:before { | |
content: "\f00c"; | |
} | |
#mode-menu { | |
overflow: auto; | |
max-height: 20em; | |
} | |
.edit_app #header { | |
-webkit-box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2); | |
box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2); | |
} | |
.edit_app #menubar .navbar { | |
/* Use a negative 1 bottom margin, so the border overlaps the border of the | |
header */ | |
margin-bottom: -1px; | |
} | |
.dirty-indicator { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
width: 20px; | |
} | |
.dirty-indicator.fa-pull-left { | |
margin-right: .3em; | |
} | |
.dirty-indicator.fa-pull-right { | |
margin-left: .3em; | |
} | |
.dirty-indicator.pull-left { | |
margin-right: .3em; | |
} | |
.dirty-indicator.pull-right { | |
margin-left: .3em; | |
} | |
.dirty-indicator-dirty { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
width: 20px; | |
} | |
.dirty-indicator-dirty.fa-pull-left { | |
margin-right: .3em; | |
} | |
.dirty-indicator-dirty.fa-pull-right { | |
margin-left: .3em; | |
} | |
.dirty-indicator-dirty.pull-left { | |
margin-right: .3em; | |
} | |
.dirty-indicator-dirty.pull-right { | |
margin-left: .3em; | |
} | |
.dirty-indicator-clean { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
width: 20px; | |
} | |
.dirty-indicator-clean.fa-pull-left { | |
margin-right: .3em; | |
} | |
.dirty-indicator-clean.fa-pull-right { | |
margin-left: .3em; | |
} | |
.dirty-indicator-clean.pull-left { | |
margin-right: .3em; | |
} | |
.dirty-indicator-clean.pull-right { | |
margin-left: .3em; | |
} | |
.dirty-indicator-clean:before { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
content: "\f00c"; | |
} | |
.dirty-indicator-clean:before.fa-pull-left { | |
margin-right: .3em; | |
} | |
.dirty-indicator-clean:before.fa-pull-right { | |
margin-left: .3em; | |
} | |
.dirty-indicator-clean:before.pull-left { | |
margin-right: .3em; | |
} | |
.dirty-indicator-clean:before.pull-right { | |
margin-left: .3em; | |
} | |
#filename { | |
font-size: 16pt; | |
display: table; | |
padding: 0px 5px; | |
} | |
#current-mode { | |
padding-left: 5px; | |
padding-right: 5px; | |
} | |
#texteditor-backdrop { | |
padding-top: 20px; | |
padding-bottom: 20px; | |
} | |
@media not print { | |
#texteditor-backdrop { | |
background-color: #EEE; | |
} | |
} | |
@media print { | |
#texteditor-backdrop #texteditor-container .CodeMirror-gutter, | |
#texteditor-backdrop #texteditor-container .CodeMirror-gutters { | |
background-color: #fff; | |
} | |
} | |
@media not print { | |
#texteditor-backdrop #texteditor-container .CodeMirror-gutter, | |
#texteditor-backdrop #texteditor-container .CodeMirror-gutters { | |
background-color: #fff; | |
} | |
} | |
@media not print { | |
#texteditor-backdrop #texteditor-container { | |
padding: 0px; | |
background-color: #fff; | |
-webkit-box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2); | |
box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2); | |
} | |
} | |
.CodeMirror-dialog { | |
background-color: #fff; | |
} | |
/*! | |
* | |
* IPython notebook | |
* | |
*/ | |
/* CSS font colors for translated ANSI escape sequences */ | |
/* The color values are a mix of | |
http://www.xcolors.net/dl/baskerville-ivorylight and | |
http://www.xcolors.net/dl/euphrasia */ | |
.ansi-black-fg { | |
color: #3E424D; | |
} | |
.ansi-black-bg { | |
background-color: #3E424D; | |
} | |
.ansi-black-intense-fg { | |
color: #282C36; | |
} | |
.ansi-black-intense-bg { | |
background-color: #282C36; | |
} | |
.ansi-red-fg { | |
color: #E75C58; | |
} | |
.ansi-red-bg { | |
background-color: #E75C58; | |
} | |
.ansi-red-intense-fg { | |
color: #B22B31; | |
} | |
.ansi-red-intense-bg { | |
background-color: #B22B31; | |
} | |
.ansi-green-fg { | |
color: #00A250; | |
} | |
.ansi-green-bg { | |
background-color: #00A250; | |
} | |
.ansi-green-intense-fg { | |
color: #007427; | |
} | |
.ansi-green-intense-bg { | |
background-color: #007427; | |
} | |
.ansi-yellow-fg { | |
color: #DDB62B; | |
} | |
.ansi-yellow-bg { | |
background-color: #DDB62B; | |
} | |
.ansi-yellow-intense-fg { | |
color: #B27D12; | |
} | |
.ansi-yellow-intense-bg { | |
background-color: #B27D12; | |
} | |
.ansi-blue-fg { | |
color: #208FFB; | |
} | |
.ansi-blue-bg { | |
background-color: #208FFB; | |
} | |
.ansi-blue-intense-fg { | |
color: #0065CA; | |
} | |
.ansi-blue-intense-bg { | |
background-color: #0065CA; | |
} | |
.ansi-magenta-fg { | |
color: #D160C4; | |
} | |
.ansi-magenta-bg { | |
background-color: #D160C4; | |
} | |
.ansi-magenta-intense-fg { | |
color: #A03196; | |
} | |
.ansi-magenta-intense-bg { | |
background-color: #A03196; | |
} | |
.ansi-cyan-fg { | |
color: #60C6C8; | |
} | |
.ansi-cyan-bg { | |
background-color: #60C6C8; | |
} | |
.ansi-cyan-intense-fg { | |
color: #258F8F; | |
} | |
.ansi-cyan-intense-bg { | |
background-color: #258F8F; | |
} | |
.ansi-white-fg { | |
color: #C5C1B4; | |
} | |
.ansi-white-bg { | |
background-color: #C5C1B4; | |
} | |
.ansi-white-intense-fg { | |
color: #A1A6B2; | |
} | |
.ansi-white-intense-bg { | |
background-color: #A1A6B2; | |
} | |
.ansi-default-inverse-fg { | |
color: #FFFFFF; | |
} | |
.ansi-default-inverse-bg { | |
background-color: #000000; | |
} | |
.ansi-bold { | |
font-weight: bold; | |
} | |
.ansi-underline { | |
text-decoration: underline; | |
} | |
/* The following styles are deprecated an will be removed in a future version */ | |
.ansibold { | |
font-weight: bold; | |
} | |
.ansi-inverse { | |
outline: 0.5px dotted; | |
} | |
/* use dark versions for foreground, to improve visibility */ | |
.ansiblack { | |
color: black; | |
} | |
.ansired { | |
color: darkred; | |
} | |
.ansigreen { | |
color: darkgreen; | |
} | |
.ansiyellow { | |
color: #c4a000; | |
} | |
.ansiblue { | |
color: darkblue; | |
} | |
.ansipurple { | |
color: darkviolet; | |
} | |
.ansicyan { | |
color: steelblue; | |
} | |
.ansigray { | |
color: gray; | |
} | |
/* and light for background, for the same reason */ | |
.ansibgblack { | |
background-color: black; | |
} | |
.ansibgred { | |
background-color: red; | |
} | |
.ansibggreen { | |
background-color: green; | |
} | |
.ansibgyellow { | |
background-color: yellow; | |
} | |
.ansibgblue { | |
background-color: blue; | |
} | |
.ansibgpurple { | |
background-color: magenta; | |
} | |
.ansibgcyan { | |
background-color: cyan; | |
} | |
.ansibggray { | |
background-color: gray; | |
} | |
div.cell { | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: vertical; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: vertical; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: vertical; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: column; | |
align-items: stretch; | |
border-radius: 2px; | |
box-sizing: border-box; | |
-moz-box-sizing: border-box; | |
-webkit-box-sizing: border-box; | |
border-width: 1px; | |
border-style: solid; | |
border-color: transparent; | |
width: 100%; | |
padding: 5px; | |
/* This acts as a spacer between cells, that is outside the border */ | |
margin: 0px; | |
outline: none; | |
position: relative; | |
overflow: visible; | |
} | |
div.cell:before { | |
position: absolute; | |
display: block; | |
top: -1px; | |
left: -1px; | |
width: 5px; | |
height: calc(100% + 2px); | |
content: ''; | |
background: transparent; | |
} | |
div.cell.jupyter-soft-selected { | |
border-left-color: #E3F2FD; | |
border-left-width: 1px; | |
padding-left: 5px; | |
border-right-color: #E3F2FD; | |
border-right-width: 1px; | |
background: #E3F2FD; | |
} | |
@media print { | |
div.cell.jupyter-soft-selected { | |
border-color: transparent; | |
} | |
} | |
div.cell.selected, | |
div.cell.selected.jupyter-soft-selected { | |
border-color: #ababab; | |
} | |
div.cell.selected:before, | |
div.cell.selected.jupyter-soft-selected:before { | |
position: absolute; | |
display: block; | |
top: -1px; | |
left: -1px; | |
width: 5px; | |
height: calc(100% + 2px); | |
content: ''; | |
background: #42A5F5; | |
} | |
@media print { | |
div.cell.selected, | |
div.cell.selected.jupyter-soft-selected { | |
border-color: transparent; | |
} | |
} | |
.edit_mode div.cell.selected { | |
border-color: #66BB6A; | |
} | |
.edit_mode div.cell.selected:before { | |
position: absolute; | |
display: block; | |
top: -1px; | |
left: -1px; | |
width: 5px; | |
height: calc(100% + 2px); | |
content: ''; | |
background: #66BB6A; | |
} | |
@media print { | |
.edit_mode div.cell.selected { | |
border-color: transparent; | |
} | |
} | |
.prompt { | |
/* This needs to be wide enough for 3 digit prompt numbers: In[100]: */ | |
min-width: 14ex; | |
/* This padding is tuned to match the padding on the CodeMirror editor. */ | |
padding: 0.4em; | |
margin: 0px; | |
font-family: monospace; | |
text-align: right; | |
/* This has to match that of the the CodeMirror class line-height below */ | |
line-height: 1.21429em; | |
/* Don't highlight prompt number selection */ | |
-webkit-touch-callout: none; | |
-webkit-user-select: none; | |
-khtml-user-select: none; | |
-moz-user-select: none; | |
-ms-user-select: none; | |
user-select: none; | |
/* Use default cursor */ | |
cursor: default; | |
} | |
@media (max-width: 540px) { | |
.prompt { | |
text-align: left; | |
} | |
} | |
div.inner_cell { | |
min-width: 0; | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: vertical; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: vertical; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: vertical; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: column; | |
align-items: stretch; | |
/* Old browsers */ | |
-webkit-box-flex: 1; | |
-moz-box-flex: 1; | |
box-flex: 1; | |
/* Modern browsers */ | |
flex: 1; | |
} | |
/* input_area and input_prompt must match in top border and margin for alignment */ | |
div.input_area { | |
border: 1px solid #cfcfcf; | |
border-radius: 2px; | |
background: #f7f7f7; | |
line-height: 1.21429em; | |
} | |
/* This is needed so that empty prompt areas can collapse to zero height when there | |
is no content in the output_subarea and the prompt. The main purpose of this is | |
to make sure that empty JavaScript output_subareas have no height. */ | |
div.prompt:empty { | |
padding-top: 0; | |
padding-bottom: 0; | |
} | |
div.unrecognized_cell { | |
padding: 5px 5px 5px 0px; | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: horizontal; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: horizontal; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: horizontal; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: row; | |
align-items: stretch; | |
} | |
div.unrecognized_cell .inner_cell { | |
border-radius: 2px; | |
padding: 5px; | |
font-weight: bold; | |
color: red; | |
border: 1px solid #cfcfcf; | |
background: #eaeaea; | |
} | |
div.unrecognized_cell .inner_cell a { | |
color: inherit; | |
text-decoration: none; | |
} | |
div.unrecognized_cell .inner_cell a:hover { | |
color: inherit; | |
text-decoration: none; | |
} | |
@media (max-width: 540px) { | |
div.unrecognized_cell > div.prompt { | |
display: none; | |
} | |
} | |
div.code_cell { | |
/* avoid page breaking on code cells when printing */ | |
} | |
@media print { | |
div.code_cell { | |
page-break-inside: avoid; | |
} | |
} | |
/* any special styling for code cells that are currently running goes here */ | |
div.input { | |
page-break-inside: avoid; | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: horizontal; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: horizontal; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: horizontal; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: row; | |
align-items: stretch; | |
} | |
@media (max-width: 540px) { | |
div.input { | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: vertical; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: vertical; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: vertical; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: column; | |
align-items: stretch; | |
} | |
} | |
/* input_area and input_prompt must match in top border and margin for alignment */ | |
div.input_prompt { | |
color: #303F9F; | |
border-top: 1px solid transparent; | |
} | |
div.input_area > div.highlight { | |
margin: 0.4em; | |
border: none; | |
padding: 0px; | |
background-color: transparent; | |
} | |
div.input_area > div.highlight > pre { | |
margin: 0px; | |
border: none; | |
padding: 0px; | |
background-color: transparent; | |
} | |
/* The following gets added to the <head> if it is detected that the user has a | |
* monospace font with inconsistent normal/bold/italic height. See | |
* notebookmain.js. Such fonts will have keywords vertically offset with | |
* respect to the rest of the text. The user should select a better font. | |
* See: https://github.com/ipython/ipython/issues/1503 | |
* | |
* .CodeMirror span { | |
* vertical-align: bottom; | |
* } | |
*/ | |
.CodeMirror { | |
line-height: 1.21429em; | |
/* Changed from 1em to our global default */ | |
font-size: 14px; | |
height: auto; | |
/* Changed to auto to autogrow */ | |
background: none; | |
/* Changed from white to allow our bg to show through */ | |
} | |
.CodeMirror-scroll { | |
/* The CodeMirror docs are a bit fuzzy on if overflow-y should be hidden or visible.*/ | |
/* We have found that if it is visible, vertical scrollbars appear with font size changes.*/ | |
overflow-y: hidden; | |
overflow-x: auto; | |
} | |
.CodeMirror-lines { | |
/* In CM2, this used to be 0.4em, but in CM3 it went to 4px. We need the em value because */ | |
/* we have set a different line-height and want this to scale with that. */ | |
/* Note that this should set vertical padding only, since CodeMirror assumes | |
that horizontal padding will be set on CodeMirror pre */ | |
padding: 0.4em 0; | |
} | |
.CodeMirror-linenumber { | |
padding: 0 8px 0 4px; | |
} | |
.CodeMirror-gutters { | |
border-bottom-left-radius: 2px; | |
border-top-left-radius: 2px; | |
} | |
.CodeMirror pre { | |
/* In CM3 this went to 4px from 0 in CM2. This sets horizontal padding only, | |
use .CodeMirror-lines for vertical */ | |
padding: 0 0.4em; | |
border: 0; | |
border-radius: 0; | |
} | |
.CodeMirror-cursor { | |
border-left: 1.4px solid black; | |
} | |
@media screen and (min-width: 2138px) and (max-width: 4319px) { | |
.CodeMirror-cursor { | |
border-left: 2px solid black; | |
} | |
} | |
@media screen and (min-width: 4320px) { | |
.CodeMirror-cursor { | |
border-left: 4px solid black; | |
} | |
} | |
/* | |
Original style from softwaremaniacs.org (c) Ivan Sagalaev <[email protected]> | |
Adapted from GitHub theme | |
*/ | |
.highlight-base { | |
color: #000; | |
} | |
.highlight-variable { | |
color: #000; | |
} | |
.highlight-variable-2 { | |
color: #1a1a1a; | |
} | |
.highlight-variable-3 { | |
color: #333333; | |
} | |
.highlight-string { | |
color: #BA2121; | |
} | |
.highlight-comment { | |
color: #408080; | |
font-style: italic; | |
} | |
.highlight-number { | |
color: #080; | |
} | |
.highlight-atom { | |
color: #88F; | |
} | |
.highlight-keyword { | |
color: #008000; | |
font-weight: bold; | |
} | |
.highlight-builtin { | |
color: #008000; | |
} | |
.highlight-error { | |
color: #f00; | |
} | |
.highlight-operator { | |
color: #AA22FF; | |
font-weight: bold; | |
} | |
.highlight-meta { | |
color: #AA22FF; | |
} | |
/* previously not defined, copying from default codemirror */ | |
.highlight-def { | |
color: #00f; | |
} | |
.highlight-string-2 { | |
color: #f50; | |
} | |
.highlight-qualifier { | |
color: #555; | |
} | |
.highlight-bracket { | |
color: #997; | |
} | |
.highlight-tag { | |
color: #170; | |
} | |
.highlight-attribute { | |
color: #00c; | |
} | |
.highlight-header { | |
color: blue; | |
} | |
.highlight-quote { | |
color: #090; | |
} | |
.highlight-link { | |
color: #00c; | |
} | |
/* apply the same style to codemirror */ | |
.cm-s-ipython span.cm-keyword { | |
color: #008000; | |
font-weight: bold; | |
} | |
.cm-s-ipython span.cm-atom { | |
color: #88F; | |
} | |
.cm-s-ipython span.cm-number { | |
color: #080; | |
} | |
.cm-s-ipython span.cm-def { | |
color: #00f; | |
} | |
.cm-s-ipython span.cm-variable { | |
color: #000; | |
} | |
.cm-s-ipython span.cm-operator { | |
color: #AA22FF; | |
font-weight: bold; | |
} | |
.cm-s-ipython span.cm-variable-2 { | |
color: #1a1a1a; | |
} | |
.cm-s-ipython span.cm-variable-3 { | |
color: #333333; | |
} | |
.cm-s-ipython span.cm-comment { | |
color: #408080; | |
font-style: italic; | |
} | |
.cm-s-ipython span.cm-string { | |
color: #BA2121; | |
} | |
.cm-s-ipython span.cm-string-2 { | |
color: #f50; | |
} | |
.cm-s-ipython span.cm-meta { | |
color: #AA22FF; | |
} | |
.cm-s-ipython span.cm-qualifier { | |
color: #555; | |
} | |
.cm-s-ipython span.cm-builtin { | |
color: #008000; | |
} | |
.cm-s-ipython span.cm-bracket { | |
color: #997; | |
} | |
.cm-s-ipython span.cm-tag { | |
color: #170; | |
} | |
.cm-s-ipython span.cm-attribute { | |
color: #00c; | |
} | |
.cm-s-ipython span.cm-header { | |
color: blue; | |
} | |
.cm-s-ipython span.cm-quote { | |
color: #090; | |
} | |
.cm-s-ipython span.cm-link { | |
color: #00c; | |
} | |
.cm-s-ipython span.cm-error { | |
color: #f00; | |
} | |
.cm-s-ipython span.cm-tab { | |
background: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAADAAAAAMCAYAAAAkuj5RAAAAAXNSR0IArs4c6QAAAGFJREFUSMft1LsRQFAQheHPowAKoACx3IgEKtaEHujDjORSgWTH/ZOdnZOcM/sgk/kFFWY0qV8foQwS4MKBCS3qR6ixBJvElOobYAtivseIE120FaowJPN75GMu8j/LfMwNjh4HUpwg4LUAAAAASUVORK5CYII=); | |
background-position: right; | |
background-repeat: no-repeat; | |
} | |
div.output_wrapper { | |
/* this position must be relative to enable descendents to be absolute within it */ | |
position: relative; | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: vertical; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: vertical; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: vertical; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: column; | |
align-items: stretch; | |
z-index: 1; | |
} | |
/* class for the output area when it should be height-limited */ | |
div.output_scroll { | |
/* ideally, this would be max-height, but FF barfs all over that */ | |
height: 24em; | |
/* FF needs this *and the wrapper* to specify full width, or it will shrinkwrap */ | |
width: 100%; | |
overflow: auto; | |
border-radius: 2px; | |
-webkit-box-shadow: inset 0 2px 8px rgba(0, 0, 0, 0.8); | |
box-shadow: inset 0 2px 8px rgba(0, 0, 0, 0.8); | |
display: block; | |
} | |
/* output div while it is collapsed */ | |
div.output_collapsed { | |
margin: 0px; | |
padding: 0px; | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: vertical; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: vertical; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: vertical; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: column; | |
align-items: stretch; | |
} | |
div.out_prompt_overlay { | |
height: 100%; | |
padding: 0px 0.4em; | |
position: absolute; | |
border-radius: 2px; | |
} | |
div.out_prompt_overlay:hover { | |
/* use inner shadow to get border that is computed the same on WebKit/FF */ | |
-webkit-box-shadow: inset 0 0 1px #000; | |
box-shadow: inset 0 0 1px #000; | |
background: rgba(240, 240, 240, 0.5); | |
} | |
div.output_prompt { | |
color: #D84315; | |
} | |
/* This class is the outer container of all output sections. */ | |
div.output_area { | |
padding: 0px; | |
page-break-inside: avoid; | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: horizontal; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: horizontal; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: horizontal; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: row; | |
align-items: stretch; | |
} | |
div.output_area .MathJax_Display { | |
text-align: left !important; | |
} | |
div.output_area .rendered_html table { | |
margin-left: 0; | |
margin-right: 0; | |
} | |
div.output_area .rendered_html img { | |
margin-left: 0; | |
margin-right: 0; | |
} | |
div.output_area img, | |
div.output_area svg { | |
max-width: 100%; | |
height: auto; | |
} | |
div.output_area img.unconfined, | |
div.output_area svg.unconfined { | |
max-width: none; | |
} | |
div.output_area .mglyph > img { | |
max-width: none; | |
} | |
/* This is needed to protect the pre formating from global settings such | |
as that of bootstrap */ | |
.output { | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: vertical; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: vertical; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: vertical; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: column; | |
align-items: stretch; | |
} | |
@media (max-width: 540px) { | |
div.output_area { | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: vertical; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: vertical; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: vertical; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: column; | |
align-items: stretch; | |
} | |
} | |
div.output_area pre { | |
margin: 0; | |
padding: 1px 0 1px 0; | |
border: 0; | |
vertical-align: baseline; | |
color: black; | |
background-color: transparent; | |
border-radius: 0; | |
} | |
/* This class is for the output subarea inside the output_area and after | |
the prompt div. */ | |
div.output_subarea { | |
overflow-x: auto; | |
padding: 0.4em; | |
/* Old browsers */ | |
-webkit-box-flex: 1; | |
-moz-box-flex: 1; | |
box-flex: 1; | |
/* Modern browsers */ | |
flex: 1; | |
max-width: calc(100% - 14ex); | |
} | |
div.output_scroll div.output_subarea { | |
overflow-x: visible; | |
} | |
/* The rest of the output_* classes are for special styling of the different | |
output types */ | |
/* all text output has this class: */ | |
div.output_text { | |
text-align: left; | |
color: #000; | |
/* This has to match that of the the CodeMirror class line-height below */ | |
line-height: 1.21429em; | |
} | |
/* stdout/stderr are 'text' as well as 'stream', but execute_result/error are *not* streams */ | |
div.output_stderr { | |
background: #fdd; | |
/* very light red background for stderr */ | |
} | |
div.output_latex { | |
text-align: left; | |
} | |
/* Empty output_javascript divs should have no height */ | |
div.output_javascript:empty { | |
padding: 0; | |
} | |
.js-error { | |
color: darkred; | |
} | |
/* raw_input styles */ | |
div.raw_input_container { | |
line-height: 1.21429em; | |
padding-top: 5px; | |
} | |
pre.raw_input_prompt { | |
/* nothing needed here. */ | |
} | |
input.raw_input { | |
font-family: monospace; | |
font-size: inherit; | |
color: inherit; | |
width: auto; | |
/* make sure input baseline aligns with prompt */ | |
vertical-align: baseline; | |
/* padding + margin = 0.5em between prompt and cursor */ | |
padding: 0em 0.25em; | |
margin: 0em 0.25em; | |
} | |
input.raw_input:focus { | |
box-shadow: none; | |
} | |
p.p-space { | |
margin-bottom: 10px; | |
} | |
div.output_unrecognized { | |
padding: 5px; | |
font-weight: bold; | |
color: red; | |
} | |
div.output_unrecognized a { | |
color: inherit; | |
text-decoration: none; | |
} | |
div.output_unrecognized a:hover { | |
color: inherit; | |
text-decoration: none; | |
} | |
.rendered_html { | |
color: #000; | |
/* any extras will just be numbers: */ | |
} | |
.rendered_html em { | |
font-style: italic; | |
} | |
.rendered_html strong { | |
font-weight: bold; | |
} | |
.rendered_html u { | |
text-decoration: underline; | |
} | |
.rendered_html :link { | |
text-decoration: underline; | |
} | |
.rendered_html :visited { | |
text-decoration: underline; | |
} | |
.rendered_html h1 { | |
font-size: 185.7%; | |
margin: 1.08em 0 0 0; | |
font-weight: bold; | |
line-height: 1.0; | |
} | |
.rendered_html h2 { | |
font-size: 157.1%; | |
margin: 1.27em 0 0 0; | |
font-weight: bold; | |
line-height: 1.0; | |
} | |
.rendered_html h3 { | |
font-size: 128.6%; | |
margin: 1.55em 0 0 0; | |
font-weight: bold; | |
line-height: 1.0; | |
} | |
.rendered_html h4 { | |
font-size: 100%; | |
margin: 2em 0 0 0; | |
font-weight: bold; | |
line-height: 1.0; | |
} | |
.rendered_html h5 { | |
font-size: 100%; | |
margin: 2em 0 0 0; | |
font-weight: bold; | |
line-height: 1.0; | |
font-style: italic; | |
} | |
.rendered_html h6 { | |
font-size: 100%; | |
margin: 2em 0 0 0; | |
font-weight: bold; | |
line-height: 1.0; | |
font-style: italic; | |
} | |
.rendered_html h1:first-child { | |
margin-top: 0.538em; | |
} | |
.rendered_html h2:first-child { | |
margin-top: 0.636em; | |
} | |
.rendered_html h3:first-child { | |
margin-top: 0.777em; | |
} | |
.rendered_html h4:first-child { | |
margin-top: 1em; | |
} | |
.rendered_html h5:first-child { | |
margin-top: 1em; | |
} | |
.rendered_html h6:first-child { | |
margin-top: 1em; | |
} | |
.rendered_html ul:not(.list-inline), | |
.rendered_html ol:not(.list-inline) { | |
padding-left: 2em; | |
} | |
.rendered_html ul { | |
list-style: disc; | |
} | |
.rendered_html ul ul { | |
list-style: square; | |
margin-top: 0; | |
} | |
.rendered_html ul ul ul { | |
list-style: circle; | |
} | |
.rendered_html ol { | |
list-style: decimal; | |
} | |
.rendered_html ol ol { | |
list-style: upper-alpha; | |
margin-top: 0; | |
} | |
.rendered_html ol ol ol { | |
list-style: lower-alpha; | |
} | |
.rendered_html ol ol ol ol { | |
list-style: lower-roman; | |
} | |
.rendered_html ol ol ol ol ol { | |
list-style: decimal; | |
} | |
.rendered_html * + ul { | |
margin-top: 1em; | |
} | |
.rendered_html * + ol { | |
margin-top: 1em; | |
} | |
.rendered_html hr { | |
color: black; | |
background-color: black; | |
} | |
.rendered_html pre { | |
margin: 1em 2em; | |
padding: 0px; | |
background-color: #fff; | |
} | |
.rendered_html code { | |
background-color: #eff0f1; | |
} | |
.rendered_html p code { | |
padding: 1px 5px; | |
} | |
.rendered_html pre code { | |
background-color: #fff; | |
} | |
.rendered_html pre, | |
.rendered_html code { | |
border: 0; | |
color: #000; | |
font-size: 100%; | |
} | |
.rendered_html blockquote { | |
margin: 1em 2em; | |
} | |
.rendered_html table { | |
margin-left: auto; | |
margin-right: auto; | |
border: none; | |
border-collapse: collapse; | |
border-spacing: 0; | |
color: black; | |
font-size: 12px; | |
table-layout: fixed; | |
} | |
.rendered_html thead { | |
border-bottom: 1px solid black; | |
vertical-align: bottom; | |
} | |
.rendered_html tr, | |
.rendered_html th, | |
.rendered_html td { | |
text-align: right; | |
vertical-align: middle; | |
padding: 0.5em 0.5em; | |
line-height: normal; | |
white-space: normal; | |
max-width: none; | |
border: none; | |
} | |
.rendered_html th { | |
font-weight: bold; | |
} | |
.rendered_html tbody tr:nth-child(odd) { | |
background: #f5f5f5; | |
} | |
.rendered_html tbody tr:hover { | |
background: rgba(66, 165, 245, 0.2); | |
} | |
.rendered_html * + table { | |
margin-top: 1em; | |
} | |
.rendered_html p { | |
text-align: left; | |
} | |
.rendered_html * + p { | |
margin-top: 1em; | |
} | |
.rendered_html img { | |
display: block; | |
margin-left: auto; | |
margin-right: auto; | |
} | |
.rendered_html * + img { | |
margin-top: 1em; | |
} | |
.rendered_html img, | |
.rendered_html svg { | |
max-width: 100%; | |
height: auto; | |
} | |
.rendered_html img.unconfined, | |
.rendered_html svg.unconfined { | |
max-width: none; | |
} | |
.rendered_html .alert { | |
margin-bottom: initial; | |
} | |
.rendered_html * + .alert { | |
margin-top: 1em; | |
} | |
[dir="rtl"] .rendered_html p { | |
text-align: right; | |
} | |
div.text_cell { | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: horizontal; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: horizontal; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: horizontal; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: row; | |
align-items: stretch; | |
} | |
@media (max-width: 540px) { | |
div.text_cell > div.prompt { | |
display: none; | |
} | |
} | |
div.text_cell_render { | |
/*font-family: "Helvetica Neue", Arial, Helvetica, Geneva, sans-serif;*/ | |
outline: none; | |
resize: none; | |
width: inherit; | |
border-style: none; | |
padding: 0.5em 0.5em 0.5em 0.4em; | |
color: #000; | |
box-sizing: border-box; | |
-moz-box-sizing: border-box; | |
-webkit-box-sizing: border-box; | |
} | |
a.anchor-link:link { | |
text-decoration: none; | |
padding: 0px 20px; | |
visibility: hidden; | |
} | |
h1:hover .anchor-link, | |
h2:hover .anchor-link, | |
h3:hover .anchor-link, | |
h4:hover .anchor-link, | |
h5:hover .anchor-link, | |
h6:hover .anchor-link { | |
visibility: visible; | |
} | |
.text_cell.rendered .input_area { | |
display: none; | |
} | |
.text_cell.rendered .rendered_html { | |
overflow-x: auto; | |
overflow-y: hidden; | |
} | |
.text_cell.rendered .rendered_html tr, | |
.text_cell.rendered .rendered_html th, | |
.text_cell.rendered .rendered_html td { | |
max-width: none; | |
} | |
.text_cell.unrendered .text_cell_render { | |
display: none; | |
} | |
.text_cell .dropzone .input_area { | |
border: 2px dashed #bababa; | |
margin: -1px; | |
} | |
.cm-header-1, | |
.cm-header-2, | |
.cm-header-3, | |
.cm-header-4, | |
.cm-header-5, | |
.cm-header-6 { | |
font-weight: bold; | |
font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; | |
} | |
.cm-header-1 { | |
font-size: 185.7%; | |
} | |
.cm-header-2 { | |
font-size: 157.1%; | |
} | |
.cm-header-3 { | |
font-size: 128.6%; | |
} | |
.cm-header-4 { | |
font-size: 110%; | |
} | |
.cm-header-5 { | |
font-size: 100%; | |
font-style: italic; | |
} | |
.cm-header-6 { | |
font-size: 100%; | |
font-style: italic; | |
} | |
/*! | |
* | |
* IPython notebook webapp | |
* | |
*/ | |
@media (max-width: 767px) { | |
.notebook_app { | |
padding-left: 0px; | |
padding-right: 0px; | |
} | |
} | |
#ipython-main-app { | |
box-sizing: border-box; | |
-moz-box-sizing: border-box; | |
-webkit-box-sizing: border-box; | |
height: 100%; | |
} | |
div#notebook_panel { | |
margin: 0px; | |
padding: 0px; | |
box-sizing: border-box; | |
-moz-box-sizing: border-box; | |
-webkit-box-sizing: border-box; | |
height: 100%; | |
} | |
div#notebook { | |
font-size: 14px; | |
line-height: 20px; | |
overflow-y: hidden; | |
overflow-x: auto; | |
width: 100%; | |
/* This spaces the page away from the edge of the notebook area */ | |
padding-top: 20px; | |
margin: 0px; | |
outline: none; | |
box-sizing: border-box; | |
-moz-box-sizing: border-box; | |
-webkit-box-sizing: border-box; | |
min-height: 100%; | |
} | |
@media not print { | |
#notebook-container { | |
padding: 15px; | |
background-color: #fff; | |
min-height: 0; | |
-webkit-box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2); | |
box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2); | |
} | |
} | |
@media print { | |
#notebook-container { | |
width: 100%; | |
} | |
} | |
div.ui-widget-content { | |
border: 1px solid #ababab; | |
outline: none; | |
} | |
pre.dialog { | |
background-color: #f7f7f7; | |
border: 1px solid #ddd; | |
border-radius: 2px; | |
padding: 0.4em; | |
padding-left: 2em; | |
} | |
p.dialog { | |
padding: 0.2em; | |
} | |
/* Word-wrap output correctly. This is the CSS3 spelling, though Firefox seems | |
to not honor it correctly. Webkit browsers (Chrome, rekonq, Safari) do. | |
*/ | |
pre, | |
code, | |
kbd, | |
samp { | |
white-space: pre-wrap; | |
} | |
#fonttest { | |
font-family: monospace; | |
} | |
p { | |
margin-bottom: 0; | |
} | |
.end_space { | |
min-height: 100px; | |
transition: height .2s ease; | |
} | |
.notebook_app > #header { | |
-webkit-box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2); | |
box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2); | |
} | |
@media not print { | |
.notebook_app { | |
background-color: #EEE; | |
} | |
} | |
kbd { | |
border-style: solid; | |
border-width: 1px; | |
box-shadow: none; | |
margin: 2px; | |
padding-left: 2px; | |
padding-right: 2px; | |
padding-top: 1px; | |
padding-bottom: 1px; | |
} | |
.jupyter-keybindings { | |
padding: 1px; | |
line-height: 24px; | |
border-bottom: 1px solid gray; | |
} | |
.jupyter-keybindings input { | |
margin: 0; | |
padding: 0; | |
border: none; | |
} | |
.jupyter-keybindings i { | |
padding: 6px; | |
} | |
.well code { | |
background-color: #ffffff; | |
border-color: #ababab; | |
border-width: 1px; | |
border-style: solid; | |
padding: 2px; | |
padding-top: 1px; | |
padding-bottom: 1px; | |
} | |
/* CSS for the cell toolbar */ | |
.celltoolbar { | |
border: thin solid #CFCFCF; | |
border-bottom: none; | |
background: #EEE; | |
border-radius: 2px 2px 0px 0px; | |
width: 100%; | |
height: 29px; | |
padding-right: 4px; | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: horizontal; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: horizontal; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: horizontal; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: row; | |
align-items: stretch; | |
/* Old browsers */ | |
-webkit-box-pack: end; | |
-moz-box-pack: end; | |
box-pack: end; | |
/* Modern browsers */ | |
justify-content: flex-end; | |
display: -webkit-flex; | |
} | |
@media print { | |
.celltoolbar { | |
display: none; | |
} | |
} | |
.ctb_hideshow { | |
display: none; | |
vertical-align: bottom; | |
} | |
/* ctb_show is added to the ctb_hideshow div to show the cell toolbar. | |
Cell toolbars are only shown when the ctb_global_show class is also set. | |
*/ | |
.ctb_global_show .ctb_show.ctb_hideshow { | |
display: block; | |
} | |
.ctb_global_show .ctb_show + .input_area, | |
.ctb_global_show .ctb_show + div.text_cell_input, | |
.ctb_global_show .ctb_show ~ div.text_cell_render { | |
border-top-right-radius: 0px; | |
border-top-left-radius: 0px; | |
} | |
.ctb_global_show .ctb_show ~ div.text_cell_render { | |
border: 1px solid #cfcfcf; | |
} | |
.celltoolbar { | |
font-size: 87%; | |
padding-top: 3px; | |
} | |
.celltoolbar select { | |
display: block; | |
width: 100%; | |
height: 32px; | |
padding: 6px 12px; | |
font-size: 13px; | |
line-height: 1.42857143; | |
color: #555555; | |
background-color: #fff; | |
background-image: none; | |
border: 1px solid #ccc; | |
border-radius: 2px; | |
-webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); | |
box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); | |
-webkit-transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s; | |
-o-transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s; | |
transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s; | |
height: 30px; | |
padding: 5px 10px; | |
font-size: 12px; | |
line-height: 1.5; | |
border-radius: 1px; | |
width: inherit; | |
font-size: inherit; | |
height: 22px; | |
padding: 0px; | |
display: inline-block; | |
} | |
.celltoolbar select:focus { | |
border-color: #66afe9; | |
outline: 0; | |
-webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 8px rgba(102, 175, 233, 0.6); | |
box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 8px rgba(102, 175, 233, 0.6); | |
} | |
.celltoolbar select::-moz-placeholder { | |
color: #999; | |
opacity: 1; | |
} | |
.celltoolbar select:-ms-input-placeholder { | |
color: #999; | |
} | |
.celltoolbar select::-webkit-input-placeholder { | |
color: #999; | |
} | |
.celltoolbar select::-ms-expand { | |
border: 0; | |
background-color: transparent; | |
} | |
.celltoolbar select[disabled], | |
.celltoolbar select[readonly], | |
fieldset[disabled] .celltoolbar select { | |
background-color: #eeeeee; | |
opacity: 1; | |
} | |
.celltoolbar select[disabled], | |
fieldset[disabled] .celltoolbar select { | |
cursor: not-allowed; | |
} | |
textarea.celltoolbar select { | |
height: auto; | |
} | |
select.celltoolbar select { | |
height: 30px; | |
line-height: 30px; | |
} | |
textarea.celltoolbar select, | |
select[multiple].celltoolbar select { | |
height: auto; | |
} | |
.celltoolbar label { | |
margin-left: 5px; | |
margin-right: 5px; | |
} | |
.tags_button_container { | |
width: 100%; | |
display: flex; | |
} | |
.tag-container { | |
display: flex; | |
flex-direction: row; | |
flex-grow: 1; | |
overflow: hidden; | |
position: relative; | |
} | |
.tag-container > * { | |
margin: 0 4px; | |
} | |
.remove-tag-btn { | |
margin-left: 4px; | |
} | |
.tags-input { | |
display: flex; | |
} | |
.cell-tag:last-child:after { | |
content: ""; | |
position: absolute; | |
right: 0; | |
width: 40px; | |
height: 100%; | |
/* Fade to background color of cell toolbar */ | |
background: linear-gradient(to right, rgba(0, 0, 0, 0), #EEE); | |
} | |
.tags-input > * { | |
margin-left: 4px; | |
} | |
.cell-tag, | |
.tags-input input, | |
.tags-input button { | |
display: block; | |
width: 100%; | |
height: 32px; | |
padding: 6px 12px; | |
font-size: 13px; | |
line-height: 1.42857143; | |
color: #555555; | |
background-color: #fff; | |
background-image: none; | |
border: 1px solid #ccc; | |
border-radius: 2px; | |
-webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); | |
box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); | |
-webkit-transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s; | |
-o-transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s; | |
transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s; | |
height: 30px; | |
padding: 5px 10px; | |
font-size: 12px; | |
line-height: 1.5; | |
border-radius: 1px; | |
box-shadow: none; | |
width: inherit; | |
font-size: inherit; | |
height: 22px; | |
line-height: 22px; | |
padding: 0px 4px; | |
display: inline-block; | |
} | |
.cell-tag:focus, | |
.tags-input input:focus, | |
.tags-input button:focus { | |
border-color: #66afe9; | |
outline: 0; | |
-webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 8px rgba(102, 175, 233, 0.6); | |
box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 8px rgba(102, 175, 233, 0.6); | |
} | |
.cell-tag::-moz-placeholder, | |
.tags-input input::-moz-placeholder, | |
.tags-input button::-moz-placeholder { | |
color: #999; | |
opacity: 1; | |
} | |
.cell-tag:-ms-input-placeholder, | |
.tags-input input:-ms-input-placeholder, | |
.tags-input button:-ms-input-placeholder { | |
color: #999; | |
} | |
.cell-tag::-webkit-input-placeholder, | |
.tags-input input::-webkit-input-placeholder, | |
.tags-input button::-webkit-input-placeholder { | |
color: #999; | |
} | |
.cell-tag::-ms-expand, | |
.tags-input input::-ms-expand, | |
.tags-input button::-ms-expand { | |
border: 0; | |
background-color: transparent; | |
} | |
.cell-tag[disabled], | |
.tags-input input[disabled], | |
.tags-input button[disabled], | |
.cell-tag[readonly], | |
.tags-input input[readonly], | |
.tags-input button[readonly], | |
fieldset[disabled] .cell-tag, | |
fieldset[disabled] .tags-input input, | |
fieldset[disabled] .tags-input button { | |
background-color: #eeeeee; | |
opacity: 1; | |
} | |
.cell-tag[disabled], | |
.tags-input input[disabled], | |
.tags-input button[disabled], | |
fieldset[disabled] .cell-tag, | |
fieldset[disabled] .tags-input input, | |
fieldset[disabled] .tags-input button { | |
cursor: not-allowed; | |
} | |
textarea.cell-tag, | |
textarea.tags-input input, | |
textarea.tags-input button { | |
height: auto; | |
} | |
select.cell-tag, | |
select.tags-input input, | |
select.tags-input button { | |
height: 30px; | |
line-height: 30px; | |
} | |
textarea.cell-tag, | |
textarea.tags-input input, | |
textarea.tags-input button, | |
select[multiple].cell-tag, | |
select[multiple].tags-input input, | |
select[multiple].tags-input button { | |
height: auto; | |
} | |
.cell-tag, | |
.tags-input button { | |
padding: 0px 4px; | |
} | |
.cell-tag { | |
background-color: #fff; | |
white-space: nowrap; | |
} | |
.tags-input input[type=text]:focus { | |
outline: none; | |
box-shadow: none; | |
border-color: #ccc; | |
} | |
.completions { | |
position: absolute; | |
z-index: 110; | |
overflow: hidden; | |
border: 1px solid #ababab; | |
border-radius: 2px; | |
-webkit-box-shadow: 0px 6px 10px -1px #adadad; | |
box-shadow: 0px 6px 10px -1px #adadad; | |
line-height: 1; | |
} | |
.completions select { | |
background: white; | |
outline: none; | |
border: none; | |
padding: 0px; | |
margin: 0px; | |
overflow: auto; | |
font-family: monospace; | |
font-size: 110%; | |
color: #000; | |
width: auto; | |
} | |
.completions select option.context { | |
color: #286090; | |
} | |
#kernel_logo_widget .current_kernel_logo { | |
display: none; | |
margin-top: -1px; | |
margin-bottom: -1px; | |
width: 32px; | |
height: 32px; | |
} | |
[dir="rtl"] #kernel_logo_widget { | |
float: left !important; | |
float: left; | |
} | |
.modal .modal-body .move-path { | |
display: flex; | |
flex-direction: row; | |
justify-content: space; | |
align-items: center; | |
} | |
.modal .modal-body .move-path .server-root { | |
padding-right: 20px; | |
} | |
.modal .modal-body .move-path .path-input { | |
flex: 1; | |
} | |
#menubar { | |
box-sizing: border-box; | |
-moz-box-sizing: border-box; | |
-webkit-box-sizing: border-box; | |
margin-top: 1px; | |
} | |
#menubar .navbar { | |
border-top: 1px; | |
border-radius: 0px 0px 2px 2px; | |
margin-bottom: 0px; | |
} | |
#menubar .navbar-toggle { | |
float: left; | |
padding-top: 7px; | |
padding-bottom: 7px; | |
border: none; | |
} | |
#menubar .navbar-collapse { | |
clear: left; | |
} | |
[dir="rtl"] #menubar .navbar-toggle { | |
float: right; | |
} | |
[dir="rtl"] #menubar .navbar-collapse { | |
clear: right; | |
} | |
[dir="rtl"] #menubar .navbar-nav { | |
float: right; | |
} | |
[dir="rtl"] #menubar .nav { | |
padding-right: 0px; | |
} | |
[dir="rtl"] #menubar .navbar-nav > li { | |
float: right; | |
} | |
[dir="rtl"] #menubar .navbar-right { | |
float: left !important; | |
} | |
[dir="rtl"] ul.dropdown-menu { | |
text-align: right; | |
left: auto; | |
} | |
[dir="rtl"] ul#new-menu.dropdown-menu { | |
right: auto; | |
left: 0; | |
} | |
.nav-wrapper { | |
border-bottom: 1px solid #e7e7e7; | |
} | |
i.menu-icon { | |
padding-top: 4px; | |
} | |
[dir="rtl"] i.menu-icon.pull-right { | |
float: left !important; | |
float: left; | |
} | |
ul#help_menu li a { | |
overflow: hidden; | |
padding-right: 2.2em; | |
} | |
ul#help_menu li a i { | |
margin-right: -1.2em; | |
} | |
[dir="rtl"] ul#help_menu li a { | |
padding-left: 2.2em; | |
} | |
[dir="rtl"] ul#help_menu li a i { | |
margin-right: 0; | |
margin-left: -1.2em; | |
} | |
[dir="rtl"] ul#help_menu li a i.pull-right { | |
float: left !important; | |
float: left; | |
} | |
.dropdown-submenu { | |
position: relative; | |
} | |
.dropdown-submenu > .dropdown-menu { | |
top: 0; | |
left: 100%; | |
margin-top: -6px; | |
margin-left: -1px; | |
} | |
[dir="rtl"] .dropdown-submenu > .dropdown-menu { | |
right: 100%; | |
margin-right: -1px; | |
} | |
.dropdown-submenu:hover > .dropdown-menu { | |
display: block; | |
} | |
.dropdown-submenu > a:after { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
display: block; | |
content: "\f0da"; | |
float: right; | |
color: #333333; | |
margin-top: 2px; | |
margin-right: -10px; | |
} | |
.dropdown-submenu > a:after.fa-pull-left { | |
margin-right: .3em; | |
} | |
.dropdown-submenu > a:after.fa-pull-right { | |
margin-left: .3em; | |
} | |
.dropdown-submenu > a:after.pull-left { | |
margin-right: .3em; | |
} | |
.dropdown-submenu > a:after.pull-right { | |
margin-left: .3em; | |
} | |
[dir="rtl"] .dropdown-submenu > a:after { | |
float: left; | |
content: "\f0d9"; | |
margin-right: 0; | |
margin-left: -10px; | |
} | |
.dropdown-submenu:hover > a:after { | |
color: #262626; | |
} | |
.dropdown-submenu.pull-left { | |
float: none; | |
} | |
.dropdown-submenu.pull-left > .dropdown-menu { | |
left: -100%; | |
margin-left: 10px; | |
} | |
#notification_area { | |
float: right !important; | |
float: right; | |
z-index: 10; | |
} | |
[dir="rtl"] #notification_area { | |
float: left !important; | |
float: left; | |
} | |
.indicator_area { | |
float: right !important; | |
float: right; | |
color: #777; | |
margin-left: 5px; | |
margin-right: 5px; | |
width: 11px; | |
z-index: 10; | |
text-align: center; | |
width: auto; | |
} | |
[dir="rtl"] .indicator_area { | |
float: left !important; | |
float: left; | |
} | |
#kernel_indicator { | |
float: right !important; | |
float: right; | |
color: #777; | |
margin-left: 5px; | |
margin-right: 5px; | |
width: 11px; | |
z-index: 10; | |
text-align: center; | |
width: auto; | |
border-left: 1px solid; | |
} | |
#kernel_indicator .kernel_indicator_name { | |
padding-left: 5px; | |
padding-right: 5px; | |
} | |
[dir="rtl"] #kernel_indicator { | |
float: left !important; | |
float: left; | |
border-left: 0; | |
border-right: 1px solid; | |
} | |
#modal_indicator { | |
float: right !important; | |
float: right; | |
color: #777; | |
margin-left: 5px; | |
margin-right: 5px; | |
width: 11px; | |
z-index: 10; | |
text-align: center; | |
width: auto; | |
} | |
[dir="rtl"] #modal_indicator { | |
float: left !important; | |
float: left; | |
} | |
#readonly-indicator { | |
float: right !important; | |
float: right; | |
color: #777; | |
margin-left: 5px; | |
margin-right: 5px; | |
width: 11px; | |
z-index: 10; | |
text-align: center; | |
width: auto; | |
margin-top: 2px; | |
margin-bottom: 0px; | |
margin-left: 0px; | |
margin-right: 0px; | |
display: none; | |
} | |
.modal_indicator:before { | |
width: 1.28571429em; | |
text-align: center; | |
} | |
.edit_mode .modal_indicator:before { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
content: "\f040"; | |
} | |
.edit_mode .modal_indicator:before.fa-pull-left { | |
margin-right: .3em; | |
} | |
.edit_mode .modal_indicator:before.fa-pull-right { | |
margin-left: .3em; | |
} | |
.edit_mode .modal_indicator:before.pull-left { | |
margin-right: .3em; | |
} | |
.edit_mode .modal_indicator:before.pull-right { | |
margin-left: .3em; | |
} | |
.command_mode .modal_indicator:before { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
content: ' '; | |
} | |
.command_mode .modal_indicator:before.fa-pull-left { | |
margin-right: .3em; | |
} | |
.command_mode .modal_indicator:before.fa-pull-right { | |
margin-left: .3em; | |
} | |
.command_mode .modal_indicator:before.pull-left { | |
margin-right: .3em; | |
} | |
.command_mode .modal_indicator:before.pull-right { | |
margin-left: .3em; | |
} | |
.kernel_idle_icon:before { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
content: "\f10c"; | |
} | |
.kernel_idle_icon:before.fa-pull-left { | |
margin-right: .3em; | |
} | |
.kernel_idle_icon:before.fa-pull-right { | |
margin-left: .3em; | |
} | |
.kernel_idle_icon:before.pull-left { | |
margin-right: .3em; | |
} | |
.kernel_idle_icon:before.pull-right { | |
margin-left: .3em; | |
} | |
.kernel_busy_icon:before { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
content: "\f111"; | |
} | |
.kernel_busy_icon:before.fa-pull-left { | |
margin-right: .3em; | |
} | |
.kernel_busy_icon:before.fa-pull-right { | |
margin-left: .3em; | |
} | |
.kernel_busy_icon:before.pull-left { | |
margin-right: .3em; | |
} | |
.kernel_busy_icon:before.pull-right { | |
margin-left: .3em; | |
} | |
.kernel_dead_icon:before { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
content: "\f1e2"; | |
} | |
.kernel_dead_icon:before.fa-pull-left { | |
margin-right: .3em; | |
} | |
.kernel_dead_icon:before.fa-pull-right { | |
margin-left: .3em; | |
} | |
.kernel_dead_icon:before.pull-left { | |
margin-right: .3em; | |
} | |
.kernel_dead_icon:before.pull-right { | |
margin-left: .3em; | |
} | |
.kernel_disconnected_icon:before { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
content: "\f127"; | |
} | |
.kernel_disconnected_icon:before.fa-pull-left { | |
margin-right: .3em; | |
} | |
.kernel_disconnected_icon:before.fa-pull-right { | |
margin-left: .3em; | |
} | |
.kernel_disconnected_icon:before.pull-left { | |
margin-right: .3em; | |
} | |
.kernel_disconnected_icon:before.pull-right { | |
margin-left: .3em; | |
} | |
.notification_widget { | |
color: #777; | |
z-index: 10; | |
background: rgba(240, 240, 240, 0.5); | |
margin-right: 4px; | |
color: #333; | |
background-color: #fff; | |
border-color: #ccc; | |
} | |
.notification_widget:focus, | |
.notification_widget.focus { | |
color: #333; | |
background-color: #e6e6e6; | |
border-color: #8c8c8c; | |
} | |
.notification_widget:hover { | |
color: #333; | |
background-color: #e6e6e6; | |
border-color: #adadad; | |
} | |
.notification_widget:active, | |
.notification_widget.active, | |
.open > .dropdown-toggle.notification_widget { | |
color: #333; | |
background-color: #e6e6e6; | |
border-color: #adadad; | |
} | |
.notification_widget:active:hover, | |
.notification_widget.active:hover, | |
.open > .dropdown-toggle.notification_widget:hover, | |
.notification_widget:active:focus, | |
.notification_widget.active:focus, | |
.open > .dropdown-toggle.notification_widget:focus, | |
.notification_widget:active.focus, | |
.notification_widget.active.focus, | |
.open > .dropdown-toggle.notification_widget.focus { | |
color: #333; | |
background-color: #d4d4d4; | |
border-color: #8c8c8c; | |
} | |
.notification_widget:active, | |
.notification_widget.active, | |
.open > .dropdown-toggle.notification_widget { | |
background-image: none; | |
} | |
.notification_widget.disabled:hover, | |
.notification_widget[disabled]:hover, | |
fieldset[disabled] .notification_widget:hover, | |
.notification_widget.disabled:focus, | |
.notification_widget[disabled]:focus, | |
fieldset[disabled] .notification_widget:focus, | |
.notification_widget.disabled.focus, | |
.notification_widget[disabled].focus, | |
fieldset[disabled] .notification_widget.focus { | |
background-color: #fff; | |
border-color: #ccc; | |
} | |
.notification_widget .badge { | |
color: #fff; | |
background-color: #333; | |
} | |
.notification_widget.warning { | |
color: #fff; | |
background-color: #f0ad4e; | |
border-color: #eea236; | |
} | |
.notification_widget.warning:focus, | |
.notification_widget.warning.focus { | |
color: #fff; | |
background-color: #ec971f; | |
border-color: #985f0d; | |
} | |
.notification_widget.warning:hover { | |
color: #fff; | |
background-color: #ec971f; | |
border-color: #d58512; | |
} | |
.notification_widget.warning:active, | |
.notification_widget.warning.active, | |
.open > .dropdown-toggle.notification_widget.warning { | |
color: #fff; | |
background-color: #ec971f; | |
border-color: #d58512; | |
} | |
.notification_widget.warning:active:hover, | |
.notification_widget.warning.active:hover, | |
.open > .dropdown-toggle.notification_widget.warning:hover, | |
.notification_widget.warning:active:focus, | |
.notification_widget.warning.active:focus, | |
.open > .dropdown-toggle.notification_widget.warning:focus, | |
.notification_widget.warning:active.focus, | |
.notification_widget.warning.active.focus, | |
.open > .dropdown-toggle.notification_widget.warning.focus { | |
color: #fff; | |
background-color: #d58512; | |
border-color: #985f0d; | |
} | |
.notification_widget.warning:active, | |
.notification_widget.warning.active, | |
.open > .dropdown-toggle.notification_widget.warning { | |
background-image: none; | |
} | |
.notification_widget.warning.disabled:hover, | |
.notification_widget.warning[disabled]:hover, | |
fieldset[disabled] .notification_widget.warning:hover, | |
.notification_widget.warning.disabled:focus, | |
.notification_widget.warning[disabled]:focus, | |
fieldset[disabled] .notification_widget.warning:focus, | |
.notification_widget.warning.disabled.focus, | |
.notification_widget.warning[disabled].focus, | |
fieldset[disabled] .notification_widget.warning.focus { | |
background-color: #f0ad4e; | |
border-color: #eea236; | |
} | |
.notification_widget.warning .badge { | |
color: #f0ad4e; | |
background-color: #fff; | |
} | |
.notification_widget.success { | |
color: #fff; | |
background-color: #5cb85c; | |
border-color: #4cae4c; | |
} | |
.notification_widget.success:focus, | |
.notification_widget.success.focus { | |
color: #fff; | |
background-color: #449d44; | |
border-color: #255625; | |
} | |
.notification_widget.success:hover { | |
color: #fff; | |
background-color: #449d44; | |
border-color: #398439; | |
} | |
.notification_widget.success:active, | |
.notification_widget.success.active, | |
.open > .dropdown-toggle.notification_widget.success { | |
color: #fff; | |
background-color: #449d44; | |
border-color: #398439; | |
} | |
.notification_widget.success:active:hover, | |
.notification_widget.success.active:hover, | |
.open > .dropdown-toggle.notification_widget.success:hover, | |
.notification_widget.success:active:focus, | |
.notification_widget.success.active:focus, | |
.open > .dropdown-toggle.notification_widget.success:focus, | |
.notification_widget.success:active.focus, | |
.notification_widget.success.active.focus, | |
.open > .dropdown-toggle.notification_widget.success.focus { | |
color: #fff; | |
background-color: #398439; | |
border-color: #255625; | |
} | |
.notification_widget.success:active, | |
.notification_widget.success.active, | |
.open > .dropdown-toggle.notification_widget.success { | |
background-image: none; | |
} | |
.notification_widget.success.disabled:hover, | |
.notification_widget.success[disabled]:hover, | |
fieldset[disabled] .notification_widget.success:hover, | |
.notification_widget.success.disabled:focus, | |
.notification_widget.success[disabled]:focus, | |
fieldset[disabled] .notification_widget.success:focus, | |
.notification_widget.success.disabled.focus, | |
.notification_widget.success[disabled].focus, | |
fieldset[disabled] .notification_widget.success.focus { | |
background-color: #5cb85c; | |
border-color: #4cae4c; | |
} | |
.notification_widget.success .badge { | |
color: #5cb85c; | |
background-color: #fff; | |
} | |
.notification_widget.info { | |
color: #fff; | |
background-color: #5bc0de; | |
border-color: #46b8da; | |
} | |
.notification_widget.info:focus, | |
.notification_widget.info.focus { | |
color: #fff; | |
background-color: #31b0d5; | |
border-color: #1b6d85; | |
} | |
.notification_widget.info:hover { | |
color: #fff; | |
background-color: #31b0d5; | |
border-color: #269abc; | |
} | |
.notification_widget.info:active, | |
.notification_widget.info.active, | |
.open > .dropdown-toggle.notification_widget.info { | |
color: #fff; | |
background-color: #31b0d5; | |
border-color: #269abc; | |
} | |
.notification_widget.info:active:hover, | |
.notification_widget.info.active:hover, | |
.open > .dropdown-toggle.notification_widget.info:hover, | |
.notification_widget.info:active:focus, | |
.notification_widget.info.active:focus, | |
.open > .dropdown-toggle.notification_widget.info:focus, | |
.notification_widget.info:active.focus, | |
.notification_widget.info.active.focus, | |
.open > .dropdown-toggle.notification_widget.info.focus { | |
color: #fff; | |
background-color: #269abc; | |
border-color: #1b6d85; | |
} | |
.notification_widget.info:active, | |
.notification_widget.info.active, | |
.open > .dropdown-toggle.notification_widget.info { | |
background-image: none; | |
} | |
.notification_widget.info.disabled:hover, | |
.notification_widget.info[disabled]:hover, | |
fieldset[disabled] .notification_widget.info:hover, | |
.notification_widget.info.disabled:focus, | |
.notification_widget.info[disabled]:focus, | |
fieldset[disabled] .notification_widget.info:focus, | |
.notification_widget.info.disabled.focus, | |
.notification_widget.info[disabled].focus, | |
fieldset[disabled] .notification_widget.info.focus { | |
background-color: #5bc0de; | |
border-color: #46b8da; | |
} | |
.notification_widget.info .badge { | |
color: #5bc0de; | |
background-color: #fff; | |
} | |
.notification_widget.danger { | |
color: #fff; | |
background-color: #d9534f; | |
border-color: #d43f3a; | |
} | |
.notification_widget.danger:focus, | |
.notification_widget.danger.focus { | |
color: #fff; | |
background-color: #c9302c; | |
border-color: #761c19; | |
} | |
.notification_widget.danger:hover { | |
color: #fff; | |
background-color: #c9302c; | |
border-color: #ac2925; | |
} | |
.notification_widget.danger:active, | |
.notification_widget.danger.active, | |
.open > .dropdown-toggle.notification_widget.danger { | |
color: #fff; | |
background-color: #c9302c; | |
border-color: #ac2925; | |
} | |
.notification_widget.danger:active:hover, | |
.notification_widget.danger.active:hover, | |
.open > .dropdown-toggle.notification_widget.danger:hover, | |
.notification_widget.danger:active:focus, | |
.notification_widget.danger.active:focus, | |
.open > .dropdown-toggle.notification_widget.danger:focus, | |
.notification_widget.danger:active.focus, | |
.notification_widget.danger.active.focus, | |
.open > .dropdown-toggle.notification_widget.danger.focus { | |
color: #fff; | |
background-color: #ac2925; | |
border-color: #761c19; | |
} | |
.notification_widget.danger:active, | |
.notification_widget.danger.active, | |
.open > .dropdown-toggle.notification_widget.danger { | |
background-image: none; | |
} | |
.notification_widget.danger.disabled:hover, | |
.notification_widget.danger[disabled]:hover, | |
fieldset[disabled] .notification_widget.danger:hover, | |
.notification_widget.danger.disabled:focus, | |
.notification_widget.danger[disabled]:focus, | |
fieldset[disabled] .notification_widget.danger:focus, | |
.notification_widget.danger.disabled.focus, | |
.notification_widget.danger[disabled].focus, | |
fieldset[disabled] .notification_widget.danger.focus { | |
background-color: #d9534f; | |
border-color: #d43f3a; | |
} | |
.notification_widget.danger .badge { | |
color: #d9534f; | |
background-color: #fff; | |
} | |
div#pager { | |
background-color: #fff; | |
font-size: 14px; | |
line-height: 20px; | |
overflow: hidden; | |
display: none; | |
position: fixed; | |
bottom: 0px; | |
width: 100%; | |
max-height: 50%; | |
padding-top: 8px; | |
-webkit-box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2); | |
box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2); | |
/* Display over codemirror */ | |
z-index: 100; | |
/* Hack which prevents jquery ui resizable from changing top. */ | |
top: auto !important; | |
} | |
div#pager pre { | |
line-height: 1.21429em; | |
color: #000; | |
background-color: #f7f7f7; | |
padding: 0.4em; | |
} | |
div#pager #pager-button-area { | |
position: absolute; | |
top: 8px; | |
right: 20px; | |
} | |
div#pager #pager-contents { | |
position: relative; | |
overflow: auto; | |
width: 100%; | |
height: 100%; | |
} | |
div#pager #pager-contents #pager-container { | |
position: relative; | |
padding: 15px 0px; | |
box-sizing: border-box; | |
-moz-box-sizing: border-box; | |
-webkit-box-sizing: border-box; | |
} | |
div#pager .ui-resizable-handle { | |
top: 0px; | |
height: 8px; | |
background: #f7f7f7; | |
border-top: 1px solid #cfcfcf; | |
border-bottom: 1px solid #cfcfcf; | |
/* This injects handle bars (a short, wide = symbol) for | |
the resize handle. */ | |
} | |
div#pager .ui-resizable-handle::after { | |
content: ''; | |
top: 2px; | |
left: 50%; | |
height: 3px; | |
width: 30px; | |
margin-left: -15px; | |
position: absolute; | |
border-top: 1px solid #cfcfcf; | |
} | |
.quickhelp { | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: horizontal; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: horizontal; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: horizontal; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: row; | |
align-items: stretch; | |
line-height: 1.8em; | |
} | |
.shortcut_key { | |
display: inline-block; | |
width: 21ex; | |
text-align: right; | |
font-family: monospace; | |
} | |
.shortcut_descr { | |
display: inline-block; | |
/* Old browsers */ | |
-webkit-box-flex: 1; | |
-moz-box-flex: 1; | |
box-flex: 1; | |
/* Modern browsers */ | |
flex: 1; | |
} | |
span.save_widget { | |
height: 30px; | |
margin-top: 4px; | |
display: flex; | |
justify-content: flex-start; | |
align-items: baseline; | |
width: 50%; | |
flex: 1; | |
} | |
span.save_widget span.filename { | |
height: 100%; | |
line-height: 1em; | |
margin-left: 16px; | |
border: none; | |
font-size: 146.5%; | |
text-overflow: ellipsis; | |
overflow: hidden; | |
white-space: nowrap; | |
border-radius: 2px; | |
} | |
span.save_widget span.filename:hover { | |
background-color: #e6e6e6; | |
} | |
[dir="rtl"] span.save_widget.pull-left { | |
float: right !important; | |
float: right; | |
} | |
[dir="rtl"] span.save_widget span.filename { | |
margin-left: 0; | |
margin-right: 16px; | |
} | |
span.checkpoint_status, | |
span.autosave_status { | |
font-size: small; | |
white-space: nowrap; | |
padding: 0 5px; | |
} | |
@media (max-width: 767px) { | |
span.save_widget { | |
font-size: small; | |
padding: 0 0 0 5px; | |
} | |
span.checkpoint_status, | |
span.autosave_status { | |
display: none; | |
} | |
} | |
@media (min-width: 768px) and (max-width: 991px) { | |
span.checkpoint_status { | |
display: none; | |
} | |
span.autosave_status { | |
font-size: x-small; | |
} | |
} | |
.toolbar { | |
padding: 0px; | |
margin-left: -5px; | |
margin-top: 2px; | |
margin-bottom: 5px; | |
box-sizing: border-box; | |
-moz-box-sizing: border-box; | |
-webkit-box-sizing: border-box; | |
} | |
.toolbar select, | |
.toolbar label { | |
width: auto; | |
vertical-align: middle; | |
margin-right: 2px; | |
margin-bottom: 0px; | |
display: inline; | |
font-size: 92%; | |
margin-left: 0.3em; | |
margin-right: 0.3em; | |
padding: 0px; | |
padding-top: 3px; | |
} | |
.toolbar .btn { | |
padding: 2px 8px; | |
} | |
.toolbar .btn-group { | |
margin-top: 0px; | |
margin-left: 5px; | |
} | |
.toolbar-btn-label { | |
margin-left: 6px; | |
} | |
#maintoolbar { | |
margin-bottom: -3px; | |
margin-top: -8px; | |
border: 0px; | |
min-height: 27px; | |
margin-left: 0px; | |
padding-top: 11px; | |
padding-bottom: 3px; | |
} | |
#maintoolbar .navbar-text { | |
float: none; | |
vertical-align: middle; | |
text-align: right; | |
margin-left: 5px; | |
margin-right: 0px; | |
margin-top: 0px; | |
} | |
.select-xs { | |
height: 24px; | |
} | |
[dir="rtl"] .btn-group > .btn, | |
.btn-group-vertical > .btn { | |
float: right; | |
} | |
.pulse, | |
.dropdown-menu > li > a.pulse, | |
li.pulse > a.dropdown-toggle, | |
li.pulse.open > a.dropdown-toggle { | |
background-color: #F37626; | |
color: white; | |
} | |
/** | |
* Primary styles | |
* | |
* Author: Jupyter Development Team | |
*/ | |
/** WARNING IF YOU ARE EDITTING THIS FILE, if this is a .css file, It has a lot | |
* of chance of beeing generated from the ../less/[samename].less file, you can | |
* try to get back the less file by reverting somme commit in history | |
**/ | |
/* | |
* We'll try to get something pretty, so we | |
* have some strange css to have the scroll bar on | |
* the left with fix button on the top right of the tooltip | |
*/ | |
@-moz-keyframes fadeOut { | |
from { | |
opacity: 1; | |
} | |
to { | |
opacity: 0; | |
} | |
} | |
@-webkit-keyframes fadeOut { | |
from { | |
opacity: 1; | |
} | |
to { | |
opacity: 0; | |
} | |
} | |
@-moz-keyframes fadeIn { | |
from { | |
opacity: 0; | |
} | |
to { | |
opacity: 1; | |
} | |
} | |
@-webkit-keyframes fadeIn { | |
from { | |
opacity: 0; | |
} | |
to { | |
opacity: 1; | |
} | |
} | |
/*properties of tooltip after "expand"*/ | |
.bigtooltip { | |
overflow: auto; | |
height: 200px; | |
-webkit-transition-property: height; | |
-webkit-transition-duration: 500ms; | |
-moz-transition-property: height; | |
-moz-transition-duration: 500ms; | |
transition-property: height; | |
transition-duration: 500ms; | |
} | |
/*properties of tooltip before "expand"*/ | |
.smalltooltip { | |
-webkit-transition-property: height; | |
-webkit-transition-duration: 500ms; | |
-moz-transition-property: height; | |
-moz-transition-duration: 500ms; | |
transition-property: height; | |
transition-duration: 500ms; | |
text-overflow: ellipsis; | |
overflow: hidden; | |
height: 80px; | |
} | |
.tooltipbuttons { | |
position: absolute; | |
padding-right: 15px; | |
top: 0px; | |
right: 0px; | |
} | |
.tooltiptext { | |
/*avoid the button to overlap on some docstring*/ | |
padding-right: 30px; | |
} | |
.ipython_tooltip { | |
max-width: 700px; | |
/*fade-in animation when inserted*/ | |
-webkit-animation: fadeOut 400ms; | |
-moz-animation: fadeOut 400ms; | |
animation: fadeOut 400ms; | |
-webkit-animation: fadeIn 400ms; | |
-moz-animation: fadeIn 400ms; | |
animation: fadeIn 400ms; | |
vertical-align: middle; | |
background-color: #f7f7f7; | |
overflow: visible; | |
border: #ababab 1px solid; | |
outline: none; | |
padding: 3px; | |
margin: 0px; | |
padding-left: 7px; | |
font-family: monospace; | |
min-height: 50px; | |
-moz-box-shadow: 0px 6px 10px -1px #adadad; | |
-webkit-box-shadow: 0px 6px 10px -1px #adadad; | |
box-shadow: 0px 6px 10px -1px #adadad; | |
border-radius: 2px; | |
position: absolute; | |
z-index: 1000; | |
} | |
.ipython_tooltip a { | |
float: right; | |
} | |
.ipython_tooltip .tooltiptext pre { | |
border: 0; | |
border-radius: 0; | |
font-size: 100%; | |
background-color: #f7f7f7; | |
} | |
.pretooltiparrow { | |
left: 0px; | |
margin: 0px; | |
top: -16px; | |
width: 40px; | |
height: 16px; | |
overflow: hidden; | |
position: absolute; | |
} | |
.pretooltiparrow:before { | |
background-color: #f7f7f7; | |
border: 1px #ababab solid; | |
z-index: 11; | |
content: ""; | |
position: absolute; | |
left: 15px; | |
top: 10px; | |
width: 25px; | |
height: 25px; | |
-webkit-transform: rotate(45deg); | |
-moz-transform: rotate(45deg); | |
-ms-transform: rotate(45deg); | |
-o-transform: rotate(45deg); | |
} | |
ul.typeahead-list i { | |
margin-left: -10px; | |
width: 18px; | |
} | |
[dir="rtl"] ul.typeahead-list i { | |
margin-left: 0; | |
margin-right: -10px; | |
} | |
ul.typeahead-list { | |
max-height: 80vh; | |
overflow: auto; | |
} | |
ul.typeahead-list > li > a { | |
/** Firefox bug **/ | |
/* see https://github.com/jupyter/notebook/issues/559 */ | |
white-space: normal; | |
} | |
ul.typeahead-list > li > a.pull-right { | |
float: left !important; | |
float: left; | |
} | |
[dir="rtl"] .typeahead-list { | |
text-align: right; | |
} | |
.cmd-palette .modal-body { | |
padding: 7px; | |
} | |
.cmd-palette form { | |
background: white; | |
} | |
.cmd-palette input { | |
outline: none; | |
} | |
.no-shortcut { | |
min-width: 20px; | |
color: transparent; | |
} | |
[dir="rtl"] .no-shortcut.pull-right { | |
float: left !important; | |
float: left; | |
} | |
[dir="rtl"] .command-shortcut.pull-right { | |
float: left !important; | |
float: left; | |
} | |
.command-shortcut:before { | |
content: "(command mode)"; | |
padding-right: 3px; | |
color: #777777; | |
} | |
.edit-shortcut:before { | |
content: "(edit)"; | |
padding-right: 3px; | |
color: #777777; | |
} | |
[dir="rtl"] .edit-shortcut.pull-right { | |
float: left !important; | |
float: left; | |
} | |
#find-and-replace #replace-preview .match, | |
#find-and-replace #replace-preview .insert { | |
background-color: #BBDEFB; | |
border-color: #90CAF9; | |
border-style: solid; | |
border-width: 1px; | |
border-radius: 0px; | |
} | |
[dir="ltr"] #find-and-replace .input-group-btn + .form-control { | |
border-left: none; | |
} | |
[dir="rtl"] #find-and-replace .input-group-btn + .form-control { | |
border-right: none; | |
} | |
#find-and-replace #replace-preview .replace .match { | |
background-color: #FFCDD2; | |
border-color: #EF9A9A; | |
border-radius: 0px; | |
} | |
#find-and-replace #replace-preview .replace .insert { | |
background-color: #C8E6C9; | |
border-color: #A5D6A7; | |
border-radius: 0px; | |
} | |
#find-and-replace #replace-preview { | |
max-height: 60vh; | |
overflow: auto; | |
} | |
#find-and-replace #replace-preview pre { | |
padding: 5px 10px; | |
} | |
.terminal-app { | |
background: #EEE; | |
} | |
.terminal-app #header { | |
background: #fff; | |
-webkit-box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2); | |
box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2); | |
} | |
.terminal-app .terminal { | |
width: 100%; | |
float: left; | |
font-family: monospace; | |
color: white; | |
background: black; | |
padding: 0.4em; | |
border-radius: 2px; | |
-webkit-box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.4); | |
box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.4); | |
} | |
.terminal-app .terminal, | |
.terminal-app .terminal dummy-screen { | |
line-height: 1em; | |
font-size: 14px; | |
} | |
.terminal-app .terminal .xterm-rows { | |
padding: 10px; | |
} | |
.terminal-app .terminal-cursor { | |
color: black; | |
background: white; | |
} | |
.terminal-app #terminado-container { | |
margin-top: 20px; | |
} | |
/*# sourceMappingURL=style.min.css.map */ | |
</style> | |
<style type="text/css"> | |
.highlight .hll { background-color: #ffffcc } | |
.highlight { background: #f8f8f8; } | |
.highlight .c { color: #408080; font-style: italic } /* Comment */ | |
.highlight .err { border: 1px solid #FF0000 } /* Error */ | |
.highlight .k { color: #008000; font-weight: bold } /* Keyword */ | |
.highlight .o { color: #666666 } /* Operator */ | |
.highlight .ch { color: #408080; font-style: italic } /* Comment.Hashbang */ | |
.highlight .cm { color: #408080; font-style: italic } /* Comment.Multiline */ | |
.highlight .cp { color: #BC7A00 } /* Comment.Preproc */ | |
.highlight .cpf { color: #408080; font-style: italic } /* Comment.PreprocFile */ | |
.highlight .c1 { color: #408080; font-style: italic } /* Comment.Single */ | |
.highlight .cs { color: #408080; font-style: italic } /* Comment.Special */ | |
.highlight .gd { color: #A00000 } /* Generic.Deleted */ | |
.highlight .ge { font-style: italic } /* Generic.Emph */ | |
.highlight .gr { color: #FF0000 } /* Generic.Error */ | |
.highlight .gh { color: #000080; font-weight: bold } /* Generic.Heading */ | |
.highlight .gi { color: #00A000 } /* Generic.Inserted */ | |
.highlight .go { color: #888888 } /* Generic.Output */ | |
.highlight .gp { color: #000080; font-weight: bold } /* Generic.Prompt */ | |
.highlight .gs { font-weight: bold } /* Generic.Strong */ | |
.highlight .gu { color: #800080; font-weight: bold } /* Generic.Subheading */ | |
.highlight .gt { color: #0044DD } /* Generic.Traceback */ | |
.highlight .kc { color: #008000; font-weight: bold } /* Keyword.Constant */ | |
.highlight .kd { color: #008000; font-weight: bold } /* Keyword.Declaration */ | |
.highlight .kn { color: #008000; font-weight: bold } /* Keyword.Namespace */ | |
.highlight .kp { color: #008000 } /* Keyword.Pseudo */ | |
.highlight .kr { color: #008000; font-weight: bold } /* Keyword.Reserved */ | |
.highlight .kt { color: #B00040 } /* Keyword.Type */ | |
.highlight .m { color: #666666 } /* Literal.Number */ | |
.highlight .s { color: #BA2121 } /* Literal.String */ | |
.highlight .na { color: #7D9029 } /* Name.Attribute */ | |
.highlight .nb { color: #008000 } /* Name.Builtin */ | |
.highlight .nc { color: #0000FF; font-weight: bold } /* Name.Class */ | |
.highlight .no { color: #880000 } /* Name.Constant */ | |
.highlight .nd { color: #AA22FF } /* Name.Decorator */ | |
.highlight .ni { color: #999999; font-weight: bold } /* Name.Entity */ | |
.highlight .ne { color: #D2413A; font-weight: bold } /* Name.Exception */ | |
.highlight .nf { color: #0000FF } /* Name.Function */ | |
.highlight .nl { color: #A0A000 } /* Name.Label */ | |
.highlight .nn { color: #0000FF; font-weight: bold } /* Name.Namespace */ | |
.highlight .nt { color: #008000; font-weight: bold } /* Name.Tag */ | |
.highlight .nv { color: #19177C } /* Name.Variable */ | |
.highlight .ow { color: #AA22FF; font-weight: bold } /* Operator.Word */ | |
.highlight .w { color: #bbbbbb } /* Text.Whitespace */ | |
.highlight .mb { color: #666666 } /* Literal.Number.Bin */ | |
.highlight .mf { color: #666666 } /* Literal.Number.Float */ | |
.highlight .mh { color: #666666 } /* Literal.Number.Hex */ | |
.highlight .mi { color: #666666 } /* Literal.Number.Integer */ | |
.highlight .mo { color: #666666 } /* Literal.Number.Oct */ | |
.highlight .sa { color: #BA2121 } /* Literal.String.Affix */ | |
.highlight .sb { color: #BA2121 } /* Literal.String.Backtick */ | |
.highlight .sc { color: #BA2121 } /* Literal.String.Char */ | |
.highlight .dl { color: #BA2121 } /* Literal.String.Delimiter */ | |
.highlight .sd { color: #BA2121; font-style: italic } /* Literal.String.Doc */ | |
.highlight .s2 { color: #BA2121 } /* Literal.String.Double */ | |
.highlight .se { color: #BB6622; font-weight: bold } /* Literal.String.Escape */ | |
.highlight .sh { color: #BA2121 } /* Literal.String.Heredoc */ | |
.highlight .si { color: #BB6688; font-weight: bold } /* Literal.String.Interpol */ | |
.highlight .sx { color: #008000 } /* Literal.String.Other */ | |
.highlight .sr { color: #BB6688 } /* Literal.String.Regex */ | |
.highlight .s1 { color: #BA2121 } /* Literal.String.Single */ | |
.highlight .ss { color: #19177C } /* Literal.String.Symbol */ | |
.highlight .bp { color: #008000 } /* Name.Builtin.Pseudo */ | |
.highlight .fm { color: #0000FF } /* Name.Function.Magic */ | |
.highlight .vc { color: #19177C } /* Name.Variable.Class */ | |
.highlight .vg { color: #19177C } /* Name.Variable.Global */ | |
.highlight .vi { color: #19177C } /* Name.Variable.Instance */ | |
.highlight .vm { color: #19177C } /* Name.Variable.Magic */ | |
.highlight .il { color: #666666 } /* Literal.Number.Integer.Long */ | |
</style> | |
<style type="text/css"> | |
/* Temporary definitions which will become obsolete with Notebook release 5.0 */ | |
.ansi-black-fg { color: #3E424D; } | |
.ansi-black-bg { background-color: #3E424D; } | |
.ansi-black-intense-fg { color: #282C36; } | |
.ansi-black-intense-bg { background-color: #282C36; } | |
.ansi-red-fg { color: #E75C58; } | |
.ansi-red-bg { background-color: #E75C58; } | |
.ansi-red-intense-fg { color: #B22B31; } | |
.ansi-red-intense-bg { background-color: #B22B31; } | |
.ansi-green-fg { color: #00A250; } | |
.ansi-green-bg { background-color: #00A250; } | |
.ansi-green-intense-fg { color: #007427; } | |
.ansi-green-intense-bg { background-color: #007427; } | |
.ansi-yellow-fg { color: #DDB62B; } | |
.ansi-yellow-bg { background-color: #DDB62B; } | |
.ansi-yellow-intense-fg { color: #B27D12; } | |
.ansi-yellow-intense-bg { background-color: #B27D12; } | |
.ansi-blue-fg { color: #208FFB; } | |
.ansi-blue-bg { background-color: #208FFB; } | |
.ansi-blue-intense-fg { color: #0065CA; } | |
.ansi-blue-intense-bg { background-color: #0065CA; } | |
.ansi-magenta-fg { color: #D160C4; } | |
.ansi-magenta-bg { background-color: #D160C4; } | |
.ansi-magenta-intense-fg { color: #A03196; } | |
.ansi-magenta-intense-bg { background-color: #A03196; } | |
.ansi-cyan-fg { color: #60C6C8; } | |
.ansi-cyan-bg { background-color: #60C6C8; } | |
.ansi-cyan-intense-fg { color: #258F8F; } | |
.ansi-cyan-intense-bg { background-color: #258F8F; } | |
.ansi-white-fg { color: #C5C1B4; } | |
.ansi-white-bg { background-color: #C5C1B4; } | |
.ansi-white-intense-fg { color: #A1A6B2; } | |
.ansi-white-intense-bg { background-color: #A1A6B2; } | |
.ansi-bold { font-weight: bold; } | |
</style> | |
<style type="text/css"> | |
/* Overrides of notebook CSS for static HTML export */ | |
body { | |
overflow: visible; | |
padding: 8px; | |
} | |
div#notebook { | |
overflow: visible; | |
border-top: none; | |
}@media print { | |
div.cell { | |
display: block; | |
page-break-inside: avoid; | |
} | |
div.output_wrapper { | |
display: block; | |
page-break-inside: avoid; | |
} | |
div.output { | |
display: block; | |
page-break-inside: avoid; | |
} | |
} | |
</style> | |
<!-- Custom stylesheet, it must be in the same directory as the html file --> | |
<link rel="stylesheet" href="custom.css"> | |
<!-- Loading mathjax macro --> | |
<!-- Load mathjax --> | |
<script src="https://cdnjs.cloudflare.com/ajax/libs/mathjax/2.7.5/latest.js?config=TeX-AMS_HTML"></script> | |
<!-- MathJax configuration --> | |
<script type="text/x-mathjax-config"> | |
MathJax.Hub.Config({ | |
tex2jax: { | |
inlineMath: [ ['$','$'], ["\\(","\\)"] ], | |
displayMath: [ ['$$','$$'], ["\\[","\\]"] ], | |
processEscapes: true, | |
processEnvironments: true | |
}, | |
// Center justify equations in code and markdown cells. Elsewhere | |
// we use CSS to left justify single line equations in code cells. | |
displayAlign: 'center', | |
"HTML-CSS": { | |
styles: {'.MathJax_Display': {"margin": 0}}, | |
linebreaks: { automatic: true } | |
} | |
}); | |
</script> | |
<!-- End of mathjax configuration --></head> | |
<body> | |
<div tabindex="-1" id="notebook" class="border-box-sizing"> | |
<div class="container" id="notebook-container"> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [1]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="kn">from</span> <span class="nn">rdkit</span> <span class="k">import</span> <span class="n">Chem</span> | |
<span class="kn">from</span> <span class="nn">rdkit.Chem</span> <span class="k">import</span> <span class="n">AllChem</span> | |
<span class="kn">from</span> <span class="nn">rdkit.Chem.Draw</span> <span class="k">import</span> <span class="n">IPythonConsole</span> | |
<span class="kn">import</span> <span class="nn">py3Dmol</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [2]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="k">def</span> <span class="nf">drawit</span><span class="p">(</span><span class="n">mols</span><span class="p">,</span> <span class="n">p</span><span class="o">=</span><span class="kc">None</span><span class="p">,</span> <span class="n">width</span><span class="o">=</span><span class="mi">400</span><span class="p">,</span> <span class="n">height</span><span class="o">=</span><span class="mi">300</span><span class="p">):</span> | |
<span class="k">if</span> <span class="n">p</span> <span class="ow">is</span> <span class="kc">None</span><span class="p">:</span> | |
<span class="n">p</span> <span class="o">=</span> <span class="n">py3Dmol</span><span class="o">.</span><span class="n">view</span><span class="p">(</span><span class="n">width</span><span class="o">=</span><span class="n">width</span><span class="p">,</span> <span class="n">height</span><span class="o">=</span><span class="n">height</span><span class="p">)</span> | |
<span class="n">p</span><span class="o">.</span><span class="n">removeAllModels</span><span class="p">()</span> | |
<span class="k">if</span> <span class="p">(</span><span class="ow">not</span> <span class="nb">isinstance</span><span class="p">(</span><span class="n">mols</span><span class="p">,</span> <span class="nb">list</span><span class="p">)):</span> | |
<span class="n">mols</span> <span class="o">=</span> <span class="p">[</span><span class="n">mols</span><span class="p">]</span> | |
<span class="k">for</span> <span class="n">m</span><span class="p">,</span> <span class="n">conf_id</span> <span class="ow">in</span> <span class="n">mols</span><span class="p">:</span> | |
<span class="k">if</span> <span class="p">(</span><span class="n">conf_id</span> <span class="o">==</span> <span class="o">-</span><span class="mi">1</span><span class="p">):</span> | |
<span class="n">conf_ids</span> <span class="o">=</span> <span class="p">[</span><span class="n">c</span><span class="o">.</span><span class="n">GetId</span><span class="p">()</span> <span class="k">for</span> <span class="n">c</span> <span class="ow">in</span> <span class="n">m</span><span class="o">.</span><span class="n">GetConformers</span><span class="p">()]</span> | |
<span class="k">else</span><span class="p">:</span> | |
<span class="n">conf_ids</span> <span class="o">=</span> <span class="p">[</span><span class="n">conf_id</span><span class="p">]</span> | |
<span class="k">for</span> <span class="n">cid</span> <span class="ow">in</span> <span class="n">conf_ids</span><span class="p">:</span> | |
<span class="n">mb</span> <span class="o">=</span> <span class="n">Chem</span><span class="o">.</span><span class="n">MolToMolBlock</span><span class="p">(</span><span class="n">m</span><span class="p">,</span> <span class="n">confId</span><span class="o">=</span><span class="n">cid</span><span class="p">)</span> | |
<span class="n">p</span><span class="o">.</span><span class="n">addModel</span><span class="p">(</span><span class="n">mb</span><span class="p">,</span><span class="s1">'sdf'</span><span class="p">)</span> | |
<span class="n">p</span><span class="o">.</span><span class="n">setStyle</span><span class="p">({</span><span class="s1">'stick'</span><span class="p">:{}})</span> | |
<span class="n">p</span><span class="o">.</span><span class="n">setBackgroundColor</span><span class="p">(</span><span class="s1">'0xeeeeee'</span><span class="p">)</span> | |
<span class="n">p</span><span class="o">.</span><span class="n">zoomTo</span><span class="p">()</span> | |
<span class="k">return</span> <span class="n">p</span><span class="o">.</span><span class="n">show</span><span class="p">()</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [3]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">ref_smi</span> <span class="o">=</span> <span class="s2">"[NH2+]1CCC(CC1)CCc2ccccc2"</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [4]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">query_smi</span> <span class="o">=</span> <span class="s2">"[NH2+]1C[C@@H](CC1)CCc2cnccc2"</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [5]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">ref_mol</span> <span class="o">=</span> <span class="n">Chem</span><span class="o">.</span><span class="n">MolFromSmiles</span><span class="p">(</span><span class="n">ref_smi</span><span class="p">)</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [6]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">ref_mol</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
<div class="output_wrapper"> | |
<div class="output"> | |
<div class="output_area"> | |
<div class="prompt output_prompt">Out[6]:</div> | |
<div class="output_png output_subarea output_execute_result"> | |
<img src="data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAcIAAACWCAYAAABNcIgQAAAc90lEQVR4nO3de1hUdeIG8BdQvKDgvUZRygWTGQGXAZerkpnKoMgqXhJvteWuP3W1i9mubtvF1C0r2SdrrWxzt5TjqKAoeEtMhFEEUpOLgmim4A1URCEQzu+Pgg2dEUVmzpw57+d55nmsOcy8g+O853zn+z3HThRFEURERAplL3UAIiIiKbEIiYhI0ViERESkaCxCIiJSNBYhEREpGouQiIgUjUVIRESKxiIkIiJFYxESEZGisQiJiEjRWIRERKRoLEIiIlI0FiERESkai5CIiBSNRUhERIrGIiQiIkVjERIRkaKxCImISNFYhEREpGgsQiIiUjQWIRERKRqLkIiIFI1FSEREisYiJCIiRWMREhGRorEIiYhI0ViERESkaCxCIiJSNBYhEREpGouQiIgUjUVIRESKxiIkIiJFYxESEZGisQiJiEjRWIRERKRoLEIiIlI0FiER0S9u3boldQSSQCupA5DtqKysxLFjx3Dr1i1otVo4OztLHYnIpPLychw7dgxZWVkNt5MnTyIiIgJfffUVOnToIHVEshA7URRFqUOQ/FRUVODIkSPIzs5uuOXl5cHOzg4DBgyAg4MD9u3bBycnJ6mjEuHy5cuN3qvZ2dkoKiqCk5MTBg4cCF9fX/j6+uKJJ57ArFmz0LNnT2zduhWtWvFYQQlYhNSkGzdu4OjRo432nE+cOAF7e3t4eHhAq9U2utXU1GDw4MHo1asXtmzZwg8TsqirV68iJyen0fs1Ly8PHTp0gLe3d6P3av/+/eHg4NDo54uLixEQEIARI0bgs88+k+hVkCWxCKmR69ev4/vvv2/0IZKfnw8HB4e7Ss/Pzw9t27Y1+jjnz59HYGAgRo4ciU8//dTCr4KUori4uNF7NSsrCyUlJXBxccGAAQMavV89PT1hb39/0yJycnIQEhKC1157DQsXLjTzqyCpsQgV7Nq1azh+/Phde85OTk7w8fGBVquFRqOBWq3GoEGD4Ojo+ECPf/z4cYSEhGDx4sV45ZVXzPQqSCnuLL3Dhw/j4sWL6NSpEzQaTaPSU6vVsLOze6jnS0lJQXh4OD7//HNMmTKlhV4FWSMWoULUf4jk5uY2DBvl5ubC2dkZXl5ezd5zbsqOHTsQGRmJf//734iJiWmRxyTbd2fpHTp0CJcvX4ZKpWrYOat/v2o0GrPl+OKLLzBr1iwkJydj6NChZnsekhaL0Abd+SGSmZmJCxcuPPRwUXOtWbMGc+bMwe7duxESEmLW5yJ5qa2txQ8//NDoOz2DwYDS0lKoVKq7huJVKpXFM77++utYtWoV0tLS0L9/f4s/P5kfi1DmTp06hczMzEaz4crKyqBSqRpmwtXf+vTpI1nORYsWYfXq1UhLS8MTTzwhWQ6yDhUVFXjrrbewatUqVFZWom/fvvD19YVWq214v3bt2lXqmAAAURTx7LPPYv/+/TAYDHjkkUekjkQtjEUoY9u2bcP8+fMb1u39eqiob9++UsdrRBRFzJgxA6mpqfwwIaxduxYLFy7EunXroNVq4eLiYrHnrq6uRkFBQaNRE5VKBb1eb/JnampqEBERgbKyMnz77bdcFmRjWIQyFhoaiiFDhmDJkiVSR7kvNTU1CA8Px/Xr17nGUOHCw8Oh0WiwYsUKsz5PeXl5o/Wu9Ut/HBwcGr4m8PX1RUBAAAYOHNjkY4WGhqJ3795ISEjgsiAbwiKUqXPnzsHNzQ3ff/891Gq11HHuW3l5OUJCQuDm5oaEhIS71nCR7asfuj9w4AD8/f1b7HGNnSmmOUt/7uX8+fMICAiATqfD6tWrWyw7SYu7NDIlCAK8vLxkVYIA4OzsjKSkJAQGBmLOnDn45JNPpI5EFrZx40a4urrCz8+v2Y9haulP69at4e7uDq1Wi5kzZ0Kr1cLf3x9t2rRpkey9evVCUlISQkND0a9fP7z88sst8rgkLRahTAmCgIkTJ0odo1lcXV2xZcsWDBkyBE888QTmz58vdSSyIEEQMGnSpPte53c/Z4pZuHChyTPFtDQvLy+sX78eY8aMgUqlwuTJk836fGR+HBqVoaKiIri7u+PkyZNwd3eXOk6zJScnIyoqCuvXr8fYsWOljkMWcOHCBbi6uiI7Oxve3t533V9WVobU1FRkZWU1fK9XUlKCzp07N5pR6uvrC3d394deNP8w1qxZg7lz52L37t0IDg6WLAc9PB4RypAgCPDz85N1CQI/T5j46KOPMGXKFOzZswdBQUFSRyIz0+v18PDwMFqCAHDgwAHMmDGj4UwxEyZMaLEzxbS0P/zhDzh16hTGjBnDZUEyxyKUIUEQMHXqVKljtIgXXngBhYWFiIyMRHp6Ovr16yd1JDKj+mFRU0aNGoWrV69aMNHDeeedd3Du3DnodDoYDAb06NFD6kjUDBwalZkTJ07A09MTp0+fhpubm9RxWoQoipg2bRoMBgPS09P5YWKjfvzxR7i5ueH48eOym+R1L9XV1dDpdCgvL0dKSgqXBckQr1AvM+vXr0dwcLDNlCAA2NnZYc2aNXBzc8Po0aN5lXAbJQgCfHx8bKoEAcDR0RGbNm1CVVUVJk2ahNraWqkj0QNiEcqMXq+X7WzRe3F0dIRer8f169cxffp01NXVSR2JWpicZzo3xcXFBVu3bkVmZiYWLFggdRx6QCxCGTl69Cjy8/NtdoZlly5dkJycjNTUVLz66qtSx6EWVFRUhKysLERHR0sdxWwee+wxbNu2DZ999hliY2OljkMPgJNlZEQQBISFhaFnz55SRzGbxx9/HNu2bUNYWBj69OmDP//5z1JHohYQFxcHf39/2c90bopWq4UgCPj973+P3r172+xOq63hEaGMHD9egWeesY3Zovfi5+cHQRCwYMECxMfHSx2HWoAtD4veSafTNSwLMhgMUseh+8BZozKRkQEEBwPFxUD37lKnsYzVq1fjxRdfxN69exEQECB1nLvcuHEDR48ebXTGE7VajUWLFjV5Amclyc/Ph1qtxpkzZyS9FJilLViwAF9++SXS09Ph4eEhdRy6BxahTLz8MpCXByQlSZ3Esl5++WX85z//gcFgkHRYraysrNE1H7Ozs1FYWIi2bdvCx8en4WwnBw4cwK5du2AwGBT1oX8vf//735GSkoL9+/dLHcWiRFHE1KlTcfDgQRgMBnRXyh6sDLEIZUAUgccfB958E5g+Xeo0llVXV4cJEybg6NGjSE9Pt8iHiakTOjs5OcHHxwcajQZqtdroCZ1ra2sRHR2NkydPIi0tDZ06dTJ7XmunVqsxe/ZszJ49W+ooFlddXY2RI0fi5s2bSElJQfv27aWOREawCGXgwAFg2DDg4kXAgtcvtRpVVVUYNmwY7O3tsWvXrmZdPseU4uJi5ObmNjqpc25uLpydneHl5dXo0j2enp6wt2/6a/XKykoMHToUbdu2xY4dO1rsygdydOTIEfj5+eH8+fOKvRhzaWkpgoOD4e3tjbi4uPt6D5FlsQhlYO5c4Nw5QMnzRkpLSxEUFISBAwdi/fr1zfowKS4ubnSUl5WVhZKSEri4uDRcpPVBS8+Uy5cvIygoCP7+/vj666+t7jyZlvKXv/wFmZmZ2L17t9RRJHX69GkEBgZi2rRpePfdd6WOQ3dgEVq5ujrA1RX44APgHqdoVISioiIEBgbiueeew7Jly+657Z2ll5GRgUuXLqFz584Nw5r1N3Od0DkvLw8hISGYO3cu3njjjRZ/fDlwd3fHa6+9hueff17qKJLLzMxEWFgYli1bhrlz50odh36FRWjlvvkGiIz8eVi0Qwep00jv8OHDCAsLw7vvvtvwndOdpXfw4EFcuXIFKpWqoezqv9fTaDQWzZuamorhw4fj448/xrPPPmvR55baoUOHEBoaipKSEnTt2lXqOFYhISEBEydORHx8PHQ6ndRx6BcsQis3cyZw/TogCFInsR6bNm3C5MmT4ePjg7y8PFRUVODxxx9vdK06X19fqzl5tyAImDZtGhITEzF8+HCp41jMSy+9hBMnTmD79u1SR7EqEydOhEajweuvvy51FPoFzyxjxWpqgM2bgU8/lTqJdYmKikLHjh2h0WiwdOlSaLVadO7cWepYJk2cOBFFRUWIjo5GamoqfHx8pI5kdnV1ddDr9XjnnXekjmJxixYtwowZM4yuHRRFERkZGRgxYoQEycgUHhFasaSkn78XvHgRaNdO6jTWY/fu3YiKisKlS5dkdcmbOXPmID4+HgcPHkTv3r2ljmNW+/fvx/Dhw3Hx4kW4KGiq86lTp+Dh4YGioiI89thjd91vMBgwZMgQXLhwAV26dLF8QDKK83itmCAAUVEswTsJgoDIyEhZlSAAxMbGws/PDzqdDteuXZM6jlkJggCdTqeoEgSAdevWISAgwGgJAj//XkaOHMkStDIsQiv100/Ali2AQk7PeN9qamoQHx8vy/NWOjg4YP369Wjfvj3Gjh2L6upqqSOZRW1tLTZt2iTLv6OHda9zqtbV1WHjxo2K/L1YOxahlTp0CGjdGnj6aamTWJedO3fi9u3bGDlypNRRmqV9+/ZISEhAUVERZs2aJXUcs0hJScGNGzcwatQoqaNY1PHjx5GXl2fyUlP79+9HaWkpRo8ebeFk1BQWoZUaPBg4cwZwdJQ6iXWpv8RNS55dxtJUKhWSkpIQHx+PJUuWSB2nxcl16PphCYKAwYMHo1evXibvj4iIgLOzs4WTUVNYhFZMYZ8jTaqqqkJiYqJNDC2p1eqGIly7dq3UcVqMnIeuH9a9hkVv376NzZs3K/L3IgcsQpKNpKQk2Nvb46mnnpI6SosYMmQIvvzyS8ycORN79uyROk6L2LVrF2pqahS3PCArKwunT582eSHeb775Bjdv3uQieivFdYQkG4IgYPz48XC0ofHiSZMmoaCgAOPGjUNqaiq8vb2ljvRQBEFAVFQU2ilsqrMgCHjqqadMnsRBEASMGTNGccPFcsEjQpKFW7duYfv27TY5tPS3v/0NMTEx0Ol0OHfunNRxmq2qqgpbt261yb+jexFFEXq93uTrrq6uxpYtWxT3e5ETFqFCxQYDsYVSp7h/W7ZsQceOHTFkyBCpo5hFbGwsBgwYgDFjxqCiokLqOM1SP3Q9bNgwqaNYlMFgQHFxMcaMGWP0/vqZzko6vZ7csAhJFgRBQHR0NBwcHKSOYhatW7eGXq9vuBDx7du3pY70wOr/jkwNXefk5MAWT2QlCAJGjBhhcpG8IAgYO3asrGc62zoWIVm98vJy7Ny50+aHljp27Ijt27cjJydHdmsMmxq6rqqqwvDhw7Fo0SILJzOvurq6e548wJZmOtsyFqHEYoMBOzvgj8l33FEIBNsByb/aLjjWyAPcsd39PJedHTA/HZjv8b//tuZh0s2bN6N79+4ICgqSOorZ9ezZE0lJSdi4cSOWL18udZwmXb16FXv27MHs2bPRtm1bhIWFGd2ubdu2iI+PR2xsLD7++GPLhjSjphbJb9u2DY6OjjYz09lWcdaoFQgKAj5dAiwIB9zN+Dzz0oB5v/w5NhjAWmCeOZ+whQiCgAkTJjzUFePlRKPRID4+HiNHjkSvXr0wdepUqSMBAC5duoTs7OxGt9OnT6NDhw7w9PTEjRs3kJCQgHHjxhn9+UGDBmHt2rWYPHkyXF1dERkZaeFX0PIEQcCoUaNMLpIXBAHjxo1D69atLZyMHgSL0AoMWAxMWAJMjwXS5jW9vZKUlZVh7969eOutt6SOYlFhYWH44osv8Nxzz6Fnz54WP6IoLi5Gbm4ucnJyGi54nJubi44dO8Lb2xtarRaRkZHQarXo378/HBwc8Pnnn2Pq1KlQqVQmj96jo6Nx5swZTJkyBd9++y1++9vfWvR1taT6RfKrVq0yev/NmzeRnJyMxMRECyejB8UitBLzFgPzdUBshDyO0ixl48aNcHV1hZ+fn9RRLG7y5Mk4ceJEwxpDLy8vszxPcXFxQ9nV30pKSuDi4oIBAwZAq9Vi4cKF0Gq18PT0NHlk/vzzz6OwsBCRkZFIT09Hv379jG73yiuv4OzZs4iIiIDBYICbm5tZXpe51S+SDw8PN3p//UznwYMHWzgZPSgWobUIB5JmArrpQESa8SHS9PmA3fyWebp5aS3zOOYmCAImTZoEOzs7qaNI4o033sDZs2cRGRkJg8GARx999KEe787Sy8jIwKVLl9CpUydoNBpotVqMHz8eWq0WarX6gX/vy5Ytw/nz5xEeHg6DwWBygfnKlStx7tw56HQ6HDhwwKovrGxK/ckDTC2Srx/St9WZzraEF+aVWGwwkLsYWP3LTuUf7YDjK4G0CCDYA1gsAuG/bLdhgpGh08LG29mSCxcuwNXVFdnZ2bI/48rDqKmpQUREBMrKyrBv3z506NDhvn7uztI7ePAgrly5ApVKBa1WC61WC41GA7VaDY1G02J5q6urER4ejoqKCqSkpKB9+/ZGt6usrMTQoUPRpk0b7Ny5E23atGmxDOZWXV0NlUqFL7/80uhEmWvXruHRRx/F3r17FTHJS+54RGhlVicBdjogOaJ5P1+YDEzXAekAEAQkrQXCZTrUqtfr4eHhoegSBH5eY7hx40YMHjwYEydOxJYtW9Cq1f/+6dbW1iI/P7/he7ycnBykp6ejrKysUenNnDkT/v7+D31U2RRHR0fo9XoEBwdj0qRJiI+PN3pU1K5dOyQmJiIwMBDPPvssvv76a9kc+e/YsQN1dXUmF8nHx8ejR48eCAwMtHAyag4WobX51RBpc/YjtycAa8Wfh1YLYwGP6UCBiaFWa1c/LEqAs7Mztm/fjsDAQEyfPh1Dhw5tmLl59OhRVFVVwd3dHb6+vggNDcW8efPg6+sr2ZXQu3TpgqSkJAQGBmLhwoVYsWKF0e26deuG5ORkBAUF4Y033sCbb75p4aTNU385MFNHsfVXopBLsSueSJJaGSSKM5Pu/v8zIYqAKCb9aruglUYeoEAUg361nbHHMXWfNTt79qxoZ2cn5uTkSB3Fqnz33XdidHS06OnpKcbExIgffPCBuG/fPvH69etSRzMqMzNTdHJyEmNjY++53f79+8U2bdqIn3zyiYWSNV9lZaXo7Ows7tixw+j9ly9fFlu3bi0ePnzYwsmouViENqxgpShiptQpmue9994TBw4cKHUMagHbtm0THR0dxc2bN99zO0EQREdHR3Hnzp0WStY8er1e7Natm1hTU2P0/n/9619i3759xbq6Ogsno+ZSxgplBSqMBTw2AAWrpU7SPPe6yCnJS0REBP75z38iJiYGBoPB5HYTJkzAm2++iejoaBw5csRyAR9Q/TlVf/097Z33P/PMMxwWlROpm5ju3+3bojhjhig2NeJSsFIUESSKBZaJ1eJOnTol2tnZiQUFcn0FZMxLL70kduvWTTx58uQ9t5s9e7bYs2dP8ezZsxZKdv/Ky8vFdu3aiSkpKUbvLykpER0cHMRjx45ZNhg9FB4RyoiDA9CpE6DTAYUmzg2a/MdfjgRlOkEGAOLi4uDv7w93d7m+AjJmxYoVGD58OMLDw3H58mWT28XGxsLf3x/h4eG4du2a5QLeh61bt8LFxQWhoaFG79+wYQM8PDzMdvIDMg8Wocy8/z4QGgpERgJXr95xZyGw5FMA6YCH3f9OqH0/J+S2JhwWtU12dnZYs2YNHn30UYwbNw5VVVVGt3NwcMC6devQoUMHjB07FtXV1RZOalr9e9PUIvn6YVGSFy6ol6HKSmDYMKBVK2DXLkBG65CblJ+fD7VajTNnzqBPnz5SxyEzKC0tRXBwMLy9vREXF2fylG0lJSUIDAzEU089hTVr1lg45d3qF8mnpKQYXR/4448/ws3NDTk5OfD09JQgITUXjwhlqF07YOtW4MIFYPp0wJZ2ZdavX4+QkBCWoA3r2rUrkpKS8O233+Kvf/2rye1UKhWSkpIQHx+Pt99+24IJjdu8eTN69OiBgIAAo/fHxcXBx8eHJShDLEKZ6toVSEoCUlKAxYulTtNy9Ho9h0UVoG/fvti2bRs++ugjfPTRRya3U6vVSEhIwNKlS7F27VoLJrybt7c33n//fZOzQTmkL18cGpW5jAzgySeB994D/u//pE7zcI4cOQI/Pz+cP38ejzzyiNRxyAISExMRHR2NDRs2YMyYMSa3i4uLw4wZM5CYmIinn37aggnvz6lTp+Dh4YGCggL85je/kToOPSAeEcrcoEHA2rXA/Pk/D5fKmSAIePLJJ1mCCjJ69GgsX74ckydPxqFDh0xuN2nSJCxevBjR0dE4duyYBRPen7i4OAwaNIglKFMsQhsQHQ0sWwbExADffSd1mubjsKgyvfjii3jhhRcQFRWFH374weR2ixcvRkxMDHQ6Hc6dO2fBhE3jsKi8cWjUhsydC+zYUYdvvilBnz69pI7zQA4dOoTQ0FCUlJSga9euUschC6urq8P48eORl5eHtLQ0k9cnvH37NkaNGoXi4mKkpqbCxcXFwknvlp+fD41Ggx9++AGurq5Sx6Fm4BGhDVm5EhgyZAV0uhFWtxC5KYIg4Omnn2YJKpS9vT2++uordOrUCVFRUfjpp5+MbteqVSvo9XrY29vj1VdftXBK4/773/8iJCSEJShjPCK0MXK72On169eRlZWFyZMn4x//+AemT58udSSS0JUrVxAUFAStVot169aZnKFZXFyM1q1bo3v37hbNd/XqVeTk5DS64HF1dTU+/PBDjBo1yqJZqOWwCG3QlStXEBgYCD8/v3t+mFhaaWlpwzX0srKykJ2djaKiIrRr1w6zZ8/G66+/ft9XXyfbderUKQQGBmLmzJlYsmSJZDnOnj3b8H6tv5WUlKBLly7w9fVtuPn5+XGSjMyxCG1UYWEhgoKCMGvWLEkudmpszzkvLw9OTk7w8fFpuGq6RqOBl5cXHB0dLZ6RrFdGRgaefPJJrFixArNmzTL78xUXFzd6rx4+fBgXL15Ep06doNFoGt6vWq0WarXaanYuqWWwCG1Yamoqhg8fjg8//BB/+tOfzPY8v/4Qyc3NRU5ODnJzc+Hs7AwvL69GHyKenp4mT6lF9Gt6vR4xMTHYtGkTRo8e3WKPe2fpHTp0CJcvX4ZKpWrYOVOr1Q1/JtvHIrRxGzZswNSpU7F161aMGDHioR/vzg+RzMxMXLhwgXvOZBbvvfce3n77bezfvx8DBw58oJ+tra1Ffn5+w85ZVlYW0tPTUVZW1lB69Tc/Pz+oVCrzvAiyeixCBVi+fDmWLl36wB8md5ZeRkYGLl26hM6dOzfsMbP0yNzmzp2LzZs3w2AwmDwH7e3bt3HixIlG79cjR47g5s2bd5Xe7373O/To0cPCr4KsGYtQIebMmYP4+HiTHyZ3lp7BYEBpaeldHyIajQZ9+/aV4BWQUtXW1iI6OhonT55EWloanJyccPLkyUbv1+zsbFRWVt71fg0MDES3bt2kfglk5ViEClFbW4tx48ahsLAQq1evRkFBQcNMuPo95759+zaaDefr62vx6elExty8eRNhYWGora3F8ePHIYoiPD09G71XBw4cyFnH1CwsQgWpqKjA1KlTkZiYiB49ejTacw4ICGDpkVUrLy9HVlYW2rdvD29vb7Rr107qSGQjWIQKdOvWLbRv317qGEREVoFFSEREisYFXUREpGgsQiIiUjQWIRERKRqLkIiIFI1FSEREisYiJCIiRWMREhGRorEIiYhI0ViERESkaCxCIiJSNBYhEREpGouQiIgUjUVIRESKxiIkIiJFYxESEZGisQiJiEjRWIRERKRoLEIiIlI0FiERESkai5CIiBSNRUhERIrGIiQiIkVjERIRkaKxCImISNFYhEREpGgsQiIiUjQWIRERKRqLkIiIFI1FSEREisYiJCIiRWMREhGRorEIiYhI0ViERESkaCxCIiJSNBYhEREpGouQiIgU7f8B5Ld9xN0vwpsAAAAASUVORK5CYII= | |
" | |
> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [7]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">query_mol</span> <span class="o">=</span> <span class="n">Chem</span><span class="o">.</span><span class="n">MolFromSmiles</span><span class="p">(</span><span class="n">query_smi</span><span class="p">)</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [8]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">query_mol</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
<div class="output_wrapper"> | |
<div class="output"> | |
<div class="output_area"> | |
<div class="prompt output_prompt">Out[8]:</div> | |
<div class="output_png output_subarea output_execute_result"> | |
<img src="data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAcIAAACWCAYAAABNcIgQAAAcQklEQVR4nO3de1gU9eIG8HfBu4AgpiIGRPrTFPOySwZomuYFRZLwglZqeqC0SKVM6pgnPfmYpUfMU4mZmndbRRJkVcyTIpvC7pORQiBIHpVEC5KOCCL7/f3BkY7JpsLuDrPzfp5nnpKdnXlXy3fnO9+ZUQkhBIiIiBTKQeoAREREUmIREhGRorEIiYhI0ViERESkaCxCIiJSNBYhEREpGouQiIgUjUVIRESKxiIkIiJFYxESEZGisQiJiEjRWIRERKRoLEIiIlI0FiERESkai5CIiBSNRUhERIrGIiQiIkVjERIRkaKxCImISNFYhEREpGgsQiIiUjQWIRERKRqLkIiIFI1FSEREisYiJCIiRWMREhGRorEIiYhI0ViERESkaCxCIiJSNBYhEREpGouQiIgUjUVIRESKxiIkIiJFYxESEZGisQiJiEjRWIRERKRoLEIiIlK0JlIHICKypurqauTk5MBgMMBgMODbb7/FxIkTER0dDZVKJXU8agRYhERkN0wmE86cOVNbereKr7y8HF27doVGo8HgwYOxaNEiFBcXY8mSJVJHpkZAJYQQUocgIqqPoqIiGI3G2uWbb77BL7/8Ag8PD6jV6tolICAA7dq1q31fRkYGnnzySSxbtgyvvPKKhJ+AGgMWIRHJwh9L78SJE7hy5codpde/f3+0b9/+rttLSkrCuHHjsGPHDoSFhdngE1BjxSKke2YymeDgwPlVZH2lpaUwGo04duwYjEYjDAYDLl26BFdXV/Ts2RMDBgxAUFAQ/P390bFjx3rvZ82aNYiJicGhQ4cQGBhowU9AcsIipLuqrKzEqlWrsGbNGnh7e2PXrl1wd3eXOhbZiatXr+L777+/7WgvOzsbbdq0gZ+f321Hez179rT4/t944w2sX78e6enp6Natm8W3T40fi5D+VFJSEubOnYuKigq8/vrrSEhIwJUrV3DgwAF4eXlJHY9kpqysDFlZWbeVXk5ODpycnPDoo4/eVno9evSwyaxOIQSmTp2K9PR06PV6dOjQwer7pMaFRUh1MhqNiImJgcFgQHR0NBYsWAAnJydUVlbi2WefhV6vx4EDB9CrVy+po1IjlpOTA51OVzuDMz8/H61bt0bfvn2h0Whql65du0p6KUNVVRVGjx6N0tJS/Otf/4KTk5NkWcj2WIR0m6KiIixatAjr169HWFgYli9ffseRX3V1NV566SXs3r0bycnJPLdCdSosLMTEiRPh4OAAf3//2tLr3r07HB0dbZLhwoULtSXs4OCAxYsXm123rKwMTzzxBDw9PfHll1+iSRNeXaYU/JMmAEB5eTlWr16NJUuWQK1WIyMjA3379q1zXUdHR6xduxaenp4YPnw4du3ahZEjR9o4MTV2O3fuhMlkQkZGhk32V1xcfNv1g7cm2LRv3x4ajQZDhgz50/e7uLggJSUFAQEBmDlzJj799FOb5CbpsQgVTgiBXbt2Yd68eWjatCk+++wzjB8//q7vU6lUeOedd+Dm5oaxY8di48aNiIiIsEFikgutVosJEyZYZdvmJti4uLigV69eUKvVGD9+/H2fa+zUqRNSUlIwcOBAeHl54e2337ZKfmpcODSqYCdOnEBMTAyys7MRGxuLOXPmoHnz5ve9nc2bN+Mvf/kLli5dipiYGCskJbk5e/YsunTpgjNnzuDhhx9u0LZ+++03fPfdd3dMsGndujV69+5tlQk2R44cwciRI/Hxxx/jhRdeaPD2qHHjEaECnT9/Hn/961+xY8cOvPDCC9izZ889XYBszvPPPw83NzdMmDABly9fxnvvvWfBtCRHO3fuhFqtvu8SvHbtGr799tvbSu+HH36Ao6MjHn30UQQFBWH+/PlQq9V45JFHrHZd66BBg7Bx40ZMmTIFnTp1wogRI6yyH2ocWIQK8p///AfLly/HsmXLMGDAABiNRovN+gwJCcHhw4cREhKCsrIy/POf/+TF9wqm1WrvOlReVVWFvLy82sJLT0/HyZMn4eDggK5du0KtViMqKgpqtRqPPfYYmjVrZqP0NSZOnIhz585h/Pjx+Prrr9GvXz+b7p9sh0OjCmAymbBlyxa88cYbcHNzwwcffICQkBCr7Ov06dMYMWIE/P39sX37drRo0cIq+6HG627Dot9//z2mTJmCU6dOQaVSwc/PDxqNpnZmqZ+fH5o2bSpB8rrNmTMH27Ztg16vR5cuXaSOQ1bAIrRzX331FWJiYnDhwgUsXLgQL7/8stWnhf/4448YPnw4OnfujMTERLi4uFh1f9S4LF26FHv27DE7W/SXX37Bzp07odFo0Lt373qdl7Ylk8mECRMm4LvvvoNer8cDDzwgdSSyMBahncrLy8OCBQuQmJiImTNnYtGiRXB1dbXZ/ouLixEcHAwHBwfodDr+5aEg/fr1w6RJkzBv3jypo1hMRUUFhg0bhqqqKhw+fBitWrWSOhJZEE/i2JmSkhLExsaiV69euH79OnJycrBq1SqbliAAdOjQAUePHkXbtm0REBCAgoICm+6fpFFQUICTJ0/imWeekTqKRbVo0QKJiYm4evUqIiIiUF1dLXUksiAWoZ2oqqrC2rVr0a1bN6SmpuLgwYNISkpq8NT1hnByckJSUhL69u2LgQMHIisrS7IsDXX69GnExsZi+fLlUkdp1G4NeUr53521uLu7Q6fTITMzk88wtDeCZC81NVX07NlTdOrUScTHx4ubN29KHek2N2/eFJGRkcLNzU0cO3ZM6jj3rKioSMTFxYmgoCABQAAQgwcPljpWo9anTx/x/vvvSx3DqoxGo3BychIffPCB1FHIQliEMnb69GkRHBwsWrVqJebPny/KysqkjmSWyWQSf/vb30SrVq1ESkqK1HHMKi8vF1988YUICQkRTZo0qS3AW4uzs7Oorq6WOmajlJ+fL1QqlSgoKJA6itV99dVXonnz5mLTpk1SRyELYBHK0JUrV8Srr74qmjRpIsaPHy8KCwuljnTPVq1aJZo2bSrWr18vdZRa1dXVIi0tTURFRQlnZ+c7yu+PS05OjtSRG6V3331XPPbYY1LHsJktW7aI5s2bi9TUVKmjUAPxgnoZuXHjBj755BMsXLgQ3bt3x5EjR2T35IdXX30Vbdu2xYwZM1BSUoLXXntNsiynT5/G5s2bsWnTJvz000/3/L7MzEx0797disnkSavV4rnnnpM6hs08++yzKCgoQHh4OI4ePYrevXtLHYnqS+ompnuzf/9+4eXlJXx8fMTOnTuFyWSSOlKDJCcn1w7p2vKzXLhwQcTFxYm+ffve9cjP3DJmzBixb98+m2WWg9zcXKFSqWQ1OmEps2bNEp6enuLcuXNSR6F64nWEMjF8+HD4+voiLi7Obu7WcuLECYwePRpjxozBp59+arUL/cvKypCYmAitVgudTtfgqe8PP/wwfvrpJxw6dAgBAQEWSilv7777LpKTk3H8+HGpo9hcdXU1wsPDkZ+fj7S0NLi5uUkdie4TL5+QiaqqKjz44IN2U4IA0L9/fxw9ehSHDh3CuHHjUFFRYbFtV1dX49ChQ7U3TZ46dSqSk5Mtcv3XTz/9hMjISISGhiIvL88CaeVPq9Xe0+O77JGjoyO2bdsGFxcXhIWFobKyUupIdJ9YhDLh7+8Po9EodQyL69GjB9LS0pCTk4Pg4GCUlZU1aHu3rvfz9PTEsGHDsHnzZly7ds1CaWuUl5dj+vTpGDlyJEaNGoXLly9bdPtyk5eXh++//x7h4eFSR5FMq1atsHfvXhQVFWHatGkwmUxSR6L7wCKUCbVaDYPBIHUMq/Dx8YFer8f169cxZMiQ+y6W8+fPY9myZejWrRv8/PywbNkyFBcXWyltDaPRiM8++ww+Pj4ICQmxeNnKyRdffIH+/fvDx8dH6iiSateuHXQ6HQ4fPoy33npL6jh0H1iEMqHRaHD+/Pn7mt0oJ+7u7jh06BDc3d0REBCA/Pz8P13/119/xaZNmzBs2DB4e3sjNjbWpsOUBoMBzZo1w+7du1FZWYmJEyfi5s2bNtt/Y6LkYdE/evjhh/Hll19i9erV+Oijj6SOQ/eIk2VkQgiBBx54ABs3brTaI5Qagxs3buC5555DWloa9u/ff9uU9MrKSuzbtw+bN29GSkoKbty40aB9NW3aFM7OznB1dUWbNm3g7OwMFxcXODs7w9nZGW5ubrW//t9/urq6omPHjujcuTMA4OLFiwgICEBwcDDi4+MblElucnNz8cgjj6CwsBDe3t5Sx7GZvLw85OTk4Omnn67z9b///e/IysqCVqu1cTKqD15HKBMqlQr9+vWDwWCw6yJs1qwZtm/fjpkzZ+LJJ59EamoqAGDTpk3Yvn07rly5AqDmJsgeHh5wc3OrXVq2bIkWLVrc9We3fu7q6gqVStXgzJ6enkhJScHAgQPh4+ODN998s8HblItbw6JKKkEAWLduHb777juzRXjmzBk+oUJGWIQyotFo7HLCzB85OjoiPj4ep06dwoEDBxAcHIzZs2dj4cKFcHZ2tvmTyu+Fn58f9uzZg5EjR9bOUlUCrVaLadOmSR3D5nbv3m32C09lZSX27t2LLVu22DgV1RfPEcqIRqNBZmam1DFs4ty5c8jMzMTQoUPRt29f+Pr6wt3dvVGW4C2DBw/Gxo0bERUVhYMHD0odx+pyc3Nx6tQpxc0WzcjIwL///W+zR4MHDhyAEAJPPfWUjZNRffGIUEY0Gg2Ki4tx4cKF2vNT9uof//gHBgwYgP79+0sd5b5ERESgsLAQ48aNw9GjR9GnTx+pI1nNzp078fjjjytuWFSr1WLo0KFmHzat1WoxduxYu7rm197xiFBGvLy80L59e7u9jOKW0tJSbNiwAa+//rrUUerlzTffxLRp0zB69GicO3dO6jhWo8TZokII7Nq1y+znrqysRFJSkuJ+X+SORSgzGo3G7ovw448/RufOnREcHCx1lHpbuXIlHn/8cYwaNQolJSVSx7G43NxcnD59WpHDohcuXEBoaGidrx84cAAqlQrDhg2zcTJqCBahzNh7EVZWVuKjjz7CvHnz4OAg3/88HR0dsWXLFri6umLs2LEWvX1cY7Bjxw4EBATAy8tL6ig2dS/Dok8//TSaN29u42TUEPL9m0ah1Go1MjMzYa+Xf27atAkmkwmTJ0+WOkqDtWzZEnv37sXly5cxZcoUu7rtllKHRXfv3s1hUTvEIpQZf/+haN26GD/+2PDr3xobIQTi4uIwe/Zsu5lo4O7uDp1Oh6NHj2LevHlSx7GIH374AdnZ2XjmmWekjmJTGRkZuHjxIsaOHVvn6/v37+ewqEyxCGXGw6M1qqubwB5HR5OSknDu3DlERUVJHcWiHnroIezbtw9r167FypUrpY7TYDt27EBgYKBih0Xd3d3Nvj527NhGfYkP1Y1FKEP+/oA9Xle/fPlyREZGmv2LRs7UajV27tyJ+fPny/5Ca2UOiwLp6bMwZcp7db5eWVmJ5ORkxf2+2AsWoQyp1YC9XVefmZkJvV6P6OhoqaNYzahRo/DJJ59gxowZ+Oqrr6SOUy8//PADcnJyEBYWJnUUmzpxAjAafTFiRO86X9fpdFCpVLyIXqZYhDKk0dQcEdrR3Au8//77mDBhAnx9faWOYlUzZsxAbGwswsPDkZWVJXWc+7Zjxw4EBQWZHRaNj4/H1q1bbZzK+rRa4KmngLZt635dr3fAtGlzOSwqUyxCGfL3B65eBe7ypCLZKCwsxJ49ezBnzhypo9jEO++8g/DwcIwaNQrnz5+XOs59uduwqIuLC2bMmFF7s3R7IASwezdg7mNXVADx8aEYNmyhbYORxfAWazLUrh3g7Q0YDMD//Z/UaRpuxYoVGDRoEB577DGpo9iESqXCmjVrEBoailGjRiEtLQ2urq5Sx7rDzZs3kZ2dDaPRCIPBgIyMDFy7dg1+fn5m3zNp0iScPXsW48aNw5EjR+ziFnPHjwNFRYCZW4ti/37AwaHmiJHkic8jlKlx42rKcMUKqZM0TElJCby8vKDVamV9J5n6KC8vx5AhQ9CqVSvodDpJL8I2mUzIzc2FwWCoXU6ePImKigp07doVGo0GGo0Gx44dqz2f6+npaXZ70dHRSEhIgF6vl/29SGNigNxcYN++ul9/9lmgeXNg/Xrb5iLLYRHK1HvvATodcOSI1EkaZvHixdBqtcjKyrLIswHl5sqVKwgMDIS/vz+2bt1qs9+DoqIiGI3G2kWv16OkpAQeHh5Qq9W1S2Bg4G2zeKurqxEeHo6CgoI/PZKtrq7G+PHjkZubi2PHjsHNzc0mn8vShAAeegh45x2grqdNVVQAHToAO3YACvseZ1dYhDJ16BAQFgb8+ivg6Ch1mvqprKyEj48P3nvvPcU8v68u+fn5CAwMRGRkJJYsWWLx7f+x9I4fP46ff/75jtJ7/PHHzd467H+Vl5dj6NChaNGiBfbv32/2SPb69et46qmn0KRJExw8eFCWtx3T64HBg4FLl+qeKLNnDzB9OlBcDHCejHyxCGWqtBRwdwdOnQJ69JA6Tf3Ex8dj8eLFKCwsVPxsu4yMDDz55JNYtmwZXnnllXpv54+ll5mZieLi4jtKz9/fHx07dqz3fq5cuYKgoCCo1Wps27bN7JHszz//jKCgIPTp0wfbt2+X3f1j584F8vLMD4tOngy0bAl89pltc5GFCZKtLl2E+PxzqVPUj8lkEo888ohYtmyZ1FEajb1794pmzZqJhISEe1q/tLRUpKWlibi4ODF+/Hjh4eEhAIg2bdqIoKAg8eqrr4rPP/9cnDp1yip58/PzRfv27UVsbOyfrldQUCA6dOggXn/9davksBaTSQgvLyE2bKj79evXhXBxEUKns2kssgIWoYxFRAgRHS11ivrZs2ePcHZ2FqWlpVJHaVQ++eQT0bJlS5Genn7bz69evVpbes8//7zo0aOHUKlUwsXF5Y7SM5lMNst74sQJ0bp1a/Hhhx/+6XqZmZnCyclJrFy50jbBLKCwUAhPTyFKSup+ffduIdzchKistGkssgIOjcrYihU1QzaHD0ud5P7devr8CrlPe7WCN954Axs2bEBkZCQKCgpgMBhw9uxZODs7o1+/frUzODUaDbp06SJ1XCQnJyM8PBzbt2//0xtxp6SkICwsDFu3bsW4ceNsmLD+hADMzV+aNAlo3RpYt862mcjyWIQyVlFRc4JeZqddkJGRgaCgIBQUFCjuxs33QgiBDz/8EFqtFmq1urb0unXr1mjPscXHx2Pu3LlITU1FUFCQ2fXWrVuH6OhopKamYsCAATZMaFm3Zot+8QUwYoTUaaihWIRkc+Hh4WjZsqXsbz5Nt4uNjcW6deuQnp6Obt26mV3v7bffxurVq5GWloZevXrZMKHl7N4NREbWzCZV+Dwvu8AiJJs6e/YsunXrhoyMDPTt21fqOGRBQghMmzYNaWlp0Ov1ZmelCiFqb8P2zTffoHPnzjZO2nAREYCTE4dF7QWLkGxq1qxZyM/Px8GDB6WOQlZQVVWF0aNHo6SkBF9//TWcnJzMrjdmzBgUFRUhLS0Nbdq0sXHS+jOZgF69as7RjxwpdRqyBBYh2cwvv/wCb29vJCQkYPjw4VLHISspKyvDoEGD4OHhgb1796JJk7pvafzbb79h0KBBcHV1xf79+2V1LakQNUsjPWVL94l/jHTfVgUBq+rx5IvVq1fD19cXw4YNs3woajRcXFywb98+ZGdn46WXXjK7nrOzM/bt24fCwkK88MILkNN3cpWKJWhP+EdJNlFRUYE1a9Zg3rx5irynqNJ06tQJKSkpSEhIwKJFi8yu5+HhgdTUVKSmpmLhQj7GiKTBxzCRTWzYsAFNmjTBxIkTpY5CNtKjRw8kJiZixIgRaN++PWbOnFnnel26dEFSUhKGDBmCjh074uWXX7ZxUlI6HhHK2KqgmiGaF3V/eCEfCFIBuv9ZL2hVHRv4w3r3si+VCpijB+Z0/f3XdxsmNZlMWLlyJebMmSOr80DUcE888QQ+//xzzJ49G19++aXZ9fr374/t27cjJiYGiYmJtgtIBBah7AUGAmvfBaz9sPrZ6b9PEIgLBOLO/P7r2Xe5uUliYiIuXbqEyMhIK6ekxmjChAlYunQpJk+ejOPHj5tdLzQ0FHFxcZg8eTK++eYbGyas271+0ST5YxHKnN8CIA7A1LqO+BqJ5cuX48UXX5TVFHmyrNdeew1RUVEIDQ3FmTNnzK43c+ZMzJo1C6GhocjLy7NhwrrZ6osmSYtFaAdmLwD0c+o3k9Pa0tPTYTAYEB0dLXUUktiKFSswaNAgBAcH4/Lly2bX++CDDxAcHIzg4GAUFxfbMOGd5PBFkxqORWgPgoGUKGDOVPPfXPVzfj+nV7t0BfT12N3s9LqHQ69fv/Nny5cvx6RJk3hPUYKDgwO2bt0Kb29vjBkzBteuXatzPZVKhXXr1sHX1xchISFm17OVxvxFkyyDRWgnguOBKL35b66Bcb+f06tdzgCBFswwenTN3fhHjszCiBEjEBERgaSkJMTExFhwLyRnzZo1Q0JCAq5fv46IiAhUV1ebXU+r1cLf39/sOjZzD180Sd5YhHYkPqXmm2t9T+Ln62omAahUgCoI0N3n//Xr1wPJycD06a4YOHAgXF1dodPp0Lt373omInvUpk0bpKSk4OTJk396qYSrqys+/vhjuLi4WDVPVRVw8mTNfUM//bTude72RZPkjdcR2pP/fnMdNbV+R3r7EoHPBdAFQP4qoOtU4Ex6za/vhY9PzQJ4AVhQjwSkFJ07d0ZKSgqeeOIJPPTQQ5g/f75N9ltdDeTkAEYjYDDULCdPAjduAN27AyEh5t8bnwKoRgG60TaJSjbEIrQzwfFAlApYW4/3zo7//d+7zAai5gBncO9FSHQ/evXqhYSEBAQHB8PDwwNTpkyx+D6KimpK79aSng6UlgIeHoBaXfMswbfeAoKCgLZt77KxBn7RpMaLN92mOuWvArpmAyL+7usSNcS2bdswffp0JCUlNeg+tGfPnoXBYEB2djCOHnWG0QiUldWMUmg0vy9qNeDqevftrQoCshcA8cG3//zF/37RTBFAcJ3vJLlhEdId8lcBXb+4v2FRooZYsmQJ3n//fRw5cgR9+vS56/rnz5+HwWC4bSkpKUHnzp3x9NNH0bHjQ7XF166d9fOTvLEI6TYsQZJKdHQ0EhISoNfr4e3tXfvz0tJSGI1GHDt2DEajEQaDAZcuXYKrqyt69uwJtVqNAQMGYMCAAfDw8JDwE5BcsQiplu5FYNQpliBJo7q6GmFhYcjLy8OECROQlZUFg8GAixcvom3bttBoNLctDz74oNSRyU6wCKlGPhBUxwX2PA9CtlReXo6lS5ciPT39ttLz9fWVOhrZMRYhEREpGi+oJyIiRWMREhGRorEIiYhI0ViERESkaCxCIiJSNBYhEREpGouQiIgUjUVIRESKxiIkIiJFYxESEZGisQiJiEjRWIRERKRoLEIiIlI0FiERESkai5CIiBSNRUhERIrGIiQiIkVjERIRkaKxCImISNFYhEREpGgsQiIiUjQWIRERKRqLkIiIFI1FSEREisYiJCIiRWMREhGRorEIiYhI0ViERESkaCxCIiJSNBYhEREpGouQiIgUjUVIRESKxiIkIiJFYxESEZGisQiJiEjRWIRERKRoLEIiIlK0/wc+aRoOkVOmXwAAAABJRU5ErkJggg== | |
" | |
> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [9]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">ref_3d</span> <span class="o">=</span> <span class="n">Chem</span><span class="o">.</span><span class="n">AddHs</span><span class="p">(</span><span class="n">ref_mol</span><span class="p">)</span> | |
<span class="n">AllChem</span><span class="o">.</span><span class="n">EmbedMolecule</span><span class="p">(</span><span class="n">ref_3d</span><span class="p">)</span> | |
<span class="n">AllChem</span><span class="o">.</span><span class="n">MMFFOptimizeMolecule</span><span class="p">(</span><span class="n">ref_3d</span><span class="p">,</span> <span class="n">nonBondedThresh</span><span class="o">=</span><span class="mf">100.0</span><span class="p">)</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
<div class="output_wrapper"> | |
<div class="output"> | |
<div class="output_area"> | |
<div class="prompt output_prompt">Out[9]:</div> | |
<div class="output_text output_subarea output_execute_result"> | |
<pre>0</pre> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt"> | |
</div><div class="inner_cell"> | |
<div class="text_cell_render border-box-sizing rendered_html"> | |
<p>This is the 3D structure of the reference:</p> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [10]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">drawit</span><span class="p">((</span><span class="n">ref_3d</span><span class="p">,</span> <span class="o">-</span><span class="mi">1</span><span class="p">))</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
<div class="output_wrapper"> | |
<div class="output"> | |
<div class="output_area"> | |
<div class="prompt"></div> | |
<div class="output_html rendered_html output_subarea "> | |
<div id="3dmolviewer_15607095855990522" style="position: relative; width: 400px; height: 300px"> | |
<p id="3dmolwarning_15607095855990522" style="background-color:#ffcccc;color:black">You appear to be running in JupyterLab (or JavaScript failed to load for some other reason). You need to install the 3dmol extension: <br> | |
<tt>jupyter labextension install jupyterlab_3dmol</tt></p> | |
</div> | |
<script> | |
var loadScriptAsync = function(uri){ | |
return new Promise((resolve, reject) => { | |
var tag = document.createElement('script'); | |
tag.src = uri; | |
tag.async = true; | |
tag.onload = () => { | |
resolve(); | |
}; | |
var firstScriptTag = document.getElementsByTagName('script')[0]; | |
firstScriptTag.parentNode.insertBefore(tag, firstScriptTag); | |
}); | |
}; | |
if(typeof $3Dmolpromise === 'undefined') { | |
$3Dmolpromise = null; | |
$3Dmolpromise = loadScriptAsync('https://3dmol.csb.pitt.edu/build/3Dmol.js'); | |
} | |
var viewer_15607095855990522 = null; | |
var warn = document.getElementById("3dmolwarning_15607095855990522"); | |
if(warn) { | |
warn.parentNode.removeChild(warn); | |
} | |
$3Dmolpromise.then(function() { | |
viewer_15607095855990522 = $3Dmol.createViewer($("#3dmolviewer_15607095855990522"),{backgroundColor:"white"}); | |
viewer_15607095855990522.removeAllModels(); | |
viewer_15607095855990522.addModel("\n RDKit 3D\n\n 34 35 0 0 0 0 0 0 0 0999 V2000\n -3.9641 0.1794 -0.6522 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9054 1.1932 -0.3477 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0300 0.7057 0.7951 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3144 -0.6201 0.4606 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1052 -1.4412 -0.5791 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6026 -1.2548 -0.4194 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1297 -0.4132 -0.0386 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0980 0.0279 1.0669 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4930 0.2114 0.5255 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3717 -0.8775 0.4443 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6563 -0.7121 -0.0754 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0734 0.5404 -0.5210 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2067 1.6289 -0.4478 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9211 1.4662 0.0712 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.8064 0.3941 -0.1004 H 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2501 0.2989 -1.6341 H 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3268 1.3412 -1.2656 H 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4219 2.1249 -0.0986 H 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3176 1.4906 1.0661 H 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6612 0.5511 1.6804 H 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2667 -1.2094 1.3866 H 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8507 -2.5024 -0.4709 H 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8127 -1.1548 -1.5980 H 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1708 -1.8479 -1.1419 H 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9344 -1.5093 0.5928 H 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1354 0.3181 -0.8575 H 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4971 -1.3561 -0.4661 H 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7687 0.9637 1.5318 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1156 -0.7180 1.8715 H 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0652 -1.8625 0.7888 H 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3349 -1.5599 -0.1300 H 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0759 0.6687 -0.9217 H 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5363 2.6061 -0.7921 H 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2619 2.3289 0.1230 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 2 3 1 0\n 3 4 1 0\n 4 5 1 0\n 5 6 1 0\n 4 7 1 0\n 7 8 1 0\n 8 9 1 0\n 9 10 2 0\n 10 11 1 0\n 11 12 2 0\n 12 13 1 0\n 13 14 2 0\n 6 1 1 0\n 14 9 1 0\n 1 15 1 0\n 1 16 1 0\n 2 17 1 0\n 2 18 1 0\n 3 19 1 0\n 3 20 1 0\n 4 21 1 0\n 5 22 1 0\n 5 23 1 0\n 6 24 1 0\n 6 25 1 0\n 7 26 1 0\n 7 27 1 0\n 8 28 1 0\n 8 29 1 0\n 10 30 1 0\n 11 31 1 0\n 12 32 1 0\n 13 33 1 0\n 14 34 1 0\nM CHG 1 1 1\nM END\n","sdf"); | |
viewer_15607095855990522.setStyle({"stick": {}}); | |
viewer_15607095855990522.setBackgroundColor("0xeeeeee"); | |
viewer_15607095855990522.zoomTo(); | |
viewer_15607095855990522.render(); | |
}); | |
</script> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt"> | |
</div><div class="inner_cell"> | |
<div class="text_cell_render border-box-sizing rendered_html"> | |
<p>Now I generate 10 conformations for the query:</p> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [11]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">query_3d</span> <span class="o">=</span> <span class="n">Chem</span><span class="o">.</span><span class="n">AddHs</span><span class="p">(</span><span class="n">query_mol</span><span class="p">)</span> | |
<span class="n">AllChem</span><span class="o">.</span><span class="n">EmbedMultipleConfs</span><span class="p">(</span><span class="n">query_3d</span><span class="p">)</span> | |
<span class="n">AllChem</span><span class="o">.</span><span class="n">MMFFOptimizeMoleculeConfs</span><span class="p">(</span><span class="n">ref_3d</span><span class="p">,</span> <span class="n">nonBondedThresh</span><span class="o">=</span><span class="mf">100.0</span><span class="p">)</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
<div class="output_wrapper"> | |
<div class="output"> | |
<div class="output_area"> | |
<div class="prompt output_prompt">Out[11]:</div> | |
<div class="output_text output_subarea output_execute_result"> | |
<pre>[(0, 35.882546031773984)]</pre> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt"> | |
</div><div class="inner_cell"> | |
<div class="text_cell_render border-box-sizing rendered_html"> | |
<p>And I generate an <code>O3A</code> object for each conformation. I push the <code>O3A</code> objects to a list, each as a tuple with the respective <code>ConfId</code>:</p> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [12]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">o3a_list</span> <span class="o">=</span> <span class="p">[(</span><span class="n">cid</span><span class="p">,</span> <span class="n">AllChem</span><span class="o">.</span><span class="n">GetO3A</span><span class="p">(</span><span class="n">query_3d</span><span class="p">,</span> <span class="n">ref_3d</span><span class="p">,</span> <span class="n">prbCid</span><span class="o">=</span><span class="n">cid</span> | |
<span class="p">))</span> <span class="k">for</span> <span class="n">cid</span> <span class="ow">in</span> <span class="nb">range</span><span class="p">(</span><span class="n">query_3d</span><span class="o">.</span><span class="n">GetNumConformers</span><span class="p">())]</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt"> | |
</div><div class="inner_cell"> | |
<div class="text_cell_render border-box-sizing rendered_html"> | |
<p>I sort the list by decreasing <code>O3A</code> score such that the first element will be the <code>(ConfId, O3A)</code> tuple corresponding the conformation with the best O3A score:</p> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [13]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">o3a_list</span><span class="o">.</span><span class="n">sort</span><span class="p">(</span><span class="n">key</span><span class="o">=</span><span class="k">lambda</span> <span class="n">o</span><span class="p">:</span> <span class="n">o</span><span class="p">[</span><span class="mi">1</span><span class="p">]</span><span class="o">.</span><span class="n">Score</span><span class="p">(),</span> <span class="n">reverse</span><span class="o">=</span><span class="kc">True</span><span class="p">)</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [14]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">o3a_list</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
<div class="output_wrapper"> | |
<div class="output"> | |
<div class="output_area"> | |
<div class="prompt output_prompt">Out[14]:</div> | |
<div class="output_text output_subarea output_execute_result"> | |
<pre>[(5, <rdkit.Chem.rdMolAlign.O3A at 0x1575035e0d0>), | |
(2, <rdkit.Chem.rdMolAlign.O3A at 0x1575035e580>), | |
(6, <rdkit.Chem.rdMolAlign.O3A at 0x1575035e260>), | |
(3, <rdkit.Chem.rdMolAlign.O3A at 0x1575035e4e0>), | |
(8, <rdkit.Chem.rdMolAlign.O3A at 0x1574ff2ed50>), | |
(9, <rdkit.Chem.rdMolAlign.O3A at 0x1574ff2ec10>), | |
(7, <rdkit.Chem.rdMolAlign.O3A at 0x1575035e440>), | |
(4, <rdkit.Chem.rdMolAlign.O3A at 0x1575035e030>), | |
(1, <rdkit.Chem.rdMolAlign.O3A at 0x1575035e210>), | |
(0, <rdkit.Chem.rdMolAlign.O3A at 0x1574fc1d350>)]</pre> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [15]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">best_o3a</span> <span class="o">=</span> <span class="n">o3a_list</span><span class="p">[</span><span class="mi">0</span><span class="p">]</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt"> | |
</div><div class="inner_cell"> | |
<div class="text_cell_render border-box-sizing rendered_html"> | |
<p>This is the reciprocal alignment of query and reference before I apply any transformation. As expected, they are not aligned yet:</p> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [16]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">drawit</span><span class="p">([(</span><span class="n">ref_3d</span><span class="p">,</span> <span class="o">-</span><span class="mi">1</span><span class="p">),</span> <span class="p">(</span><span class="n">query_3d</span><span class="p">,</span> <span class="n">best_o3a</span><span class="p">[</span><span class="mi">0</span><span class="p">])])</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
<div class="output_wrapper"> | |
<div class="output"> | |
<div class="output_area"> | |
<div class="prompt"></div> | |
<div class="output_html rendered_html output_subarea "> | |
<div id="3dmolviewer_15607095863341823" style="position: relative; width: 400px; height: 300px"> | |
<p id="3dmolwarning_15607095863341823" style="background-color:#ffcccc;color:black">You appear to be running in JupyterLab (or JavaScript failed to load for some other reason). You need to install the 3dmol extension: <br> | |
<tt>jupyter labextension install jupyterlab_3dmol</tt></p> | |
</div> | |
<script> | |
var loadScriptAsync = function(uri){ | |
return new Promise((resolve, reject) => { | |
var tag = document.createElement('script'); | |
tag.src = uri; | |
tag.async = true; | |
tag.onload = () => { | |
resolve(); | |
}; | |
var firstScriptTag = document.getElementsByTagName('script')[0]; | |
firstScriptTag.parentNode.insertBefore(tag, firstScriptTag); | |
}); | |
}; | |
if(typeof $3Dmolpromise === 'undefined') { | |
$3Dmolpromise = null; | |
$3Dmolpromise = loadScriptAsync('https://3dmol.csb.pitt.edu/build/3Dmol.js'); | |
} | |
var viewer_15607095863341823 = null; | |
var warn = document.getElementById("3dmolwarning_15607095863341823"); | |
if(warn) { | |
warn.parentNode.removeChild(warn); | |
} | |
$3Dmolpromise.then(function() { | |
viewer_15607095863341823 = $3Dmol.createViewer($("#3dmolviewer_15607095863341823"),{backgroundColor:"white"}); | |
viewer_15607095863341823.removeAllModels(); | |
viewer_15607095863341823.addModel("\n RDKit 3D\n\n 34 35 0 0 0 0 0 0 0 0999 V2000\n -3.9641 0.1794 -0.6522 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9054 1.1932 -0.3477 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0300 0.7057 0.7951 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3144 -0.6201 0.4606 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1052 -1.4412 -0.5791 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6026 -1.2548 -0.4194 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1297 -0.4132 -0.0386 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0980 0.0279 1.0669 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4930 0.2114 0.5255 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3717 -0.8775 0.4443 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6563 -0.7121 -0.0754 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0734 0.5404 -0.5210 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2067 1.6289 -0.4478 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9211 1.4662 0.0712 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.8064 0.3941 -0.1004 H 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2501 0.2989 -1.6341 H 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3268 1.3412 -1.2656 H 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4219 2.1249 -0.0986 H 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3176 1.4906 1.0661 H 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6612 0.5511 1.6804 H 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2667 -1.2094 1.3866 H 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8507 -2.5024 -0.4709 H 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8127 -1.1548 -1.5980 H 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1708 -1.8479 -1.1419 H 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9344 -1.5093 0.5928 H 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1354 0.3181 -0.8575 H 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4971 -1.3561 -0.4661 H 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7687 0.9637 1.5318 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1156 -0.7180 1.8715 H 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0652 -1.8625 0.7888 H 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3349 -1.5599 -0.1300 H 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0759 0.6687 -0.9217 H 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5363 2.6061 -0.7921 H 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2619 2.3289 0.1230 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 2 3 1 0\n 3 4 1 0\n 4 5 1 0\n 5 6 1 0\n 4 7 1 0\n 7 8 1 0\n 8 9 1 0\n 9 10 2 0\n 10 11 1 0\n 11 12 2 0\n 12 13 1 0\n 13 14 2 0\n 6 1 1 0\n 14 9 1 0\n 1 15 1 0\n 1 16 1 0\n 2 17 1 0\n 2 18 1 0\n 3 19 1 0\n 3 20 1 0\n 4 21 1 0\n 5 22 1 0\n 5 23 1 0\n 6 24 1 0\n 6 25 1 0\n 7 26 1 0\n 7 27 1 0\n 8 28 1 0\n 8 29 1 0\n 10 30 1 0\n 11 31 1 0\n 12 32 1 0\n 13 33 1 0\n 14 34 1 0\nM CHG 1 1 1\nM END\n","sdf"); | |
viewer_15607095863341823.addModel("\n RDKit 3D\n\n 30 31 0 0 0 0 0 0 0 0999 V2000\n -3.6259 0.3211 -0.2595 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4641 0.4861 -1.0901 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2468 0.3398 -0.1891 C 0 0 1 0 0 0 0 0 0 0 0 0\n -1.8567 -0.4340 0.9755 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1669 0.3331 1.1199 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1253 -0.3975 -0.8497 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7773 -1.1241 0.1007 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1030 -0.4473 0.2480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1847 0.7197 0.9892 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2832 1.5058 0.9139 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3635 1.1207 0.2146 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3682 -0.0783 -0.4582 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1940 -0.8146 -0.5263 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9932 -0.6471 -0.4458 H 0 0 0 0 0 0 0 0 0 0 0 0\n -4.3584 1.0275 -0.4314 H 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3924 -0.2866 -1.8834 H 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4240 1.4832 -1.5864 H 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9526 1.3257 0.2284 H 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2701 -0.3441 1.8981 H 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1302 -1.4605 0.6981 H 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8689 -0.1538 1.8073 H 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9214 1.3815 1.3911 H 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5045 0.3672 -1.3711 H 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5428 -1.0819 -1.6262 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0108 -2.1425 -0.3020 H 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3536 -1.2820 1.1016 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5223 0.7832 1.8462 H 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2150 1.7967 0.1737 H 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3227 -0.5760 -0.6356 H 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1370 -1.7209 -1.1148 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 2 3 1 0\n 3 4 1 0\n 4 5 1 0\n 3 6 1 0\n 6 7 1 0\n 7 8 1 0\n 8 9 2 0\n 9 10 1 0\n 10 11 2 0\n 11 12 1 0\n 12 13 2 0\n 5 1 1 0\n 13 8 1 0\n 1 14 1 0\n 1 15 1 0\n 2 16 1 0\n 2 17 1 0\n 3 18 1 1\n 4 19 1 0\n 4 20 1 0\n 5 21 1 0\n 5 22 1 0\n 6 23 1 0\n 6 24 1 0\n 7 25 1 0\n 7 26 1 0\n 9 27 1 0\n 11 28 1 0\n 12 29 1 0\n 13 30 1 0\nM CHG 1 1 1\nM END\n","sdf"); | |
viewer_15607095863341823.setStyle({"stick": {}}); | |
viewer_15607095863341823.setBackgroundColor("0xeeeeee"); | |
viewer_15607095863341823.zoomTo(); | |
viewer_15607095863341823.render(); | |
}); | |
</script> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt"> | |
</div><div class="inner_cell"> | |
<div class="text_cell_render border-box-sizing rendered_html"> | |
<p>Now I make a copy of <code>query_3d</code> such that I have a clean copy not affected by any transformation:</p> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [17]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">query_3d_copy</span> <span class="o">=</span> <span class="n">Chem</span><span class="o">.</span><span class="n">Mol</span><span class="p">(</span><span class="n">query_3d</span><span class="p">)</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt"> | |
</div><div class="inner_cell"> | |
<div class="text_cell_render border-box-sizing rendered_html"> | |
<p>Now I compute the transformation that would align the best aligned conf of <code>query_3d</code> to <code>ref_3d</code>:</p> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [18]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">rmsd</span><span class="p">,</span> <span class="n">trans_matrix</span> <span class="o">=</span> <span class="n">best_o3a</span><span class="p">[</span><span class="mi">1</span><span class="p">]</span><span class="o">.</span><span class="n">Trans</span><span class="p">()</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [19]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">rmsd</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
<div class="output_wrapper"> | |
<div class="output"> | |
<div class="output_area"> | |
<div class="prompt output_prompt">Out[19]:</div> | |
<div class="output_text output_subarea output_execute_result"> | |
<pre>0.5991041908372658</pre> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [20]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">trans_matrix</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
<div class="output_wrapper"> | |
<div class="output"> | |
<div class="output_area"> | |
<div class="prompt output_prompt">Out[20]:</div> | |
<div class="output_text output_subarea output_execute_result"> | |
<pre>array([[ 9.97849477e-01, 6.55467502e-02, 2.10349653e-04, | |
1.64685948e-01], | |
[-2.31757705e-02, 3.49810339e-01, 9.36533828e-01, | |
6.56285316e-02], | |
[ 6.13131664e-02, -9.34524665e-01, 3.50577161e-01, | |
7.09897150e-03], | |
[ 0.00000000e+00, 0.00000000e+00, 0.00000000e+00, | |
1.00000000e+00]])</pre> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt"> | |
</div><div class="inner_cell"> | |
<div class="text_cell_render border-box-sizing rendered_html"> | |
<p>Now I do the alignment. As <code>O3A</code> objects were constructed from <code>query_3d</code>, when I call <code>Align()</code> the relevant conformation of <code>query_3d</code> is transformed to align it to <code>ref_3d</code>; in fact, the returned RMSD is the same that <code>Trans()</code> had previously returned:</p> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [21]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">best_o3a</span><span class="p">[</span><span class="mi">1</span><span class="p">]</span><span class="o">.</span><span class="n">Align</span><span class="p">()</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
<div class="output_wrapper"> | |
<div class="output"> | |
<div class="output_area"> | |
<div class="prompt output_prompt">Out[21]:</div> | |
<div class="output_text output_subarea output_execute_result"> | |
<pre>0.5991041908372658</pre> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt"> | |
</div><div class="inner_cell"> | |
<div class="text_cell_render border-box-sizing rendered_html"> | |
<p>I can now verify that that conformation of <code>query_3d</code> is now indeed aligned against <code>ref3d</code>:</p> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [22]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">drawit</span><span class="p">([(</span><span class="n">ref_3d</span><span class="p">,</span> <span class="o">-</span><span class="mi">1</span><span class="p">),</span> <span class="p">(</span><span class="n">query_3d</span><span class="p">,</span> <span class="n">best_o3a</span><span class="p">[</span><span class="mi">0</span><span class="p">])])</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
<div class="output_wrapper"> | |
<div class="output"> | |
<div class="output_area"> | |
<div class="prompt"></div> | |
<div class="output_html rendered_html output_subarea "> | |
<div id="3dmolviewer_15607095864887688" style="position: relative; width: 400px; height: 300px"> | |
<p id="3dmolwarning_15607095864887688" style="background-color:#ffcccc;color:black">You appear to be running in JupyterLab (or JavaScript failed to load for some other reason). You need to install the 3dmol extension: <br> | |
<tt>jupyter labextension install jupyterlab_3dmol</tt></p> | |
</div> | |
<script> | |
var loadScriptAsync = function(uri){ | |
return new Promise((resolve, reject) => { | |
var tag = document.createElement('script'); | |
tag.src = uri; | |
tag.async = true; | |
tag.onload = () => { | |
resolve(); | |
}; | |
var firstScriptTag = document.getElementsByTagName('script')[0]; | |
firstScriptTag.parentNode.insertBefore(tag, firstScriptTag); | |
}); | |
}; | |
if(typeof $3Dmolpromise === 'undefined') { | |
$3Dmolpromise = null; | |
$3Dmolpromise = loadScriptAsync('https://3dmol.csb.pitt.edu/build/3Dmol.js'); | |
} | |
var viewer_15607095864887688 = null; | |
var warn = document.getElementById("3dmolwarning_15607095864887688"); | |
if(warn) { | |
warn.parentNode.removeChild(warn); | |
} | |
$3Dmolpromise.then(function() { | |
viewer_15607095864887688 = $3Dmol.createViewer($("#3dmolviewer_15607095864887688"),{backgroundColor:"white"}); | |
viewer_15607095864887688.removeAllModels(); | |
viewer_15607095864887688.addModel("\n RDKit 3D\n\n 34 35 0 0 0 0 0 0 0 0999 V2000\n -3.9641 0.1794 -0.6522 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9054 1.1932 -0.3477 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0300 0.7057 0.7951 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3144 -0.6201 0.4606 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1052 -1.4412 -0.5791 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6026 -1.2548 -0.4194 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1297 -0.4132 -0.0386 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0980 0.0279 1.0669 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4930 0.2114 0.5255 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3717 -0.8775 0.4443 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6563 -0.7121 -0.0754 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0734 0.5404 -0.5210 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2067 1.6289 -0.4478 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9211 1.4662 0.0712 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.8064 0.3941 -0.1004 H 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2501 0.2989 -1.6341 H 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3268 1.3412 -1.2656 H 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4219 2.1249 -0.0986 H 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3176 1.4906 1.0661 H 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6612 0.5511 1.6804 H 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2667 -1.2094 1.3866 H 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8507 -2.5024 -0.4709 H 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8127 -1.1548 -1.5980 H 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1708 -1.8479 -1.1419 H 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9344 -1.5093 0.5928 H 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1354 0.3181 -0.8575 H 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4971 -1.3561 -0.4661 H 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7687 0.9637 1.5318 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1156 -0.7180 1.8715 H 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0652 -1.8625 0.7888 H 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3349 -1.5599 -0.1300 H 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0759 0.6687 -0.9217 H 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5363 2.6061 -0.7921 H 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2619 2.3289 0.1230 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 2 3 1 0\n 3 4 1 0\n 4 5 1 0\n 5 6 1 0\n 4 7 1 0\n 7 8 1 0\n 8 9 1 0\n 9 10 2 0\n 10 11 1 0\n 11 12 2 0\n 12 13 1 0\n 13 14 2 0\n 6 1 1 0\n 14 9 1 0\n 1 15 1 0\n 1 16 1 0\n 2 17 1 0\n 2 18 1 0\n 3 19 1 0\n 3 20 1 0\n 4 21 1 0\n 5 22 1 0\n 5 23 1 0\n 6 24 1 0\n 6 25 1 0\n 7 26 1 0\n 7 27 1 0\n 8 28 1 0\n 8 29 1 0\n 10 30 1 0\n 11 31 1 0\n 12 32 1 0\n 13 33 1 0\n 14 34 1 0\nM CHG 1 1 1\nM END\n","sdf"); | |
viewer_15607095864887688.addModel("\n RDKit 3D\n\n 30 31 0 0 0 0 0 0 0 0999 V2000\n -3.4324 0.0190 -0.6063 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2625 -0.7282 -0.9804 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0572 0.0363 -0.4532 C 0 0 1 0 0 0 0 0 0 0 0 0\n -1.7163 0.8705 0.6408 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9733 1.3044 -0.1058 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0134 -0.8663 0.0730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8667 -0.2513 1.1406 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2339 0.0927 0.6410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3921 1.1932 -0.1848 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5398 1.3722 -0.8784 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5923 0.5576 -0.6975 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5182 -0.4922 0.1874 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2983 -0.7862 0.7797 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8624 -0.4857 0.2107 H 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1171 0.1220 -1.3716 H 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2418 -1.7430 -0.5320 H 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1573 -0.8451 -2.0837 H 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6990 0.7653 -1.2101 H 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1248 1.7524 0.9162 H 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0565 0.2579 1.4861 H 0 0 0 0 0 0 0 0 0 0 0 0\n -3.7056 1.7940 0.5472 H 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6596 1.9194 -0.9754 H 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6918 -1.1016 -0.7858 H 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4483 -1.8232 0.4148 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0328 -0.9901 1.9654 H 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4338 0.6406 1.6131 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7354 2.0334 0.0157 H 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4863 0.7359 -1.2914 H 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4381 -0.8545 0.6489 H 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1819 -1.6531 1.4169 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 2 3 1 0\n 3 4 1 0\n 4 5 1 0\n 3 6 1 0\n 6 7 1 0\n 7 8 1 0\n 8 9 2 0\n 9 10 1 0\n 10 11 2 0\n 11 12 1 0\n 12 13 2 0\n 5 1 1 0\n 13 8 1 0\n 1 14 1 0\n 1 15 1 0\n 2 16 1 0\n 2 17 1 0\n 3 18 1 6\n 4 19 1 0\n 4 20 1 0\n 5 21 1 0\n 5 22 1 0\n 6 23 1 0\n 6 24 1 0\n 7 25 1 0\n 7 26 1 0\n 9 27 1 0\n 11 28 1 0\n 12 29 1 0\n 13 30 1 0\nM CHG 1 1 1\nM END\n","sdf"); | |
viewer_15607095864887688.setStyle({"stick": {}}); | |
viewer_15607095864887688.setBackgroundColor("0xeeeeee"); | |
viewer_15607095864887688.zoomTo(); | |
viewer_15607095864887688.render(); | |
}); | |
</script> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt"> | |
</div><div class="inner_cell"> | |
<div class="text_cell_render border-box-sizing rendered_html"> | |
<p><code>query_3d_copy</code> instead is still not aligned:</p> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [23]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">drawit</span><span class="p">([(</span><span class="n">ref_3d</span><span class="p">,</span> <span class="o">-</span><span class="mi">1</span><span class="p">),</span> <span class="p">(</span><span class="n">query_3d_copy</span><span class="p">,</span> <span class="n">best_o3a</span><span class="p">[</span><span class="mi">0</span><span class="p">])])</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
<div class="output_wrapper"> | |
<div class="output"> | |
<div class="output_area"> | |
<div class="prompt"></div> | |
<div class="output_html rendered_html output_subarea "> | |
<div id="3dmolviewer_15607095867824295" style="position: relative; width: 400px; height: 300px"> | |
<p id="3dmolwarning_15607095867824295" style="background-color:#ffcccc;color:black">You appear to be running in JupyterLab (or JavaScript failed to load for some other reason). You need to install the 3dmol extension: <br> | |
<tt>jupyter labextension install jupyterlab_3dmol</tt></p> | |
</div> | |
<script> | |
var loadScriptAsync = function(uri){ | |
return new Promise((resolve, reject) => { | |
var tag = document.createElement('script'); | |
tag.src = uri; | |
tag.async = true; | |
tag.onload = () => { | |
resolve(); | |
}; | |
var firstScriptTag = document.getElementsByTagName('script')[0]; | |
firstScriptTag.parentNode.insertBefore(tag, firstScriptTag); | |
}); | |
}; | |
if(typeof $3Dmolpromise === 'undefined') { | |
$3Dmolpromise = null; | |
$3Dmolpromise = loadScriptAsync('https://3dmol.csb.pitt.edu/build/3Dmol.js'); | |
} | |
var viewer_15607095867824295 = null; | |
var warn = document.getElementById("3dmolwarning_15607095867824295"); | |
if(warn) { | |
warn.parentNode.removeChild(warn); | |
} | |
$3Dmolpromise.then(function() { | |
viewer_15607095867824295 = $3Dmol.createViewer($("#3dmolviewer_15607095867824295"),{backgroundColor:"white"}); | |
viewer_15607095867824295.removeAllModels(); | |
viewer_15607095867824295.addModel("\n RDKit 3D\n\n 34 35 0 0 0 0 0 0 0 0999 V2000\n -3.9641 0.1794 -0.6522 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9054 1.1932 -0.3477 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0300 0.7057 0.7951 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3144 -0.6201 0.4606 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1052 -1.4412 -0.5791 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6026 -1.2548 -0.4194 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1297 -0.4132 -0.0386 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0980 0.0279 1.0669 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4930 0.2114 0.5255 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3717 -0.8775 0.4443 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6563 -0.7121 -0.0754 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0734 0.5404 -0.5210 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2067 1.6289 -0.4478 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9211 1.4662 0.0712 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.8064 0.3941 -0.1004 H 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2501 0.2989 -1.6341 H 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3268 1.3412 -1.2656 H 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4219 2.1249 -0.0986 H 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3176 1.4906 1.0661 H 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6612 0.5511 1.6804 H 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2667 -1.2094 1.3866 H 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8507 -2.5024 -0.4709 H 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8127 -1.1548 -1.5980 H 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1708 -1.8479 -1.1419 H 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9344 -1.5093 0.5928 H 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1354 0.3181 -0.8575 H 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4971 -1.3561 -0.4661 H 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7687 0.9637 1.5318 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1156 -0.7180 1.8715 H 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0652 -1.8625 0.7888 H 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3349 -1.5599 -0.1300 H 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0759 0.6687 -0.9217 H 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5363 2.6061 -0.7921 H 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2619 2.3289 0.1230 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 2 3 1 0\n 3 4 1 0\n 4 5 1 0\n 5 6 1 0\n 4 7 1 0\n 7 8 1 0\n 8 9 1 0\n 9 10 2 0\n 10 11 1 0\n 11 12 2 0\n 12 13 1 0\n 13 14 2 0\n 6 1 1 0\n 14 9 1 0\n 1 15 1 0\n 1 16 1 0\n 2 17 1 0\n 2 18 1 0\n 3 19 1 0\n 3 20 1 0\n 4 21 1 0\n 5 22 1 0\n 5 23 1 0\n 6 24 1 0\n 6 25 1 0\n 7 26 1 0\n 7 27 1 0\n 8 28 1 0\n 8 29 1 0\n 10 30 1 0\n 11 31 1 0\n 12 32 1 0\n 13 33 1 0\n 14 34 1 0\nM CHG 1 1 1\nM END\n","sdf"); | |
viewer_15607095867824295.addModel("\n RDKit 3D\n\n 30 31 0 0 0 0 0 0 0 0999 V2000\n -3.6259 0.3211 -0.2595 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4641 0.4861 -1.0901 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2468 0.3398 -0.1891 C 0 0 1 0 0 0 0 0 0 0 0 0\n -1.8567 -0.4340 0.9755 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1669 0.3331 1.1199 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1253 -0.3975 -0.8497 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7773 -1.1241 0.1007 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1030 -0.4473 0.2480 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1847 0.7197 0.9892 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2832 1.5058 0.9139 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3635 1.1207 0.2146 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3682 -0.0783 -0.4582 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1940 -0.8146 -0.5263 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9932 -0.6471 -0.4458 H 0 0 0 0 0 0 0 0 0 0 0 0\n -4.3584 1.0275 -0.4314 H 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3924 -0.2866 -1.8834 H 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4240 1.4832 -1.5864 H 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9526 1.3257 0.2284 H 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2701 -0.3441 1.8981 H 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1302 -1.4605 0.6981 H 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8689 -0.1538 1.8073 H 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9214 1.3815 1.3911 H 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5045 0.3672 -1.3711 H 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5428 -1.0819 -1.6262 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0108 -2.1425 -0.3020 H 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3536 -1.2820 1.1016 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5223 0.7832 1.8462 H 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2150 1.7967 0.1737 H 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3227 -0.5760 -0.6356 H 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1370 -1.7209 -1.1148 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 2 3 1 0\n 3 4 1 0\n 4 5 1 0\n 3 6 1 0\n 6 7 1 0\n 7 8 1 0\n 8 9 2 0\n 9 10 1 0\n 10 11 2 0\n 11 12 1 0\n 12 13 2 0\n 5 1 1 0\n 13 8 1 0\n 1 14 1 0\n 1 15 1 0\n 2 16 1 0\n 2 17 1 0\n 3 18 1 1\n 4 19 1 0\n 4 20 1 0\n 5 21 1 0\n 5 22 1 0\n 6 23 1 0\n 6 24 1 0\n 7 25 1 0\n 7 26 1 0\n 9 27 1 0\n 11 28 1 0\n 12 29 1 0\n 13 30 1 0\nM CHG 1 1 1\nM END\n","sdf"); | |
viewer_15607095867824295.setStyle({"stick": {}}); | |
viewer_15607095867824295.setBackgroundColor("0xeeeeee"); | |
viewer_15607095867824295.zoomTo(); | |
viewer_15607095867824295.render(); | |
}); | |
</script> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt"> | |
</div><div class="inner_cell"> | |
<div class="text_cell_render border-box-sizing rendered_html"> | |
<p>But if I apply <code>trans_matrix</code> to it, it will then be aligned:</p> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [24]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">AllChem</span><span class="o">.</span><span class="n">TransformMol</span><span class="p">(</span><span class="n">query_3d_copy</span><span class="p">,</span> <span class="n">trans_matrix</span><span class="p">,</span> | |
<span class="n">confId</span><span class="o">=</span><span class="n">best_o3a</span><span class="p">[</span><span class="mi">0</span><span class="p">],</span> <span class="n">keepConfs</span><span class="o">=</span><span class="kc">True</span><span class="p">)</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [25]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">drawit</span><span class="p">([(</span><span class="n">ref_3d</span><span class="p">,</span> <span class="o">-</span><span class="mi">1</span><span class="p">),</span> <span class="p">(</span><span class="n">query_3d_copy</span><span class="p">,</span> <span class="n">best_o3a</span><span class="p">[</span><span class="mi">0</span><span class="p">])])</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
<div class="output_wrapper"> | |
<div class="output"> | |
<div class="output_area"> | |
<div class="prompt"></div> | |
<div class="output_html rendered_html output_subarea "> | |
<div id="3dmolviewer_1560709586817336" style="position: relative; width: 400px; height: 300px"> | |
<p id="3dmolwarning_1560709586817336" style="background-color:#ffcccc;color:black">You appear to be running in JupyterLab (or JavaScript failed to load for some other reason). You need to install the 3dmol extension: <br> | |
<tt>jupyter labextension install jupyterlab_3dmol</tt></p> | |
</div> | |
<script> | |
var loadScriptAsync = function(uri){ | |
return new Promise((resolve, reject) => { | |
var tag = document.createElement('script'); | |
tag.src = uri; | |
tag.async = true; | |
tag.onload = () => { | |
resolve(); | |
}; | |
var firstScriptTag = document.getElementsByTagName('script')[0]; | |
firstScriptTag.parentNode.insertBefore(tag, firstScriptTag); | |
}); | |
}; | |
if(typeof $3Dmolpromise === 'undefined') { | |
$3Dmolpromise = null; | |
$3Dmolpromise = loadScriptAsync('https://3dmol.csb.pitt.edu/build/3Dmol.js'); | |
} | |
var viewer_1560709586817336 = null; | |
var warn = document.getElementById("3dmolwarning_1560709586817336"); | |
if(warn) { | |
warn.parentNode.removeChild(warn); | |
} | |
$3Dmolpromise.then(function() { | |
viewer_1560709586817336 = $3Dmol.createViewer($("#3dmolviewer_1560709586817336"),{backgroundColor:"white"}); | |
viewer_1560709586817336.removeAllModels(); | |
viewer_1560709586817336.addModel("\n RDKit 3D\n\n 34 35 0 0 0 0 0 0 0 0999 V2000\n -3.9641 0.1794 -0.6522 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9054 1.1932 -0.3477 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0300 0.7057 0.7951 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3144 -0.6201 0.4606 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1052 -1.4412 -0.5791 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6026 -1.2548 -0.4194 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1297 -0.4132 -0.0386 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0980 0.0279 1.0669 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4930 0.2114 0.5255 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3717 -0.8775 0.4443 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6563 -0.7121 -0.0754 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0734 0.5404 -0.5210 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2067 1.6289 -0.4478 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9211 1.4662 0.0712 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.8064 0.3941 -0.1004 H 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2501 0.2989 -1.6341 H 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3268 1.3412 -1.2656 H 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4219 2.1249 -0.0986 H 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3176 1.4906 1.0661 H 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6612 0.5511 1.6804 H 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2667 -1.2094 1.3866 H 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8507 -2.5024 -0.4709 H 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8127 -1.1548 -1.5980 H 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1708 -1.8479 -1.1419 H 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9344 -1.5093 0.5928 H 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1354 0.3181 -0.8575 H 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4971 -1.3561 -0.4661 H 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7687 0.9637 1.5318 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1156 -0.7180 1.8715 H 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0652 -1.8625 0.7888 H 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3349 -1.5599 -0.1300 H 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0759 0.6687 -0.9217 H 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5363 2.6061 -0.7921 H 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2619 2.3289 0.1230 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 2 3 1 0\n 3 4 1 0\n 4 5 1 0\n 5 6 1 0\n 4 7 1 0\n 7 8 1 0\n 8 9 1 0\n 9 10 2 0\n 10 11 1 0\n 11 12 2 0\n 12 13 1 0\n 13 14 2 0\n 6 1 1 0\n 14 9 1 0\n 1 15 1 0\n 1 16 1 0\n 2 17 1 0\n 2 18 1 0\n 3 19 1 0\n 3 20 1 0\n 4 21 1 0\n 5 22 1 0\n 5 23 1 0\n 6 24 1 0\n 6 25 1 0\n 7 26 1 0\n 7 27 1 0\n 8 28 1 0\n 8 29 1 0\n 10 30 1 0\n 11 31 1 0\n 12 32 1 0\n 13 33 1 0\n 14 34 1 0\nM CHG 1 1 1\nM END\n","sdf"); | |
viewer_1560709586817336.addModel("\n RDKit 3D\n\n 30 31 0 0 0 0 0 0 0 0999 V2000\n -3.4324 0.0190 -0.6063 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2625 -0.7282 -0.9804 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0572 0.0363 -0.4532 C 0 0 1 0 0 0 0 0 0 0 0 0\n -1.7163 0.8705 0.6408 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9733 1.3044 -0.1058 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0134 -0.8663 0.0730 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8667 -0.2513 1.1406 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2339 0.0927 0.6410 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3921 1.1932 -0.1848 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5398 1.3722 -0.8784 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5923 0.5576 -0.6975 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5182 -0.4922 0.1874 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2983 -0.7862 0.7797 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8624 -0.4857 0.2107 H 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1171 0.1220 -1.3716 H 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2418 -1.7430 -0.5320 H 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1573 -0.8451 -2.0837 H 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6990 0.7653 -1.2101 H 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1248 1.7524 0.9162 H 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0565 0.2579 1.4861 H 0 0 0 0 0 0 0 0 0 0 0 0\n -3.7056 1.7940 0.5472 H 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6596 1.9194 -0.9754 H 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6918 -1.1016 -0.7858 H 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4483 -1.8232 0.4148 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0328 -0.9901 1.9654 H 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4338 0.6406 1.6131 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7354 2.0334 0.0157 H 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4863 0.7359 -1.2914 H 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4381 -0.8545 0.6489 H 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1819 -1.6531 1.4169 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0\n 2 3 1 0\n 3 4 1 0\n 4 5 1 0\n 3 6 1 0\n 6 7 1 0\n 7 8 1 0\n 8 9 2 0\n 9 10 1 0\n 10 11 2 0\n 11 12 1 0\n 12 13 2 0\n 5 1 1 0\n 13 8 1 0\n 1 14 1 0\n 1 15 1 0\n 2 16 1 0\n 2 17 1 0\n 3 18 1 6\n 4 19 1 0\n 4 20 1 0\n 5 21 1 0\n 5 22 1 0\n 6 23 1 0\n 6 24 1 0\n 7 25 1 0\n 7 26 1 0\n 9 27 1 0\n 11 28 1 0\n 12 29 1 0\n 13 30 1 0\nM CHG 1 1 1\nM END\n","sdf"); | |
viewer_1560709586817336.setStyle({"stick": {}}); | |
viewer_1560709586817336.setBackgroundColor("0xeeeeee"); | |
viewer_1560709586817336.zoomTo(); | |
viewer_1560709586817336.render(); | |
}); | |
</script> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [ ]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
</body> | |
</html> |
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment