Created
June 5, 2023 06:32
-
-
Save kozo2/54e4a6ea61fa0989ec15b0f73a90e448 to your computer and use it in GitHub Desktop.
This file contains bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
File path | File name | Title | MS1 count | MSMS count | PRECURSORMZ | PRECURSORTYPE | Structure rank 1 | Total score | Databases | Formula | Ontology | InChIKey | SMILES | Structure rank 2 | Total score | Databases | Formula | Ontology | InChIKey | SMILES | Structure rank 3 | Total score | Databases | Formula | Ontology | InChIKey | SMILES | Structure rank 4 | Total score | Databases | Formula | Ontology | InChIKey | SMILES | Structure rank 5 | Total score | Databases | Formula | Ontology | InChIKey | SMILES | Structure rank 6 | Total score | Databases | Formula | Ontology | InChIKey | SMILES | Structure rank 7 | Total score | Databases | Formula | Ontology | InChIKey | SMILES | Structure rank 8 | Total score | Databases | Formula | Ontology | InChIKey | SMILES | Structure rank 9 | Total score | Databases | Formula | Ontology | InChIKey | SMILES | Structure rank 10 | Total score | Databases | Formula | Ontology | InChIKey | SMILES | ||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
C:\Users\knishida\Desktop\MS-FINDER demo files\S-propylmercaptoglutathione.mat | S-propylmercaptoglutathione | Unknown | 18 | 36 | 382.1105 | [M+H]+ | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
C:\Users\knishida\Desktop\MS-FINDER demo files\2-Deoxycytidine 5-diphosphate Trial 193 Neg.msp | 2-Deoxycytidine 5-diphosphate Trial 193 Neg | 2'-Deoxycytidine 5'-diphosphate; LC-ESI-QTOF; MS2; CE | 0 | 8 | 386.015991 | [M-H]- | dCDP | 8.0345 | HMDB=HMDB0001245,ChEBI=CHEBI:28846;CHEBI:58593,SMPDB=PW_C000962,YMDB=YMDB00916,FooDB=FDB022510,BMDB=BMDB01245,ECMDB=ECMDB01245,PubChem=21122964;150855,PlantCyc=DCDP,BLEXP=BLEXPDB00000000623,COCONUT=CNP0142861 | C9H15N3O10P2 | Organic pyrophosphates | FTDHDKPUHBLBTL-SHYZEUOFSA-N | O=C1N=C(N)C=CN1C2OC(COP(=O)(O)OP(=O)(O)O)C(O)C2 | UNPD122004 | 7.1501 | UNPD=UNPD122004,COCONUT=CNP0270287 | C9H15N3O10P2 | Pyrimidine deoxyribonucleoside 3',5'-bisphosphates | PIILJQRMNSOCFD-JORGKRSHNA-N | O=C1N=C(N)C=CN1C2OC(COP(=O)(O)O)C(OP(=O)(O)O)C2 | 2'-deoxyuridine 5'-alpha,beta-imido-diphosphate | 6.4508 | DrugBank=DB03641 | C9H15N3O10P2 | Pyrimidine 2'-deoxyribonucleosides | COFNIXBQVWFHTR-GKROBHDKSA-N | O=C1C=CN(C(=O)N1)C2OC(COP(=O)(O)NP(=O)(O)O)C(O)C2 | |||||||||||||||||||||||||||||||||||||||||||||||||||
C:\Users\knishida\Desktop\MS-FINDER demo files\3-indoxyl sulfate Trial 233 Neg.msp | 3-indoxyl sulfate Trial 233 Neg | 3-Indoxyl sulfate; LC-ESI-QTOF; MS2; CE | 0 | 4 | 212.002302 | [M-H]- | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
C:\Users\knishida\Desktop\MS-FINDER demo files\Cilastatin Trial 32 Neg.msp | Cilastatin Trial 32 Neg | Cilastatin; LC-ESI-ITFT; MS2; CE | 0 | 8 | 357.148967 | [M-H]- | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
C:\Users\knishida\Desktop\MS-FINDER demo files\Phosphoenolpyruvate-Pos.msp | Phosphoenolpyruvate-Pos | Phospho(enol)pyruvic acid | 0 | 70 | 168.9897 | [M+H]+ | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
C:\Users\knishida\Desktop\MS-FINDER demo files\Reserpine Trial 1022 Pos.msp | Reserpine Trial 1022 Pos | Reserpine; LC-ESI-ITFT; MS2; CE 35 eV; [M+H]+ | 0 | 26 | 609.280657 | [M+H]+ | Reserpine | 7.5658 | HMDB=HMDB0014351,KNApSAcK=C00001763,ChEBI=CHEBI:28487;CHEBI:91839;CHEBI:92652;CHEBI:94619,DrugBank=DB00206,T3DB=T3D2713,STOFF=STOFF_1320,Urine=HMDB0014351,Serum=HMDB0014351,PubChem=5770,UNPD=UNPD120699;UNPD61032;UNPD94372,BLEXP=BLEXPDB00000005052,COCONUT=CNP0215502 | C33H40N2O9 | Yohimbine alkaloids | QEVHRUUCFGRFIF-MDEJGZGSSA-N | O=C(OC1CC2CN3CCC=4C=5C=CC(OC)=CC5NC4C3CC2C(C(=O)OC)C1OC)C6=CC(OC)=C(OC)C(OC)=C6 | UNPD69383 | 7.082 | UNPD=UNPD69383,COCONUT=CNP0311292 | C33H40N2O9 | Corynanthean-type alkaloids | RLUTXHROPSJPAN-XFTHXEAONA-N | O=C(OC)C1=C(OC)C(OC(=O)C2=CC(OC)=C(OC)C(OC)=C2)CC3CN4CCC5C6=CC=C(OC)C=C6NC5C4CC13 | UNPD37021 | 7.0456 | UNPD=UNPD37021,COCONUT=CNP0120490 | C33H40N2O9 | Beta carbolines | MDMGHDFNKNZPAU-KYEBNOFANA-N | O=C(OC1CC2CN3CCC=4C=5C=CC(OC)=CC5NC4C3CC2C(OC(=O)C)C1OC)C6=CC(OC)=C(OC)C(OC)=C6 | methoserpidine | 7.0088 | ChEBI=CHEBI:135848,COCONUT=CNP0074750 | C33H40N2O9 | Yohimbine alkaloids | ULBNWNUHGJLQHO-RWCGCENENA-N | O=C(OC1CC2CN3CCC=4C=5C=C(OC)C=CC5NC4C3CC2C(C(=O)OC)C1OC)C6=CC(OC)=C(OC)C(OC)=C6 | UNPD205492 | 6.5567 | UNPD=UNPD205492,NPA=NPA015220,COCONUT=CNP0204639 | C30H44N2O9S | Macrolactams | BDIJKIUDWJLNEF-ROBUMCTANA-N | O=C(OC1C(=CC(C)C(O)C(OC)CC(C)CC=2C(=O)C(NC(=O)C(=CCCC1OC)C)=C(SC)C(=O)C2OC)C)N | 4-({4-[2-(2-aminopiperidin-1-ium-4-yl)ethyl]-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl}oxy)-7-cyclohexyl-5-hydroxy-9,10-dioxo-1,2,3,4,4a,8a,9,9a,10,10a-decahydroanthracen-1-yl | 6.4454 | COCONUT=CNP0044378 | C33H40N2O9 | CKEZCXYLGJTWBY-UHFFFAOYSA-N | O=C1C2C=C(C=C(O)C2C(=O)C3C(OC4OC(CO)C(O)C(O)(CCC5CC[NH2+]C(N)C5)C4O)CCCC13)C6CCCCC6 | epoxypheophorbide a | 6.3048 | ChEBI=CHEBI:90228 | C35H36N4O6 | Tetrapyrroles and derivatives | ICQNLVYDPRIQAA-UJSYQKIMSA-N | O=C(O)CCC1C=2N=C(C=C3NC4(OC4C5=NC(=CC=6NC7=C(C(=O)C(C(=O)OC)C72)C6C)C(=C5C)CC)C(C=C)=C3C)C1C | 7-({2-[(6-aminopiperidin-1-ium-3-yl)methyl]cyclohexyl}methyl)-5-hydroxy-9,10-dioxo-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-1,2,3,4,4a,8a,9,9a,10,10a-decahydroanthracen-1-yl | 6.272 | COCONUT=CNP0024344 | C33H40N2O9 | ZVXSJMFVTABVMS-UHFFFAOYSA-N | O=C1C2C=C(C=C(O)C2C(=O)C3C(OC4OC(CO)C(O)C(O)C4O)CCCC13)CC5CCCCC5CC6CCC(N)[NH2+]C6 | 3-[16-acetyl-11-ethyl-3-(methoxycarbonyl)-12,17,21,26-tetramethyl-4-oxo-7,23,24,25-tetraazahexacyclo[18.2.1.1?,?.1??,??.1??,??.0?,?]hexacosa-1,5(26),6,8,10(25),13,15(24),16,18,20(23)-decaen-22-yl]propanoic acid | 6.2528 | COCONUT=CNP0051492 | C35H36N4O6 | Tetrapyrroles and derivatives | FISQKHNKQUPIKO-UHFFFAOYSA-N | O=C(O)CCC1C2=NC(=CC3=NC(=CC4=NC(=CC5=NC=6C(C(=O)C(C(=O)OC)C62)=C5C)C(CC)C4C)C(C(=O)C)=C3C)C1C | UNPD166452 | 6.2348 | UNPD=UNPD166452,COCONUT=CNP0296146 | C33H40N2O9 | P-methoxybenzoic acids and derivatives | JAXWQXGHHUWAKY-OTZCPNHCNA-N | O=C(OC1CC2N(C(=O)N3C4CCC3CC(OC(=O)C5=CC=C(OC)C(OC)=C5)C4)C(CC2)C1)C6=CC=C(OC)C(OC)=C6 |
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment