Created
September 27, 2017 12:24
-
-
Save sjdv1982/955cd983c05a9d252d1fdeea3a803962 to your computer and use it in GitHub Desktop.
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| <!DOCTYPE html> | |
| <html> | |
| <head> | |
| <script src="https://ajax.googleapis.com/ajax/libs/jquery/3.2.1/jquery.min.js"></script> | |
| <script src="kekule/release/kekule.js?modules=chemWidget,openbabel,indigo"></script> | |
| <script> | |
| Kekule.Indigo.enable(); | |
| function load_kekule() { | |
| chemViewer = new Kekule.ChemWidget.Viewer(document.getElementById('kekule')); | |
| } | |
| function display_kekule(smi) { | |
| var mol = Kekule.IO.loadFormatData(smi, "smi"); | |
| chemViewer.setChemObj(mol); | |
| } | |
| function display() { | |
| var smi = document.getElementById("smiles").value; | |
| console.log(smi); | |
| display_kekule(smi); | |
| } | |
| $(window).on('load', function(){ | |
| console.log("OK"); | |
| load_kekule(); | |
| display(); | |
| $('textarea').on('change', display); | |
| }); | |
| </script | |
| </head> | |
| <body> | |
| <h2> SMILES </h2> | |
| <textarea rows="10" cols="50" id="smiles" style="font-size: 12pt"> | |
| CCN(c1cc(C)ccc1C)S(=O)(=O)c1cc(C(N)=O)n(C)c1 | |
| </textarea> | |
| <div id="div2"> | |
| <h2> Kekule </h2> | |
| <div id="kekule" style="width:100%;height:650px" | |
| data-widget="Kekule.ChemWidget.Viewer2D" data-enable-toolbar="true" data-auto-size="true" data-padding="20" | |
| data-toolbar-evoke-modes="[0]" | |
| </div> | |
| </body> | |
| </html> |
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment